![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | » ACER 3630 Ram issues/ | 2022-03-28 12:16 | - | |
| !!!!!! Acer Recalling Some Aspire Notebooks !!!!!!/ | 2022-03-28 12:05 | - | |
| !!!!please Help!!!! Random Power On Tm 2310/ | 2022-03-28 12:05 | - | |
| !!!HELP!!! TravelMate 3280 Restore Factory Settings Problem/ | 2022-03-28 12:05 | - | |
| ! Communications Port for J1708 driver Aspire 3500/ | 2022-03-28 12:05 | - | |
| ! New Aspire 1360 1520 info !/ | 2022-03-28 12:05 | - | |
| !ew haswell v7 rumors of release/ | 2022-03-28 12:05 | - | |
| !help Webdesign Note Book!/ | 2022-03-28 12:05 | - | |
| $399 Acer at Circuit City/ | 2022-03-28 12:05 | - | |
| $399 Laptop from Futureshop/ | 2022-03-28 12:05 | - | |
| $600 notebook with 2GB and 512MB Graphic/ | 2022-03-28 12:05 | - | |
| 'Camera not found!' - problem/ | 2022-03-28 12:05 | - | |
| 'G' and 'Z' suffix in Aspire models/ | 2022-03-28 12:05 | - | |
| 'Power Coupler Chip' burnout/ | 2022-03-28 12:05 | - | |
| 'The system cannot find the file specified' when Empowering Button is pushed after installing Windows 7/ | 2022-03-28 12:05 | - | |
| 'bout time/ | 2022-03-28 12:05 | - | |
| (6935G) Boot problem after restart (cant access bios boot from disk etc)/ | 2022-03-28 12:05 | - | |
| (Acer 7520) No Audio Output Device is installed/ | 2022-03-28 12:05 | - | |
| ( Acer Aspire 7720G ) 2 x Hard Drive problems/ | 2022-03-28 12:05 | - | |
| (Alt+F10) comand doesnt work on 5920G after winXP DG/ | 2022-03-28 12:05 | - | |
| (Help) BIOS Fail on Aspire 5741/ | 2022-03-28 12:05 | - | |
| (UK) Looking to upgrade 8600GS on Asus 5920G/ | 2022-03-28 12:05 | - | |
| (WANTED)-WinXP drivers for 5290G/ | 2022-03-28 12:05 | - | |
| (first post) Aspire 5580 - OpenGL 2.0/ | 2022-03-28 12:05 | - | |
| (gutted)Big help needed please new travelmate 8371g/ | 2022-03-28 12:05 | - | |
| -( aprire 5100-3557 amd unknow processor/ | 2022-03-28 12:05 | - | |
| --- NEW TM 8204 Pic Review- Want to return it! ---/ | 2022-03-28 12:05 | - | |
| - - Can I repair Acer Motherboard - - - -/ | 2022-03-28 12:05 | - | |
| -- Ferrari 4002 VS M40 --/ | 2022-03-28 12:05 | - | |
| -- HELP! -- w xp tablet edition/ | 2022-03-28 12:05 | - | |
| -eek- travelmate power jack please help!!/ | 2022-03-28 12:05 | - | |
| 0% Fully Charged battery/ | 2022-03-28 12:05 | - | |
| 0x800423F3 error on back up/ | 2022-03-28 12:05 | - | |
| 0xf0000006/ | 2022-03-28 12:05 | - | |
| 1) synaptics driver 2) bios and temperature (7720g)/ | 2022-03-28 12:05 | - | |
| 1.9cm Acer Ultra-thin with Intel Calpella ULV Processor/ | 2022-03-28 12:05 | - | |
| 1.33 Bios For Acer Aspire 5315 Xp/ | 2022-03-28 12:05 | - | |
| 1.66ghz duo core -- too slow/ | 2022-03-28 12:05 | - | |
| 1 hour with my new 5920G/ | 2022-03-28 12:05 | - | |
| 2D fullscreen apps display corruption/ | 2022-03-28 12:05 | - | |
| 2 GB Kingston Ultimate SD-card freezes Aspire 5024/ | 2022-03-28 12:05 | - | |
| 2 HDD's in 5670/ | 2022-03-28 12:05 | - | |
| 2 POS notebooks, requesting advice (Aspire 5024 and TM 5720)/ | 2022-03-28 12:05 | - | |
| 2 Questions about 3820TG/ | 2022-03-28 12:05 | - | |
| 2 Unnerving Problems with ACER Aspire3000/ | 2022-03-28 12:05 | - | |
| 2 bluetooth questions, one timeline, one aspire 7720/ | 2022-03-28 12:05 | - | |
| 2 cpus to choose from which one/ | 2022-03-28 12:05 | - | |
| 2 cracks on my Acer WTF/ | 2022-03-28 12:05 | - | |
| 2 different sound drivers in Acer Laptop/ | 2022-03-28 12:05 | - | |
| 2 external monitors for 5920/ | 2022-03-28 12:05 | - | |
| 2 finger scrolling w 8204 touchpad/ | 2022-03-28 12:05 | - | |
| 2gb/ | 2022-03-28 12:05 | - | |
| 2 gig of ram worth it/ | 2022-03-28 12:05 | - | |
| 2 graphics card problem/ | 2022-03-28 12:05 | - | |
| 2 issues with Vista and TM4102- ATI VGA crash and ePowerManagement/ | 2022-03-28 12:05 | - | |
| 2 line on LCD from top to bottom/ | 2022-03-28 12:05 | - | |
| 2nd HDD on Extensa Travelmate 5xxx/ | 2022-03-28 12:05 | - | |
| 2nd Hard Drive Aspire 6930G in USA/ | 2022-03-28 12:05 | - | |
| 2nd hdd in 7741g/ | 2022-03-28 12:05 | - | |
| 2 new Acer 7720s give error 6008/ | 2022-03-28 12:05 | - | |
| 2 proplems with acer 5750g ...!!/ | 2022-03-28 12:05 | - | |
| 2 questions, 1 thread. Acer warranty experience Cooler for 3820TG/ | 2022-03-28 12:05 | - | |
| 2 questions about Aspire 6920G/ | 2022-03-28 12:05 | - | |
| 2 quick questions about the 8943G/ | 2022-03-28 12:05 | - | |
| 3-8 second lag during gamin'/ | 2022-03-28 12:05 | - | |
| 3 Beeps - blank screen/ | 2022-03-28 12:05 | - | |
| 3D Card Question/ | 2022-03-28 12:05 | - | |
| 3DMARK06 3955 Points From OC 8600M GT (Aspire 5920G)/ | 2022-03-28 12:05 | - | |
| 3DMark05 on Aspire 2012 WLMi/ | 2022-03-28 12:05 | - | |
| 3D mark 05 on 5102 WMLI/ | 2022-03-28 12:05 | - | |
| 3G for Acer Aspire One/ | 2022-03-28 12:05 | - | |
| 3G on ACER/ | 2022-03-28 12:05 | - | |
| 3 Quick Questions about the ACER 5100 Laptop. (adjusting contrast etc)/ | 2022-03-28 12:05 | - | |
| 3 Touchscreen Acer's coming with Windows 7/ | 2022-03-28 12:05 | - | |
| 3dmark03 scores/ | 2022-03-28 12:05 | - | |
| 3g Mod to 1810TZ/ | 2022-03-28 12:05 | - | |
| 3 months of painful agony with Acer - my story/ | 2022-03-28 12:05 | - | |
| 3 months old laptop stopped functioning/ | 2022-03-28 12:05 | - | |
| 3 questions/ | 2022-03-28 12:05 | - | |
| 3 sets of same type of DVD software with 5929 G/ | 2022-03-28 12:05 | - | |
| 3 times for dvd rom is this normal 5930 owners, check this/ | 2022-03-28 12:05 | - | |
| 4-way scroll & virtual scroll stops working/ | 2022-03-28 12:05 | - | |
| 4.1 Sound works on Acer 7520G/ | 2022-03-28 12:05 | - | |
| 4 BSOD in one day. HELP!/ | 2022-03-28 12:05 | - | |
| 4GB DDR2 800MHz on 1810TZ/ | 2022-03-28 12:05 | - | |
| 4GB DDR2800- 4-4-4-12 vs. 6-6-6-18 on 1810T/ | 2022-03-28 12:05 | - | |
| 4GB RAM showed less in BIOS & Vista 64-bit/ | 2022-03-28 12:05 | - | |
| 4GB of memory giving PFN_LIST_CORRUPT!/ | 2022-03-28 12:05 | - | |
| 4Gb memory in Acer Aspire 5100/ | 2022-03-28 12:05 | - | |
| 4Gb on Acer Aspire 5715Z not working/ | 2022-03-28 12:05 | - | |
| 4 different CPU temp monitors display different readings/ | 2022-03-28 12:05 | - | |
| 4gb in 5672 vista 64/ | 2022-03-28 12:05 | - | |
| 4 gig and it only uses 2 gig !/ | 2022-03-28 12:05 | - | |
| 4pin 1394 connector/ | 2022-03-28 12:05 | - | |
| 4 year old extensa RAM upgrade/ | 2022-03-28 12:05 | - | |
| 5.1 channel sound problem/ | 2022-03-28 12:05 | - | |
| 5.1 headsets on 5920G/ | 2022-03-28 12:05 | - | |
| 5.1 speakers & sound card questions/ | 2022-03-28 12:05 | - | |
| 5.5GB of Hidden Files on Aspire 5610Z/ | 2022-03-28 12:05 | - | |
| 5GHz WiFi card for Aspire 5332/ | 2022-03-28 12:05 | - | |
| 5h 30min for a 5600mha bat normal/ | 2022-03-28 12:05 | - | |
| 5 in 1 card reader on Aspire 5670/ | 2022-03-28 12:05 | - | |
| 5in1 reader on vista/ | 2022-03-28 12:05 | - | |
| 6 Cell Aspire One models/ | 2022-03-28 12:05 | - | |
| 6 cell for aspire5500 travelmate3210 series/ | 2022-03-28 12:05 | - | |
| 7 and 10 Android Tablets with Sandy Bridge Coming Soon/ | 2022-03-28 12:05 | - | |
| 8.9-inch Acer Aspire One said to have hard drive flaw/ | 2022-03-28 12:05 | - | |
| 8 Blinks/ | 2022-03-28 12:05 | - | |
| 8 GB RAM 4810T unstable/ | 2022-03-28 12:05 | - | |
| 8GB on 6935G (PM45)/ | 2022-03-28 12:05 | - | |
| 8GIG yet Anyone/ | 2022-03-28 12:05 | - | |
| 9-cell battery for Aspire One What's the life like/ | 2022-03-28 12:05 | - | |
| 9.0 mm HDD vs 9.5mm HDD/ | 2022-03-28 12:05 | - | |
| 10-key function locked/ | 2022-03-28 12:05 | - | |
| 11.6 AMD Fusion Acer AO722-BZ480 at Costco for $330/ | 2022-03-28 12:05 | - | |
| 11.6 Timeline Revealed/ | 2022-03-28 12:05 | - | |
| 11.6 Timeline coming/ | 2022-03-28 12:05 | - | |
| 11.6 TravelMate B113/ | 2022-03-28 12:05 | - | |
| 11 Netbook Notebook for present/ | 2022-03-28 12:05 | - | |
| 12GB USB Flash Card/ | 2022-03-28 12:05 | - | |
| 14 inch/ | 2022-03-28 12:05 | - | |
| 14 wscreen/ | 2022-03-28 12:05 | - | |
| 15% wear on 1810 after 4 months!/ | 2022-03-28 12:05 | - | |
| 15-inch Dual Screen Acer Laptop Spotted/ | 2022-03-28 12:05 | - | |
| 15.4 inches resolution TM8204/ | 2022-03-28 12:05 | - | |
| 15.4 through 14 Acer Question/ | 2022-03-28 12:05 | - | |
| 15 minute battery life/ | 2022-03-28 12:05 | - | |
| 16 pounds!!!/ | 2022-03-28 12:05 | - | |
| 18.4 Acer 8930 vs. others, help!/ | 2022-03-28 12:05 | - | |
| 24hr use of AS5630 MCE Core 2 Duo (an issue or not)/ | 2022-03-28 12:05 | - | |
| 31w - 35w/ | 2022-03-28 12:05 | - | |
| 32 Bit Vista and Total Ram/ | 2022-03-28 12:05 | - | |
| 32Mb device on Aspire 5920/ | 2022-03-28 12:05 | - | |
| 32 or 64 bit on my acer 1410/ | 2022-03-28 12:05 | - | |
| 60.AP70N.001 VGA HEATSINK wanted/ | 2022-03-28 12:05 | - | |
| 64-Bit drivers for Vista on Aspire 5100/ | 2022-03-28 12:05 | - | |
| 64 Bit Vista on Acer 8204. Please Help/ | 2022-03-28 12:05 | - | |
| 64Bit Windows on Ferrari 3200/ | 2022-03-28 12:05 | - | |
| 64bit/ | 2022-03-28 12:05 | - | |
| 64 bit Apps/ | 2022-03-28 12:05 | - | |
| 64 bit Aspire 5735z drivers/ | 2022-03-28 12:05 | - | |
| 64 bit OS & 8GB RAM in an Aspire 8935G - RAM Shows as Only 2.971GB/ | 2022-03-28 12:05 | - | |
| 64 bit Vista Ultimate & Aspire 9300/ | 2022-03-28 12:05 | - | |
| 64bit Vista on a 5920G/ | 2022-03-28 12:05 | - | |
| 64bit XP Pro Drivers for the 1810T - Do they exist/ | 2022-03-28 12:05 | - | |
| 64 bit XP or Vista/ | 2022-03-28 12:05 | - | |
| 81 degreesC idle! - overheating Aspire/ | 2022-03-28 12:05 | - | |
| 85 degrees CPU Temp at Idle/ | 2022-03-28 12:05 | - | |
| 95%+ CPU usage with youtube hd videos. Acer Aspire 5534 - Updated Catalyst drivers - Flash 10.1/ | 2022-03-28 12:05 | - | |
| 95c and thorrling is normal for Acer/ | 2022-03-28 12:05 | - | |
| 100% CPU issue/ | 2022-03-28 12:05 | - | |
| 160 GB HDD -only 136 GB available/ | 2022-03-28 12:05 | - | |
| 169x series gfx NOT upgradable/ | 2022-03-28 12:05 | - | |
| 185.20 Powermizer/ | 2022-03-28 12:05 | - | |
| 195.62 WHQL Download Now/ | 2022-03-28 12:05 | - | |
| 200 Mhz FSB Support for 5672/ | 2022-03-28 12:05 | - | |
| 256 X700 support by Main Memory/ | 2022-03-28 12:05 | - | |
| 292LMi question/ | 2022-03-28 12:05 | - | |
| 512 RAM reports as 498/ | 2022-03-28 12:05 | - | |
| 520 series post failure/ | 2022-03-28 12:05 | - | |
| 533 and 667 DDR2 RAM/ | 2022-03-28 12:05 | - | |
| 533 ram to 667 ram on5102/ | 2022-03-28 12:05 | - | |
| 591g (v15 nitro) only two speakers in win10/ | 2022-03-28 12:05 | - | |
| 667 or 533FSB/ | 2022-03-28 12:05 | - | |
| 720p HD Lag on Aspire 5253-BZ475 (AMD C-50+HD6250)/ | 2022-03-28 12:05 | - | |
| 751h Graphics driver giving me headaches/ | 2022-03-28 12:05 | - | |
| 910GML support pin mod 533FSP/ | 2022-03-28 12:05 | - | |
| 1080tz left clicker button/ | 2022-03-28 12:05 | - | |
| 1366x768 15.6 screen for acer 5750g with wide view angles/ | 2022-03-28 12:05 | - | |
| 1366x768 to 1600x900 on 14.0/ | 2022-03-28 12:05 | - | |
| 1400 dual core bluetooth adapter question/ | 2022-03-28 12:05 | - | |
| 1410 11.9 timeline 8 gig mem support/ | 2022-03-28 12:05 | - | |
| 1410 1810 Sleeve Wrappers - Review/ | 2022-03-28 12:05 | - | |
| 1410 1810TZ 1810TZ 1830TZ waaay too confusing/ | 2022-03-28 12:05 | - | |
| 1410 1810 disassembly/ | 2022-03-28 12:05 | - | |
| 1410 Battery Life/ | 2022-03-28 12:05 | - | |
| 1410 Drivers/ | 2022-03-28 12:05 | - | |
| 1410 HDMI output question/ | 2022-03-28 12:05 | - | |
| 1410T dual core/ | 2022-03-28 12:05 | - | |
| 1410 WiFi module replacement/ | 2022-03-28 12:05 | - | |
| 1410 and 1810 in the UK/ | 2022-03-28 12:05 | - | |
| 1410 clean windows install- which drivers/ | 2022-03-28 12:05 | - | |
| 1410 dual core and H.264 vs. the 1810T/ | 2022-03-28 12:05 | - | |
| 1410 not recognizing the HD/ | 2022-03-28 12:05 | - | |
| 1410tz - release date/ | 2022-03-28 12:05 | - | |
| 1410 vs. 751/ | 2022-03-28 12:05 | - | |
| 1410 wakes from sleep by itself, but ONLY when lid closed/ | 2022-03-28 12:05 | - | |
| 1420 1820 Touch in Canada/ | 2022-03-28 12:05 | - | |
| 1430 can't add SP1 to win 7-64/ | 2022-03-28 12:05 | - | |
| 1501LCe discontinued/ | 2022-03-28 12:05 | - | |
| 1640Z CD DVD recorder doesn't seem to recognise blank disc/ | 2022-03-28 12:05 | - | |
| 1642 hard drive and memory upgrade/ | 2022-03-28 12:05 | - | |
| 1644 wlmi Wireless intel pro 2200bg not good/ | 2022-03-28 12:05 | - | |
| 1652 WLMi random lockups freezes shut downs/ | 2022-03-28 12:05 | - | |
| 1662 - Battery Help/ | 2022-03-28 12:05 | - | |
| 1662WLMi Screen/ | 2022-03-28 12:05 | - | |
| 1662 overclocked....success!/ | 2022-03-28 12:05 | - | |
| 1680 DVD-RW!/ | 2022-03-28 12:05 | - | |
| 1680 WLmi and optical drive/ | 2022-03-28 12:05 | - | |
| 1681 Card Reader/ | 2022-03-28 12:05 | - | |
| 1681 Clock Speed/ | 2022-03-28 12:05 | - | |
| 1681 Fan/ | 2022-03-28 12:05 | - | |
| 1681 WMLI or 2012WLCi!!/ | 2022-03-28 12:05 | - | |
| 1681 Wlci wireless problem/ | 2022-03-28 12:05 | - | |
| 1681 vs 2012/ | 2022-03-28 12:05 | - | |
| 1683 vs 4002 (display)/ | 2022-03-28 12:05 | - | |
| 1690 DDR DDR 2 bioses/ | 2022-03-28 12:05 | - | |
| 1690 Memory Upgrade/ | 2022-03-28 12:05 | - | |
| 1690 Series Drivers/ | 2022-03-28 12:05 | - | |
| 1690 Series and Linux/ | 2022-03-28 12:05 | - | |
| 1690 how to extract the DVDROM & reinstall eRecov/ | 2022-03-28 12:05 | - | |
| 1691 and Wi-Fi oscilations/ | 2022-03-28 12:05 | - | |
| 1691wlmi vs. 1691/ | 2022-03-28 12:05 | - | |
| 1692WLMi - 1 week of use/ | 2022-03-28 12:05 | - | |
| 1694WLMi bluetooth + Wifi probs/ | 2022-03-28 12:05 | - | |
| 1694WLMi w X700 256mb, what BIOS/ | 2022-03-28 12:05 | - | |
| 1694WLMi with x700 has reached the UK/ | 2022-03-28 12:05 | - | |
| 1694 intermittent WiFi LED/ | 2022-03-28 12:05 | - | |
| 1694wlmi bluetooth/ | 2022-03-28 12:05 | - | |
| 1694wmli bios update/ | 2022-03-28 12:05 | - | |
| 1694wmli temperature/ | 2022-03-28 12:05 | - | |
| 1700 encounter/ | 2022-03-28 12:05 | - | |
| 1759$ for 8204/ | 2022-03-28 12:05 | - | |
| 1801 fan noise/ | 2022-03-28 12:05 | - | |
| 1804WSMI w IPN2220 - can't see any wireless networks/ | 2022-03-28 12:05 | - | |
| 1804wsmi PCMCIA and the blue screen of death/ | 2022-03-28 12:05 | - | |
| 1810T- Finnicky arrow keys/ | 2022-03-28 12:05 | - | |
| 1810T- How do I disable power management on Bluetooth; keep Bluetooth fully powered/ | 2022-03-28 12:05 | - | |
| 1810T - Installing Intel Wifi Link 5300's Third Antenna/ | 2022-03-28 12:05 | - | |
| 1810T - Suggestions for installing W7 ult and old partitions/ | 2022-03-28 12:05 | - | |
| 1810T 9 Cell Battery Reviews/ | 2022-03-28 12:05 | - | |
| 1810T 1810TZ WebCam/ | 2022-03-28 12:05 | - | |
| 1810T Battery/ | 2022-03-28 12:05 | - | |
| 1810T Price Jump/ | 2022-03-28 12:05 | - | |
| 1810T SD Card Reader Max/ | 2022-03-28 12:05 | - | |
| 1810T SU7300, no WiFi in 32-bit XP/ | 2022-03-28 12:05 | - | |
| 1810T Super cool bluetooth solution/ | 2022-03-28 12:05 | - | |
| 1810T Superpi 1M contest (stock clocks)/ | 2022-03-28 12:05 | - | |
| 1810T Suyin Camera driver/ | 2022-03-28 12:05 | - | |
| 1810TZ, Limit Charge Capacity/ | 2022-03-28 12:05 | - | |
| 1810TZ, statically charged screen when on AC !/ | 2022-03-28 12:05 | - | |
| 1810TZ -History of BIOS changes/ | 2022-03-28 12:05 | - | |
| 1810TZ - You Helped Get the W7 Pro Installed but where's the WiFi Adapters Go/ | 2022-03-28 12:05 | - | |
| 1810TZ- display overflow when use HDMI out/ | 2022-03-28 12:05 | - | |
| 1810TZ 3GB memory configuration/ | 2022-03-28 12:05 | - | |
| 1810TZ Charger rate results/ | 2022-03-28 12:05 | - | |
| 1810TZ Wireless Drivers/ | 2022-03-28 12:05 | - | |
| 1810TZ and YouTube 1080p/ | 2022-03-28 12:05 | - | |
| 1810TZ battery in 1410/ | 2022-03-28 12:05 | - | |
| 1810TZ with Huawei EM770W wwan GPS/ | 2022-03-28 12:05 | - | |
| 1810T and wifi card intel 5100 to N 6205 upgrade/ | 2022-03-28 12:05 | - | |
| 1810T clean install, but keep PQService/ | 2022-03-28 12:05 | - | |
| 1810T running 1.6Ghz/ | 2022-03-28 12:05 | - | |
| 1810T webcam question/ | 2022-03-28 12:05 | - | |
| 1810 Ubuntu Battery Life/ | 2022-03-28 12:05 | - | |
| 1810t (HardwareMod) iPhone like Acceleration Sensor Analog Joystick/ | 2022-03-28 12:05 | - | |
| 1810t- SSD + HDD/ | 2022-03-28 12:05 | - | |
| 1810t Abnormal idle power consumption after x264 video/ | 2022-03-28 12:05 | - | |
| 1810t TME MOD/ | 2022-03-28 12:05 | - | |
| 1810tray/ | 2022-03-28 12:05 | - | |
| 1810tz - Video lagging on tv after w7 upgrade/ | 2022-03-28 12:05 | - | |
| 1810tz Availability and Updates/ | 2022-03-28 12:05 | - | |
| 1810tz Explorer crash right click desktop/ | 2022-03-28 12:05 | - | |
| 1810tz Keyboard/ | 2022-03-28 12:05 | - | |
| 1810tz and external monitor/ | 2022-03-28 12:05 | - | |
| 1810tz audio problem, background noises/ | 2022-03-28 12:05 | - | |
| 1810tz reset to default/ | 2022-03-28 12:05 | - | |
| 1810tz vs Silverlight Movie = stutter -(/ | 2022-03-28 12:05 | - | |
| 1830T- PCI Simple Communication Device, Modem and Card Reader/ | 2022-03-28 12:05 | - | |
| 1830T Owners Lounge/ | 2022-03-28 12:05 | - | |
| 1830T Power Issue/ | 2022-03-28 12:05 | - | |
| 1830T and Sata 3/ | 2022-03-28 12:05 | - | |
| 1920x1080, or 1680x1050 External Monitor with 7720/ | 2022-03-28 12:05 | - | |
| 2001lci or 2012wlci/ | 2022-03-28 12:05 | - | |
| 2001wlci/ | 2022-03-28 12:05 | - | |
| 2003 and 2012/ | 2022-03-28 12:05 | - | |
| 2003 lmc/ | 2022-03-28 12:05 | - | |
| 2012- WIreless network not working!!!/ | 2022-03-28 12:05 | - | |
| 2012WLMi/ | 2022-03-28 12:05 | - | |
| 2012wlmi cheaper then 2012wlci/ | 2022-03-28 12:05 | - | |
| 2012wlmi future Banias to Dothan/ | 2022-03-28 12:05 | - | |
| 2019 Acer Predator Helios 700 PH717-71/ | 2022-03-28 12:05 | - | |
| 2019 Acer Swift 7/ | 2022-03-28 12:05 | - | |
| 2023 Aspire Arcade DVD Movie stops/ | 2022-03-28 12:05 | - | |
| 2023 vs 1662/ | 2022-03-28 12:05 | - | |
| 2023wlmi in order/ | 2022-03-28 12:05 | - | |
| 2303LCi information opinions needed/ | 2022-03-28 12:05 | - | |
| 2303WLCi Opinions wanted/ | 2022-03-28 12:05 | - | |
| 2303WLci Bluetooth/ | 2022-03-28 12:05 | - | |
| 2303Wlmi/ | 2022-03-28 12:05 | - | |
| 2410 - Wireless button on front gives No Device/ | 2022-03-28 12:05 | - | |
| 2490 5 in 1 Card Reader - Not Reading Cards!/ | 2022-03-28 12:05 | - | |
| 2920-6569 cpu upgradeable/ | 2022-03-28 12:05 | - | |
| 3002 3WLCi versus 5002WLCi/ | 2022-03-28 12:05 | - | |
| 3002 LMi HDD busted - what now/ | 2022-03-28 12:05 | - | |
| 3002WTCi - Upgrading Mini-PCI Wifi Card - comp freezes/ | 2022-03-28 12:05 | - | |
| 3003LCI Battery/ | 2022-03-28 12:05 | - | |
| 3003LCI Ram upgrade/ | 2022-03-28 12:05 | - | |
| 3003LCI reformat with XP Pro/ | 2022-03-28 12:05 | - | |
| 3003WLCi AC adapter problem/ | 2022-03-28 12:05 | - | |
| 3003WLCi graphic problems/ | 2022-03-28 12:05 | - | |
| 3003 info incorrect/ | 2022-03-28 12:05 | - | |
| 3003wlmi/ | 2022-03-28 12:05 | - | |
| 3020 contrast/ | 2022-03-28 12:05 | - | |
| 3023 Laptop Sleeve/ | 2022-03-28 12:05 | - | |
| 3050 DVDrom help please/ | 2022-03-28 12:05 | - | |
| 3050 cooling question/ | 2022-03-28 12:05 | - | |
| 3050 wireless drivers/ | 2022-03-28 12:05 | - | |
| 3100 Left mouse button failure/ | 2022-03-28 12:05 | - | |
| 3100 Series Modding/ | 2022-03-28 12:05 | - | |
| 3201 AC adapter/ | 2022-03-28 12:05 | - | |
| 3201XCi HDD RPM Issue/ | 2022-03-28 12:05 | - | |
| 3201XCi Wireless intermittent/ | 2022-03-28 12:05 | - | |
| 3201XCi gripes/ | 2022-03-28 12:05 | - | |
| 3201XCi problem & Acer service/ | 2022-03-28 12:05 | - | |
| 3201XCi questions (RAM, HD)/ | 2022-03-28 12:05 | - | |
| 3201XCi upgrades/ | 2022-03-28 12:05 | - | |
| 3201 XMi on its way/ | 2022-03-28 12:05 | - | |
| 3201 does not comes with 5400rpm HD/ | 2022-03-28 12:05 | - | |
| 3201 extra power/ | 2022-03-28 12:05 | - | |
| 3201 touchpad - Sensitive!!/ | 2022-03-28 12:05 | - | |
| 3201xci-xpp vs. 3201xci-xpp-sp2...differences, etc/ | 2022-03-28 12:05 | - | |
| 3201xci BlueTooth/ | 2022-03-28 12:05 | - | |
| 3201xci Story (blueman, are you there )/ | 2022-03-28 12:05 | - | |
| 3201xci and dvd drive/ | 2022-03-28 12:05 | - | |
| 3201xci reviewed by asia cnet/ | 2022-03-28 12:05 | - | |
| 3212wxmi problems/ | 2022-03-28 12:05 | - | |
| 3273WXMi disconnects from the internet/ | 2022-03-28 12:05 | - | |
| 3315 bios/ | 2022-03-28 12:05 | - | |
| 3319 Bios for 8204 on US site/ | 2022-03-28 12:05 | - | |
| 3500 can't see my DVD RW drive/ | 2022-03-28 12:05 | - | |
| 3502 will not turn on/ | 2022-03-28 12:05 | - | |
| 3613LCi Harddrive Upgrade/ | 2022-03-28 12:05 | - | |
| 3620 upgrades/ | 2022-03-28 12:05 | - | |
| 3680-2682 Ram and CPU swap comming soon/ | 2022-03-28 12:05 | - | |
| 3680 DVD ROM Problem/ | 2022-03-28 12:05 | - | |
| 3680 Integrated graphics upgrade/ | 2022-03-28 12:05 | - | |
| 3680 Problem/ | 2022-03-28 12:05 | - | |
| 3680 bios 3508/ | 2022-03-28 12:05 | - | |
| 3680 swappable parts with an Extensa/ | 2022-03-28 12:05 | - | |
| 3680 turns on but blank screen/ | 2022-03-28 12:05 | - | |
| 3690-2846 model/ | 2022-03-28 12:05 | - | |
| 3690 Battery life/ | 2022-03-28 12:05 | - | |
| 3810 (w SU2700) or 1410 (w SU2300)/ | 2022-03-28 12:05 | - | |
| 3810T (4500MHD) or 3810TG (+HD4330)/ | 2022-03-28 12:05 | - | |
| 3810T-6775 only has 28GB of free space out of box!/ | 2022-03-28 12:05 | - | |
| 3810T Bios/ | 2022-03-28 12:05 | - | |
| 3810TG and 3g/ | 2022-03-28 12:05 | - | |
| 3810TG led backlight issue/ | 2022-03-28 12:05 | - | |
| 3810T Strange Windows 7 BSODs/ | 2022-03-28 12:05 | - | |
| 3810TZ freezing problem/ | 2022-03-28 12:05 | - | |
| 3810TZ has the BEST webcam EVER, 1810 does not/ | 2022-03-28 12:05 | - | |
| 3810T as Mediacenter/ | 2022-03-28 12:05 | - | |
| 3810T drivers/ | 2022-03-28 12:05 | - | |
| 3810T tuning for optimum Performance/ | 2022-03-28 12:05 | - | |
| 3810 availability/ | 2022-03-28 12:05 | - | |
| 3810 display problems/ | 2022-03-28 12:05 | - | |
| 3810 keyboard compatible with 3820TG/ | 2022-03-28 12:05 | - | |
| 3810t doesnt recognize boot disk, crashes repeatedly - Help!/ | 2022-03-28 12:05 | - | |
| 3810t hangs in SleepMode on WinXP/ | 2022-03-28 12:05 | - | |
| 3810t problems/ | 2022-03-28 12:05 | - | |
| 3810t recall timeframe/ | 2022-03-28 12:05 | - | |
| 3810t timeline battery charging orange blue LED/ | 2022-03-28 12:05 | - | |
| 3820T - Flash Bios fail. (0x4D0)/ | 2022-03-28 12:05 | - | |
| 3820T 3G Modul/ | 2022-03-28 12:05 | - | |
| 3820T BSoD MACHINE_CHECK_EXCEPTION/ | 2022-03-28 12:05 | - | |
| 3820TG-3022 (HD5470). Has the video card crashed/ | 2022-03-28 12:05 | - | |
| 3820TG - Broken Screen. Any non-TN replacement options/ | 2022-03-28 12:05 | - | |
| 3820TG - Green Line On Screen/ | 2022-03-28 12:05 | - | |
| 3820TG - New LCD LVDS cable - Not same part number, would it work/ | 2022-03-28 12:05 | - | |
| 3820TG- SSD causes windows 7 to freeze often/ | 2022-03-28 12:05 | - | |
| 3820TG - Where to buy a battery/ | 2022-03-28 12:05 | - | |
| 3820TG Battery Life/ | 2022-03-28 12:05 | - | |
| 3820TG Dolby Digital Live/ | 2022-03-28 12:05 | - | |
| 3820TG Out of stock. Please help/ | 2022-03-28 12:05 | - | |
| 3820TG Owner's Lounge - Part Two/ | 2022-03-28 12:05 | - | |
| 3820TG Replacement Battery/ | 2022-03-28 12:05 | - | |
| 3820TG Scratches/ | 2022-03-28 12:05 | - | |
| 3820TG Through Amazon/ | 2022-03-28 12:05 | - | |
| 3820TGTray/ | 2022-03-28 12:05 | - | |
| 3820TG Wireless card upgrade/ | 2022-03-28 12:05 | - | |
| 3820TG external monitor problem/ | 2022-03-28 12:05 | - | |
| 3820TG first time charge/ | 2022-03-28 12:05 | - | |
| 3820TG from PCHOME Defective... What Should I Do/ | 2022-03-28 12:05 | - | |
| 3820TG in the US/ | 2022-03-28 12:05 | - | |
| 3820TG no battery ssue/ | 2022-03-28 12:05 | - | |
| 3820TG vs. 4820TG/ | 2022-03-28 12:05 | - | |
| 3820TG vs 4820TG/ | 2022-03-28 12:05 | - | |
| 3820T upgrade- memory or ssd/ | 2022-03-28 12:05 | - | |
| 3820 and 4820tg/ | 2022-03-28 12:05 | - | |
| 3820t/ | 2022-03-28 12:05 | - | |
| 3820tg & linux, any problems/ | 2022-03-28 12:05 | - | |
| 3820tg-3022 backlight died/ | 2022-03-28 12:05 | - | |
| 3820tg-6829 overclock steps/ | 2022-03-28 12:05 | - | |
| 3820tg- Compatible 9-cell battery/ | 2022-03-28 12:05 | - | |
| 3820tg = ~7900 (3dmark06)/ | 2022-03-28 12:05 | - | |
| 3820tg Availability in Singapore/ | 2022-03-28 12:05 | - | |
| 3820tg BSOD when i shutdown or restart computer! !/ | 2022-03-28 12:05 | - | |
| 3820tg Discrete Graphics Failure/ | 2022-03-28 12:05 | - | |
| 3820tg Power Adapter alternative/ | 2022-03-28 12:05 | - | |
| 3820tg Trackpad Problem!!!!/ | 2022-03-28 12:05 | - | |
| 3820tg Unusual Issue- missing GPU/ | 2022-03-28 12:05 | - | |
| 3820tg and 4820tg- Battery compatibility/ | 2022-03-28 12:05 | - | |
| 3820tg and standby problem/ | 2022-03-28 12:05 | - | |
| 3820tg cpu fan won't start/ | 2022-03-28 12:05 | - | |
| 3820tg i7 launched in Korea/ | 2022-03-28 12:05 | - | |
| 3820tg ssd upgrade problem/ | 2022-03-28 12:05 | - | |
| 3820tg stripped screw middle of bottom plate/ | 2022-03-28 12:05 | - | |
| 3820tg switchable graphics problems/ | 2022-03-28 12:05 | - | |
| 3820tg thermal compound spread technique/ | 2022-03-28 12:05 | - | |
| 3830TG - Turning off Power and Battery Indicator LED's/ | 2022-03-28 12:05 | - | |
| 3830TG Fn keys display toggle/ | 2022-03-28 12:05 | - | |
| 3830TG keyboad error/ | 2022-03-28 12:05 | - | |
| 3830tg and League of legends/ | 2022-03-28 12:05 | - | |
| 3935 Fn keys/ | 2022-03-28 12:05 | - | |
| 3960-2970 4Gb Memory Capable/ | 2022-03-28 12:05 | - | |
| 4001LCi - GPU question/ | 2022-03-28 12:05 | - | |
| 4002WLMI won't boot any more/ | 2022-03-28 12:05 | - | |
| 4005 CPU running cool/ | 2022-03-28 12:05 | - | |
| 4011 & backup dvd- I figured it out/ | 2022-03-28 12:05 | - | |
| 4021 Wireless issue/ | 2022-03-28 12:05 | - | |
| 4062LCi 1.7Centrino game server problem/ | 2022-03-28 12:05 | - | |
| 4062MLi wont charge/ | 2022-03-28 12:05 | - | |
| 4072 vs. 5672/ | 2022-03-28 12:05 | - | |
| 4102's access of harddrive and memory/ | 2022-03-28 12:05 | - | |
| 4315 LCD Compatability/ | 2022-03-28 12:05 | - | |
| 4315 boots with Intel Core Duo T8100 2.10GHz!/ | 2022-03-28 12:05 | - | |
| 4400 or 6600 ma h batteri on TM4500/ | 2022-03-28 12:05 | - | |
| 4402 is out of stock in some stores, is it wise to go to 4404/ | 2022-03-28 12:05 | - | |
| 4420-5963 fresh vista os....where do i start/ | 2022-03-28 12:05 | - | |
| 4420 XP change/ | 2022-03-28 12:05 | - | |
| 4420 freezes when watching movies/ | 2022-03-28 12:05 | - | |
| 4420 turbo memory driver/ | 2022-03-28 12:05 | - | |
| 4500mhd GS45/ | 2022-03-28 12:05 | - | |
| 4501-newegg has ARRIVED!!!/ | 2022-03-28 12:05 | - | |
| 4501 Feedback/ | 2022-03-28 12:05 | - | |
| 4501WLMI Question/ | 2022-03-28 12:05 | - | |
| 4501WLMi CPU upgrade/ | 2022-03-28 12:05 | - | |
| 4501WLMi for Canadians/ | 2022-03-28 12:05 | - | |
| 4501 WMLI, did I get screwed/ | 2022-03-28 12:05 | - | |
| 4501wlmi hard drive speed/ | 2022-03-28 12:05 | - | |
| 4502LMI Technical Specifications/ | 2022-03-28 12:05 | - | |
| 4502 graphics card/ | 2022-03-28 12:05 | - | |
| 4502lmi - any chance to upgrade and unlock bios/ | 2022-03-28 12:05 | - | |
| 4650 4100 for budget buyers/ | 2022-03-28 12:05 | - | |
| 4650 heat output/ | 2022-03-28 12:05 | - | |
| 4670 vs. 5670/ | 2022-03-28 12:05 | - | |
| 4710Z - issues after Vista - XP upgrade/ | 2022-03-28 12:05 | - | |
| 4710 keyboard shortcut/ | 2022-03-28 12:05 | - | |
| 4710z 4gb ram it possible aur not/ | 2022-03-28 12:05 | - | |
| 4720z/ | 2022-03-28 12:05 | - | |
| 4720z has mxm pins, can I use them/ | 2022-03-28 12:05 | - | |
| 4720z sd card reader/ | 2022-03-28 12:05 | - | |
| 4730z Battery Problems/ | 2022-03-28 12:05 | - | |
| 4730z aspire not taking charge or turning on/ | 2022-03-28 12:05 | - | |
| 4736z HDMI problem/ | 2022-03-28 12:05 | - | |
| 4741 DMI problem/ | 2022-03-28 12:05 | - | |
| 4741g - gt540m/ | 2022-03-28 12:05 | - | |
| 4750G Stuck on Boot Splash Screen/ | 2022-03-28 12:05 | - | |
| 4810/ | 2022-03-28 12:05 | - | |
| 4810 SU4100 vs SU9400/ | 2022-03-28 12:05 | - | |
| 4810T + Windows 7 = 4 Hours Battery! Help!/ | 2022-03-28 12:05 | - | |
| 4810T - the end of the freezing saga/ | 2022-03-28 12:05 | - | |
| 4810TG and Bluetooth/ | 2022-03-28 12:05 | - | |
| 4810TG don't boot after hybernation/ | 2022-03-28 12:05 | - | |
| 4810T Travel adapter/ | 2022-03-28 12:05 | - | |
| 4810TZ and external monitor/ | 2022-03-28 12:05 | - | |
| 4810TZ plugged in light/ | 2022-03-28 12:05 | - | |
| 4810T bluetooth at startup/ | 2022-03-28 12:05 | - | |
| 4810T headphone jack CRT board/ | 2022-03-28 12:05 | - | |
| 4810T won't let me flash BIOS/ | 2022-03-28 12:05 | - | |
| 4810 annoying sound/ | 2022-03-28 12:05 | - | |
| 4810 for Web Design/ | 2022-03-28 12:05 | - | |
| 4810 performance question/ | 2022-03-28 12:05 | - | |
| 4820TG - Gaming, Heat, Switchable GFX, and HDMI/ | 2022-03-28 12:05 | - | |
| 4820TG - Strange Issue/ | 2022-03-28 12:05 | - | |
| 4820TG 1900x600 screen BIOS hack needed/ | 2022-03-28 12:05 | - | |
| 4820TG GPU Overclocking/ | 2022-03-28 12:05 | - | |
| 4820TG Graphics drivers not updating/ | 2022-03-28 12:05 | - | |
| 4820TG HDMI audio stutter problem while playing movies/ | 2022-03-28 12:05 | - | |
| 4820TG HDMI issue/ | 2022-03-28 12:05 | - | |
| 4820TG Intel driver problem/ | 2022-03-28 12:05 | - | |
| 4820TG SSD & Storage Options/ | 2022-03-28 12:05 | - | |
| 4820TG best graphics performance/ | 2022-03-28 12:05 | - | |
| 4820TG drivers on 4810TGZ/ | 2022-03-28 12:05 | - | |
| 4820TG dying a slow and painful death/ | 2022-03-28 12:05 | - | |
| 4820TG hard drive optical bay caddy/ | 2022-03-28 12:05 | - | |
| 4820 TG repair speakers/ | 2022-03-28 12:05 | - | |
| 4820TG vs 5820TG/ | 2022-03-28 12:05 | - | |
| 4820TG w 5650M - vBIOS overclocking/ | 2022-03-28 12:05 | - | |
| 4820T card reader/ | 2022-03-28 12:05 | - | |
| 4820T hard drive/ | 2022-03-28 12:05 | - | |
| 4820T keyboard/ | 2022-03-28 12:05 | - | |
| 4820T maximum brightness during startup/ | 2022-03-28 12:05 | - | |
| 4820T video memory/ | 2022-03-28 12:05 | - | |
| 4820T vs 4820TG/ | 2022-03-28 12:05 | - | |
| 4820T won't start with RTC battery/ | 2022-03-28 12:05 | - | |
| 4820tg-6847 wireless card/ | 2022-03-28 12:05 | - | |
| 4820tg - Any Common Problems/ | 2022-03-28 12:05 | - | |
| 4820tg - i3 or i5/ | 2022-03-28 12:05 | - | |
| 4820tg Keyboard Ribbon Disconnect from Socket/ | 2022-03-28 12:05 | - | |
| 4820tg durability reliability/ | 2022-03-28 12:05 | - | |
| 4820tg gone/ | 2022-03-28 12:05 | - | |
| 4820tg how to autoswitch switch graphics/ | 2022-03-28 12:05 | - | |
| 4820tg or wait for 4830/ | 2022-03-28 12:05 | - | |
| 4820tg track pad help/ | 2022-03-28 12:05 | - | |
| 4920G w XP low sound/ | 2022-03-28 12:05 | - | |
| 4920 recovery, help sought/ | 2022-03-28 12:05 | - | |
| 5002 - Adding Bluetooth/ | 2022-03-28 12:05 | - | |
| 5002 wlmi questions/ | 2022-03-28 12:05 | - | |
| 5003, 4402 or 4404 can not decide, plz help me/ | 2022-03-28 12:05 | - | |
| 5003 WMLi Half life 2 plays! No go on Farcry/ | 2022-03-28 12:05 | - | |
| 5014 graphics problem/ | 2022-03-28 12:05 | - | |
| 5021WLMi, suddenly goes black screen/ | 2022-03-28 12:05 | - | |
| 5021 screen problem/ | 2022-03-28 12:05 | - | |
| 5022wlmi W-LAN button - Driver controlled/ | 2022-03-28 12:05 | - | |
| 5024WLMi - can't read 1-2GB SD cards/ | 2022-03-28 12:05 | - | |
| 5024WLMi - no reboot/ | 2022-03-28 12:05 | - | |
| 5024WLMi random reboot problem/ | 2022-03-28 12:05 | - | |
| 5024 and light under wlan button/ | 2022-03-28 12:05 | - | |
| 5024 wlan problem/ | 2022-03-28 12:05 | - | |
| 5044WLMI Vs 5002WLMi/ | 2022-03-28 12:05 | - | |
| 5050 concern/ | 2022-03-28 12:05 | - | |
| 5050 sound volume low since Vista upgrade/ | 2022-03-28 12:05 | - | |
| 5051AWXMi - RAM faults, BSOD/ | 2022-03-28 12:05 | - | |
| 5051 Power problems/ | 2022-03-28 12:05 | - | |
| 5100-3357 Gaming x1100/ | 2022-03-28 12:05 | - | |
| 5100-3357 does it have BT/ | 2022-03-28 12:05 | - | |
| 5100-3357 is 10-7!/ | 2022-03-28 12:05 | - | |
| 5100-5102/ | 2022-03-28 12:05 | - | |
| 5100 - Power settings auto detect when plugged in and when using battery/ | 2022-03-28 12:05 | - | |
| 5100 best audio settings for small speakers equalizer/ | 2022-03-28 12:05 | - | |
| 5100 driver to make built in mic work/ | 2022-03-28 12:05 | - | |
| 5100 internal mic/ | 2022-03-28 12:05 | - | |
| 5100 vista upgrade cd a restore disk/ | 2022-03-28 12:05 | - | |
| 5100 which wireless driver do I use/ | 2022-03-28 12:05 | - | |
| 5101awlmi/ | 2022-03-28 12:05 | - | |
| 5101awlmi or 5102wlmi/ | 2022-03-28 12:05 | - | |
| 5101 battery not charging/ | 2022-03-28 12:05 | - | |
| 5101 fan always on/ | 2022-03-28 12:05 | - | |
| 5101 wlmi external wifi/ | 2022-03-28 12:05 | - | |
| 5102 Keyboard problem/ | 2022-03-28 12:05 | - | |
| 5102 Sleep Fix/ | 2022-03-28 12:05 | - | |
| 5102 Vista/ | 2022-03-28 12:05 | - | |
| 5102WLMi- Catalyst Control Center Update/ | 2022-03-28 12:05 | - | |
| 5102WLMi BIOS update/ | 2022-03-28 12:05 | - | |
| 5102WLMi Battlefield 2 graphics/ | 2022-03-28 12:05 | - | |
| 5102WLMi Memory..what would you buy/ | 2022-03-28 12:05 | - | |
| 5102WLMi service errors on startup/ | 2022-03-28 12:05 | - | |
| 5102 WLMi shut down problem in Vista/ | 2022-03-28 12:05 | - | |
| 5102Wlmi...which Atheros Wireless Driver/ | 2022-03-28 12:05 | - | |
| 5102 audio drivers/ | 2022-03-28 12:05 | - | |
| 5102 bios problem/ | 2022-03-28 12:05 | - | |
| 5102 bluetooht/ | 2022-03-28 12:05 | - | |
| 5102 graphics driver wanted/ | 2022-03-28 12:05 | - | |
| 5102 is having major problems/ | 2022-03-28 12:05 | - | |
| 5102 managing cores/ | 2022-03-28 12:05 | - | |
| 5102 memory upgrade advice needed/ | 2022-03-28 12:05 | - | |
| 5102 tl-64 upgrade/ | 2022-03-28 12:05 | - | |
| 5102wlmi Problems w the touchpad - Help/ | 2022-03-28 12:05 | - | |
| 5102wlmi new hdd driver problems/ | 2022-03-28 12:05 | - | |
| 5103 Orbicam not working/ | 2022-03-28 12:05 | - | |
| 5103 wlmi audio problems/ | 2022-03-28 12:05 | - | |
| 5110 Video Drivers/ | 2022-03-28 12:05 | - | |
| 5112WLMi and Xp 64/ | 2022-03-28 12:05 | - | |
| 5290G downgraded to xp internal mic drivers/ | 2022-03-28 12:05 | - | |
| 5290g aspire i want to update graphic card-problem i cant find/ | 2022-03-28 12:05 | - | |
| 5300 or 5400/ | 2022-03-28 12:05 | - | |
| 5315, Clean Vista install, nearly perfect!/ | 2022-03-28 12:05 | - | |
| 5315-2122 Accer CPU/ | 2022-03-28 12:05 | - | |
| 5315-2153 Hard Drive Compatibility/ | 2022-03-28 12:05 | - | |
| 5315 - annoying screensaver/ | 2022-03-28 12:05 | - | |
| 5315... bad mobo/ | 2022-03-28 12:05 | - | |
| 5315 1.43 bios and XP/ | 2022-03-28 12:05 | - | |
| 5315 Alt F10/ | 2022-03-28 12:05 | - | |
| 5315 Reinstall of original OS/ | 2022-03-28 12:05 | - | |
| 5315 Switches on then off in 3 sec's/ | 2022-03-28 12:05 | - | |
| 5315 XP Issues/ | 2022-03-28 12:05 | - | |
| 5315 battery weirdness/ | 2022-03-28 12:05 | - | |
| 5315 drivers/ | 2022-03-28 12:05 | - | |
| 5315 from acer/ | 2022-03-28 12:05 | - | |
| 5315 hard drive help/ | 2022-03-28 12:05 | - | |
| 5315 hd, dos'nt fit in 7730G/ | 2022-03-28 12:05 | - | |
| 5315 laptop question/ | 2022-03-28 12:05 | - | |
| 5315 no boot after 2GB Ram upgrade/ | 2022-03-28 12:05 | - | |
| 5315 randomly shuts down/ | 2022-03-28 12:05 | - | |
| 5315 red disaplay on startup/ | 2022-03-28 12:05 | - | |
| 5315 windows 7/ | 2022-03-28 12:05 | - | |
| 5315 with win 7/ | 2022-03-28 12:05 | - | |
| 5502wxmi 4024wlmi/ | 2022-03-28 12:05 | - | |
| 5515 and Windows 7/ | 2022-03-28 12:05 | - | |
| 5515 will not turn completely on/ | 2022-03-28 12:05 | - | |
| 5516,5517,5532,5534 compatible/ | 2022-03-28 12:05 | - | |
| 5517 and getting lots of systemhaving big probs with acer labtop/ | 2022-03-28 12:05 | - | |
| 5520-5716 BIOS Updates/ | 2022-03-28 12:05 | - | |
| 5520-5716 Wireless/ | 2022-03-28 12:05 | - | |
| 5520 Aspire Question/ | 2022-03-28 12:05 | - | |
| 5520 Bios Resetting/ | 2022-03-28 12:05 | - | |
| 5520G died/ | 2022-03-28 12:05 | - | |
| 5520 Possible Hard Drive Problem/ | 2022-03-28 12:05 | - | |
| 5520g with 9300m gs problem/ | 2022-03-28 12:05 | - | |
| 5520 motherboard to 5520g motherboard possible/ | 2022-03-28 12:05 | - | |
| 5520 random keystrokes when typing/ | 2022-03-28 12:05 | - | |
| 5536 no os found after factory restore/ | 2022-03-28 12:05 | - | |
| 5542-1462 dvd inop/ | 2022-03-28 12:05 | - | |
| 5553G AMD N930 CPU overclocking- How/ | 2022-03-28 12:05 | - | |
| 5560 sound issue/ | 2022-03-28 12:05 | - | |
| 5562 or 5672 tv-out problem/ | 2022-03-28 12:05 | - | |
| 5570z LCD display help/ | 2022-03-28 12:05 | - | |
| 5570z processor upgrade/ | 2022-03-28 12:05 | - | |
| 5600 mAh battery on the 1410/ | 2022-03-28 12:05 | - | |
| 5610 CPU upgradable/ | 2022-03-28 12:05 | - | |
| 5610Z recovery partition password protected/ | 2022-03-28 12:05 | - | |
| 5610Z replacement screen/ | 2022-03-28 12:05 | - | |
| 5610 booting from XP cd/ | 2022-03-28 12:05 | - | |
| 5610z and XP cd/ | 2022-03-28 12:05 | - | |
| 5610z dvd cd rom will not recognize anything at all/ | 2022-03-28 12:05 | - | |
| 5610z problems/ | 2022-03-28 12:05 | - | |
| 5613 volume problem/ | 2022-03-28 12:05 | - | |
| 5620z-4025/ | 2022-03-28 12:05 | - | |
| 5620z/ | 2022-03-28 12:05 | - | |
| 5620z Vista to WinXP Pro with issues on IDE to AHCI and NO SOUND/ | 2022-03-28 12:05 | - | |
| 5630-6091 internal bluetooth adptation help/ | 2022-03-28 12:05 | - | |
| 5630 Clock resetting very frequently!!/ | 2022-03-28 12:05 | - | |
| 5630 sound and mouse problem/ | 2022-03-28 12:05 | - | |
| 5633 Orbicam frame rate/ | 2022-03-28 12:05 | - | |
| 5650 clean install/ | 2022-03-28 12:05 | - | |
| 5652WLMi Graphics card problem/ | 2022-03-28 12:05 | - | |
| 5670- after BIOS 3224 update fan runs less often/ | 2022-03-28 12:05 | - | |
| 5670 Problem with wireless lan/ | 2022-03-28 12:05 | - | |
| 5670 Removing Hard Drive, How/ | 2022-03-28 12:05 | - | |
| 5670 and variable CPU speed/ | 2022-03-28 12:05 | - | |
| 5670 fan not working..much. solutions/ | 2022-03-28 12:05 | - | |
| 5670 touchpad/ | 2022-03-28 12:05 | - | |
| 5672 & BT Headphones/ | 2022-03-28 12:05 | - | |
| 5672 - Can't disable 1394 adapter/ | 2022-03-28 12:05 | - | |
| 5672 - out of standby issue/ | 2022-03-28 12:05 | - | |
| 5672 - what do you use the webcam for/ | 2022-03-28 12:05 | - | |
| 5672 4 Gig Memory Upgrade/ | 2022-03-28 12:05 | - | |
| 5672AWLMI screen grainyness/ | 2022-03-28 12:05 | - | |
| 5672 Beeps @ Startup/ | 2022-03-28 12:05 | - | |
| 5672 Bios Update for X1600 graininess/ | 2022-03-28 12:05 | - | |
| 5672 Bios error Event log/ | 2022-03-28 12:05 | - | |
| 5672 DVD Burning Speeds/ | 2022-03-28 12:05 | - | |
| 5672 DVD Drive Dead/ | 2022-03-28 12:05 | - | |
| 5672 Display NOT Working/ | 2022-03-28 12:05 | - | |
| 5672 Drivers, helpp please/ | 2022-03-28 12:05 | - | |
| 5672 Freezing during Browsing/ | 2022-03-28 12:05 | - | |
| 5672 Install Questions Comments/ | 2022-03-28 12:05 | - | |
| 5672 Memory Upgrade with benchmark results (667MHz CL4 RAM)/ | 2022-03-28 12:05 | - | |
| 5672 PXE-E61 & M0F Error - need some help please/ | 2022-03-28 12:05 | - | |
| 5672 Purchase Decision Help/ | 2022-03-28 12:05 | - | |
| 5672 Questions/ | 2022-03-28 12:05 | - | |
| 5672 Right Speaker Not Working/ | 2022-03-28 12:05 | - | |
| 5672 SOund/ | 2022-03-28 12:05 | - | |
| 5672 So Far,So Good/ | 2022-03-28 12:05 | - | |
| 5672 Vista Unknown Device/ | 2022-03-28 12:05 | - | |
| 5672WLMi & Orbicam Working on Vista/ | 2022-03-28 12:05 | - | |
| 5672WLMi Orbicam drivers and iPhone/ | 2022-03-28 12:05 | - | |
| 5672WLMi Tests/ | 2022-03-28 12:05 | - | |
| 5672 Webcam won't work with Skype/ | 2022-03-28 12:05 | - | |
| 5672 WiFi problems/ | 2022-03-28 12:05 | - | |
| 5672 and Linux/ | 2022-03-28 12:05 | - | |
| 5672 and XP Pro Setup/ | 2022-03-28 12:05 | - | |
| 5672 battery, usb issue/ | 2022-03-28 12:05 | - | |
| 5672 battery/ | 2022-03-28 12:05 | - | |
| 5672 bios and heat core 0, 1/ | 2022-03-28 12:05 | - | |
| 5672 dead - Why I don't know! Help required/ | 2022-03-28 12:05 | - | |
| 5672 for $800; anyone buy from Babel Computers/ | 2022-03-28 12:05 | - | |
| 5672 graphic problem/ | 2022-03-28 12:05 | - | |
| 5672 hard disk damaged questions/ | 2022-03-28 12:05 | - | |
| 5672 heat issue/ | 2022-03-28 12:05 | - | |
| 5672 help, lock cd eject and screen brightness/ | 2022-03-28 12:05 | - | |
| 5672 is back and running/ | 2022-03-28 12:05 | - | |
| 5672 latest bios/ | 2022-03-28 12:05 | - | |
| 5672 noise problem/ | 2022-03-28 12:05 | - | |
| 5672 on-screen indicator for Fn keys/ | 2022-03-28 12:05 | - | |
| 5672 question/ | 2022-03-28 12:05 | - | |
| 5672 reformat... which drivers to install/ | 2022-03-28 12:05 | - | |
| 5672 reinstall using key/ | 2022-03-28 12:05 | - | |
| 5672 running Vista RTM Enterprise/ | 2022-03-28 12:05 | - | |
| 5672 to pass 3.5 hours/ | 2022-03-28 12:05 | - | |
| 5672 trackpad on firefox not working. HELP/ | 2022-03-28 12:05 | - | |
| 5672 vista 64 sd card driver/ | 2022-03-28 12:05 | - | |
| 5672 wireless question/ | 2022-03-28 12:05 | - | |
| 5672 with X1600/ | 2022-03-28 12:05 | - | |
| 5672wlmi $1,116.14 Shipped/ | 2022-03-28 12:05 | - | |
| 5672 wlmi brightness volume/ | 2022-03-28 12:05 | - | |
| 5672wlmi xp home/ | 2022-03-28 12:05 | - | |
| 5672 won't turn on/ | 2022-03-28 12:05 | - | |
| 5672 x1600 and Catalyst 6.5 problem/ | 2022-03-28 12:05 | - | |
| 5672 xphome to xppro HELP/ | 2022-03-28 12:05 | - | |
| 5673 WLMi FPS Lag Spike Problems/ | 2022-03-28 12:05 | - | |
| 5680 Driver Help/ | 2022-03-28 12:05 | - | |
| 5684 dual boot problem/ | 2022-03-28 12:05 | - | |
| 5685 5 in 1 Card Reader/ | 2022-03-28 12:05 | - | |
| 5685wlmi - factory restore disc needed/ | 2022-03-28 12:05 | - | |
| 5710 - difference in models/ | 2022-03-28 12:05 | - | |
| 5710g bricked after power outage during Windows Vista updates/ | 2022-03-28 12:05 | - | |
| 5715Z Overheats/ | 2022-03-28 12:05 | - | |
| 5720G-602G25Mn/ | 2022-03-28 12:05 | - | |
| 5720G temps and fan/ | 2022-03-28 12:05 | - | |
| 5720G with 9600GT best driver for win xp/ | 2022-03-28 12:05 | - | |
| 5720g cpu upgraded to T9300, questions/ | 2022-03-28 12:05 | - | |
| 5732Z Aspire Hard Drive Failure Error/ | 2022-03-28 12:05 | - | |
| 5733z-4851 bios disable for touch pad or keyboard/ | 2022-03-28 12:05 | - | |
| 5733z-4851 vs 5733z-4633/ | 2022-03-28 12:05 | - | |
| 5733z CPU upgrade to i7 640M etc/ | 2022-03-28 12:05 | - | |
| 5738G GFX opencl driver/ | 2022-03-28 12:05 | - | |
| 5738G new bios problem/ | 2022-03-28 12:05 | - | |
| 5738Z smart power key not working after windows 7 upgrade/ | 2022-03-28 12:05 | - | |
| 5738g/ | 2022-03-28 12:05 | - | |
| 5738g Fingerprint device issue/ | 2022-03-28 12:05 | - | |
| 5739G-6132 cpu upgrade/ | 2022-03-28 12:05 | - | |
| 5739G Dead as a dodo/ | 2022-03-28 12:05 | - | |
| 5739G MediaTouch button settings/ | 2022-03-28 12:05 | - | |
| 5739G or 5935G/ | 2022-03-28 12:05 | - | |
| 5739G won't boot up after Acer Arcade Instant-On/ | 2022-03-28 12:05 | - | |
| 5739 and GTA IV/ | 2022-03-28 12:05 | - | |
| 5739g battery/ | 2022-03-28 12:05 | - | |
| 5739g mxm-a upgrade (help)/ | 2022-03-28 12:05 | - | |
| 5739 g swapped mxm gts250m but ve drv problem/ | 2022-03-28 12:05 | - | |
| 5740 White Screen Problem/ | 2022-03-28 12:05 | - | |
| 5740 grey white screen of death/ | 2022-03-28 12:05 | - | |
| 5741A, refurb/ | 2022-03-28 12:05 | - | |
| 5741G Change Video Card/ | 2022-03-28 12:05 | - | |
| 5741G changing screen/ | 2022-03-28 12:05 | - | |
| 5741 USB intermittent/ | 2022-03-28 12:05 | - | |
| 5741 info/ | 2022-03-28 12:05 | - | |
| 5742 CPU upgrade/ | 2022-03-28 12:05 | - | |
| 5742ZG dead/ | 2022-03-28 12:05 | - | |
| 5742g DPC latency huge spikes/ | 2022-03-28 12:05 | - | |
| 5742 spec check/ | 2022-03-28 12:05 | - | |
| 5745DG sound indicator vanished/ | 2022-03-28 12:05 | - | |
| 5745G, 3820TG or 4820TG (UK)/ | 2022-03-28 12:05 | - | |
| 5745G media buttons/ | 2022-03-28 12:05 | - | |
| 5745PG touchpad issue/ | 2022-03-28 12:05 | - | |
| 5745 bios upgrade/ | 2022-03-28 12:05 | - | |
| 5749 - won't stay on/ | 2022-03-28 12:05 | - | |
| 5750G trackpad drivers - feels weird/ | 2022-03-28 12:05 | - | |
| 5750g Fan control/ | 2022-03-28 12:05 | - | |
| 5810 - what OS/ | 2022-03-28 12:05 | - | |
| 5810T ATI Mobility Radeon Issue/ | 2022-03-28 12:05 | - | |
| 5810T Bricked, won't even power/ | 2022-03-28 12:05 | - | |
| 5810T Screen Brightness at 100% after reboot/ | 2022-03-28 12:05 | - | |
| 5810TZ, Win 7 64-bit Memory Upgrade/ | 2022-03-28 12:05 | - | |
| 5810TZ BIOS help!/ | 2022-03-28 12:05 | - | |
| 5810TZG INTEL + HD4330 - anybody got catalyst 9.11 or 9.12 working/ | 2022-03-28 12:05 | - | |
| 5810t high power consumption/ | 2022-03-28 12:05 | - | |
| 5810t how to remove keyboard/ | 2022-03-28 12:05 | - | |
| 5810t keyboard problem/ | 2022-03-28 12:05 | - | |
| 5820TG (5470) Powersmart problem/ | 2022-03-28 12:05 | - | |
| 5820TG - cannot update graphics/ | 2022-03-28 12:05 | - | |
| 5820TG ATI Driver Update ISSUES! Please Help/ | 2022-03-28 12:05 | - | |
| 5820TG overheating problem/ | 2022-03-28 12:05 | - | |
| 5820t Scrolling And Right Click Issues!/ | 2022-03-28 12:05 | - | |
| 5820tg/ | 2022-03-28 12:05 | - | |
| 5820tg high pictched noise/ | 2022-03-28 12:05 | - | |
| 5820tg some issues/ | 2022-03-28 12:05 | - | |
| 5830TG Boot Problems, how to disassemble & reset battery/ | 2022-03-28 12:05 | - | |
| 5830tg or 581tg which to buy/ | 2022-03-28 12:05 | - | |
| 5920-6273 Questions/ | 2022-03-28 12:05 | - | |
| 5920-6313 Quick Review and Upgrade Benchmarks/ | 2022-03-28 12:05 | - | |
| 5920- Bluetooth A2DP Problem/ | 2022-03-28 12:05 | - | |
| 5920- Upgrading to 4965 abgn (not happening...)/ | 2022-03-28 12:05 | - | |
| 5920 - crack near hinge; need opinions/ | 2022-03-28 12:05 | - | |
| 5920 - harddrive always active/ | 2022-03-28 12:05 | - | |
| 5920.............XP.....launch manager/ | 2022-03-28 12:05 | - | |
| 5920..Different models uk/ | 2022-03-28 12:05 | - | |
| 5920 8600m gt vs f3 8600m gs/ | 2022-03-28 12:05 | - | |
| 5920 Bluescreen error/ | 2022-03-28 12:05 | - | |
| 5920 Burning DL dvds/ | 2022-03-28 12:05 | - | |
| 5920 CD DVD Drive Question/ | 2022-03-28 12:05 | - | |
| 5920 Drive Problems/ | 2022-03-28 12:05 | - | |
| 5920 Express Card Remote/ | 2022-03-28 12:05 | - | |
| 5920G's out with the Penryn!/ | 2022-03-28 12:05 | - | |
| 5920G's radial volume button and win 7/ | 2022-03-28 12:05 | - | |
| 5920G(H) High pitch noise on closing lid!/ | 2022-03-28 12:05 | - | |
| 5920G + Acer Monitor P223W = trouble/ | 2022-03-28 12:05 | - | |
| 5920G, HD-DVD, & HDMI Driver Issue/ | 2022-03-28 12:05 | - | |
| 5920G, old videocard back in after failed videocard change black screen/ | 2022-03-28 12:05 | - | |
| 5920G - Audio Over HDMI/ | 2022-03-28 12:05 | - | |
| 5920G - Dolby Home Theatre Question/ | 2022-03-28 12:05 | - | |
| 5920G - Enabling onboard audio/ | 2022-03-28 12:05 | - | |
| 5920G - Game Setting problem/ | 2022-03-28 12:05 | - | |
| 5920G - Headphones line out jack problem/ | 2022-03-28 12:05 | - | |
| 5920G- How many RPMs for 160GB HD/ | 2022-03-28 12:05 | - | |
| 5920G - How many processes running! !/ | 2022-03-28 12:05 | - | |
| 5920G- Intel drivers cause BSOD/ | 2022-03-28 12:05 | - | |
| 5920G - Loud beeping/ | 2022-03-28 12:05 | - | |
| 5920G - Normal GPU Temperature/ | 2022-03-28 12:05 | - | |
| 5920G- Partition broken, need of assistance!/ | 2022-03-28 12:05 | - | |
| 5920G - Penryn upgrade/ | 2022-03-28 12:05 | - | |
| 5920G- ReadyDrive Disabled after bios update 3805/ | 2022-03-28 12:05 | - | |
| 5920G- Replacing the DVD drive/ | 2022-03-28 12:05 | - | |
| 5920G- S-Video doesn't work anymore/ | 2022-03-28 12:05 | - | |
| 5920G- Should I be concerned of overheating/ | 2022-03-28 12:05 | - | |
| 5920G- What SPDIF cable to get/ | 2022-03-28 12:05 | - | |
| 5920G - What exactly = Gaming Performance + HD-DVD/ | 2022-03-28 12:05 | - | |
| 5920G- Where is my L2 Cache/ | 2022-03-28 12:05 | - | |
| 5920G- Which miniPCI to get/ | 2022-03-28 12:05 | - | |
| 5920G- Windows Vista reinstall 32 or 64 bit/ | 2022-03-28 12:05 | - | |
| 5920G - Write caching is now enabled on disk- good thing/ | 2022-03-28 12:05 | - | |
| 5920G- some issues (overheating + restart, media keys...)/ | 2022-03-28 12:05 | - | |
| 5920G.. Wireless Signal is Never the Same!!/ | 2022-03-28 12:05 | - | |
| 5920G 6 month later still the best bang for your buck/ | 2022-03-28 12:05 | - | |
| 5920G 32bit or 64bit/ | 2022-03-28 12:05 | - | |
| 5920G 8600m GT 256MB Safe overclock Temps/ | 2022-03-28 12:05 | - | |
| 5920G 8600m GT w 256 DDR3 Upgrade Question/ | 2022-03-28 12:05 | - | |
| 5920G = new 3708 bios available/ | 2022-03-28 12:05 | - | |
| 5920G Aspire - Bios Flash from DOS help please/ | 2022-03-28 12:05 | - | |
| 5920G Audio drivers/ | 2022-03-28 12:05 | - | |
| 5920G Bios Update Failure and System Collapse/ | 2022-03-28 12:05 | - | |
| 5920G Black Screen of Annoyance/ | 2022-03-28 12:05 | - | |
| 5920G Bluetooth/ | 2022-03-28 12:05 | - | |
| 5920G Bluetooth Problems/ | 2022-03-28 12:05 | - | |
| 5920G Burning DJ Mix CD's Problem/ | 2022-03-28 12:05 | - | |
| 5920G Classic skin, new machine/ | 2022-03-28 12:05 | - | |
| 5920G DVD Playback software/ | 2022-03-28 12:05 | - | |
| 5920G DVD burning question/ | 2022-03-28 12:05 | - | |
| 5920G Dead --(/ | 2022-03-28 12:05 | - | |
| 5920G Dead Screen Question/ | 2022-03-28 12:05 | - | |
| 5920G Downgraded XP - Hang - Need Help Desperately - Thanks/ | 2022-03-28 12:05 | - | |
| 5920G FEAR multiplayer performance !/ | 2022-03-28 12:05 | - | |
| 5920G GPU Upgrade/ | 2022-03-28 12:05 | - | |
| 5920G HD4650 problem!/ | 2022-03-28 12:05 | - | |
| 5920G Incompatible Video Driver - Code 102/ | 2022-03-28 12:05 | - | |
| 5920G Internet problems, streaming in particular/ | 2022-03-28 12:05 | - | |
| 5920G LCD Upgrade/ | 2022-03-28 12:05 | - | |
| 5920G LCD won't come on after a while/ | 2022-03-28 12:05 | - | |
| 5920G OC Question/ | 2022-03-28 12:05 | - | |
| 5920G Penryn support/ | 2022-03-28 12:05 | - | |
| 5920G Realtek Audio driver issue/ | 2022-03-28 12:05 | - | |
| 5920G Sleep Hibernate problem ...solved for me!!!/ | 2022-03-28 12:05 | - | |
| 5920G Sound Issue/ | 2022-03-28 12:05 | - | |
| 5920G Upgraded To...Radeon HD 4650 !/ | 2022-03-28 12:05 | - | |
| 5920G Vista 64bit SP1 Driver/ | 2022-03-28 12:05 | - | |
| 5920G XP 64 Bit/ | 2022-03-28 12:05 | - | |
| 5920G and Bluetooth/ | 2022-03-28 12:05 | - | |
| 5920G and D- Partition/ | 2022-03-28 12:05 | - | |
| 5920G and DOOM III problems... LQQk here!!/ | 2022-03-28 12:05 | - | |
| 5920G and HDMI Output/ | 2022-03-28 12:05 | - | |
| 5920G and dolby headphone/ | 2022-03-28 12:05 | - | |
| 5920G and its 8600Gt... faulty and what to do/ | 2022-03-28 12:05 | - | |
| 5920G and the endless black screen/ | 2022-03-28 12:05 | - | |
| 5920G and wireless card network problem/ | 2022-03-28 12:05 | - | |
| 5920G battery issue/ | 2022-03-28 12:05 | - | |
| 5920G best driver for Nvidia 8600m GS/ | 2022-03-28 12:05 | - | |
| 5920G bios update problem/ | 2022-03-28 12:05 | - | |
| 5920G buzzing fan/ | 2022-03-28 12:05 | - | |
| 5920G crippled MCE No TV options!/ | 2022-03-28 12:05 | - | |
| 5920G disassembly problem/ | 2022-03-28 12:05 | - | |
| 5920G distorted audio issue! Help!/ | 2022-03-28 12:05 | - | |
| 5920G e Recovery/ | 2022-03-28 12:05 | - | |
| 5920G external monitor issue/ | 2022-03-28 12:05 | - | |
| 5920G fan cleaning/ | 2022-03-28 12:05 | - | |
| 5920G freezing/ | 2022-03-28 12:05 | - | |
| 5920G how to max out battery life/ | 2022-03-28 12:05 | - | |
| 5920G idle issues/ | 2022-03-28 12:05 | - | |
| 5920G is not keeping time. ARGG/ | 2022-03-28 12:05 | - | |
| 5920G keyboard/ | 2022-03-28 12:05 | - | |
| 5920G life shorted by temp/ | 2022-03-28 12:05 | - | |
| 5920G not getting past POST/ | 2022-03-28 12:05 | - | |
| 5920G not responding/ | 2022-03-28 12:05 | - | |
| 5920G owners!/ | 2022-03-28 12:05 | - | |
| 5920G owners I NEED HELP!/ | 2022-03-28 12:05 | - | |
| 5920G piercing sound/ | 2022-03-28 12:05 | - | |
| 5920G power on problem/ | 2022-03-28 12:05 | - | |
| 5920G ram question/ | 2022-03-28 12:05 | - | |
| 5920G recovery DVD/ | 2022-03-28 12:05 | - | |
| 5920G restarts itself 4 times before boot/ | 2022-03-28 12:05 | - | |
| 5920G review/ | 2022-03-28 12:05 | - | |
| 5920G s-video tv problem/ | 2022-03-28 12:05 | - | |
| 5920G sleep issue solved!!!/ | 2022-03-28 12:05 | - | |
| 5920G sound quality & pictures via HDMI thru amp & S PDIF/ | 2022-03-28 12:05 | - | |
| 5920G temps while watching HD-DVD/ | 2022-03-28 12:05 | - | |
| 5920G touchpad/ | 2022-03-28 12:05 | - | |
| 5920G using hacked drivers causes BSOD/ | 2022-03-28 12:05 | - | |
| 5920G video card upgrade/ | 2022-03-28 12:05 | - | |
| 5920G vs Crysis!/ | 2022-03-28 12:05 | - | |
| 5920G w 802.11n and router (802.11n draft 2.0) possible compatibility issues/ | 2022-03-28 12:05 | - | |
| 5920G wallpapers/ | 2022-03-28 12:05 | - | |
| 5920G wifi problem/ | 2022-03-28 12:05 | - | |
| 5920G wireless card problem/ | 2022-03-28 12:05 | - | |
| 5920G wireless problem/ | 2022-03-28 12:05 | - | |
| 5920G won't update driver software/ | 2022-03-28 12:05 | - | |
| 5920G working badly with MMORPG/ | 2022-03-28 12:05 | - | |
| 5920G xp drivers/ | 2022-03-28 12:05 | - | |
| 5920 Keyboard Issues - Help!/ | 2022-03-28 12:05 | - | |
| 5920 MXM GPIO WPC8769LDG pin 17 problem/ | 2022-03-28 12:05 | - | |
| 5920 Memory and CPU upgrade/ | 2022-03-28 12:05 | - | |
| 5920 OS Backup problems/ | 2022-03-28 12:05 | - | |
| 5920 Question - Heat related/ | 2022-03-28 12:05 | - | |
| 5920 Santa Rosa/ | 2022-03-28 12:05 | - | |
| 5920 Screen flickering/ | 2022-03-28 12:05 | - | |
| 5920 Synaptics not reacting/ | 2022-03-28 12:05 | - | |
| 5920 UK models, Acer finally come clean/ | 2022-03-28 12:05 | - | |
| 5920 Upgrade Graphics/ | 2022-03-28 12:05 | - | |
| 5920 Volume control problem (again)/ | 2022-03-28 12:05 | - | |
| 5920 acer e power management setting randomly changing after sleep hibernate/ | 2022-03-28 12:05 | - | |
| 5920 bios upgrade diffculty/ | 2022-03-28 12:05 | - | |
| 5920 black screen/ | 2022-03-28 12:05 | - | |
| 5920 black screen after uninstalling display drivers/ | 2022-03-28 12:05 | - | |
| 5920 boot issue - acer arcade/ | 2022-03-28 12:05 | - | |
| 5920 card reader question/ | 2022-03-28 12:05 | - | |
| 5920 card reader upgrade/ | 2022-03-28 12:05 | - | |
| 5920 driver install problem/ | 2022-03-28 12:05 | - | |
| 5920 ePresentation Mgmg Screen Resolution wont return to normal Notebook mode/ | 2022-03-28 12:05 | - | |
| 5920 eRecovery Nvidia driver missing unable to install not recognised/ | 2022-03-28 12:05 | - | |
| 5920 format help/ | 2022-03-28 12:05 | - | |
| 5920g, what are the hidden partition for/ | 2022-03-28 12:05 | - | |
| 5920g- Bios mod/ | 2022-03-28 12:05 | - | |
| 5920g-vista drivers/ | 2022-03-28 12:05 | - | |
| 5920g/ | 2022-03-28 12:05 | - | |
| 5920g 8600gs s-video issue/ | 2022-03-28 12:05 | - | |
| 5920g Blind flash Bios question/ | 2022-03-28 12:05 | - | |
| 5920g Died. no sound or lights at all. mainboard failiure/ | 2022-03-28 12:05 | - | |
| 5920g GPU upgrade opinions/ | 2022-03-28 12:05 | - | |
| 5920g Hd-dvd/ | 2022-03-28 12:05 | - | |
| 5920g Hd Dvd/ | 2022-03-28 12:05 | - | |
| 5920g Help please/ | 2022-03-28 12:05 | - | |
| 5920g Help with Hinges!/ | 2022-03-28 12:05 | - | |
| 5920g Vbios/ | 2022-03-28 12:05 | - | |
| 5920g Won't Post! Might be dead -(/ | 2022-03-28 12:05 | - | |
| 5920g and loss of sound/ | 2022-03-28 12:05 | - | |
| 5920g battery, which one to choose/ | 2022-03-28 12:05 | - | |
| 5920g black screen/ | 2022-03-28 12:05 | - | |
| 5920g help/ | 2022-03-28 12:05 | - | |
| 5920g memory runs low, forced to close programs/ | 2022-03-28 12:05 | - | |
| 5920g motherboard short circuit/ | 2022-03-28 12:05 | - | |
| 5920g onboard sound/ | 2022-03-28 12:05 | - | |
| 5920g power jack with cable/ | 2022-03-28 12:05 | - | |
| 5920g processor upgrade/ | 2022-03-28 12:05 | - | |
| 5920g projector VGA connector results in dull pic/ | 2022-03-28 12:05 | - | |
| 5920g questions/ | 2022-03-28 12:05 | - | |
| 5920g sleep problem/ | 2022-03-28 12:05 | - | |
| 5920g software update/ | 2022-03-28 12:05 | - | |
| 5920g stock drivers/ | 2022-03-28 12:05 | - | |
| 5920g tv tuner problem/ | 2022-03-28 12:05 | - | |
| 5920g vga replace/ | 2022-03-28 12:05 | - | |
| 5920g vista to win7/ | 2022-03-28 12:05 | - | |
| 5920g vista update loses network adapter/ | 2022-03-28 12:05 | - | |
| 5920g w 9600m gt bios upgrade/ | 2022-03-28 12:05 | - | |
| 5920 infared port/ | 2022-03-28 12:05 | - | |
| 5920 info needed/ | 2022-03-28 12:05 | - | |
| 5920 internet setup/ | 2022-03-28 12:05 | - | |
| 5920 lights stay on/ | 2022-03-28 12:05 | - | |
| 5920 on Order, What can i Expect/ | 2022-03-28 12:05 | - | |
| 5920 or 5920G/ | 2022-03-28 12:05 | - | |
| 5920 pci dirver help -/ | 2022-03-28 12:05 | - | |
| 5920 question/ | 2022-03-28 12:05 | - | |
| 5920 recovery disc/ | 2022-03-28 12:05 | - | |
| 5920 screen half black half white with lines/ | 2022-03-28 12:05 | - | |
| 5920 skins/ | 2022-03-28 12:05 | - | |
| 5920 touchpad problem/ | 2022-03-28 12:05 | - | |
| 5920 video replace/ | 2022-03-28 12:05 | - | |
| 5920 vs 5720/ | 2022-03-28 12:05 | - | |
| 5920 webcam software missing/ | 2022-03-28 12:05 | - | |
| 5920 with 1.5GHZ!!!/ | 2022-03-28 12:05 | - | |
| 5929 questions - just bought it!/ | 2022-03-28 12:05 | - | |
| 5930 Bluetooth Upgrade/ | 2022-03-28 12:05 | - | |
| 5930G-733G25Mn Win XP installation problem/ | 2022-03-28 12:05 | - | |
| 5930G - Possible upgrades + Using XP/ | 2022-03-28 12:05 | - | |
| 5930G CPU P7350 to P9700/ | 2022-03-28 12:05 | - | |
| 5930G DVD and Wifi speed issue/ | 2022-03-28 12:05 | - | |
| 5930G HDMI Audio Greyed Out/ | 2022-03-28 12:05 | - | |
| 5930G change CPU + disable virual surround/ | 2022-03-28 12:05 | - | |
| 5930G cooling solution/ | 2022-03-28 12:05 | - | |
| 5930G news reviews/ | 2022-03-28 12:05 | - | |
| 5930G speakers - fizzing/ | 2022-03-28 12:05 | - | |
| 5930g AHCI Driver for WinXP/ | 2022-03-28 12:05 | - | |
| 5930g Screen Replacement/ | 2022-03-28 12:05 | - | |
| 5930g problems- help/ | 2022-03-28 12:05 | - | |
| 5930g with 9600gt/ | 2022-03-28 12:05 | - | |
| 5935G ,6930G QUAD CORE support/ | 2022-03-28 12:05 | - | |
| 5935G Switchable Graphics/ | 2022-03-28 12:05 | - | |
| 5935g and..... 7970m!/ | 2022-03-28 12:05 | - | |
| 5940G - is it noisy run hot/ | 2022-03-28 12:05 | - | |
| 5940G VGA Output/ | 2022-03-28 12:05 | - | |
| 6290G RAM issues after re-instaling vista/ | 2022-03-28 12:05 | - | |
| 6300 cooling/ | 2022-03-28 12:05 | - | |
| 6470M or 6520G video on A6-3400M/ | 2022-03-28 12:05 | - | |
| 6530G Chipset Driver/ | 2022-03-28 12:05 | - | |
| 6592G CMOS battery/ | 2022-03-28 12:05 | - | |
| 6920 & 8920/ | 2022-03-28 12:05 | - | |
| 6920-6141 Question/ | 2022-03-28 12:05 | - | |
| 6920-6621 64 bit windows vista upgrade/ | 2022-03-28 12:05 | - | |
| 6920-LF1 Display upgrade/ | 2022-03-28 12:05 | - | |
| 6920 - black screen with mouse pointer/ | 2022-03-28 12:05 | - | |
| 6920 8920 Software Screen Fix (tip for all gemstone blue users)/ | 2022-03-28 12:05 | - | |
| 6920 Bluray drive problem/ | 2022-03-28 12:05 | - | |
| 6920 Dimmer not working in XP/ | 2022-03-28 12:05 | - | |
| 6920G - Build Quality/ | 2022-03-28 12:05 | - | |
| 6920G - Disabling tapping on the touch pad/ | 2022-03-28 12:05 | - | |
| 6920G - Win 7 Clean Install Log/ | 2022-03-28 12:05 | - | |
| 6920G- looking for 9500M GS 64 bit driver/ | 2022-03-28 12:05 | - | |
| 6920G 5.1 Surround Problem/ | 2022-03-28 12:05 | - | |
| 6920G 9500M GS swapped - HD4650!!!!/ | 2022-03-28 12:05 | - | |
| 6920G BIOS problem/ | 2022-03-28 12:05 | - | |
| 6920G BT in Win7 64-bit/ | 2022-03-28 12:05 | - | |
| 6920G Bluetooth card/ | 2022-03-28 12:05 | - | |
| 6920G CD Drive doesn't work/ | 2022-03-28 12:05 | - | |
| 6920G CPU GPU Temps/ | 2022-03-28 12:05 | - | |
| 6920G CineDash/ | 2022-03-28 12:05 | - | |
| 6920G Clean install/ | 2022-03-28 12:05 | - | |
| 6920G Cooler/ | 2022-03-28 12:05 | - | |
| 6920G Driver powerstate failure/ | 2022-03-28 12:05 | - | |
| 6920G Freezes permeneantly during gaming/ | 2022-03-28 12:05 | - | |
| 6920G HDD random freeze/ | 2022-03-28 12:05 | - | |
| 6920G HDMI-Out Problem/ | 2022-03-28 12:05 | - | |
| 6920G HDMI Sound Problem/ | 2022-03-28 12:05 | - | |
| 6920G Keyboard issues/ | 2022-03-28 12:05 | - | |
| 6920G Keyboard still rubbish/ | 2022-03-28 12:05 | - | |
| 6920G PSU problem/ | 2022-03-28 12:05 | - | |
| 6920G Replacement keyboard in UK Ireland/ | 2022-03-28 12:05 | - | |
| 6920G Screen Contrast/ | 2022-03-28 12:05 | - | |
| 6920G Speaker panel dirt/ | 2022-03-28 12:05 | - | |
| 6920G T9300 for sale (its stolen!)/ | 2022-03-28 12:05 | - | |
| 6920G Tuba subwoofer stopped working!/ | 2022-03-28 12:05 | - | |
| 6920G WLAN problem/ | 2022-03-28 12:05 | - | |
| 6920G and Windows Media Center TV Pack/ | 2022-03-28 12:05 | - | |
| 6920G audio skipping/ | 2022-03-28 12:05 | - | |
| 6920G bad screen problem/ | 2022-03-28 12:05 | - | |
| 6920G black lid when supposed to be blue/ | 2022-03-28 12:05 | - | |
| 6920G boots into XP, and starts acer arcade/ | 2022-03-28 12:05 | - | |
| 6920G bootup/ | 2022-03-28 12:05 | - | |
| 6920G does not boot/ | 2022-03-28 12:05 | - | |
| 6920G downclocking yet Im not OC'ing -S/ | 2022-03-28 12:05 | - | |
| 6920G fan always on/ | 2022-03-28 12:05 | - | |
| 6920G freezing up/ | 2022-03-28 12:05 | - | |
| 6920G gaming issues/ | 2022-03-28 12:05 | - | |
| 6920G graphics queston/ | 2022-03-28 12:05 | - | |
| 6920G max upgrade, cpu+gfx+hd/ | 2022-03-28 12:05 | - | |
| 6920G partitions/ | 2022-03-28 12:05 | - | |
| 6920G performance halving randomly/ | 2022-03-28 12:05 | - | |
| 6920G speakers + questions about win7 & Empowering/ | 2022-03-28 12:05 | - | |
| 6920G speakers echoey/ | 2022-03-28 12:05 | - | |
| 6920G subwoofer/ | 2022-03-28 12:05 | - | |
| 6920G suddenly has many problems, stemming from the same cause/ | 2022-03-28 12:05 | - | |
| 6920G take apart keys on keyboard/ | 2022-03-28 12:05 | - | |
| 6920G temperatures/ | 2022-03-28 12:05 | - | |
| 6920G to videotape stuff/ | 2022-03-28 12:05 | - | |
| 6920G with ATI 3650 DDR3/ | 2022-03-28 12:05 | - | |
| 6920G won't POST!/ | 2022-03-28 12:05 | - | |
| 6920 Problem with the subwoofer/ | 2022-03-28 12:05 | - | |
| 6920 Screen replacement upgrade problem/ | 2022-03-28 12:05 | - | |
| 6920 and 1080P/ | 2022-03-28 12:05 | - | |
| 6920g + ps3 HD/ | 2022-03-28 12:05 | - | |
| 6920g 3dmark06/ | 2022-03-28 12:05 | - | |
| 6920g Blue-Ray Fullscreen/ | 2022-03-28 12:05 | - | |
| 6920g CPU Upgrade/ | 2022-03-28 12:05 | - | |
| 6920g CPU upgrade but it's complicated/ | 2022-03-28 12:05 | - | |
| 6920g Hdd replacement/ | 2022-03-28 12:05 | - | |
| 6920g MXM-II module/ | 2022-03-28 12:05 | - | |
| 6920g OE907 Cap Replacement/ | 2022-03-28 12:05 | - | |
| 6920g Shutdown Problem/ | 2022-03-28 12:05 | - | |
| 6920g Tuba Cinebass booster problems/ | 2022-03-28 12:05 | - | |
| 6920g blu ray problem/ | 2022-03-28 12:05 | - | |
| 6920g fan blowing hot air/ | 2022-03-28 12:05 | - | |
| 6920g gaming settings issues/ | 2022-03-28 12:05 | - | |
| 6920g gpu up downgradeable/ | 2022-03-28 12:05 | - | |
| 6920g graphics/ | 2022-03-28 12:05 | - | |
| 6920g iastor errors freezes/ | 2022-03-28 12:05 | - | |
| 6920g laptop down throttling when gaming/ | 2022-03-28 12:05 | - | |
| 6920g nvidia drivers/ | 2022-03-28 12:05 | - | |
| 6920g restarts on shutdown and wakes up on sleep/ | 2022-03-28 12:05 | - | |
| 6920g thermal pad or thermal paste for the northbridge/ | 2022-03-28 12:05 | - | |
| 6920g throttling and new board/ | 2022-03-28 12:05 | - | |
| 6920g toslink fiber optic audio/ | 2022-03-28 12:05 | - | |
| 6920g tuba drivers for windows 7/ | 2022-03-28 12:05 | - | |
| 6920g upgraded with 6935g motherboard/ | 2022-03-28 12:05 | - | |
| 6920g upgrade to 9600m gt 512mb ddr3 and problems/ | 2022-03-28 12:05 | - | |
| 6920g won't boot vista after using gparted/ | 2022-03-28 12:05 | - | |
| 6920g won't turn on/ | 2022-03-28 12:05 | - | |
| 6920 mbr issue/ | 2022-03-28 12:05 | - | |
| 6920 question/ | 2022-03-28 12:05 | - | |
| 6920 screen upgrade/ | 2022-03-28 12:05 | - | |
| 6920 sound glitching -(/ | 2022-03-28 12:05 | - | |
| 6930-6073/ | 2022-03-28 12:05 | - | |
| 6930 Blu-ray LCD issue/ | 2022-03-28 12:05 | - | |
| 6930G & 9600m GT Temperatures & NiBiTor/ | 2022-03-28 12:05 | - | |
| 6930G (with blu-ray) and fresh install of Windows 7/ | 2022-03-28 12:05 | - | |
| 6930G - Fancontrol/ | 2022-03-28 12:05 | - | |
| 6930G - help getting 9600m GT to work, please!/ | 2022-03-28 12:05 | - | |
| 6930G Battery life/ | 2022-03-28 12:05 | - | |
| 6930G Bios start problem/ | 2022-03-28 12:05 | - | |
| 6930G GPU fan problem/ | 2022-03-28 12:05 | - | |
| 6930G Temps/ | 2022-03-28 12:05 | - | |
| 6930G Win 7 Bluetooth issue/ | 2022-03-28 12:05 | - | |
| 6930G subwoofer (buzzing with the good driver)/ | 2022-03-28 12:05 | - | |
| 6930G upgrade or get new laptop/ | 2022-03-28 12:05 | - | |
| 6930G upgrades/ | 2022-03-28 12:05 | - | |
| 6930G won't start/ | 2022-03-28 12:05 | - | |
| 6930 built in camera/ | 2022-03-28 12:05 | - | |
| 6930 cpu upgrage/ | 2022-03-28 12:05 | - | |
| 6930g- help with P9500 cpu upgrade dismantling/ | 2022-03-28 12:05 | - | |
| 6930g media keys problem after Bios update/ | 2022-03-28 12:05 | - | |
| 6930g upgrade to x9100- advisable/ | 2022-03-28 12:05 | - | |
| 6930z drop out issues !/ | 2022-03-28 12:05 | - | |
| 6935, new firmware/ | 2022-03-28 12:05 | - | |
| 6935G, Windows 7, Launch Manager and Realtek drivers/ | 2022-03-28 12:05 | - | |
| 6935G - Soundpad stopped workin Win 7/ | 2022-03-28 12:05 | - | |
| 6935G 5.1 problems/ | 2022-03-28 12:05 | - | |
| 6935G Bluetooth Driver Query - Windows 7/ | 2022-03-28 12:05 | - | |
| 6935G Quick Question/ | 2022-03-28 12:05 | - | |
| 6935G RAM Upgrade Fail -S/ | 2022-03-28 12:05 | - | |
| 6935G Replacement screen/ | 2022-03-28 12:05 | - | |
| 6935G Upgrade/ | 2022-03-28 12:05 | - | |
| 6935 fan sounds/ | 2022-03-28 12:05 | - | |
| 6935 firmware update 1.19/ | 2022-03-28 12:05 | - | |
| 6935g Bios and RAM upgrade/ | 2022-03-28 12:05 | - | |
| 6935g CPU problems/ | 2022-03-28 12:05 | - | |
| 6935g TV tuner help please!/ | 2022-03-28 12:05 | - | |
| 6935g and HDMI/ | 2022-03-28 12:05 | - | |
| 6935g fsb overclock/ | 2022-03-28 12:05 | - | |
| 6935g keyboard/ | 2022-03-28 12:05 | - | |
| 6935g kingston hyperX KHX8500S3ULK2 4g upgrade success/ | 2022-03-28 12:05 | - | |
| 6935g t6400 oc/ | 2022-03-28 12:05 | - | |
| 6935g volume control D-/ | 2022-03-28 12:05 | - | |
| 6935g vs 8935g/ | 2022-03-28 12:05 | - | |
| 7103WSMI Bios refuses to flash. Acer refuse to comment/ | 2022-03-28 12:05 | - | |
| 7200 RPM Hitachi 60gb in 4501WLMi/ | 2022-03-28 12:05 | - | |
| 7200rpm hdd in 3690 not working/ | 2022-03-28 12:05 | - | |
| 7520G boot woes/ | 2022-03-28 12:05 | - | |
| 7520G new M B,CPU,GPU,MMR/ | 2022-03-28 12:05 | - | |
| 7520 liquid in heat pipe gone/ | 2022-03-28 12:05 | - | |
| 7530 7530G hybrid upgrades available/ | 2022-03-28 12:05 | - | |
| 7530G 9600m GS GDDR2 or GDDR3/ | 2022-03-28 12:05 | - | |
| 7551g-5821 Questions/ | 2022-03-28 12:05 | - | |
| 7720 & Raid/ | 2022-03-28 12:05 | - | |
| 7720 BIOS issue & no sound!/ | 2022-03-28 12:05 | - | |
| 7720G - Firewire GUID 0000000000000000 is invalid/ | 2022-03-28 12:05 | - | |
| 7720G BIOS update crash/ | 2022-03-28 12:05 | - | |
| 7720G BIOS v1.34 little issue/ | 2022-03-28 12:05 | - | |
| 7720G Intel Pro Wireless3945ABG/ | 2022-03-28 12:05 | - | |
| 7720G Screen is BUSTED!!! Help ! !/ | 2022-03-28 12:05 | - | |
| 7720G Upgrade to 9600m GT/ | 2022-03-28 12:05 | - | |
| 7720G Upgrade to Nvidia 9600M GT/ | 2022-03-28 12:05 | - | |
| 7720G Video Upgrade - Help Needed!/ | 2022-03-28 12:05 | - | |
| 7720G Video card upgrade/ | 2022-03-28 12:05 | - | |
| 7720G suddendly die/ | 2022-03-28 12:05 | - | |
| 7720 Questions/ | 2022-03-28 12:05 | - | |
| 7720 black keyboard/ | 2022-03-28 12:05 | - | |
| 7720 dial up problem/ | 2022-03-28 12:05 | - | |
| 7720g, any good/ | 2022-03-28 12:05 | - | |
| 7720g - randomly light on screen/ | 2022-03-28 12:05 | - | |
| 7720g 9600m gt ddr3 512 gpu always at max never idle/ | 2022-03-28 12:05 | - | |
| 7720g Fan issues/ | 2022-03-28 12:05 | - | |
| 7720g Problems/ | 2022-03-28 12:05 | - | |
| 7720g problem with fan and 9600m gt/ | 2022-03-28 12:05 | - | |
| 7720 with x3100, can I upgrade the video/ | 2022-03-28 12:05 | - | |
| 7720 wont start after driver install hang/ | 2022-03-28 12:05 | - | |
| 7720z resolution problem/ | 2022-03-28 12:05 | - | |
| 7730G CPU UPgrade/ | 2022-03-28 12:05 | - | |
| 7730G CPU upgrade Tutorial/ | 2022-03-28 12:05 | - | |
| 7730G ram upgrade and info pictures/ | 2022-03-28 12:05 | - | |
| 7730 WiFi button/ | 2022-03-28 12:05 | - | |
| 7730g cooling pad/ | 2022-03-28 12:05 | - | |
| 7730zg and aver a306 tv card/ | 2022-03-28 12:05 | - | |
| 7738G problem with new partition and EISA/ | 2022-03-28 12:05 | - | |
| 7738G quad core compatibility/ | 2022-03-28 12:05 | - | |
| 7738g Part Required (FFC Cable)/ | 2022-03-28 12:05 | - | |
| 7740-6656 bios password/ | 2022-03-28 12:05 | - | |
| 7740G-6488, Performance in gaming/ | 2022-03-28 12:05 | - | |
| 7741G-7017 Aspire - Video editing/ | 2022-03-28 12:05 | - | |
| 7745G-5468G1T -SSD install/ | 2022-03-28 12:05 | - | |
| 7745g-6662 2nd hard drive bay parts numbers here!!/ | 2022-03-28 12:05 | - | |
| 7745g backpack/ | 2022-03-28 12:05 | - | |
| 7745g heat issues/ | 2022-03-28 12:05 | - | |
| 7770M part Number/ | 2022-03-28 12:05 | - | |
| 7770m/ | 2022-03-28 12:05 | - | |
| 8003-8005-8006/ | 2022-03-28 12:05 | - | |
| 8006LMi/ | 2022-03-28 12:05 | - | |
| 8006Lmi questions!! please help!/ | 2022-03-28 12:05 | - | |
| 8103 and graphics corruption/ | 2022-03-28 12:05 | - | |
| 8104 - 5.1 sound/ | 2022-03-28 12:05 | - | |
| 8104 Poor QC. A Referb for the price of a new 8104/ | 2022-03-28 12:05 | - | |
| 8104WLMi Hardrive Speed/ | 2022-03-28 12:05 | - | |
| 8104WLMi screen flicker while charging/ | 2022-03-28 12:05 | - | |
| 8104 help please/ | 2022-03-28 12:05 | - | |
| 8104 hidden partition/ | 2022-03-28 12:05 | - | |
| 8104 in UK - only 512meg/ | 2022-03-28 12:05 | - | |
| 8104 in the UK/ | 2022-03-28 12:05 | - | |
| 8200 Socket/ | 2022-03-28 12:05 | - | |
| 8200TM Vista wireless driver problem/ | 2022-03-28 12:05 | - | |
| 8204 & x1600/ | 2022-03-28 12:05 | - | |
| 8204 (New orbicam_944_1069_a(whql).zip)/ | 2022-03-28 12:05 | - | |
| 8204, failing fan, replacement, cooler or/ | 2022-03-28 12:05 | - | |
| 8204, missing the audio icons when fn key pressed/ | 2022-03-28 12:05 | - | |
| 8204, screen fade to white/ | 2022-03-28 12:05 | - | |
| 8204 -- keyboard speakers interfearence/ | 2022-03-28 12:05 | - | |
| 8204- Acer webcam screensaver/ | 2022-03-28 12:05 | - | |
| 8204- BSOD when power-up on batteries!/ | 2022-03-28 12:05 | - | |
| 8204- Bios 3313 and hard drive speed/ | 2022-03-28 12:05 | - | |
| 8204 - Lag in typing, sluggish mouse movements/ | 2022-03-28 12:05 | - | |
| 8204- Need partitioning suggestions/ | 2022-03-28 12:05 | - | |
| 8204- Price high, 7600 better/ | 2022-03-28 12:05 | - | |
| 8204 - Sound Quality/ | 2022-03-28 12:05 | - | |
| 8204- Text on screen is chopped/ | 2022-03-28 12:05 | - | |
| 8204- black smudge on screen/ | 2022-03-28 12:05 | - | |
| 8204 - temp issue drivers and software advice/ | 2022-03-28 12:05 | - | |
| 8204 April Build Date/ | 2022-03-28 12:05 | - | |
| 8204 DVI PORT How can I use it/ | 2022-03-28 12:05 | - | |
| 8204 GFX Fan dying/ | 2022-03-28 12:05 | - | |
| 8204 Loose LCD Screen/ | 2022-03-28 12:05 | - | |
| 8204 Low 3dmark And weird cpu speed under system/ | 2022-03-28 12:05 | - | |
| 8204 MultiDrive..HD DVD or BluRay in the Future/ | 2022-03-28 12:05 | - | |
| 8204 NIC firmware update/ | 2022-03-28 12:05 | - | |
| 8204 New Video Driver at ACER FTP/ | 2022-03-28 12:05 | - | |
| 8204 Question for anyone who has used the backup image/ | 2022-03-28 12:05 | - | |
| 8204 Restore and Hard Drive information/ | 2022-03-28 12:05 | - | |
| 8204 Screen Help/ | 2022-03-28 12:05 | - | |
| 8204WLMi, Fat32 and NTFS/ | 2022-03-28 12:05 | - | |
| 8204 WinXP Disk DIY/ | 2022-03-28 12:05 | - | |
| 8204 Wireless problem! Help me!!/ | 2022-03-28 12:05 | - | |
| 8204Wlmi Heat issue/ | 2022-03-28 12:05 | - | |
| 8204 and 3312 Bios/ | 2022-03-28 12:05 | - | |
| 8204 and Firewire port/ | 2022-03-28 12:05 | - | |
| 8204 and New BIOS, BLUE Screen/ | 2022-03-28 12:05 | - | |
| 8204 and Synaptics touch pad/ | 2022-03-28 12:05 | - | |
| 8204 and data corruption/ | 2022-03-28 12:05 | - | |
| 8204 and the USB power bug/ | 2022-03-28 12:05 | - | |
| 8204 bay battery/ | 2022-03-28 12:05 | - | |
| 8204 bluetooth sync and wifi security- newbie/ | 2022-03-28 12:05 | - | |
| 8204 cooling pad/ | 2022-03-28 12:05 | - | |
| 8204 discontinued, or MWave just lying/ | 2022-03-28 12:05 | - | |
| 8204 flashing power indicator/ | 2022-03-28 12:05 | - | |
| 8204 graphics artifacts/ | 2022-03-28 12:05 | - | |
| 8204 graphics performance/ | 2022-03-28 12:05 | - | |
| 8204 little software quirks after format/ | 2022-03-28 12:05 | - | |
| 8204 mini-review/ | 2022-03-28 12:05 | - | |
| 8204 or 5672/ | 2022-03-28 12:05 | - | |
| 8204 owners, check your network!/ | 2022-03-28 12:05 | - | |
| 8204 port replicators/ | 2022-03-28 12:05 | - | |
| 8204 problems/ | 2022-03-28 12:05 | - | |
| 8204 question/ | 2022-03-28 12:05 | - | |
| 8204 screen issue - widespread/ | 2022-03-28 12:05 | - | |
| 8204 software conflicts problems - help anyone/ | 2022-03-28 12:05 | - | |
| 8204wlmi and dual monitor setup/ | 2022-03-28 12:05 | - | |
| 8204wlmi hard disk make/ | 2022-03-28 12:05 | - | |
| 8204wlmi user upgrading/ | 2022-03-28 12:05 | - | |
| 8400M and 8600M troubles/ | 2022-03-28 12:05 | - | |
| 8600GT M differences/ | 2022-03-28 12:05 | - | |
| 8600gt/ | 2022-03-28 12:05 | - | |
| 8600m GT 256MB ACER 5920 OVERCLOCK/ | 2022-03-28 12:05 | - | |
| 8735g graphic driver/ | 2022-03-28 12:05 | - | |
| 8920 + X9000 + 4gb Crucial Ram + Vista 64bit =/ | 2022-03-28 12:05 | - | |
| 8920 BlueRay problem/ | 2022-03-28 12:05 | - | |
| 8920G (nvidia 9650m gs) overheating/ | 2022-03-28 12:05 | - | |
| 8920G-934G64BN GF9650M GS goes up to 96C° 206F° while playing games/ | 2022-03-28 12:05 | - | |
| 8920G - no BIOS, no video, no beeps/ | 2022-03-28 12:05 | - | |
| 8920G Bluetooth/ | 2022-03-28 12:05 | - | |
| 8920G CPU upgrade... the monster is alive/ | 2022-03-28 12:05 | - | |
| 8920G Downgrade to XP x64/ | 2022-03-28 12:05 | - | |
| 8920G SPDIF headphone-jacket not working/ | 2022-03-28 12:05 | - | |
| 8920G Troubled Screen/ | 2022-03-28 12:05 | - | |
| 8920G Windows 7 Audio Problem/ | 2022-03-28 12:05 | - | |
| 8920G driver help/ | 2022-03-28 12:05 | - | |
| 8920G hardware upgrades & recovery problems/ | 2022-03-28 12:05 | - | |
| 8920G problems/ | 2022-03-28 12:05 | - | |
| 8920G run Windows 7/ | 2022-03-28 12:05 | - | |
| 8920G wifi upgrade GOING NUTS NEED HELP/ | 2022-03-28 12:05 | - | |
| 8920G will not wake up/ | 2022-03-28 12:05 | - | |
| 8920 Problems/ | 2022-03-28 12:05 | - | |
| 8920 cpu upgrade/ | 2022-03-28 12:05 | - | |
| 8920g - replacing inverter/ | 2022-03-28 12:05 | - | |
| 8920g BIOS/ | 2022-03-28 12:05 | - | |
| 8920g Blu Ray quality based on graphics card/ | 2022-03-28 12:05 | - | |
| 8920g XP drivers (esp. audio)/ | 2022-03-28 12:05 | - | |
| 8920 gemstone black bars/ | 2022-03-28 12:05 | - | |
| 8920g from ATI - nvidia, problem!/ | 2022-03-28 12:05 | - | |
| 8920g random shut downs/ | 2022-03-28 12:05 | - | |
| 8930 3dmark06 scores/ | 2022-03-28 12:05 | - | |
| 8930 Application and Drivers Disk/ | 2022-03-28 12:05 | - | |
| 8930 Battery issue - Experiences desperatley needed/ | 2022-03-28 12:05 | - | |
| 8930 Bios/ | 2022-03-28 12:05 | - | |
| 8930B screen buzz/ | 2022-03-28 12:05 | - | |
| 8930G, core temps do not change as it gets hotter/ | 2022-03-28 12:05 | - | |
| 8930G - 5.1 Surround Sound Not Working After Windows 7 Installation/ | 2022-03-28 12:05 | - | |
| 8930G - No speech when playing DVD's or BD's/ | 2022-03-28 12:05 | - | |
| 8930G 4gb Vista32 or 64bit/ | 2022-03-28 12:05 | - | |
| 8930G BIOS Update....... What am i doing wrong !/ | 2022-03-28 12:05 | - | |
| 8930G Center and Right Speakerchannel Switched/ | 2022-03-28 12:05 | - | |
| 8930G Crystal Eye/ | 2022-03-28 12:05 | - | |
| 8930G Geforce 9600 GT graphics driver/ | 2022-03-28 12:05 | - | |
| 8930G One request, please/ | 2022-03-28 12:05 | - | |
| 8930G Replacement headphone jack/ | 2022-03-28 12:05 | - | |
| 8930G Wireless Problems/ | 2022-03-28 12:05 | - | |
| 8930G after BIOS Update Patch not starting/ | 2022-03-28 12:05 | - | |
| 8930G and remote/ | 2022-03-28 12:05 | - | |
| 8930G nvidia drivers/ | 2022-03-28 12:05 | - | |
| 8930G optimum/ | 2022-03-28 12:05 | - | |
| 8930G overheating. 2yrs old/ | 2022-03-28 12:05 | - | |
| 8930G quick graphic's question/ | 2022-03-28 12:05 | - | |
| 8930G resolution/ | 2022-03-28 12:05 | - | |
| 8930 HDMI problem/ | 2022-03-28 12:05 | - | |
| 8930 Models and Differences/ | 2022-03-28 12:05 | - | |
| 8930 No webcam, and no microphone/ | 2022-03-28 12:05 | - | |
| 8930 Open Box Question/ | 2022-03-28 12:05 | - | |
| 8930 Shuts down, yet it doesn't shut down/ | 2022-03-28 12:05 | - | |
| 8930 Speakers going out/ | 2022-03-28 12:05 | - | |
| 8930 User Manual and Auto Password Function/ | 2022-03-28 12:05 | - | |
| 8930 and ESata/ | 2022-03-28 12:05 | - | |
| 8930g & 6935g owners/ | 2022-03-28 12:05 | - | |
| 8930g- 6058 -upgrade- Cpu/ | 2022-03-28 12:05 | - | |
| 8930g - Cooling Pad/ | 2022-03-28 12:05 | - | |
| 8930g How do I restore from pq partition without erecovery/ | 2022-03-28 12:05 | - | |
| 8930g XP downgrade and CPU Upgrade/ | 2022-03-28 12:05 | - | |
| 8930g and Cod 5/ | 2022-03-28 12:05 | - | |
| 8930g clicks, won't boot - Help/ | 2022-03-28 12:05 | - | |
| 8930g no screen display/ | 2022-03-28 12:05 | - | |
| 8930g small snap[ sound, then poweed off/ | 2022-03-28 12:05 | - | |
| 8930g touchpad/ | 2022-03-28 12:05 | - | |
| 8930 survives beer/ | 2022-03-28 12:05 | - | |
| 8930 won't post/ | 2022-03-28 12:05 | - | |
| 8935G Display problem/ | 2022-03-28 12:05 | - | |
| 8935G No bios boot, only black screen/ | 2022-03-28 12:05 | - | |
| 8935G and 5935G- Gemstone Blue/ | 2022-03-28 12:05 | - | |
| 8935G with Linux/ | 2022-03-28 12:05 | - | |
| 8935g and Windows 7 upgrade/ | 2022-03-28 12:05 | - | |
| 8935g dpc latency/ | 2022-03-28 12:05 | - | |
| 8935g help/ | 2022-03-28 12:05 | - | |
| 8935g windows 7 upgrade/ | 2022-03-28 12:05 | - | |
| 8940G's touchpad stops working when any key is pressed/ | 2022-03-28 12:05 | - | |
| 8940G-6865 question/ | 2022-03-28 12:05 | - | |
| 8940G 6865 cooling pad/ | 2022-03-28 12:05 | - | |
| 8940G Retention Bracket/ | 2022-03-28 12:05 | - | |
| 8940G overheating/ | 2022-03-28 12:05 | - | |
| 8940G where to buy/ | 2022-03-28 12:05 | - | |
| 8940 problem with SD car reader/ | 2022-03-28 12:05 | - | |
| 8942G Build quality LCD quality/ | 2022-03-28 12:05 | - | |
| 8942 in states yet/ | 2022-03-28 12:05 | - | |
| 8942 where are you/ | 2022-03-28 12:05 | - | |
| 8943G - Upgrading the i5 to i7/ | 2022-03-28 12:05 | - | |
| 8943G 8950G 8951G.. Multimedia buttons/ | 2022-03-28 12:05 | - | |
| 8943G Mass Storage Driver/ | 2022-03-28 12:05 | - | |
| 8943G RAM upgrade question/ | 2022-03-28 12:05 | - | |
| 8943G Wireless disconnect/ | 2022-03-28 12:05 | - | |
| 8943G with i3 350, upgrade to i7/ | 2022-03-28 12:05 | - | |
| 8943 drive bay cover/ | 2022-03-28 12:05 | - | |
| 8943g media console controls quit working/ | 2022-03-28 12:05 | - | |
| 8950G Overheating and Auto shutdown/ | 2022-03-28 12:05 | - | |
| 8951G backlit keyboard in 8943G...possible/ | 2022-03-28 12:05 | - | |
| 9113WLMi vs 8204WLMi/ | 2022-03-28 12:05 | - | |
| 9300 Won't power up/ | 2022-03-28 12:05 | - | |
| 9300 bluetooth startup problem/ | 2022-03-28 12:05 | - | |
| 9301 recommended nvidia video driver suggestions/ | 2022-03-28 12:05 | - | |
| 9302AWSMI which memory/ | 2022-03-28 12:05 | - | |
| 9304 1 month out of warrantee and its stopped working/ | 2022-03-28 12:05 | - | |
| 9410Z-2028 Bluetooth/ | 2022-03-28 12:05 | - | |
| 9410Z wireless- Does Atheros AR5005 support WPA2/ | 2022-03-28 12:05 | - | |
| 9410z WD scorpio troubles/ | 2022-03-28 12:05 | - | |
| 9410z cpu options/ | 2022-03-28 12:05 | - | |
| 9410z cpu upgrade-)/ | 2022-03-28 12:05 | - | |
| 9500M GS Acer Aspire 8920 6920 games minimizing on start/ | 2022-03-28 12:05 | - | |
| 9520 Bluetooth automatic startup problem/ | 2022-03-28 12:05 | - | |
| 9600 GT - DDR2 or DDR3/ | 2022-03-28 12:05 | - | |
| 9600m GT gives black screen on Acer 7720g/ | 2022-03-28 12:05 | - | |
| 9600m GT installed on Aspire 5720 but driver = no install/ | 2022-03-28 12:05 | - | |
| 9600m GT much better than the 9500m GS/ | 2022-03-28 12:05 | - | |
| 9650m gt and acer aspire 5720zg/ | 2022-03-28 12:05 | - | |
| 9650m gt in 5920g - blank screen/ | 2022-03-28 12:05 | - | |
| 9810 Firmware Goofed !! Help Needed/ | 2022-03-28 12:05 | - | |
| 9920 - DVI - does it have audio/ | 2022-03-28 12:05 | - | |
| 9920 - how to turn on wifi on automatically/ | 2022-03-28 12:05 | - | |
| 9920G GPU Options/ | 2022-03-28 12:05 | - | |
| 9920G Problems/ | 2022-03-28 12:05 | - | |
| 9920G with 4GB, MEMORY ERRORS/ | 2022-03-28 12:05 | - | |
| 9920 Lcd Driver Found!/ | 2022-03-28 12:05 | - | |
| === 5920G ArticSilver Question/ | 2022-03-28 12:05 | - | |
| @ key not working brand new acer aspire1670/ | 2022-03-28 12:05 | - | |
| A1 spec discrepancy/ | 2022-03-28 12:05 | - | |
| A1 will not hold aspec ratio from boot to boot/ | 2022-03-28 12:05 | - | |
| AA1- smoothing out scratches on black LCD bezel/ | 2022-03-28 12:05 | - | |
| AA1- what does the left light next to the wifi do/ | 2022-03-28 12:05 | - | |
| AA1 D250 Not charging, tried BIOS battery methods/ | 2022-03-28 12:05 | - | |
| A BUCNH of question about my new 8920g/ | 2022-03-28 12:05 | - | |
| A Battery for Acer 3050 that does not bulge in the back/ | 2022-03-28 12:05 | - | |
| AC Adapter Acer 2012WLMi/ | 2022-03-28 12:06 | - | |
| AC Adapter Aspire 5100-3019 specs/ | 2022-03-28 12:06 | - | |
| AC Adapter for Acer 3820T 3820TG/ | 2022-03-28 12:06 | - | |
| AC Adapter no longer charges after 1 yr/ | 2022-03-28 12:06 | - | |
| ACER'S NEW 6920 g gemstome blue/ | 2022-03-28 12:10 | - | |
| ACER's Giant MARKETING Hit On Graphic Card!!!/ | 2022-03-28 12:10 | - | |
| ACER, how long for delivery/ | 2022-03-28 12:10 | - | |
| ACER - Aspire/ | 2022-03-28 12:06 | - | |
| ACER- We want the WHITE 1410 & 1810TZ IN AMERICA!!!/ | 2022-03-28 12:10 | - | |
| ACER 110 and SATA/ | 2022-03-28 12:06 | - | |
| ACER 110 keyboard/ | 2022-03-28 12:06 | - | |
| ACER 230 audio problems/ | 2022-03-28 12:06 | - | |
| ACER 634LC (630 series) and SP2/ | 2022-03-28 12:06 | - | |
| ACER 730 Travelmate Service Guide Manual PDF link/ | 2022-03-28 12:07 | - | |
| ACER 1502 don't detect HDD 80GB/ | 2022-03-28 12:06 | - | |
| ACER 1680 Help with CHIPSET re-load/ | 2022-03-28 12:06 | - | |
| ACER 1802 WSMi - Any user opnions Reviews/ | 2022-03-28 12:06 | - | |
| ACER 1804wmsi and s pdif support/ | 2022-03-28 12:06 | - | |
| ACER 1804wsmi vs CLEVO D870P/ | 2022-03-28 12:06 | - | |
| ACER 1804wsmi vs CLEVO D900P!!!!/ | 2022-03-28 12:06 | - | |
| ACER 1810TZ Mod/ | 2022-03-28 12:06 | - | |
| ACER 3003 Aspire/ | 2022-03-28 12:06 | - | |
| ACER 3004 WTM1 keyboard/ | 2022-03-28 12:06 | - | |
| ACER 3004 max disk size/ | 2022-03-28 12:06 | - | |
| ACER 3010 intro'd to US market_12 wide/ | 2022-03-28 12:06 | - | |
| ACER 3050 NO eRECOVERY FEATURE/ | 2022-03-28 12:06 | - | |
| ACER 3302 (sub 2.0kg + 14 WXGA)/ | 2022-03-28 12:06 | - | |
| ACER 3613WLMi/ | 2022-03-28 12:06 | - | |
| ACER 3680-2682 hangs/ | 2022-03-28 12:06 | - | |
| ACER 3680 Boot From USB/ | 2022-03-28 12:06 | - | |
| ACER 3680 wireless problems/ | 2022-03-28 12:06 | - | |
| ACER 3690, Windows Vista, problem with Camera and Bluetooth/ | 2022-03-28 12:06 | - | |
| ACER 3820TG vs M11X, my little review/ | 2022-03-28 12:06 | - | |
| ACER 4082 WLMi-is there any solution/ | 2022-03-28 12:06 | - | |
| ACER 4100/ | 2022-03-28 12:06 | - | |
| ACER 4520 sound problems/ | 2022-03-28 12:06 | - | |
| ACER 4674 Heat Issue (TM4674WLMi--0306)/ | 2022-03-28 12:06 | - | |
| ACER 4750G Crisis Mode/ | 2022-03-28 12:06 | - | |
| ACER 4820TG, Video Card Problen/ | 2022-03-28 12:06 | - | |
| ACER 5002WLMi reflection/ | 2022-03-28 12:06 | - | |
| ACER 5024 - replacing ML-34 (1,8 Ghz) with MT-37 (2,0 Ghz)/ | 2022-03-28 12:06 | - | |
| ACER 5103 Sleep Hibernate Fails Vista/ | 2022-03-28 12:06 | - | |
| ACER 5220 XP SP3 - no sound/ | 2022-03-28 12:06 | - | |
| ACER 5230 Press F1 Boot Error @ C2D T7500 - Please Help/ | 2022-03-28 12:06 | - | |
| ACER 5251 WIll not erecover will not work/ | 2022-03-28 12:06 | - | |
| ACER 5290G - white screen while starting/ | 2022-03-28 12:06 | - | |
| ACER 5310 LCD Screen (need one)/ | 2022-03-28 12:06 | - | |
| ACER 5310 Maximum Hard Drive Size/ | 2022-03-28 12:06 | - | |
| ACER 5315-2122 Gl960 or GMA965/ | 2022-03-28 12:06 | - | |
| ACER 5315 laptop VS SKY router SAGEM,pls help/ | 2022-03-28 12:06 | - | |
| ACER 5315 w Atheros wifi... SOS!/ | 2022-03-28 12:06 | - | |
| ACER 5552 - Black screen. please help I have limited internet access/ | 2022-03-28 12:06 | - | |
| ACER 5552 SA drivers needed to install win7/ | 2022-03-28 12:06 | - | |
| ACER 5610 Ethernet Driver/ | 2022-03-28 12:06 | - | |
| ACER 5610 Vista erecovery and TEMP TMP/ | 2022-03-28 12:06 | - | |
| ACER 5610Z 5-in-1 reader/ | 2022-03-28 12:06 | - | |
| ACER 5633WLMi + Clean XP Pro SP2 Install = Audio Problems/ | 2022-03-28 12:06 | - | |
| ACER 5633WLMi DVD drive not recognised recognized/ | 2022-03-28 12:06 | - | |
| ACER 5670 5672 s-video out not work/ | 2022-03-28 12:06 | - | |
| ACER 5670 vs ACER 5650/ | 2022-03-28 12:06 | - | |
| ACER 5672 Network controller driver/ | 2022-03-28 12:06 | - | |
| ACER 5672 ver. ATIx1600 TOTAL REFORMAT + INSTALL PROGRAMS FOR SUPER NOOB!!/ | 2022-03-28 12:06 | - | |
| ACER 5672 w ATI X1600 DVD Drive Not Responding/ | 2022-03-28 12:06 | - | |
| ACER 5680 Broadcom drivers installation help/ | 2022-03-28 12:06 | - | |
| ACER 5720G-Flash Bios-Dead machine!/ | 2022-03-28 12:06 | - | |
| ACER 5720Z 4gb what ram modules work/ | 2022-03-28 12:06 | - | |
| ACER 5735 Intel GMA 3400MHD gaming/ | 2022-03-28 12:06 | - | |
| ACER 5740 BIOS update failed Cant get CRISIS to work/ | 2022-03-28 12:06 | - | |
| ACER 5740 Touchpad Issue/ | 2022-03-28 12:06 | - | |
| ACER 5742G BIOS modding/ | 2022-03-28 12:06 | - | |
| ACER 5745-6492 start-up error- NEED HELP/ | 2022-03-28 12:06 | - | |
| ACER 5755G Bluetooth startup issue/ | 2022-03-28 12:06 | - | |
| ACER 5810TZ with Windows 7 upgrade + Power Mgt. Issues + LOCKUPS!/ | 2022-03-28 12:06 | - | |
| ACER 5820TG Discontinued/ | 2022-03-28 12:06 | - | |
| ACER 5920 & 4.1 Creative Speakers Problem/ | 2022-03-28 12:06 | - | |
| ACER 5920G 3D mark 06/ | 2022-03-28 12:06 | - | |
| ACER 5920G 8600M GT best driver/ | 2022-03-28 12:06 | - | |
| ACER 5920G MIC configuration/ | 2022-03-28 12:06 | - | |
| ACER 5920G SATA problems/ | 2022-03-28 12:06 | - | |
| ACER 5920G Wireless Help/ | 2022-03-28 12:06 | - | |
| ACER 5920G help! can't find video card driver/ | 2022-03-28 12:06 | - | |
| ACER 5920G how to connect 4 speakers/ | 2022-03-28 12:06 | - | |
| ACER 5920G not charging when adapter is put in, help!/ | 2022-03-28 12:06 | - | |
| ACER 5920 Rear Cover Removal/ | 2022-03-28 12:06 | - | |
| ACER 5920 Screen Size Problem during Games/ | 2022-03-28 12:06 | - | |
| ACER 5920 at Best Buy but with 1.5GHZ/ | 2022-03-28 12:06 | - | |
| ACER 5920g - ATI HD 3650 512 MB DDR3/ | 2022-03-28 12:06 | - | |
| ACER5920g - Sound only coming out of Sub not speakers/ | 2022-03-28 12:10 | - | |
| ACER 5920g Battery Life/ | 2022-03-28 12:06 | - | |
| ACER 5920g Blue Screen/ | 2022-03-28 12:06 | - | |
| ACER 5920g Temperatures!/ | 2022-03-28 12:06 | - | |
| ACER 5920 pics/ | 2022-03-28 12:06 | - | |
| ACER 6290 Freezing/ | 2022-03-28 12:06 | - | |
| ACER 6292 - Short Review/ | 2022-03-28 12:06 | - | |
| ACER 6920-6508 Vista 64 can't burn DVDs/ | 2022-03-28 12:06 | - | |
| ACER 6920 - Webcam Hijacked/ | 2022-03-28 12:06 | - | |
| ACER 6920G - Boots - white screen/ | 2022-03-28 12:06 | - | |
| ACER 6920G Headphones not working/ | 2022-03-28 12:06 | - | |
| ACER 6920G Motherboard/ | 2022-03-28 12:06 | - | |
| ACER 6930G Problem/ | 2022-03-28 12:06 | - | |
| ACER 6930G multitouch trackpad/ | 2022-03-28 12:06 | - | |
| ACER 6930g - Cpu Upgrade replacement/ | 2022-03-28 12:06 | - | |
| ACER 6930 touch keys problem/ | 2022-03-28 12:06 | - | |
| ACER 6935G Battery charging/ | 2022-03-28 12:06 | - | |
| ACER 6935G and CUDA - Performances up/ | 2022-03-28 12:06 | - | |
| ACER 7520-5168 with 4GB RAM question/ | 2022-03-28 12:07 | - | |
| ACER 7520G Power supply issue !/ | 2022-03-28 12:07 | - | |
| ACER 7535g Upgrading to Windows 7 problems/ | 2022-03-28 12:07 | - | |
| ACER 7552G freez problem/ | 2022-03-28 12:07 | - | |
| ACER 7720 CPU GPU RAM upgrade/ | 2022-03-28 12:07 | - | |
| ACER 7720 Switched to XP Pro/ | 2022-03-28 12:07 | - | |
| ACER 7736Z User Manual/ | 2022-03-28 12:07 | - | |
| ACER 7741z-4433/ | 2022-03-28 12:07 | - | |
| ACER 8005LMi - Bluetooth Profiles Supported/ | 2022-03-28 12:07 | - | |
| ACER 8204 - found it - in stock!/ | 2022-03-28 12:07 | - | |
| ACER 8204 6 cell battery/ | 2022-03-28 12:07 | - | |
| ACER 8204 After repair Issues/ | 2022-03-28 12:07 | - | |
| ACER 8204 New Bios Available (3311)/ | 2022-03-28 12:07 | - | |
| ACER 8204 WLMi problem/ | 2022-03-28 12:07 | - | |
| ACER 8204WLMi upgrade to Vista,cannot detect bluetooth..!!/ | 2022-03-28 12:07 | - | |
| ACER 8204WMLI Service Manual/ | 2022-03-28 12:07 | - | |
| ACER 8204 and CounterStrike freezing problems/ | 2022-03-28 12:07 | - | |
| ACER 8735G Need help with setting up bios for Q9000 CPU/ | 2022-03-28 12:07 | - | |
| ACER 8930G ERROR Please Read HELP/ | 2022-03-28 12:07 | - | |
| ACER 8930G and Blackberry/ | 2022-03-28 12:07 | - | |
| ACER 8930G touchpad mouse suddently got off!/ | 2022-03-28 12:07 | - | |
| ACER 8930 does not read cd/ | 2022-03-28 12:07 | - | |
| ACER 8935G WITH Nvidia GTS 250M Installling..Please Help/ | 2022-03-28 12:07 | - | |
| ACER 8935 windows requires a digitally signed driver issue/ | 2022-03-28 12:07 | - | |
| ACER 8940Gnotebook - problems running MR816X external sound module/ | 2022-03-28 12:07 | - | |
| ACER 8951G missing Dvd No.3 from recovery DVD/ | 2022-03-28 12:07 | - | |
| ACER 9300-4272 - speakers/ | 2022-03-28 12:07 | - | |
| ACER 9300 touchpad right-click left-click problem!/ | 2022-03-28 12:07 | - | |
| ACER 9410Z board question/ | 2022-03-28 12:07 | - | |
| ACER 50920 Recover Disk creation problem with 2nd Disk/ | 2022-03-28 12:06 | - | |
| ACER ARACDE driving me nuts/ | 2022-03-28 12:07 | - | |
| ACER AS1694 WLMi Disappearing Partitions/ | 2022-03-28 12:07 | - | |
| ACER AS3613WLMi $899 Canadian/ | 2022-03-28 12:07 | - | |
| ACER AS6920-6021 - Great deal!! - need advice/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 1520 weird power/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 2025 HARD DISK SPEED/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 3000 how to replace power jack/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 3003LMI hangs/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 3503 not working; is the hdd fried HELP!!/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 3742g/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 4736z Power Problem Please Share you Ideas/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 5021-black line on LCD 0,79inch/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 5100 silver square scroll button driver/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 5610Z- I need MANUAL + RECOVERY software/ | 2022-03-28 12:07 | - | |
| ACER ASPIRE 5720Z Guide to flashing bios/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE 5740 BIOS LOCATION/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE 5830TG TImelineX/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE 6920G Laptop battery/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE 6920G Successfully working with all drivers in W7/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE 7735g MXM III/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE 8930g SCREEN PROBLEM/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE 9410Z Keyboard Replacement/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE ONE AOD250 Value for Money/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE not powering on/ | 2022-03-28 12:08 | - | |
| ACER ASPIRE recovery cd lost/ | 2022-03-28 12:08 | - | |
| ACER Applications and high CPU usage/ | 2022-03-28 12:07 | - | |
| ACER Aspire 573x/ | 2022-03-28 12:08 | - | |
| ACER Aspire 1362WLMi is good/ | 2022-03-28 12:07 | - | |
| ACER Aspire 1640 power issue/ | 2022-03-28 12:07 | - | |
| ACER Aspire 1642ZNWLMI/ | 2022-03-28 12:07 | - | |
| ACER Aspire 1670lmi fan noise/ | 2022-03-28 12:07 | - | |
| ACER Aspire 1672 LMi/ | 2022-03-28 12:07 | - | |
| ACER Aspire 1692WLMI Monitor Settings/ | 2022-03-28 12:07 | - | |
| ACER Aspire 4703Z Problem!..HElp!/ | 2022-03-28 12:07 | - | |
| ACER Aspire 4730-4947 webcam wont work/ | 2022-03-28 12:07 | - | |
| ACER Aspire 4736 recovery question .. help !/ | 2022-03-28 12:07 | - | |
| ACER Aspire 4810TZ-4120/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5002Wlmi MBR needed/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5020 Turion 64/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5043 Graphic Card question/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5050 CPU upgrade/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5349-2481 - How to Access RAM/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5570 - Memory Dump BSOD/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5570 power down/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5610 Factory Reset/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5672WLMi avg temps and CPU Fan/ | 2022-03-28 12:07 | - | |
| ACER Aspire 5739G BIOS recovery HELP Please -(/ | 2022-03-28 12:08 | - | |
| ACER Aspire 5739G fan speed control/ | 2022-03-28 12:08 | - | |
| ACER Aspire 5740 dead after BIOS UPDATE/ | 2022-03-28 12:08 | - | |
| ACER Aspire 5750 screen problem help/ | 2022-03-28 12:08 | - | |
| ACER Aspire 5920G-302G25Mi- How can I put XP on this laptop/ | 2022-03-28 12:08 | - | |
| ACER Aspire 5920G BIOS update, Please Help!!!/ | 2022-03-28 12:08 | - | |
| ACER Aspire 5920G Display Driver Update/ | 2022-03-28 12:08 | - | |
| ACER Aspire 5920g with 8600M GT - Slow in a game!!!/ | 2022-03-28 12:08 | - | |
| ACER Aspire 5942G i5 issues and comments/ | 2022-03-28 12:08 | - | |
| ACER Aspire 6572 Power Conector/ | 2022-03-28 12:08 | - | |
| ACER Aspire 6920G BD-Rom Problem/ | 2022-03-28 12:08 | - | |
| ACER Aspire 6920 Power Jack Replacement/ | 2022-03-28 12:08 | - | |
| ACER Aspire 7520G laptop does not turn on/ | 2022-03-28 12:08 | - | |
| ACER Aspire 7530 HDMI sound problem/ | 2022-03-28 12:08 | - | |
| ACER Aspire 7551g-6477 Fan Issue/ | 2022-03-28 12:08 | - | |
| ACER Aspire 7730G-734G32BN/ | 2022-03-28 12:08 | - | |
| ACER Aspire 8935G CPU Upgraded to Intel T9900 3.06 GHz/ | 2022-03-28 12:08 | - | |
| ACER Aspire 9410Z Recovery Disk/ | 2022-03-28 12:08 | - | |
| ACER Aspire 9413AWSMi Orbicam problem/ | 2022-03-28 12:08 | - | |
| ACER Aspire One A0752-2105/ | 2022-03-28 12:08 | - | |
| ACER Aspire One AOA150-1447 Stand by freezes/ | 2022-03-28 12:08 | - | |
| ACER Aspire One D150 query/ | 2022-03-28 12:08 | - | |
| ACER Aspire One D250-1042 Speedup/ | 2022-03-28 12:08 | - | |
| ACER Aspire V3-471G issues. Help needed!/ | 2022-03-28 12:08 | - | |
| ACER Aspire V3 571G - any good extended 9-cell batteries around/ | 2022-03-28 12:08 | - | |
| ACER Aspire V3 571G 736b8G1TMaii review... awesome gaming laptop with IPS screen for those on a budget/ | 2022-03-28 12:08 | - | |
| ACER Battery Charge issue/ | 2022-03-28 12:09 | - | |
| ACER Bluetooth problem/ | 2022-03-28 12:09 | - | |
| ACER Build Quality/ | 2022-03-28 12:09 | - | |
| ACER C110 - lost my recovery cds and hiddent partition/ | 2022-03-28 12:09 | - | |
| ACER Chromebook/ | 2022-03-28 12:09 | - | |
| ACER D250 LCD brightness default, can you change it/ | 2022-03-28 12:09 | - | |
| ACER D 250 service manual/ | 2022-03-28 12:09 | - | |
| ACER DUO CORE AS5672WLMi/ | 2022-03-28 12:09 | - | |
| ACER DVD Drive Question/ | 2022-03-28 12:09 | - | |
| ACER EXTENSA 5620Z Speaker trouble/ | 2022-03-28 12:09 | - | |
| ACER Extensa 4420-5239 laptop/ | 2022-03-28 12:09 | - | |
| ACER Extensa 4420 V I D E O P R O B L E M/ | 2022-03-28 12:09 | - | |
| ACER Extensa 4420 video driver/ | 2022-03-28 12:09 | - | |
| ACER Extensa 4620Z Bluetooth/ | 2022-03-28 12:09 | - | |
| ACER Extensa 5610 Windows XP help/ | 2022-03-28 12:09 | - | |
| ACER Extensa 5620G Thread/ | 2022-03-28 12:09 | - | |
| ACER Extensa hard drive speed problem/ | 2022-03-28 12:09 | - | |
| ACER FERRARÝ3400/ | 2022-03-28 12:09 | - | |
| ACER FERRARI 4000, MORE PICS FROM AMD BOARD/ | 2022-03-28 12:09 | - | |
| ACER FERRARI 4006WLMi - 100% CPU usage in every game! HELP!/ | 2022-03-28 12:09 | - | |
| ACER Ferrari 3400/ | 2022-03-28 12:09 | - | |
| ACER HOW IS THE BATTERY LIVE/ | 2022-03-28 12:09 | - | |
| ACER ICONIA 6210 Touchbook/ | 2022-03-28 12:09 | - | |
| ACER Iconia 6120/ | 2022-03-28 12:09 | - | |
| ACER MEMORY/ | 2022-03-28 12:09 | - | |
| ACER Memory Problems/ | 2022-03-28 12:09 | - | |
| ACER NWXCI 2424 SCREEN problem/ | 2022-03-28 12:09 | - | |
| ACER Notebook Holiday refresh/ | 2022-03-28 12:09 | - | |
| ACER Notebook Models, Support Numbers, BIOS, User Manuals and Drivers Links/ | 2022-03-28 12:09 | - | |
| ACER ONE 8 homepage won't display colors/ | 2022-03-28 12:09 | - | |
| ACER Partition problem/ | 2022-03-28 12:09 | - | |
| ACER Power supply unit - a consumable item/ | 2022-03-28 12:09 | - | |
| ACER RS400 Chipset, NEED HELP!!!!/ | 2022-03-28 12:09 | - | |
| ACER Recovery tips/ | 2022-03-28 12:09 | - | |
| ACER S3 Ultrabook + pico projector/ | 2022-03-28 12:09 | - | |
| ACER Survey/ | 2022-03-28 12:09 | - | |
| ACER TM-8000LMI HD upgrade/ | 2022-03-28 12:09 | - | |
| ACER TM 4000 WLMI/ | 2022-03-28 12:09 | - | |
| ACER TM 4000 WLMI vs TOSHIBA Satellite M30X-113/ | 2022-03-28 12:09 | - | |
| ACER TM 4000 WLMI with Windows 2000/ | 2022-03-28 12:09 | - | |
| ACER TM4024WLMi/ | 2022-03-28 12:10 | - | |
| ACER TRAVELMATE 212TXV/ | 2022-03-28 12:10 | - | |
| ACER TRAVELMATE 8172 11.6 Thread/ | 2022-03-28 12:10 | - | |
| ACER Timeline with SU2700, is it a dual core/ | 2022-03-28 12:09 | - | |
| ACER TravelMate 2410 Model 2413NLMi. How to take apart/ | 2022-03-28 12:10 | - | |
| ACER TravelMate 2480 how I can connect internet on XP/ | 2022-03-28 12:10 | - | |
| ACER TravelMate 4402 Opinions Wanted/ | 2022-03-28 12:10 | - | |
| ACER TravelMate 4720 overheating/ | 2022-03-28 12:10 | - | |
| ACER TravelMate 5530 Windows 7 reinstall HELP/ | 2022-03-28 12:10 | - | |
| ACER TravelMate 7740G-484G64 temperature/ | 2022-03-28 12:10 | - | |
| ACER TravelMate 8473TG, is it worth buying/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 230 - Battery wont charge/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 290 stops at system boot/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 2400 series; replacing power jack/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 2420 fails to see operating system and will not restore from disc. HELP!!!/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 2423 BIOS/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 2480 Problem with Mouse Touchpad/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 4402 RAM upgrade/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 5530G-704G32Mi/ | 2022-03-28 12:10 | - | |
| ACER Travelmate 6292 cant boot up window/ | 2022-03-28 12:10 | - | |
| ACER V3-571G (UK @Comet i7-3610QM, 16gb ram, 1TB HD, 120gb SSD, GT650M 2 GB, 17.3inch)/ | 2022-03-28 12:10 | - | |
| ACER V5-573PG TOUCH SCREEN replacement to NON-TOUCH SCREEN. PLEASE, HELP!/ | 2022-03-28 12:10 | - | |
| ACER Warranty, basically, there isn't one/ | 2022-03-28 12:10 | - | |
| ACER X3800 Aspire Upgrades/ | 2022-03-28 12:10 | - | |
| ACER arrived-- Power plug won't go in outlet/ | 2022-03-28 12:07 | - | |
| ACER aspire 3690, recovery help plz/ | 2022-03-28 12:07 | - | |
| ACER aspire 5738g on sale at comet.co.uk/ | 2022-03-28 12:08 | - | |
| ACER aspire wifi problem/ | 2022-03-28 12:09 | - | |
| ACER being sold with known Hardware fault (LINE-IN) (Comet,UK)/ | 2022-03-28 12:09 | - | |
| ACER connection question/ | 2022-03-28 12:09 | - | |
| ACER core 2 duo price/ | 2022-03-28 12:09 | - | |
| ACER customer services is appalling/ | 2022-03-28 12:09 | - | |
| ACER eRecovery Help (Alt+F10 Problem)/ | 2022-03-28 12:09 | - | |
| ACER eRecovery error Monitor - image size error/ | 2022-03-28 12:09 | - | |
| ACER eRecovery error image size error/ | 2022-03-28 12:09 | - | |
| ACER gemstone 5920- 6273 poor screen quality/ | 2022-03-28 12:09 | - | |
| ACER need to know's/ | 2022-03-28 12:09 | - | |
| ACER poor customer service/ | 2022-03-28 12:09 | - | |
| ACERs' WARRANTY/ | 2022-03-28 12:10 | - | |
![[DIR]](/icons/compressed.gif) | ACER software lookup eRecovery 1.3.9.2.zip/ | 2022-03-28 12:09 | - | |
| ACER substituted a TF-20 processor with a 2.0 GHZ TF-36 processor on my newly bought laptop- downgrade upgrade/ | 2022-03-28 12:09 | - | |
| ACER support policy!/ | 2022-03-28 12:09 | - | |
| ACER techsupport SUX/ | 2022-03-28 12:09 | - | |
| ACER timeline 3830TG Driver help/ | 2022-03-28 12:09 | - | |
| ACER timelines 3810 Screen contrast issue/ | 2022-03-28 12:09 | - | |
| ACER travelmate 2423 Heat problem, I think/ | 2022-03-28 12:10 | - | |
| ACER with switchable graphics (5810TG) and Windows 8/ | 2022-03-28 12:10 | - | |
| ACER would not honor Vista Upgrade/ | 2022-03-28 12:10 | - | |
| ACHI to IDE - Any Data Loss/ | 2022-03-28 12:10 | - | |
| ACK! New Aspire 2012WLMi DOA !/ | 2022-03-28 12:10 | - | |
| ACPI issues with Acer Extensa 5620/ | 2022-03-28 12:10 | - | |
| ACPI support for acer aspire 1690/ | 2022-03-28 12:10 | - | |
| AC Plug broken for ASPIRE 5672WLMI/ | 2022-03-28 12:06 | - | |
| AC adapter replacement for 5738z-4111/ | 2022-03-28 12:06 | - | |
| ACer 4736 - What is the function of this button/ | 2022-03-28 12:06 | - | |
| ACer 5672 with Vista RTM - Issues/ | 2022-03-28 12:06 | - | |
| ACer 5738ZG- Enable 4500MHD/ | 2022-03-28 12:06 | - | |
| ACer 8204 using not on native SATA/ | 2022-03-28 12:07 | - | |
| AC is connected, but the battery doesnt charge/ | 2022-03-28 12:06 | - | |
| AC power adapter for Aspire 5740/ | 2022-03-28 12:06 | - | |
| A Favour to Ask for Acer Arcade Deluxe Users/ | 2022-03-28 12:05 | - | |
| A Fresh Install on an 8204/ | 2022-03-28 12:05 | - | |
| AKE Express Card USB 3.0 54mm Card forAcer Aspire 6920G not recognized/ | 2022-03-28 12:10 | - | |
| AMD-Based Acer Aspire 5044NWLCi --- Graphic Driver Problem/ | 2022-03-28 12:10 | - | |
| AMD Catalyst Mobility drivers for Acer AS7552G-6436/ | 2022-03-28 12:10 | - | |
| AMD Dynamic Switchable Graphics 6xxxm Series No OpenGL support/ | 2022-03-28 12:10 | - | |
| AMD M5950 (from HP) in Acer 7738g/ | 2022-03-28 12:10 | - | |
| AMD MK-36 Upgrade/ | 2022-03-28 12:10 | - | |
| AMD RM-72 in Acer Aspire 7520G/ | 2022-03-28 12:10 | - | |
| AMD Sempron 3000 + wierd GHz question/ | 2022-03-28 12:10 | - | |
| AMD TuX2 gamer- ACER ASPIRE 4520G-404G16MI/ | 2022-03-28 12:10 | - | |
| AMD Turion 64x2 1.6ghz TL50 Temp monitor/ | 2022-03-28 12:10 | - | |
| AMD Turion 64x2 TMDTL66HAX5DM or TMDTL66HAX5DC/ | 2022-03-28 12:10 | - | |
| AN515-54 120Hz panel but I can't set 60Hz/ | 2022-03-28 12:10 | - | |
| ANOTHER Acer recovery question/ | 2022-03-28 12:10 | - | |
| ANYONE HEARD OF THE 1674WLMi/ | 2022-03-28 12:10 | - | |
| AO522 models, any REAL differences/ | 2022-03-28 12:10 | - | |
| AO 532h 2GB RAM upgrade/ | 2022-03-28 12:10 | - | |
| AO532h ePower utility for WinXP - where/ | 2022-03-28 12:10 | - | |
| AO722 Netbook -Issues/ | 2022-03-28 12:10 | - | |
| AO722 Won't Run From Battery-Runs A C Only/ | 2022-03-28 12:10 | - | |
| AO751h-52BGw 802.11n/ | 2022-03-28 12:10 | - | |
| AO 756 disassembly/ | 2022-03-28 12:10 | - | |
| AO756 screen problem/ | 2022-03-28 12:10 | - | |
| AOA110 clean install fails/ | 2022-03-28 12:10 | - | |
| AOA 150 having trouble finding out how to record videos with the crystal eye webcam/ | 2022-03-28 12:10 | - | |
| A Question About XP Media Center Authenticity ... Did Acer LIE to Me/ | 2022-03-28 12:05 | - | |
| A Question for Ferrari 4002 Owners/ | 2022-03-28 12:05 | - | |
| A Quick Question/ | 2022-03-28 12:05 | - | |
| AS-5672-WLMi $15.00 Review Rebate/ | 2022-03-28 12:10 | - | |
| AS-5755G laptop screen upgrade possibility/ | 2022-03-28 12:10 | - | |
| AS07B2 battery won't charge/ | 2022-03-28 12:10 | - | |
| AS1410 - no speaker output/ | 2022-03-28 12:10 | - | |
| AS1410 Hard drive/ | 2022-03-28 12:10 | - | |
| AS1681wlmi replacement for 2012wlmi/ | 2022-03-28 12:10 | - | |
| AS1691 GPU in U.S/ | 2022-03-28 12:10 | - | |
| AS1804WSMI Troubles/ | 2022-03-28 12:10 | - | |
| AS1804WSMI is it the bug free 1802/ | 2022-03-28 12:10 | - | |
| AS1810T Keyboard layout/ | 2022-03-28 12:10 | - | |
| AS1810TZ vs ASUS UL30/ | 2022-03-28 12:10 | - | |
| AS 1830-3595 (AT&T version) battery life/ | 2022-03-28 12:10 | - | |
| AS1830-3595 ... Should I Buy/ | 2022-03-28 12:10 | - | |
| AS2012WLMi Memory Upgrade/ | 2022-03-28 12:10 | - | |
| AS2012WLMi notebook/ | 2022-03-28 12:10 | - | |
| AS2012WLMi vs Toshiba M30-00K/ | 2022-03-28 12:10 | - | |
| AS2920-602G25 on XP/ | 2022-03-28 12:10 | - | |
| AS3003LCi + Fedora Core 5 + Wireless/ | 2022-03-28 12:10 | - | |
| AS3003WLCI 3009WLCI fan noise!/ | 2022-03-28 12:10 | - | |
| AS 3003WLMI screen calibration/ | 2022-03-28 12:10 | - | |
| AS3004WLCi...any good/ | 2022-03-28 12:10 | - | |
| AS 3623WXCi Problem..Please Help!!/ | 2022-03-28 12:10 | - | |
| AS3680-2633 recovery disc/ | 2022-03-28 12:10 | - | |
| AS3810T-354G32n battery charging problem/ | 2022-03-28 12:10 | - | |
| AS 4720Z DVD-Rom/ | 2022-03-28 12:10 | - | |
| AS4730 Mini-Review/ | 2022-03-28 12:10 | - | |
| AS4820TG has Powered USB/ | 2022-03-28 12:10 | - | |
| AS 5520G 8600M GS to 9600M GT/ | 2022-03-28 12:10 | - | |
| AS 5520 G Cpu upgrade/ | 2022-03-28 12:10 | - | |
| AS5530g upgrade 9600mgt comes error,need help!/ | 2022-03-28 12:10 | - | |
| AS5570 AS5580, Available CPU Upgrades/ | 2022-03-28 12:10 | - | |
| AS5672 - Anyone getting decent frame rates on their Orbicam/ | 2022-03-28 12:10 | - | |
| AS5672 - Realtek HD Audio Drivers/ | 2022-03-28 12:10 | - | |
| AS5672WLMi-ATI X1600 running hot!/ | 2022-03-28 12:10 | - | |
| AS5672WLMi 3dmark05/ | 2022-03-28 12:10 | - | |
| AS5672 kits. What's the difference/ | 2022-03-28 12:10 | - | |
| AS5672 problems! Please help!/ | 2022-03-28 12:10 | - | |
| AS5720 Help- from 8400m GS to 8600m GT (GDDR3)/ | 2022-03-28 12:10 | - | |
| AS5738G-664G32MN vs AS5738ZG-434G50MN vs AS5738G-664G50MN/ | 2022-03-28 12:10 | - | |
| AS5739G-6959 - CPU upgradeable/ | 2022-03-28 12:10 | - | |
| AS5740G - Drivers vs Performance - Turbo Boost Driver/ | 2022-03-28 12:10 | - | |
| AS5830TG US discontinued/ | 2022-03-28 12:10 | - | |
| AS5920G - Buying spare HD for RAID/ | 2022-03-28 12:10 | - | |
| AS5920G worth it/ | 2022-03-28 12:10 | - | |
| AS5920 Owners Lounge/ | 2022-03-28 12:10 | - | |
| AS6920 - Fan clicking loudly/ | 2022-03-28 12:10 | - | |
| AS6920 - distorted bas/ | 2022-03-28 12:10 | - | |
| AS 6920 - unable to use dvd drive/ | 2022-03-28 12:10 | - | |
| AS 6920G Best Bios version/ | 2022-03-28 12:10 | - | |
| AS 6920G Cooler Needed/ | 2022-03-28 12:10 | - | |
| AS6920G DPC latency issue/ | 2022-03-28 12:10 | - | |
| AS 6920G Restarting/ | 2022-03-28 12:10 | - | |
| AS 6920G Temperature Control/ | 2022-03-28 12:10 | - | |
| AS6920G freezes or shuts down/ | 2022-03-28 12:10 | - | |
| AS6920G to TV HDMI/ | 2022-03-28 12:10 | - | |
| AS6920 Owners Lounge/ | 2022-03-28 12:10 | - | |
| AS6920g and intel matrix storage/ | 2022-03-28 12:10 | - | |
| AS 6920 problems (display error and rundll32)/ | 2022-03-28 12:10 | - | |
| AS6930-6941 Tiger Direct/ | 2022-03-28 12:10 | - | |
| AS6935 gets hot, epower management/ | 2022-03-28 12:10 | - | |
| AS7720 Start Up - No Windows Display/ | 2022-03-28 12:10 | - | |
| AS 8920G BIOS update/ | 2022-03-28 12:10 | - | |
| AS8930-6555 and Windows 7 build 6801/ | 2022-03-28 12:10 | - | |
| AS8940G-6865 anyone/ | 2022-03-28 12:10 | - | |
| AS8950G dual monitor support and docking station/ | 2022-03-28 12:10 | - | |
| AS9410-4541 for light gaming/ | 2022-03-28 12:10 | - | |
| AS9504EWSMI fan noise driving me nuts/ | 2022-03-28 12:10 | - | |
| ASAP Looking for Any PM Acer $1000 or less/ | 2022-03-28 12:10 | - | |
| ASPIRE 573AZ Windows 7 takes time to be launched/ | 2022-03-28 12:11 | - | |
| ASPIRE 1522WLMi Athlon 64 3000+/ | 2022-03-28 12:10 | - | |
| ASPIRE 1690 specs BIG diff in AMERICAS/ | 2022-03-28 12:10 | - | |
| ASPIRE 1692 Screen Problem/ | 2022-03-28 12:10 | - | |
| ASPIRE 3003WLCI & ASPIRE 3503/ | 2022-03-28 12:10 | - | |
| ASPIRE 3690 shuts down automatically/ | 2022-03-28 12:10 | - | |
| ASPIRE 4715z Not Throttling After XP Install/ | 2022-03-28 12:10 | - | |
| ASPIRE 4720z BT Problem/ | 2022-03-28 12:10 | - | |
| ASPIRE5051 - really slow performance/ | 2022-03-28 12:11 | - | |
| ASPIRE 5100 BIG problem/ | 2022-03-28 12:10 | - | |
| ASPIRE 5100 Installing XP SP3 replace Vista/ | 2022-03-28 12:10 | - | |
| ASPIRE 5105 - Problem with the Sound Card (High Definition Audio)/ | 2022-03-28 12:10 | - | |
| ASPIRE 5315-2122 Which CPU for upgrade/ | 2022-03-28 12:10 | - | |
| ASPIRE 5315 BIOS RECOVERY using a USB THUMBDRIVE/ | 2022-03-28 12:10 | - | |
| ASPIRE 5315 XP DRIVERS (latest updates)/ | 2022-03-28 12:10 | - | |
| ASPIRE 5670 Duo core 1.66 mhz, 1 CPU shows 982hz speed/ | 2022-03-28 12:11 | - | |
| ASPIRE 5672 Best of Best Laptop Mag. 4 06/ | 2022-03-28 12:11 | - | |
| ASPIRE 5672 X1400 issue/ | 2022-03-28 12:11 | - | |
| ASPIRE 5715Z won't boot!/ | 2022-03-28 12:11 | - | |
| ASPIRE 5738G double click problem/ | 2022-03-28 12:11 | - | |
| ASPIRE 5920 Tread(Benchmark Results,HW & Software Issues,Q & A,Modifications)/ | 2022-03-28 12:11 | - | |
| ASPIRE 5920 owners - 8600m GT or GM what did you get!!!!/ | 2022-03-28 12:11 | - | |
| ASPIRE 6530G turn off by itself when watching a movie/ | 2022-03-28 12:11 | - | |
| ASPIRE 6920G INTEL core duo T8300/ | 2022-03-28 12:11 | - | |
| ASPIRE 7745G - Missing Bluetooth/ | 2022-03-28 12:11 | - | |
| ASPIRE 7745G Bluetooth mouse keeps stopping/ | 2022-03-28 12:11 | - | |
| ASPIRE 8930G CPU GPU upgrade/ | 2022-03-28 12:11 | - | |
| ASPIRE 8935G & Windows 7/ | 2022-03-28 12:11 | - | |
| ASPIRE ONE - WWAN options/ | 2022-03-28 12:11 | - | |
| AS Timeline 3810 TZ - Windows 7 - Displaybrightness !/ | 2022-03-28 12:10 | - | |
| ASUS G51J 3D -First 3D Vision Notebook/ | 2022-03-28 12:11 | - | |
| ASpire 3100 not running dual channel/ | 2022-03-28 12:10 | - | |
| ASpire 5520-5908 wireless problem. Please help/ | 2022-03-28 12:10 | - | |
| ASpire 8930 Problem/ | 2022-03-28 12:11 | - | |
| ATI 2evxx.exe problem/ | 2022-03-28 12:11 | - | |
| ATI 6.4's that work!/ | 2022-03-28 12:11 | - | |
| ATI 4379 Serial ATA Controller question/ | 2022-03-28 12:11 | - | |
| ATI 5650 and resolution downscaling for a program/ | 2022-03-28 12:11 | - | |
| ATI 5650 much worse than NV GT420M in 3DMark06 !/ | 2022-03-28 12:11 | - | |
| ATI 9700 128MB vs x600 64MB/ | 2022-03-28 12:11 | - | |
| ATI Catalyst 5.5/ | 2022-03-28 12:11 | - | |
| ATI Catalyst 6.11 drivers are out!/ | 2022-03-28 12:11 | - | |
| ATI Catalyst 6.12 in my Acer 5112/ | 2022-03-28 12:11 | - | |
| ATI Catalyst 10.12 possibly throttling 5650 @ GPU temp 75C/ | 2022-03-28 12:11 | - | |
| ATI Catalyst Control Center= i do not have rights to run that, HELP/ | 2022-03-28 12:11 | - | |
| ATI Driver Updating - Need help/ | 2022-03-28 12:11 | - | |
| ATI Drivers/ | 2022-03-28 12:11 | - | |
| ATI GPU Tool wont work/ | 2022-03-28 12:11 | - | |
| ATI HD5650 - 3dmark06 score!/ | 2022-03-28 12:11 | - | |
| ATI Mob driver x1300 for acer 5620 series/ | 2022-03-28 12:11 | - | |
| ATI Mobility Catalyst 6.12 Released/ | 2022-03-28 12:11 | - | |
| ATI Mobility Radeon X1600 Omega drivers/ | 2022-03-28 12:11 | - | |
| ATI Radeon 200m- Why can I get 256mb when it's advertised at 128mb/ | 2022-03-28 12:11 | - | |
| ATI Radeon HD4570/ | 2022-03-28 12:11 | - | |
| ATI X700 Mobility screen corruption/ | 2022-03-28 12:11 | - | |
| ATI X700 drivers/ | 2022-03-28 12:11 | - | |
| ATI X1400 bug in NHL 2007 and 2008/ | 2022-03-28 12:11 | - | |
| ATI x600 & Linux/ | 2022-03-28 12:11 | - | |
| ATI x700 mobility and Vista problem/ | 2022-03-28 12:11 | - | |
| AUO109B display owners, could you share EDID dump/ | 2022-03-28 12:11 | - | |
| AVAILABLE in APRIL - Acer Aspire V3 series feat. Ivy Bridge and NVIDIA Kepler discussion/ | 2022-03-28 12:11 | - | |
| AVI files/ | 2022-03-28 12:11 | - | |
| Aacer 7730 easy upgrade CPU RAM GPU and FAN!! advice needed/ | 2022-03-28 12:05 | - | |
| A and G wireless channels on 5002WLMi/ | 2022-03-28 12:05 | - | |
| A beginer's question about AC adapter/ | 2022-03-28 12:05 | - | |
| A better laptop/ | 2022-03-28 12:05 | - | |
| A bit of info needed/ | 2022-03-28 12:05 | - | |
| Abiword Disappeared!/ | 2022-03-28 12:05 | - | |
| About Acer Aspire 1661WLCi/ | 2022-03-28 12:06 | - | |
| About PDF visualisation/ | 2022-03-28 12:06 | - | |
| About Power Smart/ | 2022-03-28 12:06 | - | |
| About Serial Numbers/ | 2022-03-28 12:06 | - | |
| About acer aspire 4736,5738G,5739G/ | 2022-03-28 12:06 | - | |
| About acer ferrari 4005/ | 2022-03-28 12:06 | - | |
| About laptop LCD TFT screen change/ | 2022-03-28 12:06 | - | |
| About original disc windows XP/ | 2022-03-28 12:06 | - | |
| About partitions in Vista on an acer/ | 2022-03-28 12:06 | - | |
| About the HD movie on my Acer laptops/ | 2022-03-28 12:06 | - | |
| About to buy 5102, media center seemed really slow at store/ | 2022-03-28 12:06 | - | |
| About to replace Vista with XP 5920G/ | 2022-03-28 12:06 | - | |
| About to upgrade my 8920G CPU/ | 2022-03-28 12:06 | - | |
| A bunch of questions about the AS6920 series!/ | 2022-03-28 12:05 | - | |
| Abysmal performance on my Acer 4315/ | 2022-03-28 12:06 | - | |
| Ac adapter Noite/ | 2022-03-28 12:06 | - | |
| Ac adapter tip size/ | 2022-03-28 12:06 | - | |
| Accelerated Flash on 1410 1810T(Z), does it work for you/ | 2022-03-28 12:06 | - | |
| Accelerated hardware issues tips[Acer 7520 models]/ | 2022-03-28 12:06 | - | |
| Accer aspire 5002/ | 2022-03-28 12:06 | - | |
| Access Command Promt/ | 2022-03-28 12:06 | - | |
| Accessing BIOS of 5920G to change Boot Order/ | 2022-03-28 12:06 | - | |
| Accessing PQSERVICE hidden partition/ | 2022-03-28 12:06 | - | |
| Accessing files on an external drive/ | 2022-03-28 12:06 | - | |
| Access time issue. Advice please/ | 2022-03-28 12:06 | - | |
| Accidentally erased BIOS. how to recover/ | 2022-03-28 12:06 | - | |
| Ace 5672 - NHC configuration/ | 2022-03-28 12:06 | - | |
| Ace Aspire 6935g battery/ | 2022-03-28 12:06 | - | |
| Acer & AMD Turion64 ML MT/ | 2022-03-28 12:06 | - | |
| Acer & Bluetooth Generally How does it work/ | 2022-03-28 12:06 | - | |
| Acer's ATI control panel & aspect ratio/ | 2022-03-28 12:10 | - | |
| Acer's BIOS--they don't post most recent BIOS versions online/ | 2022-03-28 12:10 | - | |
| Acer's Bad Reputation/ | 2022-03-28 12:10 | - | |
| Acer's DASP--what does it really do/ | 2022-03-28 12:10 | - | |
| Acer's Elan Smartpad/ | 2022-03-28 12:10 | - | |
| Acer's Launchpad and other acer tools/ | 2022-03-28 12:10 | - | |
| Acer's New Logo/ | 2022-03-28 12:10 | - | |
| Acer's Quality and Lifespan/ | 2022-03-28 12:10 | - | |
| Acer's TM4400 series plans/ | 2022-03-28 12:10 | - | |
| Acer's TimelineX Replacement Almost Here/ | 2022-03-28 12:10 | - | |
| Acer's Upgrade Policy/ | 2022-03-28 12:10 | - | |
| Acer's branding---again! Acer Aspire 4745G-5462G64Mnks versus Acer Aspire TimelineX 4820TG-5462G64Mnks/ | 2022-03-28 12:10 | - | |
| Acer's built in Wireless Software/ | 2022-03-28 12:10 | - | |
| Acer's continued descent into blandness/ | 2022-03-28 12:10 | - | |
| Acer's new notebooks are incredibly ugly/ | 2022-03-28 12:10 | - | |
| Acer (AS 8930G), Wireless Network button dosen't work/ | 2022-03-28 12:06 | - | |
| Acer (Gateway) secondary hdd issue/ | 2022-03-28 12:06 | - | |
| Acer + Student Discount/ | 2022-03-28 12:06 | - | |
| Acer, 3820TG. PCI-Express running v1.1, how to change to v2.0/ | 2022-03-28 12:10 | - | |
| Acer, Vista and potential for upgrades/ | 2022-03-28 12:10 | - | |
| Acer, Wireless & Bluetooth/ | 2022-03-28 12:10 | - | |
| Acer, type of touch pad/ | 2022-03-28 12:10 | - | |
| Acer- 1.7 AMD Athlon II Neo vs 1.3 AMD Athlon II Neo dual-core/ | 2022-03-28 12:10 | - | |
| Acer - 5024 - News - Wheretobuy/ | 2022-03-28 12:06 | - | |
| Acer-AS59206470/ | 2022-03-28 12:10 | - | |
| Acer - Any real gaming laptops/ | 2022-03-28 12:06 | - | |
| Acer- Can't Install Driver Video under Vista 32 bit/ | 2022-03-28 12:10 | - | |
| Acer - Extensa 4210 Fan Problem/ | 2022-03-28 12:06 | - | |
| Acer- Policy on dead and stuck pixels/ | 2022-03-28 12:10 | - | |
| Acer- Reliable Innovation/ | 2022-03-28 12:10 | - | |
| Acer - TravelMate 4504LMi - Problem with CD DVR writer/ | 2022-03-28 12:06 | - | |
| Acer - Virtual Technology - Windows 7/ | 2022-03-28 12:06 | - | |
| Acer- What are you doing to Timeline Series/ | 2022-03-28 12:10 | - | |
| Acer - backup to ACERDATA partition - Please help me/ | 2022-03-28 12:06 | - | |
| Acer - faint clicking and grinding sounds/ | 2022-03-28 12:06 | - | |
| Acer-scr error/ | 2022-03-28 12:10 | - | |
| Acer- the worst company and computer/ | 2022-03-28 12:10 | - | |
| Acer- totally black screen/ | 2022-03-28 12:10 | - | |
| Acer/ | 2022-03-28 12:06 | - | |
| Acer 3 Year Extended Warranty/ | 2022-03-28 12:06 | - | |
| Acer 4 cell battery = deal breaker for Acer/ | 2022-03-28 12:06 | - | |
| Acer 12 cell battery/ | 2022-03-28 12:06 | - | |
| Acer 15.6in Timeline model CONFUSION/ | 2022-03-28 12:06 | - | |
| Acer 17 CrystalBrite light bleed/ | 2022-03-28 12:06 | - | |
| Acer 17 aspire 9300 - grapic card replacement/ | 2022-03-28 12:06 | - | |
| Acer 18.4 Laptops Refresh/ | 2022-03-28 12:06 | - | |
| Acer 18.4 laptops in USA/ | 2022-03-28 12:06 | - | |
| Acer 20XX and Standby problem -/ | 2022-03-28 12:06 | - | |
| Acer 110 power button always on/ | 2022-03-28 12:06 | - | |
| Acer 290 Keyboard replacement (HELP)/ | 2022-03-28 12:06 | - | |
| Acer 290 Wireless Issues/ | 2022-03-28 12:06 | - | |
| Acer 291LMi vs. 662LMi/ | 2022-03-28 12:06 | - | |
| Acer 521TEV BIOS UPDATE/ | 2022-03-28 12:06 | - | |
| Acer 522 - fan spins without reason/ | 2022-03-28 12:06 | - | |
| Acer 532h-2223 major problem/ | 2022-03-28 12:06 | - | |
| Acer 552-5686 always rebooting/ | 2022-03-28 12:06 | - | |
| Acer 721 1551 DOES NOT WORK with Intel x25-m/ | 2022-03-28 12:07 | - | |
| Acer 722 netbook - battery fluctuation/ | 2022-03-28 12:07 | - | |
| Acer 772G with Killer-N 1202 Compatiable/ | 2022-03-28 12:07 | - | |
| Acer 1350 powers up but won't boot (x 2!)/ | 2022-03-28 12:06 | - | |
| Acer 1350 starts up but won't POST/ | 2022-03-28 12:06 | - | |
| Acer 1350 wireless card won't connect/ | 2022-03-28 12:06 | - | |
| Acer 1355LC - Video Memory allocation/ | 2022-03-28 12:06 | - | |
| Acer 1362 WLMi - dead, black display, fast fan/ | 2022-03-28 12:06 | - | |
| Acer 1410 & Intel 5100 Wireless/ | 2022-03-28 12:06 | - | |
| Acer 1410, 1810, 1830 11.6 Sleeves, Bags and Cases thread/ | 2022-03-28 12:06 | - | |
| Acer 1410, 1810, 3810, 4810, 5810 Timeline Drivers, Software, Tweaks and Settings FAQ/ | 2022-03-28 12:06 | - | |
| Acer 1410-2285 Unexpected Error and restart/ | 2022-03-28 12:06 | - | |
| Acer 1410-2936 (SU2300) not working with cpu temp monitors/ | 2022-03-28 12:06 | - | |
| Acer 1410 - Resume on Lid Opening/ | 2022-03-28 12:06 | - | |
| Acer 1410- Should I get single or dual-core (ned quick advice!)/ | 2022-03-28 12:06 | - | |
| Acer 1410 - Should I install ePower Management/ | 2022-03-28 12:06 | - | |
| Acer 1410 - resume from sleep/ | 2022-03-28 12:06 | - | |
| Acer 1410 11,6 - loose hinges/ | 2022-03-28 12:06 | - | |
| Acer 1410 11.6 Wifi does not work connect. Help/ | 2022-03-28 12:06 | - | |
| Acer 1410 1810t 1810tz add 3g hsdpa wwan mod/ | 2022-03-28 12:06 | - | |
| Acer 1410 AC Power Adapter/ | 2022-03-28 12:06 | - | |
| Acer 1410 Can't adjust screen brightness once Windows 7 starts booting/ | 2022-03-28 12:06 | - | |
| Acer 1410 DIY Magnetic Power Adapter/ | 2022-03-28 12:06 | - | |
| Acer 1410 Gateway 1436u wireless adapter dead/ | 2022-03-28 12:06 | - | |
| Acer 1410 LCD screen replacement/ | 2022-03-28 12:06 | - | |
| Acer 1410 Ram Upgrade problem/ | 2022-03-28 12:06 | - | |
| Acer 1410 SU2300 Benchmarks with RAM & HDD Upgrades [surprising results!]/ | 2022-03-28 12:06 | - | |
| Acer 1410 Screen Flickering Issue/ | 2022-03-28 12:06 | - | |
| Acer 1410T Webcam/ | 2022-03-28 12:06 | - | |
| Acer 1410 VGA-Out and HDMI problem/ | 2022-03-28 12:06 | - | |
| Acer 1410 Warranty policy !!!/ | 2022-03-28 12:06 | - | |
| Acer 1410 and TV-Out through the VGA port/ | 2022-03-28 12:06 | - | |
| Acer 1410 and games/ | 2022-03-28 12:06 | - | |
| Acer 1410 capable of spdif 5.1 sound/ | 2022-03-28 12:06 | - | |
| Acer 1410 or 1810 Be able to run CS-Source TF2/ | 2022-03-28 12:06 | - | |
| Acer 1410 partial keyboard failure/ | 2022-03-28 12:06 | - | |
| Acer 1410 screen flicker/ | 2022-03-28 12:06 | - | |
| Acer 1410 screen problems after hibernation/ | 2022-03-28 12:06 | - | |
| Acer 1410 shutting off when back is hit/ | 2022-03-28 12:06 | - | |
| Acer 1410 with SU2300 - vcore/ | 2022-03-28 12:06 | - | |
| Acer 1414WLCI remove hard drive partition/ | 2022-03-28 12:06 | - | |
| Acer 1430Z 9 cell battery/ | 2022-03-28 12:06 | - | |
| Acer 1430Z keyboard dead/ | 2022-03-28 12:06 | - | |
| Acer 1500 (1501 1502), regular sound dropouts& fix/ | 2022-03-28 12:06 | - | |
| Acer 1501/ | 2022-03-28 12:06 | - | |
| Acer 1501LCe nightmare/ | 2022-03-28 12:06 | - | |
| Acer 1501LMi, TV out/ | 2022-03-28 12:06 | - | |
| Acer 1501LMi just randomly freezes/ | 2022-03-28 12:06 | - | |
| Acer 1551 mod BIOS/ | 2022-03-28 12:06 | - | |
| Acer 1551 wireless card upgrade/ | 2022-03-28 12:06 | - | |
| Acer 1640/ | 2022-03-28 12:06 | - | |
| Acer 1640 Problem/ | 2022-03-28 12:06 | - | |
| Acer 1640z Won't boot/ | 2022-03-28 12:06 | - | |
| Acer 1641 NWLMI vs ACER 4061/ | 2022-03-28 12:06 | - | |
| Acer 1642WLMi- a good choice/ | 2022-03-28 12:06 | - | |
| Acer 1652 Dual Boot XP Linux with Recovery/ | 2022-03-28 12:06 | - | |
| Acer 1652LMI/ | 2022-03-28 12:06 | - | |
| Acer 1661 WLC - noise level/ | 2022-03-28 12:06 | - | |
| Acer 1662WLMi VS 1681WLMi/ | 2022-03-28 12:06 | - | |
| Acer 1662WLMi benchmarks, first impression-]/ | 2022-03-28 12:06 | - | |
| Acer 1662WLMi review/ | 2022-03-28 12:06 | - | |
| Acer 1680 - S-Video out to TV - No Audio/ | 2022-03-28 12:06 | - | |
| Acer 1681/ | 2022-03-28 12:06 | - | |
| Acer 1681 Battery/ | 2022-03-28 12:06 | - | |
| Acer 1681WLCi screen glare/ | 2022-03-28 12:06 | - | |
| Acer 1681WLMi- windows prblm/ | 2022-03-28 12:06 | - | |
| Acer 1681 WLMi or Acer 1802 WSMi/ | 2022-03-28 12:06 | - | |
| Acer 1681WLmi vs Acer 1690WLmi/ | 2022-03-28 12:06 | - | |
| Acer 1681 laptop battery/ | 2022-03-28 12:06 | - | |
| Acer 1682 3WMli/ | 2022-03-28 12:06 | - | |
| Acer 1682 WLMi service hints/ | 2022-03-28 12:06 | - | |
| Acer 1682lmi battery/ | 2022-03-28 12:06 | - | |
| Acer 1683- boot from usb-disk/ | 2022-03-28 12:06 | - | |
| Acer 1683 WLMi - 4 way scroll button not working/ | 2022-03-28 12:06 | - | |
| Acer 1690 - Touchpad dead/ | 2022-03-28 12:06 | - | |
| Acer 1690 External Monitor/ | 2022-03-28 12:06 | - | |
| Acer 1690 Problem/ | 2022-03-28 12:06 | - | |
| Acer 1690 system crash/ | 2022-03-28 12:06 | - | |
| Acer 1691. fan working strange/ | 2022-03-28 12:06 | - | |
| Acer 1692WLMi - smart investment or not/ | 2022-03-28 12:06 | - | |
| Acer 1692WLMi problem/ | 2022-03-28 12:06 | - | |
| Acer 1692 with multiple problems/ | 2022-03-28 12:06 | - | |
| Acer 1694 Touchpad Not Working/ | 2022-03-28 12:06 | - | |
| Acer 1694WLMI - Battery and performance questions/ | 2022-03-28 12:06 | - | |
| Acer 1694 overheating/ | 2022-03-28 12:06 | - | |
| Acer 1710 Screen Went Dim/ | 2022-03-28 12:06 | - | |
| Acer 1711sci LCD problem/ | 2022-03-28 12:06 | - | |
| Acer 1714 Model Differences/ | 2022-03-28 12:06 | - | |
| Acer 1714SMi DDR400/ | 2022-03-28 12:06 | - | |
| Acer 1714SMi Motherboard/ | 2022-03-28 12:06 | - | |
| Acer 1714SMi Spin Down Solution/ | 2022-03-28 12:06 | - | |
| Acer 1802WSMi problems/ | 2022-03-28 12:06 | - | |
| Acer 1804 Power Light Flashing/ | 2022-03-28 12:06 | - | |
| Acer 1810- Question/ | 2022-03-28 12:06 | - | |
| Acer 1810T - Best webcam driver/ | 2022-03-28 12:06 | - | |
| Acer 1810T - Win Xp wlan driver problem/ | 2022-03-28 12:06 | - | |
| Acer 1810T 11.6 vs. Acer 3810T 13.3 ... A Flight Attendant's Confusion...!!!/ | 2022-03-28 12:06 | - | |
| Acer 1810T Dual Core Photos/ | 2022-03-28 12:06 | - | |
| Acer 1810T Timeline - Fried motherboard/ | 2022-03-28 12:06 | - | |
| Acer 1810TZ (Win7) & iPod Touch - working !/ | 2022-03-28 12:06 | - | |
| Acer 1810TZ- After the official upgrade from Vista to Win7 I can not find my bluetooth/ | 2022-03-28 12:06 | - | |
| Acer 1810TZ - webcam not working after clean Win7 install/ | 2022-03-28 12:06 | - | |
| Acer 1810TZ 3G Edition - Pictorial/ | 2022-03-28 12:06 | - | |
| Acer 1810TZ 11.6/ | 2022-03-28 12:06 | - | |
| Acer 1810 TZ Battery life slump/ | 2022-03-28 12:06 | - | |
| Acer 1810TZ Crumpler Sleeves/ | 2022-03-28 12:06 | - | |
| Acer 1810TZ Turn off wireless/ | 2022-03-28 12:06 | - | |
| Acer 1810T and .11n networking/ | 2022-03-28 12:06 | - | |
| Acer 1810T and 2 external monitors/ | 2022-03-28 12:06 | - | |
| Acer 1810T and Dell U2711 - 2560 x 1440 over hdmi possible/ | 2022-03-28 12:06 | - | |
| Acer 1810T battery discharge when laptop is off/ | 2022-03-28 12:06 | - | |
| Acer 1810T screen is locking up...!/ | 2022-03-28 12:06 | - | |
| Acer 1810tZ Powerpoint/ | 2022-03-28 12:06 | - | |
| Acer 1810tz Corsair Force Series 3 120GB poor battery life/ | 2022-03-28 12:06 | - | |
| Acer 1810tz harddrive failed (I think Help ). Also, which replacement HDDs SSDs fit with ZIF/ | 2022-03-28 12:06 | - | |
| Acer 1830T -- I need replacement screws/ | 2022-03-28 12:06 | - | |
| Acer 1830T Clock Generator (PLL) & CPU Change & Repaire Guide/ | 2022-03-28 12:06 | - | |
| Acer 1830t-68u118 Dim LED screen... need help/ | 2022-03-28 12:06 | - | |
| Acer 1830t will not boot/ | 2022-03-28 12:06 | - | |
| Acer 2000 questions/ | 2022-03-28 12:06 | - | |
| Acer 2000 v.s. Acer 2010/ | 2022-03-28 12:06 | - | |
| Acer 2003lmi Broken hinge/ | 2022-03-28 12:06 | - | |
| Acer 2010 Fan Noise/ | 2022-03-28 12:06 | - | |
| Acer 2010 Series/ | 2022-03-28 12:06 | - | |
| Acer 2012, 2025 or 8006/ | 2022-03-28 12:06 | - | |
| Acer2012 Problems on Battery Only. Help!/ | 2022-03-28 12:10 | - | |
| Acer 2012 Replacement/ | 2022-03-28 12:06 | - | |
| Acer 2012 WLCI video problem, please help/ | 2022-03-28 12:06 | - | |
| Acer 2012 WLCi Laptop/ | 2022-03-28 12:06 | - | |
| Acer 2012WLMI - Where cheapest to buy in UK/ | 2022-03-28 12:06 | - | |
| Acer 2012WLMi and Mat a UJ-820S/ | 2022-03-28 12:06 | - | |
| Acer 2020/ | 2022-03-28 12:06 | - | |
| Acer 2023 vs Sony Vaio GRT 916V/ | 2022-03-28 12:06 | - | |
| Acer 2025 2026/ | 2022-03-28 12:06 | - | |
| Acer 2025 Anandtech review/ | 2022-03-28 12:06 | - | |
| Acer 2300 Series COMPARISONS/ | 2022-03-28 12:06 | - | |
| Acer 2303- Cool and Quiet/ | 2022-03-28 12:06 | - | |
| Acer 2403WXCi What do you think/ | 2022-03-28 12:06 | - | |
| Acer 2441NWXCi budget laptop/ | 2022-03-28 12:06 | - | |
| Acer 2480 sound not coming out of audio jack/ | 2022-03-28 12:06 | - | |
| Acer 2490 travel mate display problem/ | 2022-03-28 12:06 | - | |
| Acer 2492 NWLMI/ | 2022-03-28 12:06 | - | |
| Acer 2501 cardbus problem/ | 2022-03-28 12:06 | - | |
| Acer 2920/ | 2022-03-28 12:06 | - | |
| Acer 2920 Gemstone Graphics problem/ | 2022-03-28 12:06 | - | |
| Acer 2920Z Inverter Problem (pics inside)/ | 2022-03-28 12:06 | - | |
| Acer 2920z (T2310 1.4ghz) possible CPU upgrade to T7300/ | 2022-03-28 12:06 | - | |
| Acer 2920z Audio not working/ | 2022-03-28 12:06 | - | |
| Acer 2930 - Help Me decide/ | 2022-03-28 12:06 | - | |
| Acer 2930 VT-x/ | 2022-03-28 12:06 | - | |
| Acer 2930Z Service Guide CPU Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 2930z/ | 2022-03-28 12:06 | - | |
| Acer 3000 5000 need bootable system recover cd/ | 2022-03-28 12:06 | - | |
| Acer 3000 A C Adapter/ | 2022-03-28 12:06 | - | |
| Acer 3000 Battery/ | 2022-03-28 12:06 | - | |
| Acer 3000 Series startup problem/ | 2022-03-28 12:06 | - | |
| Acer 3000 erecovery problem/ | 2022-03-28 12:06 | - | |
| Acer 3000 screen replacement/ | 2022-03-28 12:06 | - | |
| Acer 3002 Add-On Battery/ | 2022-03-28 12:06 | - | |
| Acer 3002CLi Heat problem/ | 2022-03-28 12:06 | - | |
| Acer 3002Lci bios problems.. Dead laptop. HELP/ | 2022-03-28 12:06 | - | |
| Acer 3002 Upgrades/ | 2022-03-28 12:06 | - | |
| Acer 3003WLCi display question/ | 2022-03-28 12:06 | - | |
| Acer 3003WLCi idle temperature/ | 2022-03-28 12:06 | - | |
| Acer 3003WLCi upgrade/ | 2022-03-28 12:06 | - | |
| Acer 3003 no Keyboard or touchpad/ | 2022-03-28 12:06 | - | |
| Acer 3003wlci quick question/ | 2022-03-28 12:06 | - | |
| Acer 3020 does not read my SDHC card/ | 2022-03-28 12:06 | - | |
| Acer 3023 Sempron 3000+ problem CPU-Z/ | 2022-03-28 12:06 | - | |
| Acer 3023WLMi problems/ | 2022-03-28 12:06 | - | |
| Acer 3023 and USB speed/ | 2022-03-28 12:06 | - | |
| Acer 3023wlmi getting hot!/ | 2022-03-28 12:06 | - | |
| Acer 3050-1150 upgrade to 64-bit vista/ | 2022-03-28 12:06 | - | |
| Acer 3050-1594 CPU Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 3050 ... 533 or 667 RAM/ | 2022-03-28 12:06 | - | |
| Acer 3050 Battery/ | 2022-03-28 12:06 | - | |
| Acer 3050 Downgrade to XP From Vista/ | 2022-03-28 12:06 | - | |
| Acer 3053wxci/ | 2022-03-28 12:06 | - | |
| Acer 3054 - Win xp drivers/ | 2022-03-28 12:06 | - | |
| Acer 3100 5100 Motherboard Repair video/ | 2022-03-28 12:06 | - | |
| Acer 3100 Series Usb Problems/ | 2022-03-28 12:06 | - | |
| Acer 3100 Wireless adapter NOT FOUND in Device Manager/ | 2022-03-28 12:06 | - | |
| Acer 3100 vs 5100/ | 2022-03-28 12:06 | - | |
| Acer 3200 Service Manual/ | 2022-03-28 12:06 | - | |
| Acer 3200 series Pictures/ | 2022-03-28 12:06 | - | |
| Acer 3200 touchpad not working/ | 2022-03-28 12:06 | - | |
| Acer 3201, 3-1 multidisc/ | 2022-03-28 12:06 | - | |
| Acer 3201Xci Questions/ | 2022-03-28 12:06 | - | |
| Acer 3201 owners, your advice please!/ | 2022-03-28 12:06 | - | |
| Acer 3201xci and XP Pro logical drive/ | 2022-03-28 12:06 | - | |
| Acer 3201xci battery 8 cell yet/ | 2022-03-28 12:06 | - | |
| Acer 3203xmi/ | 2022-03-28 12:06 | - | |
| Acer 3282/ | 2022-03-28 12:06 | - | |
| Acer 3290 Series/ | 2022-03-28 12:06 | - | |
| Acer 3502 mother board crash.Help retrive data/ | 2022-03-28 12:06 | - | |
| Acer 3610 (3614WLMi) CPU Options/ | 2022-03-28 12:06 | - | |
| Acer 3610 boot problem/ | 2022-03-28 12:06 | - | |
| Acer 3620 Parts/ | 2022-03-28 12:06 | - | |
| Acer 3620 fan noise/ | 2022-03-28 12:06 | - | |
| Acer 3620 windows lagging seriusly after adding ram/ | 2022-03-28 12:06 | - | |
| Acer 3623-100 Media Markt Germany Problems!/ | 2022-03-28 12:06 | - | |
| Acer 3630 Hard Drive upgrade/ | 2022-03-28 12:06 | - | |
| Acer 3651 Audio Problem/ | 2022-03-28 12:06 | - | |
| Acer 3660 series-sound stuttering- need bios upgrade/ | 2022-03-28 12:06 | - | |
| Acer 3680-2633- Major Problem!/ | 2022-03-28 12:06 | - | |
| Acer 3680-2633 Celeron M 520 cpu, Memrom-L or older model/ | 2022-03-28 12:06 | - | |
| Acer 3680-2682 RAM Memory Help/ | 2022-03-28 12:06 | - | |
| Acer 3680 - No power boot on AC, battery failure/ | 2022-03-28 12:06 | - | |
| Acer 3680- just bought a 1.73ghz Celeron Proc/ | 2022-03-28 12:06 | - | |
| Acer 3680 - very faint, then black screen/ | 2022-03-28 12:06 | - | |
| Acer 3680- what HD to upgrade to/ | 2022-03-28 12:06 | - | |
| Acer 3680 .. screen damage/ | 2022-03-28 12:06 | - | |
| Acer 3680 3682 BIOS Currupted/ | 2022-03-28 12:06 | - | |
| Acer 3680 Battery life/ | 2022-03-28 12:06 | - | |
| Acer 3680 HD Upgrade..WOW!/ | 2022-03-28 12:06 | - | |
| Acer 3680 Hard drive issue/ | 2022-03-28 12:06 | - | |
| Acer 3680 Keyboard/ | 2022-03-28 12:06 | - | |
| Acer 3680 Laptop Battery Issue/ | 2022-03-28 12:06 | - | |
| Acer 3680 Occasionally Fails to Boot/ | 2022-03-28 12:06 | - | |
| Acer 3680 RAM question/ | 2022-03-28 12:06 | - | |
| Acer 3680 SSD Options/ | 2022-03-28 12:06 | - | |
| Acer 3680 Sound Problems/ | 2022-03-28 12:06 | - | |
| Acer 3680 Speaker/ | 2022-03-28 12:06 | - | |
| Acer 3680 Upgraded to T5200/ | 2022-03-28 12:06 | - | |
| Acer 3680 anyone think the keyboard sucks/ | 2022-03-28 12:06 | - | |
| Acer 3680 can't read SDHC cards/ | 2022-03-28 12:06 | - | |
| Acer 3680 format issue/ | 2022-03-28 12:06 | - | |
| Acer 3680 grinding buzzing sound at power-on/ | 2022-03-28 12:06 | - | |
| Acer 3680 owners - Check your BIOS if you upgrade your RAM/ | 2022-03-28 12:06 | - | |
| Acer 3680 power battery issue/ | 2022-03-28 12:06 | - | |
| Acer 3680 problems/ | 2022-03-28 12:06 | - | |
| Acer 3680 recovery help/ | 2022-03-28 12:06 | - | |
| Acer 3680 resource disk/ | 2022-03-28 12:06 | - | |
| Acer 3680 still Dead after DC USB board replacement..HELP/ | 2022-03-28 12:06 | - | |
| Acer 3680 ~ no internal or external video/ | 2022-03-28 12:06 | - | |
| Acer 3690 - wireless range problem/ | 2022-03-28 12:06 | - | |
| Acer 3690 BSOD'ing when launching games (Vista)/ | 2022-03-28 12:06 | - | |
| Acer 3690 Fan issues/ | 2022-03-28 12:06 | - | |
| Acer 3690 Hard drive and Empowering tech issues/ | 2022-03-28 12:06 | - | |
| Acer 3690 LCD off but laptop still on/ | 2022-03-28 12:06 | - | |
| Acer 3690 cpu upgrade/ | 2022-03-28 12:06 | - | |
| Acer 3690 screen shrunk/ | 2022-03-28 12:06 | - | |
| Acer 3810 (500gb) question/ | 2022-03-28 12:06 | - | |
| Acer 3810 Battery Life Problems/ | 2022-03-28 12:06 | - | |
| Acer 3810 No WIN 7 CD/ | 2022-03-28 12:06 | - | |
| Acer 3810 Replacement Palm Rest/ | 2022-03-28 12:06 | - | |
| Acer 3810T + Xpal energizer XP8000 external battery/ | 2022-03-28 12:06 | - | |
| Acer 3810T, windows 7, wakeup issue/ | 2022-03-28 12:06 | - | |
| Acer 3810T - erecovery error - hdd config not set to factory default/ | 2022-03-28 12:06 | - | |
| Acer 3810T - reduce size of Acer erecovery image/ | 2022-03-28 12:06 | - | |
| Acer 3810T Battery discharges/ | 2022-03-28 12:06 | - | |
| Acer 3810T Fan issue/ | 2022-03-28 12:06 | - | |
| Acer 3810TG-944G50n - Made a complete mess!/ | 2022-03-28 12:06 | - | |
| Acer 3810TG Battery Problem/ | 2022-03-28 12:06 | - | |
| Acer 3810TG External Monitor Help Please/ | 2022-03-28 12:06 | - | |
| Acer 3810TG installation problem/ | 2022-03-28 12:06 | - | |
| Acer 3810TZ Fan Always On/ | 2022-03-28 12:06 | - | |
| Acer 3810TZG 1080P MKV and 10.1 Flash/ | 2022-03-28 12:06 | - | |
| Acer 3810TZ VideoCard Problem/ | 2022-03-28 12:06 | - | |
| Acer 3810T wont boot up/ | 2022-03-28 12:06 | - | |
| Acer 3810 different batteries/ | 2022-03-28 12:06 | - | |
| Acer 3810t HDMI problem under Windows 7/ | 2022-03-28 12:06 | - | |
| Acer 3810t Screen Problem/ | 2022-03-28 12:06 | - | |
| Acer 3810t battery led light problems! help please/ | 2022-03-28 12:06 | - | |
| Acer 3810tg and windows 7 problems/ | 2022-03-28 12:06 | - | |
| Acer 3810t won't turn on/ | 2022-03-28 12:06 | - | |
| Acer 3810tz backlight problem/ | 2022-03-28 12:06 | - | |
| Acer 3810 with dual-core proc. reduced batt life/ | 2022-03-28 12:06 | - | |
| Acer 3810 with or without HD4330 graphic card/ | 2022-03-28 12:06 | - | |
| Acer 3820T (or TG) bluetooth install success/ | 2022-03-28 12:06 | - | |
| Acer 3820TG's display does not work/ | 2022-03-28 12:06 | - | |
| Acer 3820TG Batteries/ | 2022-03-28 12:06 | - | |
| Acer 3820TG North America Purchase Options/ | 2022-03-28 12:06 | - | |
| Acer 3820TG Replacement Power Brick/ | 2022-03-28 12:06 | - | |
| Acer 3820TG Sandy Bridge replacement/ | 2022-03-28 12:06 | - | |
| Acer 3820TG create factory default disk/ | 2022-03-28 12:06 | - | |
| Acer 3820TG gaming experience/ | 2022-03-28 12:06 | - | |
| Acer 3820TG i3 vs i5 versions - Battery Life/ | 2022-03-28 12:06 | - | |
| Acer 3820TG or 4820TG with HD5650 in Canada/ | 2022-03-28 12:06 | - | |
| Acer 3820TG or Gateway ID49C/ | 2022-03-28 12:06 | - | |
| Acer 3820TG random sound skipping/ | 2022-03-28 12:06 | - | |
| Acer 3820TG vs 4820TG/ | 2022-03-28 12:06 | - | |
| Acer 3820 TG wifi problem/ | 2022-03-28 12:06 | - | |
| Acer 3820TG windows won't see hdd/ | 2022-03-28 12:06 | - | |
| Acer 3820TG with an ATI 5650 - how to import to UK/ | 2022-03-28 12:06 | - | |
| Acer 3820tg- Lenovo screen replacement/ | 2022-03-28 12:06 | - | |
| Acer 3820tg - Replace LCD/ | 2022-03-28 12:06 | - | |
| Acer 3820tg is not starting up/ | 2022-03-28 12:06 | - | |
| Acer 3820tg not starting/ | 2022-03-28 12:06 | - | |
| Acer 3820tg ram ugrade/ | 2022-03-28 12:06 | - | |
| Acer 3820tg thermal grease replacment/ | 2022-03-28 12:06 | - | |
| Acer3820tg won't boot! HELP!!!/ | 2022-03-28 12:10 | - | |
| Acer 3830TG- SSD corrupted after changing HDD/ | 2022-03-28 12:06 | - | |
| Acer 3830 keyboard for 3820/ | 2022-03-28 12:06 | - | |
| Acer 3935, Backlit keyboard/ | 2022-03-28 12:06 | - | |
| Acer 3935/ | 2022-03-28 12:06 | - | |
| Acer 3935 2.5 harddrive removal/ | 2022-03-28 12:06 | - | |
| Acer 3935 Wifi Bluetooth repeatedly turning off and on. SOLVED/ | 2022-03-28 12:06 | - | |
| Acer 3935 question and potential problem ( )/ | 2022-03-28 12:06 | - | |
| Acer 4000 Price Check anyone/ | 2022-03-28 12:06 | - | |
| Acer 4000 vs 4500/ | 2022-03-28 12:06 | - | |
| Acer 4001- only one usb 2.0/ | 2022-03-28 12:06 | - | |
| Acer 4001LCi won't load windows/ | 2022-03-28 12:06 | - | |
| Acer 4001WLMI vs Asus M6N vs Acer 372TCI/ | 2022-03-28 12:06 | - | |
| Acer 4001wlci Options Purchase/ | 2022-03-28 12:06 | - | |
| Acer 4002WLMI GPS MOUSE USB problem/ | 2022-03-28 12:06 | - | |
| Acer 4002 or 4502 (what about the screen)/ | 2022-03-28 12:06 | - | |
| Acer 4020 series/ | 2022-03-28 12:06 | - | |
| Acer 4072 NWLMi/ | 2022-03-28 12:06 | - | |
| Acer 4150 CPU fan always run on AC power/ | 2022-03-28 12:06 | - | |
| Acer 4220 Keyboard Issues/ | 2022-03-28 12:06 | - | |
| Acer 4222WLMI sound problems,please help/ | 2022-03-28 12:06 | - | |
| Acer 4230 Travelmate CPU upgrade options/ | 2022-03-28 12:06 | - | |
| Acer 4310 dead monitor, can't activate external/ | 2022-03-28 12:06 | - | |
| Acer 4315's screen has gone all weird. HELP/ | 2022-03-28 12:06 | - | |
| Acer 4315-2004 Cpu Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 4315-2963 Shows GM965 Chipset in CPU-Z/ | 2022-03-28 12:06 | - | |
| Acer 4315 - BIOS Power Check Error/ | 2022-03-28 12:06 | - | |
| Acer 4315 - How do I reset the Cmos (Setup) Password/ | 2022-03-28 12:06 | - | |
| Acer 4315 2x1GB support only/ | 2022-03-28 12:06 | - | |
| Acer 4315 BIOS v1.18 download. Where/ | 2022-03-28 12:06 | - | |
| Acer 4315 Crashes/ | 2022-03-28 12:06 | - | |
| Acer 4315 Internet signal light is off/ | 2022-03-28 12:06 | - | |
| Acer 4315 Screen Issue/ | 2022-03-28 12:06 | - | |
| Acer 4315 WLAN not working/ | 2022-03-28 12:06 | - | |
| Acer 4315 help in diagnosis please/ | 2022-03-28 12:06 | - | |
| Acer 4402/ | 2022-03-28 12:06 | - | |
| Acer 4402 Problem in Games/ | 2022-03-28 12:06 | - | |
| Acer 4404 - [weird] goes to standby by itself then goes dead (but not completely )/ | 2022-03-28 12:06 | - | |
| Acer 4420-5239 Wifi help/ | 2022-03-28 12:06 | - | |
| Acer 4420-5847 + Video Card Question/ | 2022-03-28 12:06 | - | |
| Acer 4420-5963/ | 2022-03-28 12:06 | - | |
| Acer 4420 x64 Upgrade issues/ | 2022-03-28 12:06 | - | |
| Acer 4500 Avatar added/ | 2022-03-28 12:06 | - | |
| Acer 4500 Live pics/ | 2022-03-28 12:06 | - | |
| Acer 4501 Bluetooth/ | 2022-03-28 12:06 | - | |
| Acer 4502lmi lasted 4.5 days/ | 2022-03-28 12:06 | - | |
| Acer 4520 Shuts down while playing any video file/ | 2022-03-28 12:06 | - | |
| Acer 4520 cannot boot!/ | 2022-03-28 12:06 | - | |
| Acer 4520 dvd writer not detected/ | 2022-03-28 12:06 | - | |
| Acer 4520g Black screen..nothing but black screen/ | 2022-03-28 12:06 | - | |
| Acer 4530 GPU constantly in the upper 60s C and above/ | 2022-03-28 12:06 | - | |
| Acer 4540 comptability/ | 2022-03-28 12:06 | - | |
| Acer 4601Lci OR Asus A3800G/ | 2022-03-28 12:06 | - | |
| Acer 4620-4605 & Crystal Eye Web Cam/ | 2022-03-28 12:06 | - | |
| Acer 4620Z bios upgrades not working/ | 2022-03-28 12:06 | - | |
| Acer 4620 and the latest Zonealarm/ | 2022-03-28 12:06 | - | |
| Acer 4650G, APU Llano Notebook/ | 2022-03-28 12:06 | - | |
| Acer 4672LMI-- Dual Core new machine/ | 2022-03-28 12:06 | - | |
| Acer 4674 series -Any reviews/ | 2022-03-28 12:06 | - | |
| Acer 4710 Home Vista Wireless Lan Problems/ | 2022-03-28 12:06 | - | |
| Acer 4710 Keyboard Touchpad Freeze/ | 2022-03-28 12:06 | - | |
| Acer 4710Z audio stutter/ | 2022-03-28 12:06 | - | |
| Acer 4710g Drivers/ | 2022-03-28 12:06 | - | |
| Acer 4715z Service manual/ | 2022-03-28 12:06 | - | |
| Acer 4715z and XP/ | 2022-03-28 12:06 | - | |
| Acer 4720G upgraded, but now I want more!/ | 2022-03-28 12:06 | - | |
| Acer 4720z, what cpu supports/ | 2022-03-28 12:06 | - | |
| Acer 4736/ | 2022-03-28 12:06 | - | |
| Acer 4743G w nvidia 540M and amazing cooling/ | 2022-03-28 12:06 | - | |
| Acer 4750g GT 540m Stutter problem/ | 2022-03-28 12:06 | - | |
| Acer 4750 lost recovery partition/ | 2022-03-28 12:06 | - | |
| Acer 4752G- Boot screen hangs; Cannot enter bios setup boot menu/ | 2022-03-28 12:06 | - | |
| Acer 4755g No Turbo Boost/ | 2022-03-28 12:06 | - | |
| Acer 4801T internet problems/ | 2022-03-28 12:06 | - | |
| Acer 4810T-8480.. Sim slot/ | 2022-03-28 12:06 | - | |
| Acer 4810T-8480 USB port current draw/ | 2022-03-28 12:06 | - | |
| Acer 4810T DMI Utility Needed/ | 2022-03-28 12:06 | - | |
| Acer 4810TZ - Lines flashing on screen/ | 2022-03-28 12:06 | - | |
| Acer 4810TZ- Power management question/ | 2022-03-28 12:06 | - | |
| Acer 4810TZ/ | 2022-03-28 12:06 | - | |
| Acer 4810TZG Noise/ | 2022-03-28 12:06 | - | |
| Acer 4810TZG issues/ | 2022-03-28 12:06 | - | |
| Acer 4810TZ Internals/ | 2022-03-28 12:06 | - | |
| Acer 4810TZ Power Button Question/ | 2022-03-28 12:06 | - | |
| Acer 4810TZ screen brightness XP pro/ | 2022-03-28 12:06 | - | |
| Acer 4810T drive D problem/ | 2022-03-28 12:06 | - | |
| Acer 4810T volume key not working anymore/ | 2022-03-28 12:06 | - | |
| Acer 4810tz screen problem/ | 2022-03-28 12:06 | - | |
| Acer 4810 vs 3810/ | 2022-03-28 12:06 | - | |
| Acer 4820T Distorted crackly sound/ | 2022-03-28 12:06 | - | |
| Acer 4820TG-6847 vs ASUS U41JF-A1/ | 2022-03-28 12:06 | - | |
| Acer 4820TG - Good or bad temps/ | 2022-03-28 12:06 | - | |
| Acer 4820TG - Standby Problems/ | 2022-03-28 12:06 | - | |
| Acer 4820TG-Windows on VirtualBox/ | 2022-03-28 12:06 | - | |
| Acer 4820TG - change cpu/ | 2022-03-28 12:06 | - | |
| Acer 4820TG DVD drive problems/ | 2022-03-28 12:06 | - | |
| Acer 4820TG Issue!/ | 2022-03-28 12:06 | - | |
| Acer 4820TG Launch Manager won't start on Win7/ | 2022-03-28 12:06 | - | |
| Acer 4820TG Vs Hp dv6 3032TX/ | 2022-03-28 12:06 | - | |
| Acer 4820 TG and International warranty extension/ | 2022-03-28 12:06 | - | |
| Acer 4820TG and external monitor problem/ | 2022-03-28 12:06 | - | |
| Acer 4820TG high temperature/ | 2022-03-28 12:06 | - | |
| Acer 4820TG not booting!/ | 2022-03-28 12:06 | - | |
| Acer 4820TG switching out hd questions/ | 2022-03-28 12:06 | - | |
| Acer 4820tg Fan Random turns on/ | 2022-03-28 12:06 | - | |
| Acer 4820tg i7 640m - what clockgen/ | 2022-03-28 12:06 | - | |
| Acer 4820t graphics help/ | 2022-03-28 12:06 | - | |
| Acer 4830TG Trade Question/ | 2022-03-28 12:06 | - | |
| Acer 4830T Scrolling Not Working/ | 2022-03-28 12:06 | - | |
| Acer 4830T loose power jack/ | 2022-03-28 12:06 | - | |
| Acer 4830tg teardown images/ | 2022-03-28 12:06 | - | |
| Acer 4920 !20Gb HD/ | 2022-03-28 12:06 | - | |
| Acer 4920- Activation backup & restore/ | 2022-03-28 12:06 | - | |
| Acer 4920 - change of graphic card/ | 2022-03-28 12:06 | - | |
| Acer 4920 Hard Drive 'ticking' (Hitachi 5k250)/ | 2022-03-28 12:06 | - | |
| Acer 4930 Problem/ | 2022-03-28 12:06 | - | |
| Acer 4937g/ | 2022-03-28 12:06 | - | |
| Acer 5000 excessive loud fan noise/ | 2022-03-28 12:06 | - | |
| Acer 5002WLMI out! in Canada/ | 2022-03-28 12:06 | - | |
| Acer 5002WLMi - Why Fat 32/ | 2022-03-28 12:06 | - | |
| Acer 5002 Wlmi Radom reboots crashing/ | 2022-03-28 12:06 | - | |
| Acer 5002 and DVD RW - problem burning DVDs/ | 2022-03-28 12:06 | - | |
| Acer 5002 and TV-out/ | 2022-03-28 12:06 | - | |
| Acer 5002wlmi service manual/ | 2022-03-28 12:06 | - | |
| Acer 5003 WMLI Help/ | 2022-03-28 12:06 | - | |
| Acer 5004WLMi/ | 2022-03-28 12:06 | - | |
| Acer 5004 Whirring Noise/ | 2022-03-28 12:06 | - | |
| Acer 5020!/ | 2022-03-28 12:06 | - | |
| Acer 5020 in the US/ | 2022-03-28 12:06 | - | |
| Acer 5021/ | 2022-03-28 12:06 | - | |
| Acer 5022- Is it possible to adjust fan speed manually/ | 2022-03-28 12:06 | - | |
| Acer 5024 Firewire/ | 2022-03-28 12:06 | - | |
| Acer 5024 High Temperatures/ | 2022-03-28 12:06 | - | |
| Acer 5024 WLMI Performance Problem under Windows XP Pro/ | 2022-03-28 12:06 | - | |
| Acer 5024and Ati x700/ | 2022-03-28 12:06 | - | |
| Acer 5050-3371/ | 2022-03-28 12:06 | - | |
| Acer 5050 - Locking up Freezing/ | 2022-03-28 12:06 | - | |
| Acer 5050 HDD upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5050 charging problems/ | 2022-03-28 12:06 | - | |
| Acer 5050 no LCD video/ | 2022-03-28 12:06 | - | |
| Acer 5050 problems with WoW/ | 2022-03-28 12:06 | - | |
| Acer 5050 without battery/ | 2022-03-28 12:06 | - | |
| Acer 5051 Sound Problems/ | 2022-03-28 12:06 | - | |
| Acer 5072Wlmi Side buttons not working/ | 2022-03-28 12:06 | - | |
| Acer 5100-3357/ | 2022-03-28 12:06 | - | |
| Acer 5100-3357 Hibernation Problem - Help!/ | 2022-03-28 12:06 | - | |
| Acer 5100-3357 Partitions Question/ | 2022-03-28 12:06 | - | |
| Acer 5100-3357 from Circuit City/ | 2022-03-28 12:06 | - | |
| Acer 5100-3357 live messenger constantly crashes/ | 2022-03-28 12:06 | - | |
| Acer 5100-5400 vista graphics rating/ | 2022-03-28 12:06 | - | |
| Acer 5100-5674 Realtek RL8139(X) 8130 810X PCI Fast Ethernet Controller V 2.13 (020326)/ | 2022-03-28 12:06 | - | |
| Acer 5100-5674 Webcam Driver/ | 2022-03-28 12:06 | - | |
| Acer 5100-5830 and Internal Bluetooth module/ | 2022-03-28 12:06 | - | |
| Acer 5100 AMD Turion SLOW/ | 2022-03-28 12:06 | - | |
| Acer 5100 BL-51 CMOS battery location/ | 2022-03-28 12:06 | - | |
| Acer 5100 CPU help required - Please -)/ | 2022-03-28 12:06 | - | |
| Acer 5100 Can Use Both 11.1V and 14.8V Battery/ | 2022-03-28 12:06 | - | |
| Acer 5100 Error - Resource Conflict PCI in slot 03/ | 2022-03-28 12:06 | - | |
| Acer 5100 Keyboard Problem/ | 2022-03-28 12:06 | - | |
| Acer 5100 PQSERVICE does not boot/ | 2022-03-28 12:06 | - | |
| Acer 5100 Restore Failure Oxa0000002/ | 2022-03-28 12:06 | - | |
| Acer 5100 Touchpad Dead/ | 2022-03-28 12:06 | - | |
| Acer 5100 Turion X2 (TL-58) upgrade issue/ | 2022-03-28 12:06 | - | |
| Acer 5100 USB problem/ | 2022-03-28 12:06 | - | |
| Acer 5100 Vista back to XP - Orbicam/ | 2022-03-28 12:06 | - | |
| Acer 5100 Vista to xp NEED HELP PLZ!/ | 2022-03-28 12:06 | - | |
| Acer 5100 Wireless Connection Problem/ | 2022-03-28 12:06 | - | |
| Acer 5100 fixes itself on trip to Temple Help! Please/ | 2022-03-28 12:06 | - | |
| Acer 5100 format/ | 2022-03-28 12:06 | - | |
| Acer 5100 hangs during the Welcome screen of windows XP/ | 2022-03-28 12:06 | - | |
| Acer 5100 may part out/ | 2022-03-28 12:06 | - | |
| Acer 5100 not booting XP/ | 2022-03-28 12:06 | - | |
| Acer5100 not reading DVD´S well/ | 2022-03-28 12:10 | - | |
| Acer 5100 orbicam issue/ | 2022-03-28 12:06 | - | |
| Acer 5100 problem/ | 2022-03-28 12:06 | - | |
| Acer 5100 re-format/ | 2022-03-28 12:06 | - | |
| Acer 5100 running out of memory/ | 2022-03-28 12:06 | - | |
| Acer 5100 vista driver/ | 2022-03-28 12:06 | - | |
| Acer 5100 won't boot xp/ | 2022-03-28 12:06 | - | |
| Acer 5100 x86 only basic drivers available/ | 2022-03-28 12:06 | - | |
| Acer 5101, FAT32 or NTFS/ | 2022-03-28 12:06 | - | |
| Acer 5101 - Slow booting of Windows XPMCE/ | 2022-03-28 12:06 | - | |
| Acer 5101 - Why are there screws missing from my fan/ | 2022-03-28 12:06 | - | |
| Acer 5101 LCD problem/ | 2022-03-28 12:06 | - | |
| Acer 5101 USB ports dead/ | 2022-03-28 12:06 | - | |
| Acer 5101 not charging when on/ | 2022-03-28 12:06 | - | |
| Acer 5101 problem/ | 2022-03-28 12:06 | - | |
| Acer 5102 + ATI Catalyst 6.10 != not recognized/ | 2022-03-28 12:06 | - | |
| Acer 5102- eTechnology apps not runnning anymore/ | 2022-03-28 12:06 | - | |
| Acer 5102 - system hangs/ | 2022-03-28 12:06 | - | |
| Acer 5102/ | 2022-03-28 12:06 | - | |
| Acer 5102 Battery/ | 2022-03-28 12:06 | - | |
| Acer 5102 Chipset Display Driver Problem/ | 2022-03-28 12:06 | - | |
| Acer 5102 System Restore without disks/ | 2022-03-28 12:06 | - | |
| Acer 5102 WLMI/ | 2022-03-28 12:06 | - | |
| Acer 5102WLMI and Linux/ | 2022-03-28 12:06 | - | |
| Acer 5102WLMi - How do I restore the factory settings without the restore CD/ | 2022-03-28 12:06 | - | |
| Acer 5102WLMi Disk Image/ | 2022-03-28 12:06 | - | |
| Acer 5102WLMi Extra Power Adapter/ | 2022-03-28 12:06 | - | |
| Acer 5102 WLMi ModemDriver Error !/ | 2022-03-28 12:06 | - | |
| Acer 5102WLMi Wireless Adapter/ | 2022-03-28 12:06 | - | |
| Acer 5102Wlmi's DVD-CDRW.... support/ | 2022-03-28 12:06 | - | |
| Acer 5102 Wlmi Sound bad !!!!!/ | 2022-03-28 12:06 | - | |
| Acer 5102 and Win 7/ | 2022-03-28 12:06 | - | |
| Acer 5102 partition problem/ | 2022-03-28 12:06 | - | |
| Acer 5102 vid card/ | 2022-03-28 12:06 | - | |
| Acer 5102 will not power down monitor/ | 2022-03-28 12:06 | - | |
| Acer 5102 wireless problems/ | 2022-03-28 12:06 | - | |
| Acer 5102 with Windows 2K/ | 2022-03-28 12:06 | - | |
| Acer 5102wlmi-MCE problem/ | 2022-03-28 12:06 | - | |
| Acer 5103 - Internet Deal - good/ | 2022-03-28 12:06 | - | |
| Acer 5103 Problem/ | 2022-03-28 12:06 | - | |
| Acer 5103WLMi BLUETOOTH problem/ | 2022-03-28 12:06 | - | |
| Acer 5112 Aspire WLMI first laptom need help/ | 2022-03-28 12:06 | - | |
| Acer 5112 Aspire WLMI hidden partition/ | 2022-03-28 12:06 | - | |
| Acer 5112 GPU question/ | 2022-03-28 12:06 | - | |
| Acer 5112WLMI what does someone know this is/ | 2022-03-28 12:06 | - | |
| Acer 5112 WLmi/ | 2022-03-28 12:06 | - | |
| Acer 5112 problems with S-video ( )/ | 2022-03-28 12:06 | - | |
| Acer 5135 ICL50 Problem/ | 2022-03-28 12:06 | - | |
| Acer 5135 flashing amber light/ | 2022-03-28 12:06 | - | |
| Acer 5230E--Can you order just one key on keyboard/ | 2022-03-28 12:06 | - | |
| Acer 5230E CPU Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5250 system restore CD/ | 2022-03-28 12:06 | - | |
| Acer 5251-1513 Cpu Uprading/ | 2022-03-28 12:06 | - | |
| Acer 5253-BZ663 missing drivers/ | 2022-03-28 12:06 | - | |
| Acer 5253-bz602 connection to tv that has no hdmi/ | 2022-03-28 12:06 | - | |
| Acer 5310 Recovery Problem/ | 2022-03-28 12:06 | - | |
| Acer 5310 Sound issue/ | 2022-03-28 12:06 | - | |
| Acer 5310 downgrade Vista to XP. How do I load SATA AHCI driver/ | 2022-03-28 12:06 | - | |
| Acer 5310 hard drive PLEASE HELP/ | 2022-03-28 12:06 | - | |
| Acer 5310 laptop upgrade!/ | 2022-03-28 12:06 | - | |
| Acer 5313 no POST/ | 2022-03-28 12:06 | - | |
| Acer 5315, 7200rpm HD, performance gain/ | 2022-03-28 12:06 | - | |
| Acer 5315, installing Wifi 'n' card/ | 2022-03-28 12:06 | - | |
| Acer 5315-2153 Laptop AC Adapter/ | 2022-03-28 12:06 | - | |
| Acer 5315-2713 video memory/ | 2022-03-28 12:06 | - | |
| Acer 5315-2713 video messed up/ | 2022-03-28 12:06 | - | |
| Acer 5315 - BIOS Update/ | 2022-03-28 12:06 | - | |
| Acer 5315 - Hard Drive Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5315 - Hardrive upgrade advice req'd/ | 2022-03-28 12:06 | - | |
| Acer 5315- enet management will not connect/ | 2022-03-28 12:06 | - | |
| Acer 5315 - which one to buy/ | 2022-03-28 12:06 | - | |
| Acer 5315/ | 2022-03-28 12:06 | - | |
| Acer 5315 Graphics Card Question/ | 2022-03-28 12:06 | - | |
| Acer 5315 Hard drive/ | 2022-03-28 12:06 | - | |
| Acer 5315 Hinges Broken/ | 2022-03-28 12:06 | - | |
| Acer 5315 Laptop dead/ | 2022-03-28 12:06 | - | |
| Acer 5315 Memory Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5315 OS From Acer 5517 Question/ | 2022-03-28 12:06 | - | |
| Acer 5315 SHOULD work using 4 GB of RAM - The Facts/ | 2022-03-28 12:06 | - | |
| Acer 5315 Upgrade - Drive Clone to Larger Drive/ | 2022-03-28 12:06 | - | |
| Acer 5315 XP driver package/ | 2022-03-28 12:06 | - | |
| Acer 5315 and SATA II Drive and CPU Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5315 bios settings/ | 2022-03-28 12:06 | - | |
| Acer 5315 died!/ | 2022-03-28 12:06 | - | |
| Acer 5315 laptop upgrade suggestions/ | 2022-03-28 12:06 | - | |
| Acer 5315 looking to upgrade network card/ | 2022-03-28 12:06 | - | |
| Acer 5315 optical drive/ | 2022-03-28 12:06 | - | |
| Acer 5315 pinout diagram/ | 2022-03-28 12:06 | - | |
| Acer 5315 power problem/ | 2022-03-28 12:06 | - | |
| Acer 5315 running x64 windows 7, Extra Ram/ | 2022-03-28 12:06 | - | |
| Acer 5315 series model ICL50 notebook wireless woes Options/ | 2022-03-28 12:06 | - | |
| Acer 5315 sleep hibernate waking problem/ | 2022-03-28 12:06 | - | |
| Acer 5315 temperature problem/ | 2022-03-28 12:06 | - | |
| Acer 5315 to TV/ | 2022-03-28 12:06 | - | |
| Acer 5315 to the rescue!/ | 2022-03-28 12:06 | - | |
| Acer 5315 upgrade wifi card/ | 2022-03-28 12:06 | - | |
| Acer 5315 won't boot!/ | 2022-03-28 12:06 | - | |
| Acer 5332 Thoughts/ | 2022-03-28 12:06 | - | |
| Acer 5333-2418 wifi button/ | 2022-03-28 12:06 | - | |
| Acer 5335 - Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5335 - Volume level missing on screen/ | 2022-03-28 12:06 | - | |
| Acer 5336 Webcam Problem -s/ | 2022-03-28 12:06 | - | |
| Acer 5420 XP Drivers/ | 2022-03-28 12:06 | - | |
| Acer 5500 upgrade questions/ | 2022-03-28 12:06 | - | |
| Acer 5502 WXMi Bluetooth Drivers/ | 2022-03-28 12:06 | - | |
| Acer 5515/ | 2022-03-28 12:06 | - | |
| Acer 5515 Vista 32bit Basic/ | 2022-03-28 12:06 | - | |
| Acer 5515 hangs entering boot device selection menu/ | 2022-03-28 12:06 | - | |
| Acer 5516 - DIM LCD, CHANGED INVERTER and LCD/ | 2022-03-28 12:06 | - | |
| Acer 5517 Bricked after failed BIOS update/ | 2022-03-28 12:06 | - | |
| Acer 5520 - 2 Grpahics Problems/ | 2022-03-28 12:06 | - | |
| Acer 5520-5912 RAM upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5520-5912 VGA output to LCD TV/ | 2022-03-28 12:06 | - | |
| Acer 5520G. Is it dead/ | 2022-03-28 12:06 | - | |
| Acer 5520G dead motherboard/ | 2022-03-28 12:06 | - | |
| Acer 5520G sata II/ | 2022-03-28 12:06 | - | |
| Acer 5520G short circuit/ | 2022-03-28 12:06 | - | |
| Acer 5520G upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5520 Hard Drive Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5520 S PDIF output/ | 2022-03-28 12:06 | - | |
| Acer 5520 Shuts down when setup is running/ | 2022-03-28 12:06 | - | |
| Acer 5520g/ | 2022-03-28 12:06 | - | |
| Acer 5520g CPU Upgrade - need help/ | 2022-03-28 12:06 | - | |
| Acer 5520g IEEE1394 problem/ | 2022-03-28 12:06 | - | |
| Acer 5520g Optical drive failure help/ | 2022-03-28 12:06 | - | |
| Acer 5520g Strange colour video output/ | 2022-03-28 12:06 | - | |
| Acer 5520 help please/ | 2022-03-28 12:06 | - | |
| Acer 5520 laptop is acting weird/ | 2022-03-28 12:06 | - | |
| Acer 5520 power button flashing/ | 2022-03-28 12:06 | - | |
| Acer 5520 runs hot and fan never stops/ | 2022-03-28 12:06 | - | |
| Acer 5520 shutting off randomly warning/ | 2022-03-28 12:06 | - | |
| Acer 5520 won't power on/ | 2022-03-28 12:06 | - | |
| Acer 5534 Liquid Damage Indicator/ | 2022-03-28 12:06 | - | |
| Acer 5535 Aspire - Disable Multi-Gesture/ | 2022-03-28 12:06 | - | |
| Acer 5535 Problems/ | 2022-03-28 12:06 | - | |
| Acer 5535 RM-70 CPU Max Temp Help =(/ | 2022-03-28 12:06 | - | |
| Acer 5535 disconnects from wireless when buffering during video downloading/ | 2022-03-28 12:06 | - | |
| Acer 5536/ | 2022-03-28 12:06 | - | |
| Acer 5536G-744G50M Dvdrw firmware/ | 2022-03-28 12:06 | - | |
| Acer 5536G Camera/ | 2022-03-28 12:06 | - | |
| Acer 5536 NEED HELP/ | 2022-03-28 12:06 | - | |
| Acer 5536 SLOW start up/ | 2022-03-28 12:06 | - | |
| Acer 5536 little help/ | 2022-03-28 12:06 | - | |
| Acer 5542 5542G New BIOS 1.08/ | 2022-03-28 12:06 | - | |
| Acer 5542 overheating/ | 2022-03-28 12:06 | - | |
| Acer 5551 Touchpad/ | 2022-03-28 12:06 | - | |
| Acer 5552/ | 2022-03-28 12:06 | - | |
| Acer 5552 and I have software problems/ | 2022-03-28 12:06 | - | |
| Acer 5552 blu ray/ | 2022-03-28 12:06 | - | |
| Acer5552 hard drive replacement/ | 2022-03-28 12:10 | - | |
| Acer 5553G, which realtek sound chip it uses/ | 2022-03-28 12:06 | - | |
| Acer 5560 sb256 support SATA 3 6GB s/ | 2022-03-28 12:06 | - | |
| Acer 5562 Heat Issues With A notebook Cooler/ | 2022-03-28 12:06 | - | |
| Acer 5562NWXLMi My Review/ | 2022-03-28 12:06 | - | |
| Acer 5562 Problems!/ | 2022-03-28 12:06 | - | |
| Acer 5562 freezes (5560 and 5670 series)/ | 2022-03-28 12:06 | - | |
| Acer 5570 + T7400, Fan always on/ | 2022-03-28 12:06 | - | |
| Acer 5570- Reviews/ | 2022-03-28 12:06 | - | |
| Acer 5570 - modem on high audio bus/ | 2022-03-28 12:06 | - | |
| Acer 5570 Orbicam help/ | 2022-03-28 12:06 | - | |
| Acer 5570 Question - Process 1 1 Cleanup/ | 2022-03-28 12:06 | - | |
| Acer 5570 RAM upgrade problem/ | 2022-03-28 12:06 | - | |
| Acer 5570Z Laptop Graphics Driver Needed to Enable Rotate Screen under Vista Win7/ | 2022-03-28 12:06 | - | |
| Acer 5570z Max Ram/ | 2022-03-28 12:06 | - | |
| Acer 5570z buttons under touchpad not working/ | 2022-03-28 12:06 | - | |
| Acer 5570z slowdowns...-(/ | 2022-03-28 12:06 | - | |
| Acer 5570z support more ram with 64 bit Vista Ultimate/ | 2022-03-28 12:06 | - | |
| Acer 5571 drivers for win7/ | 2022-03-28 12:06 | - | |
| Acer 5583 Bsod on 4 gb ram/ | 2022-03-28 12:06 | - | |
| Acer 5583 DVD ram drive/ | 2022-03-28 12:06 | - | |
| Acer 5590 compatible with 5570/ | 2022-03-28 12:06 | - | |
| Acer 5600- Driver backup help/ | 2022-03-28 12:06 | - | |
| Acer 5600 - Need some urgent help reformatting/ | 2022-03-28 12:06 | - | |
| Acer 5600 Screen problem/ | 2022-03-28 12:06 | - | |
| Acer 5600 tries to boot, then turns off, and on again (With Video)/ | 2022-03-28 12:06 | - | |
| Acer 5601AWLMI Problem/ | 2022-03-28 12:06 | - | |
| Acer 5601 AWLMi/ | 2022-03-28 12:06 | - | |
| Acer 5601 LAN error/ | 2022-03-28 12:06 | - | |
| Acer 5601 and MSConfig --- Searched, still need help/ | 2022-03-28 12:06 | - | |
| Acer 5601 dropped and screen cracked/ | 2022-03-28 12:06 | - | |
| Acer 5610--upgrade SD-- SDHC/ | 2022-03-28 12:06 | - | |
| Acer 5610-2328 Aspire Orbicam Problems/ | 2022-03-28 12:06 | - | |
| Acer 5610/ | 2022-03-28 12:06 | - | |
| Acer 5610 Bad Bios Flash/ | 2022-03-28 12:06 | - | |
| Acer 5610 Internet Radio Station Distortion/ | 2022-03-28 12:06 | - | |
| Acer 5610 Lan Driver - Windows Xp - Unable To Install/ | 2022-03-28 12:06 | - | |
| Acer 5610 Laptop/ | 2022-03-28 12:06 | - | |
| Acer 5610 Orbi Cam Problems/ | 2022-03-28 12:06 | - | |
| Acer 5610 PLL Overclock/ | 2022-03-28 12:06 | - | |
| Acer 5610 Restore Disks/ | 2022-03-28 12:06 | - | |
| Acer 5610 Service guide - techno3/ | 2022-03-28 12:06 | - | |
| Acer 5610Z HDD Problem/ | 2022-03-28 12:06 | - | |
| Acer 5610Z Wireless No Device/ | 2022-03-28 12:06 | - | |
| Acer 5610 and installing Intel 5100 Wifi/ | 2022-03-28 12:06 | - | |
| Acer 5610 dead/ | 2022-03-28 12:06 | - | |
| Acer 5610 making random beeping noises/ | 2022-03-28 12:06 | - | |
| Acer 5610 orbicam error/ | 2022-03-28 12:06 | - | |
| Acer 5610 screen problems/ | 2022-03-28 12:06 | - | |
| Acer 5610 with Intel 945GM getting 1080p/ | 2022-03-28 12:06 | - | |
| Acer 5610z restore disc help/ | 2022-03-28 12:06 | - | |
| Acer 5612 EPower Error - The Specified Module Could Not Be Found/ | 2022-03-28 12:06 | - | |
| Acer 5612 Memory Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5612z wants to connect to wrong wireless connection/ | 2022-03-28 12:06 | - | |
| Acer 5620-6380 Bluetooth w Dell RD530 Module/ | 2022-03-28 12:06 | - | |
| Acer 5620 CPU Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5620Z lcd problem/ | 2022-03-28 12:06 | - | |
| Acer 5626 - laptop gets hot/ | 2022-03-28 12:06 | - | |
| Acer 5630-6288 fan control/ | 2022-03-28 12:06 | - | |
| Acer 5630 - Restore failed - reason 0xa0000001/ | 2022-03-28 12:06 | - | |
| Acer 5630- a number of problems (restarting, beeps, etc.)/ | 2022-03-28 12:06 | - | |
| Acer 5630 6288 no boot power on/ | 2022-03-28 12:06 | - | |
| Acer 5630 Laptop Fan doesnt start in windowsXp/ | 2022-03-28 12:06 | - | |
| Acer 5630 Lcd Help Please!!/ | 2022-03-28 12:06 | - | |
| Acer 5630 Major LCD Problem (Notebook)/ | 2022-03-28 12:06 | - | |
| Acer 5630 VS 5680/ | 2022-03-28 12:06 | - | |
| Acer 5630Z LCD cable/ | 2022-03-28 12:06 | - | |
| Acer 5630 back of screen melts/ | 2022-03-28 12:06 | - | |
| Acer 5630 beep errors (1 long, 2 short) won't boot/ | 2022-03-28 12:06 | - | |
| Acer 5630 problem/ | 2022-03-28 12:06 | - | |
| Acer 5630 screen very loose/ | 2022-03-28 12:06 | - | |
| Acer 5630 sound problem fixed (see for details)/ | 2022-03-28 12:06 | - | |
| Acer 5633, Failed BIOS update = Dead/ | 2022-03-28 12:06 | - | |
| Acer 5633 TV-out/ | 2022-03-28 12:06 | - | |
| Acer 5633WLMI DVD-RW Problems/ | 2022-03-28 12:06 | - | |
| Acer 5633 WLMI recovery discs/ | 2022-03-28 12:06 | - | |
| Acer 5633 WLMi Start up slow/ | 2022-03-28 12:06 | - | |
| Acer 5633 problems/ | 2022-03-28 12:06 | - | |
| Acer 5633 switching wireless networks/ | 2022-03-28 12:06 | - | |
| Acer 5633 vs Acer 5103/ | 2022-03-28 12:06 | - | |
| Acer 5633wlmi - Service manual/ | 2022-03-28 12:06 | - | |
| Acer 5633wlmi WIFI problems after upgrade.. HELP!!!/ | 2022-03-28 12:06 | - | |
| Acer 5633wlmi service manual/ | 2022-03-28 12:06 | - | |
| Acer 5633 won't go past POST/ | 2022-03-28 12:06 | - | |
| Acer 5635 140 GB insteed of 160GB/ | 2022-03-28 12:06 | - | |
| Acer 5635 DVD-Rom won't eject/ | 2022-03-28 12:06 | - | |
| Acer 5652 WLMI/ | 2022-03-28 12:06 | - | |
| Acer 5670 Audio Problem/ | 2022-03-28 12:06 | - | |
| Acer 5670 Battery/ | 2022-03-28 12:06 | - | |
| Acer 5670 Bluetooth problems XP Pro No Device/ | 2022-03-28 12:06 | - | |
| Acer 5670 Orbicam Problem/ | 2022-03-28 12:06 | - | |
| Acer 5670 or 5672 cpu/ | 2022-03-28 12:06 | - | |
| Acer 5670 troubles/ | 2022-03-28 12:06 | - | |
| Acer 5671 Uprading/ | 2022-03-28 12:06 | - | |
| Acer 5671WLMI recovery problem/ | 2022-03-28 12:06 | - | |
| Acer 5672 & DVI Question/ | 2022-03-28 12:06 | - | |
| Acer 5672, is the X1400 128Mb or 256Mb/ | 2022-03-28 12:06 | - | |
| Acer 5672 - High pitched fan noise/ | 2022-03-28 12:06 | - | |
| Acer 5672 - Orbicam - XP/ | 2022-03-28 12:06 | - | |
| Acer 5672 - PF USage and looks/ | 2022-03-28 12:06 | - | |
| Acer 5672 - replace DVD to additional HDD/ | 2022-03-28 12:06 | - | |
| Acer 5672 AC adapter problem/ | 2022-03-28 12:06 | - | |
| Acer 5672 Audio Problems Sluggish Performance cause Now Pinpointed Dont Miss/ | 2022-03-28 12:06 | - | |
| Acer 5672 Benchmarks/ | 2022-03-28 12:06 | - | |
| Acer 5672 Bios version ZB1_3239 out/ | 2022-03-28 12:06 | - | |
| Acer 5672 Burner/ | 2022-03-28 12:06 | - | |
| Acer 5672 Cooling Pad!/ | 2022-03-28 12:06 | - | |
| Acer 5672 Fresh Win XP PRO install/ | 2022-03-28 12:06 | - | |
| Acer 5672 Keyboard Part Number/ | 2022-03-28 12:06 | - | |
| Acer 5672 Low Resources/ | 2022-03-28 12:06 | - | |
| Acer 5672 Microphone issue/ | 2022-03-28 12:06 | - | |
| Acer 5672 NEW!! BIOS 3236/ | 2022-03-28 12:06 | - | |
| Acer 5672 Recovery Disk/ | 2022-03-28 12:06 | - | |
| Acer 5672 S-video issues, it doesnt work, please help!/ | 2022-03-28 12:06 | - | |
| Acer 5672 Side Buttons and Winamp/ | 2022-03-28 12:06 | - | |
| Acer 5672 Touchpad Noise/ | 2022-03-28 12:06 | - | |
| Acer 5672 VISTA Drivers/ | 2022-03-28 12:06 | - | |
| Acer 5672 Video out - Sound/ | 2022-03-28 12:06 | - | |
| Acer 5672 Vista Drivers Question/ | 2022-03-28 12:06 | - | |
| Acer 5672 Vista RtM Blue Screen/ | 2022-03-28 12:06 | - | |
| Acer 5672 Vista Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5672 WLMI - 2nd day - laptop dead/ | 2022-03-28 12:06 | - | |
| Acer 5672 WLMI Vista Fullscreen video prob/ | 2022-03-28 12:06 | - | |
| Acer 5672WLMi/ | 2022-03-28 12:06 | - | |
| Acer 5672WLMi Media Keys and USB Ports/ | 2022-03-28 12:06 | - | |
| Acer 5672WLMi and memory stick pro/ | 2022-03-28 12:06 | - | |
| Acer 5672WLMi fan/ | 2022-03-28 12:06 | - | |
| Acer 5672WLMi recovery disk/ | 2022-03-28 12:06 | - | |
| Acer 5672 WMLI Video Problem/ | 2022-03-28 12:06 | - | |
| Acer 5672 X1600 to FireGL V5200/ | 2022-03-28 12:06 | - | |
| Acer 5672 and Surround Sound/ | 2022-03-28 12:06 | - | |
| Acer 5672 fresh XP install makes wireless network stop working/ | 2022-03-28 12:06 | - | |
| Acer 5672 graphics card replacement, help!/ | 2022-03-28 12:06 | - | |
| Acer 5672 help/ | 2022-03-28 12:06 | - | |
| Acer 5672 keeps rebooting (hardware issue)/ | 2022-03-28 12:06 | - | |
| Acer 5672 max res you've gotten/ | 2022-03-28 12:06 | - | |
| Acer 5672 problem + question!/ | 2022-03-28 12:06 | - | |
| Acer 5672 touchpad/ | 2022-03-28 12:06 | - | |
| Acer 5672 urgent power problems/ | 2022-03-28 12:06 | - | |
| Acer 5672 vs 5671A/ | 2022-03-28 12:06 | - | |
| Acer 5672 with Windows 7/ | 2022-03-28 12:06 | - | |
| Acer 5672wlmi drivers/ | 2022-03-28 12:06 | - | |
| Acer 5672wlmi dvdrw spin down time/ | 2022-03-28 12:06 | - | |
| Acer 5672 x1600 Owners Lounge!/ | 2022-03-28 12:06 | - | |
| Acer5672 x1600 stock settings and overclocking - worth it/ | 2022-03-28 12:10 | - | |
| Acer 5680 - AzMixerSel.exe error/ | 2022-03-28 12:06 | - | |
| Acer 5680/ | 2022-03-28 12:06 | - | |
| Acer 5684/ | 2022-03-28 12:06 | - | |
| Acer 5684WLMi Clock Speed/ | 2022-03-28 12:06 | - | |
| Acer 5684WLMi hump under touchpad top left side/ | 2022-03-28 12:06 | - | |
| Acer 5710 - Windows Virtual PC/ | 2022-03-28 12:06 | - | |
| Acer 5710 cracked screen/ | 2022-03-28 12:06 | - | |
| Acer 5710g/ | 2022-03-28 12:06 | - | |
| Acer 5715z question about speedstep/ | 2022-03-28 12:06 | - | |
| Acer 5720 - 6279/ | 2022-03-28 12:06 | - | |
| Acer 5720 Charging Problem/ | 2022-03-28 12:06 | - | |
| Acer 5720 External Speakers/ | 2022-03-28 12:06 | - | |
| Acer 5720G (9600GT) Problem/ | 2022-03-28 12:06 | - | |
| Acer 5720G + HD2400XT Underclocked/ | 2022-03-28 12:06 | - | |
| Acer 5720G BIOS update/ | 2022-03-28 12:06 | - | |
| Acer 5720G Sound problem/ | 2022-03-28 12:06 | - | |
| Acer 5720G Upgrade. Help/ | 2022-03-28 12:06 | - | |
| Acer 5720Z - Sound and AHCI trouble after downgrade to XP/ | 2022-03-28 12:06 | - | |
| Acer 5720Z/ | 2022-03-28 12:06 | - | |
| Acer 5720ZG, extension warranty/ | 2022-03-28 12:06 | - | |
| Acer 5720ZG CPU upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5720ZG upgrade to MXM HD3650 DDR3/ | 2022-03-28 12:06 | - | |
| Acer 5720Z Problem When Shutdown help!/ | 2022-03-28 12:06 | - | |
| Acer 5720Z does not charge when powered on/ | 2022-03-28 12:06 | - | |
| Acer 5720Z ram/ | 2022-03-28 12:06 | - | |
| Acer 5720 full screen/ | 2022-03-28 12:06 | - | |
| Acer 5720 vbios for ATI hd3650 256Mb/ | 2022-03-28 12:06 | - | |
| Acer 5720z problems/ | 2022-03-28 12:06 | - | |
| Acer 5730z Wireless problem in Xp/ | 2022-03-28 12:06 | - | |
| Acer 5730zg fan/ | 2022-03-28 12:06 | - | |
| Acer 5732Z Wireless/ | 2022-03-28 12:06 | - | |
| Acer 5732z battery/ | 2022-03-28 12:06 | - | |
| Acer 5733 Problem after trying to connect to plasma/ | 2022-03-28 12:06 | - | |
| Acer 5733 graphics card/ | 2022-03-28 12:06 | - | |
| Acer 5733 touchpad- bottom 1 5 not sensitive/ | 2022-03-28 12:06 | - | |
| Acer 5734z freezes at startup/ | 2022-03-28 12:06 | - | |
| Acer 5734z series vga to tv hook up/ | 2022-03-28 12:06 | - | |
| Acer 5735-4774/ | 2022-03-28 12:06 | - | |
| Acer 5735 Bios update/ | 2022-03-28 12:06 | - | |
| Acer 5735 Fan Control/ | 2022-03-28 12:06 | - | |
| Acer 5735Z performance help/ | 2022-03-28 12:06 | - | |
| Acer 5735 cpu, memory upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5735 gets feeling hot and turns off/ | 2022-03-28 12:06 | - | |
| Acer 5735 graphic card upgrading/ | 2022-03-28 12:06 | - | |
| Acer 5735 internet issues/ | 2022-03-28 12:06 | - | |
| Acer 5735 screen blanking/ | 2022-03-28 12:06 | - | |
| Acer 5735z Fan Replacement/ | 2022-03-28 12:06 | - | |
| Acer 5735z Not powering up/ | 2022-03-28 12:06 | - | |
| Acer 5735z Process- 12 28 eRecovery Hanged/ | 2022-03-28 12:06 | - | |
| Acer 5736 Any Good/ | 2022-03-28 12:06 | - | |
| Acer 5737z random shutdown/ | 2022-03-28 12:06 | - | |
| Acer 5738G Vents/ | 2022-03-28 12:06 | - | |
| Acer 5738G bottom vent built closed/ | 2022-03-28 12:06 | - | |
| Acer 5738G with ati mobility 4570/ | 2022-03-28 12:06 | - | |
| Acer 5738Z Factory Restore/ | 2022-03-28 12:06 | - | |
| Acer 5738ZG CPU swap P8600/ | 2022-03-28 12:06 | - | |
| Acer 5738g gpu temp problem/ | 2022-03-28 12:06 | - | |
| Acer 5738g opinions/ | 2022-03-28 12:06 | - | |
| Acer 5738z/ | 2022-03-28 12:06 | - | |
| Acer 5738z 423g16/ | 2022-03-28 12:06 | - | |
| Acer 5738zg ATi 4570 model vcores/ | 2022-03-28 12:06 | - | |
| Acer 5738z misdiagnosed/ | 2022-03-28 12:06 | - | |
| Acer 5739G - High Temperatures/ | 2022-03-28 12:06 | - | |
| Acer 5739G Instant-On funtion after windows 7 upgrade not working/ | 2022-03-28 12:06 | - | |
| Acer 5739G Problem/ | 2022-03-28 12:06 | - | |
| Acer 5739G arcade deluxe button boots up the computer/ | 2022-03-28 12:06 | - | |
| Acer 5739G does support Core 2 Quad/ | 2022-03-28 12:06 | - | |
| Acer 5739G pre-Boot password corruption/ | 2022-03-28 12:06 | - | |
| Acer 5739G problem with SSD (samsung 840 pro 256gb)/ | 2022-03-28 12:06 | - | |
| Acer 5739g - Cracles in the sound/ | 2022-03-28 12:06 | - | |
| Acer 5739g Internal bluetooth/ | 2022-03-28 12:06 | - | |
| Acer 5739g wireless problem/ | 2022-03-28 12:06 | - | |
| Acer 5740 (from OfficeMax) battery problem/ | 2022-03-28 12:06 | - | |
| Acer 5740-6025 Battery Beep/ | 2022-03-28 12:06 | - | |
| Acer 5740DG LCD Replacement (Stuck pixel)/ | 2022-03-28 12:06 | - | |
| Acer 5740DG updated 3D/ | 2022-03-28 12:06 | - | |
| Acer 5740G- Speech Recognition Not Working -/ | 2022-03-28 12:06 | - | |
| Acer 5740G - battery charging on off every 5s!/ | 2022-03-28 12:06 | - | |
| Acer 5740G Keyboard Cleaning/ | 2022-03-28 12:06 | - | |
| Acer 5740G issues , must see !! I am sad!! Bad luck/ | 2022-03-28 12:06 | - | |
| Acer 5740G original BIOS/ | 2022-03-28 12:06 | - | |
| Acer 5740G overheating/ | 2022-03-28 12:06 | - | |
| Acer 5740g 6979 shuts down while playing games/ | 2022-03-28 12:06 | - | |
| Acer 5740g DVD CD drive/ | 2022-03-28 12:06 | - | |
| Acer 5740 recovery DVD not working/ | 2022-03-28 12:06 | - | |
| Acer 5740 ventilation/ | 2022-03-28 12:06 | - | |
| Acer 5741 - Battery Issues/ | 2022-03-28 12:06 | - | |
| Acer 5741 Case Cracked Near Hinge, Suggestions/ | 2022-03-28 12:06 | - | |
| Acer 5741G Bluetooth Pairing Problem/ | 2022-03-28 12:06 | - | |
| Acer 5741 I5 - Illuminated Keyboard/ | 2022-03-28 12:06 | - | |
| Acer 5741 Laptop Blue Power Light On But No Screen or Post/ | 2022-03-28 12:06 | - | |
| Acer 5741g hard drive failure won't boot, cycling on and off/ | 2022-03-28 12:06 | - | |
| Acer 5742-7784 Launch Manager not working/ | 2022-03-28 12:06 | - | |
| Acer 5742 - How to access Startup Repair win Win 7/ | 2022-03-28 12:06 | - | |
| Acer 5742 - very strange issue...need some help or advice/ | 2022-03-28 12:06 | - | |
| Acer 5742G - 2nd gen core cpu/ | 2022-03-28 12:06 | - | |
| Acer 5742G-6846 Bios question/ | 2022-03-28 12:06 | - | |
| Acer 5742G - Barcode lines on Screen [AGAIN. Just got back from Warranty Yesterday] Please help!!/ | 2022-03-28 12:06 | - | |
| Acer 5742G Fan problem and overheating problem/ | 2022-03-28 12:06 | - | |
| Acer 5742G Graphic Card(s) Problems/ | 2022-03-28 12:06 | - | |
| Acer 5742G Graphics card problem/ | 2022-03-28 12:06 | - | |
| Acer 5742G and Crysis 2 demo/ | 2022-03-28 12:06 | - | |
| Acer 5742G missing screw/ | 2022-03-28 12:06 | - | |
| Acer 5742G vs Timeline X 4820TG/ | 2022-03-28 12:06 | - | |
| Acer 5742 Intel Core i5 460m, RAM/ | 2022-03-28 12:06 | - | |
| Acer 5742ZG/ | 2022-03-28 12:06 | - | |
| Acer 5742 drivers question/ | 2022-03-28 12:06 | - | |
| Acer 5742g, Starcraft 2 and closing notebook without alt-tab or quitting in the game/ | 2022-03-28 12:06 | - | |
| Acer 5742g Gaming Problem/ | 2022-03-28 12:06 | - | |
| Acer 5742g High Temperatures Poor Performance/ | 2022-03-28 12:06 | - | |
| Acer 5742g Nvidia gt 420m to gt42mm/ | 2022-03-28 12:06 | - | |
| Acer 5742 replacement 9 cell battery/ | 2022-03-28 12:06 | - | |
| Acer 5742z- lcd backlight dead or other issue/ | 2022-03-28 12:06 | - | |
| Acer 5742zg fps drops/ | 2022-03-28 12:06 | - | |
| Acer 5745DG-7950 Fan Control/ | 2022-03-28 12:06 | - | |
| Acer 5745G Core i7-740QM 2.53GHz 4GB 500GB HD5850 2GB 15.6/ | 2022-03-28 12:06 | - | |
| Acer 5745G Realtek High Definition Audio - high pitch noise [solved]/ | 2022-03-28 12:06 | - | |
| Acer 5745G backlit keyboard/ | 2022-03-28 12:06 | - | |
| Acer 5745PG/ | 2022-03-28 12:06 | - | |
| Acer 5745g - Artifacts when switching from Nvidia to Intel GPU/ | 2022-03-28 12:06 | - | |
| Acer 5745g CPU upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5748G Bluetooth/ | 2022-03-28 12:06 | - | |
| Acer 5749 DDR3 RAM Speed/ | 2022-03-28 12:06 | - | |
| Acer 5750-6439 video memory shared/ | 2022-03-28 12:06 | - | |
| Acer 5750G-9821/ | 2022-03-28 12:06 | - | |
| Acer 5750G 2nd Gen Intel Mobo (Non-recall )/ | 2022-03-28 12:06 | - | |
| Acer 5750G Bios Unlock/ | 2022-03-28 12:06 | - | |
| Acer 5750G Fan/ | 2022-03-28 12:06 | - | |
| Acer 5750G Hardware Issues/ | 2022-03-28 12:06 | - | |
| Acer 5750G Mini PCIE/ | 2022-03-28 12:06 | - | |
| Acer 5750G Owners Lounge/ | 2022-03-28 12:06 | - | |
| Acer 5750G Thermal Pad/ | 2022-03-28 12:06 | - | |
| Acer 5750G does not boot/ | 2022-03-28 12:06 | - | |
| Acer 5750G i7 2630QM repast/ | 2022-03-28 12:06 | - | |
| Acer 5750G overheating/ | 2022-03-28 12:06 | - | |
| Acer 5750g bios Help/ | 2022-03-28 12:06 | - | |
| Acer 5750g overheating & throttling PERMANENT FIX!/ | 2022-03-28 12:06 | - | |
| Acer 5755/ | 2022-03-28 12:06 | - | |
| Acer 5755G - LCD Panel Upgrade - Help/ | 2022-03-28 12:06 | - | |
| Acer 5755G/ | 2022-03-28 12:06 | - | |
| Acer 5755G Backlit Keyboard Mod/ | 2022-03-28 12:06 | - | |
| Acer 5755G RAM Upgrade (Performance RAM)/ | 2022-03-28 12:06 | - | |
| Acer 5755g Problem Help/ | 2022-03-28 12:06 | - | |
| Acer 5810...What is this And Mod Questions/ | 2022-03-28 12:06 | - | |
| Acer 5810TG Freezing Problem/ | 2022-03-28 12:06 | - | |
| Acer 5810TZ-4784...THOUGHTS/ | 2022-03-28 12:06 | - | |
| Acer 5810TZ/ | 2022-03-28 12:06 | - | |
| Acer 5810TZ battery problem/ | 2022-03-28 12:06 | - | |
| Acer 5820TG Timeline in US/ | 2022-03-28 12:06 | - | |
| Acer 5820TG big temp issue/ | 2022-03-28 12:06 | - | |
| Acer 5820TG issues/ | 2022-03-28 12:06 | - | |
| Acer 5820TG normal fan noise/ | 2022-03-28 12:06 | - | |
| Acer 5820TG temp issue/ | 2022-03-28 12:06 | - | |
| Acer 5820TG thermal sensor issue/ | 2022-03-28 12:06 | - | |
| Acer 5820T issues (URGENT HELP NEEDED)/ | 2022-03-28 12:06 | - | |
| Acer 5830TG-6614 Battery Not Detected/ | 2022-03-28 12:06 | - | |
| Acer 5830tg - throttling a big issue or not/ | 2022-03-28 12:06 | - | |
| Acer 5920 + Command&Conquer3/ | 2022-03-28 12:06 | - | |
| Acer 5920 - 169.xx vs 174.xx/ | 2022-03-28 12:06 | - | |
| Acer 5920-6470- possible to add a discrete video card/ | 2022-03-28 12:06 | - | |
| Acer 5920-6470 media control bar drivers XP/ | 2022-03-28 12:06 | - | |
| Acer 5920-6864 - Add your comments here/ | 2022-03-28 12:06 | - | |
| Acer 5920- Battery meter lies!/ | 2022-03-28 12:06 | - | |
| Acer 5920 - High Pitch noise on increasing volume/ | 2022-03-28 12:06 | - | |
| Acer 5920 - Microphone/ | 2022-03-28 12:06 | - | |
| Acer 5920 - strange noise from within!/ | 2022-03-28 12:06 | - | |
| Acer 5920 - which Acer software is useful/ | 2022-03-28 12:06 | - | |
| Acer 5920...reassurance needed/ | 2022-03-28 12:06 | - | |
| Acer 5920 = $1500/ | 2022-03-28 12:06 | - | |
| Acer 5920 BIOS Upgrade Win7 64bit/ | 2022-03-28 12:06 | - | |
| Acer 5920 Bios problem/ | 2022-03-28 12:06 | - | |
| Acer 5920 Boot Times/ | 2022-03-28 12:06 | - | |
| Acer 5920 Build Quality Poll/ | 2022-03-28 12:06 | - | |
| Acer 5920 CMOS Battery/ | 2022-03-28 12:06 | - | |
| Acer 5920 D2D Recovery/ | 2022-03-28 12:06 | - | |
| Acer 5920 DVD-drive opens almost by itself/ | 2022-03-28 12:06 | - | |
| Acer 5920 Fan speed and temperature problems/ | 2022-03-28 12:06 | - | |
| Acer 5920G & Win7 64bit RC (Drivers) Question/ | 2022-03-28 12:06 | - | |
| Acer 5920G (XP Pro) - USB drivers - HELP!!!/ | 2022-03-28 12:06 | - | |
| Acer 5920G + Orange Broadband Problems/ | 2022-03-28 12:06 | - | |
| Acer 5920G + T9300 = overheating/ | 2022-03-28 12:06 | - | |
| Acer 5920G, disable vga (bad vga) use it as a server/ | 2022-03-28 12:06 | - | |
| Acer 5920G, upgrade from 8600M GT to 9500M GS or 9600M GT/ | 2022-03-28 12:06 | - | |
| Acer 5920G- Blank Screen on Boot/ | 2022-03-28 12:06 | - | |
| Acer 5920G-Difference between BestBuy and Acer Website/ | 2022-03-28 12:06 | - | |
| Acer 5920G - GFX Problem -(!/ | 2022-03-28 12:06 | - | |
| Acer 5920G- Laptopvideo2go vs. New Acer driver/ | 2022-03-28 12:06 | - | |
| Acer 5920G - Nvdia 8600M GT Driver/ | 2022-03-28 12:06 | - | |
| Acer 5920G - Problems with TV setup/ | 2022-03-28 12:06 | - | |
| Acer 5920G - Problem with left-side speaker/ | 2022-03-28 12:06 | - | |
| Acer 5920G-System crash, I need HELP!!!!!/ | 2022-03-28 12:06 | - | |
| Acer 5920G - Toshiba HD-DVD Driver/ | 2022-03-28 12:06 | - | |
| Acer 5920G - Upgrading HDD/ | 2022-03-28 12:06 | - | |
| Acer 5920G- heat and noise/ | 2022-03-28 12:06 | - | |
| Acer 5920G- notebookcheck review already up!/ | 2022-03-28 12:06 | - | |
| Acer 5920G 800MHZ FSB MEM how/ | 2022-03-28 12:06 | - | |
| Acer 5920G AC Charger Compatibility Help/ | 2022-03-28 12:06 | - | |
| Acer 5920G AC Power adapter issue/ | 2022-03-28 12:06 | - | |
| Acer 5920G ATI replacement video card not recognized but boots into Windows with black screen/ | 2022-03-28 12:06 | - | |
| Acer 5920G Arcade Partition/ | 2022-03-28 12:06 | - | |
| Acer 5920G BIOS update question/ | 2022-03-28 12:06 | - | |
| Acer 5920G BLU-RAY problems/ | 2022-03-28 12:06 | - | |
| Acer 5920G Battery Issues/ | 2022-03-28 12:06 | - | |
| Acer 5920G Battery and S-video/ | 2022-03-28 12:06 | - | |
| Acer 5920G Bios MOD to Switch Nvidia 8800M to Intel GMA X3100/ | 2022-03-28 12:06 | - | |
| Acer 5920G Blue screen error Due to Card Reader!/ | 2022-03-28 12:06 | - | |
| Acer 5920G Brightness Problem/ | 2022-03-28 12:06 | - | |
| Acer 5920G CD HD- DVD Drive not working. (And other problems)/ | 2022-03-28 12:06 | - | |
| Acer 5920G CPU Temperature/ | 2022-03-28 12:06 | - | |
| Acer 5920G Camera Question(s)/ | 2022-03-28 12:06 | - | |
| Acer 5920G Configurations/ | 2022-03-28 12:06 | - | |
| Acer 5920G DVD Drive/ | 2022-03-28 12:06 | - | |
| Acer 5920G DVD Drive Won't Open/ | 2022-03-28 12:06 | - | |
| Acer 5920G Display Flickering/ | 2022-03-28 12:06 | - | |
| Acer 5920G Dual Channel with 800mhz RAM/ | 2022-03-28 12:06 | - | |
| Acer 5920G Empowering Technology Password/ | 2022-03-28 12:06 | - | |
| Acer 5920G ExpressCard type/ | 2022-03-28 12:06 | - | |
| Acer 5920G Full Upgrade (GPU, CPU, HD, RAM)/ | 2022-03-28 12:06 | - | |
| Acer 5920G GFX Replacement/ | 2022-03-28 12:06 | - | |
| Acer 5920G GPU Upgrade Problem/ | 2022-03-28 12:06 | - | |
| Acer5920G GPU upgrade problem/ | 2022-03-28 12:10 | - | |
| Acer 5920G Games and driver problem/ | 2022-03-28 12:06 | - | |
| Acer 5920G Graphic card replacing/ | 2022-03-28 12:06 | - | |
| Acer 5920G HD DVD DVDR burn speed/ | 2022-03-28 12:06 | - | |
| Acer 5920G HD DVD Playback/ | 2022-03-28 12:06 | - | |
| Acer 5920G HDMI doesn't work/ | 2022-03-28 12:06 | - | |
| Acer 5920G HDMI out Problem/ | 2022-03-28 12:06 | - | |
| Acer 5920G Hard Drive Upgrade Seagate 7200.4/ | 2022-03-28 12:06 | - | |
| Acer 5920G Heat issues/ | 2022-03-28 12:06 | - | |
| Acer 5920G How to Fix Vanishing HD DVD-Rom/ | 2022-03-28 12:06 | - | |
| Acer 5920G Keyboard/ | 2022-03-28 12:06 | - | |
| Acer 5920G LAN Connectivity Problem/ | 2022-03-28 12:06 | - | |
| Acer 5920G LEDs/ | 2022-03-28 12:06 | - | |
| Acer 5920G LX.AGS0X.015 Crash at startup/ | 2022-03-28 12:06 | - | |
| Acer 5920G MXM II Graphics Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5920G Nvdia failure ati upgrade but problem encounted/ | 2022-03-28 12:06 | - | |
| Acer 5920 GPU... downgrade. I need a few bits of advice/ | 2022-03-28 12:06 | - | |
| Acer 5920G RAM/ | 2022-03-28 12:06 | - | |
| Acer 5920G RAM upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5920G Replace Card/ | 2022-03-28 12:06 | - | |
| Acer 5920G Speaker Proplem/ | 2022-03-28 12:06 | - | |
| Acer 5920G USB port failure/ | 2022-03-28 12:06 | - | |
| Acer 5920G Upgraded to T9300/ | 2022-03-28 12:06 | - | |
| Acer 5920G Upgrades (Ram, HD, CPU)/ | 2022-03-28 12:06 | - | |
| Acer 5920G Usb bandwidth Problem/ | 2022-03-28 12:06 | - | |
| Acer 5920G Vista x64 Ricoh Card Reader Drivers/ | 2022-03-28 12:06 | - | |
| Acer 5920G Windows Media Player volume boost/ | 2022-03-28 12:06 | - | |
| Acer 5920G and CyberLink Power DVD Ultra - Work for anyone/ | 2022-03-28 12:06 | - | |
| Acer 5920G and Intel Turbo Memory/ | 2022-03-28 12:06 | - | |
| Acer 5920G and T7400 upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5920G and USB Port Power/ | 2022-03-28 12:06 | - | |
| Acer 5920G and battery issue/ | 2022-03-28 12:06 | - | |
| Acer 5920G and new installed Intel Turbo Memory 1Gb/ | 2022-03-28 12:06 | - | |
| Acer 5920G audio input not working/ | 2022-03-28 12:06 | - | |
| Acer 5920 G black screen Problem/ | 2022-03-28 12:06 | - | |
| Acer 5920G boots to a blank screen - no beep/ | 2022-03-28 12:06 | - | |
| Acer 5920G continuous siren sound/ | 2022-03-28 12:06 | - | |
| Acer 5920G fan query/ | 2022-03-28 12:06 | - | |
| Acer 5920G has Arrived and ...... -(/ | 2022-03-28 12:06 | - | |
| Acer 5920G hibernation not working/ | 2022-03-28 12:06 | - | |
| Acer 5920G is no longer on BestBuy website/ | 2022-03-28 12:06 | - | |
| Acer 5920G keyboard problem/ | 2022-03-28 12:06 | - | |
| Acer 5920G looses WLAN and LAN after warms up/ | 2022-03-28 12:06 | - | |
| Acer 5920G not powering up/ | 2022-03-28 12:06 | - | |
| Acer 5920G problem - 3a2g25mi don't boot/ | 2022-03-28 12:06 | - | |
| Acer 5920G ram vents/ | 2022-03-28 12:06 | - | |
| Acer 5920G some questions urgently/ | 2022-03-28 12:06 | - | |
| Acer 5920G sound problems/ | 2022-03-28 12:06 | - | |
| Acer 5920G spacebar key retainers broke/ | 2022-03-28 12:06 | - | |
| Acer 5920G temperature problem/ | 2022-03-28 12:06 | - | |
| Acer 5920G upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5920G without any MXM card/ | 2022-03-28 12:06 | - | |
| Acer 5920G won't boot/ | 2022-03-28 12:06 | - | |
| Acer 5920G won't restore/ | 2022-03-28 12:06 | - | |
| Acer 5920 HDD question/ | 2022-03-28 12:06 | - | |
| Acer 5920 HINGE !/ | 2022-03-28 12:06 | - | |
| Acer 5920 Infrared and terratec remote/ | 2022-03-28 12:06 | - | |
| Acer 5920 Media Buttons Help!/ | 2022-03-28 12:06 | - | |
| Acer 5920 Microphone Webcam tweaking/ | 2022-03-28 12:06 | - | |
| Acer 5920 Microphone issue/ | 2022-03-28 12:06 | - | |
| Acer 5920 Occasional Screen Flicker/ | 2022-03-28 12:06 | - | |
| Acer 5920 Parts/ | 2022-03-28 12:06 | - | |
| Acer 5920 Problem (minor)/ | 2022-03-28 12:06 | - | |
| Acer 5920 Sata or sata II/ | 2022-03-28 12:06 | - | |
| Acer 5920 Screen flicker/ | 2022-03-28 12:06 | - | |
| Acer 5920 So-Dimm upgrade to 4gb/ | 2022-03-28 12:06 | - | |
| Acer 5920 Synaptics update/ | 2022-03-28 12:06 | - | |
| Acer 5920 Touchpad problem/ | 2022-03-28 12:06 | - | |
| Acer 5920 Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5920 Upgraded to T8300 Won't Boot -(/ | 2022-03-28 12:06 | - | |
| Acer 5920 and LCD change/ | 2022-03-28 12:06 | - | |
| Acer 5920 and SDHC cards/ | 2022-03-28 12:06 | - | |
| Acer 5920 and blue-ray/ | 2022-03-28 12:06 | - | |
| Acer 5920 annoying fan short bursts/ | 2022-03-28 12:06 | - | |
| Acer 5920 bios 3808 question/ | 2022-03-28 12:06 | - | |
| Acer 5920 cpu upgrade & cooling fan problem/ | 2022-03-28 12:06 | - | |
| Acer 5920 crash complete lock-up problem/ | 2022-03-28 12:06 | - | |
| Acer 5920 digital coax audio output/ | 2022-03-28 12:06 | - | |
| Acer 5920 external monitor help/ | 2022-03-28 12:06 | - | |
| Acer 5920g - Multiple Probs, But Basically Regarding Ram memory/ | 2022-03-28 12:06 | - | |
| Acer 5920g - fan always on from day 1!/ | 2022-03-28 12:06 | - | |
| Acer 5920g/ | 2022-03-28 12:06 | - | |
| Acer 5920g BIG prob!!! HELP!!!!/ | 2022-03-28 12:06 | - | |
| Acer 5920g Dvd A Ds8a1p Ata/ | 2022-03-28 12:06 | - | |
| Acer 5920g Heat/ | 2022-03-28 12:06 | - | |
| Acer 5920g LCD problem/ | 2022-03-28 12:06 | - | |
| Acer 5920g No Sound/ | 2022-03-28 12:06 | - | |
| Acer 5920g Power button boot up problem/ | 2022-03-28 12:06 | - | |
| Acer 5920g Problem with hddvd & wireless n/ | 2022-03-28 12:06 | - | |
| Acer 5920g Tweaks/ | 2022-03-28 12:06 | - | |
| Acer 5920g Update Driver software/ | 2022-03-28 12:06 | - | |
| Acer 5920g and SDHC/ | 2022-03-28 12:06 | - | |
| Acer 5920g buyers- Did you get a free WD elements external HDD Does it work/ | 2022-03-28 12:06 | - | |
| Acer 5920g connect to LCDTV via HDMI/ | 2022-03-28 12:06 | - | |
| Acer 5920g error sreen with games!/ | 2022-03-28 12:06 | - | |
| Acer 5920g go on hibernate/ | 2022-03-28 12:06 | - | |
| Acer 5920g graphics problem/ | 2022-03-28 12:06 | - | |
| Acer 5920g hard drive failure/ | 2022-03-28 12:06 | - | |
| Acer 5920g issue/ | 2022-03-28 12:06 | - | |
| Acer 5920 gpu change failed/ | 2022-03-28 12:06 | - | |
| Acer 5920 grey screen doesnt boot/ | 2022-03-28 12:06 | - | |
| Acer 5920g shortcut key change/ | 2022-03-28 12:06 | - | |
| Acer 5920g sound icon bottom right/ | 2022-03-28 12:06 | - | |
| Acer 5920g sound over HDMI/ | 2022-03-28 12:06 | - | |
| Acer 5920g touchpad problem-(/ | 2022-03-28 12:06 | - | |
| Acer 5920 help/ | 2022-03-28 12:06 | - | |
| Acer 5920 laptop keeps freezing after a few minutes/ | 2022-03-28 12:06 | - | |
| Acer 5920 mxm vga card...Help/ | 2022-03-28 12:06 | - | |
| Acer 5920 new bios ver. 3811/ | 2022-03-28 12:06 | - | |
| Acer 5920 power button/ | 2022-03-28 12:06 | - | |
| Acer 5920 upgrades/ | 2022-03-28 12:06 | - | |
| Acer 5920 via HDMI/ | 2022-03-28 12:06 | - | |
| Acer 5920 xp install changing Brightness screen/ | 2022-03-28 12:06 | - | |
| Acer 5930G - Bios/ | 2022-03-28 12:06 | - | |
| Acer 5930G- Need to Reflash my 9600M GT, not kept any back up files. -eek-/ | 2022-03-28 12:06 | - | |
| Acer 5930G BIOS extracting/ | 2022-03-28 12:06 | - | |
| Acer 5930G HDMI 5.1/ | 2022-03-28 12:06 | - | |
| Acer 5930G SM Bus Controller Driver/ | 2022-03-28 12:06 | - | |
| Acer 5930 Memory, CPU Etc/ | 2022-03-28 12:06 | - | |
| Acer 5930g - Anyone in UK with this laptop able to do be a big favour -)/ | 2022-03-28 12:06 | - | |
| Acer 5930 new bios available/ | 2022-03-28 12:06 | - | |
| Acer 5930 upgrade/ | 2022-03-28 12:06 | - | |
| Acer 5935G- Was this only shipped with Vista or Windows 7 too/ | 2022-03-28 12:06 | - | |
| Acer 5935G can't get rid of Vista!/ | 2022-03-28 12:06 | - | |
| Acer 5935g, now in pieces, any motherboard picture requests/ | 2022-03-28 12:06 | - | |
| Acer 5942 5740 differences/ | 2022-03-28 12:06 | - | |
| Acer 5942 series. Need help password problem/ | 2022-03-28 12:06 | - | |
| Acer 5943g touchpad/ | 2022-03-28 12:06 | - | |
| Acer 5950G, i7 computer/ | 2022-03-28 12:06 | - | |
| Acer 5951G/ | 2022-03-28 12:06 | - | |
| Acer 6039g Upgrade Questions/ | 2022-03-28 12:06 | - | |
| Acer 6390G/ | 2022-03-28 12:06 | - | |
| Acer 6390G BIOS update help/ | 2022-03-28 12:06 | - | |
| Acer 6390g - Upgrading/ | 2022-03-28 12:06 | - | |
| Acer 6530 Dead after Bad Bios Update/ | 2022-03-28 12:06 | - | |
| Acer 6530G - won't power on - restart loop/ | 2022-03-28 12:06 | - | |
| Acer 6530G won't turn on with or without battery!/ | 2022-03-28 12:06 | - | |
| Acer 6530 Owners lounge/ | 2022-03-28 12:06 | - | |
| Acer 6530g Dead/ | 2022-03-28 12:06 | - | |
| Acer 6530g Screen saver/ | 2022-03-28 12:06 | - | |
| Acer 6530 heat issue/ | 2022-03-28 12:06 | - | |
| Acer 6592g Bios issues/ | 2022-03-28 12:06 | - | |
| Acer 6920-6141 CPU Overclocking/ | 2022-03-28 12:06 | - | |
| Acer 6920-6507 your thoughts/ | 2022-03-28 12:06 | - | |
| Acer 6920-6621 Graphics Card Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 6920-6973 Convert from Vista to XP/ | 2022-03-28 12:06 | - | |
| Acer 6920/ | 2022-03-28 12:06 | - | |
| Acer 6920 Airflow/ | 2022-03-28 12:06 | - | |
| Acer 6920 Audio - Small Issue/ | 2022-03-28 12:06 | - | |
| Acer 6920 Audio issues/ | 2022-03-28 12:06 | - | |
| Acer 6920 BSD,crashing problem solved/ | 2022-03-28 12:06 | - | |
| Acer 6920 Battery Life Under Windows 7/ | 2022-03-28 12:06 | - | |
| Acer 6920 CineDash Volume [Out of sync]/ | 2022-03-28 12:06 | - | |
| Acer 6920 Crash Blue Screen/ | 2022-03-28 12:06 | - | |
| Acer 6920 DEP Problem/ | 2022-03-28 12:06 | - | |
| Acer 6920 Freeze Problem!!!Help!/ | 2022-03-28 12:06 | - | |
| Acer 6920G, Windows 7 Experience/ | 2022-03-28 12:06 | - | |
| Acer 6920G - 64bit drivers/ | 2022-03-28 12:06 | - | |
| Acer 6920G-6968/ | 2022-03-28 12:06 | - | |
| Acer 6920G - HD3650 overclocking in Windows 7/ | 2022-03-28 12:06 | - | |
| Acer 6920G - Using recovery parition/ | 2022-03-28 12:06 | - | |
| Acer 6920G- Very poor Geforce 9500GS performance/ | 2022-03-28 12:06 | - | |
| Acer 6920G - maybe other Gemstones - Keyboard lag/ | 2022-03-28 12:06 | - | |
| Acer 6920G 9600M GT Bios mystery/ | 2022-03-28 12:06 | - | |
| Acer 6920G; sound unusable system slowdown/ | 2022-03-28 12:06 | - | |
| Acer 6920G ATI HD3650 512MB vBIOS Reques/ | 2022-03-28 12:06 | - | |
| Acer 6920G ATI HD4650 1Gb vBIOS or mod mbios Request/ | 2022-03-28 12:06 | - | |
| Acer 6920G Bios Updated 1.16v released/ | 2022-03-28 12:06 | - | |
| Acer 6920G Blu Ray Driver/ | 2022-03-28 12:06 | - | |
| Acer 6920G Booting Up, beginning Recovery, then Shutting Down! (full desc. inside)/ | 2022-03-28 12:06 | - | |
| Acer 6920G Graphics Driver problems/ | 2022-03-28 12:06 | - | |
| Acer 6920G High Idle Temperature/ | 2022-03-28 12:06 | - | |
| Acer 6920G Overheating/ | 2022-03-28 12:06 | - | |
| Acer 6920G Screen Upgrade Possible/ | 2022-03-28 12:06 | - | |
| Acer 6920G Switching off after around 15mins of gameplay/ | 2022-03-28 12:06 | - | |
| Acer 6920G Throttling!/ | 2022-03-28 12:06 | - | |
| Acer 6920G Win 7 upgrade battery issue/ | 2022-03-28 12:06 | - | |
| Acer 6920G backlight not working/ | 2022-03-28 12:06 | - | |
| Acer 6920G help/ | 2022-03-28 12:06 | - | |
| Acer 6920G motherboard replacement HELP!/ | 2022-03-28 12:06 | - | |
| Acer 6920G overclock question/ | 2022-03-28 12:06 | - | |
| Acer 6920G power plan settings changing (wont stay as I set them)/ | 2022-03-28 12:06 | - | |
| Acer 6920G screen replacement/ | 2022-03-28 12:06 | - | |
| Acer 6920G slowed to a crawl/ | 2022-03-28 12:06 | - | |
| Acer 6920G sound issue/ | 2022-03-28 12:06 | - | |
| Acer 6920G will NOT take a microphone/ | 2022-03-28 12:06 | - | |
| Acer 6920G windows 7 issue/ | 2022-03-28 12:06 | - | |
| Acer 6920 Laptop CPU overheating issue/ | 2022-03-28 12:06 | - | |
| Acer 6920 Laptop Spontaneous Shutdown/ | 2022-03-28 12:06 | - | |
| Acer 6920 Tv Tuner driver for xp/ | 2022-03-28 12:06 | - | |
| Acer 6920 UAC slow in ltd user/ | 2022-03-28 12:06 | - | |
| Acer 6920 Vidock attempted/ | 2022-03-28 12:06 | - | |
| Acer 6920 bluetooth addon and cpu/ | 2022-03-28 12:06 | - | |
| Acer 6920 doesn't boot, not even into BIOS/ | 2022-03-28 12:06 | - | |
| Acer 6920g-6428 switches off and on randomly with no solution whatsoever/ | 2022-03-28 12:06 | - | |
| Acer 6920g - card reader problem/ | 2022-03-28 12:06 | - | |
| Acer 6920g. 9500m to 9600m gt swap/ | 2022-03-28 12:06 | - | |
| Acer 6920g/ | 2022-03-28 12:06 | - | |
| Acer 6920g BIOS/ | 2022-03-28 12:06 | - | |
| Acer 6920g NVIDIA Drivers=Screen dimness/ | 2022-03-28 12:06 | - | |
| Acer 6920g Power supply died/ | 2022-03-28 12:06 | - | |
| Acer 6920g Sound problem/ | 2022-03-28 12:06 | - | |
| Acer 6920g Vista to XP no sound audio/ | 2022-03-28 12:06 | - | |
| Acer 6920g Windows 7 help/ | 2022-03-28 12:06 | - | |
| Acer 6920g Windows RC 7100 issues/ | 2022-03-28 12:06 | - | |
| Acer 6920g Z partition problems/ | 2022-03-28 12:06 | - | |
| Acer 6920g battery Life- 2hours to 45 mins/ | 2022-03-28 12:06 | - | |
| Acer 6920g battery life issue/ | 2022-03-28 12:06 | - | |
| Acer 6920g black screen/ | 2022-03-28 12:06 | - | |
| Acer 6920g desperate for 1.16 MXM modded bios/ | 2022-03-28 12:06 | - | |
| Acer 6920g error/ | 2022-03-28 12:06 | - | |
| Acer 6920g graphic driver causes blue screen/ | 2022-03-28 12:06 | - | |
| Acer 6920g heating problem/ | 2022-03-28 12:06 | - | |
| Acer 6920g in-place upgrade to Win 7= laggy unplayable games/ | 2022-03-28 12:06 | - | |
| Acer 6920g keep shutting off, help!!!!!! Help!!!!!!/ | 2022-03-28 12:06 | - | |
| Acer 6920g lags during games and core at half speed! ..help/ | 2022-03-28 12:06 | - | |
| Acer 6920g missing data (D) drive/ | 2022-03-28 12:06 | - | |
| Acer 6920g no display plz help me/ | 2022-03-28 12:06 | - | |
| Acer 6920g problems with overheating/ | 2022-03-28 12:06 | - | |
| Acer 6920g sudden freezing/ | 2022-03-28 12:06 | - | |
| Acer 6920g thermal paste/ | 2022-03-28 12:06 | - | |
| Acer 6920g won't boot up even when plugged in/ | 2022-03-28 12:06 | - | |
| Acer 6920g won't turn on - need help fast/ | 2022-03-28 12:06 | - | |
| Acer 6920 installed 4gb ram and it says only using 2.99gm of it.. Is there a way to fix it/ | 2022-03-28 12:06 | - | |
| Acer 6920 laptop/ | 2022-03-28 12:06 | - | |
| Acer 6920 lcd problem/ | 2022-03-28 12:06 | - | |
| Acer 6920 problems/ | 2022-03-28 12:06 | - | |
| Acer 6920 red key é/ | 2022-03-28 12:06 | - | |
| Acer 6920 screen problem/ | 2022-03-28 12:06 | - | |
| Acer 6920 upgrade/ | 2022-03-28 12:06 | - | |
| Acer 6930-6560 is very big/ | 2022-03-28 12:06 | - | |
| Acer 6930 - New problem with replaced screen/ | 2022-03-28 12:06 | - | |
| Acer 6930 - Windows 7/ | 2022-03-28 12:06 | - | |
| Acer 6930/ | 2022-03-28 12:06 | - | |
| Acer 6930 2nd Hard Drive/ | 2022-03-28 12:06 | - | |
| Acer 6930 4500MHD Drivers/ | 2022-03-28 12:06 | - | |
| Acer 6930 6920 Build Quality/ | 2022-03-28 12:06 | - | |
| Acer 6930 8930 quad core ready/ | 2022-03-28 12:06 | - | |
| Acer 6930 BSOD - will updated BIOS fix/ | 2022-03-28 12:06 | - | |
| Acer 6930G & Windows 7 installation help!/ | 2022-03-28 12:06 | - | |
| Acer 6930G(6930-6941) Recovery Issue/ | 2022-03-28 12:06 | - | |
| Acer 6930G (bios corrupted)/ | 2022-03-28 12:06 | - | |
| Acer 6930G-744G32 Questions and performance vs my current MBP/ | 2022-03-28 12:06 | - | |
| Acer 6930G - Help Overheating/ | 2022-03-28 12:06 | - | |
| Acer 6930G - Upgrades, suggestions/ | 2022-03-28 12:06 | - | |
| Acer 6930G - Urgent Repairs/ | 2022-03-28 12:06 | - | |
| Acer 6930G - after adding +1Gig Ram Video drivers Crashing/ | 2022-03-28 12:06 | - | |
| Acer 6930G - a host of problems/ | 2022-03-28 12:06 | - | |
| Acer 6930G Audio not working/ | 2022-03-28 12:06 | - | |
| Acer 6930G Blu Ray Drive/ | 2022-03-28 12:06 | - | |
| Acer 6930G CPU Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 6930G Cinebass TUBA/ | 2022-03-28 12:06 | - | |
| Acer 6930G Driver Support Website Message Upadated for Windows 7 Downloads/ | 2022-03-28 12:06 | - | |
| Acer 6930G GPU Upgrade help/ | 2022-03-28 12:06 | - | |
| Acer 6930G GPU upgrade mixed success/ | 2022-03-28 12:06 | - | |
| Acer 6930G Heat/ | 2022-03-28 12:06 | - | |
| Acer 6930G Notebook HDD removal/ | 2022-03-28 12:06 | - | |
| Acer 6930G USB eSATA Port question/ | 2022-03-28 12:06 | - | |
| Acer 6930G Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 6930G Vent Fan Clarification/ | 2022-03-28 12:06 | - | |
| Acer 6930G WMP playback problems/ | 2022-03-28 12:06 | - | |
| Acer 6930G Warm on left side of keyboard/ | 2022-03-28 12:06 | - | |
| Acer 6930G biometric scanner!/ | 2022-03-28 12:06 | - | |
| Acer 6930G card/ | 2022-03-28 12:06 | - | |
| Acer 6930G connect to Sony Hifi audio system/ | 2022-03-28 12:06 | - | |
| Acer 6930G gaming screen problem/ | 2022-03-28 12:06 | - | |
| Acer 6930G shut down when closing screen/ | 2022-03-28 12:06 | - | |
| Acer 6930G temps/ | 2022-03-28 12:06 | - | |
| Acer 6930G upgrades worth it/ | 2022-03-28 12:06 | - | |
| Acer6930G with FX770M/ | 2022-03-28 12:10 | - | |
| Acer 6930G won't boot up/ | 2022-03-28 12:06 | - | |
| Acer 6930 Wireless Problems/ | 2022-03-28 12:06 | - | |
| Acer 6930ZG freezes/ | 2022-03-28 12:06 | - | |
| Acer 6930 drivers/ | 2022-03-28 12:06 | - | |
| Acer 6930g, not pulling its weight/ | 2022-03-28 12:06 | - | |
| Acer 6930g - randomly shutting down/ | 2022-03-28 12:06 | - | |
| Acer 6930g/ | 2022-03-28 12:06 | - | |
| Acer 6930g Bios/ | 2022-03-28 12:06 | - | |
| Acer 6930g Bios And Hdd P word Not Recognised/ | 2022-03-28 12:06 | - | |
| Acer 6930g Blue Ray player not working! Help!!/ | 2022-03-28 12:06 | - | |
| Acer 6930g Freeze/ | 2022-03-28 12:06 | - | |
| Acer 6930g Gfx Upgrade and Other possible upgrades/ | 2022-03-28 12:06 | - | |
| Acer 6930g Graphic card upgrade help/ | 2022-03-28 12:06 | - | |
| Acer 6930g LED Display/ | 2022-03-28 12:06 | - | |
| Acer 6930g complete conversion!/ | 2022-03-28 12:06 | - | |
| Acer 6930g overclock/ | 2022-03-28 12:06 | - | |
| Acer 6930g problems/ | 2022-03-28 12:06 | - | |
| Acer 6930 help please/ | 2022-03-28 12:06 | - | |
| Acer 6930 using windows vista reinstall/ | 2022-03-28 12:06 | - | |
| Acer 6930 weird audio-driver/ | 2022-03-28 12:06 | - | |
| Acer 6930 windows 7 audio-touch problem/ | 2022-03-28 12:06 | - | |
| Acer6935 - a problem with battery/ | 2022-03-28 12:10 | - | |
| Acer 6935G, New CPU, Blue Screening!!! -(/ | 2022-03-28 12:06 | - | |
| Acer6935G - DVD drive issue/ | 2022-03-28 12:10 | - | |
| Acer 6935G - Desperately out of ideas!/ | 2022-03-28 12:06 | - | |
| Acer 6935G - No Sound!/ | 2022-03-28 12:06 | - | |
| Acer6935G - PCI-Ex16@1/ | 2022-03-28 12:10 | - | |
| Acer 6935G - Upgrading the Hard drive - Clicking/ | 2022-03-28 12:06 | - | |
| Acer 6935G. Problems with keyboard/ | 2022-03-28 12:06 | - | |
| Acer 6935G/ | 2022-03-28 12:06 | - | |
| Acer 6935G CPU Upgrade - What options/ | 2022-03-28 12:06 | - | |
| Acer 6935G CPU upgrade/ | 2022-03-28 12:06 | - | |
| Acer 6935G Clean install - HELP/ | 2022-03-28 12:06 | - | |
| Acer 6935G HDD Upgrade/ | 2022-03-28 12:06 | - | |
| Acer 6935G Heat in certain area/ | 2022-03-28 12:06 | - | |
| Acer 6935G Hot HDD/ | 2022-03-28 12:06 | - | |
| Acer 6935G Keyboard!/ | 2022-03-28 12:06 | - | |
| Acer 6935G Numerous questions regarding upgrades and the like/ | 2022-03-28 12:06 | - | |
| Acer 6935G OS question/ | 2022-03-28 12:06 | - | |
| Acer 6935G Purchase question/ | 2022-03-28 12:06 | - | |
| Acer 6935G Ram and CPU Question/ | 2022-03-28 12:06 | - | |
| Acer 6935G T9600 upgrade success/ | 2022-03-28 12:06 | - | |
| Acer 6935G WARNING - DO NOT INSTALL BIOS VERSION 1.14/ | 2022-03-28 12:06 | - | |
| Acer 6935G cpu OC/ | 2022-03-28 12:06 | - | |
| Acer 6935G eRecovery stops at 99%/ | 2022-03-28 12:06 | - | |
| Acer 6935G keyboard problem/ | 2022-03-28 12:06 | - | |
| Acer 6935G with Vista Ultimate 32 or 64/ | 2022-03-28 12:06 | - | |
| Acer 6935 Screen Refresh Rate/ | 2022-03-28 12:06 | - | |
| Acer 6935 and SPDIF/ | 2022-03-28 12:06 | - | |
| Acer 6935g (bought From Pcworld, Sound Issue,any Help Please )/ | 2022-03-28 12:06 | - | |
| Acer 6935g - Ultime upgrade/ | 2022-03-28 12:06 | - | |
| Acer 6935g - VT-x/ | 2022-03-28 12:06 | - | |
| Acer 6935g. Problems with keyboard and graphics/ | 2022-03-28 12:06 | - | |
| Acer 6935g Help Please (win 7 install gone wrong )/ | 2022-03-28 12:06 | - | |
| Acer 6935g Upgrade Possibility's/ | 2022-03-28 12:06 | - | |
| Acer 6935g audio Q/ | 2022-03-28 12:06 | - | |
| Acer 6935g downclocking/ | 2022-03-28 12:06 | - | |
| Acer 6935g laptop monitor not detected/ | 2022-03-28 12:06 | - | |
| Acer 6935g quad core CPU upgrade/ | 2022-03-28 12:06 | - | |
| Acer 6935 in USA/ | 2022-03-28 12:06 | - | |
| Acer 6935 missing storage controller driver/ | 2022-03-28 12:06 | - | |
| Acer 6962, anyone recognize/ | 2022-03-28 12:07 | - | |
| Acer 7110 How do i restore without a restore disc/ | 2022-03-28 12:07 | - | |
| Acer 7110 Orbicam (Bison) does not take videos/ | 2022-03-28 12:07 | - | |
| Acer 7220 Have fan always on -overheats/ | 2022-03-28 12:07 | - | |
| Acer 7520 - gone totally dead/ | 2022-03-28 12:07 | - | |
| Acer 7520 - reboot loop, what are my options/ | 2022-03-28 12:07 | - | |
| Acer 7520G-604G25Bi WLAN N-Draft, !/ | 2022-03-28 12:07 | - | |
| Acer 7520G Notebook - audio problem!!!/ | 2022-03-28 12:07 | - | |
| Acer 7520G totally dead/ | 2022-03-28 12:07 | - | |
| Acer 7520G with new ATI HD 2600 - black screen/ | 2022-03-28 12:07 | - | |
| Acer 7520 charger/ | 2022-03-28 12:07 | - | |
| Acer 7520g problem/ | 2022-03-28 12:07 | - | |
| Acer 7520z BIOS custom upgrade/ | 2022-03-28 12:07 | - | |
| Acer 7530G Massively overheating/ | 2022-03-28 12:07 | - | |
| Acer 7530G RunDll32 failing on startup/ | 2022-03-28 12:07 | - | |
| Acer 7535G HDMI Out!/ | 2022-03-28 12:07 | - | |
| Acer 7535g/ | 2022-03-28 12:07 | - | |
| Acer 7540 Keyboard Problem/ | 2022-03-28 12:07 | - | |
| Acer 7551G-5821 CPU Support/ | 2022-03-28 12:07 | - | |
| Acer 7551G Fan Control utility (fixes overheating)/ | 2022-03-28 12:07 | - | |
| Acer 7551G Not Charging/ | 2022-03-28 12:07 | - | |
| Acer 7551G or Acer Aspire 5553G/ | 2022-03-28 12:07 | - | |
| Acer 7551G rattles and buzzes/ | 2022-03-28 12:07 | - | |
| Acer 7720, battery only gets to 90%, batt. LED flashes wildly/ | 2022-03-28 12:07 | - | |
| Acer 7720-6536 AHCI Drivers for XP64/ | 2022-03-28 12:07 | - | |
| Acer 7720-6536 CD-ROM Issues/ | 2022-03-28 12:07 | - | |
| Acer 7720- power settings problem when unplugging please help/ | 2022-03-28 12:07 | - | |
| Acer 7720G Disply Driver stops working!!!!!!/ | 2022-03-28 12:07 | - | |
| Acer 7720G FPS Drops/ | 2022-03-28 12:07 | - | |
| Acer 7720G Wireless Card issues thread/ | 2022-03-28 12:07 | - | |
| Acer 7720G black screen issue/ | 2022-03-28 12:07 | - | |
| Acer 7720G freezes on acer splash screen on start up/ | 2022-03-28 12:07 | - | |
| Acer 7720G vs Call of Duty 4/ | 2022-03-28 12:07 | - | |
| Acer 7720 Intel-VT disabled/ | 2022-03-28 12:07 | - | |
| Acer 7720 Upgrade adventure/ | 2022-03-28 12:07 | - | |
| Acer 7720 bluetooth socket location/ | 2022-03-28 12:07 | - | |
| Acer 7720g - low 3d performance/ | 2022-03-28 12:07 | - | |
| Acer 7720g CPU upgrade 2011/ | 2022-03-28 12:07 | - | |
| Acer 7720g Restoring back to factory settings/ | 2022-03-28 12:07 | - | |
| Acer 7720g Synaptics Touchpad Problem/ | 2022-03-28 12:07 | - | |
| Acer 7720g graphics problem Nvidia 8400m gs/ | 2022-03-28 12:07 | - | |
| Acer 7720g internal tv card and antenna connection/ | 2022-03-28 12:07 | - | |
| Acer 7720g laptop connecting to TV/ | 2022-03-28 12:07 | - | |
| Acer 7720g stopped posting/ | 2022-03-28 12:07 | - | |
| Acer 7720 problem/ | 2022-03-28 12:07 | - | |
| Acer 7720 runs hot , distorted audio, unpredictable fan/ | 2022-03-28 12:07 | - | |
| Acer 7720zg/ | 2022-03-28 12:07 | - | |
| Acer 7730.change vista to xp/ | 2022-03-28 12:07 | - | |
| Acer 7730 Empowering Technology Problem/ | 2022-03-28 12:07 | - | |
| Acer 7730ZG/ | 2022-03-28 12:07 | - | |
| Acer 7735-6719 laptop vs Acer 7530-5682 laptop/ | 2022-03-28 12:07 | - | |
| Acer 7735z drivers/ | 2022-03-28 12:07 | - | |
| Acer 7736G + 7736Z - No vertical scrollbar on touchpad/ | 2022-03-28 12:07 | - | |
| Acer 7736Z/ | 2022-03-28 12:07 | - | |
| Acer 7736 with backlit keyboard/ | 2022-03-28 12:07 | - | |
| Acer 7738G + SSD/ | 2022-03-28 12:07 | - | |
| Acer 7738G-6006 Burnt Pixels/ | 2022-03-28 12:07 | - | |
| Acer 7738G Touchpanel issues/ | 2022-03-28 12:07 | - | |
| Acer 7738G add second hard drive Guide/ | 2022-03-28 12:07 | - | |
| Acer 7738 vs 8935/ | 2022-03-28 12:07 | - | |
| Acer 7740G/ | 2022-03-28 12:07 | - | |
| Acer 7740G Hard Drive upgrade/ | 2022-03-28 12:07 | - | |
| Acer 7740G with a 5650 HD gpu, throttling problem/ | 2022-03-28 12:07 | - | |
| Acer 7740g - gpu failure - damaged/ | 2022-03-28 12:07 | - | |
| Acer 7740g BIOS/ | 2022-03-28 12:07 | - | |
| Acer 7741G (Intel I5, ATI 5470) - no POST, only backlight comes on - 99% time/ | 2022-03-28 12:07 | - | |
| Acer 7741G ATI 5650 driver problem/ | 2022-03-28 12:07 | - | |
| Acer 7741G Graphic driver causes crash/ | 2022-03-28 12:07 | - | |
| Acer 7741G constantly freezes crashes/ | 2022-03-28 12:07 | - | |
| Acer 7741g - help me to upgrade the ram -/ | 2022-03-28 12:07 | - | |
| Acer 7741g GPU Overheat 105+ degrees/ | 2022-03-28 12:07 | - | |
| Acer 7741g SSD Install/ | 2022-03-28 12:07 | - | |
| Acer 7741g Screen Failure/ | 2022-03-28 12:07 | - | |
| Acer 7745G keyboard problem/ | 2022-03-28 12:07 | - | |
| Acer 7745g-662 Blue-tooth question/ | 2022-03-28 12:07 | - | |
| Acer 7750-- good computer for Diablo 3/ | 2022-03-28 12:07 | - | |
| Acer 7750G/ | 2022-03-28 12:07 | - | |
| Acer 7750 Synaptics driver issues (Cant Acces PalmCheck)!!!!!!!!/ | 2022-03-28 12:07 | - | |
| Acer 7920 £399!!/ | 2022-03-28 12:07 | - | |
| Acer 8006 LMi or Acer 1714SMi/ | 2022-03-28 12:07 | - | |
| Acer 8100 - English XP CDs/ | 2022-03-28 12:07 | - | |
| Acer 8100 Series, noisy or not/ | 2022-03-28 12:07 | - | |
| Acer 8100 Smartcard Advice/ | 2022-03-28 12:07 | - | |
| Acer 8100 new Drivers 09 March 2005/ | 2022-03-28 12:07 | - | |
| Acer 8100 series- Who is the OEM ODM/ | 2022-03-28 12:07 | - | |
| Acer 8104 - Should I/ | 2022-03-28 12:07 | - | |
| Acer 8104 Audio input output Multiquesitons/ | 2022-03-28 12:07 | - | |
| Acer 8104 Heat Issues/ | 2022-03-28 12:07 | - | |
| Acer 8104 Opinions please/ | 2022-03-28 12:07 | - | |
| Acer 8104 Quality Control Issues/ | 2022-03-28 12:07 | - | |
| Acer 8106wlmi/ | 2022-03-28 12:07 | - | |
| Acer 8172 Z perfect ubuntu notebook/ | 2022-03-28 12:07 | - | |
| Acer 8200 & Vista/ | 2022-03-28 12:07 | - | |
| Acer 8200, ATI X1600 Driver Upgrade/ | 2022-03-28 12:07 | - | |
| Acer 8200/ | 2022-03-28 12:07 | - | |
| Acer 8200 8204 Battery Life/ | 2022-03-28 12:07 | - | |
| Acer 8202 and 8204 Avaliable in UK/ | 2022-03-28 12:07 | - | |
| Acer 8204 - Nic Issue/ | 2022-03-28 12:07 | - | |
| Acer 8204 - Strange temperature problem/ | 2022-03-28 12:07 | - | |
| Acer 8204 - Wireless Problem!!/ | 2022-03-28 12:07 | - | |
| Acer 8204/ | 2022-03-28 12:07 | - | |
| Acer 8204 Accessories/ | 2022-03-28 12:07 | - | |
| Acer 8204 Battery Issue If you wanna call it that/ | 2022-03-28 12:07 | - | |
| Acer 8204 DVD audio/ | 2022-03-28 12:07 | - | |
| Acer 8204 DVI Max Resolution/ | 2022-03-28 12:07 | - | |
| Acer 8204 Free of problems now/ | 2022-03-28 12:07 | - | |
| Acer 8204 Hard Drive Upgrade/ | 2022-03-28 12:07 | - | |
| Acer 8204 Question/ | 2022-03-28 12:07 | - | |
| Acer 8204 Service Manual... Anyone have it/ | 2022-03-28 12:07 | - | |
| Acer 8204 StandBy Hibernate Insufficient Resources... Solution/ | 2022-03-28 12:07 | - | |
| Acer 8204 TV-out/ | 2022-03-28 12:07 | - | |
| Acer 8204 Travelmate GPU Pixelation/ | 2022-03-28 12:07 | - | |
| Acer 8204 Updates/ | 2022-03-28 12:07 | - | |
| Acer 8204 VoIP phone/ | 2022-03-28 12:07 | - | |
| Acer 8204WLMI/ | 2022-03-28 12:07 | - | |
| Acer 8204WLMI Battery Issues and the Acer Xperience!/ | 2022-03-28 12:07 | - | |
| Acer 8204WLMI and Linux/ | 2022-03-28 12:07 | - | |
| Acer 8204WLMi Travelmate Notebook - Very Slow Start After Increasing RAM to 4GB/ | 2022-03-28 12:07 | - | |
| Acer 8204 WLMi failed to upgrade correctly to 4GB RAM/ | 2022-03-28 12:07 | - | |
| Acer 8204 Wlmi £/ | 2022-03-28 12:07 | - | |
| Acer 8204 and Catalyst 6.X/ | 2022-03-28 12:07 | - | |
| Acer 8204 black screen during start up/ | 2022-03-28 12:07 | - | |
| Acer 8204 does not boot with USB devices connected/ | 2022-03-28 12:07 | - | |
| Acer 8204 experiance/ | 2022-03-28 12:07 | - | |
| Acer 8204 messed up/ | 2022-03-28 12:07 | - | |
| Acer 8204 or 5672 Please help/ | 2022-03-28 12:07 | - | |
| Acer 8204 orbicam fix/ | 2022-03-28 12:07 | - | |
| Acer 8204 possible flaws/ | 2022-03-28 12:07 | - | |
| Acer 8204 running very hot/ | 2022-03-28 12:07 | - | |
| Acer 8204 vs acer 4674/ | 2022-03-28 12:07 | - | |
| Acer 8204wlmi bios to recognise 4gb/ | 2022-03-28 12:07 | - | |
| Acer 8210 USB port issue/ | 2022-03-28 12:07 | - | |
| Acer 8215 WLMi HDCP Support for Blu Ray/ | 2022-03-28 12:07 | - | |
| Acer 8215WLMi screen/ | 2022-03-28 12:07 | - | |
| Acer 8730/ | 2022-03-28 12:07 | - | |
| Acer 8730G - Upgreable/ | 2022-03-28 12:07 | - | |
| Acer 8730g P.O.S.T Fail/ | 2022-03-28 12:07 | - | |
| Acer 8735G LVDS problem (white lines)/ | 2022-03-28 12:07 | - | |
| Acer 8735zg gpu/ | 2022-03-28 12:07 | - | |
| Acer 8920-6030/ | 2022-03-28 12:07 | - | |
| Acer 8920-6048/ | 2022-03-28 12:07 | - | |
| Acer 8920 8930 6920 - Installing an internal TV card/ | 2022-03-28 12:07 | - | |
| Acer 8920 8930 changing LCD Panel/ | 2022-03-28 12:07 | - | |
| Acer 8920G-834G32Bn/ | 2022-03-28 12:07 | - | |
| Acer 8920G - CPU upgrade/ | 2022-03-28 12:07 | - | |
| Acer 8920G/ | 2022-03-28 12:07 | - | |
| Acer 8920G CineDash Problem/ | 2022-03-28 12:07 | - | |
| Acer 8920G Gaming performance - audio related/ | 2022-03-28 12:07 | - | |
| Acer 8920G finger print reader/ | 2022-03-28 12:07 | - | |
| Acer 8920G overheating/ | 2022-03-28 12:07 | - | |
| Acer 8920G partitioning help/ | 2022-03-28 12:07 | - | |
| Acer 8920G w 9500m gs shut itself down/ | 2022-03-28 12:07 | - | |
| Acer 8920 Issue with broadband card/ | 2022-03-28 12:07 | - | |
| Acer 8920 Nvidia Control Panel/ | 2022-03-28 12:07 | - | |
| Acer 8920 Shows Only Blue Screen/ | 2022-03-28 12:07 | - | |
| Acer 8920 bluetooth adapter location/ | 2022-03-28 12:07 | - | |
| Acer 8920g.Battery problems/ | 2022-03-28 12:07 | - | |
| Acer 8920g Blu-ray (please insert Disc)/ | 2022-03-28 12:07 | - | |
| Acer 8920g Speakers Problem/ | 2022-03-28 12:07 | - | |
| Acer 8920g graphics problem/ | 2022-03-28 12:07 | - | |
| Acer 8920g not 1080p/ | 2022-03-28 12:07 | - | |
| Acer 8920g reboots continuosly/ | 2022-03-28 12:07 | - | |
| Acer 8920 or 8930 into Older Sony Plasma with DVI Input/ | 2022-03-28 12:07 | - | |
| Acer 8930 - How to change display settings/ | 2022-03-28 12:07 | - | |
| Acer 8930 - Need to restore from recovery partition (still intact) - please help!/ | 2022-03-28 12:07 | - | |
| Acer 8930 - connecting two external monitors/ | 2022-03-28 12:07 | - | |
| Acer 8930/ | 2022-03-28 12:07 | - | |
| Acer 8930 6935g 1.14 bios slic 2.1/ | 2022-03-28 12:07 | - | |
| Acer 8930 AC power plug replacement/ | 2022-03-28 12:07 | - | |
| Acer 8930 Blu-ray/ | 2022-03-28 12:07 | - | |
| Acer 8930 Charging problems/ | 2022-03-28 12:07 | - | |
| Acer 8930 Display Dim on first startup/ | 2022-03-28 12:07 | - | |
| Acer 8930G, Dual Boot/ | 2022-03-28 12:07 | - | |
| Acer 8930G-844G32Bn upgrate/ | 2022-03-28 12:07 | - | |
| Acer 8930G - Problem adding 2nd hard drive/ | 2022-03-28 12:07 | - | |
| Acer 8930G - Windows 7 Upgrade/ | 2022-03-28 12:07 | - | |
| Acer 8930G 9A4G100WN overheating GPU/ | 2022-03-28 12:07 | - | |
| Acer 8930G Audio Decoder/ | 2022-03-28 12:07 | - | |
| Acer 8930G Black screen/ | 2022-03-28 12:07 | - | |
| Acer 8930G Blu Ray Problems/ | 2022-03-28 12:07 | - | |
| Acer 8930G Blu ray woes/ | 2022-03-28 12:07 | - | |
| Acer 8930G Boot Problems,Please Help/ | 2022-03-28 12:07 | - | |
| Acer 8930G CPU Upgrade T6400 to Q9100/ | 2022-03-28 12:07 | - | |
| Acer 8930G CPU Upgrade issue/ | 2022-03-28 12:07 | - | |
| Acer 8930G Drivers/ | 2022-03-28 12:07 | - | |
| Acer 8930G HDMI Question/ | 2022-03-28 12:07 | - | |
| Acer 8930G Highest CPU What can I get/ | 2022-03-28 12:07 | - | |
| Acer 8930G INTEL CORE 2 QUAD Q9000 Question/ | 2022-03-28 12:07 | - | |
| Acer 8930G Issues/ | 2022-03-28 12:07 | - | |
| Acer 8930G Quad core options/ | 2022-03-28 12:07 | - | |
| Acer 8930G Touch Screen Installation (and Virtualization, again)/ | 2022-03-28 12:07 | - | |
| Acer 8930G VT enable success in windows!/ | 2022-03-28 12:07 | - | |
| Acer 8930G and wireless/ | 2022-03-28 12:07 | - | |
| Acer 8930G anyone have this laptop with windows 7/ | 2022-03-28 12:07 | - | |
| Acer 8930G bios update help/ | 2022-03-28 12:07 | - | |
| Acer 8930G failure/ | 2022-03-28 12:07 | - | |
| Acer 8930G no eRecovery icon in Windows/ | 2022-03-28 12:07 | - | |
| Acer 8930G power issues/ | 2022-03-28 12:07 | - | |
| Acer 8930G questions/ | 2022-03-28 12:07 | - | |
| Acer 8930G repair woes/ | 2022-03-28 12:07 | - | |
| Acer 8930G screen problem/ | 2022-03-28 12:07 | - | |
| Acer 8930G sound issue (since installing drivers someone told me about on here!)/ | 2022-03-28 12:07 | - | |
| Acer 8930G tweaks, wallpapers, etc/ | 2022-03-28 12:07 | - | |
| Acer 8930G upgrade/ | 2022-03-28 12:07 | - | |
| Acer 8930G upgrade help needed/ | 2022-03-28 12:07 | - | |
| Acer 8930G windows 7/ | 2022-03-28 12:07 | - | |
| Acer 8930G with Win 8 64bit, 5.1 sound problem/ | 2022-03-28 12:07 | - | |
| Acer 8930G won't boot/ | 2022-03-28 12:07 | - | |
| Acer 8930 Recovery Media/ | 2022-03-28 12:07 | - | |
| Acer 8930 Release Date/ | 2022-03-28 12:07 | - | |
| Acer 8930 Replacement battery And tips/ | 2022-03-28 12:07 | - | |
| Acer 8930 Synaptic Tool Help Needed!!!!/ | 2022-03-28 12:07 | - | |
| Acer 8930 enter Current Password/ | 2022-03-28 12:07 | - | |
| Acer 8930g (from 2008) issue, laptop suddenly turned off and now won't boot/ | 2022-03-28 12:07 | - | |
| Acer 8930g, insyde Bios Dead!/ | 2022-03-28 12:07 | - | |
| Acer 8930g 18.4 Service Manual/ | 2022-03-28 12:07 | - | |
| Acer 8930g Battery Not Detected/ | 2022-03-28 12:07 | - | |
| Acer 8930g DEAD!!!/ | 2022-03-28 12:07 | - | |
| Acer 8930g Display Problem/ | 2022-03-28 12:07 | - | |
| Acer 8930g Finally a Problem Black Screen/ | 2022-03-28 12:07 | - | |
| Acer 8930g Graphic card/ | 2022-03-28 12:07 | - | |
| Acer 8930g Power Problems/ | 2022-03-28 12:07 | - | |
| Acer 8930g Restore Disk Probs - HELLPPP!!/ | 2022-03-28 12:07 | - | |
| Acer 8930g Screen Compatibility/ | 2022-03-28 12:07 | - | |
| Acer 8930g Upgrade to 7 Questions/ | 2022-03-28 12:07 | - | |
| Acer 8930 gaming problems!/ | 2022-03-28 12:07 | - | |
| Acer 8930g and 5.1 audio problem/ | 2022-03-28 12:07 | - | |
| Acer 8930g problems with XP/ | 2022-03-28 12:07 | - | |
| Acer 8930g recovery issue/ | 2022-03-28 12:07 | - | |
| Acer 8930 multitouch/ | 2022-03-28 12:07 | - | |
| Acer 8930 service manual/ | 2022-03-28 12:07 | - | |
| Acer 8930 throttling issue fix/ | 2022-03-28 12:07 | - | |
| Acer 8930 user i need your help please/ | 2022-03-28 12:07 | - | |
| Acer 8935G/ | 2022-03-28 12:07 | - | |
| Acer 8935G Backlight turns itself off after a few seconds/ | 2022-03-28 12:07 | - | |
| Acer 8935G Keyboard Issues/ | 2022-03-28 12:07 | - | |
| Acer 8935G Notebook graphic problems/ | 2022-03-28 12:07 | - | |
| Acer 8935G Second HDD/ | 2022-03-28 12:07 | - | |
| Acer 8935G Upgrade/ | 2022-03-28 12:07 | - | |
| Acer 8935G backlit keyboard problem/ | 2022-03-28 12:07 | - | |
| Acer 8935G questions/ | 2022-03-28 12:07 | - | |
| Acer 8935G screen issue - goes black then flashes colors/ | 2022-03-28 12:07 | - | |
| Acer 8935G sound problem/ | 2022-03-28 12:07 | - | |
| Acer 8935g - Upgrading GPU - CPU - RAM HELP/ | 2022-03-28 12:07 | - | |
| Acer 8935g - Using Wrong Display Adapter/ | 2022-03-28 12:07 | - | |
| Acer 8935g Ati Radeon HD 4670 -- Geforce GTS 250m/ | 2022-03-28 12:07 | - | |
| Acer 8935g CPU GPU Upgarde help[/ | 2022-03-28 12:07 | - | |
| Acer 8935g Wifi botton Frustration!/ | 2022-03-28 12:07 | - | |
| Acer 8935g does not detect replacement ATI 6770M graphics card/ | 2022-03-28 12:07 | - | |
| Acer 8935g install xp and boot from arcade button/ | 2022-03-28 12:07 | - | |
| Acer 8935g overheating [solution]/ | 2022-03-28 12:07 | - | |
| Acer 8940G - Quick Start Guide/ | 2022-03-28 12:07 | - | |
| Acer 8940g HELP/ | 2022-03-28 12:07 | - | |
| Acer 8940g Random Restarts even in Idle Mode/ | 2022-03-28 12:07 | - | |
| Acer 8942G Speaker Problem/ | 2022-03-28 12:07 | - | |
| Acer 8942G graphic card upgrade/ | 2022-03-28 12:07 | - | |
| Acer 8942g Windows 7 only 2.43gb out of 8gb usable RAM/ | 2022-03-28 12:07 | - | |
| Acer 8943G - Remote Control/ | 2022-03-28 12:07 | - | |
| Acer 8943G - can I do a fresh windows install if the BIOS is locked/ | 2022-03-28 12:07 | - | |
| Acer 8943G BIOS Update/ | 2022-03-28 12:07 | - | |
| Acer 8943G Fan/ | 2022-03-28 12:07 | - | |
| Acer 8943G Problem/ | 2022-03-28 12:07 | - | |
| Acer 8943G Touch Pad and Scrolling/ | 2022-03-28 12:07 | - | |
| Acer 8943G game freeze sound stutter problem/ | 2022-03-28 12:07 | - | |
| Acer 8943g - Need very large laptop Case!/ | 2022-03-28 12:07 | - | |
| Acer 8943g - questions from potential buyer/ | 2022-03-28 12:07 | - | |
| Acer 8943g CPU Upgrades/ | 2022-03-28 12:07 | - | |
| Acer 8943g Owners Lounge/ | 2022-03-28 12:07 | - | |
| Acer 8943g media controls on the touchpad still fail to light up/ | 2022-03-28 12:07 | - | |
| Acer 8943g memory upgrade/ | 2022-03-28 12:07 | - | |
| Acer 8950G 9479 media console problems/ | 2022-03-28 12:07 | - | |
| Acer 9114, slick BUT problems/ | 2022-03-28 12:07 | - | |
| Acer 9300-5005/ | 2022-03-28 12:07 | - | |
| Acer 9300-5317 crashed/ | 2022-03-28 12:07 | - | |
| Acer 9300/ | 2022-03-28 12:07 | - | |
| Acer 9300 BIOS failure/ | 2022-03-28 12:07 | - | |
| Acer 9300 BIOS failure and recovery tips/ | 2022-03-28 12:07 | - | |
| Acer 9300 CDR Burning Problem!/ | 2022-03-28 12:07 | - | |
| Acer 9300 HDD space/ | 2022-03-28 12:07 | - | |
| Acer 9300 Vista install problem/ | 2022-03-28 12:07 | - | |
| Acer 9300 audio is low/ | 2022-03-28 12:07 | - | |
| Acer 9300 dvd drive probs/ | 2022-03-28 12:07 | - | |
| Acer 9301 Vista graphics driver question/ | 2022-03-28 12:07 | - | |
| Acer 9303WSMI/ | 2022-03-28 12:07 | - | |
| Acer 9303WSMi start when plug in the power/ | 2022-03-28 12:07 | - | |
| Acer 9303 killed stone dead by Acers bios flash!!/ | 2022-03-28 12:07 | - | |
| Acer 9410 XP downgrade problem - COM & LPT not functioning/ | 2022-03-28 12:07 | - | |
| Acer 9410Z fan/ | 2022-03-28 12:07 | - | |
| Acer 9410 battery won't charge to 100%/ | 2022-03-28 12:07 | - | |
| Acer 9410 downgrade to XP problem/ | 2022-03-28 12:07 | - | |
| Acer 9410z Spdif Out No Sound !/ | 2022-03-28 12:07 | - | |
| Acer 9411 AWSMi troubles/ | 2022-03-28 12:07 | - | |
| Acer 9424wsmi batterry problem/ | 2022-03-28 12:07 | - | |
| Acer 9425WSMi line on screen/ | 2022-03-28 12:07 | - | |
| Acer 9500 CPU does not work, any suggestions/ | 2022-03-28 12:07 | - | |
| Acer 9500 LCD replacement/ | 2022-03-28 12:07 | - | |
| Acer 9502WSMi cpu temp/ | 2022-03-28 12:07 | - | |
| Acer 9502 will be here tomorrow/ | 2022-03-28 12:07 | - | |
| Acer 9510 available in Germany ... but/ | 2022-03-28 12:07 | - | |
| Acer 9800 - Replacing Keyboard/ | 2022-03-28 12:07 | - | |
| Acer 9800/ | 2022-03-28 12:07 | - | |
| Acer 9810/ | 2022-03-28 12:07 | - | |
| Acer 9810 9810-6994 CPU Upgrade Questions/ | 2022-03-28 12:07 | - | |
| Acer9810 XP Pro and Obicam/ | 2022-03-28 12:10 | - | |
| Acer 9920/ | 2022-03-28 12:07 | - | |
| Acer 9920G Black blank screen of death/ | 2022-03-28 12:07 | - | |
| Acer 9920 GFX change/ | 2022-03-28 12:07 | - | |
| Acer 9920 GPU upgrade/ | 2022-03-28 12:07 | - | |
| Acer A0A 110-1137 Upgrades/ | 2022-03-28 12:07 | - | |
| Acer A515-51G Car Charger/ | 2022-03-28 12:07 | - | |
| Acer AC power question/ | 2022-03-28 12:07 | - | |
| Acer AM5641 what video card/ | 2022-03-28 12:07 | - | |
| Acer AO522 compatible chargers and keyboards/ | 2022-03-28 12:07 | - | |
| Acer AO722 netbook - What sata/ | 2022-03-28 12:07 | - | |
| Acer AO751h Intel z520 @ 1.33 Ghz 2 GB Windows Vista home basic from walmart. Problems/ | 2022-03-28 12:07 | - | |
| Acer AO 756 Speaker Mod/ | 2022-03-28 12:07 | - | |
| Acer AOD150 and the Sony Bravia KDL 40ex600/ | 2022-03-28 12:07 | - | |
| Acer AOD250-1146 opinion/ | 2022-03-28 12:07 | - | |
| Acer AOD255-1549 Ram Upgrade/ | 2022-03-28 12:07 | - | |
| Acer AOD255 Dual Core Netbook Ram Upgrade/ | 2022-03-28 12:07 | - | |
| Acer AS 1410 - Play Battlefield 2/ | 2022-03-28 12:07 | - | |
| Acer AS1410 Battery Purchase Anywhere/ | 2022-03-28 12:07 | - | |
| Acer AS1410 Intel I5 ULV CPU -)/ | 2022-03-28 12:07 | - | |
| Acer AS1410 Sound no longer works, no device detected/ | 2022-03-28 12:07 | - | |
| Acer AS1410 w SU2300 speedstep/ | 2022-03-28 12:07 | - | |
| Acer AS1410 work with Aspire One charger/ | 2022-03-28 12:07 | - | |
| Acer AS1662WLMi-XPH vs Acer AS1681WLMi-2MB/ | 2022-03-28 12:07 | - | |
| Acer AS1681WLMI question/ | 2022-03-28 12:07 | - | |
| Acer AS1691WLMi/ | 2022-03-28 12:07 | - | |
| Acer AS 1801WSMi P4 515 17 WXGA-CrystalBrite ATI/ | 2022-03-28 12:07 | - | |
| Acer AS1810T-6188 SETUP HELP (11.5 SU9400 4Gb)/ | 2022-03-28 12:07 | - | |
| Acer AS1830 fan is always on and loud/ | 2022-03-28 12:07 | - | |
| Acer AS3003WLMI DVD burner removal/ | 2022-03-28 12:07 | - | |
| Acer AS3810T-8737/ | 2022-03-28 12:07 | - | |
| Acer AS3830TG-6431 unboxing and first look/ | 2022-03-28 12:07 | - | |
| Acer AS5002WLMI Notebook PC/ | 2022-03-28 12:07 | - | |
| Acer AS5100-5540/ | 2022-03-28 12:07 | - | |
| Acer AS5112WLMi. Is there such a laptop/ | 2022-03-28 12:07 | - | |
| Acer AS5534-1096 WalMart/ | 2022-03-28 12:07 | - | |
| Acer AS5552G-7859 Laptop Sale - Good VS Bad/ | 2022-03-28 12:07 | - | |
| Acer AS5560-Sb653 Loose Hinge/ | 2022-03-28 12:07 | - | |
| Acer AS5630-6368 or AS5570-4011/ | 2022-03-28 12:07 | - | |
| Acer AS5630 Problems/ | 2022-03-28 12:07 | - | |
| Acer AS5632 XP pro suport/ | 2022-03-28 12:07 | - | |
| Acer AS5672 Screen Upgrade/ | 2022-03-28 12:07 | - | |
| Acer AS5672WLMi vs. HP dv5000t/ | 2022-03-28 12:07 | - | |
| Acer AS5672 and OSX/ | 2022-03-28 12:07 | - | |
| Acer AS5674WMHi/ | 2022-03-28 12:07 | - | |
| Acer AS5742G-6846 - Questions about display/ | 2022-03-28 12:07 | - | |
| Acer AS5742G-6846/ | 2022-03-28 12:07 | - | |
| Acer AS5750 - please complete operating system setup process before doing system recovery/ | 2022-03-28 12:07 | - | |
| Acer AS5920/ | 2022-03-28 12:07 | - | |
| Acer AS5920G - Reinstalling Vista/ | 2022-03-28 12:07 | - | |
| Acer AS5920 Windows XP SP3 drivers/ | 2022-03-28 12:07 | - | |
| Acer AS 5942g+IR remote help/ | 2022-03-28 12:07 | - | |
| Acer AS6920G - Keyboard error/ | 2022-03-28 12:07 | - | |
| Acer AS7560 worth buying/ | 2022-03-28 12:07 | - | |
| Acer AS7741G-6426 any good/ | 2022-03-28 12:07 | - | |
| Acer AS8735G upgrade problem/ | 2022-03-28 12:07 | - | |
| Acer AS8735ZG motherboard/ | 2022-03-28 12:07 | - | |
| Acer AS8930-6442 Sound Panel problems & upgrade/ | 2022-03-28 12:07 | - | |
| Acer AS8943G needs intel 6300AGN card/ | 2022-03-28 12:07 | - | |
| Acer AS 8950G LCD not working/ | 2022-03-28 12:07 | - | |
| Acer AS9301WSMi laptop/ | 2022-03-28 12:07 | - | |
| Acer AS9301WSMi laptop hard drive/ | 2022-03-28 12:07 | - | |
| Acer ASPIRE 4553-1_BR333/ | 2022-03-28 12:07 | - | |
| Acer ASPIRE 5315 eRecovery problem/ | 2022-03-28 12:07 | - | |
| Acer ASPIRE 5315 mod upgrade club/ | 2022-03-28 12:07 | - | |
| Acer ASPIRE 5530G Pink light/ | 2022-03-28 12:07 | - | |
| Acer ASPIRE 5920G problems/ | 2022-03-28 12:08 | - | |
| Acer ASPIRE 7720G Audio and Clock Issues/ | 2022-03-28 12:08 | - | |
| Acer ASV3-731-4634 2nd bay/ | 2022-03-28 12:09 | - | |
| Acer ASpire 5102 WLMi BIOS (memory settings) question for memory upgrade/ | 2022-03-28 12:07 | - | |
| Acer ASpire 5610z fails to boot... PLease Help!/ | 2022-03-28 12:07 | - | |
| Acer ASpire 5630 Media Keys not working/ | 2022-03-28 12:07 | - | |
| Acer ASpire 5672 WLMI died - Cause- Unknown! Please help/ | 2022-03-28 12:07 | - | |
| Acer AX3950-U2042 Desktop Info/ | 2022-03-28 12:09 | - | |
| Acer Accessories/ | 2022-03-28 12:07 | - | |
| Acer Advantage Warranty/ | 2022-03-28 12:07 | - | |
| Acer Advantage platinum 3 yr bundle/ | 2022-03-28 12:07 | - | |
| Acer Alt + F10 Recovery/ | 2022-03-28 12:07 | - | |
| Acer Anti Glare Screen/ | 2022-03-28 12:07 | - | |
| Acer Ao751h Ram Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Apire 1410/ | 2022-03-28 12:07 | - | |
| Acer Apire 5100/ | 2022-03-28 12:07 | - | |
| Acer Apire 6920G Performance for gaming !!!/ | 2022-03-28 12:07 | - | |
| Acer Apsire 5100-3357 AC Adapter problem/ | 2022-03-28 12:07 | - | |
| Acer Apsire 6530G odd fault/ | 2022-03-28 12:07 | - | |
| Acer Apsire One Just keeps on hating everything/ | 2022-03-28 12:07 | - | |
| Acer Arcade - Help!/ | 2022-03-28 12:07 | - | |
| Acer Arcade....Anybody use it/ | 2022-03-28 12:07 | - | |
| Acer Arcade/ | 2022-03-28 12:07 | - | |
| Acer Arcade Delux/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe Problem/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe Removal help/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe and LCT TV (via HDMI)/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe audio settings/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe booting on it's own/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe can't find MP3s/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe coming up as a keylogger virus/ | 2022-03-28 12:07 | - | |
| Acer Arcade Deluxe v2.6.7130 Trojan/ | 2022-03-28 12:07 | - | |
| Acer Arcade InstantOn & DivX files/ | 2022-03-28 12:07 | - | |
| Acer Arcade Issue/ | 2022-03-28 12:07 | - | |
| Acer Arcade Quick Boot - 5920g/ | 2022-03-28 12:07 | - | |
| Acer Arcade has completly ruined my Acer 5930G/ | 2022-03-28 12:07 | - | |
| Acer Arcade has trashed Acer Aspire 5920/ | 2022-03-28 12:07 | - | |
| Acer Arcade on Aspire 4520/ | 2022-03-28 12:07 | - | |
| Acer Arcade partition importance/ | 2022-03-28 12:07 | - | |
| Acer As5672wlmi-165/ | 2022-03-28 12:07 | - | |
| Acer Asipre 6920 Windows 7 Problems, Need Help Please/ | 2022-03-28 12:07 | - | |
| Acer Asp. 5021wlmi + launch manager +vista/ | 2022-03-28 12:07 | - | |
| Acer Asp. 5602-eRecovery Password lost!/ | 2022-03-28 12:07 | - | |
| Acer Asp 6736G problem/ | 2022-03-28 12:07 | - | |
| Acer Asphire/ | 2022-03-28 12:07 | - | |
| Acer Aspie Help/ | 2022-03-28 12:07 | - | |
| Acer Aspier 3630 Boot Failure/ | 2022-03-28 12:07 | - | |
| Acer Aspier 5112WLMI/ | 2022-03-28 12:07 | - | |
| Acer Aspir 1705 SCi/ | 2022-03-28 12:07 | - | |
| Acer Aspir 5942g power management and backup manager problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire (any way to disable blinking orange WIFI status LED)/ | 2022-03-28 12:07 | - | |
| Acer Aspire, 6 weeks old, dust under screen already/ | 2022-03-28 12:09 | - | |
| Acer Aspire - 5740 [HD Issues, May be corrupt]/ | 2022-03-28 12:07 | - | |
| Acer Aspire - Blinking power light/ | 2022-03-28 12:07 | - | |
| Acer Aspire - Bluescreen w. certain programs/ | 2022-03-28 12:07 | - | |
| Acer Aspire -Built in Mic not working/ | 2022-03-28 12:07 | - | |
| Acer Aspire - Dual monitors/ | 2022-03-28 12:07 | - | |
| Acer Aspire -Model 5601AWLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire - Problems in CHKDSK/ | 2022-03-28 12:07 | - | |
| Acer Aspire. . .2 hard drives/ | 2022-03-28 12:09 | - | |
| Acer Aspire/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2K series - what screws bluetooth/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5 (A515-51) Clean Install Whats In the Box/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5 A515-51G-53V6 upgrades/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5 Slim memory upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 7 (i7-7700hq+gtx1060 6gb)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7 A717-72G-700J/ | 2022-03-28 12:08 | - | |
| Acer Aspire 15.6 AMD Athlon 64 TF-20 1.6GHz Laptop Good/ | 2022-03-28 12:07 | - | |
| Acer Aspire 17.3 Laptop featuring Intel Core i7-720QM (AS7745G-6845)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 574g2- Core-i5- Bluetooth/ | 2022-03-28 12:08 | - | |
| Acer Aspire 1301XV sound recording quality/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1302 problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1310/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1350 HDD Password/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1355/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1362/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1363- any reviews/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1363WLCI or Travelmate TM4002WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1400/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 (11.6) Keyboard Identical to Timeline 1810/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 (1810T) 11.6 Boot Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410-2954/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 - My Thoughts/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 - Weak Hinges HELP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 - Win 7/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 - duplicate model # Need AC adapter/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 - dying after teacup disaster/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 11 not going into sleep mode when close the lid but goes into sleep mode by pressing FN + F4/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 CPU Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 High CPU Usage/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 High Pitched Noise Whine/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 Intel SU3500 with online Flash Video and Multi-tasking/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 Service Manual Needed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 Wi-Fi Chip Noise/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 and 1810T Timeline (single core) 11.6 Thread/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 and 1810 Timeline 11.6 Thread/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 mouse pad & keyboard conflict HELP!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1410 screen garbled after sleep, following Intel driver update/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1430Z-4677 an i5 or U5600/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1430Z won't get into window 7, can't use recovery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1454 wireless adapter problem!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1500 - CPU Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1513LMi 64bit drivers/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1520 Bios Shut Down/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1521LCI/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1522LMI cleaning/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1524WLMi Memory/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1600 Series problem (1603LM)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640 + or - DVD re-writer/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640 - How to flash BIOS from DOS, not winphlash/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640Z/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640Z Processor Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640 and supervisor password/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640 not booting/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640 wireless doesn't work after Windows 7 install/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640z Mouse And Keyboard Issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640z Wifi problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1640z cd dvd wont write but reads fine!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1642WLMi - destryed bios, now what/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1642 ZWLMi - Ram update and slow boots with HP Printer/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1644 WLMi Windows 7 Drivers/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1652WLMi-all good but NO SVIDEO! -(/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1652WMLI - knacked/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1652WMLi- No reboot after system freeze/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1652 video flex cable/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1652wlmi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1672WLMi or 1522WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1672 wlmi, external power [-(]/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1674WLMi Comments/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1680 + Vista = No battery detected...pls help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1680 Extensa 3000 series/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1680 Service Repair Manual Needed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1680 USB problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681 - email button/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681 2 3 WLMi or TM 4502 WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681 DVD Writer/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681WLCi crashing with games/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681WLMI benchmark result/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681WLMi - Refurbished/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681 and battery led/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1681 series, passe/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1682WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1683WLMi - Card Reader Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1683WLMi specifications/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1683wlmi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1690/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1690WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1690 recovery partition need/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1690 ultra high temperature/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1691's VGA/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1691WLMi - Supply Problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1691WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1691 WLMi DVD-driver problems - HELP!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1691WLMi and bios is not flashable !/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1691WLMi cardreader problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1692 Vista Video Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1692 WLMI S-video/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1692WLMi won't Boot -(/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1692 random problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1693 with DDR2 667 memory/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1694/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1694WLMI/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1694WLMI Vista Drivers/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1694WLMi- Is the Video Dedicated/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1694 WLMi Review (pics, specs)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1694WLMi or Acer Ferrari 4002 WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1694WMLI - Quick review !/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1694 wlmi bios update problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire1694 wlmi dvd replacement/ | 2022-03-28 12:09 | - | |
| Acer Aspire 1700 Not Powering Up/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1700 Review/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1710 - HDD problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1710 Graphic/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1710 help needed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1711/ | 2022-03-28 12:07 | - | |
| Acer Aspire1714Smi & Windows Vista/ | 2022-03-28 12:09 | - | |
| Acer Aspire 1800/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1800 Lid Switch/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1800 Please Help!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1801WSMi,possible underclock/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1802WSMI can't erase DVDs/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1802WSMi - x600 Mobility Ati/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1804-Cooling fans/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1804wmsi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1810 Tablets Thread/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1810 advice please/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1820 & 1825 touchscreen, help and info/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1825PT, does anyone own one/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1825PTZ runs pretty hot!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1825pt wifi mysteriously stopped working/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1830t i5 430 worse 3d than 1810tz !!!!! HELP !!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1960/ | 2022-03-28 12:07 | - | |
| Acer Aspire 1962 CD DVD drive problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2001 LCI/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2003WLMi - HDD Bay/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2003WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2010 Won't Power On!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2012WLMi wireless disconnects/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2012lmi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2020/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2020 Media Keys/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2021WLCi 4 $767.99 + $100 rebate/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2023 & Bluetooth/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2023 fan problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2025/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2025 vs. configured HP zt3000/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2025wlmi Review w Photos + Benchmarks/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2026/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2390 BIOS problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2920 + xp drivers (novice user)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2920 Service Manual/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2930/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2930Z - Downgrading to XP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2930 repair/ | 2022-03-28 12:07 | - | |
| Acer Aspire 2930z automatic power off/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000 - Not recognising CD Drive/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000 Base Install Lockup/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000 Hard Disk Upgarde/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000 Model ZL5 memory upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000 Series/ | 2022-03-28 12:07 | - | |
| Acer Aspire3000 battery charger/ | 2022-03-28 12:09 | - | |
| Acer Aspire 3000 keyboard wont work - help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000 problems with hard drive/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000 series - sound issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3000 series owners, does your hard drive make noise/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3002LCI notebook/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3002LCI power jack problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3002LCi - Reformat, Drivers, etc. - HELP!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3002LCi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3002LCi 3003LCi Owners/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3002LCi manual/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3002WLC mac id problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3002lc unable to boot from cd/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003 (3003WLCI) - undervolting/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003 LCi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003LCi Reformatting Reinstalling windows Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003 LCi Wireless B G Drivers/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003WLMi problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003 not able to play Starcraft/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003 review (3003WLCI)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003 switching Off Automatically/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3003 wcli Fan replacement/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3004WLCi Fan Problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3004WLMI Recovery Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3009WLCi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3020 lcd problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3023 & X700 Laptops Advice/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3023WLMI Retailer/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3050-1150 Video Card Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3050 Dual Monitor Question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3050 Resource conflict - PCI on Motherboard/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3050 Will not Shutdown/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3050 With Intel/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3050 and Intel 6230 system freeze/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3050 gets very hot (CPU )/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3050 recovery problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3053 upgrades/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3100-3102 series/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3100 - RAM Question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3100 CPU upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3100 Series laptop (3104nWlmi) CPU Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3100 crashed during Vista now asking 4 Bios Password/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3100 screen not turning on/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3100series/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3102 Not recognize 2x2Gb Memory/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3160 eRecovery Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3200 AMD 64-bit Notebook/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3500 Series Touchpad Keyboard Issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3500 keyboard scroll pad dead/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3503 Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3600 5500 series RAM slot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3610/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3610 upgrade question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3613WLMi...your thoughts on laptop price/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3620 Bios Update/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3624WXCi @ CompUSA for $400 after rebates. Is it any good/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3628/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3630 Laptop CMOS Help!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3634 WLMi - Bluetooth (BT)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3650/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680-2022 help!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680-2354 - Running Hot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680-2682 HELP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680-2682 atheros network adapter/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680-2682 hard drive upgrade options/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 - Power adapter problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 5570 5580 laptop cooling mod/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 Bluetooth Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 Celeron 430 Overclocking!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 HDD, BIOS issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 Headphone SPDIF jack problem (no sound)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 Headphones Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 Memory/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 No Power, no lights/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 Sound issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 audio video issues when playing DVDs/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 dis-assembly/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 internal dial-up modem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 not turning on/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3680 problems- No sound, will not take E drive/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3683 Audio Problem! Help Please!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3683 Help!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3683 LAN problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3683NWXMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3683 volume/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3690-2940 Recovery Media/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3690-2970 Questions/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3690 - Best CPU upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3690 Heat Issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3690 Help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3690 Network & Ethernet Drivers XP Professional Needed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3690 Tips & Tricks/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3690 media buttons/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3692 - bluetooth activation/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3740G/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3810T CPU upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3810 TZ/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3810TZ USB/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3810TZ USB drive/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3810 Thread/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3810 battery is not working plugged in,not charging/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3810tz No Audio/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3820T/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3820TG Don't have power, as in dead/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3820TG Wont Start When Pressing Power Button/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3820TG killing hard drives/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3820T screen issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3830TG- NVIDIA Graphics is missing/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3935/ | 2022-03-28 12:07 | - | |
| Acer Aspire 3935 larger capacity battery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4135 screen/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4220/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4220 Bluetooth Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4310/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4315-2004 mouse problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4315 - XP - Lan problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4315Mi - Downgrade to XP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4315 Owner's Lounge/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4315 PQservice AltF10 HELP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4315 or Aspire 4730z/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4315 screen problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4520/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4520 Processor upgrade (info needed please help)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4520 Slow to Boot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4520 T55 Driver problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4520 heating cooling issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4530/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4530 Running Like A Oven!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4530 Temperature readings are off the charts/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4530 Weird Headphone Jack Problem!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4540/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4547G + eGPU/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4551-2522 Caps Lock indicator doesn't display/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4553g graphics card question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4710G-GPU Upgrade Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4710G modded bios for 9600M GT GPU/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4715Z CPU Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4720-4825 losing internet connection periodically/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4720 - Windows XP installing Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4720 Linux Drivers/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4720Z/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4720Z troubleshooting/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4720 long shutdown problem soultion here/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4720z Atheros card physical installation/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4720z continually enters stand by on its own/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4730Z - Power issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4730z Booting Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4730z Touchpad Scroll not working in windows 7/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4730z manual available/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4736 4736z/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4736G Crisis Disk/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4736z video card upgrade add/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4741G Recovery problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4741G can support Optimus/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4741G with NVidia GT540M/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4741g/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4743G Info/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4745 boot with lot of RRRR character/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4745g graphics/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4750G BIOS Mod Request/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4750G BIOS Recovery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4750Z Hangs on Shutdown!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4752G Failed BIOS Flash/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4755g i5-2430m 2.40GHz/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4810T Crash Question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4810TZ Won't Boot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4810T problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4810tz Random Freeze/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4810 vs. TravelMate 8471/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4820 - HDMI passthrough/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4820TG/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4820TG won't boot, stuck in first screen/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4830TG WiFi upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4830 replacement monitor issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4920-5A1G12Mi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4920 ATI & Bluetooth Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4920G-101G16N/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4920G - second memory slot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4920G/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4935G/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4935G HELP!!!!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4935G Random Shutdowns, Not Charging when turned on/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4935G Volume is low/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4935G [Fully-Unlock Insyde BIOS Request]/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4935G hold button problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4937G - mp3 lag when surfing net/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4937G service manual video/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4937G sudden shutdown/ | 2022-03-28 12:07 | - | |
| Acer Aspire 4937g upgrading issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000, Distorted display at start up/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000, no sound/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 5020/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 Heat Issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 Series (5003 WLMi) Questions/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 Series/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 Series Power Management!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 adding new 320 drive/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 booths on sometimes/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 grafix/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 graphics card question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 need assistance/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 re-call/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 series restore/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5000 service manual I need one bad!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5002 - Bios dead/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5002 - Graphics card/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5002WLMI --- 2 Black Stripe Top to Bottom/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5002WLMI - Crashes/ | 2022-03-28 12:07 | - | |
| AcerAspire5002WLMI15.4 Vertical BlackStrip on LCD right side/ | 2022-03-28 12:10 | - | |
| Acer Aspire 5002WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5002WLMi Boot Issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5002 wlmi LCD Monitor question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5003WLMi Question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5003WLMi WIFI not working/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5003 WLMi turns off unexpectidtly/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5003 problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5004 DEAD!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5014WLMI power weirdness/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5020 - How do I disable launch manager !/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5021/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5021 Wlmi and Windows Vista, experiences/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5021 and Vista/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5021 freeze problem without sound/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5021wlmi vs. 5670/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5023LCi driver modem download/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5024WLMi (LX.AA505.010) a good buy/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5024WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5024WLMi Beep on Windows startup/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5024 or 9104/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5025wlmi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5040, GridVista/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5040 - Where is my CD DVD ROM !/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5040 Wireless Button/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5040 heating problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5040 video card information/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5044 WiFi problem with Windows 7 RC/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 (vista) really weird behaviour, go on u know you want a challange!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 (vista) won't shut down/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050-5410 Notebook/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 - Battery & Wireless Don't Play Nice/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 - Battery not charging/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050- No Post/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 - loud fan!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 - recovery from a bad BIOS flash/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 3371 help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 Battery Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 Charging Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 Help NO OP SYSTEM OR HARD DRIVE FOUND!!!!AHHH/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 Laptop Help!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 Network controller Problem!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 Problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 Recovery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 Recovery Disk/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 annoying microphone problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5050 upgarade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5051 + External Monitor/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5051 AWXMi disk drive problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5052 Problem!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100- '0200- Failure Fixed Disk 0' Fix/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100- 5in1Reader/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100-3019 strange blue screen with white broken lines while playing certain games, DVDs, and videos/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100-3357/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100-3959 standby mode issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100-5022/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100-5023 15.4 Widescreen Notebook PC/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 - 5455 DVD Burner Drive problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100-5674 still shows the old realtek driver version/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 - On Off Vibrating matrix sound and stop start cursor movements/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100...Lots of beeps on stratup and NTLDR missing..HELP plz/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100. Cursor and Scrolling going crazy!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100/ | 2022-03-28 12:07 | - | |
| Acer Aspire5100 Audio Problems/ | 2022-03-28 12:09 | - | |
| Acer Aspire 5100 Bios + MIC/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Boot issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 CD DVD rom drive not detected, again!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 CPU Half Speed Help!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Delete Vista add XP SP3/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Driver Problems - Help Please/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Error/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Garbled display after waking from sleep mode/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 HDD DVD problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 LCD automatically dims/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Laptop/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Orbicam Software/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Password Recovery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Power problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Problems!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Ram/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Upgrades/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Vista Upgrade Shipping/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 Wont Restore Need Help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 battle/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 bios update failure/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 booting up problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 external display problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 not reading USB ports/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 screen color problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 slow outlook/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 won't boot without USB inserted!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5100 won't load and doesn't boot from a CD/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5101 DDR2 Question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5101 ERROR on startup/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5101 dead/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5101 keyboard and mousepad/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5101 problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5101 video problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102-(5100) Screen Brightness Adjustment/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102 WLMI/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102WLMI with tl-60/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102WLMi -or- used ThinkPad T41/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102WLMi Notebook --No Display/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102WLMi Parts and Questions/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102WLMi keys and touchpad problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102 WLMi memory upgrade and compatibility/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102 freezing and screen showing vertical lines on battery power/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102 stuttering problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102 w AMD Turion 64 MK-38/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102wlmi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102 wmli Windows XP (x64) drivers/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5102 won't recognize usb/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5103 Wlmi (New Battery)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5103 shutdown problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5104WLMi screen problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5110 Cd drive issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5112/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5112 Need help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5112 WLMI 2 cpu/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5112 WLMI bios/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5112WLMi touchpad and keyboard troubles/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5112 WLMi updating bluetooth drivers to enable A2DP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5114 Keyboard, Touchpad, USB not working...Help!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5120WLMi graphics card &bluetooth/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5201Z power problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5210-2273 recovery disk/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5220 problem with graphics card/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5230 no post screen/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5250 and java/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5250 multicolor pixels and lines on the screen even in bios and external monitor/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5251-1513- Burning Problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5251. Upgrading from 3GB to 8Gb with a single core processor/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5251 CPU Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5253-BZ480 15.6 AMD E350 HD 6310/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5253-BZ496 weird graphics problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5253 AMD E-350 APU/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5253 soundcard issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5260 and firewalls/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5310, recovery cd lost/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5310/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5310 Celeron 520 Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5310 Enet for XP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5310 help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5313 wireless card question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315, I can't make a nlite windows xp cd=[/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315, no ethernet/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315, upgrades/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315-2153 Bios Password/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315-2326 Vista laptop slowing down/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315-2529 dead after flash bios/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315-2768 overheating and turning off/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 - Battery troubles/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 - CD DVD Optical Dive just stopped working!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315- How To Upgrade To A DVD Burner Writer/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 - Logpn failure/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 - Not turning on/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 5520 - Cooling pad/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Charge Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 DEAD!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Died...please help!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Hard Need Help ^o^/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 ICL50 CPU Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Memory Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Owners Lounge/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Power problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Recovery Failed! Need Help Please!!!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Strange Power Issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Upgrade Help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 Wireless XP Driver/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 big trouble/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 black screen help needed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 failed BIOS update/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 freezing issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 hdd change/ | 2022-03-28 12:07 | - | |
| Acer Aspire5315 memory upgrade problems/ | 2022-03-28 12:09 | - | |
| Acer Aspire 5315 new graphics card/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 no sound/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 problems, swiches off then only black screen, will not boot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 recovery problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 screen question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 to run Gears of War 1/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 will not boot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5315 wont power on via AC/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5332 - Advice/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5332 - Black Screen Intermittent/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5335-2238 CCFL to LED SCREEN conversion/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5336 Keys typing wrong letters/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5336 request - please read/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5410 CPU upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5500, is it worth the cash/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5500-series memory upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5500..Couldnt load Win XP plz help URGENT !!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5500Z problems starting up/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5500 stuck END key even when keyboard detached/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5500z Ram Upgrade Tutorial/ | 2022-03-28 12:07 | - | |
| Acer Aspire5502WXMi questions/ | 2022-03-28 12:09 | - | |
| Acer Aspire 5504/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5504WXMi....please advise/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5510/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5512wlmi bluetooth problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5514WLMi any good/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5515 Issue Accessing Internet/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5515 Webcam and Touchpad troubles/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5515 network controller/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5515 recovery backup/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5516 5517 CPU UPGRADE REPLACE SWAP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5517 Battery Charging/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5517 Ctrl key stuck/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5517 freezing when bios load/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5517 intermittent boot problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5517 very slow! Solution/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520-5865, BIOS upgraded. Now, it's dead/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520-5912 BIOS issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520-5912 CMOS Issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520-5912 Official Thread/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520-5912 USB Ports/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520-5912 keyboard problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520-5912 stock BIOS/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520-5912 upgrades DIY/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 - I want to Disable Wireless/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 Bios/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 CIR Driver (vista and XP)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520G Upgrade to 9600MGT DDR3 512MB/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520G beep problem!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 G heat reduce/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520G upgraded to 8600M GT mxm error during post/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 Series No Sound/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 Service Manual/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 UPGREDES!! Yes MXM II/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520g Heat Problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5520 will not load windows/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5530G question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5530g battery problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532 - PQSERVICE - HELP!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532 CPU Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532 CPU upgrade help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532 Powers on But Doesn't Boot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532 Upgrade Issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532 black screen problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532 chip update/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5532 keyboard issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5534 laptop screen flashes while on internet/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5535- Is Windows 8 OK/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5535 - Won't Start/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5535/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5535 Backlight/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5535 Battery life icon/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5535 Turns on but won't start/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536 - Vista installation/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536 12 Cell Batteries/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536 5236 series won't boot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536G massive overheating/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536 SATA Drivers For XP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536g Vista install problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536 keyboard problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536 multi-touch/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5536 speed heat issues!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5538 B156XW02 vs. B156XW01/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5541G temperature/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5542/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5542 fan noise, permanently ON/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5542 keyboard removal/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5550 connect to tv/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5550 cpu upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5550 keyboard problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551-2298 Atheros Wireless Card/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551-2468 Battery Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551-2863 Fan Issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551AWXMi e-power management/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551 Atheros AR5B93 upgrade options/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551 CPU upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551 Webcam Driver Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551 battery probelm/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551 fan trouble/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5551 startup problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552-5686/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552 Charging problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552G-7641/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552 GPU Upgrade New Installment/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552 Mods/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552 Recovery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552g (AMD Phenom II X4) DVD not reading DVDs until icon clicked/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552g Radeon 5650 overclocking/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5552g with windows xp/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5553G Temperature Issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5560(g) Bios Capsule needed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5560 Battery Issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5560G-sb468 won't reboot or shutdown with Win 7/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5560 Owner's Thread/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5560 Series Service Manual/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5560g/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5560 series BIOS update - HELP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5562 + Linux/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5562wxmi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5570-2977 Service Guide/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5570-4011 notebook won't start/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5570-Z/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5570 Screen - White Horizontal Line/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5570 Z/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5570Z Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5570 battery will not charge/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5570z Audio/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5580 - Line Out/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5580 No longer booting after bios upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5580 series... need help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5583WXMi XP boot up/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5595/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5600 (5601) Questions (Bluetooth, Video Card)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5600/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5600 Webcam (in-built)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5600 drivers/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5600 graphics card upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5601AWLMI Sound Driver Issues !!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5601AWLMi Info/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5601AWLMi Screen Darkening/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5601 Motherboard Question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5601 camera problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5601 ram troubles/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5602wlmi battery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5604 WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610-4182/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610-4182 Ethernet driver for XP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610-4648 Won't charge/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 - Red Line and Red Cross/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 - Update Bios/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 Black Screen/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 Enlarged Screen After S-Video Connection/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 Hardware Stability/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 Power connector problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 Shuts down/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610Z & Sony Camcorder/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610Z- Service Manual/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610Z Display Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610Z Orbi-Cam/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610Z video card problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 keyboard issue/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 manual/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 please help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 problems!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 problem using only 1 core (50%)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 screen problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610 suddenly shuts down on its own/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z (specifically 5610-2998) can't install windows XP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z -Driver Idinity/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z CPU upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z DVD problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z LCD screen grey/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z Orbit Cam/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z motherboard !/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z service manual/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z weird sounds/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5610z won't boot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5620-will not boot/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5620 PC/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630, Webcam/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 - 6368, no FireWire 1394/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 - Speakers no longer work/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 - Wine spillage!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 BIOS Virus/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Camera Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Crashing Beeping Hinge Problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Driver issues/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Help Please/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 How do i boot from cd/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 LAPTOP/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Orbicam Fix/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Recovery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Recovery Fails/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 Replacment Machine/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630S (I think)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 UPGRADE !!!!i!!!!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 USB Power Stays On/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 XP Drivers Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 buzzing - possibly fan/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 media buttons/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5630 wifi replacement/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633 - Not Recognising Video Card!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633 - what issues converting FAT32 to NTFS/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633 BiOS question (1GB version)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633 Tm 5710/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633WLMI Continuous Beeps/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633WLMi- Clean Install/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633WLMi - DVD Specification/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633WLMi Black Screen/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633WLMi Graphic not supports/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633WLMi How to watch TeleVision/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633 WLMi Recovery Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5633 and SSD in CD DVD caddy/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5634 LCD Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5634WLMI-Upgradeable RAM/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5634WLMi eRecovery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5634wlmi - Vista has disappeared/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5650 series/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5652WLMI an travelmate 4262WLMI/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5652WLMi (similar to 5672) sleep hibernate bizzareness/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5652 priced £608.65---bluff or what!/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 5672 BIOS/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 CPU RAM Upgrade/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 Dead USB/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 Frustrations/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 Help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 Orbicam Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 WLMI Fan very loud/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670WLMi Windows Clean Install/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 and SanDisk Pro duo problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 laptop will not turn on/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 new DVD CD disk drive/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5670 series BIOS damaged/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5671 - 70 ºC 80 ºC/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 + Win 7/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672, slow startup/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Dismantle Help/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Has Stopped Working/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Help please/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Keyboard Problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Replace lcd Trim/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Sata Hard Disk/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Scroll button fault/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 WLMI Mouse problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 WLMi - No LINE-IN Record/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672WLMi/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672WLMi Review Posted/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672WLMi and Core 2 Duo/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672WLMi driver needed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Window Vista Upgrading/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Wlmi Replacement Keyboard/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672Wlmi battery problem/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 Xp Pro Recovery/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 heatsink/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 heatsink fan/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 question (startup)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 question/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 upgrades (i know it's old)/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 with X1600 ETA June 1 06/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672wlmi Help Please/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5672 x1600 edition with XP Pro x64 Edition/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5680 - Upgrading advice needed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5680 Internet Problems/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5680 WiFi automatic startup/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5680 keeps overheating/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5680 only uses 3GB ram out of 4GB installed/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5680 orbicam/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5684 + Vista Ultimate + Orbicam/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5710 , Unlock Code/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5715Z motherboard/ | 2022-03-28 12:07 | - | |
| Acer Aspire 5715z Overheating and shutting down/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720, video, cpu and ram questions/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720 - VT - Any Bios/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720 Bios to 1.45 now no wireless/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720 CPU upgrade problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720G + Windows xp/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720G - Geforce 8400M GS XP driver needed/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720G - many probs.. help fix pls!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720 T7500/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720Z/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720ZG + GT230M (Toshiba)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720Z Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720Z and Kingston KVR RAM/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720 keeps turning itself off ! Help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720z - can all forum links be posted here, I'm new to this!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720z CPU upgrade questions/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720z WLAN driver/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5720z video problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5730 beeps each time the power cords is removed or attached/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5732ZG successful cpu upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5732Z WiFi does not work/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5732 Z up arrow key stuck/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5732z - weird (MB ) problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5733Z-4851 discussion/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5734Z Black Screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5735-4624 Drivers/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5735-4624 Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5735 Keyboard/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5735 Win XP Power Up Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5735 laptop Dead/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5735z VGA Win 7 driver/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5735z cpu upgrade help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5736Z/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5736Z Motherboard and Processor Compatibility/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5736Z Wireless Issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5736z F10 Recory Function not working/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 £400 worth it/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 DEAD ! only power led lights up/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738G, long post is long/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738G Bios Mod request to accept Intel Core 2 Extreme QX9300 Quad Core/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738G Crashes & lockups/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738G display problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738G fan runs almost constantly/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738G heating problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738G shuts down! Need help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738G totally dead - power adapter LED turns off when connecting/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 Surround sound connections/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 Views/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738ZG - CCFL to LED possible using 5740 LED LVDS/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738ZG - overall info on upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738ZG Screen lighting/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738ZG Startup Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738ZG causing weird sound through HDMI/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738ZG random freeze/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738Z wont boot up/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 and Windows 7/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 doesn't switch on/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738g/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 random reboots/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 upgrade question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738 windows 8 driver help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738z, Windows 7 and touchpad....help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738z fan noise/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5738z won't boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5739G Problems Please Help -(/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5739g (734G50MN) - Question about converting from Europe to UK/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5739g Overheat display wont turn on/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740 & Xbox360 Hookup Question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740-6491 Wifi is not working/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740- GFX Card Question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740 - Optiarc DVD - compatible CDs/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740G-434G50BN/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740G BIOS DMI Data/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740G BIOS hacking (Switchable Graphics - not yet)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740G No Power LED/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740G Owners Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740G problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740 compatible with NEC PA271W-BK-SV monitor/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740 dead/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5740g black screen BIOS error/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741-3541 I-core 5 Trackpad issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741-5763 touchpad freezes/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741 - Black Screen after CMOS Reset/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741A/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741G 15.6 NB with Intel Core i3 Review/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741G display driver problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741G facial recognition/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741g Weird Overheating Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5741 touchpad issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 -- cpu upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 - Strange noise when turned off but still pluged in/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742-g keyboard issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742. Can't install a clean version of windows/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G-5464G50Mnkk OC/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G - Grainy Gradient/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G - Loose headphone jack (maybe)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G - unwanted programs, folders & files/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G GPU paste/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G bios recovery/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G performance issues (freezing for a few seconds)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G video playback issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742G wireless problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 Keyboard replacement/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742Z -- Upgrading Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742Z-4200 restore loop/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742ZG Core i5 560M upgrade issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742ZG constant beeping after turning it off/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 backlight not working/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 died HELP !/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 eGPU/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742g-6426/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742g - Unsatisfied/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742g screen problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 horrible fan noise/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 screen upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 stops charging after about 15 seconds/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742 vs 5750/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742z 4813 BSOD/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5742z keyboard removal/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5745G Overheat/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5745G Owners Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5745G freeze problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5745 heatpipe failure/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5749 Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G- 802.11n supports only 2.4 GHz, not 5 Ghz/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G - Arrow Key/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G - Getting More for Less/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G Bluetooth/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G Laptop Primary Graphic Card/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G keyboard question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G mouse not working/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G paying game problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750G touchpad mouse problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750 Wireless Connectivity/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750 laptop moves i lose connection/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750 weird display problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5750zg fan control/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5755-6828 bluetooth/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5755G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5755G Display/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5755G Overheating Shutdown Solution/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5755G Owners lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5755G beeping at every other bootup/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5755g Fan not speeding up on load, causes overheating/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5755g games problem when using battery/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5810T (Timeline) - force wifi on AND OR disable wifi button/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5810T Screen Fading/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5810T Timeline is dead, any resurrection/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5810TZ - flashing white screen with lines after screen replacement/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5810TZG black screen after logging on/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5810TZ Windows Vista Pre-Installation/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5810T and battery life/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5820TG lid wake up/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5830TG Cleaning Fan/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920-6864 Is not turned on/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 - Recovery CD problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 - colour depth of screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 Battery Problems....Please help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 Bluetooth/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 CIR problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 Card Reader/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 Dont Make The Same Mistake/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G (with tv tuner) owners! !/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G + hd 4650 mobility. Help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G, Can not upgrade bios/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G- Call of Duty 2 video settings/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G- Problem reading 8GB Dual Layer DVDs/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G - Problem with MediaTouch/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G- Problem with Realtek Digital Output playback device... Help!!!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G - White Screen with a number of vertical lines rite after turn the Laptop/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G - Woth Buying/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G - boot problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G - upgrade to Windows 7/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Ati 4650 Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Black Screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Blue Screen ATI drivers, tried eveything/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G DIED but Alive after a week!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Gemstone (H) Reinstall disk/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G HDMI PORT/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Keyboard Question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G LCD Inverter/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G MemoryStick CardReader shutsdown Laptop on Vista!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Overheating Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Question!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G TV Joy - can't remove subtitles/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Video Card Clock Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G Vs Acer Aspire 7720G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G after assembly/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G and 163.75 nVIDIA driver/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G and Intel Turbo Memory/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G blank screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G build quality/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G doesn't read DVDs/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G error 4096 during flash. Need assistance/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G finally running xp... detect microphone/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G freezing/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G graphics card question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G has no sound/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G is near death/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G recovery trouble/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G resolution changes at startup!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G strange booting problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G vacant DDR2 onboard pads/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G vga Update... help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G which concretely 9600M will work/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920G wireless problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 HDD slot/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 Heat Issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 Processor Upgrade Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 Screen Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 Upgrade Recommendation/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 and 5920G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 cable that connects motherboard to the LCD/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 cpu updgrade to T9500 or X9000/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 freezing/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920g-6128/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920g - Slowing entire internet connection/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920g Battery Wear level 49%/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920g Blue Death Screen Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 graphics(ish) question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920g video card best option help!!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920g wont strat/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 making strange noises after spill/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 microphone problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 review/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 trackpad design fault/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 vista sound problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 volume control problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5920 vs. 5613/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930(G) owner thread/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930 - trouble connecting with Verbatim 1TB QUAD/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930G - Anyone who can say anything about this machine/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930G Infinite boot loop! HELP! -(/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930G Performance issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930G Suyin Webcam problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930G battery wear level/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930G display problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930 Ram Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930 Service Manual/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930g, Intel 5100 WiFi adapter DISAPPEARING/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930g - Adobe Reader/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930 not booting the first time/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5930 won't boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5935/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5935G- No Wireless/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5935G-Windows 7 PROBLEM/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5935G Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5935G owner thread!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5935g plastics/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5940G-724G50Bn Factory Recovery/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5940G - Core i7 - Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5940G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5942G Integr.video-question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5942G Owners Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5942G display problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5942 and 8942 - first notebooks with ATI Mobility Radeon HD5650/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5943G, Black Screen Monitor but Windows runs in the Background/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5943G ATI Driver Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5943G i5/ | 2022-03-28 12:08 | - | |
| Acer Aspire 5951g - Removing keyboard to access RAM slots/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530 - Cursor Freezes/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530 - Speaker Issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530 - Won't boot -(/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530G - won't boot, only power button flashing/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530G overheating/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530G won't boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530G worth £497/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530g abnormally slow - High CPU usage/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6530 sound bar doesn't show on the screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 - Keyboard problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 - erecovery error 1014/ | 2022-03-28 12:08 | - | |
| AcerAspire6920/ | 2022-03-28 12:10 | - | |
| Acer Aspire 6920 8920 DVD drive/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 8920G Contrast Ratio/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 Burning problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 CineDash drivers for XP/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 Finger Print Drivers/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 Freezing problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G-6021 review (Gemstone)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G - Changed Screen, Blurry, no HD/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G - Throttle FIX!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G - Wubi/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G BIOS V1.14/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Bass gone missing from speakers/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 G CineDash Media Console problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Downclock/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Dual Booting/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Gemstone Blue Review/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G MultiBoot/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Poor Gaming Performance/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Problems with sound on Windows 7/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G RAM - 3GB or 4GB/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Sound Driver Management Software XP/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Sound problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Throttling & Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G Vista SP1 x64 working modem drivers (needed)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G and 5.1 Speakers Setup/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G and Crystal Eye problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G and an HDTV help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G fps issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G is turning out to be a misery, Need help urgently please !!!!!!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G need help with WiFi button/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G or 5930G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G recovery/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G red tint grainy screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920G restarting/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 Recovery/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 Touch Panel Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 Upgrades/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 Windows XP Install Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 Windows XP graphic driver/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 dont boot , blank screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920g - laptop keeps restarting and new battery not charging/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920g - order to install drivers in/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920g CPU GPU heating problems °C/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920g Keyboard issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920g Shutdown Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920g freezing issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 g screen resolution/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 not booting/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 review (After 2 years)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6920 upgrade to Win7 Please read/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 - Access Bios Battery/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 Clean Install Windows 7/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 Corrupt Bios/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 Display Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G, Shakey Jumpy Flickering screen!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G - Processor Speed/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G - is this a problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G - screen flicker/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G Help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G Screen Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G Upgrade Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G easy-launch botton/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G mediatouch buttons problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G recovery problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G sound buzzing problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G urgent help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930G went down -(((/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 LAn problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 Lcd Cracked compatibility/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 OS installation question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 Quick Buttons/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 Sound Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930Z Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 cpu upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930g launch problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930g memory issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 screen replacement/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930 wireless card/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6930z Screen Problem, Please Help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935 ...bios flash didn't work. need help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935...screen and cable replaced...now what/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935G - new bios v 1.20/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935G Expresscard problem Bios request/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935G Mouse/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935G bluetooth does not start automatically/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935 Keyboard Cleaning/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935 cpu problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935 cpu temp/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935g Bluray Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935g MXM-II Graphics Card upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 6935g fan control/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7000 Error Message/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7000 Lid trouble/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7000 series/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7220 flashing power light, doesn't boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520-5311 Pathetic Performance/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520-5757 model need help upgrading/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 Bluetooth problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G - S-Video Videocard Prob/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G- screen black, but gfx and display ok - what then/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G 702G32Mi/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G BIOS battery location/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G CPU AMD Turion Vista problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G Harddrives/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G Webcam on XP - Need Drivers/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G Weird lag and overheating/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G boot problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G keyboard problem!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520G weird boot loop/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 Power Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 Questions/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 Replacment Power Supply/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 Slow Graphics Processing/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 Sound Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 TV out PAL help needed/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 Updating my cpu and video card/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 Windows Vista/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 and 7720G keyboard problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 flashing lights/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520g video fail/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 trouble. -( Wont turn on!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7520 vista restore to factory default/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7530 Does not reboot after a restart/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7530G - thermal module urgently needed!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7530G Keyboard not working/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7530 mysterius problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7535 - 5415 Drivers/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7535 BIOS Not Booting/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7535g/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7540 (uk)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7540, PQService I need to re-enable the F10 Restore Option!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7540-5750/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7540/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7540G Screen Replacement/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7540 backup discs/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7551-7422 Problems with Startup/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7551-7422 Windows not loading/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7551-7442 Promblems with Startup/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7551G-5821/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7551G- Keyboard/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7551 Random Shut Downs/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7552G-6061 - SSD Compatibility Installation/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7552G-6061 Blu-Ray drive links/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7552g-5430 Temp/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7560-sb416 RAM question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7560 Screen LCD flicker/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7715z fails to sleep properly/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720 + 5.1 Creative Inspire P580 problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720, Can I upgrade the processor/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720-6155 Video Memory adjusting/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720-6155 freezing problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720-6155 motherboard upgrade question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720-6794...questions please help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720 - Nvidia Defect/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720 Black Screen of Death/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720 CPU Support/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G-703G25Hn problems!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G - 8600m GT bios/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G - Boot shutdown problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G - Issues Installing Windows 7/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G - Keyboard Replacement - Service Manual/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G - POST YOUR SPECS!!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G Boot Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G Graphics problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G Problem... Please help!!!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G Vista Mystery/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G not working and driving me crazy/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720G won't record right channel/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720 Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720Z BIOS recovery (again!)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720 crashing under XP/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720g- help upgrading to nVidia 9600M GT/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720g 8400gs to 9600m GT 1gb Driver Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720g bootmgr missing/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720g cpu upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720g graphics upgrade!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720g network issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720g problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720 specs/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720 upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7720zg/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7730 Fan behaviour/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7730G GPU bios/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7730G XP QUESTION/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7730G black screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7730G system manager etc. question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7730g Problem with original apple wifi card/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7730 series, where to put 3g aircard Ericsson and SIM mobile card/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7735G owners lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7735ZG 2rd HDD on motherboard/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7735ZG windows 7/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7736/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7736ZG - fan/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7738G- Adding SSD to second hard drive bay/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7738G Keyboard Help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7738G Problem with Volumen for MediaTouch/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7738G Sound Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7738g 644g32mn Ram Upgrade woes/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7739G-6647/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7739Z-4605 booting problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7739Z no backlight after replacing LCD/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7740 5.1 audio problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7740 Bricked/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741-8445 power jack feels loose/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741G-3647/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741G - clean fan/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741G Bios upgrade HELP/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741Z-4433/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741Z factory restore fail -- Please Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741g - soldered CPU/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741g not partition pqservice/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7741z + core i7/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7745G-434G32MNKS or something else/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7745G Hard Drive Upgrade help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7745G Owners lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7745G PQservice/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7745G bios flash fail. HELP/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7745G brightness and sound fn problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7745G with ATI HD 5650/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7745g Loud Fan Problems!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750G-6662- Artic Silver Paste/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750G-6669 - BIOS needs work/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750G - Switchable Graphics problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750G DOA/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750g-6444 has no ram slots !/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750g BIOS update 1.18, any changes/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750g Owner's Thread/ | 2022-03-28 12:08 | - | |
| Acer Aspire 7750g help with advanced BIOS/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8730G 644g32mn Graphic card change/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8730G CPU Upgrade (C2D T6400)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8730G Users/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8730G help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8730 and compatible model AIRFLOW discussion/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G-T9600 Overclocking/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G 8 GB Ram/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G BIOS Mod/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G CPU upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G GPU Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G Overheating/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G Quad Core/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G from GT 240M to HD 5870M/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G gtx 470m/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735G white screen on display/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735 and gt 540m can't install drivers/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8735g problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8902g CInedash problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920 - Screen issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920 Blu ray Not Working/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G, independent and $ keys not working/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G-6A4G32Bn/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G-934G64Bn/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G - AS8920/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G Bio-Protection fingerprint reader/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G Gemstone Blue Review/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G HDMI input/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G Making Annoying Sound/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G No Display During Boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920G Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920g wont turn on/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920 problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920 red pixels/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920 running Windows 7 - Wifi needs restart + date time changes to 26 Dec 2006 23-01/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8920 speakers dying/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930 'Laggy'/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930-7665/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G & HDMI Audio/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G, which one/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G- Blu Ray Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G-How to set threshold of battery recharge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G - Pink vertical lines/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G - Where to get hard drive caddy/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G - replacement battery issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G - update RAM/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G 844G32Bn/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G 9650m GT video driver problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G Ethernet issues +cinedash question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G Instantly Shut Off!![solved]/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G Raid 0 1 setup/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G VS. 8935G for photography - Screen Gamut differences/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G Will Not Boot - Black Screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G big problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G bios/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G boot up (Bios) frozen/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G processor/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G questions and help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G screen problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G sudden random power loss and shutdown[solved]/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930G will not charge replacement batteries/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930 Vs World of warcraft/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930 cinedash touch screen not responding/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930g unsolvable problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930 no suround sound in windows XP/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8930 webcam/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935, successor to the 8930/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935G- Is It SATA or SATA II/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935G- high GPU temperature crash/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935G/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935G Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935G RAM/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935G Temperature questions/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935g, trying to upgrade graphic card/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935g GTS 250M/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935g GTS 250M PartII/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8935g hd4670 - GTX260m bios issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8940G, need a full backup for the laptop/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8940G -- Core i7 Quad -- Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8940G-6865 won't power on/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8940G - Good things on the horizon!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8940G GPU UPGRADE - Firepro M4000 or Nvidia/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8940g, trying to upgrade graphic card/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8942G Core i7 Owners Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8942G Keyboard/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8942G no LED backlight/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8942G update..... pre-orders available/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8942G vs Asus G73JH/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8942g CPU Upgrade General Guide/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8942g Volume control wheel/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8943 5943 (Ethos)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8943G, Intel PM55 Chipset, and RAID0/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8943G HEATING PROBLEM!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8943g Serious performance issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8943g optical drive problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 8950G Owners Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9104 WLMI and Arcade feature/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9113 lcd light leakage/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300-5317/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300-5317 install XP Pro - SATA/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300... HELPP MEE ! !/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 4 GB's/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 Bios update/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 Graphics Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 Motherboard/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 RAM upgrade, NEED HELP!/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 Series Motherboard CPU question/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 Series backup dvd/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 blue screen (BSOD)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 hardware upgrade tutorial/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 is not always able to boot with large harddrive/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9300 power light comes on but nothing eles/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9301AWSMI video drivers Vista32/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9400 help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410-2028 Notebook Questions/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410-4441/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410-4933 with 2x2GB DDR2/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410 Webcam Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410Z - is there a Word Perfect Program/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410Z - upgrades/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410Z/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410Z locks when on standby/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410 freezes/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410 problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410 sound card problem !/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9410z Downgrading Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9411AWSMi/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9411AWSMi bluetooth module/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9425WSMi bios upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9500/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9500 Bios Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9500 powers off (possibly overheats) before windows loads/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9504 charging problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9524 - wrong bios flashed - no POST/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9800 Recovery Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9800 The sound is choppy/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9802/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9804 WKMi - Clean install - Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9804WKMi ram issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9804WKMi ~ Bigger is better/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9805/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9805 DVD drive problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9813/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9815WKHi (9810)/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9820g problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9830g HELPPPPPPP ]-/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9920 doesn't boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire 9920 manual/ | 2022-03-28 12:08 | - | |
| Acer Aspire 57202z Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire AOD250 @ Sign messed up/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS 1410 slow to boot Windows 7/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS1810T-6188 netbook/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS2920/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS2930/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS3050-1150 RAM Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS3618AWLMi/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS3810TG-944G50n - Faulty Screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS4730-4857 Warranty/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS4830TG-6808 vs Acer Aspire AS5755G-6841/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5520-5716 (Screen Dimension)/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5520-5716/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5532 user experience and review!/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5536 Good/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5542G-324G50MN/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5542G-5281/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5552-5898/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5552G-7632 Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5560-4334G75 on xp/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5560G, any good/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5560G-SB448 available in the US/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5560G-SB485/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5570-2067 for $550 at BestBuy/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5570 Comments/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5570 Replacement battery/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672 - FAT32 vs NTFS/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672WLMI for $1059, no rebate/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672WLMi - Audio speakers/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672WLMi - Help Please/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672WLMi- Keep or Return for a Merom Laptop/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672WLMi/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672WLMi Memory Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672WLMi dualcore/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5672WLMi vs. Acer Ferrarri 4005WLMi/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5710 or Acer Aspire 7520 Gemstone/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5733-6696 blurry VGA output/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5738-6444/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5738G-6335/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5740G-6454 now discontinued!!! OFFICIAL!!!/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5740g-6454 review and 1st impression!/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5741G-6983 Ordered Today/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5742Z-4646 Review Complaint/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5745G-3690 NoteBook/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5745 vs TimelineX AS4820T/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5755G-6823/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5755G-9471 RAM Question/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5920-6444 vs. Toshiba/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS5920-6914 cpu upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS6530-5753 information/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS6920 with 9500 GS/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS6930-6073/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS7552G-6061 - GPU Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS7552G-6061 Shipped/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS7720-6155 Intel Core 2 Duo T5250 1.5GHz for $400/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS7720-6604 Boot No Windows/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS7741G/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS7750G-6662 Notebook/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS7750G/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS8930-6386/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS8930-6448 --- Overclock/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS8940G-6865/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS8951G - anyone own this/ | 2022-03-28 12:08 | - | |
| Acer Aspire AS9411AWSMI @ CircuitCity!!! (NVIDIA 7900gs) 4 900 USD!!!/ | 2022-03-28 12:08 | - | |
| Acer Aspire Aspire 7520 7520G 7220 7220G Service Guide Service Manual/ | 2022-03-28 12:08 | - | |
| Acer Aspire B940 shutting off NOT overheating/ | 2022-03-28 12:08 | - | |
| Acer Aspire BL50/ | 2022-03-28 12:08 | - | |
| Acer Aspire Backup/ | 2022-03-28 12:08 | - | |
| Acer Aspire Battery/ | 2022-03-28 12:08 | - | |
| Acer Aspire Black Edition VN7-591G-755E - M.2 boot! !/ | 2022-03-28 12:08 | - | |
| Acer Aspire Blu-Ray Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire CPU Temperature/ | 2022-03-28 12:08 | - | |
| Acer Aspire CPU upgrade options/ | 2022-03-28 12:08 | - | |
| Acer Aspire Desktop M3420/ | 2022-03-28 12:08 | - | |
| Acer Aspire Dim Screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire Driver Digital Authentication Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire E1-471G-53212G50Mnks couldn't use TouchPad in Linux(Ubuntu12.04)/ | 2022-03-28 12:08 | - | |
| Acer Aspire E1-571 hinge loose/ | 2022-03-28 12:08 | - | |
| Acer Aspire E1-572-6870 Screen Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire E1 472 bios locked help/ | 2022-03-28 12:08 | - | |
| Acer Aspire E5-575G-53VG turned off and doesn't boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire E15 E5-575G-53VG/ | 2022-03-28 12:08 | - | |
| Acer Aspire E 15 E5-575G-5341/ | 2022-03-28 12:08 | - | |
| Acer Aspire E15 doesnt start up/ | 2022-03-28 12:08 | - | |
| Acer Aspire E 15 screen too bright and white. Hurts my eyes/ | 2022-03-28 12:08 | - | |
| Acer Aspire ES1-512 cm-5 Need Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire ES1 520 strange disk restart on shutdown/ | 2022-03-28 12:08 | - | |
| Acer Aspire Ethos/ | 2022-03-28 12:08 | - | |
| Acer Aspire Ethos 5943G - headphones/ | 2022-03-28 12:08 | - | |
| Acer Aspire Ethos 5951g/ | 2022-03-28 12:08 | - | |
| Acer Aspire Ethos 8943G-7744G75Bnss MXM Grafik/ | 2022-03-28 12:08 | - | |
| Acer Aspire Ethos 8943G - thinking of buying it any feedback welcomed/ | 2022-03-28 12:08 | - | |
| Acer Aspire Ethos 8951G/ | 2022-03-28 12:08 | - | |
| Acer Aspire Fan Always On/ | 2022-03-28 12:08 | - | |
| Acer Aspire Firewall problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire Freezes Randomly, Tried Everything/ | 2022-03-28 12:08 | - | |
| Acer Aspire Gemstone 1920x1020 resolution/ | 2022-03-28 12:08 | - | |
| Acer Aspire Gemstone 8920G + Vista 64bit/ | 2022-03-28 12:08 | - | |
| Acer Aspire Gemstone Sound Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire HDD replacement Disk Read Error/ | 2022-03-28 12:08 | - | |
| Acer Aspire ICL50 notebook upgrades/ | 2022-03-28 12:08 | - | |
| Acer Aspire Idea 510 Media Center/ | 2022-03-28 12:08 | - | |
| Acer Aspire Inverter board or LCD backlite/ | 2022-03-28 12:07 | - | |
| Acer Aspire Keyboard/ | 2022-03-28 12:08 | - | |
| Acer Aspire Keyboard Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire L5100 help putting OS on it/ | 2022-03-28 12:08 | - | |
| Acer Aspire Laptop Reaching 96C Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire Laptop Refresh/ | 2022-03-28 12:08 | - | |
| Acer Aspire Laptop and Steam Software/ | 2022-03-28 12:08 | - | |
| Acer Aspire M3/ | 2022-03-28 12:08 | - | |
| Acer Aspire M3 Timeline/ | 2022-03-28 12:08 | - | |
| Acer Aspire M5-481PT-6488/ | 2022-03-28 12:08 | - | |
| Acer Aspire M5-481PT Orange Light Blinks & Installation Q's/ | 2022-03-28 12:08 | - | |
| Acer Aspire M5-481PT WIFI Speed & Orange Light Blinks/ | 2022-03-28 12:08 | - | |
| Acer Aspire M5-481t-6820/ | 2022-03-28 12:08 | - | |
| Acer Aspire M5-581T Shuts off unexpectedly while on battery/ | 2022-03-28 12:08 | - | |
| Acer Aspire M1610 Desktop Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire M3802 Windows 7 will not boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire Modem issue for dialup/ | 2022-03-28 12:08 | - | |
| Acer Aspire Motherboard Help needed/ | 2022-03-28 12:08 | - | |
| Acer Aspire New HDD Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire ONE - Problems with System Restore/ | 2022-03-28 12:08 | - | |
| Acer Aspire OS Problems, please help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire One (win Xp)+apple Airport Express/ | 2022-03-28 12:08 | - | |
| Acer Aspire One, D150-1920 replacement LCD/ | 2022-03-28 12:08 | - | |
| Acer Aspire One, general questions/ | 2022-03-28 12:08 | - | |
| Acer Aspire One - Battery Issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire One - Gets Stuck in Sleep Mode/ | 2022-03-28 12:08 | - | |
| Acer Aspire One - No power/ | 2022-03-28 12:08 | - | |
| Acer Aspire One - bloatware strategy/ | 2022-03-28 12:08 | - | |
| Acer Aspire One - data security/ | 2022-03-28 12:08 | - | |
| Acer Aspire One - is it good or not good/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 3G question/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 8.9in Laptop 1.6GHz 1GB 120GB question/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 10.1-Inch Netbook/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 11.6/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 110 Recovery/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 150 Video Driver issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 521, 533 or D255/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 521/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 521 WinXP Video driver help/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 522 @ BestBuy.ca/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 522 Owners Lounge [AMD Fusion Netbook]/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 532/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 532G- first netbook with dedicated graphics for true Hi-Def video enjoyment/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 532H memory upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 532g/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 532h-2588 so very slow!/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 532h Wireless Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 721-3070 vs. AO721-3574/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 721/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 721 BIOS BOOT issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 722 -BZ197 Netbook/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 722 Owners!/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 722 video driver/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 725-0684 Keyboard Question/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 725 Temperature/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 751 Review - 11.6 Netbook with 1366 768 res/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 752 11.6 Netbook (Formerly known as the AS1410)/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 753/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 756 - larger capacity battery/ | 2022-03-28 12:08 | - | |
| Acer Aspire One 756 build quality, need help plz/ | 2022-03-28 12:08 | - | |
| Acer Aspire One A0A150-1570. Best buy out of stock/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AO521 & Windows XP/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AO522 - not starting/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AO721 UK Release/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AO722-0473 - Is it good/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AO725 Wireless problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AOA150-1049 overclocking/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AOA150-1570 buy it/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AOA 150-1635 Car Charger DC Adapter/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AOA150 9 cell battery won't charge/ | 2022-03-28 12:08 | - | |
| Acer Aspire One AOA150 lcd screen issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Accessory kit/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Battery Upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Boot Issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Combining Recovery Discs/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D-150 Tech Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D150-1920 N270 or N280/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D150 Boot Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D150 Unknown Device ... Webcam/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D225e Network Controller!/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D250 (10.1 N270)/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D250-0Dr black screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D250 - Xp Drivers/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D250 Clone. Gateway LT2016u/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D250 wont power up/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D257 Netbook Display Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D257 battery/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D260-A Netbook boot issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D260 keyboard problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire One D270 Keyboard Latch (Black piece that holds keyboard ribbon)/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Display Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire One First Impression/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Issue Will Not Post- No Video Problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Netbook - Age of Empires/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Netbook HDD/ | 2022-03-28 12:08 | - | |
| Acer Aspire One No Boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Power Socket Broke/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Power button Light question/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Question/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Screen Dying/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Screen Replacement/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Screen Replacement help!/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Standby Mode/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Vista/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Webcam Trouble/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Wi Fi/ | 2022-03-28 12:08 | - | |
| Acer Aspire One Wireless disappeared from deviece manager/ | 2022-03-28 12:08 | - | |
| Acer Aspire One ZG5/ | 2022-03-28 12:08 | - | |
| Acer Aspire One ZG5 Screen problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire One ZG5 Wireless and Browser/ | 2022-03-28 12:08 | - | |
| Acer Aspire One ZG5 shuts off at startup/ | 2022-03-28 12:08 | - | |
| Acer Aspire One ZH7 - Why is this model less talked about on internet/ | 2022-03-28 12:08 | - | |
| Acer Aspire One and MS Media Player 9/ | 2022-03-28 12:08 | - | |
| Acer Aspire One aoa150 BIOS replacement/ | 2022-03-28 12:08 | - | |
| Acer Aspire One at Costco/ | 2022-03-28 12:08 | - | |
| Acer Aspire One battery life/ | 2022-03-28 12:08 | - | |
| Acer Aspire One battery won't charge EVEN AFTER BIOS UPDATE/ | 2022-03-28 12:08 | - | |
| Acer Aspire One can not boot into Windows/ | 2022-03-28 12:08 | - | |
| Acer Aspire One dudes are in luck. 32GB SSD/ | 2022-03-28 12:08 | - | |
| Acer Aspire One mini pci express mod & egpu/ | 2022-03-28 12:08 | - | |
| Acer Aspire One netbook won't boot up/ | 2022-03-28 12:08 | - | |
| Acer Aspire One printer driver needed/ | 2022-03-28 12:08 | - | |
| Acer Aspire One screen freezing, pixelating, then slowly becoming brighter until white/ | 2022-03-28 12:08 | - | |
| Acer Aspire One wireless fix (new WiFi module)/ | 2022-03-28 12:08 | - | |
| Acer Aspire One won't run on battery, only on main/ | 2022-03-28 12:08 | - | |
| Acer Aspire One won't stay powered on/ | 2022-03-28 12:08 | - | |
| Acer Aspire One won't take power from AC/ | 2022-03-28 12:08 | - | |
| Acer Aspire P3-171 Intel Management Acer/ | 2022-03-28 12:08 | - | |
| Acer Aspire PQService missing MBR files/ | 2022-03-28 12:08 | - | |
| Acer Aspire PSD/ | 2022-03-28 12:08 | - | |
| Acer Aspire R3-131T-C8B3 will not boot, HDD light stays solid/ | 2022-03-28 12:08 | - | |
| Acer Aspire R5-471T-52EE Touchscreen inconsistent lag or latency problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire R5 Blurry HDMI Out Picture/ | 2022-03-28 12:08 | - | |
| Acer Aspire R7 !! what is the HDD size 7mm or 9mm/ | 2022-03-28 12:08 | - | |
| Acer Aspire R7-571 pre-purchase questions/ | 2022-03-28 12:08 | - | |
| Acer Aspire R7 with Ezel hinge discussion/ | 2022-03-28 12:08 | - | |
| Acer Aspire R7 with Haswell and Active Digitizer--first impressions and discussion/ | 2022-03-28 12:08 | - | |
| Acer Aspire R7 with Haswell problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire R7 with dedicated GPU + English keyboard/ | 2022-03-28 12:08 | - | |
| Acer Aspire R3600 how long to use/ | 2022-03-28 12:08 | - | |
| Acer Aspire RAm upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire REVO eSATA Connection Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire Ram Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire Random Hibernation/ | 2022-03-28 12:08 | - | |
| Acer Aspire Recovery - Best Strategy/ | 2022-03-28 12:08 | - | |
| Acer Aspire S3-391 BIOS Recovery BIOS Password Remove No Bootable Device issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire S3-471/ | 2022-03-28 12:08 | - | |
| Acer Aspire S3-951 doesn't recognize my USB 3.0 flash-drive/ | 2022-03-28 12:08 | - | |
| Acer Aspire S3 Ultrabook Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire S3 ultrabook/ | 2022-03-28 12:08 | - | |
| Acer Aspire S5 Windows 8 problem - screen randomly changes to Metro screen/ | 2022-03-28 12:08 | - | |
| Acer Aspire S7-392 (Haswell) Owners Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire S7-392 and Windows 8.1 RTM display driver issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire S7-392 hinge cap same as S7-391 Laptop Hinge Cover Cap 42.M3EN1.001/ | 2022-03-28 12:08 | - | |
| Acer Aspire S7-393 (Broadwell) Owners Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire S7/ | 2022-03-28 12:08 | - | |
| Acer Aspire S7 Owner Thread/ | 2022-03-28 12:08 | - | |
| Acer Aspire S7 Ultrabooks/ | 2022-03-28 12:08 | - | |
| Acer Aspire Screen Fault, Can you help please/ | 2022-03-28 12:08 | - | |
| Acer Aspire Screen Going Really Dim/ | 2022-03-28 12:08 | - | |
| Acer Aspire Screen Resolution - Help/ | 2022-03-28 12:08 | - | |
| Acer Aspire Service Manuals/ | 2022-03-28 12:08 | - | |
| Acer Aspire Shutting off issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire Sound Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire TImelineX 4820TG[Webcam Quality]/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimeLineX 5830T Battery Fault/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline 1410 Official Specs & Pricing/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline 1810tz/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline 3810T Battery recommendations/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline 3810tz Vista to XP downgrade help/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline 4810t-8480 slow shut down/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline 4810t-8480 with Windows 7 RTM/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline 4820TG Recovery Error/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline 5810TG or Acer Aspire 5738Z/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline AS1810TZ-4906/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline AS3810T-6415/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline M3-581TG vs Acer Aspire 5755G/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline Shipped Worried About Recall/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline Ultra M3 News/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 1410 1810t 1810tz BIOS MOD (Insyde)/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 1830T Thread/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 1830TZ WIFI Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 3820TG mods tweaks ONLY!/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 3820TG vs Acer Aspire TimelineX 4820TG/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 3820TZ - Good Buy & CPU Upgrade Question/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 3830TG-6494/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 4820TG 5820TG Modded BIOS (Insyde)/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 4820TG Owners Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 4820TG build quality/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 4830 Owner's Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 4830TG question/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX 5820TG Review + discussion/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX AS1830T WiFi Suspend Issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX AS3820TG touchpad button problem defective or normal/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX AS4820T-5570 reviews/ | 2022-03-28 12:08 | - | |
| Acer Aspire TimelineX AS5820T-7683 versus Acer Aspire TimelineX AS4820TG-7805/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timeline and Optical Drive Power Management Problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire Timelinex 3820TG - I7-720qm upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire Tuba Booster/ | 2022-03-28 12:08 | - | |
| Acer Aspire USB problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire Upgrade to Vista Ultimate SP1/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-571 Built in WebCam is working with Windows 8 apps, but not with Desktop programs/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-571G fan cleaning/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-571G gaming performance/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-572G-76EM (Help Needed Please!)/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-575T-7008 laptop stuck in headphone mode hardware issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-771G-9875 Warranty question/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-771G BIOS EFI- Stuck!/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-771G Recovery/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-772G-9820/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-772G fan direction/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3-5710g/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3 771 G graphics card switch problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire V3 9890 - Is Full HD screen upgrade possible/ | 2022-03-28 12:08 | - | |
| Acer Aspire V5-121 - Problem with playing videos/ | 2022-03-28 12:08 | - | |
| Acer Aspire V5-122P GPU CPU issues with AMD Drivers/ | 2022-03-28 12:08 | - | |
| Acer Aspire V5-122P Owners' thread/ | 2022-03-28 12:08 | - | |
| Acer Aspire V5-471PG XP display driver/ | 2022-03-28 12:09 | - | |
| Acer Aspire V5-531 - Failure to power on most of the time, blinking lights/ | 2022-03-28 12:09 | - | |
| Acer Aspire V5-561p/ | 2022-03-28 12:09 | - | |
| Acer Aspire V5-572P-6858 first impression. Some problems. Need some advice/ | 2022-03-28 12:09 | - | |
| Acer Aspire V5-573G/ | 2022-03-28 12:09 | - | |
| Acer Aspire V5-573PG-9610 = IPS Screen or not/ | 2022-03-28 12:09 | - | |
| Acer Aspire V5-573P Owners' lounge/ | 2022-03-28 12:09 | - | |
| Acer Aspire V5 2nd Gen Owners' Lounge/ | 2022-03-28 12:08 | - | |
| Acer Aspire V7 482 582 - Question for owners, how is protected against scratches Display TouchScreen/ | 2022-03-28 12:09 | - | |
| Acer Aspire V7 482PG availability/ | 2022-03-28 12:09 | - | |
| Acer Aspire V15 Nitro Black Edition VN7-592G-71ZL 15.6-inchFull HD Notebook/ | 2022-03-28 12:08 | - | |
| Acer Aspire V 15 V3-572-596L memory upgrade/ | 2022-03-28 12:08 | - | |
| Acer Aspire V17 Nitro/ | 2022-03-28 12:08 | - | |
| Acer Aspire V 17 Nitro Black Edition VN7-793G-71AG Bios Mod possible/ | 2022-03-28 12:08 | - | |
| Acer Aspire V17 Nitro fails to respond to power button or being plugged in/ | 2022-03-28 12:08 | - | |
| Acer Aspire VN7-591G USB boot + SSD question/ | 2022-03-28 12:09 | - | |
| Acer Aspire VN7-791G-79VU questions/ | 2022-03-28 12:09 | - | |
| Acer Aspire V Nitro VN7-792G-70KY availability/ | 2022-03-28 12:08 | - | |
| Acer Aspire V Nitro VN7 2017 15' (1060+i7 7th)/ | 2022-03-28 12:08 | - | |
| Acer Aspire V Nitro any good/ | 2022-03-28 12:08 | - | |
| Acer Aspire X3810 eRecovery failure - please help/ | 2022-03-28 12:09 | - | |
| Acer Aspire Z1800/ | 2022-03-28 12:09 | - | |
| Acer Aspire Z5610 All In One PC Tv Antenna/ | 2022-03-28 12:09 | - | |
| Acer Aspire ZG5 (AOA110-BB) issues/ | 2022-03-28 12:09 | - | |
| Acer Aspire and Halo Mod/ | 2022-03-28 12:08 | - | |
| Acer Aspire and Windows Vista Issues/ | 2022-03-28 12:08 | - | |
| Acer Aspire beeps when knocked/ | 2022-03-28 12:08 | - | |
| Acer Aspire connection & compatibility problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire gaming/ | 2022-03-28 12:08 | - | |
| Acer Aspire hates Firefox/ | 2022-03-28 12:08 | - | |
| Acer Aspire inverters in the uk/ | 2022-03-28 12:08 | - | |
| Acer Aspire isass.exe error at boot up/ | 2022-03-28 12:08 | - | |
| Acer Aspire keyboard backlight timeout/ | 2022-03-28 12:08 | - | |
| Acer Aspire laptop [Screen MOD]/ | 2022-03-28 12:08 | - | |
| Acer Aspire laptop power problems/ | 2022-03-28 12:08 | - | |
| Acer Aspire line up. Good value for the $/ | 2022-03-28 12:08 | - | |
| Acer Aspire monitor brightness/ | 2022-03-28 12:08 | - | |
| Acer Aspire monitor goes grey and fuzzy/ | 2022-03-28 12:08 | - | |
| Acer Aspire not booting after cleaning the fan/ | 2022-03-28 12:08 | - | |
| Acer Aspire one (AO722-0490) - a couple of questions/ | 2022-03-28 12:08 | - | |
| Acer Aspire one/ | 2022-03-28 12:08 | - | |
| Acer Aspire one 522 and Windows 8/ | 2022-03-28 12:08 | - | |
| Acer Aspire one Dual Core is out!/ | 2022-03-28 12:08 | - | |
| Acer Aspire one crystal eye camera issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire one doesn't boot/ | 2022-03-28 12:08 | - | |
| Acer Aspire one pav70 wont turn on no leds anything/ | 2022-03-28 12:08 | - | |
| Acer Aspire one series zg5 screen problem/ | 2022-03-28 12:08 | - | |
| Acer Aspire or Acer TM/ | 2022-03-28 12:08 | - | |
| Acer Aspire or Gigabyte's G-Max/ | 2022-03-28 12:08 | - | |
| Acer Aspire or Travelmate/ | 2022-03-28 12:08 | - | |
| Acer Aspire pew76 display problem/ | 2022-03-28 12:08 | - | |
| Acer Aspireproblem with the alimentation/ | 2022-03-28 12:09 | - | |
| Acer Aspire screen issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire screen saver Acer.scr vanished/ | 2022-03-28 12:08 | - | |
| Acer Aspire sounds like helicopter/ | 2022-03-28 12:08 | - | |
| Acer Aspire switches itself off/ | 2022-03-28 12:08 | - | |
| Acer Aspire utility bloat/ | 2022-03-28 12:08 | - | |
| Acer Aspire v3-772G connectivity issue/ | 2022-03-28 12:08 | - | |
| Acer Aspire v3-772g BSOD's (kmode_exception_not_handled, irql_not_less_or_equal)/ | 2022-03-28 12:08 | - | |
| Acer Aspire v3-772g screen flickering (like bad refresh rate)/ | 2022-03-28 12:08 | - | |
| Acer Aspire v5-122p-0869, may not be what I need!/ | 2022-03-28 12:09 | - | |
| Acer Aspire v5-431 password locked/ | 2022-03-28 12:09 | - | |
| Acer Aspire v5-472-6852/ | 2022-03-28 12:09 | - | |
| Acer Aspire with Matt Screen Help me to choose/ | 2022-03-28 12:09 | - | |
| Acer Aspire x3200 GPU upgrade/ | 2022-03-28 12:09 | - | |
| Acer Aspire z5710 - Possible to upgrade VGA/ | 2022-03-28 12:09 | - | |
| Acer Aspirre 8930-7665 Design Flaw- Overheating then Downclocking When Playings Games, Causing Lag...Anyone Experiencing/ | 2022-03-28 12:09 | - | |
| Acer Aspre timeline x 4830TG keybord problems/ | 2022-03-28 12:09 | - | |
| Acer Asprie 7750g shortcuts/ | 2022-03-28 12:09 | - | |
| Acer Asspire 7720G Upgrade question/ | 2022-03-28 12:09 | - | |
| Acer BIOS CD Tool/ | 2022-03-28 12:09 | - | |
| Acer BIOS Modding/ | 2022-03-28 12:09 | - | |
| Acer BIOS Upgrade - CPU performance clamps/ | 2022-03-28 12:09 | - | |
| Acer BIOS option greyed out video memory/ | 2022-03-28 12:09 | - | |
| Acer Backup Factory Recovery query/ | 2022-03-28 12:09 | - | |
| Acer Backup Image/ | 2022-03-28 12:09 | - | |
| Acer Backup Manager/ | 2022-03-28 12:09 | - | |
| Acer Backup Manager button not working/ | 2022-03-28 12:09 | - | |
| Acer Backup Utility Question (Timeline)/ | 2022-03-28 12:09 | - | |
| Acer Batteries Recalled/ | 2022-03-28 12:09 | - | |
| Acer Battery AC Power Problem -- Need Help/ | 2022-03-28 12:09 | - | |
| Acer Battery Connection Problem/ | 2022-03-28 12:09 | - | |
| Acer Battery Problem/ | 2022-03-28 12:09 | - | |
| Acer Bio Protection/ | 2022-03-28 12:09 | - | |
| Acer Biometrics Software problem - 6920g/ | 2022-03-28 12:09 | - | |
| Acer Bioprotection in firefox/ | 2022-03-28 12:09 | - | |
| Acer Bios/ | 2022-03-28 12:09 | - | |
| Acer Bios 1.33 vs 1.34 Aspire 5315/ | 2022-03-28 12:09 | - | |
| Acer Bios Lock Out/ | 2022-03-28 12:09 | - | |
| Acer Bios Problem HELP!!!!/ | 2022-03-28 12:09 | - | |
| Acer Bloatware/ | 2022-03-28 12:09 | - | |
| Acer Blue 6920g and Bose problems, help!/ | 2022-03-28 12:09 | - | |
| Acer Bluetooth Blue light keeps flashing/ | 2022-03-28 12:09 | - | |
| Acer Bluetooth VoIP Phone won't detect/ | 2022-03-28 12:09 | - | |
| Acer Bluetooth Voip Phone V2/ | 2022-03-28 12:09 | - | |
| Acer Bluray optical drive/ | 2022-03-28 12:09 | - | |
| Acer Boot times what is yours -)/ | 2022-03-28 12:09 | - | |
| Acer Brightness Auto-Adjustment Disabling/ | 2022-03-28 12:09 | - | |
| Acer C24-865 Headphones device disappears from devices/ | 2022-03-28 12:09 | - | |
| Acer C100/ | 2022-03-28 12:09 | - | |
| Acer C112 C113 tablet PC/ | 2022-03-28 12:09 | - | |
| Acer C300 CXI/ | 2022-03-28 12:09 | - | |
| Acer CD DVD Problems/ | 2022-03-28 12:09 | - | |
| Acer CMOS Battery/ | 2022-03-28 12:09 | - | |
| Acer CPU overclocking/ | 2022-03-28 12:09 | - | |
| Acer Canada publishes new notebook pricing/ | 2022-03-28 12:09 | - | |
| Acer Canada repair infos/ | 2022-03-28 12:09 | - | |
| Acer Canada service/ | 2022-03-28 12:09 | - | |
| Acer Certified Repair Shop(s) Reseller(s) in Boston, Mass.!/ | 2022-03-28 12:09 | - | |
| Acer Chargers... pa-1900-04 & adp90sb bb What is the Differance/ | 2022-03-28 12:09 | - | |
| Acer Chaser Update - 8935G Getting Better Graphics Cards!/ | 2022-03-28 12:09 | - | |
| Acer Chaser Update - Aspire 8935G!/ | 2022-03-28 12:09 | - | |
| Acer Chaser Update- Model Announcements!/ | 2022-03-28 12:09 | - | |
| Acer Chaser Update - New i3 i5 Models Incoming!/ | 2022-03-28 12:09 | - | |
| Acer Chaser Update/ | 2022-03-28 12:09 | - | |
| Acer Chaser Update Re- 6920G Throttling/ | 2022-03-28 12:09 | - | |
| Acer Chromebook AC700/ | 2022-03-28 12:09 | - | |
| Acer Chromebook C7 Owners Lounge/ | 2022-03-28 12:09 | - | |
| Acer CineDash Config/ | 2022-03-28 12:09 | - | |
| Acer CineDash FIX! (Working with Winamp)/ | 2022-03-28 12:09 | - | |
| Acer Connected by W-Fi, Excellent Signal, my SSID, will not load webpages/ | 2022-03-28 12:09 | - | |
| Acer Cpu Cooling control/ | 2022-03-28 12:09 | - | |
| Acer CrystalBrite/ | 2022-03-28 12:09 | - | |
| Acer CrystalBrite = glossy screen/ | 2022-03-28 12:09 | - | |
| Acer Crystal Eye Web Cam/ | 2022-03-28 12:09 | - | |
| Acer Crystal Eye Webcam/ | 2022-03-28 12:09 | - | |
| Acer Crystal Eye Webcam Problem/ | 2022-03-28 12:09 | - | |
| Acer Crystal Eye Webcam Unknown Device Acer 5739g/ | 2022-03-28 12:09 | - | |
| Acer Crystal Eye Webcam problem!! help/ | 2022-03-28 12:09 | - | |
| Acer Crystal Eye webcam App/ | 2022-03-28 12:09 | - | |
| Acer Crystalbrite - Color Calibration/ | 2022-03-28 12:09 | - | |
| Acer Customer Service/ | 2022-03-28 12:09 | - | |
| Acer Customer Support/ | 2022-03-28 12:09 | - | |
| Acer Customization/ | 2022-03-28 12:09 | - | |
| Acer D- partition/ | 2022-03-28 12:09 | - | |
| Acer D2D Recovery/ | 2022-03-28 12:09 | - | |
| Acer D2D and Arcade Deluxe Problems/ | 2022-03-28 12:09 | - | |
| Acer D255E Windows 7 sleep problem/ | 2022-03-28 12:09 | - | |
| AcerDATA partition/ | 2022-03-28 12:10 | - | |
| Acer DHL warranty computer lost/ | 2022-03-28 12:09 | - | |
| Acer DVD issue's on Vista/ | 2022-03-28 12:09 | - | |
| Acer Deterioration Specifically Sound/ | 2022-03-28 12:09 | - | |
| Acer Diagnostics/ | 2022-03-28 12:09 | - | |
| Acer Displays- How do they rate/ | 2022-03-28 12:09 | - | |
| Acer Dothan Overclocking/ | 2022-03-28 12:09 | - | |
| Acer Downgrading/ | 2022-03-28 12:09 | - | |
| Acer Drivers or Realtek/ | 2022-03-28 12:09 | - | |
| Acer Dual Core/ | 2022-03-28 12:09 | - | |
| Acer Dual DVD/ | 2022-03-28 12:09 | - | |
| Acer E1-421 RAM upgrade doubt/ | 2022-03-28 12:09 | - | |
| Acer E5-573 ventilation/ | 2022-03-28 12:09 | - | |
| Acer E5-575G Backlit Keyboard Mod/ | 2022-03-28 12:09 | - | |
| Acer E5-575G no boot/ | 2022-03-28 12:09 | - | |
| Acer E5-771G-50MN/ | 2022-03-28 12:09 | - | |
| Acer E5-773 Notebook - White Patch visible during dark background/ | 2022-03-28 12:09 | - | |
| Acer E5 575 52JF battery swap with Acer E5 575G 53GV/ | 2022-03-28 12:09 | - | |
| Acer E11 ES1-111M-P2YU Laptop Review by HTWingNut/ | 2022-03-28 12:09 | - | |
| Acer ERecovery - Partitioning/ | 2022-03-28 12:09 | - | |
| Acer E Recovery/ | 2022-03-28 12:09 | - | |
| Acer EX4420-5963 OS Installation problem/ | 2022-03-28 12:09 | - | |
| Acer EasyPort IV pinout/ | 2022-03-28 12:09 | - | |
| Acer Emachines E732ZG/ | 2022-03-28 12:09 | - | |
| Acer Empower Error Weird Wireless Error/ | 2022-03-28 12:09 | - | |
| Acer Empower Software for Windows XP/ | 2022-03-28 12:09 | - | |
| Acer Empowering . NET Error/ | 2022-03-28 12:09 | - | |
| Acer Empowering Software for 64bit/ | 2022-03-28 12:09 | - | |
| Acer Empowering Technology Framework for Vista/ | 2022-03-28 12:09 | - | |
| Acer Empowering Technology Framework not working after installing SP1/ | 2022-03-28 12:09 | - | |
| Acer Empowering Technology for Vista/ | 2022-03-28 12:09 | - | |
| Acer Empowering Technology hotkey/ | 2022-03-28 12:09 | - | |
| Acer Empowering Tech not compatible with WinXP on 7720/ | 2022-03-28 12:09 | - | |
| Acer Empowering Utilities/ | 2022-03-28 12:09 | - | |
| Acer Empowering Utils for Windows XP for Gamestone Laptops/ | 2022-03-28 12:09 | - | |
| Acer Empowering platform 2.3.2015/ | 2022-03-28 12:09 | - | |
| Acer Empowerment again!!/ | 2022-03-28 12:09 | - | |
| Acer Epower/ | 2022-03-28 12:09 | - | |
| Acer Epower manager/ | 2022-03-28 12:09 | - | |
| Acer Erecovery help info needed ASP please/ | 2022-03-28 12:09 | - | |
| Acer Erecovery hidden partition issues/ | 2022-03-28 12:09 | - | |
| Acer Ethos 8943G Random Reboot Problems (and bluetooth fix )/ | 2022-03-28 12:09 | - | |
| Acer Ethos 8950G vs. 8951G/ | 2022-03-28 12:09 | - | |
| Acer Ethos AS8951G AS5951G Owners Lounge/ | 2022-03-28 12:09 | - | |
| Acer Experience/ | 2022-03-28 12:09 | - | |
| Acer Extended Service and Warranty Contracts/ | 2022-03-28 12:09 | - | |
| Acer Extended Warranty/ | 2022-03-28 12:09 | - | |
| Acer Extended Warranty in Canada/ | 2022-03-28 12:09 | - | |
| Acer Extensa/ | 2022-03-28 12:09 | - | |
| Acer Extensa 56.. keeps shutting down when installing updates/ | 2022-03-28 12:09 | - | |
| Acer Extensa 2302LC - Disks/ | 2022-03-28 12:09 | - | |
| Acer Extensa 2303LC.... Upgrade Video RAM/ | 2022-03-28 12:09 | - | |
| Acer Extensa 2303LC Battery Problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 2900 heat problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 3000 need help/ | 2022-03-28 12:09 | - | |
| Acer Extensa 3002WLMi/ | 2022-03-28 12:09 | - | |
| Acer Extensa 3002WLMi drivers problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4220 - Linpus To Xp/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4220 Harddrive problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4230 4630 and Travelmate 4730 Owner's Lounge/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4230 Keyboard Issue/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4230 won't boot from CD/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 (2) HD (Combine )/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420-5237/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420-5237 ac adapter power cord/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420-5237 power up failure/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420-5239 upgradeable Other questions as well/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420-5817 Display Driver problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420-5963 - xp modem issue/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420-5963 Power Button problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420-5963 SSD/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 ATI Radeon x1250 driver for xp/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 Audio Not Working!/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 CMOS/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 Improving Video/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 Key Questions, Problems/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 Questions/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 SD Boot/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 Wireless and Wired internet problems/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 Wireless not working/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 from vista to XP pro/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 keeps on restarting on its own, Plz Help!/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 opinion/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 problems/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 wireless lan driver for xp not working!/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4420 won't power up/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4620/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4620 VGA Problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4620Z - XP drivers where are they/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4620Z/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4620Z Super-delayed power-on time/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4620Z Wireless connection is very slow/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4620Z and the GL960 Chipset/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4620z Disassembly guide/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4630G (aka Acer Travelmate 4730G) CPU upgrade + pics (56k warning!!)(and a nifty surprise inside!)/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4630G/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4630Z Display/ | 2022-03-28 12:09 | - | |
| Acer Extensa 4630ZG/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5210 broadcom wireless/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5220 Bluetooth Problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5220 default screen problem Win XP/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5230/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5230 CPU replacement (T9300)/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5235 cpu upgrade help/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5410/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5420/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5420G volume goes up and down by itself/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5420 Issues/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5420 Recovery/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5420 problems/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5430-8588 - Display Problems/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5510 - can't wake up from sleep/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5610. What DVD drive does it use and any reviews out there/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5610/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5610 5620 4210 4220 advice/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620-6419 video card changing possible/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620-6830, model MS2205 from eBay; several issues/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620-6830 Upgrades/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620-6830 help/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620 - LX.E970Z.123 - matte or glossy LCD/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620 - Touchpad Button Fix Spring/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620 - recovery and other stuff/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620.G/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620 Cover Cracking (again)/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620G or similar - bios wake up alarm/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620G worthles How to detect TV/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620 No Power & No Boot At All!!/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620 Recovery cd/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620Z-4A2G12Mi CPU upgrade/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620 lost sound/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620z Hanging Bios Screen/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620z bluetooth/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5620z recovery with new HDD/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5630EZ problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5630G-644G32Mn CPU Upgrade/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5630G virtualization/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5630 Recovery Media Issues/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5630z - bios microcode update for C2D T7500 Merom/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5635-Z. Is this kind of overclocking/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5635G - high CPU usage + overheating problem/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5635ZG freezes after cpu upgrade/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5635Z Headphone problem [Windows 7]/ | 2022-03-28 12:09 | - | |
| Acer Extensa 5635z bios-mod/ | 2022-03-28 12:09 | - | |
| Acer Extensa Battery/ | 2022-03-28 12:09 | - | |
| Acer Extensa Blue Tooth module/ | 2022-03-28 12:09 | - | |
| Acer Extensa EX4420/ | 2022-03-28 12:09 | - | |
| Acer Extensa EX4420 bad motherboard chance/ | 2022-03-28 12:09 | - | |
| Acer Extensa EX4420 stuck pixel dead pixel/ | 2022-03-28 12:09 | - | |
| Acer Extensa LCD Panels - 14 WXGA/ | 2022-03-28 12:09 | - | |
| Acer Extensa Laptop To TV/ | 2022-03-28 12:09 | - | |
| Acer Extensa can't detect bluetooth/ | 2022-03-28 12:09 | - | |
| Acer Extensa power adapter/ | 2022-03-28 12:09 | - | |
| Acer Extenza 4620Z Change ACHI to IDE/ | 2022-03-28 12:09 | - | |
| Acer F5-573g-59aj unlock advanced menu/ | 2022-03-28 12:09 | - | |
| Acer FAT32 HDD/ | 2022-03-28 12:09 | - | |
| Acer FAT32 NFTS Spilt drive question/ | 2022-03-28 12:09 | - | |
| Acer FX 9800P + RX540 Very Low FPS in all Games/ | 2022-03-28 12:09 | - | |
| Acer Factory IMG to external HDD possible/ | 2022-03-28 12:09 | - | |
| Acer Ferarri 3200 SP2/ | 2022-03-28 12:09 | - | |
| Acer Ferarri 3200 restarts when overclocking GPU/ | 2022-03-28 12:09 | - | |
| Acer Ferarri 3400 w Athlon 64 3000+ 90nm Low-Volt/ | 2022-03-28 12:09 | - | |
| Acer Ferrai logo/ | 2022-03-28 12:09 | - | |
| Acer Ferrari-3000- Would you buy another one/ | 2022-03-28 12:09 | - | |
| Acer Ferrari - How to Test Drive!!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 1000/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 1005 = burner!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 1005 Fan problem/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 1005WTMi boot issue/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 1100 32 bit or 64 bit Win 7 to use HDD change/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 2008 Calendar/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3000 Review/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200 - Questions/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200 Bios Issues/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200 Released in Taiwan/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200 benchmark results/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200 memory upgrade slot(s)/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200 news from Acer/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200 or emachine 6807/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3200 sound card/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400, heat and taking apart problems/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400- Removing the Hard Drive/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 64-bit Notebook Announced/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 Bluetooth/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 HD Upgrade question/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 Heat Issue help!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 Power-up Problems/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 Review/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 Upgrading from 80 Gb to 250 Gb HDD/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 heating problem finally solved!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 need a Artic Silver Guide...help/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 or Travelmate 8104/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 3400 thermal pad/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000 ( or any acer with x700 128mb )/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000 - opinions please!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000 Deal...I think it's good/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000 Officially Launched/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000 Soon to Be Released/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000 pre-order in Canada/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000 problem/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4000 wireless connection problems!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4002 and New Turion 64 X2 Dual core/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4002wlmi/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4003WLMi/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005- A story of humorous absurdity/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 - Heating up overtime/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 - Help! S Video Connection/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 - screen color adjustment/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 - unbelievably stupid question!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 HELPPPPP!!!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 Lemon/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 Notebook!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 RAM Upgrade/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 WLMI.. should I buy this/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005WLMi-Help required URGENT!!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 became discontinued/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 build quality/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 keyboard issue/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 questions/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 vs. Asus z71V/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4005 with two batteries/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4006WLMi, loud fan/ | 2022-03-28 12:09 | - | |
| Acer Ferrari4006WLMi - 100GB or 120GB ! !/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4006 heating issue/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 4500WLMi help needed -)/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 5000 Boot Problems/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 5000 Help please!/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 5000 Upgrades/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 5000 and SSD drive/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 5000 experience/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 5006WLMI/ | 2022-03-28 12:09 | - | |
| Acer Ferrari 5006WLMi with AMD Turion X2 CPU/ | 2022-03-28 12:09 | - | |
| Acer FerrariAcer Ferrari One F0200 keeps rebooting/ | 2022-03-28 12:09 | - | |
| Acer Ferrari Bluetooth/ | 2022-03-28 12:09 | - | |
| Acer Ferrari Bluetooth Mouse/ | 2022-03-28 12:09 | - | |
| Acer Ferrari Dvd Drive/ | 2022-03-28 12:09 | - | |
| Acer Ferrari LX FR406 Sleep Problems/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One- Problem with brightness controls after waking from sleep/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One - goes on sale/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One - opinions/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One 200 - net problem in USA/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One 200 user review/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One FO200 Bluetooth Module/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One Press Release/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One QuickReview/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One Reviews and Owners Lounge/ | 2022-03-28 12:09 | - | |
| Acer Ferrari One Wont Boot! -(/ | 2022-03-28 12:09 | - | |
| Acer Ferrari Start Up Sound/ | 2022-03-28 12:09 | - | |
| Acer Ferrari Story/ | 2022-03-28 12:09 | - | |
| Acer Ferrari Weird/ | 2022-03-28 12:09 | - | |
| Acer Ferrari Windows XP icon(s)/ | 2022-03-28 12:09 | - | |
| Acer Ferrari Wireless Bluetooth Mouse Problem/ | 2022-03-28 12:09 | - | |
| Acer Ferrari agere systems 97 modem doesnt work/ | 2022-03-28 12:09 | - | |
| Acer Ferrari for mid-high end notebooks, Acer BMW for low-mid end/ | 2022-03-28 12:09 | - | |
| Acer Ferrari in hibernation - For ever/ | 2022-03-28 12:09 | - | |
| Acer Ferrari notebook question/ | 2022-03-28 12:09 | - | |
| Acer Ferrari one Netbook , the fastest netbook/ | 2022-03-28 12:09 | - | |
| Acer Ferrari w i5 or i7/ | 2022-03-28 12:09 | - | |
| Acer Ferrari with Real Player/ | 2022-03-28 12:09 | - | |
| Acer Fingertouch FingerLaunch Software and Visual Basic 6 incompatibility/ | 2022-03-28 12:09 | - | |
| Acer Folio Design Flaw!/ | 2022-03-28 12:09 | - | |
| Acer Fraud- All 8930G-7665 users/ | 2022-03-28 12:09 | - | |
| Acer GEMSTONE Design, Built Quality, Opinions/ | 2022-03-28 12:06 | - | |
| Acer Gemstone - Just how good are the speakers/ | 2022-03-28 12:09 | - | |
| Acer Gemstone...Too many leds. Disabling them/ | 2022-03-28 12:09 | - | |
| Acer Gemstone 89 30/ | 2022-03-28 12:09 | - | |
| Acer Gemstone Blue 6920 and 8920 CineDash problems/ | 2022-03-28 12:09 | - | |
| Acer Gemstone Blue 8920 Release Date/ | 2022-03-28 12:09 | - | |
| Acer Gemstone Blue 8930G randomly won't start up/ | 2022-03-28 12:09 | - | |
| Acer Gemstone Blue Microsoft Office/ | 2022-03-28 12:09 | - | |
| Acer Gemstone Blue downclocking GPU/ | 2022-03-28 12:09 | - | |
| Acer Gemstone Blue slowdown/ | 2022-03-28 12:09 | - | |
| Acer Gemstone Blue speakers/ | 2022-03-28 12:09 | - | |
| Acer Gemstone blue wallpaper/ | 2022-03-28 12:09 | - | |
| Acer Gemstone concept/ | 2022-03-28 12:09 | - | |
| Acer Gemstone making Annoying Sound/ | 2022-03-28 12:09 | - | |
| Acer Good/ | 2022-03-28 12:09 | - | |
| Acer Graphics Dock - Thunderbolt 3 - Does it exist in US retail yet/ | 2022-03-28 12:09 | - | |
| Acer Graphics Drivers/ | 2022-03-28 12:09 | - | |
| Acer Grid System/ | 2022-03-28 12:09 | - | |
| Acer HDD Issues/ | 2022-03-28 12:09 | - | |
| Acer HN274H 3d Monitor/ | 2022-03-28 12:09 | - | |
| Acer Heat Sound Build Quilty Screen Cus. Support/ | 2022-03-28 12:09 | - | |
| Acer Hidden Recovery Partition/ | 2022-03-28 12:09 | - | |
| Acer Hiden Partion Problem/ | 2022-03-28 12:09 | - | |
| Acer ITW Location in Oman/ | 2022-03-28 12:09 | - | |
| Acer Iconia- Have you tried own it or know of good end-user reviews of it/ | 2022-03-28 12:09 | - | |
| Acer Iconia/ | 2022-03-28 12:09 | - | |
| Acer Iconia Dual Screen Review/ | 2022-03-28 12:09 | - | |
| Acer Iconia Dual Touch Screen Ghosting Fault/ | 2022-03-28 12:09 | - | |
| Acer Iconia PAU30 - ACER RING software/ | 2022-03-28 12:09 | - | |
| Acer Iconia Tab W500-BZ467 Tablet PC/ | 2022-03-28 12:09 | - | |
| Acer Iconia Talk/ | 2022-03-28 12:09 | - | |
| Acer Iconia w500/ | 2022-03-28 12:09 | - | |
| Acer Inspire 1690/ | 2022-03-28 12:09 | - | |
| Acer Inspire 5630 cmos battery/ | 2022-03-28 12:09 | - | |
| Acer Inspire One D255 or 533/ | 2022-03-28 12:09 | - | |
| Acer Insyde BIOS mod- Anyone tried/ | 2022-03-28 12:09 | - | |
| Acer Intel Chipset Driver Behavour/ | 2022-03-28 12:09 | - | |
| Acer Internet Modem Problems/ | 2022-03-28 12:09 | - | |
| Acer Iternational warranty/ | 2022-03-28 12:09 | - | |
| Acer L320/ | 2022-03-28 12:09 | - | |
| AcerLAppFix what this do/ | 2022-03-28 12:10 | - | |
| Acer LCD Screen DEAD/ | 2022-03-28 12:09 | - | |
| Acer LCD light bleed/ | 2022-03-28 12:09 | - | |
| Acer LCD problem/ | 2022-03-28 12:09 | - | |
| Acer LCD question/ | 2022-03-28 12:09 | - | |
| Acer Lack of support/ | 2022-03-28 12:09 | - | |
| Acer Laptop Backup Question to other laptop/ | 2022-03-28 12:09 | - | |
| Acer Laptop Battery showing Cross (X) sign, not charging/ | 2022-03-28 12:09 | - | |
| Acer Laptop Core i5 5200U 2.2GHz 1TB HDD 8GB RAM NVIDIA 940M 1080P 15.6 WIN 10/ | 2022-03-28 12:09 | - | |
| Acer Laptop Crashes Wifi Network/ | 2022-03-28 12:09 | - | |
| Acer Laptop Excessive vibration/ | 2022-03-28 12:09 | - | |
| Acer Laptop Final Solution (video)/ | 2022-03-28 12:09 | - | |
| Acer Laptop Hardware Problem/ | 2022-03-28 12:09 | - | |
| Acer Laptop Problem Help Me Please!!/ | 2022-03-28 12:09 | - | |
| Acer Laptop Replacement/ | 2022-03-28 12:09 | - | |
| Acer Laptop Restart Continuously/ | 2022-03-28 12:09 | - | |
| Acer Laptop Screen problem/ | 2022-03-28 12:09 | - | |
| Acer Laptop Temperature Monitor/ | 2022-03-28 12:09 | - | |
| Acer Laptop Thermal Testing Thread/ | 2022-03-28 12:09 | - | |
| Acer Laptop Travelmate 240/ | 2022-03-28 12:09 | - | |
| Acer Laptop VT Enable/ | 2022-03-28 12:09 | - | |
| Acer Laptop Warranty Question/ | 2022-03-28 12:09 | - | |
| Acer Laptop and Compal/ | 2022-03-28 12:09 | - | |
| Acer Laptop issues/ | 2022-03-28 12:09 | - | |
| Acer Laptop parts any one got 14 inch screen/ | 2022-03-28 12:09 | - | |
| Acer Laptops - I'm trying to make a final decision/ | 2022-03-28 12:09 | - | |
| Acer Laptops/ | 2022-03-28 12:09 | - | |
| Acer Laptop screen problem 16-10 change to 4-3/ | 2022-03-28 12:09 | - | |
| Acer Laptop with Phoenix BIOS- BIOS MOD Request - NX-bit/ | 2022-03-28 12:09 | - | |
| Acer Laptop with Phoenix BIOS- BIOS MOD Request/ | 2022-03-28 12:09 | - | |
| Acer Laptop with Phoenix BIOS- Enable Virtualization (Test Machine- Acer Aspire 9420)/ | 2022-03-28 12:09 | - | |
| Acer Laptop with Phoenix BIOS- Enable Virtualization (aspire 5580)/ | 2022-03-28 12:09 | - | |
| Acer Laptop with Phoenix BIOS- Enable Virtualization - BOB12X & KIZWAN/ | 2022-03-28 12:09 | - | |
| Acer Laptop with Phoenix BIOS- I can't flashing the bios HELP!/ | 2022-03-28 12:09 | - | |
| Acer Laptop with Phoenix BIOS BIOS MOD Request/ | 2022-03-28 12:09 | - | |
| Acer Launch Manager/ | 2022-03-28 12:09 | - | |
| Acer Launch Manager 3.0.01 download/ | 2022-03-28 12:09 | - | |
| Acer Launcher Freezes/ | 2022-03-28 12:09 | - | |
| Acer Launching Google Chromebook/ | 2022-03-28 12:09 | - | |
| Acer Launching Low Cost Notebook Later This Year/ | 2022-03-28 12:09 | - | |
| Acer Lid Problem - Help/ | 2022-03-28 12:09 | - | |
| Acer M3 581TG high pitch squeak through headphones/ | 2022-03-28 12:09 | - | |
| Acer M5-581TG LCD module replacement question/ | 2022-03-28 12:09 | - | |
| Acer M5 481TG timelineU screen is rubbish/ | 2022-03-28 12:09 | - | |
| Acer M5 581-TG weird noises/ | 2022-03-28 12:09 | - | |
| Acer MBR - how is it different from generic/ | 2022-03-28 12:09 | - | |
| Acer MXM BIOS Mods and discussion (was- x920G vs. 9600M GT)/ | 2022-03-28 12:09 | - | |
| Acer MXM Models and Cards/ | 2022-03-28 12:09 | - | |
| Acer Mat a UJ-845S Firmware Swap/ | 2022-03-28 12:09 | - | |
| Acer MediaBay/ | 2022-03-28 12:09 | - | |
| Acer Meets it Goals/ | 2022-03-28 12:09 | - | |
| Acer Mobility Center/ | 2022-03-28 12:09 | - | |
| Acer Mods Needed/ | 2022-03-28 12:09 | - | |
| Acer Motherboard for 5336-2752/ | 2022-03-28 12:09 | - | |
| Acer Mouse/ | 2022-03-28 12:09 | - | |
| Acer Mouse Bar Issue on 4810T/ | 2022-03-28 12:09 | - | |
| Acer Mp3 Player/ | 2022-03-28 12:09 | - | |
| Acer Mxm 2.1 3a Gpu Bracket/ | 2022-03-28 12:09 | - | |
| Acer MyWinlocker virtual drive recovery/ | 2022-03-28 12:09 | - | |
| Acer NAPP CD V5.1.8 download/ | 2022-03-28 12:09 | - | |
| Acer Napa Coming soon/ | 2022-03-28 12:09 | - | |
| Acer Napp Cd/ | 2022-03-28 12:09 | - | |
| Acer Netbook/ | 2022-03-28 12:09 | - | |
| Acer Netbook Boot Up Issue/ | 2022-03-28 12:09 | - | |
| Acer Netbook SLow When on Battery/ | 2022-03-28 12:09 | - | |
| Acer Network Controller problem/ | 2022-03-28 12:09 | - | |
| Acer Newest Bios 3226 cause acpi error on vista and xp/ | 2022-03-28 12:09 | - | |
| Acer Nitro 5/ | 2022-03-28 12:09 | - | |
| Acer Nitro 5 AN515-55 Cpu temp spikes/ | 2022-03-28 12:09 | - | |
| Acer Nitro 5 i5 8300h + GTX 1050 ti AMA/ | 2022-03-28 12:09 | - | |
| Acer No longer offers free shiping for returns/ | 2022-03-28 12:09 | - | |
| Acer Not Shipping New Models/ | 2022-03-28 12:09 | - | |
| Acer Notebook Battery Issue/ | 2022-03-28 12:09 | - | |
| Acer Notebook Cooling Fans/ | 2022-03-28 12:09 | - | |
| Acer Notebook Keyboard Skin Protection Available/ | 2022-03-28 12:09 | - | |
| Acer Notebook Problems/ | 2022-03-28 12:09 | - | |
| Acer Notebook Problems ask here/ | 2022-03-28 12:09 | - | |
| Acer Notebook Tru Brite/ | 2022-03-28 12:09 | - | |
| Acer Notebook help/ | 2022-03-28 12:09 | - | |
| Acer Note books/ | 2022-03-28 12:09 | - | |
| Acer Notebook wireless switch/ | 2022-03-28 12:09 | - | |
| Acer Numpad Numlock Fix/ | 2022-03-28 12:09 | - | |
| Acer ODD front bezels/ | 2022-03-28 12:09 | - | |
| Acer ODMs/ | 2022-03-28 12:09 | - | |
| Acer ONE D150 Wireless Upgrade HELP please/ | 2022-03-28 12:09 | - | |
| Acer ORBICAM question/ | 2022-03-28 12:09 | - | |
| Acer Oem Install Dvd Windows 7 Home Premium X64/ | 2022-03-28 12:09 | - | |
| Acer One/ | 2022-03-28 12:09 | - | |
| Acer One 722 Question/ | 2022-03-28 12:09 | - | |
| Acer One Aspire (AOA 150) Wireless operation has become weird/ | 2022-03-28 12:09 | - | |
| Acer One D150 no bootable device/ | 2022-03-28 12:09 | - | |
| Acer One Ferrari laptop/ | 2022-03-28 12:09 | - | |
| Acer One Memory Hard Drive Q/ | 2022-03-28 12:09 | - | |
| Acer One ZG5 SSD to HDD/ | 2022-03-28 12:09 | - | |
| Acer One and Win 7/ | 2022-03-28 12:09 | - | |
| Acer One power management downclocking Atom/ | 2022-03-28 12:09 | - | |
| Acer Ones and OLED/ | 2022-03-28 12:09 | - | |
| Acer OrbiCam failure/ | 2022-03-28 12:09 | - | |
| Acer OrbiCam not working/ | 2022-03-28 12:09 | - | |
| Acer OrbiCam webcam- Is it any good/ | 2022-03-28 12:09 | - | |
| Acer Orbicam old .avi files/ | 2022-03-28 12:09 | - | |
| Acer Orbicam with Logitech Software!/ | 2022-03-28 12:09 | - | |
| Acer OrbitCam help/ | 2022-03-28 12:09 | - | |
| Acer Outlet Scratch and Dent condition/ | 2022-03-28 12:09 | - | |
| Acer Owners Lounge Directory/ | 2022-03-28 12:09 | - | |
| Acer P645-M - biometric sensor does not show in the Control Panel (Win7)/ | 2022-03-28 12:09 | - | |
| Acer P645MG shuts down/ | 2022-03-28 12:09 | - | |
| Acer PCI conflict at boot/ | 2022-03-28 12:09 | - | |
| Acer PITA! Pain in The A/ | 2022-03-28 12:09 | - | |
| Acer PQSERVICE hidden partition request/ | 2022-03-28 12:09 | - | |
| Acer PSD (personal secure disk) problem/ | 2022-03-28 12:09 | - | |
| Acer Pentium Centrino TM 4002 WLMi/ | 2022-03-28 12:09 | - | |
| Acer Performance Enhancement/ | 2022-03-28 12:09 | - | |
| Acer Port Replicator with DVI/ | 2022-03-28 12:09 | - | |
| Acer Post-Recovery Problems Concerning Gaming/ | 2022-03-28 12:09 | - | |
| Acer Power F6 Recovery Partition/ | 2022-03-28 12:09 | - | |
| Acer PowerProducer Aspect ratio problem/ | 2022-03-28 12:09 | - | |
| Acer Power Supply - Can it be used in 220v 110v sockets/ | 2022-03-28 12:09 | - | |
| Acer Predator (Vega 56+Ryzen 2) Helios 500/ | 2022-03-28 12:09 | - | |
| Acer Predator 15 17 screen flickering/ | 2022-03-28 12:09 | - | |
| Acer Predator 15 G591 fhd or uhd best choice for photo editing/ | 2022-03-28 12:09 | - | |
| Acer Predator 15 Review G9-591 w 980m Review and Gameplay videos/ | 2022-03-28 12:09 | - | |
| Acer Predator 15 boot loop/ | 2022-03-28 12:09 | - | |
| Acer Predator 17 15 Gaming Notebooks/ | 2022-03-28 12:09 | - | |
| Acer Predator 17 Broke After Just 36 Days Of Use/ | 2022-03-28 12:09 | - | |
| Acer Predator 17 GX-792-7448/ | 2022-03-28 12:09 | - | |
| Acer Predator 17 X - GTX 1080 7820HQ/ | 2022-03-28 12:09 | - | |
| Acer Predator 17 X GX-792-77BL/ | 2022-03-28 12:09 | - | |
| Acer Predator 17X GX-792/ | 2022-03-28 12:09 | - | |
| Acer Predator 17 and external GPU/ | 2022-03-28 12:09 | - | |
| Acer Predator 17 frame drops/ | 2022-03-28 12:09 | - | |
| Acer Predator 21 X/ | 2022-03-28 12:09 | - | |
| Acer Predator G5 modding/ | 2022-03-28 12:09 | - | |
| Acer Predator G9 (593) Owners Lounge/ | 2022-03-28 12:09 | - | |
| Acer Predator G9-792-77UL/ | 2022-03-28 12:09 | - | |
| Acer Predator G9 15 17 2016 w NVidia 10 Series/ | 2022-03-28 12:09 | - | |
| Acer Predator G9 15 17 Owner's Lounge/ | 2022-03-28 12:09 | - | |
| Acer Predator G9 970M Vbios/ | 2022-03-28 12:09 | - | |
| Acer Predator Helios 300/ | 2022-03-28 12:09 | - | |
| Acer Predator Helios 300 Battery Upgrade/ | 2022-03-28 12:09 | - | |
| Acer Predator Helios 300 VBIOS modding, need help bypassing insyde secure flash/ | 2022-03-28 12:09 | - | |
| Acer Predator Helios 300 panel upgrade/ | 2022-03-28 12:09 | - | |
| Acer Predator Helios 500 (Intel + nVidia)/ | 2022-03-28 12:09 | - | |
| Acer Predator Helios 500/ | 2022-03-28 12:09 | - | |
| Acer Predator Helios 700 Owners Lounge/ | 2022-03-28 12:09 | - | |
| Acer Predator Helios 700 review/ | 2022-03-28 12:09 | - | |
| Acer Predator Laptop Questions/ | 2022-03-28 12:09 | - | |
| Acer Predator Screen Flicker/ | 2022-03-28 12:09 | - | |
| Acer Predator Triton 700 - Release Date & Screen Refresh/ | 2022-03-28 12:09 | - | |
| Acer Predator Triton 700/ | 2022-03-28 12:09 | - | |
| Acer Predator Triton 900/ | 2022-03-28 12:09 | - | |
| Acer Predator Upgrade/ | 2022-03-28 12:09 | - | |
| Acer Problem/ | 2022-03-28 12:09 | - | |
| Acer Prodock Wireless, anyone/ | 2022-03-28 12:09 | - | |
| Acer Puma Laptop/ | 2022-03-28 12:09 | - | |
| Acer R5-471T-71W2/ | 2022-03-28 12:09 | - | |
| Acer R3610 - xp drivers/ | 2022-03-28 12:09 | - | |
| Acer RMA experience/ | 2022-03-28 12:09 | - | |
| Acer RTMBR.BIN/ | 2022-03-28 12:09 | - | |
| Acer Random Reboots!/ | 2022-03-28 12:09 | - | |
| Acer Random Restarts/ | 2022-03-28 12:09 | - | |
| Acer Raw Socket Service/ | 2022-03-28 12:09 | - | |
| Acer Realtek 4820T Audio Driver/ | 2022-03-28 12:09 | - | |
| Acer Recall Battery On Some Machines/ | 2022-03-28 12:09 | - | |
| Acer Recalls Gaming PCs/ | 2022-03-28 12:09 | - | |
| Acer Recovery- New HDD/ | 2022-03-28 12:09 | - | |
| Acer Recovery/ | 2022-03-28 12:09 | - | |
| Acer Recovery Alt + F10/ | 2022-03-28 12:09 | - | |
| Acer Recovery Console problem/ | 2022-03-28 12:09 | - | |
| Acer Recovery Disc/ | 2022-03-28 12:09 | - | |
| Acer Recovery Media Purchase Program/ | 2022-03-28 12:09 | - | |
| Acer Recovery Partition - Can this be editted/ | 2022-03-28 12:09 | - | |
| Acer Recovery Problem (probably not the first)/ | 2022-03-28 12:09 | - | |
| Acer Recovery and Partitions/ | 2022-03-28 12:09 | - | |
| Acer Region free DVD Firmware Link(s)/ | 2022-03-28 12:09 | - | |
| Acer Registration/ | 2022-03-28 12:09 | - | |
| Acer Released New Bios As5672/ | 2022-03-28 12:09 | - | |
| Acer Released ePower Management for Windows 7/ | 2022-03-28 12:09 | - | |
| Acer Repair Center Address/ | 2022-03-28 12:09 | - | |
| Acer Repair LOOK OUT/ | 2022-03-28 12:09 | - | |
| Acer Repair Time/ | 2022-03-28 12:09 | - | |
| Acer Replacement Keyboard (5532, 5517...)/ | 2022-03-28 12:09 | - | |
| Acer Replacement Parts Thread/ | 2022-03-28 12:09 | - | |
| Acer Replacment Offer/ | 2022-03-28 12:09 | - | |
| Acer Revo or ax3400/ | 2022-03-28 12:09 | - | |
| Acer Rolls Out Sub-$400 Ivy Bridge Powered TravelMate B113/ | 2022-03-28 12:09 | - | |
| Acer S3-391 Windows 8.1 installed directly to iSSD/ | 2022-03-28 12:09 | - | |
| Acer S3- Impossible to install Windows 7/ | 2022-03-28 12:09 | - | |
| Acer S3 - Trying to restore a Windows 8.1 system image/ | 2022-03-28 12:09 | - | |
| Acer S3 Partition and windows fresh install question (500GB + 20GB SSD)/ | 2022-03-28 12:09 | - | |
| Acer S7-391-6810 Issues/ | 2022-03-28 12:09 | - | |
| Acer S7-392 Windows 10 and Office 2013 weird screen flicker/ | 2022-03-28 12:09 | - | |
| Acer S7-392 screen scratch resistance - is the screen really Gorilla glas/ | 2022-03-28 12:09 | - | |
| Acer S7 naming is confusing/ | 2022-03-28 12:09 | - | |
| Acer S7 with WQHD/ | 2022-03-28 12:09 | - | |
| Acer SW5-011 2in1 10.1- choose when to turn off the display setting missing/ | 2022-03-28 12:09 | - | |
| Acer SW5 - No Hibernation option - Sleep looses 4% battery and hour 36% overnight/ | 2022-03-28 12:09 | - | |
| Acer Sata Controller/ | 2022-03-28 12:09 | - | |
| Acer Screen Saver/ | 2022-03-28 12:09 | - | |
| Acer Screens, dim & muddy, wat u think/ | 2022-03-28 12:09 | - | |
| Acer Screensaver not working !/ | 2022-03-28 12:09 | - | |
| Acer Serial number - Manufacture date ralation ship/ | 2022-03-28 12:09 | - | |
| Acer Service!!!!!!!!!!/ | 2022-03-28 12:09 | - | |
| Acer Service Manual CD/ | 2022-03-28 12:09 | - | |
| Acer SignalUp dosn't detect my network/ | 2022-03-28 12:09 | - | |
| Acer Site- new bios and launch mngr drivers for 8920G/ | 2022-03-28 12:09 | - | |
| Acer Sound!/ | 2022-03-28 12:09 | - | |
| Acer Spin 5 SP513-52N-53Y6- M.2 slot PCIe NVMe compatible Capacity Restrictions/ | 2022-03-28 12:09 | - | |
| Acer Spin 5 with Acer Active Stylus/ | 2022-03-28 12:09 | - | |
| Acer Spin 7 - warranty declined due to water damage/ | 2022-03-28 12:09 | - | |
| Acer Spire 3630 wifi/ | 2022-03-28 12:09 | - | |
| Acer Stuff Missing/ | 2022-03-28 12:09 | - | |
| AcerSucks website...uhm gone/ | 2022-03-28 12:10 | - | |
| Acer Support, is it any good/ | 2022-03-28 12:09 | - | |
| Acer Support - sending laptops for repairs/ | 2022-03-28 12:09 | - | |
| Acer Support/ | 2022-03-28 12:09 | - | |
| Acer Supported Operating System/ | 2022-03-28 12:09 | - | |
| Acer Support site navigation help BIOS upgrades/ | 2022-03-28 12:09 | - | |
| Acer Swift 3 (8th Gen + MX150) Anyone/ | 2022-03-28 12:09 | - | |
| Acer Swift 3, is there a better screen I could put in it Pls help, pls/ | 2022-03-28 12:09 | - | |
| Acer Swift 3 5 (S13) Owner's Thread/ | 2022-03-28 12:09 | - | |
| Acer Swift 3 w MX150 available!!/ | 2022-03-28 12:09 | - | |
| Acer Swift 3 with Intel Coffee Lake i5 processor and Nvidia MX150 GPU spotted/ | 2022-03-28 12:09 | - | |
| Acer Swift 7 quick look/ | 2022-03-28 12:09 | - | |
| Acer Swift X (2021) - Owner's Thread/ | 2022-03-28 12:09 | - | |
| Acer Switch 10 (SW5-011) 64GB model confusion/ | 2022-03-28 12:09 | - | |
| Acer Switch 10/ | 2022-03-28 12:09 | - | |
| Acer Switch 10 Full HD Review/ | 2022-03-28 12:09 | - | |
| Acer T.Ultra M5 581-TG new 2.02 firmware.. worth it/ | 2022-03-28 12:09 | - | |
| Acer T180 Aspire 3800/ | 2022-03-28 12:09 | - | |
| Acer TIMELINE 3810T Tz Tg SAFTEY RECALL/ | 2022-03-28 12:09 | - | |
| Acer TK55/ | 2022-03-28 12:09 | - | |
| Acer TM 212TE/ | 2022-03-28 12:09 | - | |
| Acer TM291/ | 2022-03-28 12:09 | - | |
| Acer TM292LMi/ | 2022-03-28 12:09 | - | |
| Acer TM800 HD Problem/ | 2022-03-28 12:10 | - | |
| Acer TM800 modem/ | 2022-03-28 12:10 | - | |
| Acer TM2440 BIOS locked/ | 2022-03-28 12:09 | - | |
| Acer TM2480-switching between laptop tv Fn+F5/ | 2022-03-28 12:09 | - | |
| Acer TM2480 Realtek ok sound but w headphone no sound/ | 2022-03-28 12:09 | - | |
| Acer TM 2702WLMi - HELP/ | 2022-03-28 12:09 | - | |
| Acer TM3002 keyboard/ | 2022-03-28 12:09 | - | |
| Acer TM3200 Display Problem/ | 2022-03-28 12:09 | - | |
| Acer TM 3201XCi Vs. 4501/ | 2022-03-28 12:09 | - | |
| Acer TM 3201XMI mini review/ | 2022-03-28 12:09 | - | |
| Acer TM 3210 - Upgrade to Core duo/ | 2022-03-28 12:09 | - | |
| Acer TM 3210 US Release Date/ | 2022-03-28 12:09 | - | |
| Acer TM 3222 WXMI WCMI fan noise or silence/ | 2022-03-28 12:09 | - | |
| Acer TM 3222 questions!/ | 2022-03-28 12:09 | - | |
| Acer TM 4000LCI/ | 2022-03-28 12:09 | - | |
| Acer TM4000LCi info/ | 2022-03-28 12:09 | - | |
| Acer TM 4001 WLMi/ | 2022-03-28 12:09 | - | |
| Acer TM4024WLMi Battery Life/ | 2022-03-28 12:10 | - | |
| Acer TM 4100 Battery problem/ | 2022-03-28 12:09 | - | |
| Acer TM4150 Resolution Problem/ | 2022-03-28 12:10 | - | |
| Acer TM4150 and Windows 2000/ | 2022-03-28 12:10 | - | |
| Acer TM4402WLMi....bluetooth/ | 2022-03-28 12:10 | - | |
| Acer TM4402WLMi Ethernet Problem/ | 2022-03-28 12:10 | - | |
| Acer TM4402WLMi available in US -- opinions/ | 2022-03-28 12:10 | - | |
| Acer TM4402 freezes while playing DVD/ | 2022-03-28 12:10 | - | |
| Acer TM 4403LMI heat issues/ | 2022-03-28 12:09 | - | |
| Acer TM 4501 DISCONTINUED/ | 2022-03-28 12:09 | - | |
| Acer TM 5520G battery won't charge - freezing helps/ | 2022-03-28 12:09 | - | |
| Acer TM 5520 web connection problems-HELP PLEASE/ | 2022-03-28 12:09 | - | |
| Acer TM 5730G - Display/ | 2022-03-28 12:09 | - | |
| Acer TM 6292, opinions/ | 2022-03-28 12:09 | - | |
| Acer TM 6292 Upgrade!/ | 2022-03-28 12:09 | - | |
| Acer TM 6413 6463 6465- Matte or glossy LCD/ | 2022-03-28 12:09 | - | |
| Acer TM6463WLMi (and TM6593G) + Windows 7 XP mode/ | 2022-03-28 12:10 | - | |
| Acer TM 6464/ | 2022-03-28 12:09 | - | |
| Acer TM 7730 no sound on HDTV/ | 2022-03-28 12:09 | - | |
| Acer TM8000 HD problem & how 2 backup/ | 2022-03-28 12:10 | - | |
| Acer TM8006Lmi - buy or not to buy/ | 2022-03-28 12:10 | - | |
| Acer TM 8100- I need FRU for the touchpad cable!/ | 2022-03-28 12:09 | - | |
| Acer TM8100 - doesn't work with USB-mouse, why/ | 2022-03-28 12:10 | - | |
| Acer TM 8100 configurations .be - .nl/ | 2022-03-28 12:09 | - | |
| Acer TM 8101 WMLi screen issue/ | 2022-03-28 12:09 | - | |
| Acer TM8103WLMi/ | 2022-03-28 12:10 | - | |
| Acer TM8103 available again!/ | 2022-03-28 12:10 | - | |
| Acer TM 8104- Monitor.exe takes 80-90% CPU resources/ | 2022-03-28 12:09 | - | |
| Acer TM8104WLMI win xpp vs Acer Ferrari4005WLMI winxpp x64/ | 2022-03-28 12:10 | - | |
| Acer TM8104WLMi LXT7206086 and LX.TAL06.096/ | 2022-03-28 12:10 | - | |
| Acer TM 8104 WLMi display dead/ | 2022-03-28 12:09 | - | |
| Acer TM8200 (napa)/ | 2022-03-28 12:10 | - | |
| Acer TM 8200 LaunchManager driver for Win7/ | 2022-03-28 12:09 | - | |
| Acer TM 8200 purchase question/ | 2022-03-28 12:09 | - | |
| Acer TM8204 - AMT drivers/ | 2022-03-28 12:10 | - | |
| Acer TM8204 Cooling Fan (second time this had happened)/ | 2022-03-28 12:10 | - | |
| Acer TM 8204 V.S ASUS A6JA/ | 2022-03-28 12:09 | - | |
| Acer TM8204 and temperature...100 decrees Celcius o_o/ | 2022-03-28 12:10 | - | |
| Acer TM8210 motherboard doesn't support INTEL VT/ | 2022-03-28 12:10 | - | |
| Acer TM8481G - overheating temperature/ | 2022-03-28 12:10 | - | |
| Acer TM 8481 windows media player lag spike/ | 2022-03-28 12:09 | - | |
| Acer TM82042WLMI Core Duo/ | 2022-03-28 12:10 | - | |
| Acer TRavelmate 3201/ | 2022-03-28 12:10 | - | |
| Acer TavelMate 630 ac adapter connector size!/ | 2022-03-28 12:09 | - | |
| Acer Text Fonts Too Large/ | 2022-03-28 12:09 | - | |
| Acer Thermal Solutions/ | 2022-03-28 12:09 | - | |
| Acer Timeline- What exactly does eco mode do/ | 2022-03-28 12:09 | - | |
| Acer Timeline 14 SU3500 vs SU7300/ | 2022-03-28 12:09 | - | |
| Acer Timeline 1410 1810TZ Question/ | 2022-03-28 12:09 | - | |
| Acer Timeline 1410 and WD 1TB HD/ | 2022-03-28 12:09 | - | |
| Acer Timeline 1810T Announced/ | 2022-03-28 12:09 | - | |
| Acer Timeline 1810T User Guide Available online/ | 2022-03-28 12:09 | - | |
| Acer Timeline 1810TZ keyboard Windows 7/ | 2022-03-28 12:09 | - | |
| Acer Timeline 1810TZ video flicker choppy issue, wrong driver/ | 2022-03-28 12:09 | - | |
| Acer Timeline 1810T vs. Gateway EC1815u... LCD Quality Difference... !/ | 2022-03-28 12:09 | - | |
| Acer Timeline 3810T/ | 2022-03-28 12:09 | - | |
| Acer Timeline 3810T Fan Speed Problem/ | 2022-03-28 12:09 | - | |
| Acer Timeline 3810TG Available in the US/ | 2022-03-28 12:09 | - | |
| Acer Timeline 3810T Help/ | 2022-03-28 12:09 | - | |
| Acer Timeline 3810TZ Brightness Changes Automatically/ | 2022-03-28 12:09 | - | |
| Acer Timeline 3810TZ stuck at BIOS post/ | 2022-03-28 12:09 | - | |
| Acer Timeline 3810T or 4810T with SSD/ | 2022-03-28 12:09 | - | |
| Acer Timeline 4810 Beeping/ | 2022-03-28 12:09 | - | |
| Acer Timeline 4810T Backlight issue (WinXP)/ | 2022-03-28 12:09 | - | |
| Acer Timeline 4810TG limited SATA Controller/ | 2022-03-28 12:09 | - | |
| Acer Timeline 4810TZ-4011 USB Ports/ | 2022-03-28 12:09 | - | |
| Acer Timeline 4810t Initial Impression And Review/ | 2022-03-28 12:09 | - | |
| Acer Timeline 4810tg switchable graphic problem/ | 2022-03-28 12:09 | - | |
| Acer Timeline 4810tz-4696 for $399 Good Buy Help!/ | 2022-03-28 12:09 | - | |
| Acer Timeline 4820, 5820 CPU upgrade/ | 2022-03-28 12:09 | - | |
| Acer Timeline 5810TG Sleep issue/ | 2022-03-28 12:09 | - | |
| Acer Timeline 5810TZ will not see wireless card/ | 2022-03-28 12:09 | - | |
| Acer Timeline 5810tz Review! Pics Coming Soon!/ | 2022-03-28 12:09 | - | |
| Acer Timeline 5810tz first thoughts!!/ | 2022-03-28 12:09 | - | |
| Acer Timeline 5820TG Hard Diak Issue/ | 2022-03-28 12:09 | - | |
| Acer Timeline 5820TG issues/ | 2022-03-28 12:09 | - | |
| Acer Timeline AS4810T-8480 -- no network card/ | 2022-03-28 12:09 | - | |
| Acer Timeline Battery Endurance Thread/ | 2022-03-28 12:09 | - | |
| Acer Timeline CPU 100% problem/ | 2022-03-28 12:09 | - | |
| Acer Timeline Launch Date/ | 2022-03-28 12:09 | - | |
| Acer Timeline M5 Ultra vBios Unlock GT640LE/ | 2022-03-28 12:09 | - | |
| Acer Timeline Question/ | 2022-03-28 12:09 | - | |
| Acer Timeline SSD discontinued in USA/ | 2022-03-28 12:09 | - | |
| Acer Timeline Su9400 Ati 4330 (Lots of info here)/ | 2022-03-28 12:09 | - | |
| Acer TimelineU M3/ | 2022-03-28 12:09 | - | |
| Acer Timeline Ultra m5/ | 2022-03-28 12:09 | - | |
| Acer Timeline X - ODD replaceable with HDD caddy/ | 2022-03-28 12:09 | - | |
| Acer Timeline X/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 1830T Questions/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 1830TZ BCM92046 Bluetooth/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 1830 wifi won't turn on after unsleep/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 1870t (finally it has landed)/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3820T -- H.264 MKV playback/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3820TG 4820TG 5820TG Quesiton regarding graphics card switch button/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3820TG Backlit keyboard mod/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3820TG Owners Lounge. Info, benchmarks, tweaks, mods and upgrades/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3820TG fan replacement/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3820TG i5 580m upgrade. Info, temps and Overclocking/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3820t - Canada/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3820t/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3830 4830 5830 T G/ | 2022-03-28 12:09 | - | |
| Acer Timeline X 3830TG-6412 Help/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 3830TG change hard drive/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 4820TG Screen issues/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 4820TG charger plug size/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 4820tg with Sennheiser HD595/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 4830 & IPad/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 4830T - RAM HDD access upgrade/ | 2022-03-28 12:09 | - | |
| Acer Timeline X 5820T not starting/ | 2022-03-28 12:09 | - | |
| Acer Timeline X 5820T vs. Asus UL50v/ | 2022-03-28 12:09 | - | |
| Acer TimelineX 8472T laptop/ | 2022-03-28 12:09 | - | |
| Acer TimelineX AS4820TG-5637 is now shipping in U.S. (Amazon)/ | 2022-03-28 12:09 | - | |
| Acer Timeline XP Driver/ | 2022-03-28 12:09 | - | |
| Acer Timeline X Refresh/ | 2022-03-28 12:09 | - | |
| Acer TimelineX audio problems/ | 2022-03-28 12:09 | - | |
| Acer TimelineX fan speed/ | 2022-03-28 12:09 | - | |
| Acer Timeline a new line of notebooks/ | 2022-03-28 12:09 | - | |
| Acer Timeline case and sleeve/ | 2022-03-28 12:09 | - | |
| Acer Timeline hdmi to dvi not working/ | 2022-03-28 12:09 | - | |
| Acer Timeline is charging only till 85%! Help!/ | 2022-03-28 12:09 | - | |
| Acer Timeline screen problem/ | 2022-03-28 12:09 | - | |
| Acer Timeline w Win XP Any Experience/ | 2022-03-28 12:09 | - | |
| Acer Tips! READ ME if you're in college/ | 2022-03-28 12:09 | - | |
| Acer Tm 6594g dual boot/ | 2022-03-28 12:09 | - | |
| Acer TravelMate® 4200 battery life any/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8x72/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 290/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 290XCi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 290 series- Can't turn the wireless ON/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 291LmI RAM/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 292LCi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 370/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 420 Drivers/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2000 2100 2500 2600 good news/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2000 Service Guide/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2001XC - Help with Very Sluggish 3D Graphics/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2300 - FAT only/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2310 - extremly slow/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2354/ | 2022-03-28 12:10 | - | |
| Acer Travel Mate 2410 laptop mother board for sale!/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2413LCi - Wireless Button/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2420/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2420 Problem Please Help/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2420 overheating problems/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2428WXMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2480 - 2153 Reboots after Logoff/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2480-2779 Questions/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2480 Laptops Freezing... Why/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2480 Power Button/ | 2022-03-28 12:10 | - | |
| Acer Travel Mate 2480 black screen/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2480 with BIOS/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2490 vs. Acer Aspire 3690/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 2502 Battery/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3000 - opinions/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3000/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3000 TM3002WTCi...customize them/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3010 3012 (Duo Core with web cam)/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3010 3012 vs Lenovo X60 X60s/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3010 WinXP/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3200- where can i find detailed sp/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3200 memory slot/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3210, e-recovery/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3275WXMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 3280 Series!/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4001LMi(D)/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4001LMi(D) review needed/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4002LMi Pentium M 725 , 1,6 Ghz/ | 2022-03-28 12:10 | - | |
| Acer Travel Mate 4002 WLMI Review/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4003LCi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4003LCi Review/ | 2022-03-28 12:10 | - | |
| Acer Travel Mate 4011WLCI Touch Pad Problems/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4021WLCi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4050LCi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4060 TM4062WLCi (need opinions)/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4100 ram upgrading question/ | 2022-03-28 12:10 | - | |
| AcerTravelMate 4150 Shut Down/ | 2022-03-28 12:10 | - | |
| Acer Travel Mate 4202WLMI core duo/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4202 reboot problem, losing wireless/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4233wlmi Drivers/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4314WXMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4400/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4402WLMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4500/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4500 review/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4501WLMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4502LCi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4502WLMi or Aspire 2023WLMi, HELP!/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4654LMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 4730 Question/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 5520 bios/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 5720 - Problem with Realtek Audio on Windows XP/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 5720 vs Acer Aspire 5920/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 6003LMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 6292 & TravelMate 6292 Victoria/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 6292-302G16MN - help with reinstall/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 6292 screen issue/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 6465WLMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 6592-6635 - Core 2 Duo T7300 2 GHz - 15.4 TFT/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 7520/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 7520 Crystal Eye Webcam Problem/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 7520 bootable OS image version/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8005LM/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8100 LCD DVI issues; VGA fine (8104WLMi)/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8200 vs Asus A6J/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8204 February Build Date/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8204WLMI Anybody own this/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8204WLMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8204WLMi frequently drops DSL Connection/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8204 upgrades/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8210-6597 being discontinued/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8210 Memory speed 533 or 677/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8210 for a college student/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8215/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8372Z No Backlight on LED screen/ | 2022-03-28 12:10 | - | |
| Acer TravelMate 8481/ | 2022-03-28 12:10 | - | |
| Acer TravelMate M6292 Core 2 Duo 1.8GHz 2048MB 160GB TFT12.1 DVDRW Win Vista Business/ | 2022-03-28 12:10 | - | |
| Acer TravelMate TM8204WLMi/ | 2022-03-28 12:10 | - | |
| Acer TravelMate c110 network error/ | 2022-03-28 12:10 | - | |
| Acer TravelMate randomly shutting down/ | 2022-03-28 12:10 | - | |
| Acer Travelmate/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 202t/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 202t parts/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 220 hard drive compatibility/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 230 keyboard removing/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 233XC fan problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 240 routing problem after sleep mode/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 250 cmos bios restored recovered/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 290 BIOS Recovery/ | 2022-03-28 12:10 | - | |
| Acer Travelmate290 BIOS dead/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 290 problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 291 LCI-G processor clarification/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 350 series/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 360 & Windows 7/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 370 Review/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 380 series/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 800 series - Where is my RAM/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 800 series question/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 810x new bios 3C25/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2000 performance/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2200, memory upgrade problems/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2200 2700 inverter/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2200 I don't know where the RAM SLOT is HELP!!!/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2203LC - Memory increase/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2301 Lci Ram Upgrade problem !/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2304LCi-Hoggie help/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2354LC Graphics driver problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2420 won't play any games/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2424 ram speed 400mhzfsb/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2428 freezes and can't be turned off/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2480-2943/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2490/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2490 Screen Issue/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 2700 Bios Failure/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3000 - upgrade CPU to 64 bit processor/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3000 series/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3002 - Service Manual/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3002/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3002 Memory/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3002wtci heat and durability/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3002 wtmi memory upgrade/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3200/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3200 Bluetooth/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3200 Service Manual or just HELP/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3201XCi- Heat and noise/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3202XMi in Vista/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3210/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3210 Price/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3212/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3260 Bloetooth problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3260 No Sounds/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 3273WXMi/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4000 - Battery not recognized in Win7/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4000 Audio Quality/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4000 no boot/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4001LMi Trackpad Power problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4010/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4010 battery is not charging after windows XP Professional installation/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4011WLCI keyboard that bad/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4021 wlmi memory/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4024wlmi harddisk problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4050 OS Installation/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4072LCi NIC PROBLEM/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4100 Screen Fade/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4101LMi Also, Acer in general/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4151lmi/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4200 sometimes doesn't wake up/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4202 WMLi/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4220 Memory Upgrade Question/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4222WLMi - Card Reader/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4230 (4233WLMi) Drivers/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4230 - Problem with Adding Intel 5300AGN wifi/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4235WLMi Screen Problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4320/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4400 - No Color On External TV/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4400 USB drivers/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4402WLMi died/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4501WLMi - Possible Video Card problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4502LMI/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 4670 mouse and keyboard problems/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5320 - how to make XP see SATA II hdd when installing/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5510/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5520 memory slots/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5520 turns on & off every few seconds/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5530G Bluetooth on Startup/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5710 display goes black/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720 DRM component could not be upgrade for SkyAnytime/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720G-831G16Mi Opinion Needed/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720G - can it take 3GB s SATA replacement drive/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720 Keyboard Goes Dead/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720 broken power jack/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720g - UPGRADING to 8400M GS/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720g -biggest mistake ive ever done pcwise/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720 ms2205/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720 on windows XP/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5720 vs Acer Aspire 5720/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5730G power supply problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5730 Power Button Problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 5740 issue/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 6292/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 6292 reformatting/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 6292 vs Aus F9S/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 6293/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 6410 - BIOS Flash, now no power!/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 6592 - MediaBay Battery or Hardrive/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 6592 time & date problems/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 7513/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 7530 keeps switching off/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 7530 problems/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 7720 - CPU Other upgrades/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 7720G/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 7720G 8400gs- 8600gt problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 7720G GF 900GT ddr3 problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8000 wont wake-up/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8005 LMi/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8006LMI vs LG LS50/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8006lmi woes/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8100 HEAT problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8100 is Hot!/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8200/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8200 VOIP Phone/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8200 random restart/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8204- VoIP problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8204 Cooling Fan Problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8204 Keyboard tech. help please T_T/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8204WLMi FLOODING/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8204WLMi discontinued/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8204wlmi SCREEN PROBLEM/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8205 Released/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8210 Mutibay/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8210 built-in microphone problem/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8215 scroll button/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8216/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8371 - BIOS MODDED 1.28 - Changed Fan settings, Advanced Options, Graphics Fix/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8371 13.3/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8371 Availability/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8371 Timeline Owner's Lounge/ | 2022-03-28 12:10 | - | |
| Acer Travelmate 8572-373G/ | 2022-03-28 12:10 | - | |
| Acer Travelmate B113E (Celeron 1017u) SATA issue/ | 2022-03-28 12:10 | - | |
| Acer Travelmate C11O keyboard/ | 2022-03-28 12:10 | - | |
| Acer Travelmate C210 got issues please help/ | 2022-03-28 12:10 | - | |
| Acer Travelmate C300 Tablet Bluetooth/ | 2022-03-28 12:10 | - | |
| Acer Travelmate C300 problems/ | 2022-03-28 12:10 | - | |
| Acer Travelmate C302XMi sound problems/ | 2022-03-28 12:10 | - | |
| Acer Travelmate C310 Space Bar/ | 2022-03-28 12:10 | - | |
| Acer Travelmate C314XMI drivers/ | 2022-03-28 12:10 | - | |
| Acer Travelmate C314XMI wireless adapter/ | 2022-03-28 12:10 | - | |
| Acer Travelmate P645-SG-79QV 3G Upgradability/ | 2022-03-28 12:10 | - | |
| Acer Travelmate P645/ | 2022-03-28 12:10 | - | |
| Acer Travelmate P645 SSD install/ | 2022-03-28 12:10 | - | |
| Acer Travelmate P645 upgrading SSD and RAM/ | 2022-03-28 12:10 | - | |
| Acer Travelmate and CRT monitor resolutions/ | 2022-03-28 12:10 | - | |
| Acer Travelmate display problem!/ | 2022-03-28 12:10 | - | |
| Acer Travelmate eRestore Issues/ | 2022-03-28 12:10 | - | |
| Acer Travelmate shuts down immediately on battery power/ | 2022-03-28 12:10 | - | |
| Acer Travelmate stands up to Toughbook/ | 2022-03-28 12:10 | - | |
| Acer Travelmate weird pitch noise - what's that/ | 2022-03-28 12:10 | - | |
| Acer Travelmate won't run on AC power/ | 2022-03-28 12:10 | - | |
| Acer Travelmate won't turn on/ | 2022-03-28 12:10 | - | |
| Acer TravleMate 3000 Series/ | 2022-03-28 12:10 | - | |
| Acer Travlemate 3200s/ | 2022-03-28 12:10 | - | |
| Acer Turning On My HD TV just by being near it!/ | 2022-03-28 12:10 | - | |
| Acer UK support and purchase options/ | 2022-03-28 12:10 | - | |
| Acer UK warrenty terms and conditions/ | 2022-03-28 12:10 | - | |
| Acer UM09E51/ | 2022-03-28 12:10 | - | |
| Acer US Support website shot/ | 2022-03-28 12:10 | - | |
| Acer Ultra M5 - Specs/ | 2022-03-28 12:10 | - | |
| Acer Ultrabook US Relase Date/ | 2022-03-28 12:10 | - | |
| Acer Upddater/ | 2022-03-28 12:10 | - | |
| Acer V3-371 Owners Thread/ | 2022-03-28 12:10 | - | |
| Acer V3-571G backlit keyboard/ | 2022-03-28 12:10 | - | |
| Acer V3-571G owner thread/ | 2022-03-28 12:10 | - | |
| Acer V3-571g NVidia 640m drivers/ | 2022-03-28 12:10 | - | |
| Acer V3-572G-51XW - mistery whine/ | 2022-03-28 12:10 | - | |
| Acer V3-772G-9402 has MXM slot/ | 2022-03-28 12:10 | - | |
| Acer V3-772G/ | 2022-03-28 12:10 | - | |
| Acer V3 572G Trackpad + Backlight Issues/ | 2022-03-28 12:10 | - | |
| Acer V3 Shuts Down automatically/ | 2022-03-28 12:10 | - | |
| Acer V5-171 Bios - Change Shared Video Memory/ | 2022-03-28 12:10 | - | |
| Acer V5-573G 572G with 750m/ | 2022-03-28 12:10 | - | |
| Acer V7-482PG-6662 User Review (14 inch canadian model) - detailed, pros and cons, conclusion, personal rating/ | 2022-03-28 12:10 | - | |
| Acer V7 - Recovery... how/ | 2022-03-28 12:10 | - | |
| Acer V7 wifi issues/ | 2022-03-28 12:10 | - | |
| Acer V15 Nitro CPU Repasting Issue/ | 2022-03-28 12:10 | - | |
| Acer V15 Nitro VN7-591G-751V - is there an M.2 slot/ | 2022-03-28 12:10 | - | |
| Acer VCM/ | 2022-03-28 12:10 | - | |
| Acer VCM driver and installation/ | 2022-03-28 12:10 | - | |
| Acer VMC conflict with Word/ | 2022-03-28 12:10 | - | |
| Acer VN7-591G Blind Bios flash/ | 2022-03-28 12:10 | - | |
| Acer VN7-591G Launch Manager problem/ | 2022-03-28 12:10 | - | |
| Acer VN7 592G Nitro - Display is a bit orange. Do you have this issue/ | 2022-03-28 12:10 | - | |
| Acer V Nitro (VN7-791G) Quick Review/ | 2022-03-28 12:10 | - | |
| Acer VOIP/ | 2022-03-28 12:10 | - | |
| Acer Vista Upgrade - When/ | 2022-03-28 12:10 | - | |
| Acer Vista upgrade/ | 2022-03-28 12:10 | - | |
| Acer Vn7-592g+akitio node+gtx1060 works/ | 2022-03-28 12:10 | - | |
| Acer Vn7-593g/ | 2022-03-28 12:10 | - | |
| Acer Vn7-793g/ | 2022-03-28 12:10 | - | |
| Acer VoIP Phone/ | 2022-03-28 12:10 | - | |
| Acer Volume Control/ | 2022-03-28 12:10 | - | |
| Acer Wallpapers/ | 2022-03-28 12:10 | - | |
| Acer Wants To Charge $199 For SATA Cable -(/ | 2022-03-28 12:10 | - | |
| Acer Wants to Replace my Aspire 5601AWLMi with a Refurbished Acer 5100/ | 2022-03-28 12:10 | - | |
| Acer Warranty/ | 2022-03-28 12:10 | - | |
| Acer Warranty Canada/ | 2022-03-28 12:10 | - | |
| Acer Warranty Service Experience/ | 2022-03-28 12:10 | - | |
| Acer Warranty and 'Acer Advantage'/ | 2022-03-28 12:10 | - | |
| Acer Warranty in Canada (Toronto)/ | 2022-03-28 12:10 | - | |
| Acer Warranty issues/ | 2022-03-28 12:10 | - | |
| Acer Warranty questions/ | 2022-03-28 12:10 | - | |
| Acer Webcam driver Shutdown issue on XP - a more practical fix/ | 2022-03-28 12:10 | - | |
| Acer Webcams...Whats happened/ | 2022-03-28 12:10 | - | |
| Acer Website SLOWER then molasses/ | 2022-03-28 12:10 | - | |
| Acer WiFi button/ | 2022-03-28 12:10 | - | |
| Acer WiFi problem/ | 2022-03-28 12:10 | - | |
| Acer Win7 Upgrade DVD Dissapear/ | 2022-03-28 12:10 | - | |
| Acer Windows 7/ | 2022-03-28 12:10 | - | |
| Acer Windows 7 Upgrade Offer - Help!/ | 2022-03-28 12:10 | - | |
| Acer Windows version/ | 2022-03-28 12:10 | - | |
| Acer Wireless problem/ | 2022-03-28 12:10 | - | |
| Acer X54H Series XP Drivers/ | 2022-03-28 12:10 | - | |
| Acer XP Drivers (for Vista-only Models )/ | 2022-03-28 12:10 | - | |
| Acer Xpress VoIP phone/ | 2022-03-28 12:10 | - | |
| Acer Yyavelmate 3040/ | 2022-03-28 12:10 | - | |
| Acer Z5610, Touch Screen Not Working/ | 2022-03-28 12:10 | - | |
| Acer Z5710 windows 10 compatibility issues/ | 2022-03-28 12:10 | - | |
| Acer ZA3 netbook problems/ | 2022-03-28 12:10 | - | |
| Acer ZG5 Aspire One 8.9 netbook upgrade/ | 2022-03-28 12:10 | - | |
| Acer`s battery runtime figures/ | 2022-03-28 12:10 | - | |
| Acer a4535 BIOS not booting/ | 2022-03-28 12:07 | - | |
| Acer adverts on Acer 5920 laptop/ | 2022-03-28 12:07 | - | |
| Acer and Autocad/ | 2022-03-28 12:07 | - | |
| Acer and Battery Calibration/ | 2022-03-28 12:07 | - | |
| Acer and DirectX/ | 2022-03-28 12:07 | - | |
| Acer and aircard -lots of problems/ | 2022-03-28 12:07 | - | |
| Acer and vista reinstallation/ | 2022-03-28 12:07 | - | |
| Acer announce new custom notebook Travel Mate 8005/ | 2022-03-28 12:07 | - | |
| Acer announces new laptops for 2011/ | 2022-03-28 12:07 | - | |
| Acer apire 5920g won't boot/ | 2022-03-28 12:07 | - | |
| Acer applications crashing, not able to find any networks, not able to turn my firewall on. Help!/ | 2022-03-28 12:07 | - | |
| Acer arcade deluxe 5739g/ | 2022-03-28 12:07 | - | |
| Acer as5100 vga to s video problem/ | 2022-03-28 12:07 | - | |
| Acer as5580/ | 2022-03-28 12:07 | - | |
| Acer aspire, cant find an option/ | 2022-03-28 12:09 | - | |
| Acer aspire- Help to delete recovery partition/ | 2022-03-28 12:09 | - | |
| Acer aspire 169x owners/ | 2022-03-28 12:07 | - | |
| Acer aspire 751 vs. AOD250/ | 2022-03-28 12:08 | - | |
| Acer aspire 1300 series Wifi driver (detection in xp)/ | 2022-03-28 12:07 | - | |
| Acer aspire 1410 + Broadcomm HD card/ | 2022-03-28 12:07 | - | |
| Acer aspire 1511 LMI/ | 2022-03-28 12:07 | - | |
| Acer aspire 1511LMi any good/ | 2022-03-28 12:07 | - | |
| Acer aspire 1522wlmi problem/ | 2022-03-28 12:07 | - | |
| Acer aspire 1551 Owners Lounge/ | 2022-03-28 12:07 | - | |
| Acer aspire 1640 help/ | 2022-03-28 12:07 | - | |
| Acer aspire 1640z Resource conflict/ | 2022-03-28 12:07 | - | |
| Acer aspire 1690 turn off suddenly/ | 2022-03-28 12:07 | - | |
| Acer aspire 1800 service manual/ | 2022-03-28 12:07 | - | |
| Acer aspire 1800 shutdown at linux boot/ | 2022-03-28 12:07 | - | |
| Acer aspire 1804wsmi graphics problem/ | 2022-03-28 12:07 | - | |
| Acer aspire 1810tz sond problem/ | 2022-03-28 12:07 | - | |
| Acer aspire 2930Z help please -(/ | 2022-03-28 12:07 | - | |
| Acer aspire 3000 Black screen/ | 2022-03-28 12:07 | - | |
| Acer aspire 3002LC/ | 2022-03-28 12:07 | - | |
| Acer aspire 3620 always gets really hot/ | 2022-03-28 12:07 | - | |
| Acer aspire 3680 Manuals/ | 2022-03-28 12:07 | - | |
| Acer aspire 3860 BIOS recovery/ | 2022-03-28 12:07 | - | |
| Acer aspire 4310 unable to disk wipe or 0 fill/ | 2022-03-28 12:07 | - | |
| Acer aspire 4315 usb ports over current, need help asap/ | 2022-03-28 12:07 | - | |
| Acer aspire 4520 - time to get a new laptop/ | 2022-03-28 12:07 | - | |
| Acer aspire 4620z - lost my BIOS Password/ | 2022-03-28 12:07 | - | |
| Acer aspire 4720z keyboard works intermittently/ | 2022-03-28 12:07 | - | |
| Acer aspire 4736-problem with my graphic card/ | 2022-03-28 12:07 | - | |
| Acer aspire 4810T/ | 2022-03-28 12:07 | - | |
| Acer aspire 4810 XP audio driver/ | 2022-03-28 12:07 | - | |
| Acer aspire 4820TG switchable graphics problem/ | 2022-03-28 12:07 | - | |
| Acer aspire 4930G charger port/ | 2022-03-28 12:07 | - | |
| Acer aspire 5021wlmi memory type/ | 2022-03-28 12:07 | - | |
| Acer aspire 5050 and Verizon PC Card issue/ | 2022-03-28 12:07 | - | |
| Acer aspire 5050 help/ | 2022-03-28 12:07 | - | |
| Acer aspire 5051 cursor sticking and system lagging-help!!!/ | 2022-03-28 12:07 | - | |
| Acer aspire 5100-5674/ | 2022-03-28 12:07 | - | |
| Acer aspire 5100 not booting from USB memory/ | 2022-03-28 12:07 | - | |
| Acer aspire 5101 service manual/ | 2022-03-28 12:07 | - | |
| Acer aspire 5220/ | 2022-03-28 12:07 | - | |
| Acer aspire 5310 question/ | 2022-03-28 12:07 | - | |
| Acer aspire 5310 upgrade/ | 2022-03-28 12:07 | - | |
| Acer aspire 5313 series MODEL ICL50/ | 2022-03-28 12:07 | - | |
| Acer aspire 5315 LCD Latch problem/ | 2022-03-28 12:07 | - | |
| Acer aspire 5315 SATA Trouble/ | 2022-03-28 12:07 | - | |
| Acer aspire 5315 Wont boot up after 2gb ram upgrade/ | 2022-03-28 12:07 | - | |
| Acer aspire 5315 battery light blinking/ | 2022-03-28 12:07 | - | |
| Acer aspire 5315 but video memory 64mb Help......!/ | 2022-03-28 12:07 | - | |
| Acer aspire 5315 power socket/ | 2022-03-28 12:07 | - | |
| Acer aspire 5335-2238 screen/ | 2022-03-28 12:07 | - | |
| Acer aspire 5349 intel i5 3210m ivy bridge cpu support/ | 2022-03-28 12:07 | - | |
| Acer aspire 5520-5912 motherboard dead/ | 2022-03-28 12:07 | - | |
| Acer aspire 5520 ACPI Temp overheating/ | 2022-03-28 12:07 | - | |
| Acer aspire 5520 cpu upgrade/ | 2022-03-28 12:07 | - | |
| Acer aspire 5520g cpu upgrade boot loop/ | 2022-03-28 12:07 | - | |
| Acer aspire 5520 unplug main monitor cable/ | 2022-03-28 12:07 | - | |
| Acer aspire 5532 (350 @ bestbuy)/ | 2022-03-28 12:07 | - | |
| Acer aspire 5534 starts up very slow now!/ | 2022-03-28 12:07 | - | |
| Acer aspire 5536g CPU clock/ | 2022-03-28 12:07 | - | |
| Acer aspire 5538/ | 2022-03-28 12:07 | - | |
| Acer aspire 5540---Blue screen/ | 2022-03-28 12:07 | - | |
| Acer aspire 5560 recovery Disc/ | 2022-03-28 12:07 | - | |
| Acer aspire 5570z windows 7 webcam driver/ | 2022-03-28 12:07 | - | |
| Acer aspire 5580 series/ | 2022-03-28 12:07 | - | |
| Acer aspire 5610Z external monitor problem/ | 2022-03-28 12:07 | - | |
| Acer aspire 5610Z memory/ | 2022-03-28 12:07 | - | |
| Acer aspire 5610 system recovery/ | 2022-03-28 12:07 | - | |
| Acer aspire 5610z/ | 2022-03-28 12:07 | - | |
| Acer aspire 5610z Major problems/ | 2022-03-28 12:07 | - | |
| Acer aspire 5610z camera problem/ | 2022-03-28 12:07 | - | |
| Acer aspire 5610z driver install help/ | 2022-03-28 12:07 | - | |
| Acer aspire 5613 zmwlmi ples help me i need drivers/ | 2022-03-28 12:07 | - | |
| Acer aspire 5630 orbicam wont work/ | 2022-03-28 12:07 | - | |
| Acer aspire 5633 hard disk/ | 2022-03-28 12:07 | - | |
| Acer aspire 5670/ | 2022-03-28 12:07 | - | |
| Acer aspire 5670 troubles/ | 2022-03-28 12:07 | - | |
| Acer aspire 5710g Keyboard Issue/ | 2022-03-28 12:07 | - | |
| Acer aspire 5710 service manual/ | 2022-03-28 12:07 | - | |
| Acer aspire 5715 fan control!/ | 2022-03-28 12:07 | - | |
| Acer aspire 5720 BIOS battery location/ | 2022-03-28 12:08 | - | |
| Acer aspire 5720 no display/ | 2022-03-28 12:08 | - | |
| Acer aspire 5720z blank screen/ | 2022-03-28 12:08 | - | |
| Acer aspire 5735z screen problem/ | 2022-03-28 12:08 | - | |
| Acer aspire 5739G wireless problem/ | 2022-03-28 12:08 | - | |
| Acer aspire 5740 recovery problem/ | 2022-03-28 12:08 | - | |
| Acer aspire 5740 stopped turning on/ | 2022-03-28 12:08 | - | |
| Acer aspire 5750(LX.RLY02.085) usb 3.0 port not working/ | 2022-03-28 12:08 | - | |
| Acer aspire 5750g Touchpad/ | 2022-03-28 12:08 | - | |
| Acer aspire 5750g bloatware/ | 2022-03-28 12:08 | - | |
| Acer aspire 5750g hardware/ | 2022-03-28 12:08 | - | |
| Acer aspire 5755g gaming problen when using battery/ | 2022-03-28 12:08 | - | |
| Acer aspire 5920, realtek-microphone issue...need hekp/ | 2022-03-28 12:08 | - | |
| Acer aspire 5920G fan sometimes not working/ | 2022-03-28 12:08 | - | |
| Acer aspire 5920g- Shutdown after 1sec after boot/ | 2022-03-28 12:08 | - | |
| Acer aspire 5920g graphics card upgrade/ | 2022-03-28 12:08 | - | |
| Acer aspire 5920g just overheated/ | 2022-03-28 12:08 | - | |
| Acer aspire 5920g laptop i give it up i lose you win/ | 2022-03-28 12:08 | - | |
| Acer aspire 5920g running incredibly hot and noisy (pictures included)/ | 2022-03-28 12:08 | - | |
| Acer aspire 5920 lost acer recovery and need to reset to factory settings please help/ | 2022-03-28 12:08 | - | |
| Acer aspire 6920, turning the blue lights off/ | 2022-03-28 12:08 | - | |
| Acer aspire 6920G - driver irql not less or equal BSOD/ | 2022-03-28 12:08 | - | |
| Acer aspire 6920G - new partitions problem/ | 2022-03-28 12:08 | - | |
| Acer aspire 6920 dc power port not working/ | 2022-03-28 12:08 | - | |
| Acer aspire 6920g, any recommendations on what drivers to download/ | 2022-03-28 12:08 | - | |
| Acer aspire 6920 screen replacement/ | 2022-03-28 12:08 | - | |
| Acer aspire 6920 video card/ | 2022-03-28 12:08 | - | |
| Acer aspire 6930/ | 2022-03-28 12:08 | - | |
| Acer aspire 6930 sound crackling issue/ | 2022-03-28 12:08 | - | |
| Acer aspire 6935g problem/ | 2022-03-28 12:08 | - | |
| Acer aspire 7000 factory reset code/ | 2022-03-28 12:08 | - | |
| Acer aspire 7520-5460 graphics problem/ | 2022-03-28 12:08 | - | |
| Acer aspire 7520G 64x2 dual-core wireless internet problem/ | 2022-03-28 12:08 | - | |
| Acer aspire 7520 laptop upgrades/ | 2022-03-28 12:08 | - | |
| Acer aspire 7551 bios unlock reqeust/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720-6152/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720G- Can I upgrade this/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720G/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720g bios update/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720g problem 9600m gt 1gb 1024mb vg.9pg0y.007/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720g spikes/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720g with faulty GPU (one more,yes)/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720 in 2020 thread!/ | 2022-03-28 12:08 | - | |
| Acer aspire 7720 video problems/ | 2022-03-28 12:08 | - | |
| Acer aspire 7730 webcam/ | 2022-03-28 12:08 | - | |
| Acer aspire 7736zg bios mode/ | 2022-03-28 12:08 | - | |
| Acer aspire 7740/ | 2022-03-28 12:08 | - | |
| Acer aspire 7740 G recovery partition/ | 2022-03-28 12:08 | - | |
| Acer aspire 7750g - travelmate 7750g/ | 2022-03-28 12:08 | - | |
| Acer aspire 8930G/ | 2022-03-28 12:08 | - | |
| Acer aspire 8930G tips/ | 2022-03-28 12:08 | - | |
| Acer aspire 8930G upgrade questions/ | 2022-03-28 12:08 | - | |
| Acer aspire 8930g crackling high pitch sound windows7/ | 2022-03-28 12:08 | - | |
| Acer aspire 8930g freeze on acer logo/ | 2022-03-28 12:08 | - | |
| Acer aspire 8930g lost bd rom/ | 2022-03-28 12:08 | - | |
| Acer aspire 9100 recovery discs/ | 2022-03-28 12:08 | - | |
| Acer aspire 9301WSMi Video card death Help needed/ | 2022-03-28 12:08 | - | |
| Acer aspire 9412 grey white screen/ | 2022-03-28 12:08 | - | |
| Acer aspire 9424WSMi, the speakers are playing reverse stereo/ | 2022-03-28 12:08 | - | |
| Acer aspire 9425 audio card problem Realtek High Definition/ | 2022-03-28 12:08 | - | |
| Acer aspire 9810 and problems with RAID/ | 2022-03-28 12:08 | - | |
| Acer aspire 51700 mouse and keyboard not working/ | 2022-03-28 12:07 | - | |
| Acer aspire Predator- Gaming Rig/ | 2022-03-28 12:08 | - | |
| Acer aspire V5-131/ | 2022-03-28 12:09 | - | |
| Acer aspire m5 - can I replace the wireless card/ | 2022-03-28 12:08 | - | |
| Acer aspire one 532h-2ds bios update!/ | 2022-03-28 12:08 | - | |
| Acer aspire one 722 keyboard question/ | 2022-03-28 12:08 | - | |
| Acer aspire one 756/ | 2022-03-28 12:08 | - | |
| Acer aspire one AOA 150.....since restored/ | 2022-03-28 12:08 | - | |
| Acer aspire one D255 Netbook/ | 2022-03-28 12:08 | - | |
| Acer aspire one N550 with ION(2)/ | 2022-03-28 12:08 | - | |
| Acer aspire one d257 wont turn on/ | 2022-03-28 12:08 | - | |
| Acer aspire one d270 battery problem/ | 2022-03-28 12:08 | - | |
| Acer aspire one problems/ | 2022-03-28 12:08 | - | |
| Acer aspire only works on AC/ | 2022-03-28 12:08 | - | |
| Acer aspire s3 screen upgrade/ | 2022-03-28 12:08 | - | |
| Acer aspire s13 M2 SSD/ | 2022-03-28 12:08 | - | |
| Acer aspire timeline 5810T Bios restore/ | 2022-03-28 12:08 | - | |
| Acer aspire timelinex 3830tg/ | 2022-03-28 12:08 | - | |
| Acer aspire v3-571G replace optical disk with SSD/ | 2022-03-28 12:08 | - | |
| Acer aspire webcam/ | 2022-03-28 12:09 | - | |
| Acer asprie 5100-5840 wont start up/ | 2022-03-28 12:09 | - | |
| Acer at Compusa/ | 2022-03-28 12:09 | - | |
| Acer backlit keyboard/ | 2022-03-28 12:09 | - | |
| Acer batteries/ | 2022-03-28 12:09 | - | |
| Acer battery/ | 2022-03-28 12:09 | - | |
| Acer battery help/ | 2022-03-28 12:09 | - | |
| Acer battery issues/ | 2022-03-28 12:09 | - | |
| Acer battery life, only one hour!/ | 2022-03-28 12:09 | - | |
| Acer becomes world's top 5 PC maker/ | 2022-03-28 12:09 | - | |
| Acer bilingual laptops/ | 2022-03-28 12:09 | - | |
| Acer bio protection not deleteing help/ | 2022-03-28 12:09 | - | |
| Acer bios changelogs/ | 2022-03-28 12:09 | - | |
| Acer bios file convert/ | 2022-03-28 12:09 | - | |
| Acer bios options question/ | 2022-03-28 12:09 | - | |
| Acer bloatware VS The perfect recovery point/ | 2022-03-28 12:09 | - | |
| Acer bluetooth mouse problem/ | 2022-03-28 12:09 | - | |
| Acer boot problem/ | 2022-03-28 12:09 | - | |
| Acer build quality, how is it now/ | 2022-03-28 12:09 | - | |
| Acer built-in microphone doesnt work/ | 2022-03-28 12:09 | - | |
| Acer c110 Ghost partion made/ | 2022-03-28 12:09 | - | |
| Acer can't wait for Arrandale/ | 2022-03-28 12:09 | - | |
| Acer can't won't say how to wipe & reinstall/ | 2022-03-28 12:09 | - | |
| Acer cancels Aspire One 532G (ION2 netbook)/ | 2022-03-28 12:09 | - | |
| Acer caps lock , num lock osd - what software/ | 2022-03-28 12:09 | - | |
| Acer cd rom not reading files/ | 2022-03-28 12:09 | - | |
| Acer code names ... WLMi WXMi translation please !!/ | 2022-03-28 12:09 | - | |
| Acer collects Best Choice of Computex Taipei 2004/ | 2022-03-28 12:09 | - | |
| Acer crashes and stripes appear on screen (picture)/ | 2022-03-28 12:09 | - | |
| Acer crashes when wireless is on/ | 2022-03-28 12:09 | - | |
| Acer customer service awsome!!/ | 2022-03-28 12:09 | - | |
| Acer customer support - a few bytes missing/ | 2022-03-28 12:09 | - | |
| Acer customer support in Europe - what is it like/ | 2022-03-28 12:09 | - | |
| Acer customer support in France/ | 2022-03-28 12:06 | - | |
| Acer defaults/ | 2022-03-28 12:09 | - | |
| Acer doesn't have telephone support Should I buy an Acer Aspire AS5535-5452/ | 2022-03-28 12:09 | - | |
| Acer doesn't own its problem !!! 5570z/ | 2022-03-28 12:09 | - | |
| Acer driver installation order/ | 2022-03-28 12:09 | - | |
| Acer e-Recovery Failed/ | 2022-03-28 12:09 | - | |
| Acer e-apps v3 and v2 question/ | 2022-03-28 12:09 | - | |
| Acer e-power management/ | 2022-03-28 12:09 | - | |
| Acer e-reovery crashes/ | 2022-03-28 12:09 | - | |
| Acer eMachines E640 notebook beeps when left in sleep mode/ | 2022-03-28 12:09 | - | |
| Acer eManager/ | 2022-03-28 12:09 | - | |
| Acer eNet Management, disconnected notice/ | 2022-03-28 12:09 | - | |
| Acer eNet Management question/ | 2022-03-28 12:09 | - | |
| Acer eNet management replacement- NetSetMan/ | 2022-03-28 12:09 | - | |
| Acer eNet settings behaving strangely/ | 2022-03-28 12:09 | - | |
| Acer ePerformance Management on my 5920G/ | 2022-03-28 12:09 | - | |
| Acer ePowerManagement Battery Power/ | 2022-03-28 12:09 | - | |
| Acer ePowerManagement for Vista/ | 2022-03-28 12:09 | - | |
| Acer ePower management/ | 2022-03-28 12:09 | - | |
| Acer ePower management software/ | 2022-03-28 12:09 | - | |
| Acer eRcovery is messing up ! im getting the Cannot find file C- preload.tag error. PLEASE HELP/ | 2022-03-28 12:09 | - | |
| Acer eRecovery - How do I disable burn reminder/ | 2022-03-28 12:09 | - | |
| Acer eRecovery CDs, do they work after wiping MBR/ | 2022-03-28 12:09 | - | |
| Acer eRecovery Discs installation/ | 2022-03-28 12:09 | - | |
| Acer eRecovery Help (System Restore)/ | 2022-03-28 12:09 | - | |
| Acer eRecovery Management. Error code- 0xC0000003/ | 2022-03-28 12:09 | - | |
| Acer eRecovery Management/ | 2022-03-28 12:09 | - | |
| Acer eRecovery Management gone/ | 2022-03-28 12:09 | - | |
| Acer eRecovery Question/ | 2022-03-28 12:09 | - | |
| Acer eRecovery Windows 7 questions/ | 2022-03-28 12:09 | - | |
| Acer eRecovery and restore/ | 2022-03-28 12:09 | - | |
| Acer eRecovery disk question/ | 2022-03-28 12:09 | - | |
| Acer eRecovery error/ | 2022-03-28 12:09 | - | |
| Acer eRecovery failing/ | 2022-03-28 12:09 | - | |
| Acer eRecovery managment/ | 2022-03-28 12:09 | - | |
| Acer eRecovery not completing reboot - stuck at 13 29/ | 2022-03-28 12:09 | - | |
| Acer eRecovery problem/ | 2022-03-28 12:09 | - | |
| Acer eRecovery restore section not working/ | 2022-03-28 12:09 | - | |
| Acer eRecovery won't burn/ | 2022-03-28 12:09 | - | |
| Acer e launch key/ | 2022-03-28 12:06 | - | |
| Acer emachines e525 big problem!/ | 2022-03-28 12:09 | - | |
| Acer emergency BIOS flash/ | 2022-03-28 12:09 | - | |
| Acer empowering software is necessary/ | 2022-03-28 12:09 | - | |
| Acer empowering technology for Acer 5552g xp/ | 2022-03-28 12:09 | - | |
| Acer empowering technology help/ | 2022-03-28 12:09 | - | |
| Acer epower management on win 7/ | 2022-03-28 12:09 | - | |
| Acer erecovery loads on boot everytime/ | 2022-03-28 12:09 | - | |
| Acer erocovery won't install/ | 2022-03-28 12:09 | - | |
| Acer extensa 4420-5239 motherboard replacement # help/ | 2022-03-28 12:09 | - | |
| Acer extensa 4620 keyboard replacement/ | 2022-03-28 12:09 | - | |
| Acer extensa 4630z BIOS failed update -'(/ | 2022-03-28 12:09 | - | |
| Acer extensa 5220/ | 2022-03-28 12:09 | - | |
| Acer extensa 5220 battery issues/ | 2022-03-28 12:09 | - | |
| Acer extensa 5620-4025 bluetooth problem/ | 2022-03-28 12:09 | - | |
| Acer extensa acting up! Need Help Please!/ | 2022-03-28 12:09 | - | |
| Acer ezDock II Worth It/ | 2022-03-28 12:09 | - | |
| Acer ezDock docking station/ | 2022-03-28 12:09 | - | |
| Acer factory settings/ | 2022-03-28 12:09 | - | |
| Acer fan ALWAYS on, loud -(/ | 2022-03-28 12:09 | - | |
| Acer fan replacement- what to choose, DC280002FOO or DC280002WOO/ | 2022-03-28 12:09 | - | |
| Acer fan starts and stops constantly!/ | 2022-03-28 12:09 | - | |
| Acer fan wont come on/ | 2022-03-28 12:09 | - | |
| Acer ferrari 3400 NOICE/ | 2022-03-28 12:09 | - | |
| Acer ferrari 4000 display resolution/ | 2022-03-28 12:09 | - | |
| Acer ferrari 5000 going on sale soon !/ | 2022-03-28 12:09 | - | |
| Acer ferrari card reader problem/ | 2022-03-28 12:09 | - | |
| Acer ferrari mouse and windows vista/ | 2022-03-28 12:09 | - | |
| Acer floppy install/ | 2022-03-28 12:09 | - | |
| Acer for CAD - aspire 1714/ | 2022-03-28 12:09 | - | |
| Acer for gaming/ | 2022-03-28 12:09 | - | |
| Acer forum happy for Months...Now this/ | 2022-03-28 12:09 | - | |
| Acer forum philosophy about Win 7/ | 2022-03-28 12:09 | - | |
| Acer freezing/ | 2022-03-28 12:09 | - | |
| Acer freezing problems/ | 2022-03-28 12:09 | - | |
| Acer function problems/ | 2022-03-28 12:09 | - | |
| Acer gamezone - any worth keeping/ | 2022-03-28 12:09 | - | |
| Acer gemstone blue aspire 8920g question/ | 2022-03-28 12:09 | - | |
| Acer getting very hot/ | 2022-03-28 12:09 | - | |
| Acer glossy screen/ | 2022-03-28 12:09 | - | |
| Acer going 3d/ | 2022-03-28 12:09 | - | |
| Acer graphics help needed/ | 2022-03-28 12:09 | - | |
| Acer gridvista question/ | 2022-03-28 12:09 | - | |
| Acer guarantee/ | 2022-03-28 12:09 | - | |
| Acer hard drive is going/ | 2022-03-28 12:09 | - | |
| Acer hardware ID Modified Nvidia drivers/ | 2022-03-28 12:09 | - | |
| Acer hates Winamp/ | 2022-03-28 12:09 | - | |
| Acer iconia w500 mouse problem/ | 2022-03-28 12:09 | - | |
| Acer iconia w700 tablet/ | 2022-03-28 12:09 | - | |
| Acer in-built mic too quiet/ | 2022-03-28 12:09 | - | |
| Acer introduces NEW Core i7 Aspire 8940G/ | 2022-03-28 12:09 | - | |
| Acer inverter board/ | 2022-03-28 12:09 | - | |
| Acer is Acer. Please read if you have purchased a Predator/ | 2022-03-28 12:09 | - | |
| Acer is shipping models of Acer Ferrari 4000 w Windows XP 64-bit Pro pre-installed!/ | 2022-03-28 12:09 | - | |
| Acer issues recall for some Aspire Timeline laptops/ | 2022-03-28 12:09 | - | |
| Acer keyboard/ | 2022-03-28 12:09 | - | |
| Acer keyboard compatibility/ | 2022-03-28 12:09 | - | |
| Acer keyboard issues (2000 series, 4501, etc)/ | 2022-03-28 12:09 | - | |
| Acer keyboard malfunction/ | 2022-03-28 12:09 | - | |
| Acer keyboards/ | 2022-03-28 12:09 | - | |
| Acer knocks Lenovo off number three spot/ | 2022-03-28 12:09 | - | |
| Acer laptop- good for University student/ | 2022-03-28 12:09 | - | |
| Acer laptop 3273/ | 2022-03-28 12:09 | - | |
| Acer laptop USB cable/ | 2022-03-28 12:09 | - | |
| Acer laptop Vista install problem/ | 2022-03-28 12:09 | - | |
| Acer laptop beeping!! what to do !/ | 2022-03-28 12:09 | - | |
| Acer laptop buying advice needed please!/ | 2022-03-28 12:09 | - | |
| Acer laptop charging fault/ | 2022-03-28 12:09 | - | |
| Acer laptop has problem with VISTA/ | 2022-03-28 12:09 | - | |
| Acer laptop hdd failed - trying to recover thru usb enclosure/ | 2022-03-28 12:09 | - | |
| Acer laptop losing wireless con. after 2 min/ | 2022-03-28 12:09 | - | |
| Acer laptop might be broken/ | 2022-03-28 12:09 | - | |
| Acer laptop parts (2423) where to buy/ | 2022-03-28 12:09 | - | |
| Acer laptop power led keep blinking/ | 2022-03-28 12:09 | - | |
| Acer laptop powers on - no screen, no processing/ | 2022-03-28 12:09 | - | |
| Acer laptop recovery failed cannot boot/ | 2022-03-28 12:09 | - | |
| Acer laptops and no sound in headphone/ | 2022-03-28 12:09 | - | |
| Acer laptop screen not working/ | 2022-03-28 12:09 | - | |
| Acer laptop service/ | 2022-03-28 12:09 | - | |
| Acer laptop service manual exchange/ | 2022-03-28 12:09 | - | |
| Acer laptop service manuals/ | 2022-03-28 12:09 | - | |
| Acer laptops worth it/ | 2022-03-28 12:09 | - | |
| Acer launcher for Windows 7/ | 2022-03-28 12:09 | - | |
| Acer launch manager running CPU usage 100%/ | 2022-03-28 12:09 | - | |
| Acer lcd screen replacement source/ | 2022-03-28 12:09 | - | |
| Acer losing the plot/ | 2022-03-28 12:09 | - | |
| Acer lying about specs/ | 2022-03-28 12:09 | - | |
| Acer m3-581p/ | 2022-03-28 12:09 | - | |
| Acer m3 keyboard stopped working! !/ | 2022-03-28 12:09 | - | |
| Acer m5 14inch vs 15inch battery life/ | 2022-03-28 12:09 | - | |
| Acer m5 481TG (No speakers or headphones plugged in)/ | 2022-03-28 12:09 | - | |
| Acer makes available a patch to address Active X security vulnerability/ | 2022-03-28 12:09 | - | |
| Acer may be bugging its computers/ | 2022-03-28 12:09 | - | |
| Acer mediapad/ | 2022-03-28 12:09 | - | |
| Acer memory installation/ | 2022-03-28 12:09 | - | |
| Acer motherboard/ | 2022-03-28 12:09 | - | |
| Acer needs to redesign where expresscard goes/ | 2022-03-28 12:09 | - | |
| Acer netbook - a bit of water damage - keyboard not working...question/ | 2022-03-28 12:09 | - | |
| Acer netbook Aspire One/ | 2022-03-28 12:09 | - | |
| Acer new (getting old) 20.1 inch N.B/ | 2022-03-28 12:09 | - | |
| Acer new laptops coming/ | 2022-03-28 12:09 | - | |
| Acer noob, Timeline X vs Aspire/ | 2022-03-28 12:09 | - | |
| Acer notebook RAM upgrade question/ | 2022-03-28 12:09 | - | |
| Acer notebook batteries/ | 2022-03-28 12:09 | - | |
| Acer notebook damage advice/ | 2022-03-28 12:09 | - | |
| Acer notebook opening problem/ | 2022-03-28 12:09 | - | |
| Acer notebook reliability/ | 2022-03-28 12:09 | - | |
| Acer not honoring $200 price cut on Ferrari 4005 in PC World magazine/ | 2022-03-28 12:09 | - | |
| Acer not suitable for Audio Production!/ | 2022-03-28 12:09 | - | |
| Acer now #2 notebook seller worldwide, overtakes Dell/ | 2022-03-28 12:09 | - | |
| Acer number system/ | 2022-03-28 12:09 | - | |
| Acer one Fan noise Short Battery Life/ | 2022-03-28 12:09 | - | |
| Acer one netbook recover system want reboot/ | 2022-03-28 12:09 | - | |
| Acer or Toshiba/ | 2022-03-28 12:09 | - | |
| Acer orbicam/ | 2022-03-28 12:09 | - | |
| Acer orbicam problem/ | 2022-03-28 12:09 | - | |
| Acer orbicam problems/ | 2022-03-28 12:09 | - | |
| Acer overheating/ | 2022-03-28 12:09 | - | |
| Acer overlay icons for hw keys of bt, wifi, volume etc.. on off/ | 2022-03-28 12:09 | - | |
| Acer owners, are you happy with your Acer/ | 2022-03-28 12:09 | - | |
| Acer parts - where/ | 2022-03-28 12:09 | - | |
| Acer photo gallery/ | 2022-03-28 12:09 | - | |
| Acer power adapters/ | 2022-03-28 12:09 | - | |
| Acer powersmart Application/ | 2022-03-28 12:09 | - | |
| Acer power supply unit - plug tips/ | 2022-03-28 12:09 | - | |
| Acer predator 17x owners please help/ | 2022-03-28 12:09 | - | |
| Acer product codes/ | 2022-03-28 12:09 | - | |
| Acer quality/ | 2022-03-28 12:09 | - | |
| Acer question/ | 2022-03-28 12:09 | - | |
| Acerr Aspire one/ | 2022-03-28 12:10 | - | |
| Acer really have abandoned MXM by the looks of it/ | 2022-03-28 12:09 | - | |
| Acer recall/ | 2022-03-28 12:09 | - | |
| Acer recovery CD (system CD)/ | 2022-03-28 12:09 | - | |
| Acer recovery CD problem/ | 2022-03-28 12:09 | - | |
| Acer recovery Disk(s)/ | 2022-03-28 12:09 | - | |
| Acer recovery disc, not recoving/ | 2022-03-28 12:09 | - | |
| Acer recovery disk will work after reformat with Vista/ | 2022-03-28 12:09 | - | |
| Acer recovery partition... found by accident -)/ | 2022-03-28 12:09 | - | |
| Acer recovery question/ | 2022-03-28 12:09 | - | |
| Acer refresh for 6935g series/ | 2022-03-28 12:09 | - | |
| Acer removes launch manager made by acer from website only Dritek/ | 2022-03-28 12:09 | - | |
| Acer repair, how long will it take/ | 2022-03-28 12:09 | - | |
| Acer repair uninstalled my touchpad; suggestions/ | 2022-03-28 12:09 | - | |
| Acer reparation/ | 2022-03-28 12:09 | - | |
| Acer replacement Screen/ | 2022-03-28 12:09 | - | |
| Acer replacement battery/ | 2022-03-28 12:09 | - | |
| Acer resellers and distributors/ | 2022-03-28 12:09 | - | |
| Acer restore failed/ | 2022-03-28 12:09 | - | |
| Acer retail in the Bay Area/ | 2022-03-28 12:09 | - | |
| Acer retina-display laptops/ | 2022-03-28 12:09 | - | |
| Acer rules/ | 2022-03-28 12:09 | - | |
| Acers Driver for all Model/ | 2022-03-28 12:10 | - | |
| Acer screen flickers only when starting from cold room/ | 2022-03-28 12:09 | - | |
| Acer screen problem - image going black/ | 2022-03-28 12:09 | - | |
| Acer screen problem/ | 2022-03-28 12:09 | - | |
| Acer screens- Aspire 15.4 vs TravelMate 15.0/ | 2022-03-28 12:09 | - | |
| Acer sent me a new battery!/ | 2022-03-28 12:09 | - | |
| Acer service!/ | 2022-03-28 12:09 | - | |
| Acer service and repair manual/ | 2022-03-28 12:09 | - | |
| Acer service manuals/ | 2022-03-28 12:09 | - | |
| Acer service partition/ | 2022-03-28 12:09 | - | |
| Acer service turn around time/ | 2022-03-28 12:09 | - | |
| Acers get better over time/ | 2022-03-28 12:10 | - | |
| Acer shuts down during sleep/ | 2022-03-28 12:09 | - | |
| Acer site down/ | 2022-03-28 12:09 | - | |
| Acer soft Button/ | 2022-03-28 12:09 | - | |
| Acer sotware - junk spyware help to remove them/ | 2022-03-28 12:09 | - | |
| Acer sound problem/ | 2022-03-28 12:09 | - | |
| Acer sound recording problem/ | 2022-03-28 12:09 | - | |
| Acer specific power management program/ | 2022-03-28 12:09 | - | |
| Acer specs Original(1) replacement(2)/ | 2022-03-28 12:09 | - | |
| Acer start up/ | 2022-03-28 12:09 | - | |
| Acer stole 40% of Aspire5920 RAM for marketing purpouses/ | 2022-03-28 12:09 | - | |
| Acer strange power led blinking/ | 2022-03-28 12:09 | - | |
| Acer support problems/ | 2022-03-28 12:09 | - | |
| Acer support service- major problem/ | 2022-03-28 12:09 | - | |
| Acer support site- all drivers, BIOS, apps missing/ | 2022-03-28 12:09 | - | |
| Acer support warranty/ | 2022-03-28 12:09 | - | |
| Acers using same 14.1 LCD as Aspire 5050/ | 2022-03-28 12:10 | - | |
| Acers web site is horrendous/ | 2022-03-28 12:10 | - | |
| Acert 3810T trackpad suddenly not working/ | 2022-03-28 12:10 | - | |
| Acer t5500 95C overheating/ | 2022-03-28 12:09 | - | |
| Acer technical support/ | 2022-03-28 12:09 | - | |
| Acer tech support quality/ | 2022-03-28 12:09 | - | |
| Acer the disaster manufacturer pt.2/ | 2022-03-28 12:09 | - | |
| Acer timeline 1810(1410) hard drive ZIF cable problem/ | 2022-03-28 12:09 | - | |
| Acer timeline 4810TZ video resolution/ | 2022-03-28 12:09 | - | |
| Acer timeline 4810t screen tint/ | 2022-03-28 12:09 | - | |
| Acer timeline 8371 vs 3810t/ | 2022-03-28 12:09 | - | |
| Acer timeline TG series with HD 4330 switchable graphics, no discussion/ | 2022-03-28 12:09 | - | |
| Acer timelinex/ | 2022-03-28 12:09 | - | |
| Acer timelinex release today/ | 2022-03-28 12:09 | - | |
| Acer tm4002wlmi graphic card/ | 2022-03-28 12:10 | - | |
| Acer tm4510 resolution/ | 2022-03-28 12:10 | - | |
| Acer to Acquire US-Based Gateway, Inc.,/ | 2022-03-28 12:10 | - | |
| Acer to become world's 3rd largest PC vendor/ | 2022-03-28 12:10 | - | |
| Acer to modern TV connections/ | 2022-03-28 12:10 | - | |
| Acer travelmate 290e sound problems/ | 2022-03-28 12:10 | - | |
| Acer travelmate 739TLV repair manual please/ | 2022-03-28 12:10 | - | |
| Acer travelmate 2201WLC bios problem/ | 2022-03-28 12:10 | - | |
| Acer travelmate 2410, do I have PCI express/ | 2022-03-28 12:10 | - | |
| Acer travelmate 2420 random beep/ | 2022-03-28 12:10 | - | |
| Acer travelmate 2480 recovery without cds/ | 2022-03-28 12:10 | - | |
| Acer travelmate 3040; eRecovery problem/ | 2022-03-28 12:10 | - | |
| Acer travelmate 4202 wlmi BLUETOOTH/ | 2022-03-28 12:10 | - | |
| Acer travelmate 4220 problems/ | 2022-03-28 12:10 | - | |
| Acer travelmate 4670 battery problems/ | 2022-03-28 12:10 | - | |
| Acer travelmate 5742G Fan not speeding up, cpu overheating/ | 2022-03-28 12:10 | - | |
| Acer travelmate 6292 Dual screens/ | 2022-03-28 12:10 | - | |
| Acer travelmate 8372 Insyde BIOS(v1.05) hidden menu ENABLE/ | 2022-03-28 12:10 | - | |
| Acer travelmate c110 questions from the new guy/ | 2022-03-28 12:10 | - | |
| Acer travelmate help in vista/ | 2022-03-28 12:10 | - | |
| Acer trots out Aspire 8930, 6930, 5735 and 4730 laptops/ | 2022-03-28 12:10 | - | |
| Acer unveils Ferrari 5000 and Ferrari 1000- new Ferrari dual-core notebook range/ | 2022-03-28 12:10 | - | |
| Acer unveils new line of gaming notebooks/ | 2022-03-28 12:10 | - | |
| Acer unwanted programs/ | 2022-03-28 12:10 | - | |
| Acer update software/ | 2022-03-28 12:10 | - | |
| Acer used to build Thinkpads/ | 2022-03-28 12:10 | - | |
| Acer users, need ur suggestions/ | 2022-03-28 12:10 | - | |
| Acer users with 6770m need your help/ | 2022-03-28 12:10 | - | |
| Acer v. Apple/ | 2022-03-28 12:10 | - | |
| Acer v3 + 760m or 780m( ! !)/ | 2022-03-28 12:10 | - | |
| Acer v3-471g top speakers/ | 2022-03-28 12:10 | - | |
| Acer v3 - fan control problem/ | 2022-03-28 12:10 | - | |
| Acer v3 771g owners club/ | 2022-03-28 12:10 | - | |
| Acer v5-573G screen problem/ | 2022-03-28 12:10 | - | |
| Acer v7-482pg-6662 2nd monitor problem/ | 2022-03-28 12:10 | - | |
| Acer vista usb problem/ | 2022-03-28 12:10 | - | |
| Acer vn7-592g + Razer Core/ | 2022-03-28 12:10 | - | |
| Acer vs Toshiba/ | 2022-03-28 12:10 | - | |
| Acer vs acer/ | 2022-03-28 12:10 | - | |
| Acer w500 Cpu Usage issue/ | 2022-03-28 12:10 | - | |
| Acer w HD6850M or better/ | 2022-03-28 12:10 | - | |
| Acer warranty due to expire - how much do repairs cost/ | 2022-03-28 12:10 | - | |
| Acer warranty is a rip-off/ | 2022-03-28 12:10 | - | |
| Acer warranty repairs/ | 2022-03-28 12:10 | - | |
| Acer warrenty.. advice/ | 2022-03-28 12:10 | - | |
| Acer warrenty/ | 2022-03-28 12:10 | - | |
| Acer webcam/ | 2022-03-28 12:10 | - | |
| Acer website does not work for USA/ | 2022-03-28 12:10 | - | |
| Acer what are the main issues with them/ | 2022-03-28 12:10 | - | |
| Acer widescreen LCD Computer Monitor/ | 2022-03-28 12:10 | - | |
| Acer will announce new product identity for notebk/ | 2022-03-28 12:10 | - | |
| Acer wireless and USB wireless problems.... STILL!/ | 2022-03-28 12:10 | - | |
| Acer with 256 MB x700/ | 2022-03-28 12:10 | - | |
| Acer with FHD IPS screen/ | 2022-03-28 12:10 | - | |
| Acer won't turn on/ | 2022-03-28 12:10 | - | |
| Acer x1200 Hard drive removal/ | 2022-03-28 12:10 | - | |
| Aces 4005 CPU upgradeable/ | 2022-03-28 12:10 | - | |
| Acire Aspire 5000 wireless indicator BLINKING/ | 2022-03-28 12:10 | - | |
| A cooling pad for my TM8204/ | 2022-03-28 12:05 | - | |
| A couple 5315 questions/ | 2022-03-28 12:05 | - | |
| A couple of 5920G-5A3G32MI questions/ | 2022-03-28 12:05 | - | |
| Acronis Easy Migrate/ | 2022-03-28 12:10 | - | |
| Activating Bluetooth on Aspire 6930/ | 2022-03-28 12:10 | - | |
| Active digitizer/ | 2022-03-28 12:10 | - | |
| Actual RAM max for Travelmate TM1872T/ | 2022-03-28 12:10 | - | |
| Adapter for a Acer Extensa 5620z/ | 2022-03-28 12:10 | - | |
| Adapter problems/ | 2022-03-28 12:10 | - | |
| Add 1 more harddisk/ | 2022-03-28 12:10 | - | |
| Add Bluetooth to an Acer 5532/ | 2022-03-28 12:10 | - | |
| Add RAM to Acer Extensa 4620-6456/ | 2022-03-28 12:10 | - | |
| Add firewire and svideo/ | 2022-03-28 12:10 | - | |
| Adding 4GB of RAM into Aspire 4315/ | 2022-03-28 12:10 | - | |
| Adding Bluetooth to TM 2400 series/ | 2022-03-28 12:10 | - | |
| Adding Bluetooth to my Aspire 1690/ | 2022-03-28 12:10 | - | |
| Adding Desktop Speakers To Notebook/ | 2022-03-28 12:10 | - | |
| Adding Intel 5300AGN wifi to Acer Travelmate 4230/ | 2022-03-28 12:10 | - | |
| Adding Memory to Aspire 5601 AWLMi/ | 2022-03-28 12:10 | - | |
| Adding RAM/ | 2022-03-28 12:10 | - | |
| Adding RAM to 4820TG/ | 2022-03-28 12:10 | - | |
| Adding SSD to a Acer Aspire/ | 2022-03-28 12:10 | - | |
| Adding Widjets to 5920G Vista/ | 2022-03-28 12:10 | - | |
| Adding a 2nd drive to a 8950G or 8943G/ | 2022-03-28 12:10 | - | |
| Adding a HDD to Acer Aspire 7/ | 2022-03-28 12:10 | - | |
| Adding a new blu-ray writer to 8930G/ | 2022-03-28 12:10 | - | |
| Adding a second Mini PCIe to a 3820TG-3022/ | 2022-03-28 12:10 | - | |
| Adding bluetooth on Acer Travelmate 2300/ | 2022-03-28 12:10 | - | |
| Adding fingerprint scanner to Aspire 5570z/ | 2022-03-28 12:10 | - | |
| Adding internal USB from PCI-E 5734Z/ | 2022-03-28 12:10 | - | |
| Adding internal bluetooth to Aspire 6930/ | 2022-03-28 12:10 | - | |
| Adding ram to Acer 5610Z/ | 2022-03-28 12:10 | - | |
| Adding second HDD to acer 7720G/ | 2022-03-28 12:10 | - | |
| Adding tv tuner to 8920g/ | 2022-03-28 12:10 | - | |
| Additional Brightness Levels for Acer 1810t/ | 2022-03-28 12:10 | - | |
| Additional info on proccesor speed on Aspire 5920/ | 2022-03-28 12:10 | - | |
| Add multimedia key functions to keyboard with software/ | 2022-03-28 12:10 | - | |
| Add new DVD-RW drive to 5672/ | 2022-03-28 12:10 | - | |
| Adhoc Wireless Connection Errors/ | 2022-03-28 12:10 | - | |
| Adjust SPD on Nanya PC2-5300 on AS1410 SU2300/ | 2022-03-28 12:10 | - | |
| Adjust Video RAM amount on AS1410/ | 2022-03-28 12:10 | - | |
| Adjusting Button Sensitivity on 5920G/ | 2022-03-28 12:10 | - | |
| Adjustment of touchpad sensitivity on Aspire 4730Z/ | 2022-03-28 12:10 | - | |
| Admin Access required/ | 2022-03-28 12:10 | - | |
| Admin Password/ | 2022-03-28 12:10 | - | |
| Adobe Flash Player for Minefield/ | 2022-03-28 12:10 | - | |
| Adobe Premiere Pro CS4 won't run on 8920G/ | 2022-03-28 12:10 | - | |
| Advice- Acer Aspire 7736G GPU upgrade/ | 2022-03-28 12:10 | - | |
| Advice- atom vs intel [...] solo/ | 2022-03-28 12:10 | - | |
| Advice/ | 2022-03-28 12:10 | - | |
| Advice about Acer 5920G/ | 2022-03-28 12:10 | - | |
| Advice about buy new laptop/ | 2022-03-28 12:10 | - | |
| Advice flashing Aspire BIOS/ | 2022-03-28 12:10 | - | |
| Advice needed 1820(tablet) vs 3810TZG (13.3 with ext video card)/ | 2022-03-28 12:10 | - | |
| Advice needed on 9600m gt oc temperatures!/ | 2022-03-28 12:10 | - | |
| Advice needed re help on Acer Desktop BIOS Error beep codes please/ | 2022-03-28 12:10 | - | |
| Advice on Acer/ | 2022-03-28 12:10 | - | |
| Advice on Big HD for 3100/ | 2022-03-28 12:10 | - | |
| Advice on installing XP on 5920G/ | 2022-03-28 12:10 | - | |
| Advice on replacing A292 hard drive/ | 2022-03-28 12:10 | - | |
| Advice please on upgradeing Acer Aspire One D250 CPU/ | 2022-03-28 12:10 | - | |
| Advice please under waraanty laptop needs new hdd/ | 2022-03-28 12:10 | - | |
| Advice requested to boost an Acer Aspire 5720G/ | 2022-03-28 12:10 | - | |
| Aer Aspire 1692 WLMI/ | 2022-03-28 12:10 | - | |
| Aer Aspire 5600, Can i add a video card/ | 2022-03-28 12:10 | - | |
| Aero Problems with Extensa 7630/ | 2022-03-28 12:10 | - | |
| A few 5672 problems, please help!/ | 2022-03-28 12:05 | - | |
| A few Ferrari questions/ | 2022-03-28 12:05 | - | |
| A few Problems with 7/ | 2022-03-28 12:05 | - | |
| A few about about Acer TM 4504LMI/ | 2022-03-28 12:05 | - | |
| A few quesions about the 5920G/ | 2022-03-28 12:05 | - | |
| A few questions (mainly CPUs)/ | 2022-03-28 12:05 | - | |
| A few questions/ | 2022-03-28 12:05 | - | |
| A few questions about Aspire 5100/ | 2022-03-28 12:05 | - | |
| A few questions about my new Aspire 5633/ | 2022-03-28 12:05 | - | |
| A few questions about the 6920G/ | 2022-03-28 12:05 | - | |
| A few questions about the Acer Apire 5742ZG/ | 2022-03-28 12:05 | - | |
| A few questions concerns/ | 2022-03-28 12:05 | - | |
| A few questions from a first time poster/ | 2022-03-28 12:05 | - | |
| A few questions on the 9300/ | 2022-03-28 12:05 | - | |
| A few questions regarding Aspire 5920g/ | 2022-03-28 12:05 | - | |
| A few questions regarding the Acer lineup/ | 2022-03-28 12:05 | - | |
| A few questions to other Aspire 1410 owners/ | 2022-03-28 12:05 | - | |
| A fresh install for my Acer 8204/ | 2022-03-28 12:05 | - | |
| After Alt+F10 reset data partition is not visible/ | 2022-03-28 12:10 | - | |
| After Recover, AcerLaunch Stuck @ Install eRecovery/ | 2022-03-28 12:10 | - | |
| After hibernate, wlan deactivated (5920G)/ | 2022-03-28 12:10 | - | |
| After market batteries/ | 2022-03-28 12:10 | - | |
| After new ram install, can't access my computer/ | 2022-03-28 12:10 | - | |
| Again - Problem of HDDVD playback on 5920!/ | 2022-03-28 12:10 | - | |
| Age Of Conan on a 5920G/ | 2022-03-28 12:10 | - | |
| Age of Acer/ | 2022-03-28 12:10 | - | |
| A good cooling pad for Acer extensa 5630g/ | 2022-03-28 12:05 | - | |
| A good manufacturer/ | 2022-03-28 12:05 | - | |
| Ahhhh! Help! Bios update FAILED/ | 2022-03-28 12:10 | - | |
| Akku Acer Aspire TimelineX 3830T kompatible non reconnnue/ | 2022-03-28 12:10 | - | |
| A little, annoying problem/ | 2022-03-28 12:05 | - | |
| A little help/ | 2022-03-28 12:05 | - | |
| A little slow/ | 2022-03-28 12:05 | - | |
| All USB ports on my 4502 lmi are dead -(/ | 2022-03-28 12:10 | - | |
| All you ever wanted to know about the 8600M GT in the 5920G/ | 2022-03-28 12:10 | - | |
| Alt+F10 = edit boot options/ | 2022-03-28 12:10 | - | |
| Alt+F10 error, PartEDIT32 not saving/ | 2022-03-28 12:10 | - | |
| Alt F10 after Win 7 Upgrade/ | 2022-03-28 12:10 | - | |
| AltF10 still not working after successful mbrwrwin/ | 2022-03-28 12:10 | - | |
| AltGr key/ | 2022-03-28 12:10 | - | |
| Alternate graphics driver for Aspire 5520/ | 2022-03-28 12:10 | - | |
| Alternate use of D2D and PQSERVICE/ | 2022-03-28 12:10 | - | |
| Alternative Battery Monitor and Program/ | 2022-03-28 12:10 | - | |
| Alternative Freeware Power Managment. Which is Best/ | 2022-03-28 12:10 | - | |
| Alternative LCD panels for an Acer travelmate 4050/ | 2022-03-28 12:10 | - | |
| Alternatives for core2solo/ | 2022-03-28 12:10 | - | |
| Am I connected to Wireless N or not/ | 2022-03-28 12:10 | - | |
| Am I screwed Acer Aspire fan problem/ | 2022-03-28 12:10 | - | |
| Am I the first one to notice that/ | 2022-03-28 12:10 | - | |
| Am I using the correct InsydeFlash BIOS utility/ | 2022-03-28 12:10 | - | |
| Ambiguous hard disk spec for Acer notebook(Canada)/ | 2022-03-28 12:10 | - | |
| Am i screwed/ | 2022-03-28 12:10 | - | |
| A moment of silence please/ | 2022-03-28 12:05 | - | |
| An Age old Question - When is a repair too much/ | 2022-03-28 12:10 | - | |
| An NVidia driver tweak/ | 2022-03-28 12:10 | - | |
| Analysing a bootlog/ | 2022-03-28 12:10 | - | |
| Anandtech Review of Acer 2025/ | 2022-03-28 12:10 | - | |
| And we think Acers support can be bad/ | 2022-03-28 12:10 | - | |
| A newb question, but I'm desperate!/ | 2022-03-28 12:05 | - | |
| Annoying Messages/ | 2022-03-28 12:10 | - | |
| Annoying acer advert/ | 2022-03-28 12:10 | - | |
| Annoying music/ | 2022-03-28 12:10 | - | |
| Annoying pixels!help!/ | 2022-03-28 12:10 | - | |
| Annoying restart/ | 2022-03-28 12:10 | - | |
| Another 6935G RAM question/ | 2022-03-28 12:10 | - | |
| Another 8204 question (DVD Drive)/ | 2022-03-28 12:10 | - | |
| Another 8930 Bios 1.14 up for Download/ | 2022-03-28 12:10 | - | |
| Another Acer 5315 dead -(/ | 2022-03-28 12:10 | - | |
| Another Acer5920g Upgrade MXM question/ | 2022-03-28 12:10 | - | |
| Another Acer TM 4002 review/ | 2022-03-28 12:10 | - | |
| Another Acer Tech Horror/ | 2022-03-28 12:10 | - | |
| Another Clean INstall Question/ | 2022-03-28 12:10 | - | |
| Another PQService and Conversion question/ | 2022-03-28 12:10 | - | |
| Another Quirk from Acer (6600GO)/ | 2022-03-28 12:10 | - | |
| Another T3201 User/ | 2022-03-28 12:10 | - | |
| Another TM 8204 Review/ | 2022-03-28 12:10 | - | |
| Another black screen pwr button led on no bios/ | 2022-03-28 12:10 | - | |
| Another question-same newbie/ | 2022-03-28 12:10 | - | |
| Another tough one- Screen rotation/ | 2022-03-28 12:10 | - | |
| Anti Virus software/ | 2022-03-28 12:10 | - | |
| Any 12-14 Acer laptop with a DVI output/ | 2022-03-28 12:10 | - | |
| Any 5680 reviews/ | 2022-03-28 12:10 | - | |
| Any 5920G owners installed Vista SP1 yet/ | 2022-03-28 12:10 | - | |
| Any 5920 running Win XP/ | 2022-03-28 12:10 | - | |
| Any 8204 owner got USB 2.0 to work in DOS/ | 2022-03-28 12:10 | - | |
| Any 8204 owner tell me what kind of DVI to HDMI adapter I would need to get/ | 2022-03-28 12:10 | - | |
| Any Acer's with BTW 4.0/ | 2022-03-28 12:10 | - | |
| Any Acer 8920 6671 owners/ | 2022-03-28 12:10 | - | |
| Any Acer 8950G benchmarks or reviews/ | 2022-03-28 12:10 | - | |
| Any Acer Apsire 8943G users out there/ | 2022-03-28 12:10 | - | |
| Any Acer Travelmate P645 owners/ | 2022-03-28 12:10 | - | |
| Any Acer aspire 7000 series owners, I need your help/ | 2022-03-28 12:10 | - | |
| Any Acer showrooms in the DC area/ | 2022-03-28 12:10 | - | |
| Any Aspire S3-951 owners/ | 2022-03-28 12:10 | - | |
| Any Aspire S3 Cooling mod/ | 2022-03-28 12:10 | - | |
| Any Guide to install Windows 8 on an Acer 1810T/ | 2022-03-28 12:10 | - | |
| Any HIDDEN crap come installed on an ACER/ | 2022-03-28 12:10 | - | |
| Any North American Acer 5650 news/ | 2022-03-28 12:10 | - | |
| Any One Can tell me About Playing Games On Aspire/ | 2022-03-28 12:10 | - | |
| Any Other Gemstoners Having Heat Issues/ | 2022-03-28 12:10 | - | |
| Any Overheating problems with Athalon/ | 2022-03-28 12:10 | - | |
| Any Reviews on Acer Aspire 1681LCi/ | 2022-03-28 12:10 | - | |
| Any Win 7 SP1 compatible ATI Intel driver package from Acer/ | 2022-03-28 12:10 | - | |
| Any backup/ | 2022-03-28 12:10 | - | |
| Anybody had this problem with 4937G/ | 2022-03-28 12:10 | - | |
| Anybody has the AS1830T-68U118/ | 2022-03-28 12:10 | - | |
| Anybody have a acer aspire 9500 series laptop/ | 2022-03-28 12:10 | - | |
| Anybody have bluetooth on Aspire 2000 series/ | 2022-03-28 12:10 | - | |
| Anybody have the One 725 C-60 Netbook What`s your keyboard like/ | 2022-03-28 12:10 | - | |
| Anybody know how to clean the fan etc on 5738zg/ | 2022-03-28 12:10 | - | |
| Anybody know if a Travelstar 7K1000 will work with an Acer 5251/ | 2022-03-28 12:10 | - | |
| Anybody know what bluetooth module fit the Acer 4620/ | 2022-03-28 12:10 | - | |
| Anybody out there own a Aspire 5684WLMi/ | 2022-03-28 12:10 | - | |
| Anybody use their Acer Like a desktop Please post pics of your setup EITHER WAY... --)/ | 2022-03-28 12:10 | - | |
| Any brick and mortar stores that sell AS6920/ | 2022-03-28 12:10 | - | |
| Any chance of HD4330 Timelines coming to US Canada before September/ | 2022-03-28 12:10 | - | |
| Any coolbuydirect.com shoppers/ | 2022-03-28 12:10 | - | |
| Any difference between V7-582PG vs V5-573PG/ | 2022-03-28 12:10 | - | |
| Any easy way to create single partition/ | 2022-03-28 12:10 | - | |
| Any experience probs with 4502LMI please/ | 2022-03-28 12:10 | - | |
| Any experiences with the acer 4920/ | 2022-03-28 12:10 | - | |
| Any experience with AS5742G/ | 2022-03-28 12:10 | - | |
| Any feedback on www.acerdirect.co.uk/ | 2022-03-28 12:10 | - | |
| Any had any driver problems Windows experiance index problems/ | 2022-03-28 12:10 | - | |
| Any hope for my Acer Aspire 5680/ | 2022-03-28 12:10 | - | |
| Any input regarding the Acer Aspire 2930/ | 2022-03-28 12:10 | - | |
| Any know if there is a wireless driver update (Broadcom Ferrari 4005)/ | 2022-03-28 12:10 | - | |
| Any known CPU volt mods for 5920G/ | 2022-03-28 12:10 | - | |
| Anyone Else have one Should I buy it/ | 2022-03-28 12:10 | - | |
| Anyone Got $250 To Spend/ | 2022-03-28 12:10 | - | |
| Anyone Running Ubuntu on TM8204/ | 2022-03-28 12:10 | - | |
| Anyone actually seen used the T3204/ | 2022-03-28 12:10 | - | |
| Anyone added a Blu-Ray writer to an Acer 8943G/ | 2022-03-28 12:10 | - | |
| Anyone bought a 5672WLMi off Buy.com/ | 2022-03-28 12:10 | - | |
| Any one buy a repl battery for Aspire One from Provantage.com/ | 2022-03-28 12:10 | - | |
| Any one can help me/ | 2022-03-28 12:10 | - | |
| Anyone done a format clean OS install new HDD/ | 2022-03-28 12:10 | - | |
| Anyoned tried the cheap AGPTEK replacement batteries/ | 2022-03-28 12:10 | - | |
| Anyone else feel ripped off by ATi x1400s use of system memory/ | 2022-03-28 12:10 | - | |
| Anyone else getting the run-around from Acer Support/ | 2022-03-28 12:10 | - | |
| Anyone else had problems with their ACER and power battery charging/ | 2022-03-28 12:10 | - | |
| Anyone else own one of the Aspire 7735's/ | 2022-03-28 12:10 | - | |
| Anyone ever deal with Acer customer service/ | 2022-03-28 12:10 | - | |
| Anyone find a fix for Ferrari mouse/ | 2022-03-28 12:10 | - | |
| Anyone flashed new intel VIDEO bios in 1810T/ | 2022-03-28 12:10 | - | |
| Anyone from the UK that has the 6930g/ | 2022-03-28 12:10 | - | |
| Anyone get a 9300 series/ | 2022-03-28 12:10 | - | |
| Anyone got an original 9600M GT DDR3 Acer Bios/ | 2022-03-28 12:10 | - | |
| Anyone has the Timeline Travelmate 8371 or 8471 or 8571/ | 2022-03-28 12:10 | - | |
| Anyone have 1410 with hibernation problems/ | 2022-03-28 12:10 | - | |
| Anyone have Aspire 2020 Give me opinions!/ | 2022-03-28 12:10 | - | |
| Anyone have Experience with Acer's Warranty/ | 2022-03-28 12:10 | - | |
| Anyone have a 4404 Comments/ | 2022-03-28 12:10 | - | |
| Anyone have a Aspire 7745G/ | 2022-03-28 12:10 | - | |
| Anyone have an acer 8930G/ | 2022-03-28 12:10 | - | |
| Anyone have a source for the back case panel for my Extensa 5620z/ | 2022-03-28 12:10 | - | |
| Anyone have experience of the Aspire 7551-N954G50/ | 2022-03-28 12:10 | - | |
| Anyone have the AS4530-6823/ | 2022-03-28 12:10 | - | |
| Anyone have the Acer Aspire One Feedback Thoughts/ | 2022-03-28 12:10 | - | |
| Anyone having problems with Windows update AND using FSecure with Vista/ | 2022-03-28 12:10 | - | |
| Anyone heard of ACER 3002 WLMi/ | 2022-03-28 12:10 | - | |
| Anyone help with installing Windows/ | 2022-03-28 12:10 | - | |
| Anyone here using an ACER laptop w Linksys router/ | 2022-03-28 12:10 | - | |
| Anyone install Windows 7 on Acer 9810/ | 2022-03-28 12:10 | - | |
| Anyone install a 1080p panel on their 17.3 V3/ | 2022-03-28 12:10 | - | |
| Anyone interested in Acers original 2x256 DDR2/ | 2022-03-28 12:10 | - | |
| Anyone know a place (UK) to repair broken screen hinge/ | 2022-03-28 12:10 | - | |
| Anyone know how to EXPORT wifi profiles/ | 2022-03-28 12:10 | - | |
| Anyone know how to make the email btton light up on a 5672/ | 2022-03-28 12:10 | - | |
| Anyone know how to upgrade a 3680's processor !/ | 2022-03-28 12:10 | - | |
| Anyone know of a good acer revo forum/ | 2022-03-28 12:10 | - | |
| Anyone knows bout Bigo/ | 2022-03-28 12:10 | - | |
| Anyone knows this card/ | 2022-03-28 12:10 | - | |
| Anyone know the PLL for Aspire 8920G/ | 2022-03-28 12:10 | - | |
| Anyone know the max HDD size for a 5610Z/ | 2022-03-28 12:10 | - | |
| Anyone know what this update is for and is it safe !/ | 2022-03-28 12:10 | - | |
| Anyone know where I can download the empowering technology application from/ | 2022-03-28 12:10 | - | |
| Anyone know where to get new Keyboards from/ | 2022-03-28 12:10 | - | |
| Anyone know where to get the internal bluetooth for aspire 5100-3583/ | 2022-03-28 12:10 | - | |
| Anyone managed to swap motherboards on an Acer Aspire 3680 or 5570 or 5580/ | 2022-03-28 12:10 | - | |
| Anyone open up a 5672/ | 2022-03-28 12:10 | - | |
| Anyone ordered from this guy/ | 2022-03-28 12:10 | - | |
| Anyone overclocked a Acer Aspire 5100 vista version/ | 2022-03-28 12:10 | - | |
| Anyone own an Acer Travelmate 6291 or any other 12 model What do you think/ | 2022-03-28 12:10 | - | |
| Anyone own the Acer AS5253/ | 2022-03-28 12:10 | - | |
| Anyone own the Aspire 8735G-6502/ | 2022-03-28 12:10 | - | |
| Anyone own the Ferrari 3400/ | 2022-03-28 12:10 | - | |
| Anyone playing CRYSIS beta on 5920G/ | 2022-03-28 12:10 | - | |
| Anyone put a Core 2 Duo chip in a Travelmate 4202 yet/ | 2022-03-28 12:10 | - | |
| Anyone put a quad (and if so higher than q9000) in their 7738G/ | 2022-03-28 12:10 | - | |
| Anyone reccomend a SSD for the Acer Ferrari One 200/ | 2022-03-28 12:10 | - | |
| Anyone recognize this laptop/ | 2022-03-28 12:10 | - | |
| Anyone recommend a laptop to replace 8930G/ | 2022-03-28 12:10 | - | |
| Anyone regret getting the 5102/ | 2022-03-28 12:10 | - | |
| Anyone running 64bit vista on 5920G/ | 2022-03-28 12:10 | - | |
| Anyone running their 5672 w a 24 or 30 screen/ | 2022-03-28 12:10 | - | |
| Anyone seen Acer Aspire 1802WSMi/ | 2022-03-28 12:10 | - | |
| Anyone spotted the Acer Ferrari One yet in the States/ | 2022-03-28 12:10 | - | |
| Anyone successfully install 8gb ram in a 4810T/ | 2022-03-28 12:10 | - | |
| Anyone tether a palm treo to an acer with bluetooth/ | 2022-03-28 12:10 | - | |
| Anyone tried disassemble the battery Need help!/ | 2022-03-28 12:10 | - | |
| Anyone tried the ZM-NC1000 cooler from Zalman on an Acer yet/ | 2022-03-28 12:10 | - | |
| Anyone tried the dell drivers for there x1400/ | 2022-03-28 12:10 | - | |
| Anyone tried to update firmware in 20GB SSD inside Acer S3 ultrabook/ | 2022-03-28 12:10 | - | |
| Anyone try Intel's 9.0.3.9 driver for 2915 with TM8100/ | 2022-03-28 12:10 | - | |
| Anyone try installing 8GB of RAM in an 1810 or 1410/ | 2022-03-28 12:10 | - | |
| Anyone use NTI CD DVD maker on their Aspire/ | 2022-03-28 12:10 | - | |
| Anyone use greencell batteries in their aspire/ | 2022-03-28 12:10 | - | |
| Anyone using Linux on the 5920G/ | 2022-03-28 12:10 | - | |
| Anyone using USB mouse with TM 4000 or Aspire 1680/ | 2022-03-28 12:10 | - | |
| Anyone who has a 16 FULL HD 1920x1080 WUXGA acer laptop/ | 2022-03-28 12:10 | - | |
| Anyone with 6920G upgrade their wireless to Intel 4965N/ | 2022-03-28 12:10 | - | |
| Anyone with Acer 5562WXMi/ | 2022-03-28 12:10 | - | |
| Anyone with a 8940g taken apart/ | 2022-03-28 12:10 | - | |
| Anyone with the new A8-3500M APU Quad Core Acer Aspire AS5560G-SB485/ | 2022-03-28 12:10 | - | |
| Any opinions on the Acer AS8943G-9429/ | 2022-03-28 12:10 | - | |
| Any problem if I Connect my acer 5920G with 3 pin plug to a 2 pin socket/ | 2022-03-28 12:10 | - | |
| Any reason why my 7720 would not run far cry/ | 2022-03-28 12:10 | - | |
| Any repaste numbers out there for Predator Helios 500/ | 2022-03-28 12:10 | - | |
| Any review on Aspire 4937G/ | 2022-03-28 12:10 | - | |
| Any reviews of the Aspire One AO722/ | 2022-03-28 12:10 | - | |
| Any reviews on the Acer Laptop 5002WLMI/ | 2022-03-28 12:10 | - | |
| Any rhyme or reason to Acer's numbering scheme Dont know what I want/ | 2022-03-28 12:10 | - | |
| Anything comparable to the 3201XCi/ | 2022-03-28 12:10 | - | |
| Any thought on this Acer Aspire 5101AWLMi/ | 2022-03-28 12:10 | - | |
| Any thoughts on a Aspire 3680/ | 2022-03-28 12:10 | - | |
| Any us 5920 with a 5400 rpm hard drive/ | 2022-03-28 12:10 | - | |
| Anyway I can mod the Acer Aspire V3-571G-9435 The battery life on this thing is terrible/ | 2022-03-28 12:10 | - | |
| Any way to control fans on Aspire V3 772G/ | 2022-03-28 12:10 | - | |
| Any way to re-get PQSERVICE partition/ | 2022-03-28 12:10 | - | |
| Anywhere I could get the model numbers for the timeline Olympic edition notebooks/ | 2022-03-28 12:10 | - | |
| Any word on when the AS 8950G/ | 2022-03-28 12:10 | - | |
| Apire 1410, can it be faster/ | 2022-03-28 12:10 | - | |
| Apire 6930 upgrade questions/ | 2022-03-28 12:10 | - | |
| A positive Acer experience ...yes...positive!/ | 2022-03-28 12:05 | - | |
| Appearance Maintenance (6920)/ | 2022-03-28 12:10 | - | |
| Application to control keyboard light scheme/ | 2022-03-28 12:10 | - | |
| Applying MX-2 on the 5920g/ | 2022-03-28 12:10 | - | |
| A problem and a question/ | 2022-03-28 12:05 | - | |
| A problem with my Acer 5672/ | 2022-03-28 12:05 | - | |
| A program to show correct temps on Aspire One/ | 2022-03-28 12:05 | - | |
| Apsire 1 Touchpad/ | 2022-03-28 12:10 | - | |
| Apsire 1410 with dual core processor/ | 2022-03-28 12:10 | - | |
| Apsire 5570Z - integrated Buetooth is no more working/ | 2022-03-28 12:10 | - | |
| Apsire 7745g random 100% cpu spikes/ | 2022-03-28 12:10 | - | |
| A question about Acer bios/ | 2022-03-28 12:05 | - | |
| A question about SU 2700 processor/ | 2022-03-28 12:05 | - | |
| A question about my new acer 6930(lowend)/ | 2022-03-28 12:05 | - | |
| A question about the 5650 graphics-card/ | 2022-03-28 12:05 | - | |
| A question concerning Acer Aspire 5672WLMi Plz!!!!!!!/ | 2022-03-28 12:05 | - | |
| A question for Ferrari 5000 owners/ | 2022-03-28 12:05 | - | |
| A question regarding battery/ | 2022-03-28 12:05 | - | |
| A questions about the 8920 30 and Upgrades/ | 2022-03-28 12:05 | - | |
| A quick question about a Acer Aspire series/ | 2022-03-28 12:05 | - | |
| A quick question regarding upgrading hardware and Acer's Factory reset disks/ | 2022-03-28 12:05 | - | |
| Arcade Deluxe Patch Utility/ | 2022-03-28 12:10 | - | |
| Arcade Deluxe Song issue/ | 2022-03-28 12:10 | - | |
| Arcade Deluxe quiet speech/ | 2022-03-28 12:10 | - | |
| Arcade buttons and Logitech Cordless Duo software/ | 2022-03-28 12:10 | - | |
| Are ACER Killing our laptops via BIOS updates/ | 2022-03-28 12:10 | - | |
| Are ACER coming out with a 9800m based laptop/ | 2022-03-28 12:10 | - | |
| Are Acer's pretty reliable/ | 2022-03-28 12:10 | - | |
| Are Acer Gateway laptops still available at the big box stores/ | 2022-03-28 12:10 | - | |
| Are Acer laptops really as bad as people make out to be/ | 2022-03-28 12:10 | - | |
| Are Acer laptops really not into overclocking their GPU's/ | 2022-03-28 12:10 | - | |
| Are Acer pcs good/ | 2022-03-28 12:10 | - | |
| Are These ACER'S The Same/ | 2022-03-28 12:10 | - | |
| Are These Temps Normal For Ferrari One 200/ | 2022-03-28 12:10 | - | |
| Are all 3 USB ports in 4000 4500 USB2(480Mbps)/ | 2022-03-28 12:10 | - | |
| Are all acer 5315 keyboards the same/ | 2022-03-28 12:10 | - | |
| A really good deal/ | 2022-03-28 12:05 | - | |
| Are aspire 5100 using dual mem controller/ | 2022-03-28 12:10 | - | |
| Are my temperatures normal, or is my 5672 defective/ | 2022-03-28 12:10 | - | |
| A request for the USB device descriptor failed. Code 43/ | 2022-03-28 12:05 | - | |
| Are the intake holes on the bottom of the Aspire 5536-5142 missing on purpose/ | 2022-03-28 12:10 | - | |
| Arrandale CULV Updates for Timeline Series...!!/ | 2022-03-28 12:10 | - | |
| Arrandale update to 1810tz, when/ | 2022-03-28 12:10 | - | |
| Arrow key issues with gaming/ | 2022-03-28 12:10 | - | |
| As5742/ | 2022-03-28 12:10 | - | |
| As5920g-932g32bn/ | 2022-03-28 12:10 | - | |
| As6930-6455/ | 2022-03-28 12:10 | - | |
| As6930/ | 2022-03-28 12:10 | - | |
| As7720-6844/ | 2022-03-28 12:10 | - | |
| A search for Acer Aspire 5670 5620 older bios/ | 2022-03-28 12:05 | - | |
| Aser 5570 setup problem/ | 2022-03-28 12:10 | - | |
| Aser Aspire 3620 blank screen/ | 2022-03-28 12:10 | - | |
| Aser Aspire 5610 WebCam problem/ | 2022-03-28 12:10 | - | |
| Aser aspire one - Help needed/ | 2022-03-28 12:10 | - | |
| A simple question/ | 2022-03-28 12:05 | - | |
| Asipire 5153-2153 running awe-inspiring slow!/ | 2022-03-28 12:10 | - | |
| Asked Acer about buying replacement fan, asked for $50 just to answer question/ | 2022-03-28 12:10 | - | |
| Asking for advices on TravelMate 4101LMi/ | 2022-03-28 12:10 | - | |
| Ask someone who used to work for Acer/ | 2022-03-28 12:10 | - | |
| Aspier 9300- MAM_V119/ | 2022-03-28 12:10 | - | |
| Aspire® 4810 Timeline vs. Lenovo T410s/ | 2022-03-28 12:11 | - | |
| Aspire %670 Recovery disk/ | 2022-03-28 12:10 | - | |
| Aspire - screen blank on AC power use/ | 2022-03-28 12:10 | - | |
| Aspire....Carack on Hinge/ | 2022-03-28 12:11 | - | |
| Aspire 1 now shipping with HD 3650!!/ | 2022-03-28 12:10 | - | |
| Aspire 3-571g screen upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 3 A315-41-R5P7 Vega RAM expansion/ | 2022-03-28 12:10 | - | |
| Aspire 5 A517-52G not detecting 2nd HDD/ | 2022-03-28 12:10 | - | |
| Aspire 15.4 Laptop screen protector/ | 2022-03-28 12:10 | - | |
| Aspire 169x SP DIF Support (digital sound out)/ | 2022-03-28 12:10 | - | |
| Aspire 202x arcade buttons/ | 2022-03-28 12:10 | - | |
| Aspire 380 upgrade question/ | 2022-03-28 12:10 | - | |
| Aspire 521 Wireless Printing Issue/ | 2022-03-28 12:10 | - | |
| Aspire 721 good for gaming/ | 2022-03-28 12:11 | - | |
| Aspire 730 Bios ACPI/ | 2022-03-28 12:11 | - | |
| Aspire 1310 HDD failure/ | 2022-03-28 12:10 | - | |
| Aspire 1355 which model has the radeon card/ | 2022-03-28 12:10 | - | |
| Aspire 1357LMi wifi connection problem/ | 2022-03-28 12:10 | - | |
| Aspire 1360 won't boot anymore/ | 2022-03-28 12:10 | - | |
| Aspire 1362 WLMi Bios flash failed/ | 2022-03-28 12:10 | - | |
| Aspire 1400 audio/ | 2022-03-28 12:10 | - | |
| Aspire 1403lc minipci hardware disabled/ | 2022-03-28 12:10 | - | |
| Aspire 1410 (11.6 screen) eRecovery image/ | 2022-03-28 12:10 | - | |
| Aspire 1410-2801 speaker problem. Help/ | 2022-03-28 12:10 | - | |
| Aspire 1410 - how to get inside/ | 2022-03-28 12:10 | - | |
| Aspire 1410 1810 7800mah battery..worth it/ | 2022-03-28 12:10 | - | |
| Aspire 1410 1810T Fn + Brightness key, my attempt to get Acer to recognize the problem/ | 2022-03-28 12:10 | - | |
| Aspire 1410 CD problems/ | 2022-03-28 12:10 | - | |
| Aspire 1410 Screen Problem/ | 2022-03-28 12:10 | - | |
| Aspire 1410T Gateway 1803U WWAN/ | 2022-03-28 12:10 | - | |
| Aspire 1410T replacement hard drive connector/ | 2022-03-28 12:10 | - | |
| Aspire 1410 in Canada/ | 2022-03-28 12:10 | - | |
| Aspire 1410 question/ | 2022-03-28 12:10 | - | |
| Aspire 1430 - 11.6 notebook/ | 2022-03-28 12:10 | - | |
| Aspire 1430Z Battery/ | 2022-03-28 12:10 | - | |
| Aspire 1430Z wireless adapter/ | 2022-03-28 12:10 | - | |
| Aspire 1500 CDRW - DVD drive not reading/ | 2022-03-28 12:10 | - | |
| Aspire 1501, 1502/ | 2022-03-28 12:10 | - | |
| Aspire 1513/ | 2022-03-28 12:10 | - | |
| Aspire 1520 NVidia In 1360 Motherboard/ | 2022-03-28 12:10 | - | |
| Aspire 1520 notebook/ | 2022-03-28 12:10 | - | |
| Aspire 1551 or Aspire One 722/ | 2022-03-28 12:10 | - | |
| Aspire 1560- Empowering tools & Vista/ | 2022-03-28 12:10 | - | |
| Aspire 1605LM dead after firmware update/ | 2022-03-28 12:10 | - | |
| Aspire1640 ERROR/ | 2022-03-28 12:11 | - | |
| Aspire 1640Z Flickering and very dim screen problem/ | 2022-03-28 12:10 | - | |
| Aspire 1640 ZL8 [ info requested ]/ | 2022-03-28 12:10 | - | |
| Aspire 1640 reversed polarity repair help/ | 2022-03-28 12:10 | - | |
| Aspire 1640z motherboard problem/ | 2022-03-28 12:10 | - | |
| Aspire 1640z won't boot cd/ | 2022-03-28 12:10 | - | |
| Aspire 1642 Battery wont charge and is slowly discharging but runs on AC power/ | 2022-03-28 12:10 | - | |
| Aspire 1642 WLMI sound problem/ | 2022-03-28 12:10 | - | |
| Aspire 1642wlmi Samsung hm160hc upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 1644wlmi/ | 2022-03-28 12:10 | - | |
| Aspire 1652WLMi.- Recorder terribly slow. Help!/ | 2022-03-28 12:10 | - | |
| Aspire 1652WLMi 1692WLMi for stage performance/ | 2022-03-28 12:10 | - | |
| Aspire 1654 screen/ | 2022-03-28 12:10 | - | |
| Aspire 1670 instability problems/ | 2022-03-28 12:10 | - | |
| Aspire 1672 BIOS password fault/ | 2022-03-28 12:10 | - | |
| Aspire 1680 .. HELP/ | 2022-03-28 12:10 | - | |
| Aspire 1680 WLmi - no operating system found/ | 2022-03-28 12:10 | - | |
| Aspire 1681 Bios/ | 2022-03-28 12:10 | - | |
| Aspire 1681WLMi Video/ | 2022-03-28 12:10 | - | |
| Aspire 1681WLMi vs Aspire 2012WLMi/ | 2022-03-28 12:10 | - | |
| Aspire 1681 Wireless Card problem/ | 2022-03-28 12:10 | - | |
| Aspire 1682/ | 2022-03-28 12:10 | - | |
| Aspire 1682WLMi_512- BATTERY/ | 2022-03-28 12:10 | - | |
| Aspire 1683 or 2026(2025 US Ver) opinons please/ | 2022-03-28 12:10 | - | |
| Aspire 1684 Wlmi/ | 2022-03-28 12:10 | - | |
| Aspire 1690 SPDIF Support/ | 2022-03-28 12:10 | - | |
| Aspire 1690WMLi upgrading RAM question!!!/ | 2022-03-28 12:10 | - | |
| Aspire 1690 microSD reader problem/ | 2022-03-28 12:10 | - | |
| Aspire 1690 service manual!!!/ | 2022-03-28 12:10 | - | |
| Aspire 1691/ | 2022-03-28 12:10 | - | |
| Aspire 1691 My Computer USB Sticks not showing/ | 2022-03-28 12:10 | - | |
| Aspire 1691WLMi clicking hard drive issue/ | 2022-03-28 12:10 | - | |
| Aspire 1692 LX.A7205.123/ | 2022-03-28 12:10 | - | |
| Aspire 1692 WLMi - problems/ | 2022-03-28 12:10 | - | |
| Aspire 1692WLMi/ | 2022-03-28 12:10 | - | |
| Aspire 1692 WLMi Opinion/ | 2022-03-28 12:10 | - | |
| Aspire 1693 VS AMILO M 1437G/ | 2022-03-28 12:10 | - | |
| Aspire 1694 Slot DVD-Dual drive vibrations/ | 2022-03-28 12:10 | - | |
| Aspire 1694WLMi - Holland/ | 2022-03-28 12:10 | - | |
| Aspire 1694WLMi DVD removal/ | 2022-03-28 12:10 | - | |
| Aspire 1694WLMi doesn't receive analog voice phone calls/ | 2022-03-28 12:10 | - | |
| Aspire 1694 hinges cracking/ | 2022-03-28 12:10 | - | |
| Aspire 1694 wireless replacement/ | 2022-03-28 12:10 | - | |
| Aspire 1694 with x700 for the price of x600!!!/ | 2022-03-28 12:10 | - | |
| Aspire1710 (Nvidia Go5600) Bios tweak went wrong/ | 2022-03-28 12:11 | - | |
| Aspire 1714SMi - PSU needed/ | 2022-03-28 12:10 | - | |
| Aspire 1800/ | 2022-03-28 12:10 | - | |
| Aspire 1800 CPU Upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 1800 Series screen/ | 2022-03-28 12:10 | - | |
| Aspire 1800 cooling fans cleaning dust/ | 2022-03-28 12:10 | - | |
| Aspire 1800 or 1802 bios updates/ | 2022-03-28 12:10 | - | |
| Aspire 1800 series - memory speed/ | 2022-03-28 12:10 | - | |
| Aspire 1800 supports DDR2/ | 2022-03-28 12:10 | - | |
| Aspire 1801WSMi/ | 2022-03-28 12:10 | - | |
| Aspire 1801WSMi Cold booting with a cd in drive/ | 2022-03-28 12:10 | - | |
| Aspire 1802SWMi - Memory upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 1804WSMI Power Problems/ | 2022-03-28 12:10 | - | |
| Aspire 1804 WSMi Graphic Card Upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 1804 and 64 bit/ | 2022-03-28 12:10 | - | |
| Aspire 1810 - SU4100 vs SU7300 - worth 100 EUR difference/ | 2022-03-28 12:10 | - | |
| Aspire 1810T-8679 Availability in U.S/ | 2022-03-28 12:10 | - | |
| Aspire 1810T LCD Flickering Issues/ | 2022-03-28 12:10 | - | |
| Aspire 1810TZ- 16 color mode after asked for privileges standby/ | 2022-03-28 12:10 | - | |
| Aspire 1810TZ and Win7 PROBLEM!!!/ | 2022-03-28 12:10 | - | |
| Aspire 1810tz black screen/ | 2022-03-28 12:10 | - | |
| Aspire 1830T-7618 charger/ | 2022-03-28 12:10 | - | |
| Aspire 1830T Insyde Recovery Problem/ | 2022-03-28 12:10 | - | |
| Aspire 1830T pixel smearing/ | 2022-03-28 12:10 | - | |
| Aspire 2000 2010 2020 hinges/ | 2022-03-28 12:10 | - | |
| Aspire 2000 wireless problems/ | 2022-03-28 12:10 | - | |
| Aspire 2010 IR Issues/ | 2022-03-28 12:10 | - | |
| Aspire 2010 Memory Ugrade/ | 2022-03-28 12:10 | - | |
| Aspire 2010 unable to boot from cd, plz help/ | 2022-03-28 12:10 | - | |
| Aspire 2012 LCD backlight died/ | 2022-03-28 12:10 | - | |
| Aspire 2012WLCi...help please/ | 2022-03-28 12:10 | - | |
| Aspire 2012WLCi Notebook - sound card anomaly/ | 2022-03-28 12:10 | - | |
| Aspire 2012 WLMI DVD Burner/ | 2022-03-28 12:10 | - | |
| Aspire 2012WLMi SVCHOST CPU Overhead/ | 2022-03-28 12:10 | - | |
| Aspire 2012 blank screen and loud noise when turned on/ | 2022-03-28 12:10 | - | |
| Aspire 2012 has Dothan !!!/ | 2022-03-28 12:10 | - | |
| Aspire 2012 questions/ | 2022-03-28 12:10 | - | |
| Aspire 2012 wlmi/ | 2022-03-28 12:10 | - | |
| Aspire 2012wlmi Processor/ | 2022-03-28 12:10 | - | |
| Aspire 2012wlmi Startup Problems/ | 2022-03-28 12:10 | - | |
| Aspire 2020 & Bluetooth/ | 2022-03-28 12:10 | - | |
| Aspire 2020/ | 2022-03-28 12:10 | - | |
| Aspire 2020 Can`t Get Email Detection To Work/ | 2022-03-28 12:10 | - | |
| Aspire 2023 Memory Upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 2025,Travelmate 8006LMI, or Ferrari 3200/ | 2022-03-28 12:10 | - | |
| Aspire 2025, any rants or raves/ | 2022-03-28 12:10 | - | |
| Aspire 2025 questions/ | 2022-03-28 12:10 | - | |
| Aspire 2025 v. Asus W1000N/ | 2022-03-28 12:10 | - | |
| Aspire 2025wlmi/ | 2022-03-28 12:10 | - | |
| Aspire 2026WLMi How can I get one in the U.S/ | 2022-03-28 12:10 | - | |
| Aspire 2390 Firewire Connectivity/ | 2022-03-28 12:10 | - | |
| Aspire 2920 return from hibernate/ | 2022-03-28 12:10 | - | |
| Aspire 2930-6850/ | 2022-03-28 12:10 | - | |
| Aspire 3000/ | 2022-03-28 12:10 | - | |
| Aspire 3000 Blinking power led, blank screen, won't boot/ | 2022-03-28 12:10 | - | |
| Aspire 3000 Heat Sink Servce Manual/ | 2022-03-28 12:10 | - | |
| Aspire 3000 No Power (Multiple Problems)/ | 2022-03-28 12:10 | - | |
| Aspire 3000 No Visual/ | 2022-03-28 12:10 | - | |
| Aspire 3000 cracked hinge cover, please help/ | 2022-03-28 12:10 | - | |
| Aspire 3000 gets very hot in bump on underside - graphics chip/ | 2022-03-28 12:10 | - | |
| Aspire 3000 no video on boot.....help/ | 2022-03-28 12:10 | - | |
| Aspire 3000 overheating/ | 2022-03-28 12:10 | - | |
| Aspire 3000 screen issues/ | 2022-03-28 12:10 | - | |
| Aspire 3000 series playable games/ | 2022-03-28 12:10 | - | |
| Aspire 3000 sound not working after Windows reinstall/ | 2022-03-28 12:10 | - | |
| Aspire 3000 won't turn on at all (Pls Help)/ | 2022-03-28 12:10 | - | |
| Aspire 3002LC vs 3003WLMi/ | 2022-03-28 12:10 | - | |
| Aspire 3002LM notebook/ | 2022-03-28 12:10 | - | |
| Aspire 3003 Lci Battery and AC Adapter replacement/ | 2022-03-28 12:10 | - | |
| Aspire 3003WLCi Display problems/ | 2022-03-28 12:10 | - | |
| Aspire 3003WLCi screen problem/ | 2022-03-28 12:10 | - | |
| Aspire 3003WLMi Screen Problem/ | 2022-03-28 12:10 | - | |
| Aspire 3003 WLMi Sticky keys poor mouse/ | 2022-03-28 12:10 | - | |
| Aspire 3003 crashes if its battery is installed/ | 2022-03-28 12:10 | - | |
| Aspire 3003lci Bluetooth/ | 2022-03-28 12:10 | - | |
| Aspire 3003 sound issue/ | 2022-03-28 12:10 | - | |
| Aspire 3003wlci and FIR Port/ | 2022-03-28 12:10 | - | |
| Aspire 3004WLCi defective left click button/ | 2022-03-28 12:10 | - | |
| Aspire 3004WLCi speaker noise problem/ | 2022-03-28 12:10 | - | |
| Aspire 3005WLMi freezes/ | 2022-03-28 12:10 | - | |
| Aspire 3020 power management and usb problem!/ | 2022-03-28 12:10 | - | |
| Aspire 3020 won't load Windows/ | 2022-03-28 12:10 | - | |
| Aspire 3023 - Upgrade to XP Pro/ | 2022-03-28 12:10 | - | |
| Aspire 3023 Problem Please Help/ | 2022-03-28 12:10 | - | |
| Aspire 3023WLMi upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 3023 new hard drive/ | 2022-03-28 12:10 | - | |
| Aspire 3050, Any Reviews/ | 2022-03-28 12:10 | - | |
| Aspire 3050-1066/ | 2022-03-28 12:10 | - | |
| Aspire 3050-1150 Mystery Chip Upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 3050 CPU upgrade to Turion ZM-70/ | 2022-03-28 12:10 | - | |
| Aspire 3050 upgrade Sempron to Turion x2 Tl 50/ | 2022-03-28 12:10 | - | |
| Aspire 3053 - Internet Explorer cannot display/ | 2022-03-28 12:10 | - | |
| Aspire 3053 repair manual/ | 2022-03-28 12:10 | - | |
| Aspire 3053 upgraded to turion x2/ | 2022-03-28 12:10 | - | |
| Aspire 3053wxmi Turion x2 upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 3100 (3104Wlmi) CPU upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 3100-1718 HD I F/ | 2022-03-28 12:10 | - | |
| Aspire 3100 Bluetooth plug-in port location/ | 2022-03-28 12:10 | - | |
| Aspire 3100 memory errors/ | 2022-03-28 12:10 | - | |
| Aspire 3102WLMi and BT/ | 2022-03-28 12:10 | - | |
| Aspire 3200 64bit Ferrari or AS2025WLMi/ | 2022-03-28 12:10 | - | |
| Aspire 3502 WLCI/ | 2022-03-28 12:10 | - | |
| Aspire 3610, Intel IDE channel driver/ | 2022-03-28 12:10 | - | |
| Aspire 3610 - Dripping Tap/ | 2022-03-28 12:10 | - | |
| Aspire 3610 - beeping/ | 2022-03-28 12:10 | - | |
| Aspire 3610 Bluetooth sound/ | 2022-03-28 12:10 | - | |
| Aspire 3610 Screen Problem...help/ | 2022-03-28 12:10 | - | |
| Aspire 3610 Wireless Help/ | 2022-03-28 12:10 | - | |
| Aspire 3610 high pitch sound/ | 2022-03-28 12:10 | - | |
| Aspire 3620 fan- constantly running/ | 2022-03-28 12:10 | - | |
| Aspire 3623NWXCi - Need NB-Deity Advice, please/ | 2022-03-28 12:10 | - | |
| Aspire 3623 overheats/ | 2022-03-28 12:10 | - | |
| Aspire 3640 needs drivers/ | 2022-03-28 12:10 | - | |
| Aspire 3660 - Recovery help - Windows XP Media Centre Edition 2005/ | 2022-03-28 12:10 | - | |
| Aspire 3680, Aero Performance index/ | 2022-03-28 12:10 | - | |
| Aspire 3680-2022/ | 2022-03-28 12:10 | - | |
| Aspire 3680-2022 Model ZR1/ | 2022-03-28 12:10 | - | |
| Aspire 3680-2587 M520 1.6 accept T5200 1.6/ | 2022-03-28 12:10 | - | |
| Aspire 3680-2633 Blue screen of death on music playback/ | 2022-03-28 12:10 | - | |
| Aspire 3680-2633 Minor Annoyance after installed XP/ | 2022-03-28 12:10 | - | |
| Aspire 3680-2633 SATA controller/ | 2022-03-28 12:10 | - | |
| Aspire 3680 - 2682 won't power up/ | 2022-03-28 12:10 | - | |
| Aspire 3680 - Flickering screen during bootup/ | 2022-03-28 12:10 | - | |
| Aspire 3680 - No sound in headphones line-out... Please help/ | 2022-03-28 12:10 | - | |
| Aspire 3680-Orbicam Problems/ | 2022-03-28 12:10 | - | |
| Aspire 3680- Replacing RAM and optical drive/ | 2022-03-28 12:10 | - | |
| Aspire 3680 - blown capacitor/ | 2022-03-28 12:10 | - | |
| Aspire 3680/ | 2022-03-28 12:10 | - | |
| Aspire 3680 2354 boot and shut-down speed/ | 2022-03-28 12:10 | - | |
| Aspire 3680 Mouse Driver Issues/ | 2022-03-28 12:10 | - | |
| Aspire 3680 Mouse button issue/ | 2022-03-28 12:10 | - | |
| Aspire 3680 Power Board Issue/ | 2022-03-28 12:10 | - | |
| Aspire 3680 Recovery & Keyboard/ | 2022-03-28 12:10 | - | |
| Aspire 3680 Recovery CD/ | 2022-03-28 12:10 | - | |
| Aspire 3680 SPDIF out/ | 2022-03-28 12:10 | - | |
| Aspire 3680 WiFi mod/ | 2022-03-28 12:10 | - | |
| Aspire 3680 and SDHC cards/ | 2022-03-28 12:10 | - | |
| Aspire 3680 chip set/ | 2022-03-28 12:10 | - | |
| Aspire 3680 dis-assembly/ | 2022-03-28 12:10 | - | |
| Aspire 3680 network and audio problems/ | 2022-03-28 12:10 | - | |
| Aspire 3680 touchpad stopped working/ | 2022-03-28 12:10 | - | |
| Aspire 3680 wireless adapter doesn't fit new motherboard/ | 2022-03-28 12:10 | - | |
| Aspire 3680 with Vista Basic freezes/ | 2022-03-28 12:10 | - | |
| Aspire 3681WXMi - why is the fan never off/ | 2022-03-28 12:10 | - | |
| Aspire 3682WXCi line-out problems/ | 2022-03-28 12:10 | - | |
| Aspire 3682WXCi touchpad vs. mouse/ | 2022-03-28 12:10 | - | |
| Aspire 3682WXMI/ | 2022-03-28 12:10 | - | |
| Aspire 3690-2196/ | 2022-03-28 12:10 | - | |
| Aspire 3690-2672/ | 2022-03-28 12:10 | - | |
| Aspire 3690 Question/ | 2022-03-28 12:10 | - | |
| Aspire 3690 Screen Flashes and Goes Dark,Why/ | 2022-03-28 12:10 | - | |
| Aspire 3810TZ -Plugged in, Not Charging/ | 2022-03-28 12:10 | - | |
| Aspire 3810TZG LCD not working until power cycle/ | 2022-03-28 12:10 | - | |
| Aspire 3810TZ fan problem/ | 2022-03-28 12:10 | - | |
| Aspire 3830TG, FD to ROM conversion/ | 2022-03-28 12:10 | - | |
| Aspire 3935 WiFi Bluetooth Backup keys issue/ | 2022-03-28 12:10 | - | |
| Aspire 3951 - Acer's First Ultrabook/ | 2022-03-28 12:10 | - | |
| Aspire 4220 wireless problems/ | 2022-03-28 12:10 | - | |
| Aspire 4310 Wifi Error Nid Help/ | 2022-03-28 12:10 | - | |
| Aspire 4315-100508Ci Wireless Issues/ | 2022-03-28 12:10 | - | |
| Aspire 4315 BIOS download fails/ | 2022-03-28 12:10 | - | |
| Aspire 4315 White Screen/ | 2022-03-28 12:10 | - | |
| Aspire 4315 With an Engeneering Sample CPU !/ | 2022-03-28 12:10 | - | |
| Aspire 4315 fan doesn't work after sleep/ | 2022-03-28 12:10 | - | |
| Aspire 4315 fan problem+keyboard key. BIOS help/ | 2022-03-28 12:10 | - | |
| Aspire 4330 I must be the only dummy !/ | 2022-03-28 12:10 | - | |
| Aspire 4520 - Help with volume bar, not icon/ | 2022-03-28 12:10 | - | |
| Aspire 4520- Need help with XP Network Adapter driver/ | 2022-03-28 12:10 | - | |
| Aspire 4520 - Service Panel does not open/ | 2022-03-28 12:10 | - | |
| Aspire 4520 WXGA+/ | 2022-03-28 12:10 | - | |
| Aspire 4520 Wireless LAN won't work after Win7 upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 4520 Won't turn on/ | 2022-03-28 12:10 | - | |
| Aspire 4520 crashes/ | 2022-03-28 12:10 | - | |
| Aspire 4520 issues/ | 2022-03-28 12:10 | - | |
| Aspire 4520 problems/ | 2022-03-28 12:10 | - | |
| Aspire 4530 Vista --- XP PRO/ | 2022-03-28 12:10 | - | |
| Aspire 4710 importanat enquiry/ | 2022-03-28 12:10 | - | |
| Aspire 4720 - Make use 4GB RAM in Vista 32bit by using 512MB for X3100/ | 2022-03-28 12:10 | - | |
| Aspire 4720G T7100 8400mg/ | 2022-03-28 12:10 | - | |
| Aspire 4720 Hard Disk Password/ | 2022-03-28 12:10 | - | |
| Aspire 4720Z - S-video will it work with composite adapter/ | 2022-03-28 12:10 | - | |
| Aspire 4720Z Ram & video problem/ | 2022-03-28 12:10 | - | |
| Aspire 4720Z audio problem/ | 2022-03-28 12:10 | - | |
| Aspire 4720Z formatting problem/ | 2022-03-28 12:10 | - | |
| Aspire 4720z audio driver for widows xp/ | 2022-03-28 12:10 | - | |
| Aspire 4720z won't run on battery, seeking additional repair options/ | 2022-03-28 12:10 | - | |
| Aspire 4730 - Upgrade to Vista 64 bit/ | 2022-03-28 12:10 | - | |
| Aspire 4730z overheat/ | 2022-03-28 12:10 | - | |
| Aspire 4732 z running slowwww/ | 2022-03-28 12:10 | - | |
| Aspire 4736G BIOS recovery (HELP!)/ | 2022-03-28 12:10 | - | |
| Aspire 4738ZG - Broken LCD Screen Frame/ | 2022-03-28 12:10 | - | |
| Aspire 4738ZG Bluetooth for XP/ | 2022-03-28 12:10 | - | |
| Aspire 4741G keyboard problem/ | 2022-03-28 12:10 | - | |
| Aspire4743g keyboard functions, help/ | 2022-03-28 12:11 | - | |
| Aspire 4745 series Resource DVD/ | 2022-03-28 12:10 | - | |
| Aspire 4750G - always use intel HD VGA, not GeForce, update Bios/ | 2022-03-28 12:10 | - | |
| Aspire 4750G Bad Bios Flash/ | 2022-03-28 12:10 | - | |
| Aspire 4752G-2454G50MN gaming performance/ | 2022-03-28 12:10 | - | |
| Aspire 4810T Adapter beep/ | 2022-03-28 12:10 | - | |
| Aspire 4810T Freezes arggghh!/ | 2022-03-28 12:10 | - | |
| Aspire 4810T Optical drive/ | 2022-03-28 12:10 | - | |
| Aspire 4810T webcam voice recorder problems/ | 2022-03-28 12:10 | - | |
| Aspire 4810T wifi issues from new/ | 2022-03-28 12:10 | - | |
| Aspire 4810tzg blue charge light comes on after shut down/ | 2022-03-28 12:10 | - | |
| Aspire 4820TG Graphics card problem/ | 2022-03-28 12:10 | - | |
| Aspire 4920G dvd problem vista home/ | 2022-03-28 12:10 | - | |
| Aspire 4920 Monitor Colour calibration/ | 2022-03-28 12:10 | - | |
| Aspire 4920g question/ | 2022-03-28 12:10 | - | |
| Aspire 4920 problems/ | 2022-03-28 12:10 | - | |
| Aspire 4937G in XP cannot adjust brightness/ | 2022-03-28 12:10 | - | |
| Aspire 5000 Backlight Issue/ | 2022-03-28 12:10 | - | |
| Aspire 5000 CPU usage over 55% - slow running/ | 2022-03-28 12:10 | - | |
| Aspire 5000 Case Damage/ | 2022-03-28 12:10 | - | |
| Aspire 5000 No post/ | 2022-03-28 12:10 | - | |
| Aspire 5000 Power Brick Question/ | 2022-03-28 12:10 | - | |
| Aspire 5000 Power Jack Problem/ | 2022-03-28 12:10 | - | |
| Aspire 5000 Screen problem/ | 2022-03-28 12:10 | - | |
| Aspire 5000 battery fault/ | 2022-03-28 12:10 | - | |
| Aspire 5000 info/ | 2022-03-28 12:10 | - | |
| Aspire 5000 motherboard/ | 2022-03-28 12:10 | - | |
| Aspire 5002 WLMi - Boot Order/ | 2022-03-28 12:10 | - | |
| Aspire 5002 WLMi - Fresh Installation/ | 2022-03-28 12:10 | - | |
| Aspire 5002WLMi - motherboad connector Q/ | 2022-03-28 12:10 | - | |
| Aspire 5002WLMi and bluescreen/ | 2022-03-28 12:10 | - | |
| Aspire 5002WLMi cdfs.sys BSOD/ | 2022-03-28 12:10 | - | |
| Aspire 5002WLMi overheated and now dead/ | 2022-03-28 12:10 | - | |
| Aspire 5002WLMi specs/ | 2022-03-28 12:10 | - | |
| Aspire 5003WLMi Touchpad repair question/ | 2022-03-28 12:10 | - | |
| Aspire 5004WLMi, replace fan/ | 2022-03-28 12:10 | - | |
| Aspire 5004 wlmi LCD screen replacement/ | 2022-03-28 12:10 | - | |
| Aspire 5021WLMi - no WSXGA+ on external screen/ | 2022-03-28 12:10 | - | |
| Aspire 5021 and PSP/ | 2022-03-28 12:10 | - | |
| Aspire 5024, cooling/ | 2022-03-28 12:10 | - | |
| Aspire 5024 - questions/ | 2022-03-28 12:10 | - | |
| Aspire 5024 Battery Charging/ | 2022-03-28 12:10 | - | |
| Aspire 5024 or 1804/ | 2022-03-28 12:10 | - | |
| Aspire 5024wlmi Volume control/ | 2022-03-28 12:10 | - | |
| Aspire 5040 5020 How to enable USB 2.0/ | 2022-03-28 12:10 | - | |
| Aspire 5044WLMi - replacement battery/ | 2022-03-28 12:10 | - | |
| Aspire 5050-3205 problems with battery/ | 2022-03-28 12:10 | - | |
| Aspire 5050-3242 bad cpu/ | 2022-03-28 12:10 | - | |
| Aspire 5050-3371 Wireless Problems/ | 2022-03-28 12:10 | - | |
| Aspire 5050-4570/ | 2022-03-28 12:10 | - | |
| Aspire 5050 - Upgrade Wifi card - Bios no Post/ | 2022-03-28 12:10 | - | |
| Aspire 5050 3050 question!/ | 2022-03-28 12:10 | - | |
| Aspire 5050 Booting trouble/ | 2022-03-28 12:10 | - | |
| Aspire 5050 CPU upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5050 headphones and internal speakers/ | 2022-03-28 12:10 | - | |
| Aspire 5050 loosing HDD and DVD drive in XP & crash/ | 2022-03-28 12:10 | - | |
| Aspire 5050 notebook/ | 2022-03-28 12:10 | - | |
| Aspire 5050 questions/ | 2022-03-28 12:10 | - | |
| Aspire 5050 random lockups- think I know the problem/ | 2022-03-28 12:10 | - | |
| Aspire 5050 takes time-outs/ | 2022-03-28 12:10 | - | |
| Aspire 5051 - Upgrading to Bluetooth/ | 2022-03-28 12:10 | - | |
| Aspire 5051WLMI CPU compatibility/ | 2022-03-28 12:10 | - | |
| Aspire5100 + Vista home premium- how to send a fax/ | 2022-03-28 12:11 | - | |
| Aspire 5100, Need help with CPU issue/ | 2022-03-28 12:10 | - | |
| Aspire 5100, no ati-radeon xpress 1100 driver in vista/ | 2022-03-28 12:10 | - | |
| Aspire 5100, upgrade graphics card/ | 2022-03-28 12:10 | - | |
| Aspire 5100-3357 SPDIF out/ | 2022-03-28 12:10 | - | |
| Aspire 5100-3583 boot problem/ | 2022-03-28 12:10 | - | |
| Aspire 5100-3583 rebuild - questions/ | 2022-03-28 12:10 | - | |
| Aspire 5100 - Coming out of Screen Saver mode/ | 2022-03-28 12:10 | - | |
| Aspire 5100- DVD burner and recovery disk trouble/ | 2022-03-28 12:10 | - | |
| Aspire 5100 - How to flash to latest bios/ | 2022-03-28 12:10 | - | |
| Aspire 5100 - Install OS on nevv hard drive/ | 2022-03-28 12:10 | - | |
| Aspire 5100 - LOTS OF PROBLEMS/ | 2022-03-28 12:10 | - | |
| Aspire 5100 BL51 - Slow, columns of dead pixels, general unhappiness/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Backup's/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Bl51 AND Linux 4 the masses/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Boot Hard Drive problems/ | 2022-03-28 12:10 | - | |
| Aspire 5100 CD DVD not working/ | 2022-03-28 12:10 | - | |
| Aspire 5100 CPU Upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5100 D2D pqservice partition/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Disk2disk/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Display...What's failed/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Drivers Vista/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Graphics Card RAM/ | 2022-03-28 12:10 | - | |
| Aspire 5100 HDD Problem/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Input Mic Issues/ | 2022-03-28 12:10 | - | |
| Aspire 5100 LCD monitor problem/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Notebook dvd cd-rw drive not working/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Questions (BIOS)/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Upgrade Problem/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Won't boot!/ | 2022-03-28 12:10 | - | |
| Aspire 5100 Wont Boot/ | 2022-03-28 12:10 | - | |
| Aspire 5100 cpu upgrade socket s1 to am2+ phenom 9950 change adapter convertor/ | 2022-03-28 12:10 | - | |
| Aspire 5100 drivers/ | 2022-03-28 12:10 | - | |
| Aspire 5100 freezes only while using battery in power save mode/ | 2022-03-28 12:10 | - | |
| Aspire 5100 help- unlocking PQservice partition/ | 2022-03-28 12:10 | - | |
| Aspire 5100 inside cleaning/ | 2022-03-28 12:10 | - | |
| Aspire 5100 motherboard/ | 2022-03-28 12:10 | - | |
| Aspire 5100 no beep, no sound/ | 2022-03-28 12:10 | - | |
| Aspire 5100 only works with one memory chip installed/ | 2022-03-28 12:10 | - | |
| Aspire 5100 power settings keep resetting/ | 2022-03-28 12:10 | - | |
| Aspire 5100 problem 1 - shuts down in 90 seconds on DOS or BIOS mode/ | 2022-03-28 12:10 | - | |
| Aspire 5100 running extremely slow!/ | 2022-03-28 12:10 | - | |
| Aspire 5100 series Issues/ | 2022-03-28 12:10 | - | |
| Aspire 5100 service manual/ | 2022-03-28 12:10 | - | |
| Aspire 5100 tune-up/ | 2022-03-28 12:10 | - | |
| Aspire 5100 upgrades - worth it/ | 2022-03-28 12:10 | - | |
| Aspire 5100 upgrades/ | 2022-03-28 12:10 | - | |
| Aspire 5100 w Win7/ | 2022-03-28 12:10 | - | |
| Aspire 5100 won't boot, should it work without battery/ | 2022-03-28 12:10 | - | |
| Aspire 5101AWLMi problems/ | 2022-03-28 12:10 | - | |
| Aspire 5101 No Input Device/ | 2022-03-28 12:10 | - | |
| Aspire 5101 Setup Crashes/ | 2022-03-28 12:10 | - | |
| Aspire 5101 XP Wireless Problem/ | 2022-03-28 12:10 | - | |
| Aspire 5101a wlmi, a couple of questions/ | 2022-03-28 12:10 | - | |
| Aspire 5101 display problem/ | 2022-03-28 12:10 | - | |
| Aspire 5101 displays an error on POST/ | 2022-03-28 12:10 | - | |
| Aspire 5101 ghosting around/ | 2022-03-28 12:10 | - | |
| Aspire 5101 problem/ | 2022-03-28 12:10 | - | |
| Aspire 5101 upgrade turion64/ | 2022-03-28 12:10 | - | |
| Aspire 5101 v. 5102/ | 2022-03-28 12:10 | - | |
| Aspire 5102 - Touchpad joystick keys problem/ | 2022-03-28 12:10 | - | |
| Aspire 5102 DVD-CD capability/ | 2022-03-28 12:10 | - | |
| Aspire 5102 IRQ's/ | 2022-03-28 12:10 | - | |
| Aspire 5102 PCI Card Question/ | 2022-03-28 12:10 | - | |
| Aspire 5102 Touchpad problem/ | 2022-03-28 12:10 | - | |
| Aspire 5102 USB failure/ | 2022-03-28 12:10 | - | |
| Aspire 5102WLMI PATA - SATA/ | 2022-03-28 12:10 | - | |
| Aspire 5102WLMI Ram/ | 2022-03-28 12:10 | - | |
| Aspire 5102WLMi- 32-bit colors does not make difference/ | 2022-03-28 12:10 | - | |
| Aspire 5102WLMi - Melting/ | 2022-03-28 12:10 | - | |
| Aspire 5102WLMi Accessories/ | 2022-03-28 12:10 | - | |
| Aspire 5102WLMi BIOS Update- How/ | 2022-03-28 12:10 | - | |
| Aspire 5102 WLMi problems/ | 2022-03-28 12:10 | - | |
| Aspire 5102WLMi to Windows 7 Home Premium/ | 2022-03-28 12:10 | - | |
| Aspire 5102 WLmi 5102Wlmi Mini-Pcie Port not working detected/ | 2022-03-28 12:10 | - | |
| Aspire 5102WMLi (5100) slowdown (gpu )/ | 2022-03-28 12:10 | - | |
| Aspire 5102 bios/ | 2022-03-28 12:10 | - | |
| Aspire 5102 freezing! but only when running from battery/ | 2022-03-28 12:10 | - | |
| Aspire 5102 issues memory problems/ | 2022-03-28 12:10 | - | |
| Aspire 5102 overclock/ | 2022-03-28 12:10 | - | |
| Aspire 5102 video drivers please!!/ | 2022-03-28 12:10 | - | |
| Aspire 5103 MS Drive Problem/ | 2022-03-28 12:10 | - | |
| Aspire 5103NWLMi - upgrading RAM/ | 2022-03-28 12:10 | - | |
| Aspire 5103 Orbicam Problem - Blank Screen/ | 2022-03-28 12:10 | - | |
| Aspire 5103 Problem/ | 2022-03-28 12:10 | - | |
| Aspire 5103 Start up problems/ | 2022-03-28 12:10 | - | |
| Aspire 5103WLMi Intergrated Bluetooth Device/ | 2022-03-28 12:10 | - | |
| Aspire 5103WLMi internal mic wont work since reinstall/ | 2022-03-28 12:10 | - | |
| Aspire 5110/ | 2022-03-28 12:10 | - | |
| Aspire 5110 CPU Upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5110 shut down when resuming from standby/ | 2022-03-28 12:10 | - | |
| Aspire 5112 BIOS v. 2.60 LCD brightness issue/ | 2022-03-28 12:10 | - | |
| Aspire 5112Wlmi & Windows7/ | 2022-03-28 12:10 | - | |
| Aspire 5112 fails post, anyone know the beep codes/ | 2022-03-28 12:10 | - | |
| Aspire 5120 SD Card driver/ | 2022-03-28 12:10 | - | |
| Aspire 5135, T9xxx Vista Experience Numbers/ | 2022-03-28 12:10 | - | |
| Aspire 5251 battery only charges to 11%/ | 2022-03-28 12:10 | - | |
| Aspire 5253-BZ656 Error 0x00000052/ | 2022-03-28 12:10 | - | |
| Aspire 5310-cursor jumps over page;cant type properly/ | 2022-03-28 12:10 | - | |
| Aspire 5310/ | 2022-03-28 12:10 | - | |
| Aspire 5310 Bios Dead.. please help!/ | 2022-03-28 12:10 | - | |
| Aspire 5310 Empowering Technology/ | 2022-03-28 12:10 | - | |
| Aspire 5310 Screenshot/ | 2022-03-28 12:10 | - | |
| Aspire 5310 Totally lost ! please help !! -(/ | 2022-03-28 12:10 | - | |
| Aspire 5310 format/ | 2022-03-28 12:10 | - | |
| Aspire 5310 upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5315,volume buttons/ | 2022-03-28 12:10 | - | |
| Aspire 5315-2153 Question/ | 2022-03-28 12:10 | - | |
| Aspire 5315-2698 Upgrades/ | 2022-03-28 12:10 | - | |
| Aspire 5315-2713 battery questions/ | 2022-03-28 12:10 | - | |
| Aspire 5315-2713 wifi keeps dropping/ | 2022-03-28 12:10 | - | |
| Aspire 5315 - X3100 Memory Allocation/ | 2022-03-28 12:10 | - | |
| Aspire 5315 - music issue/ | 2022-03-28 12:10 | - | |
| Aspire 5315. Make recovery DVDs without a DVD burner/ | 2022-03-28 12:10 | - | |
| Aspire 5315/ | 2022-03-28 12:10 | - | |
| Aspire 5315 Acer eNet Management/ | 2022-03-28 12:10 | - | |
| Aspire 5315 BIOS Updating/ | 2022-03-28 12:10 | - | |
| Aspire 5315 CPU Step-by-Step Upgrade Guide/ | 2022-03-28 12:10 | - | |
| Aspire 5315 CPU Upgrade...FPS worse/ | 2022-03-28 12:10 | - | |
| Aspire 5315 CPU question/ | 2022-03-28 12:10 | - | |
| Aspire 5315 CPU upgrades and other info/ | 2022-03-28 12:10 | - | |
| Aspire 5315 External monitor/ | 2022-03-28 12:10 | - | |
| Aspire 5315 HDD Upgrade Can I install XP at the same time/ | 2022-03-28 12:10 | - | |
| Aspire 5315 HDD Upgrade With XP Home PRO. Have A Few Questions/ | 2022-03-28 12:10 | - | |
| Aspire 5315 Help/ | 2022-03-28 12:10 | - | |
| Aspire 5315 MXM graphics upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5315 New HDD wont boot/ | 2022-03-28 12:10 | - | |
| Aspire 5315 Problems/ | 2022-03-28 12:10 | - | |
| Aspire 5315 and gaming/ | 2022-03-28 12:10 | - | |
| Aspire 5315 battery problem/ | 2022-03-28 12:10 | - | |
| Aspire 5315 bios upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5315 boot problem with flash drive installed/ | 2022-03-28 12:10 | - | |
| Aspire 5315 cpu, memory upgrade, 15 mins!/ | 2022-03-28 12:10 | - | |
| Aspire 5315 dont have audio device installed/ | 2022-03-28 12:10 | - | |
| Aspire 5315 keyboard/ | 2022-03-28 12:10 | - | |
| Aspire 5315 loading issue/ | 2022-03-28 12:10 | - | |
| Aspire 5315 missing notification tray icons/ | 2022-03-28 12:10 | - | |
| Aspire 5315 optical drive upgrade is easy/ | 2022-03-28 12:10 | - | |
| Aspire 5315 partitioned hard drive/ | 2022-03-28 12:10 | - | |
| Aspire 5315 processor upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5315 service manual/ | 2022-03-28 12:10 | - | |
| Aspire 5315 touchpad doesn't have TAPPING option/ | 2022-03-28 12:10 | - | |
| Aspire 5315 touchpad pressure/ | 2022-03-28 12:10 | - | |
| Aspire 5315 upgrades/ | 2022-03-28 12:10 | - | |
| Aspire 5315 won't charge/ | 2022-03-28 12:10 | - | |
| Aspire 5315 won't power up/ | 2022-03-28 12:10 | - | |
| Aspire 5332 & WiFi Link 5100 card problem/ | 2022-03-28 12:10 | - | |
| Aspire 5332 broken screen/ | 2022-03-28 12:10 | - | |
| Aspire 5335 - cursor jumping around when typingt/ | 2022-03-28 12:10 | - | |
| Aspire 5336 numlock/ | 2022-03-28 12:10 | - | |
| Aspire 5349-2481 bad intel HD2000 or what/ | 2022-03-28 12:10 | - | |
| Aspire 5349 memory upgrade questions/ | 2022-03-28 12:10 | - | |
| Aspire 5472 Palm Rest Heat/ | 2022-03-28 12:10 | - | |
| Aspire 5504/ | 2022-03-28 12:10 | - | |
| Aspire 5515 - Broken Ethernet Jack/ | 2022-03-28 12:10 | - | |
| Aspire 5515 Challenge/ | 2022-03-28 12:10 | - | |
| Aspire 5515 drivers/ | 2022-03-28 12:10 | - | |
| Aspire 5516,5517,5532 owner w cam please reply/ | 2022-03-28 12:10 | - | |
| Aspire 5516 Reinstalling Vista hangs at completing installation/ | 2022-03-28 12:10 | - | |
| Aspire 5517-5671 ATI XP Drivers/ | 2022-03-28 12:10 | - | |
| Aspire 5517 and 5532 LCD2LED/ | 2022-03-28 12:10 | - | |
| Aspire 5517 memory/ | 2022-03-28 12:10 | - | |
| Aspire 5520-5908 LCD problem/ | 2022-03-28 12:10 | - | |
| Aspire 5520-5912/ | 2022-03-28 12:10 | - | |
| Aspire 5520-5912 Keyboard jumps/ | 2022-03-28 12:10 | - | |
| Aspire 5520-5912 Vista OS question/ | 2022-03-28 12:10 | - | |
| Aspire 5520-5912 stopped recognizing my DVD CD drive/ | 2022-03-28 12:10 | - | |
| Aspire 5520/ | 2022-03-28 12:10 | - | |
| Aspire 5520 Fan screws/ | 2022-03-28 12:10 | - | |
| Aspire 5520G question/ | 2022-03-28 12:10 | - | |
| Aspire 5520G touchpad & BIOS issue/ | 2022-03-28 12:10 | - | |
| Aspire 5520 Sound Problems/ | 2022-03-28 12:10 | - | |
| Aspire 5520 any good/ | 2022-03-28 12:10 | - | |
| Aspire 5520 blinking power & hdd diod - not start - solved/ | 2022-03-28 12:10 | - | |
| Aspire 5520 drivers/ | 2022-03-28 12:10 | - | |
| Aspire 5520g BIOS recovery/ | 2022-03-28 12:10 | - | |
| Aspire 5520 overheat/ | 2022-03-28 12:10 | - | |
| Aspire 5520 possible upgrade advice request/ | 2022-03-28 12:10 | - | |
| Aspire 5520 shutting down. NOT overheating/ | 2022-03-28 12:10 | - | |
| Aspire 5520 volume slider/ | 2022-03-28 12:10 | - | |
| Aspire 5530G/ | 2022-03-28 12:10 | - | |
| Aspire 5530G High Idle Temps/ | 2022-03-28 12:10 | - | |
| Aspire 5532 Camera Not Found/ | 2022-03-28 12:10 | - | |
| Aspire 5532 Issues With Internet Video/ | 2022-03-28 12:10 | - | |
| Aspire 5532 scrolling/ | 2022-03-28 12:10 | - | |
| Aspire 5535 LCD problem/ | 2022-03-28 12:10 | - | |
| Aspire 5535 XP Load Issue/ | 2022-03-28 12:10 | - | |
| Aspire 5536-5526 Blank Screen Sometimes/ | 2022-03-28 12:10 | - | |
| Aspire 5536 - NEW Black Screen Issue that I have never seen anywhere - HELP HELP/ | 2022-03-28 12:10 | - | |
| Aspire 5536 - Retrofit Bluetooth Module/ | 2022-03-28 12:10 | - | |
| Aspire 5536/ | 2022-03-28 12:10 | - | |
| Aspire 5536 ATI Update/ | 2022-03-28 12:10 | - | |
| Aspire 5536 BIOS Failure/ | 2022-03-28 12:10 | - | |
| Aspire 5536 Boot Problem Win7/ | 2022-03-28 12:10 | - | |
| Aspire 5536G - can't make recovery disks/ | 2022-03-28 12:10 | - | |
| Aspire 5536G and windows 7 battery problem/ | 2022-03-28 12:10 | - | |
| Aspire 5536 On board audio/ | 2022-03-28 12:10 | - | |
| Aspire 5536 and WDC Scorpio Blue temps/ | 2022-03-28 12:10 | - | |
| Aspire 5536 fan upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5538 wireless issue/ | 2022-03-28 12:10 | - | |
| Aspire 5542G no back light/ | 2022-03-28 12:10 | - | |
| Aspire 5542g Digital Audio/ | 2022-03-28 12:10 | - | |
| Aspire 5542 keyboard cleaning/ | 2022-03-28 12:10 | - | |
| Aspire 5551-2036 RAM upgrade(need help)/ | 2022-03-28 12:10 | - | |
| Aspire 5551 Bad BIOS Flash/ | 2022-03-28 12:10 | - | |
| Aspire 5551 Compatible Optical Disc Drive/ | 2022-03-28 12:10 | - | |
| Aspire 5552G Caps Lock Num Lock Volume Display Gone!/ | 2022-03-28 12:10 | - | |
| Aspire 5552G Questions (and some advice needed)/ | 2022-03-28 12:10 | - | |
| Aspire 5560 & Seagate Momentus 7200.2 ST9120823AS 120GB HDD/ | 2022-03-28 12:10 | - | |
| Aspire 5570-memory compartment/ | 2022-03-28 12:10 | - | |
| Aspire 5570/ | 2022-03-28 12:10 | - | |
| Aspire 5570ANWMi Motherboard problem..plz help/ | 2022-03-28 12:10 | - | |
| Aspire 5570 Battery problem/ | 2022-03-28 12:10 | - | |
| Aspire 5570 CPU upgrade & service manual/ | 2022-03-28 12:10 | - | |
| Aspire 5570Z- USB Flash drive not working/ | 2022-03-28 12:10 | - | |
| Aspire 5570Z New HDD/ | 2022-03-28 12:10 | - | |
| Aspire 5570Z Wireless Problems/ | 2022-03-28 12:10 | - | |
| Aspire 5570z - Can't get internal Bluetooth to work after XP install/ | 2022-03-28 12:10 | - | |
| Aspire 5570z Dissasembly Guide/ | 2022-03-28 12:10 | - | |
| Aspire 5570z dvd drive problems/ | 2022-03-28 12:10 | - | |
| Aspire 5570z touchpad/ | 2022-03-28 12:10 | - | |
| Aspire 5575G vs 5560G/ | 2022-03-28 12:10 | - | |
| Aspire 5580- BIOS only recognizes 3 out of 4GB of RAM/ | 2022-03-28 12:10 | - | |
| Aspire 5580 fan problem taking apart laptop/ | 2022-03-28 12:10 | - | |
| Aspire 5580 fan working randomly/ | 2022-03-28 12:10 | - | |
| Aspire 5583NWXMi - sound problem/ | 2022-03-28 12:10 | - | |
| Aspire 5584, bios v1.3503 support T7200,T7400,T7600 CPU/ | 2022-03-28 12:10 | - | |
| Aspire 5585WXMi Graphics card upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5585WXMi Ram error/ | 2022-03-28 12:10 | - | |
| Aspire 5590 black screen problem/ | 2022-03-28 12:10 | - | |
| Aspire 5601 AWLMi freezing/ | 2022-03-28 12:10 | - | |
| Aspire 5601 Overclocking and Undervolting/ | 2022-03-28 12:10 | - | |
| Aspire 5610-2823 Hard drive. 4200rpm or 5400rpm/ | 2022-03-28 12:10 | - | |
| Aspire 5610-4179 Orbicam and Touchpad Problems/ | 2022-03-28 12:10 | - | |
| Aspire 5610-4179 Questions/ | 2022-03-28 12:10 | - | |
| Aspire 5610-4179 slow on bootup/ | 2022-03-28 12:10 | - | |
| Aspire5610 - ATI card/ | 2022-03-28 12:11 | - | |
| Aspire 5610.Internal WLAN problem/ | 2022-03-28 12:10 | - | |
| Aspire 5610 Charging Problems/ | 2022-03-28 12:10 | - | |
| Aspire 5610 Max Ram I can Add/ | 2022-03-28 12:10 | - | |
| Aspire 5610 Orbicam Problem/ | 2022-03-28 12:10 | - | |
| Aspire 5610 Problem Shutting Down/ | 2022-03-28 12:10 | - | |
| Aspire 5610 Volume Keys Not Working/ | 2022-03-28 12:10 | - | |
| Aspire 5610Z-2273 Video Stutter/ | 2022-03-28 12:11 | - | |
| Aspire 5610Z - camera and media control keys not working/ | 2022-03-28 12:11 | - | |
| Aspire 5610Z Hard Drive HDD Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5610Z Restore Disc/ | 2022-03-28 12:11 | - | |
| Aspire 5610Z lags when downloading/ | 2022-03-28 12:11 | - | |
| Aspire 5610Z touchpad with Win7/ | 2022-03-28 12:11 | - | |
| Aspire 5610Z wireless network connection issue/ | 2022-03-28 12:11 | - | |
| Aspire 5610 audio problems/ | 2022-03-28 12:10 | - | |
| Aspire 5610 memory upgrade/ | 2022-03-28 12:10 | - | |
| Aspire 5610 unknown devices/ | 2022-03-28 12:10 | - | |
| Aspire 5610z (T2060)/ | 2022-03-28 12:10 | - | |
| Aspire 5610z/ | 2022-03-28 12:10 | - | |
| Aspire 5610z Keyboard Mouse Problem/ | 2022-03-28 12:11 | - | |
| Aspire 5610z graphics chipset/ | 2022-03-28 12:11 | - | |
| Aspire 5612/ | 2022-03-28 12:11 | - | |
| Aspire 5612ZWLMi/ | 2022-03-28 12:11 | - | |
| Aspire 5612z memory upgrade problems resolved/ | 2022-03-28 12:11 | - | |
| Aspire 5613 wifi upgrade problem/ | 2022-03-28 12:11 | - | |
| Aspire 5630 + Mac OSX (Tiger)/ | 2022-03-28 12:11 | - | |
| Aspire 5630, how do I install the tv-tuner/ | 2022-03-28 12:11 | - | |
| Aspire 5630-6288- Media Buttons not working in XP/ | 2022-03-28 12:11 | - | |
| Aspire 5630 - Unexpected shutdown!!/ | 2022-03-28 12:11 | - | |
| Aspire 5630 BATTERY software needed/ | 2022-03-28 12:11 | - | |
| Aspire 5630 Graphics Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5630 Media Buttons - how to remap/ | 2022-03-28 12:11 | - | |
| Aspire 5630 Recovery - no dvd's, alt f10 not working/ | 2022-03-28 12:11 | - | |
| Aspire 5630 Sound Stopped Working - In-Build Conexant Modem/ | 2022-03-28 12:11 | - | |
| Aspire 5630 Upgrades/ | 2022-03-28 12:11 | - | |
| Aspire 5630 Vista problem as well as eRecovery!/ | 2022-03-28 12:11 | - | |
| Aspire 5630 and bluetooth headset/ | 2022-03-28 12:11 | - | |
| Aspire 5630 buzzing sound/ | 2022-03-28 12:11 | - | |
| Aspire 5630 missing power icons in taskbar/ | 2022-03-28 12:11 | - | |
| Aspire 5630 with Vista won't Sleep... HELP!/ | 2022-03-28 12:11 | - | |
| Aspire 5632WLMi - Prob with media keys/ | 2022-03-28 12:11 | - | |
| Aspire 5633 - lights blink, won't boot/ | 2022-03-28 12:11 | - | |
| Aspire 5633WLMI Screen Problem too dark/ | 2022-03-28 12:11 | - | |
| Aspire 5633 WLMi- Replacing the wifi card/ | 2022-03-28 12:11 | - | |
| Aspire 5633WLMi Auto restart Please help!/ | 2022-03-28 12:11 | - | |
| Aspire 5634 'Fn+F5' stopped working/ | 2022-03-28 12:11 | - | |
| Aspire 5634LMi overheats and switches itself off/ | 2022-03-28 12:11 | - | |
| Aspire 5635WLMI feedback please/ | 2022-03-28 12:11 | - | |
| Aspire 5650/ | 2022-03-28 12:11 | - | |
| Aspire 5670's PCMCIA port not working in Vista/ | 2022-03-28 12:11 | - | |
| Aspire 5670- Keyboard or controller dead/ | 2022-03-28 12:11 | - | |
| Aspire 5670 - USB problems/ | 2022-03-28 12:11 | - | |
| Aspire 5670 5672 dead after BIOS update/ | 2022-03-28 12:11 | - | |
| Aspire 5670 Hardisk upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5670 LAN Driver for XP/ | 2022-03-28 12:11 | - | |
| Aspire 5670 Orbicam/ | 2022-03-28 12:11 | - | |
| Aspire 5670 SCREEN/ | 2022-03-28 12:10 | - | |
| Aspire 5670 System CD/ | 2022-03-28 12:11 | - | |
| Aspire 5670 T7300/ | 2022-03-28 12:11 | - | |
| Aspire 5670 and Core 2 Duo/ | 2022-03-28 12:11 | - | |
| Aspire 5670 dvd recovery/ | 2022-03-28 12:11 | - | |
| Aspire 5670 quick infos/ | 2022-03-28 12:11 | - | |
| Aspire 5670 series with 256mb gpu/ | 2022-03-28 12:11 | - | |
| Aspire 5670 starts but does nothing/ | 2022-03-28 12:11 | - | |
| Aspire 5670 with weird specs -/ | 2022-03-28 12:11 | - | |
| Aspire 5670 won't POST/ | 2022-03-28 12:11 | - | |
| Aspire 5672, Upgrades Overclocking & Undervolting/ | 2022-03-28 12:11 | - | |
| Aspire 5672, converting to NTFS format/ | 2022-03-28 12:11 | - | |
| Aspire 5672, converting to NTFS or keep FAT32/ | 2022-03-28 12:11 | - | |
| Aspire 5672 -- Missing driver/ | 2022-03-28 12:11 | - | |
| Aspire 5672 - ATI driver update/ | 2022-03-28 12:11 | - | |
| Aspire 5672 - No Ports in Device Manager - HuAwei E169G USB Modem/ | 2022-03-28 12:11 | - | |
| Aspire 5672 - No Power, No Lights, Nothing/ | 2022-03-28 12:11 | - | |
| Aspire 5672 - Overclocks Clocks - X1400 X1600/ | 2022-03-28 12:11 | - | |
| Aspire 5672 - Unknown Device in Device Manager/ | 2022-03-28 12:11 | - | |
| Aspire 5672/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Bluetooth phone charger/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Fan is making noise!/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Faulty/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Hard Drive Upgrde/ | 2022-03-28 12:11 | - | |
| Aspire 5672 LCD issue/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Memory Test Fail with Gold Memorey/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Motherboard broken.. !!/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Problem/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Processor support/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Video Driver/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Vista ATI Drivers/ | 2022-03-28 12:11 | - | |
| Aspire 5672WLMI -HELP-need Recovery dvd/ | 2022-03-28 12:11 | - | |
| Aspire 5672WLMI memory upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5672WLMi BIOS Password and Standby Problem/ | 2022-03-28 12:11 | - | |
| Aspire 5672WLMi Main Board Replacement/ | 2022-03-28 12:11 | - | |
| Aspire 5672 WLMi drivers/ | 2022-03-28 12:11 | - | |
| Aspire 5672WLMi fails to power up/ | 2022-03-28 12:11 | - | |
| Aspire 5672WLMi hardware problem/ | 2022-03-28 12:11 | - | |
| Aspire 5672WLMi keyboard problem/ | 2022-03-28 12:11 | - | |
| Aspire 5672 WLi- Blue screen after Vista Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Wifi external switch questions/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Windows Setup Problem/ | 2022-03-28 12:11 | - | |
| Aspire 5672 Windows problem/ | 2022-03-28 12:11 | - | |
| Aspire 5672 battery dead/ | 2022-03-28 12:11 | - | |
| Aspire 5672 benchmark/ | 2022-03-28 12:11 | - | |
| Aspire 5672 from CompUSA/ | 2022-03-28 12:11 | - | |
| Aspire 5672 made even faster/ | 2022-03-28 12:11 | - | |
| Aspire 5672 orbicam and USB ports out/ | 2022-03-28 12:11 | - | |
| Aspire 5672 owners, proove me wrong/ | 2022-03-28 12:11 | - | |
| Aspire 5672 power indicator always light on/ | 2022-03-28 12:11 | - | |
| Aspire 5672 questions - DVD player and OSD/ | 2022-03-28 12:11 | - | |
| Aspire 5672 questions/ | 2022-03-28 12:11 | - | |
| Aspire 5672 ram/ | 2022-03-28 12:11 | - | |
| Aspire 5672 to an older KVM (with PS 2 ports )/ | 2022-03-28 12:11 | - | |
| Aspire 5672 with 2gb of 982 MHz ram/ | 2022-03-28 12:11 | - | |
| Aspire 5672 with RAM upgrade problem/ | 2022-03-28 12:11 | - | |
| Aspire 5672 with x1600 really low volume/ | 2022-03-28 12:11 | - | |
| Aspire 5672wlmi/ | 2022-03-28 12:11 | - | |
| Aspire 5672wlmi screen questions/ | 2022-03-28 12:11 | - | |
| Aspire 5680 - I need to install eRecovery Management/ | 2022-03-28 12:11 | - | |
| Aspire 5680- Wi-Fi Problem/ | 2022-03-28 12:11 | - | |
| Aspire 5680 - battery/ | 2022-03-28 12:11 | - | |
| Aspire 5680 Power Brick Question/ | 2022-03-28 12:11 | - | |
| Aspire 5680 availability/ | 2022-03-28 12:11 | - | |
| Aspire 5682 overheating after clean XP install/ | 2022-03-28 12:11 | - | |
| Aspire 5683wlmi/ | 2022-03-28 12:11 | - | |
| Aspire 5685 (new) ... uninstalling acer empowerment programs and cr pware/ | 2022-03-28 12:11 | - | |
| Aspire 5685-wlmi won't run on battery. Help appreciated/ | 2022-03-28 12:11 | - | |
| Aspire 5685WLMi Problem/ | 2022-03-28 12:11 | - | |
| Aspire 5710 (A few problems)/ | 2022-03-28 12:11 | - | |
| Aspire 5710 5715 mistery(at least for me)/ | 2022-03-28 12:11 | - | |
| Aspire 5710 Help to take apart/ | 2022-03-28 12:11 | - | |
| Aspire 5710 downgrade to WinXP/ | 2022-03-28 12:11 | - | |
| Aspire 5710g BIG bios problem/ | 2022-03-28 12:11 | - | |
| Aspire 5715z/ | 2022-03-28 12:11 | - | |
| Aspire 5720-4230/ | 2022-03-28 12:11 | - | |
| Aspire 5720-6113 drivers/ | 2022-03-28 12:11 | - | |
| Aspire 5720 - ALPS touchpad not working/ | 2022-03-28 12:11 | - | |
| Aspire 5720 - Light leakedge/ | 2022-03-28 12:11 | - | |
| Aspire 5720 - Windows 7/ | 2022-03-28 12:11 | - | |
| Aspire 5720 Bios/ | 2022-03-28 12:11 | - | |
| Aspire 5720G 's wake up from sleep problem on Win 7/ | 2022-03-28 12:11 | - | |
| Aspire 5720G Win 7 Hibernate problem/ | 2022-03-28 12:11 | - | |
| Aspire 5720Z to XP/ | 2022-03-28 12:11 | - | |
| Aspire 5720Z with 9600M GS - problem/ | 2022-03-28 12:11 | - | |
| Aspire 5720 dissassembly!/ | 2022-03-28 12:11 | - | |
| Aspire 5720 expresscard XP drivers/ | 2022-03-28 12:11 | - | |
| Aspire 5720g vs Nvidia Geforce 9600m GT 512mb DDR3/ | 2022-03-28 12:11 | - | |
| Aspire 5720g with a defect vga card/ | 2022-03-28 12:11 | - | |
| Aspire 5720 hangs after Vista updates/ | 2022-03-28 12:11 | - | |
| Aspire 5720 help/ | 2022-03-28 12:11 | - | |
| Aspire 5720 no longer receiving power/ | 2022-03-28 12:11 | - | |
| Aspire 5720z - 4gb ram/ | 2022-03-28 12:11 | - | |
| Aspire 5720z HDD help!/ | 2022-03-28 12:11 | - | |
| Aspire 5720zg GPU heat problem/ | 2022-03-28 12:11 | - | |
| Aspire 5730z 5330 series model no ms2235/ | 2022-03-28 12:11 | - | |
| Aspire 5732ZG cpu upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5732ZG memory upgrade 4GB/ | 2022-03-28 12:11 | - | |
| Aspire 5732Z Touchpad locked/ | 2022-03-28 12:11 | - | |
| Aspire 5732Z powers on then right off/ | 2022-03-28 12:11 | - | |
| Aspire 5733 SD MMC drivers/ | 2022-03-28 12:11 | - | |
| Aspire 5734z Video/ | 2022-03-28 12:11 | - | |
| Aspire 5735-6694 CPU Replacing/ | 2022-03-28 12:11 | - | |
| Aspire 5735 5335 ms2253/ | 2022-03-28 12:11 | - | |
| Aspire 5735 Bluetooth module/ | 2022-03-28 12:11 | - | |
| Aspire 5735 Hibernates shortly after resuming from hibernation/ | 2022-03-28 12:11 | - | |
| Aspire 5735Z Acer Crystal Eye Doesn't Work, HELP/ | 2022-03-28 12:11 | - | |
| Aspire 5735Z no sound with DVDs/ | 2022-03-28 12:11 | - | |
| Aspire 5735 model known bugs/ | 2022-03-28 12:11 | - | |
| Aspire 5735z power cycling/ | 2022-03-28 12:11 | - | |
| Aspire 5735z touchpad problem/ | 2022-03-28 12:11 | - | |
| Aspire 5737z Bios Mod problem/ | 2022-03-28 12:11 | - | |
| Aspire 5738 -/ | 2022-03-28 12:11 | - | |
| Aspire 5738 - keyboard and touchpad stops working after resume from sleep/ | 2022-03-28 12:11 | - | |
| Aspire 5738 1600x900 screen/ | 2022-03-28 12:11 | - | |
| Aspire 5738G - 800MHz CPU FSB but 1066MHz DDR3 RAM !!!!/ | 2022-03-28 12:11 | - | |
| Aspire 5738G problems/ | 2022-03-28 12:11 | - | |
| Aspire 5738Z - How to lock keyboard pls/ | 2022-03-28 12:11 | - | |
| Aspire 5738ZG CPU upgrade options/ | 2022-03-28 12:11 | - | |
| Aspire 5738ZG RAM issue/ | 2022-03-28 12:11 | - | |
| Aspire 5738g no Post/ | 2022-03-28 12:11 | - | |
| Aspire 5738 keyboard repair/ | 2022-03-28 12:11 | - | |
| Aspire 5738 stuck at log off screen/ | 2022-03-28 12:11 | - | |
| Aspire 5738z cooling fan runs long when on battery with custom low power scheme/ | 2022-03-28 12:11 | - | |
| Aspire 5738zg overheating. LG monitor possible issue/ | 2022-03-28 12:11 | - | |
| Aspire 5739G-6132/ | 2022-03-28 12:11 | - | |
| Aspire 5739G/ | 2022-03-28 12:11 | - | |
| Aspire 5739G BT upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5739G Ploblems/ | 2022-03-28 12:11 | - | |
| Aspire 5739G and FirePro M5950/ | 2022-03-28 12:11 | - | |
| Aspire 5739G eSata Port Multiplication/ | 2022-03-28 12:11 | - | |
| Aspire 5739G will not run games! Help!/ | 2022-03-28 12:11 | - | |
| Aspire 5739g dos bios flash sos/ | 2022-03-28 12:11 | - | |
| Aspire 5739g speakers crackle/ | 2022-03-28 12:11 | - | |
| Aspire 5740, what's this open bay/ | 2022-03-28 12:11 | - | |
| Aspire 5740-5513 Installing a Bluetooth Card/ | 2022-03-28 12:11 | - | |
| Aspire 5740 5340 Series Charger Died/ | 2022-03-28 12:11 | - | |
| Aspire 5740G/ | 2022-03-28 12:11 | - | |
| Aspire 5740G bluetooth not staying on/ | 2022-03-28 12:11 | - | |
| Aspire 5740G trackpad unresposive/ | 2022-03-28 12:11 | - | |
| Aspire 5740G upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5740 Touch Pad Inquiry/ | 2022-03-28 12:11 | - | |
| Aspire 5740g optical bay hdd caddy size/ | 2022-03-28 12:11 | - | |
| Aspire 5741 Disassembly Help/ | 2022-03-28 12:11 | - | |
| Aspire 5741G freezing problem/ | 2022-03-28 12:11 | - | |
| Aspire 5741 HDMI and Wireless/ | 2022-03-28 12:11 | - | |
| Aspire 5741 and bluetooth/ | 2022-03-28 12:11 | - | |
| Aspire 5741z - can't set up, blank screen/ | 2022-03-28 12:11 | - | |
| Aspire 5742-7551 - No better than a 6 cell battery/ | 2022-03-28 12:11 | - | |
| Aspire 5742G, anyone bought one Thoughts etc/ | 2022-03-28 12:11 | - | |
| Aspire 5742 crackly sound/ | 2022-03-28 12:11 | - | |
| Aspire 5742g blank screen after turning off HyperThreading/ | 2022-03-28 12:11 | - | |
| Aspire 5742 no power issue/ | 2022-03-28 12:11 | - | |
| Aspire 5742 problem w restoring to original settings/ | 2022-03-28 12:11 | - | |
| Aspire 5742zg overheat/ | 2022-03-28 12:11 | - | |
| Aspire 5745G- Anything to watch out for before buying/ | 2022-03-28 12:11 | - | |
| Aspire 5745G Disaster- request BIOS!/ | 2022-03-28 12:11 | - | |
| Aspire 5745G Fan replacement/ | 2022-03-28 12:11 | - | |
| Aspire 5745G Has LCD Issue/ | 2022-03-28 12:11 | - | |
| Aspire 5745G manually CPU FAN control !/ | 2022-03-28 12:11 | - | |
| Aspire 5745g video bios/ | 2022-03-28 12:11 | - | |
| Aspire 5747-7789 Network Adapter/ | 2022-03-28 12:11 | - | |
| Aspire 5749 Memory Upgrade Help/ | 2022-03-28 12:11 | - | |
| Aspire 5750 5750G backlit keys/ | 2022-03-28 12:11 | - | |
| Aspire 5750G Review/ | 2022-03-28 12:11 | - | |
| Aspire 5750 ethernet light blinks when plugging power in/ | 2022-03-28 12:11 | - | |
| Aspire 5750g - Upgrading from 8 to 16GB of RAM/ | 2022-03-28 12:11 | - | |
| Aspire 5750g Temps/ | 2022-03-28 12:11 | - | |
| Aspire 5750 motherboard ((gpu ) fails/ | 2022-03-28 12:11 | - | |
| Aspire 5755G i3 Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5755g Overheating/ | 2022-03-28 12:11 | - | |
| Aspire 5810T, bluetooth turned off by default at startup/ | 2022-03-28 12:11 | - | |
| Aspire 5810TG + Win7 64bit problem/ | 2022-03-28 12:11 | - | |
| Aspire 5810TG laptop Win XP/ | 2022-03-28 12:11 | - | |
| Aspire 5810T Recovery CD DVD/ | 2022-03-28 12:11 | - | |
| Aspire 5810TZ-4657/ | 2022-03-28 12:11 | - | |
| Aspire 5810TZ HDMI port/ | 2022-03-28 12:11 | - | |
| Aspire 5810T not turning on, but still charging/ | 2022-03-28 12:11 | - | |
| Aspire 5820TG Stuttering issue/ | 2022-03-28 12:11 | - | |
| Aspire 5920-6864 CPU Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5920-6864 CPU and Ram Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5920- Battery indicator blinking/ | 2022-03-28 12:11 | - | |
| Aspire 5920 - Best way to upgrade to Ultimate/ | 2022-03-28 12:11 | - | |
| Aspire 5920 - Buzzing Power Supply/ | 2022-03-28 12:11 | - | |
| Aspire 5920 - Drivers Windows Xp 64bits/ | 2022-03-28 12:11 | - | |
| Aspire 5920 - MXM/ | 2022-03-28 12:11 | - | |
| Aspire 5920 - Media touch keys stopped working after installing Windows updates/ | 2022-03-28 12:11 | - | |
| Aspire 5920- What Temps are High/ | 2022-03-28 12:11 | - | |
| Aspire 5920 - uncomfortable warm palm rest/ | 2022-03-28 12:11 | - | |
| Aspire 5920/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Blue Power LED Became Amber/ | 2022-03-28 12:11 | - | |
| Aspire 5920 CPU Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Easy Launch Problem/ | 2022-03-28 12:11 | - | |
| Aspire 5920G + GF 9600M GS DDR2 512MB. Will it work/ | 2022-03-28 12:11 | - | |
| Aspire 5920G-Drivers for the 8600M GT/ | 2022-03-28 12:11 | - | |
| Aspire 5920G - Problem with the powerbutton and the time!/ | 2022-03-28 12:11 | - | |
| Aspire 5920G - Recovery Disk, D drive questions and restore points/ | 2022-03-28 12:11 | - | |
| Aspire 5920G 9650m GT problem/ | 2022-03-28 12:11 | - | |
| Aspire 5920G = Aspire 5920G-302G16Mi/ | 2022-03-28 12:11 | - | |
| Aspire 5920G Board Specifications/ | 2022-03-28 12:11 | - | |
| Aspire 5920G DVD-ROM Drive Read Error/ | 2022-03-28 12:11 | - | |
| Aspire5920G GPU Upgrade, wich card do i need/ | 2022-03-28 12:11 | - | |
| Aspire 5920G Hard Drive D/ | 2022-03-28 12:11 | - | |
| Aspire 5920G Never allow me to enable HDD write cache/ | 2022-03-28 12:11 | - | |
| Aspire 5920G OMG My hard Crash Without Notice/ | 2022-03-28 12:11 | - | |
| Aspire 5920G Problems/ | 2022-03-28 12:11 | - | |
| Aspire 5920G Wireless Problem/ | 2022-03-28 12:11 | - | |
| Aspire 5920G and ATI 3650 1Gb DDR2/ | 2022-03-28 12:11 | - | |
| Aspire 5920G compatible RAM/ | 2022-03-28 12:11 | - | |
| Aspire 5920G not enuf memory issue/ | 2022-03-28 12:11 | - | |
| Aspire 5920G or 7720G - Same price, some big differences/ | 2022-03-28 12:11 | - | |
| Aspire 5920G running hot/ | 2022-03-28 12:11 | - | |
| Aspire 5920G screen problems after replacing 8600M GT/ | 2022-03-28 12:11 | - | |
| Aspire 5920G won't turn on/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Infrared Port/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Left keys not working!!!!/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Media Keys/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Memory problem/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Problems/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Replacement Screen/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Upgrade Question t54 to T7300/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Vista hibernation problem/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Webcam Not Found/ | 2022-03-28 12:11 | - | |
| Aspire 5920 Windows 7 Freezing/ | 2022-03-28 12:11 | - | |
| Aspire 5920 and I am Beyond Confused!!/ | 2022-03-28 12:11 | - | |
| Aspire 5920 backup battery/ | 2022-03-28 12:11 | - | |
| Aspire 5920 backup problem/ | 2022-03-28 12:11 | - | |
| Aspire 5920 closing the lid/ | 2022-03-28 12:11 | - | |
| Aspire 5920 crashes after sleep mode/ | 2022-03-28 12:11 | - | |
| Aspire 5920 eAudio default setting/ | 2022-03-28 12:11 | - | |
| Aspire 5920 experiences so for/ | 2022-03-28 12:11 | - | |
| Aspire 5920 freezing/ | 2022-03-28 12:11 | - | |
| Aspire 5920g- Firmware for Optiarc BC-5500A/ | 2022-03-28 12:11 | - | |
| Aspire 5920g- New WiFi Intel Link 5300/ | 2022-03-28 12:11 | - | |
| Aspire 5920g Bluetooth Problems/ | 2022-03-28 12:11 | - | |
| Aspire 5920g DVD Drive/ | 2022-03-28 12:11 | - | |
| Aspire 5920g Fixed Finally/ | 2022-03-28 12:11 | - | |
| Aspire 5920g Vista crash after 4 months!/ | 2022-03-28 12:11 | - | |
| Aspire 5920g upgrade graphic card problem/ | 2022-03-28 12:11 | - | |
| Aspire 5920g with Windows 7/ | 2022-03-28 12:11 | - | |
| Aspire 5920g xp version cannot enter stanby mode/ | 2022-03-28 12:11 | - | |
| Aspire 5920 hidden partitions/ | 2022-03-28 12:11 | - | |
| Aspire 5920 media buttons/ | 2022-03-28 12:11 | - | |
| Aspire 5920 media keys - PLEASE HELP/ | 2022-03-28 12:11 | - | |
| Aspire 5920 middle scroll button not working/ | 2022-03-28 12:11 | - | |
| Aspire 5920 slow launch buttons/ | 2022-03-28 12:11 | - | |
| Aspire 5920 speakers crackle and screen flickers when lid open and closed/ | 2022-03-28 12:11 | - | |
| Aspire 5920 speakers stopped working/ | 2022-03-28 12:11 | - | |
| Aspire 5920 touchpad OS issue/ | 2022-03-28 12:11 | - | |
| Aspire 5920 wireless issue/ | 2022-03-28 12:11 | - | |
| Aspire 5920 xp drivers here/ | 2022-03-28 12:11 | - | |
| Aspire 5922 issue/ | 2022-03-28 12:11 | - | |
| Aspire 5930 Arcade InstantOn partition problem/ | 2022-03-28 12:11 | - | |
| Aspire 5930g and c2d t8100/ | 2022-03-28 12:11 | - | |
| Aspire 5935G Power Issue/ | 2022-03-28 12:11 | - | |
| Aspire 5935G Windows 7 hibernate wake up problem/ | 2022-03-28 12:11 | - | |
| Aspire 5935G bios fault/ | 2022-03-28 12:11 | - | |
| Aspire 5935G drivers/ | 2022-03-28 12:11 | - | |
| Aspire 5935g graphics upgrade - driver problems/ | 2022-03-28 12:11 | - | |
| Aspire 5935g with FirePro m5950 6770m/ | 2022-03-28 12:11 | - | |
| Aspire 5943 WEI Score/ | 2022-03-28 12:11 | - | |
| Aspire 6390g 8gb...really !/ | 2022-03-28 12:11 | - | |
| Aspire 6530 Eating AC adapters/ | 2022-03-28 12:11 | - | |
| Aspire 6530G - to IGP or not to IGP/ | 2022-03-28 12:11 | - | |
| Aspire 6530G Breaking for parts/ | 2022-03-28 12:11 | - | |
| Aspire 6530G flashing BIOS/ | 2022-03-28 12:11 | - | |
| Aspire 6530G start up issue/ | 2022-03-28 12:11 | - | |
| Aspire 6530 and XP/ | 2022-03-28 12:11 | - | |
| Aspire 6530 which restarts loop/ | 2022-03-28 12:11 | - | |
| Aspire 6920(G) DVD drive replacement/ | 2022-03-28 12:11 | - | |
| Aspire 6920 - turn off touch pad after HD replacement/ | 2022-03-28 12:11 | - | |
| Aspire 6920 2.1 audio system/ | 2022-03-28 12:11 | - | |
| Aspire 6920 Can't connect internet via ethernet/ | 2022-03-28 12:11 | - | |
| Aspire 6920 Dolby audio problem/ | 2022-03-28 12:11 | - | |
| Aspire 6920 Downgrading to XP - Help!/ | 2022-03-28 12:11 | - | |
| Aspire 6920G - Part Time brick/ | 2022-03-28 12:11 | - | |
| Aspire 6920G - internet problem/ | 2022-03-28 12:11 | - | |
| Aspire 6920G - which parts to upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 6920G/ | 2022-03-28 12:11 | - | |
| Aspire 6920G BIOS Update & Miracle/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Bluetooth/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Bluetooth and Blu-ray issues/ | 2022-03-28 12:11 | - | |
| Aspire 6920G CPU upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Concerns/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Cooling Solution!/ | 2022-03-28 12:11 | - | |
| Aspire 6920G DVD Drive/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Gemstone Blue/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Heat Issue/ | 2022-03-28 12:11 | - | |
| Aspire 6920G LCD issues (most issues ruled out)/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Problem/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Service Guide/ | 2022-03-28 12:11 | - | |
| Aspire 6920G Windows XP Major Problem!/ | 2022-03-28 12:11 | - | |
| Aspire 6920G keyboard/ | 2022-03-28 12:11 | - | |
| Aspire 6920G overheating after Windows 7 install/ | 2022-03-28 12:11 | - | |
| Aspire 6920G questions/ | 2022-03-28 12:11 | - | |
| Aspire 6920G randomly shuts down/ | 2022-03-28 12:11 | - | |
| Aspire 6920G screensaver/ | 2022-03-28 12:11 | - | |
| Aspire 6920G shutting down/ | 2022-03-28 12:11 | - | |
| Aspire 6920 Speaker Sound System/ | 2022-03-28 12:11 | - | |
| Aspire 6920 charging problems/ | 2022-03-28 12:11 | - | |
| Aspire 6920g's having problem during gaming!!!/ | 2022-03-28 12:11 | - | |
| Aspire6920g/ | 2022-03-28 12:11 | - | |
| Aspire 6920g CPU gone mad..Please Help/ | 2022-03-28 12:11 | - | |
| Aspire 6920g doesn't boot after bios flash failed/ | 2022-03-28 12:11 | - | |
| Aspire 6920g fan control And external GPU question/ | 2022-03-28 12:11 | - | |
| Aspire 6920g gaming issues/ | 2022-03-28 12:11 | - | |
| Aspire 6920g not working properly/ | 2022-03-28 12:11 | - | |
| Aspire 6920g restarting freezing/ | 2022-03-28 12:11 | - | |
| Aspire 6920 problems/ | 2022-03-28 12:11 | - | |
| Aspire 6920 screen flicker in games/ | 2022-03-28 12:11 | - | |
| Aspire 6930 (Two HDD )/ | 2022-03-28 12:11 | - | |
| Aspire 6930-6235 - broken LCD - upgrade option/ | 2022-03-28 12:11 | - | |
| Aspire 6930-6235 new LCD, worked, then rainbows/ | 2022-03-28 12:11 | - | |
| Aspire 6930 - Vista won't startup/ | 2022-03-28 12:11 | - | |
| Aspire 6930/ | 2022-03-28 12:11 | - | |
| Aspire 6930 2nd harddrive/ | 2022-03-28 12:11 | - | |
| Aspire 6930G + Windows 7 64bit Sound Issue/ | 2022-03-28 12:11 | - | |
| Aspire 6930G, Screen problem/ | 2022-03-28 12:11 | - | |
| Aspire 6930G, Windows 7 upgrade (but no drivers)/ | 2022-03-28 12:11 | - | |
| Aspire 6930G - Black Screen - No Video Output and Cannot access BIOS/ | 2022-03-28 12:11 | - | |
| Aspire 6930G- Can't boot from bootable Win 8 USB, I get bootmgr image is corrupt/ | 2022-03-28 12:11 | - | |
| Aspire 6930 G/ | 2022-03-28 12:11 | - | |
| Aspire 6930G 5.1 Analog Output/ | 2022-03-28 12:11 | - | |
| Aspire 6930G BIOS restore after failed flash/ | 2022-03-28 12:11 | - | |
| Aspire 6930G Backlight microswitch/ | 2022-03-28 12:11 | - | |
| Aspire 6930G Enter acts as numpad enter. Need help please/ | 2022-03-28 12:11 | - | |
| Aspire 6930 G HDD Replacement/ | 2022-03-28 12:11 | - | |
| Aspire 6930G Internet connectivity/ | 2022-03-28 12:11 | - | |
| Aspire 6930G Keyboard Mouse stopped working/ | 2022-03-28 12:11 | - | |
| Aspire 6930G Upgrade - GPU and CPU/ | 2022-03-28 12:11 | - | |
| Aspire 6930G easy-launch buttons/ | 2022-03-28 12:11 | - | |
| Aspire 6930G hardware (suspecting battery) issues/ | 2022-03-28 12:11 | - | |
| Aspire 6930G help needed!/ | 2022-03-28 12:11 | - | |
| Aspire 6930G keyboard problem/ | 2022-03-28 12:11 | - | |
| Aspire 6930G won't play GTA 4 disc HELP/ | 2022-03-28 12:11 | - | |
| Aspire 6930 Internal Mic/ | 2022-03-28 12:11 | - | |
| Aspire 6930 Password Jumper/ | 2022-03-28 12:11 | - | |
| Aspire 6930 Questions/ | 2022-03-28 12:11 | - | |
| Aspire 6930 Speaker Distortion/ | 2022-03-28 12:11 | - | |
| Aspire 6930 TUBA problem/ | 2022-03-28 12:11 | - | |
| Aspire 6930 XP Drivers/ | 2022-03-28 12:11 | - | |
| Aspire 6930 external inputs not working/ | 2022-03-28 12:11 | - | |
| Aspire 6930g 1080p/ | 2022-03-28 12:11 | - | |
| Aspire 6930g and Mobility Ati HD4670- Possibile/ | 2022-03-28 12:11 | - | |
| Aspire 6930g volume touch key automatically and continuously turns the volume down/ | 2022-03-28 12:11 | - | |
| Aspire 6930 upgrade to 9600m gt MXM-II/ | 2022-03-28 12:11 | - | |
| Aspire 6935 Bios Recovery/ | 2022-03-28 12:11 | - | |
| Aspire 6935G & Windows 7/ | 2022-03-28 12:11 | - | |
| Aspire 6935G - Different Motherboard Versions/ | 2022-03-28 12:11 | - | |
| Aspire 6935G- Memory Speed issue (CPU-Z)/ | 2022-03-28 12:11 | - | |
| Aspire 6935G - Performances, Benchmark, Heat, Drivers/ | 2022-03-28 12:11 | - | |
| Aspire6935G - a new bios ver 1.13/ | 2022-03-28 12:11 | - | |
| Aspire 6935G disable green volume bar/ | 2022-03-28 12:11 | - | |
| Aspire 6935G power problem!!/ | 2022-03-28 12:11 | - | |
| Aspire 6935 TV Tuner Driver and Model/ | 2022-03-28 12:11 | - | |
| Aspire 6935 build quality/ | 2022-03-28 12:11 | - | |
| Aspire 6935g Volume control not working/ | 2022-03-28 12:11 | - | |
| Aspire 6935g bluray drive wont let laptop turn on/ | 2022-03-28 12:11 | - | |
| Aspire 7004WSMi/ | 2022-03-28 12:11 | - | |
| Aspire 7220g Problems/ | 2022-03-28 12:11 | - | |
| Aspire 7520-5168 screen goes black/ | 2022-03-28 12:11 | - | |
| Aspire 7520-5185 - WIFI Hell after 4gb ram upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 7520 - will not start or then will not shut off/ | 2022-03-28 12:11 | - | |
| Aspire 7520 17 GemStone/ | 2022-03-28 12:11 | - | |
| Aspire 7520 Card Reader problem on Windows 2003/ | 2022-03-28 12:11 | - | |
| Aspire 7520G - no sound in the headphones/ | 2022-03-28 12:11 | - | |
| Aspire 7520G BIOS recovery/ | 2022-03-28 12:11 | - | |
| Aspire 7520G CPU Problem/ | 2022-03-28 12:11 | - | |
| Aspire 7520G Overheating Lagging/ | 2022-03-28 12:11 | - | |
| Aspire 7520G Vista 32 Home to Windows 7 32b or 64b/ | 2022-03-28 12:11 | - | |
| Aspire 7520 Windows 7 drivers question/ | 2022-03-28 12:11 | - | |
| Aspire 7520 and 7-pin mini din/ | 2022-03-28 12:11 | - | |
| Aspire 7520 chipset drivers/ | 2022-03-28 12:11 | - | |
| Aspire 7520 digital out does not work on Vista 64/ | 2022-03-28 12:11 | - | |
| Aspire 7520 project/ | 2022-03-28 12:11 | - | |
| Aspire 7520 shuts down while streaming vids/ | 2022-03-28 12:11 | - | |
| Aspire 7520 with external monitor and laptop lid closed/ | 2022-03-28 12:11 | - | |
| Aspire 7530G heat issue/ | 2022-03-28 12:11 | - | |
| Aspire 7530 cpu gpu upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 7535- Anyone know about the wrong CPU being put into the box/ | 2022-03-28 12:11 | - | |
| Aspire 7535 - Upg CPU/ | 2022-03-28 12:11 | - | |
| Aspire 7535 Battery`/ | 2022-03-28 12:11 | - | |
| Aspire 7535G - VGA Driver update problem/ | 2022-03-28 12:11 | - | |
| Aspire 7540-1284/ | 2022-03-28 12:11 | - | |
| Aspire 7540 Blu-ray play not working-sound familiar/ | 2022-03-28 12:11 | - | |
| Aspire 7540g upgrade questions/ | 2022-03-28 12:11 | - | |
| Aspire 7540 with Non-Working BluRay Drive/ | 2022-03-28 12:11 | - | |
| Aspire 7551G Keyboard removal/ | 2022-03-28 12:11 | - | |
| Aspire 7551 battery depleted, no display/ | 2022-03-28 12:11 | - | |
| Aspire 7552g-6061 Fails to POST unless hot/ | 2022-03-28 12:11 | - | |
| Aspire 7720(z)-3040 possible upgrade path/ | 2022-03-28 12:11 | - | |
| Aspire 7720-4799/ | 2022-03-28 12:11 | - | |
| Aspire 7720-6395 Questions/ | 2022-03-28 12:11 | - | |
| Aspire 7720-6640, 4650 MXM Upgrade Issues, Help Appreciated!/ | 2022-03-28 12:11 | - | |
| Aspire 7720-6708 screen goes blank coming out of standby/ | 2022-03-28 12:11 | - | |
| Aspire 7720G (I think) BIOS Problem/ | 2022-03-28 12:11 | - | |
| Aspire 7720G - 5520G Bios Advanced settings/ | 2022-03-28 12:11 | - | |
| Aspire 7720G - Clock cant tell the time/ | 2022-03-28 12:11 | - | |
| Aspire 7720G/ | 2022-03-28 12:11 | - | |
| Aspire 7720G; Temperature increasing, fan speed decreasing!/ | 2022-03-28 12:11 | - | |
| Aspire 7720G BIOS upgrade crash/ | 2022-03-28 12:11 | - | |
| Aspire 7720G Crystal Eye & MSN Issue/ | 2022-03-28 12:11 | - | |
| Aspire 7720G Graphic card update/ | 2022-03-28 12:11 | - | |
| Aspire 7720G Memory Cover/ | 2022-03-28 12:11 | - | |
| Aspire 7720G Number KeyPad/ | 2022-03-28 12:11 | - | |
| Aspire 7720 GPU Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 7720G Synaptics Driver/ | 2022-03-28 12:11 | - | |
| Aspire 7720G Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 7720G broke front audio panel/ | 2022-03-28 12:11 | - | |
| Aspire 7720G eRecovery/ | 2022-03-28 12:11 | - | |
| Aspire 7720G full vista recovery dvd/ | 2022-03-28 12:11 | - | |
| Aspire 7720G major upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 7720G problem with motherboard and MXM graphics card/ | 2022-03-28 12:11 | - | |
| Aspire 7720G ticking sound coming from speakers/ | 2022-03-28 12:11 | - | |
| Aspire 7720G upgrade GeForce 9600M GT 1GB - FAIL.......Help Please/ | 2022-03-28 12:11 | - | |
| Aspire 7720G which motherboard/ | 2022-03-28 12:11 | - | |
| Aspire 7720 Numpad is dead after bios flash/ | 2022-03-28 12:11 | - | |
| Aspire 7720 Overheating problems PLEASE HELP!!!/ | 2022-03-28 12:11 | - | |
| Aspire 7720 Owners Lounge/ | 2022-03-28 12:11 | - | |
| Aspire 7720 T7300 Ram help..Newbie -O)/ | 2022-03-28 12:11 | - | |
| Aspire 7720 T7300 ~ CPU upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 7720 Will not boot to Windows/ | 2022-03-28 12:11 | - | |
| Aspire 7720 X3100 GM965/ | 2022-03-28 12:11 | - | |
| Aspire 7720ZG and Dual Core T4300/ | 2022-03-28 12:11 | - | |
| Aspire 7720Z doesn't recognize geforce 9600M GT/ | 2022-03-28 12:11 | - | |
| Aspire 7720 and Windows 7/ | 2022-03-28 12:11 | - | |
| Aspire 7720 doesn't recognize DVD CD Drive/ | 2022-03-28 12:11 | - | |
| Aspire 7720g Wireless Card Not Detected/ | 2022-03-28 12:11 | - | |
| Aspire 7720 microphone input problem help/ | 2022-03-28 12:11 | - | |
| Aspire 7720 motherboard compatability/ | 2022-03-28 12:11 | - | |
| Aspire 7720 on the way. some questions/ | 2022-03-28 12:11 | - | |
| Aspire 7720 problem/ | 2022-03-28 12:11 | - | |
| Aspire 7730G - D2d issue/ | 2022-03-28 12:11 | - | |
| Aspire 7730G GPU upgrade (MXM-II)/ | 2022-03-28 12:11 | - | |
| Aspire 7730G please help!/ | 2022-03-28 12:11 | - | |
| Aspire 7730 subwoofer volume/ | 2022-03-28 12:11 | - | |
| Aspire 7730 touchpad issue/ | 2022-03-28 12:11 | - | |
| Aspire 7736 Video Multi-tasking/ | 2022-03-28 12:11 | - | |
| Aspire 7736Z-4809/ | 2022-03-28 12:11 | - | |
| Aspire 7738G and FirePro M4000/ | 2022-03-28 12:11 | - | |
| Aspire 7738g No hdmi option in sound driver/ | 2022-03-28 12:11 | - | |
| Aspire 7740 - Battery/ | 2022-03-28 12:11 | - | |
| Aspire 7740G - Dissasemble Guide/ | 2022-03-28 12:11 | - | |
| Aspire 7740G DPC latency/ | 2022-03-28 12:11 | - | |
| Aspire 7740G freezes while playing/ | 2022-03-28 12:11 | - | |
| Aspire 7740G performance/ | 2022-03-28 12:11 | - | |
| Aspire 7741-4643 won't hibernate/ | 2022-03-28 12:11 | - | |
| Aspire 7741/ | 2022-03-28 12:11 | - | |
| Aspire 7741G-6426 USB port not working/ | 2022-03-28 12:11 | - | |
| Aspire 7741G-6426 mini2 slot (msata )/ | 2022-03-28 12:11 | - | |
| Aspire 7741G-7017 Battery Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 7741G CPU update, help/ | 2022-03-28 12:11 | - | |
| Aspire 7741Z- Opinions/ | 2022-03-28 12:11 | - | |
| Aspire 7741 has an empty bay next to memory bay/ | 2022-03-28 12:11 | - | |
| Aspire 7741z Boot Problem/ | 2022-03-28 12:11 | - | |
| Aspire 7741z almost dead/ | 2022-03-28 12:11 | - | |
| Aspire 7745-5632 won't POST/ | 2022-03-28 12:11 | - | |
| Aspire 7745G-Sommetime blurred screen/ | 2022-03-28 12:11 | - | |
| Aspire 7745G - upgrade graphics drivers/ | 2022-03-28 12:11 | - | |
| Aspire 7745G gets BSOD/ | 2022-03-28 12:11 | - | |
| Aspire 7750G 9807 FN Keys Aren't Working!/ | 2022-03-28 12:11 | - | |
| Aspire 7750G AMD Dynamic Switchable Graphics problems -/ | 2022-03-28 12:11 | - | |
| Aspire 8730G volume throttle doesn't work/ | 2022-03-28 12:11 | - | |
| Aspire 8920/ | 2022-03-28 12:11 | - | |
| Aspire 8920 Arcade Deluxe Button/ | 2022-03-28 12:11 | - | |
| Aspire 8920G-934G64BN/ | 2022-03-28 12:11 | - | |
| Aspire 8920G XP downgrade all drivers, exept Video/ | 2022-03-28 12:11 | - | |
| Aspire 8920 Gaming Problems/ | 2022-03-28 12:11 | - | |
| Aspire 8920G white screen issue/ | 2022-03-28 12:11 | - | |
| Aspire 8920G with Geforce 240M Black screen/ | 2022-03-28 12:11 | - | |
| Aspire 8920 Owners Lounge/ | 2022-03-28 12:11 | - | |
| Aspire 8920 gemstone questions/ | 2022-03-28 12:11 | - | |
| Aspire 8920g to Plasma/ | 2022-03-28 12:11 | - | |
| Aspire 8920 webcam and arcade deluxe problems/ | 2022-03-28 12:11 | - | |
| Aspire 8930G - CineDash control stuck!/ | 2022-03-28 12:11 | - | |
| Aspire 8930G - Hardware-Assisted Virtualization/ | 2022-03-28 12:11 | - | |
| Aspire 8930G - has TV/ | 2022-03-28 12:11 | - | |
| Aspire 8930G/ | 2022-03-28 12:11 | - | |
| Aspire 8930G Bios flashing went wrong/ | 2022-03-28 12:11 | - | |
| Aspire 8930G Comparison/ | 2022-03-28 12:11 | - | |
| Aspire 8930G Essential Drivers Applications - Fresh Install of Win7/ | 2022-03-28 12:11 | - | |
| Aspire 8930G Windows 7 Driver Issues (Validity & graphics)/ | 2022-03-28 12:11 | - | |
| Aspire 8930G shuts down randomly! Need fix quick! PLEASE READ!!/ | 2022-03-28 12:11 | - | |
| Aspire 8930 Queston/ | 2022-03-28 12:11 | - | |
| Aspire 8930 sluggish with 2nd hard drive installed/ | 2022-03-28 12:11 | - | |
| Aspire 8930 won't charge new battery/ | 2022-03-28 12:11 | - | |
| Aspire 8935G - Why Does the Vista Device Manager Show a Wrong CPU/ | 2022-03-28 12:11 | - | |
| Aspire 8935G- new HD/ | 2022-03-28 12:11 | - | |
| Aspire 8935G- switchable graphics don't work after installing Win7x64/ | 2022-03-28 12:11 | - | |
| Aspire 8935G 8725G - Lots of questions!/ | 2022-03-28 12:11 | - | |
| Aspire 8935G 8735G - Buying Questions/ | 2022-03-28 12:11 | - | |
| Aspire 8935G CPU GPU UPGRADE SUCCESS!/ | 2022-03-28 12:11 | - | |
| Aspire 8935G CPU Upgrade Question/ | 2022-03-28 12:11 | - | |
| Aspire 8935G GTS 250m/ | 2022-03-28 12:11 | - | |
| Aspire 8935G Windows 7 64 - Fn Keys for Brightness Control Don't Work/ | 2022-03-28 12:11 | - | |
| Aspire 8935G and wireless-N upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 8935 erecovery boot problem/ | 2022-03-28 12:11 | - | |
| Aspire 8943G-5636 Model/ | 2022-03-28 12:11 | - | |
| Aspire 8943G/ | 2022-03-28 12:11 | - | |
| Aspire 8943G Power Circuit Replacement Help/ | 2022-03-28 12:11 | - | |
| Aspire 8943g crashing on flash video/ | 2022-03-28 12:11 | - | |
| Aspire 8943g graphics driver/ | 2022-03-28 12:11 | - | |
| Aspire 8950g/ | 2022-03-28 12:11 | - | |
| Aspire 9104 WLMI 1GB Any Good/ | 2022-03-28 12:11 | - | |
| Aspire 9110/ | 2022-03-28 12:11 | - | |
| Aspire 9300, your GeForce 7300go temps/ | 2022-03-28 12:11 | - | |
| Aspire 9300-5317 clean install/ | 2022-03-28 12:11 | - | |
| Aspire 9300 - Partion question/ | 2022-03-28 12:11 | - | |
| Aspire 9300 - Remote monitor, mouse & keyboard question/ | 2022-03-28 12:11 | - | |
| Aspire 9300 9303wsmi boots with bios noise- cant locate graphics card/ | 2022-03-28 12:11 | - | |
| Aspire 9300 Bluetooth/ | 2022-03-28 12:11 | - | |
| Aspire 9300 GPU upgrade/ | 2022-03-28 12:11 | - | |
| Aspire 9300 Vista probs/ | 2022-03-28 12:11 | - | |
| Aspire 9300 resolution issue/ | 2022-03-28 12:11 | - | |
| Aspire 9300 shutting down/ | 2022-03-28 12:11 | - | |
| Aspire 9300 vs 4G of memory/ | 2022-03-28 12:11 | - | |
| Aspire 9301 RAM upgrade problems/ | 2022-03-28 12:11 | - | |
| Aspire 9302 BIOS Flash - right method/ | 2022-03-28 12:11 | - | |
| Aspire 9303/ | 2022-03-28 12:11 | - | |
| Aspire 9303 CPU upgrade Anyone done this/ | 2022-03-28 12:11 | - | |
| Aspire 9303WSMI Restore/ | 2022-03-28 12:11 | - | |
| Aspire 9303 Wireless Network Problem/ | 2022-03-28 12:11 | - | |
| Aspire 9303 high capacity battery/ | 2022-03-28 12:11 | - | |
| Aspire 9400 NO SOUND/ | 2022-03-28 12:11 | - | |
| Aspire 9410-2079 -- Special Request Dyslexia/ | 2022-03-28 12:11 | - | |
| Aspire 9410-4317 xp brightness issue/ | 2022-03-28 12:11 | - | |
| Aspire 9410-4441 DVD sound quality/ | 2022-03-28 12:11 | - | |
| Aspire 9410- TSST TS-L632D (cross-flashed to firmware SC04)/ | 2022-03-28 12:11 | - | |
| Aspire 9410. Please Help; Important I get this fixed/ | 2022-03-28 12:11 | - | |
| Aspire 9410Z, Win XP - how to enable Line-In/ | 2022-03-28 12:11 | - | |
| Aspire 9410 any one run 4 gig/ | 2022-03-28 12:11 | - | |
| Aspire 9410 battery issue/ | 2022-03-28 12:11 | - | |
| Aspire 9410z Empowering tech issues/ | 2022-03-28 12:11 | - | |
| Aspire 9411/ | 2022-03-28 12:11 | - | |
| Aspire 9420 - Help required!/ | 2022-03-28 12:11 | - | |
| Aspire 9420... Mass Storage Controller/ | 2022-03-28 12:11 | - | |
| Aspire 9500 Duo Core/ | 2022-03-28 12:11 | - | |
| Aspire 9500 Locked Out/ | 2022-03-28 12:11 | - | |
| Aspire 9500 Manual/ | 2022-03-28 12:11 | - | |
| Aspire 9504/ | 2022-03-28 12:11 | - | |
| Aspire 9510- 17 , GeForce Go 7900 512MB, Centrino Duo, dual 120GB HDDs, up to 4GB RAM/ | 2022-03-28 12:11 | - | |
| Aspire 9520/ | 2022-03-28 12:11 | - | |
| Aspire 9630 nVidia GForce Go 7300 (would like an updated driver) Help/ | 2022-03-28 12:11 | - | |
| Aspire 9800.........omfg I luuuuv it!!/ | 2022-03-28 12:11 | - | |
| Aspire 9802 Memory to 4GB/ | 2022-03-28 12:11 | - | |
| Aspire 9802 replacement motherboard/ | 2022-03-28 12:11 | - | |
| Aspire 9813, Cannot Get 5.1 Audio via spdif/ | 2022-03-28 12:11 | - | |
| Aspire 9920 Headphone Socket/ | 2022-03-28 12:11 | - | |
| Aspire 9920 Tv Tuner Problem/ | 2022-03-28 12:11 | - | |
| Aspire A515-54G - FAN almost constant on. (No heat issues). Override it somehow/ | 2022-03-28 12:11 | - | |
| Aspire AOD250-1838- Install my own OS/ | 2022-03-28 12:11 | - | |
| Aspire AS1410 --mobile broadband upgradeable/ | 2022-03-28 12:11 | - | |
| Aspire AS 1689WLM1 vs. Aspire 1414WLC1-XPH/ | 2022-03-28 12:11 | - | |
| Aspire AS1691WLMi/ | 2022-03-28 12:11 | - | |
| Aspire AS3003WLCi newb questions/ | 2022-03-28 12:11 | - | |
| Aspire AS3004wlci or as3003wlci/ | 2022-03-28 12:11 | - | |
| Aspire AS4530-5627/ | 2022-03-28 12:11 | - | |
| Aspire AS5745G-6323 CPU- Not a 720QM, what gives/ | 2022-03-28 12:11 | - | |
| Aspire AS5920G - Recovery problems!/ | 2022-03-28 12:11 | - | |
| Aspire AS6930-6560 Keyboard issue frustration/ | 2022-03-28 12:11 | - | |
| Aspire AS7540-5750 Cant find ANY info/ | 2022-03-28 12:11 | - | |
| Aspire AS7736Z-4088 Touchpad problems/ | 2022-03-28 12:11 | - | |
| Aspire AS7741g-3647/ | 2022-03-28 12:11 | - | |
| Aspire AS9303WSMi D2D Recovery- Can't activate tool using Alt+F10/ | 2022-03-28 12:11 | - | |
| Aspire Accessories/ | 2022-03-28 12:11 | - | |
| Aspire Active Stylus V/ | 2022-03-28 12:11 | - | |
| Aspire Arcade for 5920G xp version/ | 2022-03-28 12:11 | - | |
| Aspire Batteries/ | 2022-03-28 12:11 | - | |
| Aspire Battery/ | 2022-03-28 12:11 | - | |
| Aspire CrystalEye Webcam HD/ | 2022-03-28 12:11 | - | |
| Aspire D255Aspire one/ | 2022-03-28 12:11 | - | |
| Aspire Dock/ | 2022-03-28 12:11 | - | |
| Aspire E1-421/ | 2022-03-28 12:11 | - | |
| Aspire E1-422-3444 Hard Drive upgrade/ | 2022-03-28 12:11 | - | |
| Aspire E1-522 Creaking when closing lid/ | 2022-03-28 12:11 | - | |
| Aspire E1-571, V3-571 or related model owners - how is your CPU fan/ | 2022-03-28 12:11 | - | |
| Aspire E1-572G screen replacement/ | 2022-03-28 12:11 | - | |
| Aspire E5-511/ | 2022-03-28 12:11 | - | |
| Aspire E 15 E5-574 Fan constantly running/ | 2022-03-28 12:11 | - | |
| Aspire E15 vs Swift 3/ | 2022-03-28 12:11 | - | |
| Aspire Gemstone 5920G fans/ | 2022-03-28 12:11 | - | |
| Aspire Gemstone Blue 8920 Blu Ray question/ | 2022-03-28 12:11 | - | |
| Aspire HDD broken how to reinstall everything/ | 2022-03-28 12:11 | - | |
| Aspire Idea 500 - XP install problems/ | 2022-03-28 12:11 | - | |
| Aspire M5-583P/ | 2022-03-28 12:11 | - | |
| Aspire M1640, Acer eRecovering Management fails to respond/ | 2022-03-28 12:11 | - | |
| Aspire Nitro VN7-x92G (592 792) Driver Resources Thread/ | 2022-03-28 12:11 | - | |
| Aspire ONE bios chip location/ | 2022-03-28 12:11 | - | |
| Aspire One's with WWAN slot/ | 2022-03-28 12:11 | - | |
| Aspire One + Win 7/ | 2022-03-28 12:11 | - | |
| Aspire One, PXE-MOF- Exiting INTEL PXE ROM, NO OS Found! Help!/ | 2022-03-28 12:11 | - | |
| AspireOne, plans on black/ | 2022-03-28 12:11 | - | |
| Aspire One- 5 times repaired, still not working -(/ | 2022-03-28 12:11 | - | |
| Aspire One - Battery Not Being Recognised/ | 2022-03-28 12:11 | - | |
| Aspire One- Dead. Deceased. Nada/ | 2022-03-28 12:11 | - | |
| Aspire One - SSD XP Model/ | 2022-03-28 12:11 | - | |
| Aspire One - any way to display 1024x768 w o external monitor/ | 2022-03-28 12:11 | - | |
| Aspire One - master boot records problems/ | 2022-03-28 12:11 | - | |
| Aspire One/ | 2022-03-28 12:11 | - | |
| Aspire One 10 photos/ | 2022-03-28 12:11 | - | |
| Aspire One 120gb XP question/ | 2022-03-28 12:11 | - | |
| Aspire One 521 Bezel Removal/ | 2022-03-28 12:11 | - | |
| Aspire One 532H BIOS problem/ | 2022-03-28 12:11 | - | |
| Aspire One 532h - Missing brightness icon/ | 2022-03-28 12:11 | - | |
| Aspire One 722-BZ897 WWAN module replacement/ | 2022-03-28 12:11 | - | |
| Aspire One 722 and Windows 8/ | 2022-03-28 12:11 | - | |
| Aspire One 756 Owners/ | 2022-03-28 12:11 | - | |
| Aspire One 7022 Recovery CD Frustration/ | 2022-03-28 12:11 | - | |
| Aspire One A150 Not booting anymore/ | 2022-03-28 12:11 | - | |
| Aspire One A150 Windows XP Restore DVD/ | 2022-03-28 12:11 | - | |
| Aspire One AO533 CPU Upgrade/ | 2022-03-28 12:11 | - | |
| Aspire One AO722 fan runs from computer start up/ | 2022-03-28 12:11 | - | |
| Aspire One AOA110 AOA150 bios mod/ | 2022-03-28 12:11 | - | |
| AspireOne AOA150-1447/ | 2022-03-28 12:11 | - | |
| Aspire One Bad Internet/ | 2022-03-28 12:11 | - | |
| Aspire One Bios unlock/ | 2022-03-28 12:11 | - | |
| Aspire One Brightness Setting on Startup/ | 2022-03-28 12:11 | - | |
| Aspire One D-250 Wireless Card Issue/ | 2022-03-28 12:11 | - | |
| Aspire One D250-1955/ | 2022-03-28 12:11 | - | |
| Aspire One D250 Flickering screen, Help/ | 2022-03-28 12:11 | - | |
| Aspire One D250 w Win7/ | 2022-03-28 12:11 | - | |
| Aspire One D255 series display problem/ | 2022-03-28 12:11 | - | |
| Aspire One D257 And WinVista/ | 2022-03-28 12:11 | - | |
| Aspire One D260 netbook- constant right click input/ | 2022-03-28 12:11 | - | |
| Aspire One D270 Memory upgrade/ | 2022-03-28 12:11 | - | |
| Aspire One HDD and Memory upgrade/ | 2022-03-28 12:11 | - | |
| Aspire One Harddisk password/ | 2022-03-28 12:11 | - | |
| Aspire One LCD Cracked and Smashed/ | 2022-03-28 12:11 | - | |
| Aspire One Maximum External Monitor Resolution/ | 2022-03-28 12:11 | - | |
| Aspire One Netbook- Cannot Recover with External CD Drive/ | 2022-03-28 12:11 | - | |
| Aspire One Netbook RAM upgrade/ | 2022-03-28 12:11 | - | |
| Aspire One Processor/ | 2022-03-28 12:11 | - | |
| Aspire One RAM upgrade & Question about GMA 950/ | 2022-03-28 12:11 | - | |
| Aspire One Recovery Help/ | 2022-03-28 12:11 | - | |
| Aspire One Recovery Problems/ | 2022-03-28 12:11 | - | |
| Aspire One SSD Linux version/ | 2022-03-28 12:11 | - | |
| Aspire One Screen Problems/ | 2022-03-28 12:11 | - | |
| Aspire One Slow on Battery/ | 2022-03-28 12:11 | - | |
| Aspire One Users please help!!!/ | 2022-03-28 12:11 | - | |
| Aspire One Webcam Not Working/ | 2022-03-28 12:11 | - | |
| Aspire One Windows 7 webcam driver/ | 2022-03-28 12:11 | - | |
| AspireOne Windows XP Drivers/ | 2022-03-28 12:11 | - | |
| Aspire One Wireless Lies/ | 2022-03-28 12:11 | - | |
| AspireOne With Vista Running Well -)/ | 2022-03-28 12:11 | - | |
| Aspire One Won't Boot Up/ | 2022-03-28 12:11 | - | |
| Aspire One Won't Load Screen/ | 2022-03-28 12:11 | - | |
| Aspire One battery/ | 2022-03-28 12:11 | - | |
| Aspire One erecovery cd/ | 2022-03-28 12:11 | - | |
| Aspire One is so very very slow/ | 2022-03-28 12:11 | - | |
| Aspire One making some CRAZY sounds when starting up/ | 2022-03-28 12:11 | - | |
| AspireOne power adapter tip ( )/ | 2022-03-28 12:11 | - | |
| Aspire One question/ | 2022-03-28 12:11 | - | |
| Aspire One service manual/ | 2022-03-28 12:11 | - | |
| Aspire One touchpad use with keyboard/ | 2022-03-28 12:11 | - | |
| Aspire One wireless without power issue!/ | 2022-03-28 12:11 | - | |
| Aspire One with Win7, some problems/ | 2022-03-28 12:11 | - | |
| Aspire One with a lot of problems/ | 2022-03-28 12:11 | - | |
| Aspire One wont turn on/ | 2022-03-28 12:11 | - | |
| Aspire Power Adapter Bad/ | 2022-03-28 12:11 | - | |
| Aspire R5 Dead Quiet/ | 2022-03-28 12:11 | - | |
| Aspire R7-571G/ | 2022-03-28 12:11 | - | |
| Aspire Revo x64 drivers/ | 2022-03-28 12:11 | - | |
| Aspire S3 (S3-391-9415) stumping me at work, SSD issue or Windows related Or both/ | 2022-03-28 12:11 | - | |
| Aspire S3- automatic colour settings/ | 2022-03-28 12:11 | - | |
| Aspire S3 Deep Sleep not functioning/ | 2022-03-28 12:11 | - | |
| Aspire S5-391 SSD Setup Questions/ | 2022-03-28 12:11 | - | |
| Aspire S7-392 Microphone/ | 2022-03-28 12:11 | - | |
| Aspire S7-392 Production Stop/ | 2022-03-28 12:11 | - | |
| Aspire S7-393-7451/ | 2022-03-28 12:11 | - | |
| Aspire S7-9439 Adapter/ | 2022-03-28 12:11 | - | |
| Aspire S7 i7-4500U CPU Temps/ | 2022-03-28 12:11 | - | |
| Aspire S551-2036 won't charge the battery/ | 2022-03-28 12:11 | - | |
| Aspire Timeline 1810T HDMI lockup/ | 2022-03-28 12:11 | - | |
| Aspire Timeline 1810T extremely slow/ | 2022-03-28 12:11 | - | |
| Aspire TimelineX 3820TG, still worthy to buy/ | 2022-03-28 12:11 | - | |
| Aspire TimelineX AS4830T - CPU replacement possible/ | 2022-03-28 12:11 | - | |
| Aspire Ultrabook M5 481tg. Additional SSD ( 256GB)/ | 2022-03-28 12:11 | - | |
| Aspire V3-571G/ | 2022-03-28 12:11 | - | |
| Aspire V3-572G/ | 2022-03-28 12:11 | - | |
| Aspire V3-771G-9809 A review/ | 2022-03-28 12:11 | - | |
| Aspire V3 Help/ | 2022-03-28 12:11 | - | |
| Aspire V3 won't boot/ | 2022-03-28 12:11 | - | |
| Aspire V5-552G/ | 2022-03-28 12:11 | - | |
| Aspire V5-552G owner's thread/ | 2022-03-28 12:11 | - | |
| Aspire V5-561P PG (Question about screen resolution)/ | 2022-03-28 12:11 | - | |
| Aspire V5-573G and Windows 7/ | 2022-03-28 12:11 | - | |
| Aspire V5-573g Resolution Problem/ | 2022-03-28 12:11 | - | |
| Aspire V7-482PG-9884/ | 2022-03-28 12:11 | - | |
| Aspire V7-582PG-7657 (850m) battery life, thin, gaming/ | 2022-03-28 12:11 | - | |
| Aspire V7- Default Boot Device Missing or Boot Failed/ | 2022-03-28 12:11 | - | |
| Aspire V7 Owners Lounge/ | 2022-03-28 12:11 | - | |
| Aspire V17 Nitro VN7-791g Keyboard wear/ | 2022-03-28 12:11 | - | |
| Aspire Vista to XP/ | 2022-03-28 12:11 | - | |
| Aspire Vs Travelmate/ | 2022-03-28 12:11 | - | |
| Aspire Z3771 + Tobii PCEye/ | 2022-03-28 12:11 | - | |
| Aspire ZC606/ | 2022-03-28 12:11 | - | |
| Aspire as4750g CPU temperature/ | 2022-03-28 12:11 | - | |
| Aspire blackscreen/ | 2022-03-28 12:11 | - | |
| Aspire dead [with a bit of history]/ | 2022-03-28 12:11 | - | |
| Aspire ethos BTO option/ | 2022-03-28 12:11 | - | |
| Aspire hibernates from stand-by/ | 2022-03-28 12:11 | - | |
| Aspire iDea 510/ | 2022-03-28 12:11 | - | |
| Aspire left click problem/ | 2022-03-28 12:11 | - | |
| Aspire one - HELP!/ | 2022-03-28 12:11 | - | |
| Aspire one 150- Can it run eRecovery to create backup/ | 2022-03-28 12:11 | - | |
| Aspire one D150 No Power !!!/ | 2022-03-28 12:11 | - | |
| Aspire one linux xp question/ | 2022-03-28 12:11 | - | |
| Aspire one max HDD-SDD size/ | 2022-03-28 12:11 | - | |
| Aspire one owners- faint line on outer LCD casing/ | 2022-03-28 12:11 | - | |
| Aspire one performance/ | 2022-03-28 12:11 | - | |
| Aspireone webcam driver/ | 2022-03-28 12:11 | - | |
| Aspire one with usb tv tuner/ | 2022-03-28 12:11 | - | |
| Aspire playing from speakers and headphones/ | 2022-03-28 12:11 | - | |
| Aspire problems... verdict please/ | 2022-03-28 12:11 | - | |
| Aspire problems/ | 2022-03-28 12:11 | - | |
| Aspire screen brightness/ | 2022-03-28 12:11 | - | |
| Aspire timeline with SU3500 and Netflix/ | 2022-03-28 12:11 | - | |
| Aspire v5-573P-9899 can't connect via ethernet cable/ | 2022-03-28 12:11 | - | |
| Aspire v5 572G keyboard doesn't work/ | 2022-03-28 12:11 | - | |
| Aspire versus TravelMate/ | 2022-03-28 12:11 | - | |
| Aspire vs. TravelMate/ | 2022-03-28 12:11 | - | |
| Aspire will not power up.Plz help/ | 2022-03-28 12:11 | - | |
| Aspire won't do anything/ | 2022-03-28 12:11 | - | |
| Aspite 3003 BIOS/ | 2022-03-28 12:11 | - | |
| Aspre 5652 Power Question/ | 2022-03-28 12:11 | - | |
| Asprie 5685WLMi (UK)/ | 2022-03-28 12:11 | - | |
| Asprire 9300 Black Screen Problem/ | 2022-03-28 12:11 | - | |
| Assassin's Creed on Acer AS6920/ | 2022-03-28 12:11 | - | |
| Associating Files in user directory in C drive, with D drive/ | 2022-03-28 12:11 | - | |
| Asus GT240M in 6930g vBios update required/ | 2022-03-28 12:11 | - | |
| Asus UX Ultrabook/ | 2022-03-28 12:11 | - | |
| Asus eeepc 701/ | 2022-03-28 12:11 | - | |
| Asynchronous RAM in my 6920G/ | 2022-03-28 12:11 | - | |
| At a lost/ | 2022-03-28 12:11 | - | |
| At end of my Acer 8920G rope/ | 2022-03-28 12:11 | - | |
| Atheros AR5005G Network Adapter/ | 2022-03-28 12:11 | - | |
| Atheros Wlan+Bluetooth Adapter driver on Win8.1 connectivity issue/ | 2022-03-28 12:11 | - | |
| Atherson Problem on 3680/ | 2022-03-28 12:11 | - | |
| Ati Catalyst Shows 128, Bios shows 32 - Specs at shop show 64/ | 2022-03-28 12:11 | - | |
| Ati Catalyst or new graphic drivers query/ | 2022-03-28 12:11 | - | |
| Ati Mobility Radeon 9700 Graphics Help/ | 2022-03-28 12:11 | - | |
| Ati Mobility x700 drivers/ | 2022-03-28 12:11 | - | |
| Ati Sb450 Usb 2.0 Controller on Acer Aspire 5102/ | 2022-03-28 12:11 | - | |
| Ati X200M - Unusual Weird Colour rendering/ | 2022-03-28 12:11 | - | |
| Ati X1300 driver problem/ | 2022-03-28 12:11 | - | |
| Ati hybrid crossfireX question/ | 2022-03-28 12:11 | - | |
| Ati x1100 (128MB shared) on Aspire 5102 trouble/ | 2022-03-28 12:11 | - | |
| At last- BIOS 1.09A avaible for download!!/ | 2022-03-28 12:11 | - | |
| Attention! Does your notebook have SiS graphics Then look here/ | 2022-03-28 12:11 | - | |
| Attention 8204 users/ | 2022-03-28 12:11 | - | |
| At the end....Acer travelmate 3210/ | 2022-03-28 12:11 | - | |
| Audio Codec type in Acer Aspire 8935G/ | 2022-03-28 12:11 | - | |
| Audio Issues on Acer Aspire 7720G/ | 2022-03-28 12:11 | - | |
![[DIR]](/icons/binary.gif) | Audiodg.exe/ | 2022-03-28 12:11 | - | |
| Audio distortion problem in 6930G/ | 2022-03-28 12:11 | - | |
| Audio driver for Acer Aspire 1652WMLi/ | 2022-03-28 12:11 | - | |
| Audio issues in XP/ | 2022-03-28 12:11 | - | |
| Audio problem on acer 5920/ | 2022-03-28 12:11 | - | |
| Audio problem with my Acer/ | 2022-03-28 12:11 | - | |
| Audio recording unusably faint with 4810TZ/ | 2022-03-28 12:11 | - | |
| Audio thourgh DVI-to-HDMI/ | 2022-03-28 12:11 | - | |
| Authorized Dealer Reseller Recommendation/ | 2022-03-28 12:11 | - | |
| Auto-dimming without Empowering Software/ | 2022-03-28 12:11 | - | |
| Auto Click/ | 2022-03-28 12:11 | - | |
| Auto selecting when just hovering/ | 2022-03-28 12:11 | - | |
| Availability of Acer Aspire V7-482PG in Europe (Czech fiends please help )/ | 2022-03-28 12:11 | - | |
| Available Canadian TimelineX and throttling/ | 2022-03-28 12:11 | - | |
| Aver 5102WLMI (i need a upgrade on memory help me)/ | 2022-03-28 12:11 | - | |
| A very basic question about Travelmate 8200/ | 2022-03-28 12:05 | - | |
| A very weird acer laptop/ | 2022-03-28 12:05 | - | |
| Avivo Video Converter Problem/ | 2022-03-28 12:11 | - | |
| Awesome Driver 9700M GT 8930-6448/ | 2022-03-28 12:11 | - | |
| A word of warning for Aspire 5670 5672 owners/ | 2022-03-28 12:05 | - | |
| Axer key problem/ | 2022-03-28 12:11 | - | |
| BD-Rom drive in 8920-6030/ | 2022-03-28 12:11 | - | |
| BIOS 3315 - how and where/ | 2022-03-28 12:11 | - | |
| BIOS CORRECTIONS 1410 timeline intel 3400 chipset/ | 2022-03-28 12:11 | - | |
| BIOS Downgrade/ | 2022-03-28 12:11 | - | |
| BIOS OSI Method/ | 2022-03-28 12:11 | - | |
| BIOS Recovery Acer Aspire 5739G/ | 2022-03-28 12:11 | - | |
| BIOS Recovery z5610/ | 2022-03-28 12:11 | - | |
| BIOS Update V1.24- 4GB RAM in 9410/ | 2022-03-28 12:11 | - | |
| BIOS Update for ACER TRAVELMATE 7720G !!/ | 2022-03-28 12:11 | - | |
| BIOS Update on Travelmate 8204 wlmi/ | 2022-03-28 12:11 | - | |
| BIOS Upgrade 2.03 - 2.06/ | 2022-03-28 12:11 | - | |
| BIOS Upgrate.......Need help/ | 2022-03-28 12:11 | - | |
| BIOS and Drivers on 8204/ | 2022-03-28 12:11 | - | |
| BIOS battery- TravelMate 5520/ | 2022-03-28 12:11 | - | |
| BIOS bootable disk, how to make one/ | 2022-03-28 12:11 | - | |
| BIOS information Acer 7330 for cpu-upgrade/ | 2022-03-28 12:11 | - | |
| BIOS installation question/ | 2022-03-28 12:11 | - | |
| BIOS not starting/ | 2022-03-28 12:11 | - | |
| BIOS password - aspire 5050/ | 2022-03-28 12:11 | - | |
| BIOS question- has anyone upgraded TM8204/ | 2022-03-28 12:11 | - | |
| BIOS rescue for 5810tz/ | 2022-03-28 12:11 | - | |
| BIOS to UEFI/ | 2022-03-28 12:11 | - | |
| BIOS tweaker unlocker/ | 2022-03-28 12:11 | - | |
| BIOS update 3236 for 5670 series/ | 2022-03-28 12:11 | - | |
| BIOS update fails, yes i ran it as admin -P/ | 2022-03-28 12:11 | - | |
| BIOS update problems/ | 2022-03-28 12:11 | - | |
| BIOS v1.16 for AS6920G/ | 2022-03-28 12:11 | - | |
| BIOS v1.3811, YYpire 5920g, spelling mistake/ | 2022-03-28 12:11 | - | |
| BIOS v2.3821 for Acer 7730G/ | 2022-03-28 12:11 | - | |
| BIOS v3238 UPGRADE for 6930G/ | 2022-03-28 12:11 | - | |
| BIOS version difference/ | 2022-03-28 12:11 | - | |
| BMW Acer Travelmate 8204 WLMI Build date 06 03/ | 2022-03-28 12:11 | - | |
| BOOTMGR is compressed/ | 2022-03-28 12:11 | - | |
| BSOD- irql_not_less_or_equal/ | 2022-03-28 12:11 | - | |
| BSOD 6930g only when on laptop screen not external monitor/ | 2022-03-28 12:11 | - | |
| BSOD Windows 7- Heat related/ | 2022-03-28 12:11 | - | |
| BSOD on First Book/ | 2022-03-28 12:11 | - | |
| BSOD on my new Aspire 5741G -(/ | 2022-03-28 12:11 | - | |
| BSOD on old TravelMate/ | 2022-03-28 12:11 | - | |
| BSOD while installing Windows/ | 2022-03-28 12:11 | - | |
| BUY Acer Travelmate 8204 worth it/ | 2022-03-28 12:11 | - | |
| Back-ups/ | 2022-03-28 12:11 | - | |
| BackUP DVD question/ | 2022-03-28 12:11 | - | |
| Backdoor access to your Acer laptop/ | 2022-03-28 12:11 | - | |
| Backing up drivers before clean install/ | 2022-03-28 12:11 | - | |
| Backing up on an external hdd/ | 2022-03-28 12:11 | - | |
| Backlight broke on my Aspire V5-573P-9899's screen/ | 2022-03-28 12:11 | - | |
| Backpack for my 2012...Targus Gravity/ | 2022-03-28 12:11 | - | |
| Backup DVD/ | 2022-03-28 12:11 | - | |
| Backup DVD not burning/ | 2022-03-28 12:11 | - | |
| Backup Image DVD not working/ | 2022-03-28 12:11 | - | |
| Backup Restore an Acer (Tip of the Iceberg)/ | 2022-03-28 12:11 | - | |
| Backup problems/ | 2022-03-28 12:11 | - | |
| Bad Acer Support and false Statements on Acer Homepage/ | 2022-03-28 12:11 | - | |
| Bad Bios Flash/ | 2022-03-28 12:11 | - | |
| Bad Bios update aspire 1694 wmli/ | 2022-03-28 12:11 | - | |
| Bad DVD playback on 5810T/ | 2022-03-28 12:11 | - | |
| Bad Motherboard 7551g/ | 2022-03-28 12:11 | - | |
| Bad charger difficult to charge/ | 2022-03-28 12:11 | - | |
| Bad performance - TravelMate 5612/ | 2022-03-28 12:11 | - | |
| Bad recovery DVD/ | 2022-03-28 12:11 | - | |
| Bad review acer/ | 2022-03-28 12:11 | - | |
| Bad sound - Acer Aspire 5720Z/ | 2022-03-28 12:11 | - | |
| Bad sound with Realtek HD Audio (TravelMate 8202 8204)/ | 2022-03-28 12:11 | - | |
| Bag Case for Travelmate380/ | 2022-03-28 12:11 | - | |
| Banias - Dothan upgrade on TM800 = no fan!/ | 2022-03-28 12:11 | - | |
| Base system driver problem/ | 2022-03-28 12:11 | - | |
| Basic questions about the 4501/ | 2022-03-28 12:11 | - | |
| Batteries for Extensa 4620Z/ | 2022-03-28 12:11 | - | |
| Battery & Speed/ | 2022-03-28 12:11 | - | |
| Battery/ | 2022-03-28 12:11 | - | |
| Battery AC adaptor for laptop ES1-512 low end version/ | 2022-03-28 12:11 | - | |
| Battery Bar stopped working... and it doesn't want to work anymore/ | 2022-03-28 12:11 | - | |
| Battery Calibration/ | 2022-03-28 12:11 | - | |
| Battery Care software for ACER/ | 2022-03-28 12:11 | - | |
| Battery Indicator while on AC flashes amber for a brief second/ | 2022-03-28 12:11 | - | |
| Battery Issue/ | 2022-03-28 12:11 | - | |
| Battery Life - W7 Upgrade/ | 2022-03-28 12:11 | - | |
| Battery Life is weird for 4820TG/ | 2022-03-28 12:11 | - | |
| Battery Life on Aspire One/ | 2022-03-28 12:11 | - | |
| Battery Lifetime in Acer TravelMate 2000/ | 2022-03-28 12:11 | - | |
| Battery Locks Aspire 5000/ | 2022-03-28 12:11 | - | |
| Battery Low Alert/ | 2022-03-28 12:11 | - | |
| Battery Manager for Acer's/ | 2022-03-28 12:11 | - | |
| Battery Problem/ | 2022-03-28 12:11 | - | |
| Battery Problem on Acer Aspire TimelineX 5820TG/ | 2022-03-28 12:11 | - | |
| Battery Replacement/ | 2022-03-28 12:11 | - | |
| Battery Software/ | 2022-03-28 12:11 | - | |
| Battery Trouble/ | 2022-03-28 12:11 | - | |
| Battery Wear/ | 2022-03-28 12:11 | - | |
| Battery Wear Levels (from mobile meter)/ | 2022-03-28 12:11 | - | |
| Battery and OrbiCam troubles after 8204 Clean Install/ | 2022-03-28 12:11 | - | |
| Battery charge not lasting with Windows 7/ | 2022-03-28 12:11 | - | |
| Battery charges extremely slow/ | 2022-03-28 12:11 | - | |
| Battery contest -- who will win/ | 2022-03-28 12:11 | - | |
| Battery for 4501 and 1681/ | 2022-03-28 12:11 | - | |
| Battery for 5562wxmi/ | 2022-03-28 12:11 | - | |
| Battery for Acer Aspire 5920G/ | 2022-03-28 12:11 | - | |
| Battery for Aspire 3680/ | 2022-03-28 12:11 | - | |
| Battery for TM4500 AS1680/ | 2022-03-28 12:11 | - | |
| Battery for the 1694wlmi (CDN)/ | 2022-03-28 12:11 | - | |
| Battery help with Aspire 5520/ | 2022-03-28 12:11 | - | |
| Batterylife Timeline with SU9400/ | 2022-03-28 12:11 | - | |
| Battery life doesnt change even when I change my settings/ | 2022-03-28 12:11 | - | |
| Battery life icon not changing/ | 2022-03-28 12:11 | - | |
| Battery life of Acer TimelineX1830T and TimelineX 3820T/ | 2022-03-28 12:11 | - | |
| Battery life of acer 5502z/ | 2022-03-28 12:11 | - | |
| Battery life of you Acer laptop/ | 2022-03-28 12:11 | - | |
| Battery life span/ | 2022-03-28 12:11 | - | |
| Battery maximum charge level/ | 2022-03-28 12:11 | - | |
| Battery not holding charge/ | 2022-03-28 12:11 | - | |
| Battery on 3810T no longer fully charges/ | 2022-03-28 12:11 | - | |
| Battery problem !!/ | 2022-03-28 12:11 | - | |
| Battery problem - ACER ASPIRE 5050/ | 2022-03-28 12:11 | - | |
| Battery problems/ | 2022-03-28 12:11 | - | |
| Battery problem with Acer travelmate 800/ | 2022-03-28 12:11 | - | |
| Battery question/ | 2022-03-28 12:11 | - | |
| Battery removal/ | 2022-03-28 12:11 | - | |
| Battery sloooooow charging/ | 2022-03-28 12:11 | - | |
| Battery timing/ | 2022-03-28 12:11 | - | |
| Battery upgrade/ | 2022-03-28 12:11 | - | |
| Battery wear level in Ferrari/ | 2022-03-28 12:11 | - | |
| Battery when discharging goes from 10% to 5%/ | 2022-03-28 12:11 | - | |
| Battery will not charge... power supply/ | 2022-03-28 12:11 | - | |
| Battlefield 2 on 1410 and Windows 7 x64/ | 2022-03-28 12:11 | - | |
| Bb Core 2, SATA, Express card capable, LCD 1280 x # OK, smaller than 17/ | 2022-03-28 12:11 | - | |
| Before i format 5920 what drivers should i save/ | 2022-03-28 12:11 | - | |
| Beginners guide to thermal compound replacement on the 5672wlmi/ | 2022-03-28 12:11 | - | |
| Being offered NVIDIA drivers via Windows Update/ | 2022-03-28 12:11 | - | |
| Being prompted to install driver for COPROCESSOR after clean install/ | 2022-03-28 12:11 | - | |
| Belkin vertical bag for 4501/ | 2022-03-28 12:11 | - | |
| BenQ = Acer/ | 2022-03-28 12:11 | - | |
| Benchmark Matchup- 8204 vs. Dell E1705/ | 2022-03-28 12:11 | - | |
| Benchmarking AOA150/ | 2022-03-28 12:11 | - | |
| Benchmarking my 4736G/ | 2022-03-28 12:11 | - | |
| Benchmark on 5920G/ | 2022-03-28 12:11 | - | |
| Benifits of a fresh install (8204)/ | 2022-03-28 12:11 | - | |
| Best 15 Acer/ | 2022-03-28 12:11 | - | |
| Best 8204 Headphone Volume Solutions/ | 2022-03-28 12:11 | - | |
| Best AMD Dual core processor monitor/ | 2022-03-28 12:11 | - | |
| Best Acer platform for laptop gaming/ | 2022-03-28 12:11 | - | |
| Best Bang For Your Buck/ | 2022-03-28 12:11 | - | |
| Best CPU for 6935G/ | 2022-03-28 12:11 | - | |
| Best Catayst Driver for Aspire 5672 x1600/ | 2022-03-28 12:11 | - | |
| Best Core i' processor I can put in a Travelmate 5740/ | 2022-03-28 12:11 | - | |
| Best Dual RAM for 5033/ | 2022-03-28 12:11 | - | |
| Best MXM upgrade for my 6920G/ | 2022-03-28 12:11 | - | |
| Best Method to Wipe Clear Memory on Acer 4720Z/ | 2022-03-28 12:11 | - | |
| Best Mod Bios Acer Aspire 5630/ | 2022-03-28 12:11 | - | |
| Best SSD Card for Acer Aspire/ | 2022-03-28 12:11 | - | |
| Best WIFI N for Acer 5315/ | 2022-03-28 12:11 | - | |
| Best bang buck upgrade to boost a 5920G/ | 2022-03-28 12:11 | - | |
| Best bang for your buck gaming Acer laptop/ | 2022-03-28 12:11 | - | |
| Best cooler for a 7720G/ | 2022-03-28 12:11 | - | |
| Best ddr3 1066/ | 2022-03-28 12:11 | - | |
| Best drivers for 4820TG/ | 2022-03-28 12:11 | - | |
| Best for gaming/ | 2022-03-28 12:11 | - | |
| Best performance you can get from your laptop/ | 2022-03-28 12:11 | - | |
| Best place to buy 5740G w ATI 5650/ | 2022-03-28 12:11 | - | |
| Best place to buy 8024/ | 2022-03-28 12:11 | - | |
| Best place to buy Ferrari/ | 2022-03-28 12:11 | - | |
| Best place to buy an Acer/ | 2022-03-28 12:11 | - | |
| Best processor for an Aspire 6920G/ | 2022-03-28 12:11 | - | |
| Best screens, Acer nitros/ | 2022-03-28 12:11 | - | |
| Best source for Genuine ACER laptop batteries/ | 2022-03-28 12:11 | - | |
| Best video drivers for Radeon X1400/ | 2022-03-28 12:11 | - | |
| Best way to squeeze more performance from my TM8202/ | 2022-03-28 12:11 | - | |
| Best webcam software for Acer webcams/ | 2022-03-28 12:11 | - | |
| Better Ferrari Bluetooth Driver/ | 2022-03-28 12:11 | - | |
| Better Game Machine/ | 2022-03-28 12:11 | - | |
| Better control of Acer 5741 cooling/ | 2022-03-28 12:11 | - | |
| Beware of Acer Service Dept & Policies/ | 2022-03-28 12:11 | - | |
| Beware of Acer TravelMate 2000/ | 2022-03-28 12:11 | - | |
| Big Bios Upgrade Problem/ | 2022-03-28 12:11 | - | |
| Big Issue with Acer 5920G/ | 2022-03-28 12:11 | - | |
| Big Problems after Partitioning/ | 2022-03-28 12:11 | - | |
| Big Problems in 5920g, help required/ | 2022-03-28 12:11 | - | |
| Big problem!/ | 2022-03-28 12:11 | - | |
| Big problem with Aspire 5942G/ | 2022-03-28 12:11 | - | |
| Big problem with aspire 1661 WLM/ | 2022-03-28 12:11 | - | |
| Big problem with my acer aspire!!!!!!!!!!!!/ | 2022-03-28 12:11 | - | |
| Bilingual Keyboard/ | 2022-03-28 12:11 | - | |
| Bio Protection - Windows 7 x64 - 8935G/ | 2022-03-28 12:11 | - | |
| Bio Protection and Windows Live Messenger/ | 2022-03-28 12:11 | - | |
| Bios & ATI driver help!...and DVD drive/ | 2022-03-28 12:11 | - | |
| Bios/ | 2022-03-28 12:11 | - | |
| Bios 1.08 on aspire 5024/ | 2022-03-28 12:11 | - | |
| Bios 1.23 Killed my timeline 4810t, now hangs at boot/ | 2022-03-28 12:11 | - | |
| Bios 3224 now available for Aspire 5672/ | 2022-03-28 12:11 | - | |
| Bios Acer 9500m gs thanks/ | 2022-03-28 12:11 | - | |
| Bios Boot from PCIE sata controller on Aspire 5920g/ | 2022-03-28 12:11 | - | |
| Bios Damaged/ | 2022-03-28 12:11 | - | |
| Bios HDD password is frozen/ | 2022-03-28 12:11 | - | |
| Bios PW/ | 2022-03-28 12:11 | - | |
| Bios Power ON password reset/ | 2022-03-28 12:11 | - | |
| Bios Recovery In Acer Aspire 5315/ | 2022-03-28 12:11 | - | |
| Bios Recovery on 4810T/ | 2022-03-28 12:11 | - | |
| Bios Recovery on 5810tz/ | 2022-03-28 12:11 | - | |
| Bios Release notes/ | 2022-03-28 12:11 | - | |
| Bios Update Failed and now wont power on - Aspire 5810TZ/ | 2022-03-28 12:11 | - | |
| Bios access/ | 2022-03-28 12:11 | - | |
| Bios corrupted Acer 8930G, need a sollution/ | 2022-03-28 12:11 | - | |
| Bios mod for 5560-7679/ | 2022-03-28 12:11 | - | |
| Bios password after stand by problem/ | 2022-03-28 12:11 | - | |
| Bios recovery 3810, 4810, 5810 models/ | 2022-03-28 12:11 | - | |
| Bios recovery on Acer timeline 4810 TG - olympic edition/ | 2022-03-28 12:11 | - | |
| Bios recovery on Aspire One D250/ | 2022-03-28 12:11 | - | |
| Bios recovery on timeline series/ | 2022-03-28 12:11 | - | |
| Bios update failure Acer 5633Wlmi/ | 2022-03-28 12:11 | - | |
| Bios update guide for Aspire series/ | 2022-03-28 12:11 | - | |
| Bios update issue/ | 2022-03-28 12:11 | - | |
| Bios update on 5315-2153/ | 2022-03-28 12:11 | - | |
| Bios update on Acer Travemate 290...PLEASE HELP/ | 2022-03-28 12:11 | - | |
| Bios upgrade on 4011/ | 2022-03-28 12:11 | - | |
| Bizarre Laptop Boot Problem- Only Boots Once Per Day !/ | 2022-03-28 12:11 | - | |
| Black Screen Acer Aspire 1360/ | 2022-03-28 12:11 | - | |
| Black Screen White Blinking Cursor/ | 2022-03-28 12:11 | - | |
| Black screen one minute, working the next/ | 2022-03-28 12:11 | - | |
| Black screen with cursor/ | 2022-03-28 12:11 | - | |
| Blank Screen/ | 2022-03-28 12:11 | - | |
| Blank Screen With Mouse Cursor @ Vista Startup/ | 2022-03-28 12:11 | - | |
| Blank screen Acer Ferrari 3400/ | 2022-03-28 12:11 | - | |
| Blank screen problem with 8930G - Help with diagnosis please/ | 2022-03-28 12:11 | - | |
| Blargy- How do I remap Acer buttons on 5920/ | 2022-03-28 12:11 | - | |
| Blind Flash 5920g/ | 2022-03-28 12:11 | - | |
| Blinking Acer Aspire 6930g/ | 2022-03-28 12:11 | - | |
| Blinking power led, blank screen, won't boot/ | 2022-03-28 12:11 | - | |
| Blinking screen at startup/ | 2022-03-28 12:11 | - | |
| Blinking wireless light - Aspire/ | 2022-03-28 12:11 | - | |
| Bloatware removal guide for Acer/ | 2022-03-28 12:11 | - | |
| Blown Tuba CineBass Booster/ | 2022-03-28 12:11 | - | |
| Blu-Ray TV output/ | 2022-03-28 12:11 | - | |
| Blu-Ray drive or burner upgrade/ | 2022-03-28 12:11 | - | |
| Blu-Ray for Aspire 5739G/ | 2022-03-28 12:11 | - | |
| Blu-Ray won't display on TV/ | 2022-03-28 12:11 | - | |
| Blu-ray drive for my 7750G/ | 2022-03-28 12:11 | - | |
| BluRay problem [im new here too]/ | 2022-03-28 12:11 | - | |
| Blu Ray problems with Acer 8920g/ | 2022-03-28 12:11 | - | |
| Blue Gemstone/ | 2022-03-28 12:11 | - | |
| Blue Screen Problem!!/ | 2022-03-28 12:11 | - | |
| Blue Screen of Death/ | 2022-03-28 12:11 | - | |
| Blue Screen of Death after installing XP on 6920g/ | 2022-03-28 12:11 | - | |
| BlueTooth on a Acer Aspire 9300/ | 2022-03-28 12:11 | - | |
| Blue charge light comes on after shut down/ | 2022-03-28 12:11 | - | |
| Blue ray onto big TV from 8930/ | 2022-03-28 12:11 | - | |
| Bluescreen - RAM/ | 2022-03-28 12:11 | - | |
| Bluescreen after clean install with TinyXp/ | 2022-03-28 12:11 | - | |
| Blue screen on wake up/ | 2022-03-28 12:11 | - | |
| Blue screen problem and more/ | 2022-03-28 12:11 | - | |
| Blue screen with white dashes after 4gb memory upgrade 5100 series/ | 2022-03-28 12:11 | - | |
| Bluetooth/ | 2022-03-28 12:11 | - | |
| Bluetooth 1694/ | 2022-03-28 12:11 | - | |
| Bluetooth Driver For Ferrari/ | 2022-03-28 12:11 | - | |
| Bluetooth Help/ | 2022-03-28 12:11 | - | |
| Bluetooth Issue/ | 2022-03-28 12:11 | - | |
| Bluetooth Issues/ | 2022-03-28 12:11 | - | |
| Bluetooth Management SW/ | 2022-03-28 12:11 | - | |
| Bluetooth Module for Acer Aspire AS4730-4857/ | 2022-03-28 12:11 | - | |
| Bluetooth Module for Timeline 5810TZ/ | 2022-03-28 12:11 | - | |
| Bluetooth Module install in an 8943g/ | 2022-03-28 12:11 | - | |
| Bluetooth Question/ | 2022-03-28 12:11 | - | |
| Bluetooth addon/ | 2022-03-28 12:11 | - | |
| Bluetooth and Acer/ | 2022-03-28 12:11 | - | |
| Bluetooth and Wireless LAN - No-Function/ | 2022-03-28 12:11 | - | |
| Bluetooth autostart/ | 2022-03-28 12:11 | - | |
| Bluetooth device Aspire 6920g/ | 2022-03-28 12:11 | - | |
| Bluetooth error code 43/ | 2022-03-28 12:11 | - | |
| Bluetooth file transfer issue/ | 2022-03-28 12:11 | - | |
| Bluetooth for 1410/ | 2022-03-28 12:11 | - | |
| Bluetooth in 5672wlmi/ | 2022-03-28 12:11 | - | |
| Bluetoothmodul btm200 and Acer aspire 9920/ | 2022-03-28 12:11 | - | |
| Bluetooth module for 1410 1810T that doesn't constantly blink/ | 2022-03-28 12:11 | - | |
| Bluetooth module for 4501 WLMi/ | 2022-03-28 12:11 | - | |
| Bluetooth module for Aspire/ | 2022-03-28 12:11 | - | |
| Bluetooth not working on Aspire 5749/ | 2022-03-28 12:11 | - | |
| Bluetooth on 4501/ | 2022-03-28 12:11 | - | |
| Bluetooth on 5672WLMi/ | 2022-03-28 12:11 | - | |
| Bluetooth on 8204/ | 2022-03-28 12:11 | - | |
| Bluetooth on ASPIRE 9410Z/ | 2022-03-28 12:11 | - | |
| Bluetooth on Acer 7720Z/ | 2022-03-28 12:11 | - | |
| Bluetooth on Acers!/ | 2022-03-28 12:11 | - | |
| Bluetooth on frehsly-installed 1810TZ/ | 2022-03-28 12:11 | - | |
| Bluetooth on the Aspire 5021/ | 2022-03-28 12:11 | - | |
| Bluetooth phone/ | 2022-03-28 12:11 | - | |
| Bluetooth problem Acer Ferrari 4000 help/ | 2022-03-28 12:11 | - | |
| Bluetooth problem on my Acer TM8372/ | 2022-03-28 12:11 | - | |
| Bluetooth socket location Acer 9920/ | 2022-03-28 12:11 | - | |
| Bluetooth turning off on reboot [FIX] Aspire Timeline X/ | 2022-03-28 12:11 | - | |
| Bluray for Acer Travelmate 6292/ | 2022-03-28 12:11 | - | |
| Blu ray issue/ | 2022-03-28 12:11 | - | |
| Bluray playback problem - Aspire 8930/ | 2022-03-28 12:11 | - | |
| Blurry text on my Acer Aspire vN7, please help/ | 2022-03-28 12:11 | - | |
| BootMGR is missing/ | 2022-03-28 12:11 | - | |
| Boot Problem/ | 2022-03-28 12:11 | - | |
| Boot Timeline 3810T from USB DVD drive/ | 2022-03-28 12:11 | - | |
| Boot Times for SATA vs SSD/ | 2022-03-28 12:11 | - | |
| Bootable DVDRAM- is it possible/ | 2022-03-28 12:11 | - | |
| Bootable USB HD w 5672/ | 2022-03-28 12:11 | - | |
| Boot from dvd/ | 2022-03-28 12:11 | - | |
| Booting from USB problems/ | 2022-03-28 12:11 | - | |
| Booting from the SD slot!/ | 2022-03-28 12:11 | - | |
| Boot problem - Aspire 4730z/ | 2022-03-28 12:11 | - | |
| Boot problem on Acer 5920G/ | 2022-03-28 12:11 | - | |
| Boot up 8930G on a USB drive/ | 2022-03-28 12:11 | - | |
| Bought a Acer laptop...how do I downgrade to Xp/ | 2022-03-28 12:11 | - | |
| Bought an Acer Aspire 5613ZWLMi, got a 5610Z/ | 2022-03-28 12:11 | - | |
| Bought an Aspire w o HD need help with connector/ | 2022-03-28 12:11 | - | |
| Bought my first laptop, a 5570-2977/ | 2022-03-28 12:11 | - | |
| Bought myself Acer Aspire 5920G --D/ | 2022-03-28 12:11 | - | |
| Bought two 5750-6677 today/ | 2022-03-28 12:11 | - | |
| Box Dimension/ | 2022-03-28 12:11 | - | |
| Brand New Acer Models 2011/ | 2022-03-28 12:11 | - | |
| Brand Spanking New Acer 5672/ | 2022-03-28 12:11 | - | |
| Brand new 4720z won't turn on anymore! !/ | 2022-03-28 12:11 | - | |
| Brand new ACER 7535G laptop goes bust!!/ | 2022-03-28 12:11 | - | |
| Brand new ACER Aspire 5630 problem/ | 2022-03-28 12:11 | - | |
| Brand new Acer 4820T won't boot/ | 2022-03-28 12:11 | - | |
| Brand new Acer 5532, so many problems/ | 2022-03-28 12:11 | - | |
| Brand new Acer V5-571 (i3 model) - disappointments, advice needed/ | 2022-03-28 12:11 | - | |
| Brand new Travelmate 2300 will not power up!/ | 2022-03-28 12:11 | - | |
| Bricked Acer Extensa 5230E After BIOS Update/ | 2022-03-28 12:11 | - | |
| Bricked Bios Acer Aspire 7720 ICK70/ | 2022-03-28 12:11 | - | |
| Bricked Travelmate C110/ | 2022-03-28 12:11 | - | |
| Bricked my Acer Aspire 5739G!!/ | 2022-03-28 12:11 | - | |
| Brick updating bios aspire 7720Z/ | 2022-03-28 12:11 | - | |
| Brightness controls no longer work on Timeline 1410 upgraded to Windows 7 (32 bit)/ | 2022-03-28 12:11 | - | |
| Brightness function keys acting weird/ | 2022-03-28 12:11 | - | |
| Brightness problem with Timeline 4810TZ/ | 2022-03-28 12:11 | - | |
| Broadcom BCM4318 drivers/ | 2022-03-28 12:11 | - | |
| Broadcom HD Accelerator on Acer Timeline/ | 2022-03-28 12:11 | - | |
| Broke keyboard retaining tabs on Aspire One ZE6 D255 Gateway LT28/ | 2022-03-28 12:11 | - | |
| Broken Acer 5020, Repair Or Sell, Any Advice/ | 2022-03-28 12:11 | - | |
| Broken Hinges/ | 2022-03-28 12:11 | - | |
| Broken LCD - Send to Acer for repair or DIY/ | 2022-03-28 12:11 | - | |
| Broken Laptop - Please help!!/ | 2022-03-28 12:11 | - | |
| Broken Launch Board/ | 2022-03-28 12:11 | - | |
| Broken Ram bracket/ | 2022-03-28 12:11 | - | |
| Broken Screen Hinge/ | 2022-03-28 12:11 | - | |
| Broken Touchpad/ | 2022-03-28 12:11 | - | |
| Broken USB socket Acer 5516/ | 2022-03-28 12:11 | - | |
| Broken WiFi Switch on Aspire 1410/ | 2022-03-28 12:11 | - | |
| Broken case on Acer Aspire 3610/ | 2022-03-28 12:11 | - | |
| Broken headphone ending/ | 2022-03-28 12:11 | - | |
| Broken notebook acer 8102wlmi/ | 2022-03-28 12:11 | - | |
| Broken screen/ | 2022-03-28 12:11 | - | |
| Bsod/ | 2022-03-28 12:11 | - | |
| Budget Acer in UK/ | 2022-03-28 12:11 | - | |
| Budget of 800$/ | 2022-03-28 12:11 | - | |
| Buffer overload warning/ | 2022-03-28 12:11 | - | |
| Bug in Acer Aspire 4740G BIOS V1.05/ | 2022-03-28 12:11 | - | |
| Build Quality on Acer Aspire AS5755G-6823/ | 2022-03-28 12:11 | - | |
| Build quality/ | 2022-03-28 12:11 | - | |
| Built-in Microphone of Acer 6930G/ | 2022-03-28 12:11 | - | |
| Built-in mic/ | 2022-03-28 12:11 | - | |
| Bumping up the rez on the 5672/ | 2022-03-28 12:11 | - | |
| Burning DVDs on Acer Aspire 1712/ | 2022-03-28 12:11 | - | |
| Burnt out Charger port on aspire laptop/ | 2022-03-28 12:11 | - | |
| Bus speed/ | 2022-03-28 12:11 | - | |
| Busted Ferrari 5000 fan/ | 2022-03-28 12:11 | - | |
| Buy Aspire 5672 in Canada/ | 2022-03-28 12:11 | - | |
| Buy an 1810T now or wait for the Arrandale ULVs/ | 2022-03-28 12:11 | - | |
| Buy decision Acer 4005 vs asus w2v/ | 2022-03-28 12:11 | - | |
| Buyer Beware of Acer 5920G being sold at Micro Center!!!/ | 2022-03-28 12:11 | - | |
| Buying 4820TG 3820TG - Some questions/ | 2022-03-28 12:11 | - | |
| Buying 5920G in the UK/ | 2022-03-28 12:11 | - | |
| Buying a 4810T, but which one/ | 2022-03-28 12:11 | - | |
| Buying a 8204 now - What build date would it be/ | 2022-03-28 12:11 | - | |
| Buying an Acer/ | 2022-03-28 12:11 | - | |
| Buying an Acer 2023WLMI OVERSEAS/ | 2022-03-28 12:11 | - | |
| Buying an Acer 5920 tomorrow, question before I do/ | 2022-03-28 12:11 | - | |
| Buying an Acer 8200/ | 2022-03-28 12:11 | - | |
| Buying an Acer Computer/ | 2022-03-28 12:11 | - | |
| Buying a new Acer One battery/ | 2022-03-28 12:11 | - | |
| Buying a new LCD screen for ACER ASPIRE 5253-BZ480/ | 2022-03-28 12:11 | - | |
| Buying the 2023WLMI from overseas/ | 2022-03-28 12:11 | - | |
| Buying used Helios 500 (ryzen and vega)/ | 2022-03-28 12:11 | - | |
| Buy the TM8204 now or wait for the next Ferrari/ | 2022-03-28 12:11 | - | |
| Buzzing Noise from Acer Travelmate 230/ | 2022-03-28 12:11 | - | |
| Buzzing soung at up right corner ACER ASPIRE 2001/ | 2022-03-28 12:11 | - | |
| By far the most bizarre laptop problem I've ever encountered/ | 2022-03-28 12:11 | - | |
| C-50 or K145/ | 2022-03-28 12:11 | - | |
| C- Acer Empowering Technology eRecovery Autorun ACER TOOLS SHELEXEC.E XE/ | 2022-03-28 12:11 | - | |
| C- SWSetup Folder Not in Acer 5100-5674/ | 2022-03-28 12:11 | - | |
| C- drive and D- drive if i download and save software on my D- drive wil it make my pc faster/ | 2022-03-28 12:11 | - | |
| C2D Mobile Extreme X7800 Benchmark Results/ | 2022-03-28 12:11 | - | |
| C60 in the USA (for Acer Aspire One 522)/ | 2022-03-28 12:11 | - | |
| C100 tabletPC... several problems/ | 2022-03-28 12:11 | - | |
| C110 Operating System Not Found/ | 2022-03-28 12:11 | - | |
| C300 with SmartCard- any hard disk except original one not working/ | 2022-03-28 12:11 | - | |
| CC Deal on BF Any Good - Acer AMD Turion 64 Dual-Core TL-50/ | 2022-03-28 12:11 | - | |
| CD-drive no longer detected, 5920/ | 2022-03-28 12:11 | - | |
| CD Burning Issues/ | 2022-03-28 12:11 | - | |
| CD DVD rw not working PLEASE HELP!!! -(/ | 2022-03-28 12:11 | - | |
| CD Drive is not reading cds anymore/ | 2022-03-28 12:11 | - | |
| CD Rom drive isn't recognised Can I replace registry keys/ | 2022-03-28 12:11 | - | |
| CD drive problem/ | 2022-03-28 12:11 | - | |
| CD stuck in Aspire 7520 optical drive/ | 2022-03-28 12:11 | - | |
| CIR (consumer infrared port)Acer 4520/ | 2022-03-28 12:11 | - | |
| CIR Remote for Aspire 5920/ | 2022-03-28 12:11 | - | |
| CIR in 5920G/ | 2022-03-28 12:11 | - | |
| CLMLSvc.exe/ | 2022-03-28 12:12 | - | |
| CMOS Battery/ | 2022-03-28 12:12 | - | |
| CMOS Battery Help!!/ | 2022-03-28 12:12 | - | |
| CMOS Battery for Ferrari 3400/ | 2022-03-28 12:12 | - | |
| CMOS Battery location for Ferrari 3400/ | 2022-03-28 12:12 | - | |
| CMOS Jumper Switch 5610Z/ | 2022-03-28 12:12 | - | |
| CMOS battery for 8930G/ | 2022-03-28 12:12 | - | |
| CNET Review- TravelMate 8200 defeats MacBook Pro/ | 2022-03-28 12:12 | - | |
| COD4 on Acer Aspire 6920G, help/ | 2022-03-28 12:12 | - | |
| CPU-Z shows 1.6Ghz when I have a 2Ghz CPU/ | 2022-03-28 12:12 | - | |
| CPU Buzzing and Clicking - Acer 8204/ | 2022-03-28 12:12 | - | |
| CPU Compatibility with 5738G/ | 2022-03-28 12:12 | - | |
| CPU Memory ratio/ | 2022-03-28 12:12 | - | |
| CPU TL-50 vs MK-36 AMD Turion/ | 2022-03-28 12:12 | - | |
| CPU Temp Problem/ | 2022-03-28 12:12 | - | |
| CPU Temperatures!/ | 2022-03-28 12:12 | - | |
| CPU Temp on TM 4001wlci/ | 2022-03-28 12:12 | - | |
| CPU Upgrade for 4620Z Anyone try this yet/ | 2022-03-28 12:12 | - | |
| CPU Upgrade for 5315-2122/ | 2022-03-28 12:12 | - | |
| CPU Upgrade on Aspire 5315-2153/ | 2022-03-28 12:12 | - | |
| CPU Upgrade on Ferrari 3200/ | 2022-03-28 12:12 | - | |
| CPU Upgrade on a Aspire 3680/ | 2022-03-28 12:12 | - | |
| CPU and GPU/ | 2022-03-28 12:12 | - | |
| CPU and GPU Temperature/ | 2022-03-28 12:12 | - | |
| CPU and GPU upgrade on Acer Aspire 6930G/ | 2022-03-28 12:12 | - | |
| CPU and Screen problem!/ | 2022-03-28 12:12 | - | |
| CPU clock/ | 2022-03-28 12:12 | - | |
| CPU compatibility in acer aspire 8930G/ | 2022-03-28 12:12 | - | |
| CPU failure in aspire 5672 wlmi/ | 2022-03-28 12:12 | - | |
| CPU fan/ | 2022-03-28 12:12 | - | |
| CPU fan of Acer Aspire 5000/ | 2022-03-28 12:12 | - | |
| CPU fan speed control/ | 2022-03-28 12:12 | - | |
| CPU from Taiwan/ | 2022-03-28 12:12 | - | |
| CPU in 4820tg/ | 2022-03-28 12:12 | - | |
| CPU overclocking/ | 2022-03-28 12:12 | - | |
| CPU speed on battery!!/ | 2022-03-28 12:12 | - | |
| CPU stuck at 100% !/ | 2022-03-28 12:12 | - | |
| CPU temps, what do you think/ | 2022-03-28 12:12 | - | |
| CPU that compatible with Aspire 5670/ | 2022-03-28 12:12 | - | |
| CPU upgade for Acer 3100-1458/ | 2022-03-28 12:12 | - | |
| CPU upgrade aspire 7720/ | 2022-03-28 12:12 | - | |
| CPU upgrade failure/ | 2022-03-28 12:12 | - | |
| CPU upgrade for Acer Travelmate2303lmi/ | 2022-03-28 12:12 | - | |
| CRACK on my Acer notebook/ | 2022-03-28 12:12 | - | |
| Cable for extra HDD in Travelmate P6/ | 2022-03-28 12:11 | - | |
| Calibration of Laptop Monitor/ | 2022-03-28 12:11 | - | |
| Calling All Acer OCers! HWbot Action Time!/ | 2022-03-28 12:11 | - | |
| Calling Aspire 3680 Owners - True Max Ram/ | 2022-03-28 12:11 | - | |
| Calling Timeline 5810 owners!/ | 2022-03-28 12:11 | - | |
| Calling all 1500 Series users/ | 2022-03-28 12:11 | - | |
| Calling all Acer 5920 gamers! A little advice please-/ | 2022-03-28 12:11 | - | |
| Calling all Acer 8920 owner's/ | 2022-03-28 12:11 | - | |
| Calling all Samaritans - My Extensa 4420-5237 will not complete a Vista Home Premium (retail) installation/ | 2022-03-28 12:11 | - | |
| Call of Duty 2 & Ferrari 4005/ | 2022-03-28 12:11 | - | |
| Call of Duty 2 on TM 8104/ | 2022-03-28 12:11 | - | |
| Call out to acer owners with the GTS250M (8940g for example) for VGA bios/ | 2022-03-28 12:11 | - | |
| Call to Acer Aspire 5670-series owners! Help!/ | 2022-03-28 12:11 | - | |
| Camera causing BSOD - 5672 WLMi/ | 2022-03-28 12:11 | - | |
| Camera working spontaneous, Acer aspire 5630,Logitech,Vista,Skype/ | 2022-03-28 12:11 | - | |
| Can´t stress cpu to 100%/ | 2022-03-28 12:11 | - | |
| Can't Access BIOS after flash!/ | 2022-03-28 12:11 | - | |
| Can't Boot Acer Aspire 9300/ | 2022-03-28 12:11 | - | |
| Can't Find CD DVD Drive/ | 2022-03-28 12:11 | - | |
| Can't Load Windows - any version/ | 2022-03-28 12:11 | - | |
| Can't Load Windows 7 x64 on Acer 1410/ | 2022-03-28 12:11 | - | |
| Can't achieve max resolution of external monitor via Aspire 5740G - please help!/ | 2022-03-28 12:11 | - | |
| Can't add another partition on Acer Aspire 6920G/ | 2022-03-28 12:11 | - | |
| Can't be another faulty DC Adaptor/ | 2022-03-28 12:11 | - | |
| Can't buy Acer Extended Warranty - any recommendations/ | 2022-03-28 12:11 | - | |
| Can't downgrade Vista to XP on 7735Z - Need SATA drivers/ | 2022-03-28 12:11 | - | |
| Can't enable Bluetooth for Acer Aspire 5630-6803/ | 2022-03-28 12:11 | - | |
| Can't enable SATA back on 9520 after XP install/ | 2022-03-28 12:11 | - | |
| Can't find 5652wlmi/ | 2022-03-28 12:11 | - | |
| Can't find hidden partition/ | 2022-03-28 12:11 | - | |
| Can't find much info on this unit/ | 2022-03-28 12:11 | - | |
| Can't find new Predator Helios 300 (8th gen) for sale ANYWHERE online. Help/ | 2022-03-28 12:11 | - | |
| Can't find the ordinale 3171 in DLL-file LIBEAY32.dll/ | 2022-03-28 12:11 | - | |
| Can't find the right drivers after downgrading from Vista to XP/ | 2022-03-28 12:11 | - | |
| Can't fresh install Windows 8 from USB, lots of partition related problems (Acer Aspire S5-391)/ | 2022-03-28 12:11 | - | |
| Can't get ALT+F10 to work/ | 2022-03-28 12:11 | - | |
| Can't get Acer 6935 backlight to work/ | 2022-03-28 12:11 | - | |
| Can't get clean install of Windows 8.1 pick up product key from BIOS/ | 2022-03-28 12:11 | - | |
| Can't get recovery disk to load 5520 Help!!/ | 2022-03-28 12:11 | - | |
| Can't get started with USB boot (Acer 3810tz)/ | 2022-03-28 12:11 | - | |
| Can't insert any CD in CD-DVD Drive/ | 2022-03-28 12:11 | - | |
| Can't install Mobile Intel 965 Express Chipset on 5620/ | 2022-03-28 12:11 | - | |
| Can't install SSD in my TimelineX/ | 2022-03-28 12:11 | - | |
| Can't install Win XP pro on Acer Aspire 5102wlmi/ | 2022-03-28 12:11 | - | |
| Can't install XP on Acer Aspire 5050 - 5554/ | 2022-03-28 12:11 | - | |
| Can't install anything to program files/ | 2022-03-28 12:11 | - | |
| Can't navigate in bios/ | 2022-03-28 12:11 | - | |
| Can't remove memory cover/ | 2022-03-28 12:11 | - | |
| Can't rotate monitor in Win7x64, Acer 1410/ | 2022-03-28 12:11 | - | |
| Can't rotate screen in Intel GMA X3100/ | 2022-03-28 12:11 | - | |
| Can't save my power options settings in new Aspire 4810TZ/ | 2022-03-28 12:11 | - | |
| Can't start webcam after reinstalling Vista on 5920G/ | 2022-03-28 12:11 | - | |
| Can't update my BIOS, Aspire 6920/ | 2022-03-28 12:11 | - | |
| Can't use Bluetooth on Aspire 9300/ | 2022-03-28 12:11 | - | |
| Can't use Windows any more (Aspire 1691)/ | 2022-03-28 12:11 | - | |
| Can 32bit vista home premium be installed side by side with 64bit/ | 2022-03-28 12:11 | - | |
| Can 8930G support 8GB RAM/ | 2022-03-28 12:11 | - | |
| Can Acer laptops run Dual external Monitor setups/ | 2022-03-28 12:11 | - | |
| Can Anyone Help Me,please !/ | 2022-03-28 12:11 | - | |
| Can Aspire 1410 video memory be changed/ | 2022-03-28 12:11 | - | |
| Can Aspire 1690 set LCD to 75Hz up/ | 2022-03-28 12:11 | - | |
| Can Aspire One recover from a flash drive/ | 2022-03-28 12:11 | - | |
| Can Ferrari 4005 use mini CD DVDs/ | 2022-03-28 12:11 | - | |
| Can I Upgrade The Graphic Card On Timeline 5810tz/ | 2022-03-28 12:11 | - | |
| Can I add RAM to My 3820TG-7945/ | 2022-03-28 12:11 | - | |
| Can I boot from PQSERVICE to restore/ | 2022-03-28 12:11 | - | |
| Can I buy acer notebook from www.comet.co.uk while I am in USA/ | 2022-03-28 12:11 | - | |
| Can I change the wifi card in 5741G/ | 2022-03-28 12:11 | - | |
| Can I connect my laptop's HDD with a Desktop's USB/ | 2022-03-28 12:11 | - | |
| Can I downgrade an Acer 5100-3372 to XP/ | 2022-03-28 12:11 | - | |
| Can I insert a Bluetooth to my Acer laptop/ | 2022-03-28 12:11 | - | |
| Can I install WLAN on winXP/ | 2022-03-28 12:11 | - | |
| Can I install XP, then change back to Vista later/ | 2022-03-28 12:11 | - | |
| Can I install eRecovery by myself (Aspire169x)/ | 2022-03-28 12:11 | - | |
| Can I install windows XP 64 on a 7520/ | 2022-03-28 12:11 | - | |
| Can I leave my Acer Latptop on 24 7/ | 2022-03-28 12:11 | - | |
| Can I overclock 3810t cpu/ | 2022-03-28 12:11 | - | |
| Can I put 2x2GB=4GB in the 5315/ | 2022-03-28 12:11 | - | |
| Can I put my HDD in another computer/ | 2022-03-28 12:11 | - | |
| Can I replace my 8930g 1920x1080 w 1920x1200 lcd/ | 2022-03-28 12:11 | - | |
| Can I replace the fan in my 7720/ | 2022-03-28 12:11 | - | |
| Can I restore Vista from Acer PQSERVICE Partition/ | 2022-03-28 12:11 | - | |
| Can I resurrect a dead ACER Ferrari 3400/ | 2022-03-28 12:11 | - | |
| Can I run Vista64 on 5672 (Intel Core Duo T2300)/ | 2022-03-28 12:11 | - | |
| Can I run an Acer without a battery/ | 2022-03-28 12:11 | - | |
| Can I set invisible BIOS settings/ | 2022-03-28 12:11 | - | |
| Can I still use my laptop if I remove the battery/ | 2022-03-28 12:11 | - | |
| Can I tilt my laptop/ | 2022-03-28 12:11 | - | |
| Can I turn of the CPU throttling/ | 2022-03-28 12:11 | - | |
| Can I upgrade 5920 with x3100 IGP to 8xxxm/ | 2022-03-28 12:11 | - | |
| Can I upgrade Acer Aspire 2930 CPU/ | 2022-03-28 12:11 | - | |
| Can I upgrade my Acer 7720-6398/ | 2022-03-28 12:11 | - | |
| Can I upgrade my aspire 5630/ | 2022-03-28 12:11 | - | |
| Can I upgrade the BIOS of my Gateway EC1435u (Acer 1410-2285)/ | 2022-03-28 12:11 | - | |
| Can We Control 5930 Fans/ | 2022-03-28 12:11 | - | |
| Can You Recommend a 14-inch Glossy Screen 1080p Acer for Movies Gaming/ | 2022-03-28 12:11 | - | |
| Can a 1920x1080 resolution be reduced to 1366x768 in 6930 6920/ | 2022-03-28 12:11 | - | |
| Can a WD10TPVT fit in a Acer Aspire AS5740G-6395/ | 2022-03-28 12:11 | - | |
| Canadian store for 8204/ | 2022-03-28 12:11 | - | |
| Can an Acer S3-391 work without the 20GB SSD cache/ | 2022-03-28 12:11 | - | |
| Can an Aspire 1410-2039 do TV out/ | 2022-03-28 12:11 | - | |
| Can an acer laptops be overclocked/ | 2022-03-28 12:11 | - | |
| Can anybody identify this type of empty slot in Acer Aspire 5600 series laptop/ | 2022-03-28 12:11 | - | |
| Can anybody tell AO521 battery model/ | 2022-03-28 12:11 | - | |
| Can anyone confirm if the Acer Timeline has/ | 2022-03-28 12:11 | - | |
| Can anyone decipher an Acer model number suffix/ | 2022-03-28 12:11 | - | |
| Can anyone get apps like AnyDVD or DVDRegionFree working on the 8204/ | 2022-03-28 12:11 | - | |
| Can anyone help me find an Acer AS5552-6838 15.6-Inch Laptop (Mesh Black)/ | 2022-03-28 12:11 | - | |
| Can anyone help me with this problem/ | 2022-03-28 12:11 | - | |
| Can anyone play The Sims 2 on Aspire One/ | 2022-03-28 12:11 | - | |
| Can anyone please provide a guideline for undervolting the GTX 1080 Max-Q properly (Triton 700)/ | 2022-03-28 12:11 | - | |
| Can anyone tell me why this notebook is so cheap/ | 2022-03-28 12:11 | - | |
| Can anyone try to decode this file/ | 2022-03-28 12:11 | - | |
| Can anyone with a 6920G run Team Fortress 2 at acceptable frame rates/ | 2022-03-28 12:11 | - | |
| Can aspire 5100 take a WD Scorpio Blue 320Gb/ | 2022-03-28 12:11 | - | |
| Can ePower Management or Launch Manager recognize custom hardware/ | 2022-03-28 12:11 | - | |
| Can i Upgrade my ram to 6-8GB on my Acer Aspire 6920G/ | 2022-03-28 12:11 | - | |
| Can i do .flv to DVD with 5920G software/ | 2022-03-28 12:11 | - | |
| Can i upgrade my Intel 915gm gms Vga Card/ | 2022-03-28 12:11 | - | |
| Can i upgrade the battery/ | 2022-03-28 12:11 | - | |
| Can i use a 17.3 inch laptop sleeve for Predator 15/ | 2022-03-28 12:11 | - | |
| Can i use another pc to reflash my bios/ | 2022-03-28 12:11 | - | |
| Can laptop videocards be exchanged/ | 2022-03-28 12:11 | - | |
| Can my 5920g Input Output HDMI/ | 2022-03-28 12:11 | - | |
| Can my laptop use any 15.4 inch lcd screen/ | 2022-03-28 12:11 | - | |
| Cannot System Recovery on ACER EXTENSA 5620Z/ | 2022-03-28 12:11 | - | |
| Cannot boot after changing system locale/ | 2022-03-28 12:11 | - | |
| Cannot boot from cd (Aspire 3610)/ | 2022-03-28 12:11 | - | |
| Cannot burn dl dvd's on Aspire 5920g/ | 2022-03-28 12:11 | - | |
| Cannot cool Turion 64 x2 TL-60. WHY/ | 2022-03-28 12:11 | - | |
| Cannot get WMP 11 to run on brand new 6935G - help please !!/ | 2022-03-28 12:11 | - | |
| Cannot get video signal out of Acer Aspire/ | 2022-03-28 12:11 | - | |
| Cannot install Broadcom Card Reader drivers on Aspire E1-571/ | 2022-03-28 12:11 | - | |
| Cannot put disk in drive/ | 2022-03-28 12:11 | - | |
| Cannot record my own voice/ | 2022-03-28 12:11 | - | |
| Cannot reinstall Vista/ | 2022-03-28 12:11 | - | |
| Cannot remove 1810t Keyboard/ | 2022-03-28 12:11 | - | |
| Cannot restore factory format/ | 2022-03-28 12:11 | - | |
| Cannot switch to AHCI SATA Mode after installing Win XP on D255/ | 2022-03-28 12:11 | - | |
| Cannot use SetFSB with AO751h/ | 2022-03-28 12:11 | - | |
| Cannot wake Acer AO531 up with a wireless mice/ | 2022-03-28 12:11 | - | |
| Cannot write any DVDs using any program/ | 2022-03-28 12:11 | - | |
| Can processors be upgraded in Aspire series/ | 2022-03-28 12:11 | - | |
| Can someone give me a simply way to under clock the 6920g +Temps/ | 2022-03-28 12:11 | - | |
| Can someone help me with 1080p videos. please read/ | 2022-03-28 12:11 | - | |
| Can someone help me with updating bios Aspire 5551 2010 series/ | 2022-03-28 12:11 | - | |
| Can someone who has the acer aspire 7750g do a review of it pretty please!!!/ | 2022-03-28 12:11 | - | |
| Cant Disable Integrated GPU in BIOS, Help/ | 2022-03-28 12:11 | - | |
| Cant Recover My Acer Laptop Help Plz/ | 2022-03-28 12:11 | - | |
| Cant access hidden partition/ | 2022-03-28 12:11 | - | |
| Cant boot from hidden partition/ | 2022-03-28 12:11 | - | |
| Cant defragment my PC/ | 2022-03-28 12:11 | - | |
| Cant find the Acer Ferrari 4002/ | 2022-03-28 12:11 | - | |
| Cant get Audio to work on Acer Aspire r3610/ | 2022-03-28 12:11 | - | |
| Cant get Launch Manager buttons to work on Acer 6920 HELP !!!!/ | 2022-03-28 12:11 | - | |
| Cant get into BIOS (8204)/ | 2022-03-28 12:11 | - | |
| Can the 5920G handle 800mhz DDR-2/ | 2022-03-28 12:11 | - | |
| Can the 6920G (9500m GS) output composite video signals/ | 2022-03-28 12:11 | - | |
| Can the Aspire 1690 be upgraded/ | 2022-03-28 12:11 | - | |
| Can the Aspire 4720z use Internal Bluetooth/ | 2022-03-28 12:11 | - | |
| Can the Aspire V3-571 support 16GB RAM/ | 2022-03-28 12:11 | - | |
| Can the GPU be upgraded in this model/ | 2022-03-28 12:11 | - | |
| Can this kind of backlighting considered as normal/ | 2022-03-28 12:11 | - | |
| Can this netbook be upgraded to Windows7/ | 2022-03-28 12:11 | - | |
| Can timeline digital media card reader read SDHC/ | 2022-03-28 12:11 | - | |
| Cant recovery/ | 2022-03-28 12:11 | - | |
| Can we expect Acer laptops with X2 TL50/ | 2022-03-28 12:11 | - | |
| Can you get Acer Aspire 5930 yet/ | 2022-03-28 12:11 | - | |
| Can you install Mac OS X on the Acer Aspire s7-392/ | 2022-03-28 12:11 | - | |
| Can you install an uprated 3rd party battery in the 11.6 2012 S7/ | 2022-03-28 12:11 | - | |
| Can you keep a netbook upside down/ | 2022-03-28 12:11 | - | |
| Can you put int PCI-E mini cards in 5672/ | 2022-03-28 12:11 | - | |
| Can you upgrade the cpu on Aspire 3002lci/ | 2022-03-28 12:11 | - | |
| Can you upgrade video card of ACER ASPIRE 7720G/ | 2022-03-28 12:11 | - | |
| Capturing webcam video/ | 2022-03-28 12:11 | - | |
| CardBus drivers/ | 2022-03-28 12:11 | - | |
| CardBus expansion question, USB expander --- Acer Aspire 5601/ | 2022-03-28 12:11 | - | |
| Card Reader Problems/ | 2022-03-28 12:11 | - | |
| Card Reader on acer 3050 - Installed Drivers, Still doesnt Pick up my memory stick duo/ | 2022-03-28 12:11 | - | |
| Cardbus Controller and Base System Device Issue/ | 2022-03-28 12:11 | - | |
| Cardbus Firewire card disables Wireless/ | 2022-03-28 12:11 | - | |
| Card reader cannot read a 2GB H-Type xD card/ | 2022-03-28 12:11 | - | |
| Card reader update for Acer 1692 WLMI/ | 2022-03-28 12:11 | - | |
| Carry it in or solve it by myself/ | 2022-03-28 12:11 | - | |
| Case for 2012/ | 2022-03-28 12:11 | - | |
| Case for Ferrari 4005/ | 2022-03-28 12:11 | - | |
| Catalyst 6.5 Mobility A-ok For OC/ | 2022-03-28 12:11 | - | |
| Catalyst 6.10/ | 2022-03-28 12:11 | - | |
| Catalyst 11.10 breaks Sapphire TriXX voltage control/ | 2022-03-28 12:11 | - | |
| Catalyst Mobility 6.10 for Windows XP/ | 2022-03-28 12:11 | - | |
| Catalyst drivers uncompatible with mobility Radeon/ | 2022-03-28 12:11 | - | |
| Cd drive error/ | 2022-03-28 12:11 | - | |
| Cdrom not working properly on aspire 5622/ | 2022-03-28 12:11 | - | |
| Celeron'M 420/ | 2022-03-28 12:11 | - | |
| Celeron vs core 2 duo (need technical help) cannot choose/ | 2022-03-28 12:11 | - | |
| Centrino Properties in Device Manager/ | 2022-03-28 12:11 | - | |
| Centrino or P4 Confused/ | 2022-03-28 12:11 | - | |
| Centrino or P4M/ | 2022-03-28 12:11 | - | |
| Centrino performance/ | 2022-03-28 12:11 | - | |
| Change 1410 Resolution to 1024x576/ | 2022-03-28 12:11 | - | |
| Change 5920G default sound setting/ | 2022-03-28 12:11 | - | |
| Change Acer 3202 XCI CMOS Battery/ | 2022-03-28 12:11 | - | |
| Change CTRL to FN, possible/ | 2022-03-28 12:11 | - | |
| Change hard drive on 8935g/ | 2022-03-28 12:11 | - | |
| Change in keyboard key coniguratons/ | 2022-03-28 12:11 | - | |
| Change the FSB & CPU frequency on Aspire 5315, which soft/ | 2022-03-28 12:11 | - | |
| Change your harddisk... and the recovery cd's wont work (TimelineX 5820TG)/ | 2022-03-28 12:11 | - | |
| Changing 8204 to ntfs/ | 2022-03-28 12:11 | - | |
| Changing GPU in my Acer Aspire 5742G/ | 2022-03-28 12:11 | - | |
| Changing Graphics card on Acer Aspire 5810T Possible/ | 2022-03-28 12:11 | - | |
| Changing HDD on Aspire 5560/ | 2022-03-28 12:11 | - | |
| Changing Hard Drive in Acer 1692wlmi/ | 2022-03-28 12:11 | - | |
| Changing Medal Of Honor Airborne Resolution/ | 2022-03-28 12:11 | - | |
| Changing hard drive in acer 1692/ | 2022-03-28 12:11 | - | |
| Changing language from German to English on new Travelmate 8371/ | 2022-03-28 12:11 | - | |
| Changing operation mode of GPU to 2D only/ | 2022-03-28 12:11 | - | |
| Changing speaker settings Aspire 5920/ | 2022-03-28 12:11 | - | |
| Changing the DVD RAM drive on 5634WLMi/ | 2022-03-28 12:11 | - | |
| Changing the dvd drive on an acer aspire 1692WLMi, part II/ | 2022-03-28 12:11 | - | |
| Changing the dvd drive on an acer aspire 1692WLMi/ | 2022-03-28 12:11 | - | |
| Changing the function of the side buttons (Wireless Bluetooth activators, etc)/ | 2022-03-28 12:11 | - | |
| Changing the graphics card on 4820TG/ | 2022-03-28 12:11 | - | |
| Charging 1681/ | 2022-03-28 12:11 | - | |
| Charging Battery Question/ | 2022-03-28 12:11 | - | |
| Charging Issues/ | 2022-03-28 12:11 | - | |
| Charging Problem Acer Aspire 1683wlmi/ | 2022-03-28 12:11 | - | |
| Charging Problem for ACER 5050 Laptop/ | 2022-03-28 12:11 | - | |
| Charging Question/ | 2022-03-28 12:11 | - | |
| Charging beep noise/ | 2022-03-28 12:11 | - | |
| Charging problem with Acer Travelmate 4152/ | 2022-03-28 12:11 | - | |
| Charging up/ | 2022-03-28 12:11 | - | |
| Cheaper than 4400/ | 2022-03-28 12:11 | - | |
| Cheapest Place to Buy Second power adapter/ | 2022-03-28 12:11 | - | |
| Check Quality/ | 2022-03-28 12:11 | - | |
| Check out this cool 5920G Video!!/ | 2022-03-28 12:11 | - | |
| Check these Temps on my acer 6920G/ | 2022-03-28 12:11 | - | |
| China Help 5610Z/ | 2022-03-28 12:11 | - | |
| Chipset driver for 8943g/ | 2022-03-28 12:11 | - | |
| Choice b w two acers (Sempron vs Centrino)/ | 2022-03-28 12:11 | - | |
| Choosing between 2 laptops, not familiar with Radeon or Onboard Graphics Media Accelerators/ | 2022-03-28 12:11 | - | |
| Choosing the right graphics card for 8920g/ | 2022-03-28 12:11 | - | |
| Choosy Aspire 5602 DVD Drive/ | 2022-03-28 12:11 | - | |
| Choppy DVD playback driving me nuts!!/ | 2022-03-28 12:11 | - | |
| Choppy HDMI out video...Possible Acer GPU Bios Driver Issues/ | 2022-03-28 12:11 | - | |
| Choppy Media Playback on Aspire 3100 Notebook/ | 2022-03-28 12:11 | - | |
| Choppy Sound, Video and DPC Latency Issues/ | 2022-03-28 12:11 | - | |
| Choppy sound on Acer Aspire 3102WLMi(Vista). Help needed!/ | 2022-03-28 12:11 | - | |
| Chwing gum damage to LCD screen, need advice/ | 2022-03-28 12:11 | - | |
| CineCrystal vs. CrystalBrite/ | 2022-03-28 12:11 | - | |
| CineDash, working as a VUmeter/ | 2022-03-28 12:11 | - | |
| Cine Dash any good/ | 2022-03-28 12:11 | - | |
| CineDash problem on Acer Aspire 6920G/ | 2022-03-28 12:11 | - | |
| CineDash problems since v1.14/ | 2022-03-28 12:11 | - | |
| Cinedash For Acer Aspire 6920g/ | 2022-03-28 12:11 | - | |
| Cinedash volume problem with windows 7/ | 2022-03-28 12:11 | - | |
| Cinetouch + Winamp/ | 2022-03-28 12:11 | - | |
| Clean Install/ | 2022-03-28 12:12 | - | |
| Clean Install Win 8.1 on an Acer/ | 2022-03-28 12:12 | - | |
| Cleaners/ | 2022-03-28 12:12 | - | |
| Cleaning Aspire 5732z/ | 2022-03-28 12:12 | - | |
| Cleaning a HeatSink -6930g/ | 2022-03-28 12:12 | - | |
| Cleaning keys on keyboard (7750g)/ | 2022-03-28 12:12 | - | |
| Cleaning out an Aspire 5102/ | 2022-03-28 12:12 | - | |
| Clean install Acer 5920 - What do I need/ | 2022-03-28 12:12 | - | |
| Clean install Vista- hard drive partitioning question/ | 2022-03-28 12:12 | - | |
| Clean install on Acer Aspire 5672 with win xp pro What programs to install or not/ | 2022-03-28 12:12 | - | |
| Clean install over vista 32bit with Windows 7/ | 2022-03-28 12:12 | - | |
| Clean installs/ | 2022-03-28 12:12 | - | |
| Clean keyboard on Acer 5315/ | 2022-03-28 12:12 | - | |
| Clean os install without PQService backup/ | 2022-03-28 12:12 | - | |
| Clicking Hard Drive on TravelMate 4501/ | 2022-03-28 12:12 | - | |
| Clicking sound on Extensa 4620Z/ | 2022-03-28 12:12 | - | |
| Clicking sound on acer timeline u m5 when idle (I think it's the HD)/ | 2022-03-28 12:12 | - | |
| Clip to plug in keyboard broke off. Anything I can do/ | 2022-03-28 12:12 | - | |
| Closed Lid Sensor (Aspire 6920)/ | 2022-03-28 12:12 | - | |
| Close laptop with external monitor/ | 2022-03-28 12:12 | - | |
| Clueless about Acer/ | 2022-03-28 12:12 | - | |
| College Laptop - 3810T a good choice/ | 2022-03-28 12:12 | - | |
| Color problem with Acer TravelMate 4402WLMI and WMV video files/ | 2022-03-28 12:12 | - | |
| Color profiles for ACER screens/ | 2022-03-28 12:12 | - | |
| Colour of original screws Acer ES1-131 back casing/ | 2022-03-28 12:12 | - | |
| Come in if you own a Ferrari!!!/ | 2022-03-28 12:12 | - | |
| Coming out of hibernation/ | 2022-03-28 12:12 | - | |
| Comments and Questions about the Aspire 4730Z/ | 2022-03-28 12:12 | - | |
| Comments on Acer Aspire 1690 WLMi/ | 2022-03-28 12:12 | - | |
| Comments on the Travelmate 4202 duo core/ | 2022-03-28 12:12 | - | |
| Communication problem/ | 2022-03-28 12:12 | - | |
| Compact Ferrari/ | 2022-03-28 12:12 | - | |
| Compaq Setup partition/ | 2022-03-28 12:12 | - | |
| Comparable model to Dell 9300 or 9400/ | 2022-03-28 12:12 | - | |
| Compare- UK vs US/ | 2022-03-28 12:12 | - | |
| Comparing Quanta and AUO displays for 5672wmli/ | 2022-03-28 12:12 | - | |
| Comparing Radeon xpress 1100/ | 2022-03-28 12:12 | - | |
| Comparing new Acer TM3204 with CL56 and Sony S360/ | 2022-03-28 12:12 | - | |
| Comp goes into standby - I get disconnected/ | 2022-03-28 12:12 | - | |
| Complete Config For All Acer Notebooks/ | 2022-03-28 12:12 | - | |
| Completely Erase [Acer 6920 WindowsVista] Help/ | 2022-03-28 12:12 | - | |
| Completely erased hard drive/ | 2022-03-28 12:12 | - | |
| Completely restore system - need guidance/ | 2022-03-28 12:12 | - | |
| Computer Freezes/ | 2022-03-28 12:12 | - | |
| Computer Runs In Bios With Battery but/ | 2022-03-28 12:12 | - | |
| Computer fool with battery problem!/ | 2022-03-28 12:12 | - | |
| Computer keeps rebooting/ | 2022-03-28 12:12 | - | |
| Computer types backwards/ | 2022-03-28 12:12 | - | |
| Concern over ordering new Acer Aspire 9402/ | 2022-03-28 12:12 | - | |
| Concerns over acer build qualtiy/ | 2022-03-28 12:12 | - | |
| Configure Launch Manager/ | 2022-03-28 12:12 | - | |
| Configure to Order/ | 2022-03-28 12:12 | - | |
| Configuring the hotkey buttons on the keyboard/ | 2022-03-28 12:12 | - | |
| Conflicting Info on Aspire 3000/ | 2022-03-28 12:12 | - | |
| Confused ... again/ | 2022-03-28 12:12 | - | |
| Confused...which one is true temperature/ | 2022-03-28 12:12 | - | |
| Confused/ | 2022-03-28 12:12 | - | |
| Confused Scared with my new HD in 5672/ | 2022-03-28 12:12 | - | |
| Confused about Acer Vista SP1 drivers/ | 2022-03-28 12:12 | - | |
| Confused about my 5102WLMi Battery capacity/ | 2022-03-28 12:12 | - | |
| Confused by Driver Sets/ | 2022-03-28 12:12 | - | |
| Confused by battery spec !!!/ | 2022-03-28 12:12 | - | |
| Confused by model numbers/ | 2022-03-28 12:12 | - | |
| Confused on FAT32 to NTFS and recovery partition/ | 2022-03-28 12:12 | - | |
| Confusing Aspire Model sub Model Numbers/ | 2022-03-28 12:12 | - | |
| Confusing specs on my Aspire 5100-5355/ | 2022-03-28 12:12 | - | |
| Confusion over Aspire 5920G and ATI driver update/ | 2022-03-28 12:12 | - | |
| Congrats TehSuigi on achieving Mod status/ | 2022-03-28 12:12 | - | |
| Connecting 4500 to a TV via RCA/ | 2022-03-28 12:12 | - | |
| Connecting 8920g 8930 to LCD TV/ | 2022-03-28 12:12 | - | |
| Connecting Acer Aspire 5733 to TV/ | 2022-03-28 12:12 | - | |
| Connecting Acer Extensa 4420 to Sony Bravia/ | 2022-03-28 12:12 | - | |
| Connecting Aspire One 110L to 37 lcd tv/ | 2022-03-28 12:12 | - | |
| Connecting a Acer Travelmate 8204WLMi to an audio receiver/ | 2022-03-28 12:12 | - | |
| Connecting an Aspire 6920 to a P223w Monitor/ | 2022-03-28 12:12 | - | |
| Connecting an external HDD to Acer 6930G/ | 2022-03-28 12:12 | - | |
| Connecting computer to television/ | 2022-03-28 12:12 | - | |
| Connecting laptop to TV/ | 2022-03-28 12:12 | - | |
| Connecting laptop to TV via VGA/ | 2022-03-28 12:12 | - | |
| Connecting to the TV/ | 2022-03-28 12:12 | - | |
| Connecting to wireless/ | 2022-03-28 12:12 | - | |
| Connectinig Acer 1810TZ to LCD screen/ | 2022-03-28 12:12 | - | |
| Connetcing acer apsire to tv, with surround sound/ | 2022-03-28 12:12 | - | |
| Consensus of best LCD brand in current Acers/ | 2022-03-28 12:12 | - | |
| Consensus on 4820TG vs. 3820TG's temperatures cooling/ | 2022-03-28 12:12 | - | |
| Consensus on 5315 w T9300/ | 2022-03-28 12:12 | - | |
| Considering 2 different Acers (1430 and 3820T). Questions/ | 2022-03-28 12:12 | - | |
| Considering Acer, a few questions/ | 2022-03-28 12:12 | - | |
| Considering Acer Read this first/ | 2022-03-28 12:12 | - | |
| Considering TM 8204WLMi - Some Questions/ | 2022-03-28 12:12 | - | |
| Considering an Acer 6930g/ | 2022-03-28 12:12 | - | |
| Considering buying an Acer laptop/ | 2022-03-28 12:12 | - | |
| Considering swapping acer notebooks/ | 2022-03-28 12:12 | - | |
| Constant problems with internet connection/ | 2022-03-28 12:12 | - | |
| Constant turning off and on open and close/ | 2022-03-28 12:12 | - | |
| Consumer InfraRed on 5920G and HVR-1300 remote/ | 2022-03-28 12:12 | - | |
| Consumer Reports/ | 2022-03-28 12:12 | - | |
| Consumer Reports 2008 Buying Guide/ | 2022-03-28 12:12 | - | |
| Contemplating buying the TravelMate 5601/ | 2022-03-28 12:12 | - | |
| Contrast Control in laptops/ | 2022-03-28 12:12 | - | |
| Contribution- Aspire Wallpapers/ | 2022-03-28 12:12 | - | |
| Control CPU speed without installer Acer's Power Management Software/ | 2022-03-28 12:12 | - | |
| Control Panel - Folder Options - Hide empty drives in the Computer folder - My 1810T's Card Reader doesn't appear/ | 2022-03-28 12:12 | - | |
| Control fan speed on my Acer/ | 2022-03-28 12:12 | - | |
| Convert Format Problem with 5670/ | 2022-03-28 12:12 | - | |
| Converting C- partition to NTFS/ | 2022-03-28 12:12 | - | |
| Cooking on my Aspire/ | 2022-03-28 12:12 | - | |
| Cooler Acer nitro 5 i5-8250U - NH.Q2XEP.001/ | 2022-03-28 12:12 | - | |
| Cooler for Aspire 5920/ | 2022-03-28 12:12 | - | |
| Cooler for your lappie See this thread/ | 2022-03-28 12:12 | - | |
| Coolers for the 3820TG/ | 2022-03-28 12:12 | - | |
| Cooling Laptop/ | 2022-03-28 12:12 | - | |
| Cooling Pad/ | 2022-03-28 12:12 | - | |
| Cooling Pad Recommendations/ | 2022-03-28 12:12 | - | |
| Cooling Pads/ | 2022-03-28 12:12 | - | |
| Cooling Question/ | 2022-03-28 12:12 | - | |
| Cooling down the Travelmate 8200/ | 2022-03-28 12:12 | - | |
| Cooling mods/ | 2022-03-28 12:12 | - | |
| Copper Mod on Acer Aspire 4937G (NVIDIA G105M)/ | 2022-03-28 12:12 | - | |
| Core 2 Duo T5800 VS Core 2 Extreme x9100/ | 2022-03-28 12:12 | - | |
| Core 2 Duo in Aspir 5672wlmi/ | 2022-03-28 12:12 | - | |
| Core 2 Extreme X9100 Tempratures in 6930G/ | 2022-03-28 12:12 | - | |
| Core 2 duo power management/ | 2022-03-28 12:12 | - | |
| Core Duo - HT Status Disabled/ | 2022-03-28 12:12 | - | |
| Core Duo Cpu Temp Util/ | 2022-03-28 12:12 | - | |
| Core i7 620m CPU thermal throttling upon reaching 90 degrees, causing Turbo Boost to shut down/ | 2022-03-28 12:12 | - | |
| Core i7 Update for Acer Timeline... !/ | 2022-03-28 12:12 | - | |
| Corrupt Optiarc BD ROM BC-5500S Drivers/ | 2022-03-28 12:12 | - | |
| Corsair/ | 2022-03-28 12:12 | - | |
| Costco 17 Acer Aspire V3/ | 2022-03-28 12:12 | - | |
| Costco Aspire 5 A515-51G-82TP Display/ | 2022-03-28 12:12 | - | |
| Cost of a major 6920G upgrade/ | 2022-03-28 12:12 | - | |
| Could I upgrade to 4GB memory/ | 2022-03-28 12:12 | - | |
| Could Timeline AS3810T-6775 support external Bluray drive/ | 2022-03-28 12:12 | - | |
| Could a SSD be a possbile solution to a broken HDD/ | 2022-03-28 12:12 | - | |
| Could i use parts form an Aspire 5570 into 3000/ | 2022-03-28 12:12 | - | |
| Couple Question/ | 2022-03-28 12:12 | - | |
| Couple issues with 4810T/ | 2022-03-28 12:12 | - | |
| Couple of 6935g problems/ | 2022-03-28 12:12 | - | |
| Couple of Qs about new Aspire 7750g/ | 2022-03-28 12:12 | - | |
| Couple of questions about my 8920g/ | 2022-03-28 12:12 | - | |
| Couple warranty questions/ | 2022-03-28 12:12 | - | |
| Cpu-Z shows my 1333Mhz ram at 532.2Mhz/ | 2022-03-28 12:12 | - | |
| Cpu Core Temps ! ! !/ | 2022-03-28 12:12 | - | |
| Cpu and other upgrades/ | 2022-03-28 12:12 | - | |
| Cpu question/ | 2022-03-28 12:12 | - | |
| Cpu upgrades/ | 2022-03-28 12:12 | - | |
| Cracked 1410-2285 Screen/ | 2022-03-28 12:12 | - | |
| Cracked Acer Timelinex 4830TG-6450 screen/ | 2022-03-28 12:12 | - | |
| Cracked LCD, ACER won't help me/ | 2022-03-28 12:12 | - | |
| Cracked LCD/ | 2022-03-28 12:12 | - | |
| Cracked Screen Acer Travelmate 4200/ | 2022-03-28 12:12 | - | |
| Cracked Screen After 8 Days!/ | 2022-03-28 12:12 | - | |
| Cracked back cover on my Aspire 9410/ | 2022-03-28 12:12 | - | |
| Cracked or Pixel Problem/ | 2022-03-28 12:12 | - | |
| Crack in screen casing - Ferarri 3200/ | 2022-03-28 12:12 | - | |
| Crackling sounds on my ACER Aspire 8930G laptop/ | 2022-03-28 12:12 | - | |
| Crack on the back of my screen on my Acer Aspire 5021WLMI - Any with same problem/ | 2022-03-28 12:12 | - | |
| Crank more speed out of an old 1640/ | 2022-03-28 12:12 | - | |
| Crash! Acer Aspire 4738G/ | 2022-03-28 12:12 | - | |
| Crashed again. Help -)/ | 2022-03-28 12:12 | - | |
| Crashing Acer 5920/ | 2022-03-28 12:12 | - | |
| Crazy auto-repeat on some keys/ | 2022-03-28 12:12 | - | |
| Create Factory Default Backup issues/ | 2022-03-28 12:12 | - | |
| Create Factory Default Disk/ | 2022-03-28 12:12 | - | |
| Create MCE CD from Laptop Recovery files help/ | 2022-03-28 12:12 | - | |
| Creating BIOS Flashing Boot Disk/ | 2022-03-28 12:12 | - | |
| Creating Recovery DVDs without using eRecovery/ | 2022-03-28 12:12 | - | |
| Creating Rescue CDs/ | 2022-03-28 12:12 | - | |
| Creating XP Install CD from Acer PC (without having an XP CD)/ | 2022-03-28 12:12 | - | |
| Creating a restore disc 5920G/ | 2022-03-28 12:12 | - | |
| Creating restore partition with windows 7 (3810tz)/ | 2022-03-28 12:12 | - | |
| Creative Speaker/ | 2022-03-28 12:12 | - | |
| Creators Update and Driver 381.65 - Black screen/ | 2022-03-28 12:12 | - | |
| Crisis Recovery CD, Acer AS5520 Failed BIOS upgrade/ | 2022-03-28 12:12 | - | |
| Critical update for Intel Core CPUs is out/ | 2022-03-28 12:12 | - | |
| Crysis 2 Pwns my Laptop/ | 2022-03-28 12:12 | - | |
| Crysis demo & 5920G/ | 2022-03-28 12:12 | - | |
| Crystal Bright - Old vs. New/ | 2022-03-28 12:12 | - | |
| Crystal Bright Technology/ | 2022-03-28 12:12 | - | |
| CrystalBrite- just a shiny, glossy LCD cover/ | 2022-03-28 12:12 | - | |
| Crystal Eye HD Resolution and Recording Button Missing/ | 2022-03-28 12:12 | - | |
| CrystalEye Webcam - Audio Video doesn't sync/ | 2022-03-28 12:12 | - | |
| Crystal Eye Webcam/ | 2022-03-28 12:12 | - | |
| Crystal Eye Webcam problem with MSN/ | 2022-03-28 12:12 | - | |
| Crystal Eye on Aspire 9920 not found under Vista Premium/ | 2022-03-28 12:12 | - | |
| Crystal Eye web cam/ | 2022-03-28 12:12 | - | |
| Crystal Eye webcam for Acer Extensa 4620 HELP!!!/ | 2022-03-28 12:12 | - | |
| Crystalbrite (glossy) or matt (non-glossy)/ | 2022-03-28 12:12 | - | |
| Crystal eye HD not found in Vista and XP/ | 2022-03-28 12:12 | - | |
| Curious about users 6920G battery life/ | 2022-03-28 12:12 | - | |
| Curser jumps around/ | 2022-03-28 12:12 | - | |
| Cursor jumping all over the place!/ | 2022-03-28 12:12 | - | |
| Custom Built Acer Notebook/ | 2022-03-28 12:12 | - | |
| Custom D2D PQService partition/ | 2022-03-28 12:12 | - | |
| Cut LCD wire. Replace wire/ | 2022-03-28 12:12 | - | |
| D- Partiition Removal Problems/ | 2022-03-28 12:12 | - | |
| D2D Recovery - reset entire drive/ | 2022-03-28 12:12 | - | |
| D2D Recovery Blues/ | 2022-03-28 12:12 | - | |
| D2D error/ | 2022-03-28 12:12 | - | |
| D2D recovery/ | 2022-03-28 12:12 | - | |
| D2D recovery CD(NAPP)/ | 2022-03-28 12:12 | - | |
| DBAN on Acer Aspire 5532/ | 2022-03-28 12:12 | - | |
| DC Power Jack Replacement Guide/ | 2022-03-28 12:12 | - | |
| DDR2-533 RAM Running on 266 mhz speed frequency/ | 2022-03-28 12:12 | - | |
| DEP problem...can it be eliminated/ | 2022-03-28 12:12 | - | |
| DIY Bluetooth in Aspire 5520/ | 2022-03-28 12:12 | - | |
| DIY Homemade Cooling ideas/ | 2022-03-28 12:12 | - | |
| DJing with an Aspire - Will smoke ruin my computer/ | 2022-03-28 12:12 | - | |
| DOES ACER 9920g WORK WITH BLUETOOTH HEADPHONES/ | 2022-03-28 12:12 | - | |
| DOES ANYONE WHERE TO GET TECHSPEC ON TM4501/ | 2022-03-28 12:12 | - | |
| DPI setting on Acer Notebook/ | 2022-03-28 12:12 | - | |
| DVD-RAM drive problem/ | 2022-03-28 12:12 | - | |
| DVD-ROM no longer works on 4810t/ | 2022-03-28 12:12 | - | |
| DVD-RW For 3690/ | 2022-03-28 12:12 | - | |
| DVD-RW multi recorder problem/ | 2022-03-28 12:12 | - | |
| DVD-R not working/ | 2022-03-28 12:12 | - | |
| DVD Burn Problems - QSI DVD+-RW SDW-082/ | 2022-03-28 12:12 | - | |
| DVD Burner not working/ | 2022-03-28 12:12 | - | |
| DVD Burning Error/ | 2022-03-28 12:12 | - | |
| DVD Burning Problems/ | 2022-03-28 12:12 | - | |
| DVD Burning questions/ | 2022-03-28 12:12 | - | |
| DVD CD Drive Not Reading/ | 2022-03-28 12:12 | - | |
| DVD Drive, PIO Mode Only -/ | 2022-03-28 12:12 | - | |
| DVD Drive Missing Acer Aspire 4220/ | 2022-03-28 12:12 | - | |
| DVD Drive replaced by Acer/ | 2022-03-28 12:12 | - | |
| DVD Dual vs DVD Super Multi/ | 2022-03-28 12:12 | - | |
| DVD ROM and External HDD not DETECTED!!/ | 2022-03-28 12:12 | - | |
| DVD ROM cant read certain DVD/ | 2022-03-28 12:12 | - | |
| DVDRW super multi drive/ | 2022-03-28 12:12 | - | |
| DVD Slot Loading Problems/ | 2022-03-28 12:12 | - | |
| DVD Software after fresh install on 8204/ | 2022-03-28 12:12 | - | |
| DVD Video won't play on my Apspire 2012WLMi/ | 2022-03-28 12:12 | - | |
| DVD With Lightscribe Upgrade/ | 2022-03-28 12:12 | - | |
| DVD burner/ | 2022-03-28 12:12 | - | |
| DVD burning going slooooooow Please HELP!/ | 2022-03-28 12:12 | - | |
| DVD drive compatibility/ | 2022-03-28 12:12 | - | |
| DVD drive intermittent/ | 2022-03-28 12:12 | - | |
| DVD drive missing - Windows 7/ | 2022-03-28 12:12 | - | |
| DVD drive replacement/ | 2022-03-28 12:12 | - | |
| DVD drive replacement for Aspire 5100-3357/ | 2022-03-28 12:12 | - | |
| DVD not recognized in BIOS - Travelmate 4670/ | 2022-03-28 12:12 | - | |
| DVD region problem/ | 2022-03-28 12:12 | - | |
| DVD writer on 5672 wlmi/ | 2022-03-28 12:12 | - | |
| DVI Output/ | 2022-03-28 12:12 | - | |
| DVI out on 5672/ | 2022-03-28 12:12 | - | |
| DVI output on ezDock does not work/ | 2022-03-28 12:12 | - | |
| DVI to Component video/ | 2022-03-28 12:12 | - | |
| DVd, bluetooth, wireless.. not working/ | 2022-03-28 12:12 | - | |
| DXVA & MPC Video Quality on 1410 Intel 4500/ | 2022-03-28 12:12 | - | |
| Dad's Acer Aspire 5930 touchpad frozen dead cursor not moving... he will kill me/ | 2022-03-28 12:12 | - | |
| Daft Question Probably/ | 2022-03-28 12:12 | - | |
| Damage Trim Asipre 5670/ | 2022-03-28 12:12 | - | |
| Damaged Lid Sensor/ | 2022-03-28 12:12 | - | |
| Damaged laptop worth saving/ | 2022-03-28 12:12 | - | |
| Damage having dropped my Acer Travelmate/ | 2022-03-28 12:12 | - | |
| Dark screen; FN Keys increase doesn't help; XP is loading/ | 2022-03-28 12:12 | - | |
| Dated- Aspire 6935G In Canada on Sept. 20!/ | 2022-03-28 12:12 | - | |
| Dated- Aspire 8930G in Canada on Sept. 20!/ | 2022-03-28 12:12 | - | |
| Dead ACER 5315/ | 2022-03-28 12:12 | - | |
| Dead Acer Aspire 5102 (5100)/ | 2022-03-28 12:12 | - | |
| Dead Acer Aspire 5735Z/ | 2022-03-28 12:12 | - | |
| Dead Aspire 5715z/ | 2022-03-28 12:12 | - | |
| Dead Pixel Found on Aspire 5920/ | 2022-03-28 12:12 | - | |
| Dead Screen Acer Aspire 8930G-864G64Bn/ | 2022-03-28 12:12 | - | |
| Dead TS-l802a in Aspire 5920G/ | 2022-03-28 12:12 | - | |
| Dead acer 5742G. Please help/ | 2022-03-28 12:12 | - | |
| Dead monitor Aspire 5102/ | 2022-03-28 12:12 | - | |
| Dead power supply or battery/ | 2022-03-28 12:12 | - | |
| Dead shorted Battery/ | 2022-03-28 12:12 | - | |
| Dear God help me/ | 2022-03-28 12:12 | - | |
| Dear Meaker, need your advise very much!!/ | 2022-03-28 12:12 | - | |
| Decompression error/ | 2022-03-28 12:12 | - | |
| Decreased Battery Life on 5810TG After Installing Win7 SP1/ | 2022-03-28 12:12 | - | |
| Decryption software 5672/ | 2022-03-28 12:12 | - | |
| Default 8930G eaudio sound preset/ | 2022-03-28 12:12 | - | |
| Default Acer 4315 WLAN not working/ | 2022-03-28 12:12 | - | |
| Default Partitions Size for Acer TravelMate 8215 WLMi/ | 2022-03-28 12:12 | - | |
| Default Sound Settings For 6920/ | 2022-03-28 12:12 | - | |
| Defect Acer Aspire 9301AWSMi/ | 2022-03-28 12:12 | - | |
| Defendmyname, Acer error 0200 booting/ | 2022-03-28 12:12 | - | |
| Definative ACER ASPIRE 5920G HD DVD Fix/ | 2022-03-28 12:12 | - | |
| Delay between pressing Fn button and on-screen symbol appearing/ | 2022-03-28 12:12 | - | |
| Delete Acer 7720 Hidden Partition on XP/ | 2022-03-28 12:12 | - | |
| Delete Linux and install Win XP/ | 2022-03-28 12:12 | - | |
| Delete Recovery Partition/ | 2022-03-28 12:12 | - | |
| Deleted PQSERVICE...Now what ! HELP!!/ | 2022-03-28 12:12 | - | |
| Delete recovery-partition/ | 2022-03-28 12:12 | - | |
| Delete vista partitions, format hard drive, reinstall Vista onto ONE c- partition using only Acer recovery disks/ | 2022-03-28 12:12 | - | |
| Deleting old vista partition after win 7 install/ | 2022-03-28 12:12 | - | |
| Depressed, being bullied by Acer, need evidence/ | 2022-03-28 12:12 | - | |
| Description of Acer BIOS updates/ | 2022-03-28 12:12 | - | |
| Desktop Theme & Startup Sound for the Ferrari/ | 2022-03-28 12:12 | - | |
| Desktop objects size changes when I switch between displays/ | 2022-03-28 12:12 | - | |
| Desperate buyer --(/ | 2022-03-28 12:12 | - | |
| Desperately Need Recovery CD/ | 2022-03-28 12:12 | - | |
| Desperately required can you help/ | 2022-03-28 12:12 | - | |
| Detail Spec of Acer Timeline Ultra ( Aspire M3 5800 tg)/ | 2022-03-28 12:12 | - | |
| Determining Touchpad Manufacturer - Acer 5741/ | 2022-03-28 12:12 | - | |
| Device Drivers for Acer Notebook TravleMate C213TMi/ | 2022-03-28 12:12 | - | |
| Devices not enabled on startup/ | 2022-03-28 12:12 | - | |
| Dial in front Sound level Aspire 5943G/ | 2022-03-28 12:12 | - | |
| Dial up problem/ | 2022-03-28 12:12 | - | |
| Did anyone have problems with latest windows updates/ | 2022-03-28 12:12 | - | |
| Did any one here upgrade to Windows 7 Via Acer/ | 2022-03-28 12:12 | - | |
| Did anyone try a 5800mha battery on 1810T/ | 2022-03-28 12:12 | - | |
| Did a re-format and my startup still seems to be off slow/ | 2022-03-28 12:12 | - | |
| Didin't know where to post this need help setting ACFanControl for Acer V3 772G/ | 2022-03-28 12:12 | - | |
| Did some upgrades to my 1694WLMi, som questions remains/ | 2022-03-28 12:12 | - | |
| Did you test the IE8 on your single core ACER/ | 2022-03-28 12:12 | - | |
| Difference between 6920G-6A4G25 and 6A3G25/ | 2022-03-28 12:12 | - | |
| Difference between AS5745G ELITE and ACER AS5745/ | 2022-03-28 12:12 | - | |
| Difference between Acer Aspire 5742 and 5733/ | 2022-03-28 12:12 | - | |
| Difference between Acer Ferrari 5005WLMI and 5006WLMI/ | 2022-03-28 12:12 | - | |
| Difference between Aspire and Travelmate/ | 2022-03-28 12:12 | - | |
| Difference between TM 4010 & TM 4011/ | 2022-03-28 12:12 | - | |
| Difference between V5 and V7/ | 2022-03-28 12:12 | - | |
| Difference between eRecovery and Windows 7 image/ | 2022-03-28 12:12 | - | |
| Difference between wlmi and wsmi/ | 2022-03-28 12:12 | - | |
| Difference in Amazon Listings/ | 2022-03-28 12:12 | - | |
| Differences/ | 2022-03-28 12:12 | - | |
| Differences between Acer TM 8200 and AS 5670/ | 2022-03-28 12:12 | - | |
| Differences between Travelmate 3201 & 4502/ | 2022-03-28 12:12 | - | |
| Different Model Numbers but the laptops are identical in everyway Lol/ | 2022-03-28 12:12 | - | |
| Different Recovery Problem/ | 2022-03-28 12:12 | - | |
| Different in specs of almost 2 same models/ | 2022-03-28 12:12 | - | |
| Digital Audio 8204/ | 2022-03-28 12:12 | - | |
| Digital Microphone is missing/ | 2022-03-28 12:12 | - | |
| Digital SP DIF/ | 2022-03-28 12:12 | - | |
| Dim corner on screen/ | 2022-03-28 12:12 | - | |
| Direct e-mails/ | 2022-03-28 12:12 | - | |
| Direct link to latest ATI mobility drivers/ | 2022-03-28 12:12 | - | |
| Disable Battery From Charging/ | 2022-03-28 12:12 | - | |
| Disable CineDash/ | 2022-03-28 12:12 | - | |
| Disable ENet on VISTA Home Basic says Acer/ | 2022-03-28 12:12 | - | |
| Disable HD Audio Surround by default/ | 2022-03-28 12:12 | - | |
| Disable Nvidia Optimus on Acer 5750G/ | 2022-03-28 12:12 | - | |
| Disable Onboard Sound @ Bios (Aspire 1522WLMi)/ | 2022-03-28 12:12 | - | |
| Disable Remap Euro and Dollar keys/ | 2022-03-28 12:12 | - | |
| Disable Touchpad on the Acer Aspire 5315/ | 2022-03-28 12:12 | - | |
| Disableing CIR reciever on Aspire 7720G/ | 2022-03-28 12:12 | - | |
| Disable lights on 6920g/ | 2022-03-28 12:12 | - | |
| Disable on-board sound on acer aspire 5520/ | 2022-03-28 12:12 | - | |
| Disabling Built in Mic on Travelmate 2480/ | 2022-03-28 12:12 | - | |
| Disabling all wireless/ | 2022-03-28 12:12 | - | |
| Disabling awful power cord beep/ | 2022-03-28 12:12 | - | |
| Disadvantages/ | 2022-03-28 12:12 | - | |
| Disappointed in my ACER 5102WMLi - pls offer yr consolations or advice/ | 2022-03-28 12:12 | - | |
| Disappointed with the new speaker system/ | 2022-03-28 12:12 | - | |
| Disappointing Acer 8943G/ | 2022-03-28 12:12 | - | |
| Disassemble Acer Ferrari 1004/ | 2022-03-28 12:12 | - | |
| Disassemble Travelmate 2350/ | 2022-03-28 12:12 | - | |
| Disassembling Acer Aspire 7720-6536/ | 2022-03-28 12:12 | - | |
| Disassembling an Aspire 5040/ | 2022-03-28 12:12 | - | |
| Disassembly Instructions for an Acer Extensa 4620z/ | 2022-03-28 12:12 | - | |
| Disassembly Manual for Aspire 9420/ | 2022-03-28 12:12 | - | |
| Disassembly guide for 7740G/ | 2022-03-28 12:12 | - | |
| Disassembly pictures for the Timeline 4810T/ | 2022-03-28 12:12 | - | |
| Disaster!!/ | 2022-03-28 12:12 | - | |
| Discovered 8920 Fingerprint Reader problem but/ | 2022-03-28 12:12 | - | |
| Discrete graphics in a Timeline, wouldn't that be nice/ | 2022-03-28 12:12 | - | |
| Disk data transfer rate index 4.8 on 5920G/ | 2022-03-28 12:12 | - | |
| Disk failure/ | 2022-03-28 12:12 | - | |
| Disk hardware configuration error/ | 2022-03-28 12:12 | - | |
| Disk recovery/ | 2022-03-28 12:12 | - | |
| Dismal, even abysmal customer service/ | 2022-03-28 12:12 | - | |
| Dismantling Acer TM2428/ | 2022-03-28 12:12 | - | |
| Dismantling a 5315/ | 2022-03-28 12:12 | - | |
| Display/ | 2022-03-28 12:12 | - | |
| Display Adaptors/ | 2022-03-28 12:12 | - | |
| Display HW problems- Vertical lines/ | 2022-03-28 12:12 | - | |
| Display Replacement/ | 2022-03-28 12:12 | - | |
| Display driver/ | 2022-03-28 12:12 | - | |
| Display for Acer 8920g/ | 2022-03-28 12:12 | - | |
| Display keeps automatically dimming to 0% brightness during movie playback [acer 5685]/ | 2022-03-28 12:12 | - | |
| Display shifted to the left even in the bios, fine on external any ideas how to fix/ | 2022-03-28 12:12 | - | |
| Display switching problems/ | 2022-03-28 12:12 | - | |
| Display toggle ( Fn + F5 ) does not work on my TM 8204/ | 2022-03-28 12:12 | - | |
| Distorted sound/ | 2022-03-28 12:12 | - | |
| Do 2GB 2 heat more than 1GB 2/ | 2022-03-28 12:12 | - | |
| Do ALL Vista Acers have ERecovery partition/ | 2022-03-28 12:12 | - | |
| Do Acer Ferraris easily get hot/ | 2022-03-28 12:12 | - | |
| Do Acer have sneaky tracking spyware/ | 2022-03-28 12:12 | - | |
| Do Acer manufacture their own motherboards for laptops/ | 2022-03-28 12:12 | - | |
| Do Acer not do high-res screens on 14-15 models/ | 2022-03-28 12:12 | - | |
| Do Acers have any reliability and quality issues/ | 2022-03-28 12:12 | - | |
| Do Acer support Windows 7 for the Aspire/ | 2022-03-28 12:12 | - | |
| Do Gateway and Acer laptops share the same chassis/ | 2022-03-28 12:12 | - | |
| Do I Have To Spend $80 To Remove Bloatware!!!!/ | 2022-03-28 12:12 | - | |
| Do I need Acer utilities to get Fn F5 to toggle to monitor with Aspire 5100/ | 2022-03-28 12:12 | - | |
| Do I need a new battery/ | 2022-03-28 12:12 | - | |
| Do I want the 8204/ | 2022-03-28 12:12 | - | |
| Do NOT buy the ACER ASPIRE V15 NITRO (VN7-592G)/ | 2022-03-28 12:12 | - | |
| Do all the timeline's 3810T with different processors have the same screen/ | 2022-03-28 12:12 | - | |
| Does ACER bios have this/ | 2022-03-28 12:12 | - | |
| Does Acer 5520 Support DDR2 800/ | 2022-03-28 12:12 | - | |
| Does Acer Aspire 5920G has GDDR3 VRAM/ | 2022-03-28 12:12 | - | |
| Does Acer Aspire One read and boot from USB flash drive/ | 2022-03-28 12:12 | - | |
| Does Acer Power Management improve battery life/ | 2022-03-28 12:12 | - | |
| Does Acer Reimage/ | 2022-03-28 12:12 | - | |
| Does Acer US have a general email/ | 2022-03-28 12:12 | - | |
| Does Acer recovery wipe the D- drive/ | 2022-03-28 12:12 | - | |
| Does Acers have international warranty/ | 2022-03-28 12:12 | - | |
| Does Aspire 3623WXCi have a CrystalBrite display/ | 2022-03-28 12:12 | - | |
| Does Aspire 3624WXCi have CrystalBrite display/ | 2022-03-28 12:12 | - | |
| Does Aspire ES1-533 ( ES 15) have a M.2 SSD slot/ | 2022-03-28 12:12 | - | |
| Does SpeedFan 4.32 work on the 5920G to control fan speed/ | 2022-03-28 12:12 | - | |
| Does Timeline 4810TZ play 1080p/ | 2022-03-28 12:12 | - | |
| Does a CPU affect HD-DVD/ | 2022-03-28 12:12 | - | |
| Does acer recovery require NTI backup now/ | 2022-03-28 12:12 | - | |
| Does anybody have/ | 2022-03-28 12:12 | - | |
| Does anybody have a 1622lm yet/ | 2022-03-28 12:12 | - | |
| Does anybody have an Aspire One Need Feedback/ | 2022-03-28 12:12 | - | |
| Does anyone got a 6920 or 8920 with Vista x64/ | 2022-03-28 12:12 | - | |
| Does anyone has the Acer 3620 PLEASE I NEED YOUR HELP !/ | 2022-03-28 12:12 | - | |
| Does anyone have 6930G restore disk/ | 2022-03-28 12:12 | - | |
| Does anyone have an Acer Travelmate 4283/ | 2022-03-28 12:12 | - | |
| Does anyone have experience or looked into the HP DM1Z vs timelinex (1830T) 11.6/ | 2022-03-28 12:12 | - | |
| Does anyone here own an Acer/ | 2022-03-28 12:12 | - | |
| Does anyone know about the Acer Aspire One SSDs/ | 2022-03-28 12:12 | - | |
| Does anyone own a Aspire 4720G or 5920G/ | 2022-03-28 12:12 | - | |
| Does anyone own an Acer 11.6 with U3400 CPU Like 753 or 1430/ | 2022-03-28 12:12 | - | |
| Does anyone play DoD-S/ | 2022-03-28 12:12 | - | |
| Does anyone use Readyboost on 5920G/ | 2022-03-28 12:12 | - | |
| Does my Acer 6930zg support SSD/ | 2022-03-28 12:12 | - | |
| Does my Warranty cover this/ | 2022-03-28 12:12 | - | |
| Does openning the RAM cover void warranty/ | 2022-03-28 12:12 | - | |
| Does such an Acer Aspire 8930G exist/ | 2022-03-28 12:12 | - | |
| Does the 2012 have Bluetooth/ | 2022-03-28 12:12 | - | |
| Does the 5102 have TV-out/ | 2022-03-28 12:12 | - | |
| Does the 5920 have blue-tooth/ | 2022-03-28 12:12 | - | |
| Does the Acer 6463 have a matte display/ | 2022-03-28 12:12 | - | |
| Does the Acer Aspire 5315 have an internal fan/ | 2022-03-28 12:12 | - | |
| Does the Acer Aspire 5735-733G32Mn have a 3gb limit/ | 2022-03-28 12:12 | - | |
| Does the Acer Aspire 5742 have a hidden BIOS menu/ | 2022-03-28 12:12 | - | |
| Does the Acer Aspire 6920G take in air through the bottom ordoes it blow out air through the bottom of the laptop/ | 2022-03-28 12:12 | - | |
| Does the Acer Aspire One netbook support HDMI out/ | 2022-03-28 12:12 | - | |
| Does the Acer Extensa 5620 have a Socket P/ | 2022-03-28 12:12 | - | |
| Does the Acer recovery CD delete data on the D partition/ | 2022-03-28 12:12 | - | |
| Does the Aspire 5520 have Two Graphic Cards/ | 2022-03-28 12:12 | - | |
| Does the Aspire 5520 support SPFIF or not/ | 2022-03-28 12:12 | - | |
| Does the Aspire 6930 support intel hardware virtualization/ | 2022-03-28 12:12 | - | |
| Does the Aspire 7745G have optical out/ | 2022-03-28 12:12 | - | |
| Does the Aspire 7750g have a spare HDD bay/ | 2022-03-28 12:12 | - | |
| Does the Aspire AS7741G-6426 have an expresscard slot/ | 2022-03-28 12:12 | - | |
| Does the Firepro M4000 have a ROM chip/ | 2022-03-28 12:12 | - | |
| Does this 3DMark03 score sound right to you guys/ | 2022-03-28 12:12 | - | |
| Does this Acer Model have Glossy Screen/ | 2022-03-28 12:12 | - | |
| Does this Acer NX.RZNEK.005 have a Matt panel/ | 2022-03-28 12:12 | - | |
| Does this Acer sound decent/ | 2022-03-28 12:12 | - | |
| Does this Switch 10 have the option for the HDD in the keyboard/ | 2022-03-28 12:12 | - | |
| Does this problem has a specific name/ | 2022-03-28 12:12 | - | |
| Does upgrading the RAM void warranty/ | 2022-03-28 12:12 | - | |
| Does your Acer make crackling noises Not performing in Games Here's the answer!/ | 2022-03-28 12:12 | - | |
| Does your Aspire One AOA150 6-cell comes with a soft case/ | 2022-03-28 12:12 | - | |
| Does your Cpu temp go above 90 while gaming/ | 2022-03-28 12:12 | - | |
| Doing a clean install using eRecovery Managment/ | 2022-03-28 12:12 | - | |
| Do it yourself- Bluetooth module for Aspire 3680/ | 2022-03-28 12:12 | - | |
| Dolby settings in acer aspire 5750/ | 2022-03-28 12:12 | - | |
| Don't Buy Acer/ | 2022-03-28 12:12 | - | |
| Don't Buy The Wrong Variant of Swift 3 (2017)/ | 2022-03-28 12:12 | - | |
| Don't buy Acer in Ireland UK if you want to put up with poor support service/ | 2022-03-28 12:12 | - | |
| Don't buy TravelMate 2420/ | 2022-03-28 12:12 | - | |
| Dont Know How To Record With My Acer Camera!!!/ | 2022-03-28 12:12 | - | |
| Dont see my laptop model anywhere here/ | 2022-03-28 12:12 | - | |
| Do recovery dvd`s work on new hdd to re-install os/ | 2022-03-28 12:12 | - | |
| Dothan or Sonoma How to check/ | 2022-03-28 12:12 | - | |
| Down Gradeing from Vista/ | 2022-03-28 12:12 | - | |
| Downgrade 9500m gs to 9300m gs/ | 2022-03-28 12:12 | - | |
| Downgrade Acer Aspire 5520 to XP problems/ | 2022-03-28 12:12 | - | |
| Downgrade Vista to XP Pro on 5633 - Need BIOS downgrade/ | 2022-03-28 12:12 | - | |
| Downgrade Vista to XP on 5610/ | 2022-03-28 12:12 | - | |
| Downgraded 5315 to XP/ | 2022-03-28 12:12 | - | |
| Downgraded My 5630 from Vista to XP Pro/ | 2022-03-28 12:12 | - | |
| Downgrading 4315 from Vista to XP/ | 2022-03-28 12:12 | - | |
| Downgrading Aspire to XP, how hard/ | 2022-03-28 12:12 | - | |
| Downgrading Bios- Bios needed/ | 2022-03-28 12:12 | - | |
| Downgrading an Acer Aspire 5630 to Windows XP/ | 2022-03-28 12:12 | - | |
| Downgrading to XP/ | 2022-03-28 12:12 | - | |
| Download acer napp cd/ | 2022-03-28 12:12 | - | |
| Download a similar tool to Acer ePower management/ | 2022-03-28 12:12 | - | |
| Downloaded eRecovery Mgmnt won't install/ | 2022-03-28 12:12 | - | |
| Downloads are dying with TravelMate 4402/ | 2022-03-28 12:12 | - | |
| Do you consider HDMI important/ | 2022-03-28 12:12 | - | |
| Do you have an Aspire 5050 recovery disk/ | 2022-03-28 12:12 | - | |
| Do you know something about AS4736/ | 2022-03-28 12:12 | - | |
| Do you like your Acer Aspire One/ | 2022-03-28 12:12 | - | |
| Do you recomend me to buy an Acer/ | 2022-03-28 12:12 | - | |
| Do you void the warranty if you repaste cpu gpu of an acer laptop/ | 2022-03-28 12:12 | - | |
| Dreadful whooshing sound/ | 2022-03-28 12:12 | - | |
| Drill a few holes in the chassis/ | 2022-03-28 12:12 | - | |
| Dritek Launch Manager question/ | 2022-03-28 12:12 | - | |
| Drivelock password removal/ | 2022-03-28 12:12 | - | |
| Driver & Support Service Confusion/ | 2022-03-28 12:12 | - | |
| Driver Magician for free/ | 2022-03-28 12:12 | - | |
| Driver Problem!!/ | 2022-03-28 12:12 | - | |
| Driver Suggestions for Comparison/ | 2022-03-28 12:12 | - | |
| Driver difference/ | 2022-03-28 12:12 | - | |
| Driver failure on 2D mode/ | 2022-03-28 12:12 | - | |
| Driver for SATA (winxp 64 bit - 5315)/ | 2022-03-28 12:12 | - | |
| Driver for WinXP on Extensa 5620/ | 2022-03-28 12:12 | - | |
| Driver help, Mass storage controller missing driver/ | 2022-03-28 12:12 | - | |
| Driver install order for Aspire 5100 with XP/ | 2022-03-28 12:12 | - | |
| Driver issues, Aspire 8935G & ATI HD4670/ | 2022-03-28 12:12 | - | |
| Driver issues with the 2023/ | 2022-03-28 12:12 | - | |
| Driver problem, I NEED HELP!/ | 2022-03-28 12:12 | - | |
| Drivers For My Acer Aspire 6391 (e)desktop/ | 2022-03-28 12:12 | - | |
| Drivers XP - Acer Aspire ONE D250/ | 2022-03-28 12:12 | - | |
| Drivers for 5051 AWXMi/ | 2022-03-28 12:12 | - | |
| Drivers for 5920G after fresh install/ | 2022-03-28 12:12 | - | |
| Drivers for Acer Aspire 5930G/ | 2022-03-28 12:12 | - | |
| Drivers for Acer Aspire Win 7 32 bit/ | 2022-03-28 12:12 | - | |
| Drivers for MR9700 on Acer/ | 2022-03-28 12:12 | - | |
| Drivers for Win7/ | 2022-03-28 12:12 | - | |
| Drivers for chipset,Aspire 5100/ | 2022-03-28 12:12 | - | |
| Drivers went to crap/ | 2022-03-28 12:12 | - | |
| Driver that I can use that is compatible with Rivatuner so I can control fan/ | 2022-03-28 12:12 | - | |
| Driver update for ATI Xpress 1100- driver not found/ | 2022-03-28 12:12 | - | |
| Drives for Aspire 5024 after a reformat/ | 2022-03-28 12:12 | - | |
| Drop FPS HEAT acer aspire 5630/ | 2022-03-28 12:12 | - | |
| Dropped my laptop/ | 2022-03-28 12:12 | - | |
| Dual Boot AS6920 help!/ | 2022-03-28 12:12 | - | |
| Dual Boot Vista XP and HD failure - beware!/ | 2022-03-28 12:12 | - | |
| Dual Boot Vista and Windows 7/ | 2022-03-28 12:12 | - | |
| Dual Boot Vista and XP SP2 on 5044 WLMi/ | 2022-03-28 12:12 | - | |
| Dual Boot Windows Xp 64 and Vista 32/ | 2022-03-28 12:12 | - | |
| Dual Boot XP Prof and Vista using Clean Installs on a Acer 5100/ | 2022-03-28 12:12 | - | |
| Dual Booting Option/ | 2022-03-28 12:12 | - | |
| Dual Booting XP Vista on Aspire 6930/ | 2022-03-28 12:12 | - | |
| Dual Core- TM4672, TM4222, TM3012 (and 4674)/ | 2022-03-28 12:12 | - | |
| Dual Core SU2300 Benchmarks vs Single Core SU3500 Acer 1410/ | 2022-03-28 12:12 | - | |
| Dual Display Help/ | 2022-03-28 12:12 | - | |
| Dual External Monitors on 5672 x x1400/ | 2022-03-28 12:12 | - | |
| Dual Memory Channel TM8100/ | 2022-03-28 12:12 | - | |
| Dual Monitor Problems/ | 2022-03-28 12:12 | - | |
| Dual Monitor setup on Acer Aspire 1/ | 2022-03-28 12:12 | - | |
| Dual OS- XP + Vista in one laptop (or PC)/ | 2022-03-28 12:12 | - | |
| Dual channel Memory 5740G/ | 2022-03-28 12:12 | - | |
| Dual external monitors on Acer 5672 via DVI and VGA ports/ | 2022-03-28 12:12 | - | |
| Dual install XP Vista, hide partitions on each OS/ | 2022-03-28 12:12 | - | |
| Dual voltage for 5102WLMI/ | 2022-03-28 12:12 | - | |
| Dull Screen - Acer Aspire 5610/ | 2022-03-28 12:12 | - | |
| Dull Screen - Acer Aspire 5630/ | 2022-03-28 12:12 | - | |
| Dull Screen - Aspire 5610/ | 2022-03-28 12:12 | - | |
| Dumb question about upgrading video cards/ | 2022-03-28 12:12 | - | |
| Durability of Acer Power Brick/ | 2022-03-28 12:12 | - | |
| During Gaming a Line of White Pixels Appear/ | 2022-03-28 12:12 | - | |
| Dvd Multi Double Layer/ | 2022-03-28 12:12 | - | |
| Dvmt/ | 2022-03-28 12:12 | - | |
| E-Recovery Disc Problem/ | 2022-03-28 12:12 | - | |
| E-recovery 2 DVD's isn't working,System Crashes/ | 2022-03-28 12:12 | - | |
| E-rocovery partition delete/ | 2022-03-28 12:12 | - | |
| E1-571-53236G50Mnks & V3-571-53236G50Makk weight & screen size/ | 2022-03-28 12:12 | - | |
| E1-572P and HDD caddy/ | 2022-03-28 12:12 | - | |
| E5-572G-57Y9 color calibration/ | 2022-03-28 12:12 | - | |
| E56R41u Charging problem/ | 2022-03-28 12:12 | - | |
| EBackup question/ | 2022-03-28 12:12 | - | |
| EC Firmware mod on Acer laptop/ | 2022-03-28 12:12 | - | |
| EISA Config. Partition (Partition that Contains Recovery Data)/ | 2022-03-28 12:12 | - | |
| EOLeSystemError/ | 2022-03-28 12:12 | - | |
| E Presentation/ | 2022-03-28 12:12 | - | |
| ERecovery - Anyway to Restore Just Windows/ | 2022-03-28 12:12 | - | |
| ETA- Acer 5000 Series Notebook (Turion)/ | 2022-03-28 12:12 | - | |
| EZdock usb resume/ | 2022-03-28 12:12 | - | |
| Easy Upgrades on the 5100/ | 2022-03-28 12:12 | - | |
| Easy mistake to make!/ | 2022-03-28 12:12 | - | |
| Echo affect when using/ | 2022-03-28 12:12 | - | |
| Either a black screen or a blue screen/ | 2022-03-28 12:12 | - | |
| Elan Smart-Pad. Not showing Tapping 2+ fingers options after Windows 10/ | 2022-03-28 12:12 | - | |
| Eliminate annoying high pitched chirp click cricket sound/ | 2022-03-28 12:12 | - | |
| Emachines Clean install problem/ | 2022-03-28 12:12 | - | |
| Emachines E625 reassembly/ | 2022-03-28 12:12 | - | |
| Emachines bios password/ | 2022-03-28 12:12 | - | |
| Emergency bios recovery on Acer Aspire Timeline 4810TZ/ | 2022-03-28 12:12 | - | |
| Emergent help required! arcade deluxe and windows media center/ | 2022-03-28 12:12 | - | |
| Empowering Tech/ | 2022-03-28 12:12 | - | |
| Empowering Technology Aspire 4315/ | 2022-03-28 12:12 | - | |
| Empowering Technology Issue/ | 2022-03-28 12:12 | - | |
| Empowering Technology Password. I want to unistall and reinstall/ | 2022-03-28 12:12 | - | |
| Empowering Technology and Epower Management for Timeline 1810t/ | 2022-03-28 12:12 | - | |
| Empowering Technology password/ | 2022-03-28 12:12 | - | |
| Empowering Tools and long boot time/ | 2022-03-28 12:12 | - | |
| Empowering technology/ | 2022-03-28 12:12 | - | |
| Empowering technology Power Plan/ | 2022-03-28 12:12 | - | |
| Empowering technology Vista 64bit/ | 2022-03-28 12:12 | - | |
| Empowering works on Vista x64...NOT/ | 2022-03-28 12:12 | - | |
| Enable Afterburner Speed Booster on wireless LAN/ | 2022-03-28 12:12 | - | |
| Enable Aspire wireless on boot/ | 2022-03-28 12:12 | - | |
| Enable SPDIF outout- Step by step guide/ | 2022-03-28 12:12 | - | |
| Enable VT on Acer 5570z T2080/ | 2022-03-28 12:12 | - | |
| Enable Wireless without Empowering or Emanagement/ | 2022-03-28 12:12 | - | |
| Enable higher voltage on GeForce G 105M GPU/ | 2022-03-28 12:12 | - | |
| Enable the second core on the su3500/ | 2022-03-28 12:12 | - | |
| Enabling SATA mode to AHCI after XP Install (applicable to most laptops, or systems)/ | 2022-03-28 12:12 | - | |
| Enabling USSD and Voice support for EM770W 3G module/ | 2022-03-28 12:12 | - | |
| Enabling VT/ | 2022-03-28 12:12 | - | |
| Enabling eRecovery on fresh partition/ | 2022-03-28 12:12 | - | |
| Enabling intel virtualization technology in ACER ASPIRE 5738G/ | 2022-03-28 12:12 | - | |
| Endurance. Is it okay for acer notebook/ | 2022-03-28 12:12 | - | |
| Enhanced LCD or not on TM and Aspire-series/ | 2022-03-28 12:12 | - | |
| E power Management for 4005 ferrari/ | 2022-03-28 12:12 | - | |
| Epowermanagement and cardbus/ | 2022-03-28 12:12 | - | |
| Erecovery Basics _ Win XP _ Acer notebooks/ | 2022-03-28 12:12 | - | |
| Erecovery Use/ | 2022-03-28 12:12 | - | |
| Erecovery etc and FAt32 and NTFS again/ | 2022-03-28 12:12 | - | |
| Erevovery/ | 2022-03-28 12:12 | - | |
| Erratic behavior with Acer Aspire 9300/ | 2022-03-28 12:12 | - | |
| Error, Need Help!/ | 2022-03-28 12:12 | - | |
| Error- fsquirt.exe!!!!/ | 2022-03-28 12:12 | - | |
| Error Message/ | 2022-03-28 12:12 | - | |
| Error OE - 0028 - FF03B779/ | 2022-03-28 12:12 | - | |
| Error intel dual core processor mounted on Acer/ | 2022-03-28 12:12 | - | |
| Error log entries before bought computer/ | 2022-03-28 12:12 | - | |
| Error sound while exiting and starting windows on 5672/ | 2022-03-28 12:12 | - | |
| Errors whilst resizing clusters!/ | 2022-03-28 12:12 | - | |
| Error with new drivers - Extreme graphics 2/ | 2022-03-28 12:12 | - | |
| Esata port on 8930G/ | 2022-03-28 12:12 | - | |
| Esobi's innovative RSS reader/ | 2022-03-28 12:12 | - | |
| Essential software to have on your laptop/ | 2022-03-28 12:12 | - | |
| Ethernet Card Missing/ | 2022-03-28 12:12 | - | |
| Ethernet Port sudently stopped working/ | 2022-03-28 12:12 | - | |
| Ethernet card not detected/ | 2022-03-28 12:12 | - | |
| Ethernet loose connection on 1810tz/ | 2022-03-28 12:12 | - | |
| Ethos 8951G/ | 2022-03-28 12:12 | - | |
| Euro and dollar keys in Acer 4501wlmi/ | 2022-03-28 12:12 | - | |
| European store taking pre orders for 1810T at 469/ | 2022-03-28 12:12 | - | |
| Ever wondered what make all your peripherals are Acer can now tell you/ | 2022-03-28 12:12 | - | |
| Exactly how heavy is the 6920/ | 2022-03-28 12:12 | - | |
| Exact spec of my 5920g/ | 2022-03-28 12:12 | - | |
| Excessive heat when using usb device/ | 2022-03-28 12:12 | - | |
| Exchange HD on Aspire 9410Z/ | 2022-03-28 12:12 | - | |
| Exchanged my AS1410-8804 for AS1410-2099/ | 2022-03-28 12:12 | - | |
| Experience using ACER AS5112WLMi/ | 2022-03-28 12:12 | - | |
| Expert Advise Needed - Aspire 5610 PQSERVICE/ | 2022-03-28 12:12 | - | |
| Exploring Hidden Partition/ | 2022-03-28 12:12 | - | |
| Express Card on Acer 5930G-944G32BN/ | 2022-03-28 12:12 | - | |
| ExpressCard size/ | 2022-03-28 12:12 | - | |
| Express card remote for Aspire/ | 2022-03-28 12:12 | - | |
| Expresscard with USB3 ports/ | 2022-03-28 12:12 | - | |
| Extended Warranties/ | 2022-03-28 12:12 | - | |
| Extended batteries...5920/ | 2022-03-28 12:12 | - | |
| Extended warranty/ | 2022-03-28 12:12 | - | |
| Extending my desktop to TWO monitors on Aspire 5920- possible/ | 2022-03-28 12:12 | - | |
| Extensa 390CX/ | 2022-03-28 12:12 | - | |
| Extensa 4230 black screen please help/ | 2022-03-28 12:12 | - | |
| Extensa 4420-5237 and 4100 series/ | 2022-03-28 12:12 | - | |
| Extensa 4420-5239 VGA out problem/ | 2022-03-28 12:12 | - | |
| Extensa 4420-5963 BIOS and SATA/ | 2022-03-28 12:12 | - | |
| Extensa 4420-5963 Partitioning/ | 2022-03-28 12:12 | - | |
| Extensa 4420; XP Pro installed.... have glitches/ | 2022-03-28 12:12 | - | |
| Extensa 4420 HDD upgrade help/ | 2022-03-28 12:12 | - | |
| Extensa 4420 Ram Upgrade to 3GB, worth it/ | 2022-03-28 12:12 | - | |
| Extensa 4420 Restore Discs/ | 2022-03-28 12:12 | - | |
| Extensa 4420 Speaker Problem/ | 2022-03-28 12:12 | - | |
| Extensa 4420 VGA Out Issue/ | 2022-03-28 12:12 | - | |
| Extensa 4420 increasing video ram/ | 2022-03-28 12:12 | - | |
| Extensa 4420 memory cover trouble/ | 2022-03-28 12:12 | - | |
| Extensa 4420 only charges (extended) battery while it's ON/ | 2022-03-28 12:12 | - | |
| Extensa 4620Z CPU and memory upgrade/ | 2022-03-28 12:12 | - | |
| Extensa 4620Z software problem-/ | 2022-03-28 12:12 | - | |
| Extensa 4620 backlight not working/ | 2022-03-28 12:12 | - | |
| Extensa 4620 battery life/ | 2022-03-28 12:12 | - | |
| Extensa 4620z onscreen info missing on clean install/ | 2022-03-28 12:12 | - | |
| Extensa 4630Z - Removing French OS and installing English/ | 2022-03-28 12:12 | - | |
| Extensa 4630z XP driver help/ | 2022-03-28 12:12 | - | |
| Extensa 5220 - Reinstalling vista without CD/ | 2022-03-28 12:12 | - | |
| Extensa5220 - wifi problem/ | 2022-03-28 12:12 | - | |
| Extensa 5220 upgrade/ | 2022-03-28 12:12 | - | |
| Extensa 5220 wont boot nor enter bios/ | 2022-03-28 12:12 | - | |
| Extensa 5420, installed new hardware, now lots of things dont work/ | 2022-03-28 12:12 | - | |
| Extensa 5420 - 11.1 volts or 14.8 volts Battery/ | 2022-03-28 12:12 | - | |
| Extensa 5420-5059 GDDR2 or GDDR3/ | 2022-03-28 12:12 | - | |
| Extensa 5420 - Battery Not Detected/ | 2022-03-28 12:12 | - | |
| Extensa 5420 - Should I Change Format From EISA To NTFS/ | 2022-03-28 12:12 | - | |
| Extensa 5420 ... Snappy Except For/ | 2022-03-28 12:12 | - | |
| Extensa 5420 Wont boot/ | 2022-03-28 12:12 | - | |
| Extensa 5420 wifi not working (help!)/ | 2022-03-28 12:12 | - | |
| Extensa 5610 not seeing all 4GB of RAM/ | 2022-03-28 12:12 | - | |
| Extensa 5620-4020- upgrade or replace/ | 2022-03-28 12:12 | - | |
| Extensa 5620-6830 CPU Upgrade/ | 2022-03-28 12:12 | - | |
| Extensa 5620-6830 Share video memory prbl/ | 2022-03-28 12:12 | - | |
| Extensa 5620/ | 2022-03-28 12:12 | - | |
| Extensa 5620 Blue Screen/ | 2022-03-28 12:12 | - | |
| Extensa 5620 CPU Upgrade/ | 2022-03-28 12:12 | - | |
| Extensa 5620 Downgrade to XP/ | 2022-03-28 12:12 | - | |
| Extensa 5620 Recovery CDs/ | 2022-03-28 12:12 | - | |
| Extensa 5620 USB Driver Issue/ | 2022-03-28 12:12 | - | |
| Extensa 5620 XP x64 Display Driver/ | 2022-03-28 12:12 | - | |
| Extensa 5620Z 12 Cell Battery/ | 2022-03-28 12:12 | - | |
| Extensa 5620Z XP Empowering Technology/ | 2022-03-28 12:12 | - | |
| Extensa 5620 with 2003 server/ | 2022-03-28 12:12 | - | |
| Extensa 5620z 3.5mm Female Mount/ | 2022-03-28 12:12 | - | |
| Extensa 5620z StandBy Hibernate lid problem/ | 2022-03-28 12:12 | - | |
| Extensa 5620z eNet doesn't work/ | 2022-03-28 12:12 | - | |
| Extensa 5620z erecovery issue/ | 2022-03-28 12:12 | - | |
| Extensa 5630EZ doesn't POST/ | 2022-03-28 12:12 | - | |
| Extensa 5630ZG Screen Dark/ | 2022-03-28 12:12 | - | |
| Extensa 5635z Stereo Mic help/ | 2022-03-28 12:12 | - | |
| Extensa Bios Update/ | 2022-03-28 12:12 | - | |
| Extensa Recovery Question/ | 2022-03-28 12:12 | - | |
| Extensa downgrade to XP/ | 2022-03-28 12:12 | - | |
| Extensa line of Acer laptops as 'modernized' old Aspire models/ | 2022-03-28 12:12 | - | |
| External Battery for an Acer 5002/ | 2022-03-28 12:12 | - | |
| External DVD RW/ | 2022-03-28 12:12 | - | |
| External Drive question/ | 2022-03-28 12:12 | - | |
| External Keyboard for Ferrari/ | 2022-03-28 12:12 | - | |
| External Monitor/ | 2022-03-28 12:12 | - | |
| External Monitor Issue/ | 2022-03-28 12:12 | - | |
| External Monitor problems/ | 2022-03-28 12:12 | - | |
| External battery charger for Aspire 3050/ | 2022-03-28 12:12 | - | |
| External fan stand/ | 2022-03-28 12:12 | - | |
| External hard drives USB devices with 8204/ | 2022-03-28 12:12 | - | |
| External ieee1394/ | 2022-03-28 12:12 | - | |
| Extracting files from PQSERVICE/ | 2022-03-28 12:12 | - | |
| Extremely weird WIFI problem (AAone D260)/ | 2022-03-28 12:12 | - | |
| Ezdock extension cable/ | 2022-03-28 12:12 | - | |
| F11 won't activate Fullscreen/ | 2022-03-28 12:12 | - | |
| FACTORY RECOVERY DISKS from ACER, Emachines, Gateway will work in their other brand machines/ | 2022-03-28 12:12 | - | |
| FAN ALWAYS ON regardless of temps/ | 2022-03-28 12:12 | - | |
| FAN ON AT 35 CELSIUS/ | 2022-03-28 12:12 | - | |
| FAT32 of NFTS - Which should I use/ | 2022-03-28 12:12 | - | |
| FB No microcode update loaded for alternate processor (ACER)/ | 2022-03-28 12:12 | - | |
| FINALLY got my laptop back! Need some IMPORTANT answers/ | 2022-03-28 12:12 | - | |
| FIR, do you use it/ | 2022-03-28 12:12 | - | |
| FIR on Aspire5672/ | 2022-03-28 12:12 | - | |
| FIX..removed vista and inst xp..now no wireless/ | 2022-03-28 12:12 | - | |
| FN+F5 Does Not Work on 5920G/ | 2022-03-28 12:12 | - | |
| FN Keys .....Display Question for Vista. Drivers or Settings/ | 2022-03-28 12:12 | - | |
| FN key mapping problem, help appreciated!/ | 2022-03-28 12:12 | - | |
| FPS Dropoff on Acer 5920G with 8600GT, In smoke/ | 2022-03-28 12:12 | - | |
| FTP site update for new BIOS, drivers, but not really/ | 2022-03-28 12:12 | - | |
| Factory Default Restore/ | 2022-03-28 12:12 | - | |
| Factory Reset help with F3Se/ | 2022-03-28 12:12 | - | |
| Factory Reset partition/ | 2022-03-28 12:12 | - | |
| Factory Restore Complete Failed/ | 2022-03-28 12:12 | - | |
| Factory Seal broken on my Aspire s7. What should I test/ | 2022-03-28 12:12 | - | |
| Factory phoenix Bios V1.19 or V1.17 for Aspire 7004wsmi/ | 2022-03-28 12:12 | - | |
| Factory reset issues on Acer Travelmate C110/ | 2022-03-28 12:12 | - | |
| Factory setting (Need help)/ | 2022-03-28 12:12 | - | |
| Failed Bios Recovery 6930/ | 2022-03-28 12:12 | - | |
| Failed Bios Update/ | 2022-03-28 12:12 | - | |
| Failed Bios Update Acer Aspire 7741Z/ | 2022-03-28 12:12 | - | |
| Failed attempt at haggling/ | 2022-03-28 12:12 | - | |
| Failed harware problem on 3003LCI/ | 2022-03-28 12:12 | - | |
| Fan 5750g control/ | 2022-03-28 12:12 | - | |
| Fan Always on/ | 2022-03-28 12:12 | - | |
| Fan On 24 7 on Acer Travelmate 8205 WLMi/ | 2022-03-28 12:12 | - | |
| Fan Speed goes high when coming out of standby Acer (TravelMate 6463)/ | 2022-03-28 12:12 | - | |
| Fan Trouble!/ | 2022-03-28 12:12 | - | |
| Fan always enabled on Aspire 5102/ | 2022-03-28 12:12 | - | |
| Fan always on,very annoying situation/ | 2022-03-28 12:12 | - | |
| Fancontrol/ | 2022-03-28 12:12 | - | |
| Fan controller software for Acer 5100/ | 2022-03-28 12:12 | - | |
| Fan control utility/ | 2022-03-28 12:12 | - | |
| Fan control utility for Acer V5 571G/ | 2022-03-28 12:12 | - | |
| Fan is always working!/ | 2022-03-28 12:12 | - | |
| Fan kicking in [45-50 Celsius]/ | 2022-03-28 12:12 | - | |
| Fanless noiseless 3630 as WHS/ | 2022-03-28 12:12 | - | |
| Fan noise! Fan replacement/ | 2022-03-28 12:12 | - | |
| Fan noise on AA1s/ | 2022-03-28 12:12 | - | |
| Fan not working properly on Aspire 5750G/ | 2022-03-28 12:12 | - | |
| Fan on tm4501wlmi/ | 2022-03-28 12:12 | - | |
| Fan problem =[/ | 2022-03-28 12:12 | - | |
| Fan question/ | 2022-03-28 12:12 | - | |
| Fan running loud, but CPU's are cold/ | 2022-03-28 12:12 | - | |
| Fan runs too often/ | 2022-03-28 12:12 | - | |
| Fast answer- Acer 1800/ | 2022-03-28 12:12 | - | |
| Fast delete of acer games, etc/ | 2022-03-28 12:12 | - | |
| Fastest Acer notebooks in the world - 6770M owners club/ | 2022-03-28 12:12 | - | |
| Fastest CPU for Acer Aspire 5002 S754/ | 2022-03-28 12:12 | - | |
| Fastest RAM for Aspire 6920G/ | 2022-03-28 12:12 | - | |
| Fastest RAM on an Acer Aspire 6920-6021/ | 2022-03-28 12:12 | - | |
| Fastest mem for tr8003 Difference between DDR and DDR2/ | 2022-03-28 12:12 | - | |
| Fastest processor i can use with my 6920g/ | 2022-03-28 12:12 | - | |
| Fastest processor that can go in a 4810t/ | 2022-03-28 12:12 | - | |
| Fat32/ | 2022-03-28 12:12 | - | |
| Fat32 to NTFS/ | 2022-03-28 12:12 | - | |
| Fatal Bug in Ubuntu 9.10 Alpha 6, affects timelines/ | 2022-03-28 12:12 | - | |
| Fatal Execution Engine Error (0x7927e03e) and ePower Management/ | 2022-03-28 12:12 | - | |
| Favour please/ | 2022-03-28 12:12 | - | |
| Favour required from AS7520 Geforce 7000m owners!/ | 2022-03-28 12:12 | - | |
| Fed up of waiting for Vista upgrade from Moduslink!/ | 2022-03-28 12:12 | - | |
| Feedback on AS5830TG & AS3830TG-6415 models Any issues with them/ | 2022-03-28 12:12 | - | |
| Ferarri Scroll wheel/ | 2022-03-28 12:12 | - | |
| Ferrai 3200 with Turion MT40 - Neat Mod/ | 2022-03-28 12:12 | - | |
| Ferrari 1000/ | 2022-03-28 12:12 | - | |
| Ferrari 2009 Calendars/ | 2022-03-28 12:12 | - | |
| Ferrari 3000's optical drive/ | 2022-03-28 12:12 | - | |
| Ferrari 3200, changing OS language 9700/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 - Need Suggestions/ | 2022-03-28 12:12 | - | |
| Ferrari 3200/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 Boot Problems/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 HDD upgrade/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 HD speed/ | 2022-03-28 12:12 | - | |
| Ferrari3200 HD video Problems/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 battery life/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 in professional use/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 in stock!!!/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 paint job protection/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 pics/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 processor replacement/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 s-video out/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 upgrade/ | 2022-03-28 12:12 | - | |
| Ferrari 3200 vs. 8003lmi/ | 2022-03-28 12:12 | - | |
| Ferrari 3400, quality of the screen/ | 2022-03-28 12:12 | - | |
| Ferrari 3400 Cant find second memory module Help/ | 2022-03-28 12:12 | - | |
| Ferrari 4000 - Mass Storage Controller/ | 2022-03-28 12:12 | - | |
| Ferrari 4000-series Vista Drivers/ | 2022-03-28 12:12 | - | |
| Ferrari 4000/ | 2022-03-28 12:12 | - | |
| Ferrari 4000 HDD upgrade problem/ | 2022-03-28 12:12 | - | |
| Ferrari 4000 WLAN chip/ | 2022-03-28 12:12 | - | |
| Ferrari 4000 sound/ | 2022-03-28 12:12 | - | |
| Ferrari 4002 & Fan noise/ | 2022-03-28 12:12 | - | |
| Ferrari 4002 or Ferrari 4005/ | 2022-03-28 12:12 | - | |
| Ferrari 4005, Fan Speeds and Temperatures/ | 2022-03-28 12:12 | - | |
| Ferrari 4005- Is the GPU changeable/ | 2022-03-28 12:12 | - | |
| Ferrari 4005- Which recovery disk is WinXP on/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 Bluetooth mouse .. again/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 ML turion mmm/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 Problem/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 Slow Startup/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 Sounds/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 Standby issue(s)/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 WLMi - Font sizes/ | 2022-03-28 12:12 | - | |
| Ferrari 4005WLMi 4-direction scroll button/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 WLMi fails to sleep after windows update/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 battery/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 bus problem/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 or TravelMate 8104 (for MS Vista OS)/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 power supply noise/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 slot DVD drive not accepting disks/ | 2022-03-28 12:12 | - | |
| Ferrari 4005 with Acer ezDock/ | 2022-03-28 12:12 | - | |
| Ferrari 5000 - 64 bit Vista Drivers/ | 2022-03-28 12:12 | - | |
| Ferrari 5000/ | 2022-03-28 12:12 | - | |
| Ferrari 5000 vs. Aspire AS6930-6723/ | 2022-03-28 12:12 | - | |
| Ferrari 5004, HDMI to TV sound issues/ | 2022-03-28 12:12 | - | |
| Ferrari 5005/ | 2022-03-28 12:12 | - | |
| Ferrari 5005 bits/ | 2022-03-28 12:12 | - | |
| Ferrari Bluetooth mouse/ | 2022-03-28 12:12 | - | |
| Ferrari F3000 Heat Issue/ | 2022-03-28 12:12 | - | |
| Ferrari FR4005WLMi/ | 2022-03-28 12:12 | - | |
| Ferrari One- Built-in Microphone/ | 2022-03-28 12:12 | - | |
| Ferrari One - where is it/ | 2022-03-28 12:12 | - | |
| Ferrari One 200 maximum memory 4GB or 8GB/ | 2022-03-28 12:12 | - | |
| Ferrari One Cant Change Desktop ! - Win 7/ | 2022-03-28 12:12 | - | |
| Ferrari One FO200 replace Atheros AR5B93 w Dual Band Card/ | 2022-03-28 12:12 | - | |
| Ferrari One questions/ | 2022-03-28 12:12 | - | |
| Ferrari Optical Drive/ | 2022-03-28 12:12 | - | |
| Ferrari Questions/ | 2022-03-28 12:12 | - | |
| Ferrari Wallpaper question/ | 2022-03-28 12:12 | - | |
| Ferrari Wallpapers/ | 2022-03-28 12:12 | - | |
| Ferrari good on gaming/ | 2022-03-28 12:12 | - | |
| Ferrari heat question/ | 2022-03-28 12:12 | - | |
| Ferrari one +TK42 help/ | 2022-03-28 12:12 | - | |
| Ferrari processor and RAM question, help/ | 2022-03-28 12:12 | - | |
| Ferrari vs. Travelmate/ | 2022-03-28 12:12 | - | |
| Ferrarri One (1810T equiv) keyboard ribbon cable help/ | 2022-03-28 12:12 | - | |
| Ferrri 4002wlmi Windows xp pro/ | 2022-03-28 12:12 | - | |
| Few questions- Aspire Timeline X 5830G/ | 2022-03-28 12:12 | - | |
| Few questions about 4820T/ | 2022-03-28 12:12 | - | |
| Few questions about my acer 5920g/ | 2022-03-28 12:12 | - | |
| Few questions on new BIOS and drivers for 5920G/ | 2022-03-28 12:12 | - | |
| Fighting mice problem/ | 2022-03-28 12:12 | - | |
| File Transfer via USB on Vista Problem/ | 2022-03-28 12:12 | - | |
| Final Fantasy Xiv/ | 2022-03-28 12:12 | - | |
| Final check for 2012WLMi RAM compatability/ | 2022-03-28 12:12 | - | |
| Finally! Found a tool to set my Ram to 400 after installing DDR 400 in my 5003WMLi/ | 2022-03-28 12:12 | - | |
| Finally! New Acer Nvidia Drivers -175.61!/ | 2022-03-28 12:12 | - | |
| Finally. Got the new battery and SSD for my sons S3/ | 2022-03-28 12:12 | - | |
| Finally confirmed- 4501 battery fits 1681/ | 2022-03-28 12:12 | - | |
| Finally decided, buying an Acer/ | 2022-03-28 12:12 | - | |
| Finally fixed that annoying lag every couple minutes on games/ | 2022-03-28 12:12 | - | |
| Finally got CC to instal but still no 1024 x 600, or 1280 x 600 in options/ | 2022-03-28 12:12 | - | |
| Finally the Aspire 1683WLMi/ | 2022-03-28 12:12 | - | |
| Finance Acer, Sager, etc/ | 2022-03-28 12:12 | - | |
| Findigs about timeline excessive battery drain/ | 2022-03-28 12:12 | - | |
| Finding an Acer that is similar to the HP zv5000z/ | 2022-03-28 12:12 | - | |
| Finding compatible US-input keyboard/ | 2022-03-28 12:12 | - | |
| Finding out Touchpad manufactuer - 4810TZ/ | 2022-03-28 12:12 | - | |
| Finding the hardware/ | 2022-03-28 12:12 | - | |
| FineTrack - FingerNav/ | 2022-03-28 12:12 | - | |
| Fine Tuning the Aspire 2012/ | 2022-03-28 12:12 | - | |
| Finger Launch/ | 2022-03-28 12:12 | - | |
| Fingerprint Reader/ | 2022-03-28 12:12 | - | |
| Fingerprint Scanner question for 8943G/ | 2022-03-28 12:12 | - | |
| Fingerprint does not work with internet explorer 8/ | 2022-03-28 12:12 | - | |
| Fingerprint reader and LAN not working anymore/ | 2022-03-28 12:12 | - | |
| Fingerprint reader problems under Vista x64 (6920G)/ | 2022-03-28 12:12 | - | |
| Fingerprint solution/ | 2022-03-28 12:12 | - | |
| Fingerprint sounds/ | 2022-03-28 12:12 | - | |
| Fire Acer Aspire V3-551/ | 2022-03-28 12:12 | - | |
| FireWatcherSSD/ | 2022-03-28 12:12 | - | |
| FireWire Port/ | 2022-03-28 12:12 | - | |
| Firefox 3 and Aspire 8920/ | 2022-03-28 12:12 | - | |
| Firefox Scrolling FIX/ | 2022-03-28 12:12 | - | |
| Fire hazard/ | 2022-03-28 12:12 | - | |
| Firewire/ | 2022-03-28 12:12 | - | |
| Firewire audio interface doesn't work with microsoft/ | 2022-03-28 12:12 | - | |
| Firewire into Acer 1410/ | 2022-03-28 12:12 | - | |
| Firewire on Aspire 5920/ | 2022-03-28 12:12 | - | |
| Firmware update for the 5672wmli/ | 2022-03-28 12:12 | - | |
| First AMD Quad Core Laptop 4551/ | 2022-03-28 12:12 | - | |
| First Acer Laptop with GT 240M and it is AS 5739G/ | 2022-03-28 12:12 | - | |
| First Acer warranty experience to cometh!/ | 2022-03-28 12:12 | - | |
| First Steps/ | 2022-03-28 12:12 | - | |
| First impressions of the Acer Timeline 4810T/ | 2022-03-28 12:12 | - | |
| First time notebook buyer/ | 2022-03-28 12:12 | - | |
| Fitted a turbo memory module in my 5920G/ | 2022-03-28 12:12 | - | |
| Fix for Windows Live Messenger 2009 problem/ | 2022-03-28 12:12 | - | |
| Flakey Power Button/ | 2022-03-28 12:12 | - | |
| Flashed Bios/ | 2022-03-28 12:12 | - | |
| Flashed Bios 6920g and gained 0.200MHZ/ | 2022-03-28 12:12 | - | |
| Flashing(updating) 5930G bios/ | 2022-03-28 12:12 | - | |
| Flashing 5650 card to something else/ | 2022-03-28 12:12 | - | |
| Flashing Aspire 5502 BIOS/ | 2022-03-28 12:12 | - | |
| Flashing BIOS/ | 2022-03-28 12:12 | - | |
| Flashing BIOS from dos/ | 2022-03-28 12:12 | - | |
| Flashing TravelMate 5520 with BIOS 1.17/ | 2022-03-28 12:12 | - | |
| Flicker in external monitor/ | 2022-03-28 12:12 | - | |
| Flickering Ferrari 4005/ | 2022-03-28 12:12 | - | |
| Flickering screen on battery power/ | 2022-03-28 12:12 | - | |
| Fn + Up Down volume popup disappeared on 1810T/ | 2022-03-28 12:12 | - | |
| Fn-F5 toggle on Acer 630 series and SP2/ | 2022-03-28 12:12 | - | |
| Fn Key Screen Display/ | 2022-03-28 12:12 | - | |
| Fn keys don't work on Timeline with XP on it/ | 2022-03-28 12:12 | - | |
| Fn key won't work/ | 2022-03-28 12:12 | - | |
| Focus Jumping/ | 2022-03-28 12:12 | - | |
| For anyone have mouse keyboard input problems!/ | 2022-03-28 12:12 | - | |
| Forcing Aspire 7720G to use internal screen before drivers are loaded/ | 2022-03-28 12:12 | - | |
| Forcing a driver on to PC. How do you do it/ | 2022-03-28 12:12 | - | |
| Forgot Harddisk Password for E725-4520 (_acer type of eMachines_)/ | 2022-03-28 12:12 | - | |
| Forgot laptop password!/ | 2022-03-28 12:12 | - | |
| Forgotten Password/ | 2022-03-28 12:12 | - | |
| Format Acer Travelmate 290/ | 2022-03-28 12:12 | - | |
| Format C drive Only & Reinstall XP on ACER 5502 Laptop, with recovery CD only/ | 2022-03-28 12:12 | - | |
| Format D- Acer 6920 Safe/ | 2022-03-28 12:12 | - | |
| Format PQSERVICE partition/ | 2022-03-28 12:12 | - | |
| Format install vista, install eRecovery/ | 2022-03-28 12:12 | - | |
| Format on ACER Aspire 1350/ | 2022-03-28 12:12 | - | |
| Format problem/ | 2022-03-28 12:12 | - | |
| Formatted/ | 2022-03-28 12:12 | - | |
| Formatted D250, chipset drivers issue/ | 2022-03-28 12:12 | - | |
| Formatted HDD Now Can't Install OS on Acer AspireOne D250 Series/ | 2022-03-28 12:12 | - | |
| Formatting 4500/ | 2022-03-28 12:12 | - | |
| Formatting HDD in Vista/ | 2022-03-28 12:12 | - | |
| Formatting Win XP x64 and Installing 32bit in ferrari 4006/ | 2022-03-28 12:12 | - | |
| Formatting infos needed/ | 2022-03-28 12:12 | - | |
| Formatting issues/ | 2022-03-28 12:12 | - | |
| Formatting my new laptop.. please help if possible/ | 2022-03-28 12:12 | - | |
| Formatting notebook/ | 2022-03-28 12:12 | - | |
| For the most part, whos happy with their Acer/ | 2022-03-28 12:12 | - | |
| For those in the US, Acer Aspire One is on sale at Target, $250 ($220 after $30 gift card)/ | 2022-03-28 12:12 | - | |
| For those using the convert C- fs-ntfs Command/ | 2022-03-28 12:12 | - | |
| For those who notice the touchpad lag on the Acer Timeline series/ | 2022-03-28 12:12 | - | |
| For who it has ACER 4404 or 5670/ | 2022-03-28 12:12 | - | |
| Found a way to boost volume/ | 2022-03-28 12:12 | - | |
| Four way integrated scroll - error message/ | 2022-03-28 12:12 | - | |
| Frame rates drop whenever I charge my Laptop/ | 2022-03-28 12:12 | - | |
| Freaky problem with Acer Aspire 1640/ | 2022-03-28 12:12 | - | |
| Free Space suddenly disappeared from D Drive after installing demo game/ | 2022-03-28 12:12 | - | |
| Free Windows 7 upgrade/ | 2022-03-28 12:12 | - | |
| Freeze issue with acer aspire 5732 Z/ | 2022-03-28 12:12 | - | |
| Freeze on OS installation/ | 2022-03-28 12:12 | - | |
| Freezes while playing DvD's!/ | 2022-03-28 12:12 | - | |
| Freezing Acer!!!!/ | 2022-03-28 12:12 | - | |
| Freezing Aspire 5600/ | 2022-03-28 12:12 | - | |
| Freezing Problem with Acer Aspire 5630/ | 2022-03-28 12:12 | - | |
| Freezing at Windows XP logo/ | 2022-03-28 12:12 | - | |
| Freezing problem/ | 2022-03-28 12:12 | - | |
| Freezing when windows starts/ | 2022-03-28 12:12 | - | |
| Frequency locked to 1ghz/ | 2022-03-28 12:12 | - | |
| Fresh Install. Getting Empowering Software/ | 2022-03-28 12:12 | - | |
| Fresh install (5672)/ | 2022-03-28 12:12 | - | |
| Frozen Screen On My Aspire 1/ | 2022-03-28 12:12 | - | |
| Frustrated with Windows 7 Upgrade on Aspire 1410/ | 2022-03-28 12:12 | - | |
| Fsx Crashing/ | 2022-03-28 12:12 | - | |
| Full BIOS Access/ | 2022-03-28 12:12 | - | |
| Full HD- 1080 Playback/ | 2022-03-28 12:12 | - | |
| Full HD Screen Upgrade for Acer v5/ | 2022-03-28 12:12 | - | |
| Full Screen prob...aspire5720z/ | 2022-03-28 12:12 | - | |
| Full System Backup, Do they include OS/ | 2022-03-28 12:12 | - | |
| Full screen DVD/ | 2022-03-28 12:12 | - | |
| Full upgrade on Aspire 3680/ | 2022-03-28 12:12 | - | |
| Function Key/ | 2022-03-28 12:12 | - | |
| Fundamental flaw in 5672 cooling/ | 2022-03-28 12:12 | - | |
| Funny Acer Jokes/ | 2022-03-28 12:12 | - | |
| Further Tweaks on Aspire 5002WLMi/ | 2022-03-28 12:12 | - | |
| Fuzzy screen on Acer 5720/ | 2022-03-28 12:12 | - | |
| GAcer Aspire 4736g/ | 2022-03-28 12:12 | - | |
| GMA X3100 memory share question in Aspire 4720z/ | 2022-03-28 12:12 | - | |
| GPU Overclocking/ | 2022-03-28 12:12 | - | |
| GPU Repair/ | 2022-03-28 12:12 | - | |
| GPU Upgrades for Acer Aspire 7520/ | 2022-03-28 12:12 | - | |
| GPU spiking causing GPU to downlclock... i think/ | 2022-03-28 12:12 | - | |
| GPU throttling Acer Aspire Gemstone/ | 2022-03-28 12:12 | - | |
| GTA IV & Acer aspire 6920G/ | 2022-03-28 12:12 | - | |
| GTA IV on 6920G - Nvidia Clocks + Temps - OK or Not/ | 2022-03-28 12:12 | - | |
| GTM382 Only !!/ | 2022-03-28 12:12 | - | |
| GTX 860M High temperatures and usage/ | 2022-03-28 12:12 | - | |
| Game Recommendations for 1410 and 1810 notebooks (SU3500, SU2300, Celeron M 743)/ | 2022-03-28 12:12 | - | |
| Game lag/ | 2022-03-28 12:12 | - | |
| Game requirements met/ | 2022-03-28 12:12 | - | |
| Game running too fast/ | 2022-03-28 12:12 | - | |
| Games Problem On Acer Aspire 5920G/ | 2022-03-28 12:12 | - | |
| Games on the Acer 4072WLCI/ | 2022-03-28 12:12 | - | |
| Games running slow/ | 2022-03-28 12:12 | - | |
| Gaming on a TM291Lmi/ | 2022-03-28 12:12 | - | |
| Gaming on an Acer tablet/ | 2022-03-28 12:12 | - | |
| Gaming on the Aspire 1810T Special Edition/ | 2022-03-28 12:12 | - | |
| Gaming wise, which one/ | 2022-03-28 12:12 | - | |
| Gateway's equivalent for the Acer 1810T/ | 2022-03-28 12:12 | - | |
| Gateway LT Series LT2044u/ | 2022-03-28 12:12 | - | |
| GeForce 9500M GS the best out there/ | 2022-03-28 12:12 | - | |
| GeForce 9600M GT - overscan problem/ | 2022-03-28 12:12 | - | |
| GeForce 9600M GT overheating on Aspire 7720g/ | 2022-03-28 12:12 | - | |
| GeForce Go 6100 Vista drivers no available/ | 2022-03-28 12:12 | - | |
| Gears Of War.. What a big pain the ars!!/ | 2022-03-28 12:12 | - | |
| Geforce 9600m gs for old acer 5520g/ | 2022-03-28 12:12 | - | |
| Geforce GT 420m, crashing with punkbuster, BF-BC2!!!/ | 2022-03-28 12:12 | - | |
| Gemstome Blue Users, Post If You've Been Throttled!/ | 2022-03-28 12:12 | - | |
| Gemstone Blue 8920 Pricing and Availability in the USA/ | 2022-03-28 12:12 | - | |
| Gemstone Blue Overclocking/ | 2022-03-28 12:12 | - | |
| Gemstone Blue Owners Lounge/ | 2022-03-28 12:12 | - | |
| Gemstone Blue record from mixer/ | 2022-03-28 12:12 | - | |
| Gemstone Quality/ | 2022-03-28 12:12 | - | |
| Gemstone blue dust in speaker panel/ | 2022-03-28 12:12 | - | |
| General- programs used to check laptop temperature/ | 2022-03-28 12:12 | - | |
| Generic Batteries OK/ | 2022-03-28 12:12 | - | |
| German acer (or any other laptop) users! Help me please/ | 2022-03-28 12:12 | - | |
| Get 1810t-8968 or wait for 1830t/ | 2022-03-28 12:12 | - | |
| Get my money back/ | 2022-03-28 12:12 | - | |
| Get out of my screen!/ | 2022-03-28 12:12 | - | |
| Get rid of your 5920 nvidia stock drivers/ | 2022-03-28 12:12 | - | |
| Getting Laptop on Wednesday....What should I do !/ | 2022-03-28 12:12 | - | |
| Getting No Partition Error When Attempting Reload of O S/ | 2022-03-28 12:12 | - | |
| Getting an Acer Aspire 5520, some info plzz/ | 2022-03-28 12:12 | - | |
| Getting an Aspire 5742G. Can it take a 1080p screen/ | 2022-03-28 12:12 | - | |
| Getting an older acer s3 for my son. What can be upgraded/ | 2022-03-28 12:12 | - | |
| Getting back to Vista through acerboot.iso/ | 2022-03-28 12:12 | - | |
| Getting choppiness issues/ | 2022-03-28 12:12 | - | |
| Getting in to bios settings/ | 2022-03-28 12:12 | - | |
| Getting nostaligic with the 8204WLMi/ | 2022-03-28 12:12 | - | |
| Getting rid of PQSERVICE/ | 2022-03-28 12:12 | - | |
| Getting to mobo how on travelmate 4010/ | 2022-03-28 12:12 | - | |
| Ghetto Acer 2010 2012 Laptop Keyboard/ | 2022-03-28 12:12 | - | |
| Ghost, recovery disks, and custom partition size/ | 2022-03-28 12:12 | - | |
| Gigabit ethernet on my Aspire 7520/ | 2022-03-28 12:12 | - | |
| Give me reasons not to buy $1600 Predator 7 on Amazon/ | 2022-03-28 12:12 | - | |
| Going WAAAAAAY Back. Upgrade CPU from Turion single to dual on Ferrari 4000/ | 2022-03-28 12:12 | - | |
| Going for it/ | 2022-03-28 12:12 | - | |
| Going from 2gb to 4gb, Aspire 5251/ | 2022-03-28 12:12 | - | |
| Going from Vista to XP on Acer 5100/ | 2022-03-28 12:12 | - | |
| Good Acer resellers NOT in California/ | 2022-03-28 12:12 | - | |
| Good Deal/ | 2022-03-28 12:12 | - | |
| Good News! Acer Vista Upgrade Available/ | 2022-03-28 12:12 | - | |
| Good Question/ | 2022-03-28 12:12 | - | |
| Good Website To Order Spare Parts For 4830TG/ | 2022-03-28 12:12 | - | |
| Goodbye 5315/ | 2022-03-28 12:12 | - | |
| Goodbye 5920/ | 2022-03-28 12:12 | - | |
| Goodbye to the trusty 5102, Say Hello to my little friend!!/ | 2022-03-28 12:12 | - | |
| Good games/ | 2022-03-28 12:12 | - | |
| Good old Acer (Travelmate 4230)/ | 2022-03-28 12:12 | - | |
| Good place to get Acer laptops/ | 2022-03-28 12:12 | - | |
| Good software that lowers cpu temp at idle/ | 2022-03-28 12:12 | - | |
| Good upgradable one for $1000-$1500/ | 2022-03-28 12:12 | - | |
| Google Chrome on the 6920/ | 2022-03-28 12:12 | - | |
| Got 1 14.8v battery for my 5935g/ | 2022-03-28 12:12 | - | |
| Got An Acer Aspire 4720z Problem....help!/ | 2022-03-28 12:12 | - | |
| Got Intel 965 video chipset ..do not go latest driver !/ | 2022-03-28 12:12 | - | |
| Got My NEW 1694 Canadian Edition Laptop/ | 2022-03-28 12:12 | - | |
| Got My TM6592G, Now What And ePower/ | 2022-03-28 12:12 | - | |
| Got TM 8204- Clean Install Info, Drivers, NTFS, etc/ | 2022-03-28 12:12 | - | |
| Got coke on my keyboard/ | 2022-03-28 12:12 | - | |
| Got fresh new Battery - Any tips/ | 2022-03-28 12:12 | - | |
| Got my 5650 with geforce 7600 today!/ | 2022-03-28 12:12 | - | |
| Got my Acer/ | 2022-03-28 12:12 | - | |
| Got my Aspire 1681!!!/ | 2022-03-28 12:12 | - | |
| Got my Gemstone blue today/ | 2022-03-28 12:12 | - | |
| Got my HDD, I need RAM now for 3201xci/ | 2022-03-28 12:12 | - | |
| Got my money ready but, 5920 6313 disappeared/ | 2022-03-28 12:12 | - | |
| Got the wife a new laptop! (6920g)/ | 2022-03-28 12:12 | - | |
| Grammy1234/ | 2022-03-28 12:12 | - | |
| Graphic Card RAM improvement/ | 2022-03-28 12:12 | - | |
| Graphic Card Upgrade/ | 2022-03-28 12:12 | - | |
| Graphic Question for TravelMate 8204/ | 2022-03-28 12:12 | - | |
| Graphic card for Acer Aspire 7720/ | 2022-03-28 12:12 | - | |
| Graphic card for acer 8942G/ | 2022-03-28 12:12 | - | |
| Graphic driver update/ | 2022-03-28 12:12 | - | |
| Graphics Card upgrade for Acer TM 4502LMi/ | 2022-03-28 12:12 | - | |
| Graphics Card upgrade on Acer 5135/ | 2022-03-28 12:12 | - | |
| Graphics Driver 8204/ | 2022-03-28 12:12 | - | |
| Graphics Drivers/ | 2022-03-28 12:12 | - | |
| Graphics Issues with Acer Aspire 5742G-7200/ | 2022-03-28 12:12 | - | |
| Graphics Memory Resetting Itself/ | 2022-03-28 12:12 | - | |
| Graphics card not working/ | 2022-03-28 12:12 | - | |
| Graphics card upgrade in 5920/ | 2022-03-28 12:12 | - | |
| Graphics driver/ | 2022-03-28 12:12 | - | |
| Graphics driver upgrade on Acer Aspire 4920/ | 2022-03-28 12:12 | - | |
| Graphics driver wont install, weird error/ | 2022-03-28 12:12 | - | |
| Graphics on Acer 5050-3785/ | 2022-03-28 12:12 | - | |
| Graphics or GPU upgrade/ | 2022-03-28 12:12 | - | |
| Graphics stopped working on my Acer 7720ZG with nVidia GeForce 8400M GS/ | 2022-03-28 12:12 | - | |
| Great Acer Support story/ | 2022-03-28 12:12 | - | |
| Great Deal on An Acer Notebook!/ | 2022-03-28 12:12 | - | |
| Great backup options (cf. MacOS Time Machine)/ | 2022-03-28 12:12 | - | |
| Green image Help!/ | 2022-03-28 12:12 | - | |
| Green spots on screen!/ | 2022-03-28 12:12 | - | |
| GregHSRW.exe/ | 2022-03-28 12:12 | - | |
| GridVista available separately/ | 2022-03-28 12:12 | - | |
| Grinding Fan!/ | 2022-03-28 12:12 | - | |
| Ground lifting on Acer Power Supply/ | 2022-03-28 12:12 | - | |
| Grow up Acer users/ | 2022-03-28 12:12 | - | |
| Guide - How to install Windows 7 x64 on Acer Spin 5 laptop/ | 2022-03-28 12:12 | - | |
| Guide- Overclocking Acer 5672 (and possibly other Socket M builds)/ | 2022-03-28 12:12 | - | |
| Guide on stripping down Aspire 3680 (3682WXMi)/ | 2022-03-28 12:12 | - | |
| Guide to Acer 8204 merom upgrade/ | 2022-03-28 12:12 | - | |
| Guide to Dual booting Windows and ubuntu/ | 2022-03-28 12:12 | - | |
| Guys a Little Help/ | 2022-03-28 12:12 | - | |
| H!E!L!P! Display problems/ | 2022-03-28 12:12 | - | |
| H.264 AVC graphics acceleration in the series timeline/ | 2022-03-28 12:12 | - | |
| H264 Performance Test/ | 2022-03-28 12:12 | - | |
| HD3650 in 5920G doesn't boot/ | 2022-03-28 12:12 | - | |
| HD4650 vs 9600M GT for acer 4720G/ | 2022-03-28 12:12 | - | |
| HD5650 OC Temperature-question (aspire 8943G)/ | 2022-03-28 12:12 | - | |
| HDCP not supported in Realtek HDMI Output for 5920G, Win 7 with Realtek 2.36/ | 2022-03-28 12:12 | - | |
| HDD Activity Noise - normal/ | 2022-03-28 12:12 | - | |
| HDD Heat/ | 2022-03-28 12:12 | - | |
| HDD Performance Numbers/ | 2022-03-28 12:12 | - | |
| HDD Replacement Help/ | 2022-03-28 12:12 | - | |
| HDD Spinning Up And Down - Acer 5755G/ | 2022-03-28 12:12 | - | |
| HD DVD Firmware/ | 2022-03-28 12:12 | - | |
| HD DVD drive upgrade for 5920/ | 2022-03-28 12:12 | - | |
| HD DVD not playing protected content/ | 2022-03-28 12:12 | - | |
| HD DVD not reading/ | 2022-03-28 12:12 | - | |
| HDD burning smell/ | 2022-03-28 12:12 | - | |
| HDD for 8204 help/ | 2022-03-28 12:12 | - | |
| HDD for Acer Aspire 5100/ | 2022-03-28 12:12 | - | |
| HDD problem with Acer Aspire 5315/ | 2022-03-28 12:12 | - | |
| HDD screwed (i think)/ | 2022-03-28 12:12 | - | |
| HDD slow in AHCI and one more problem/ | 2022-03-28 12:12 | - | |
| HDD upgrade on 1524 problem/ | 2022-03-28 12:12 | - | |
| HDMI Input/ | 2022-03-28 12:12 | - | |
| HDMI Out on Acer 5920H/ | 2022-03-28 12:12 | - | |
| HDMI Output on 8930g/ | 2022-03-28 12:12 | - | |
| HDMI Out to 1080p - AS4820TG/ | 2022-03-28 12:12 | - | |
| HDMI Problem - Timeline 1810/ | 2022-03-28 12:12 | - | |
| HDMI as input/ | 2022-03-28 12:12 | - | |
| HDMI connection laptop to TV/ | 2022-03-28 12:12 | - | |
| HDMI not working/ | 2022-03-28 12:12 | - | |
| HDMI problem/ | 2022-03-28 12:12 | - | |
| HDMI sound not working! (5738ZG)/ | 2022-03-28 12:12 | - | |
| HD Size/ | 2022-03-28 12:12 | - | |
| HD Temperature in Asp 1683 WLMi/ | 2022-03-28 12:12 | - | |
| HD connections/ | 2022-03-28 12:12 | - | |
| HD dying and Bios Error Code for Acer 1691/ | 2022-03-28 12:12 | - | |
| HD on TM 8204/ | 2022-03-28 12:12 | - | |
| HELLLP! Did I screw up my 5672/ | 2022-03-28 12:12 | - | |
| HELP!!!!!!!!! acer aspire 6920g gemstone VISTA TO XP/ | 2022-03-28 12:13 | - | |
| HELP!!!!acer 6920g not starting/ | 2022-03-28 12:13 | - | |
| HELP!!! ACER 4402WLMi Graphic Card Problem/ | 2022-03-28 12:13 | - | |
| HELP!!! Acer TM 4502 WLMi or 4002 WLMi/ | 2022-03-28 12:13 | - | |
| HELP !!!Acer TravelMate Timeline TM8471-6306 Wireless Issues/ | 2022-03-28 12:12 | - | |
| HELP!!! Acer eRecovery - HELP!!!/ | 2022-03-28 12:13 | - | |
| HELP !!! How to disable the Intel Chipset and Hybrid Mode in Acer Aspire 5745G/ | 2022-03-28 12:12 | - | |
| HELP!!! new hard drive installation problem HELP!!!/ | 2022-03-28 12:13 | - | |
| HELP!! ACER 4920 power/ | 2022-03-28 12:13 | - | |
| HELP!! Acer 1681wlmi CD DVD drawer broken ( )/ | 2022-03-28 12:13 | - | |
| HELP!! Acer Travelmate 2480-2196 CPU UPGRADE/ | 2022-03-28 12:13 | - | |
| HELP!! Aspire 4315/ | 2022-03-28 12:13 | - | |
| HELP!! I spilled water on my laptop/ | 2022-03-28 12:13 | - | |
| HELP!...I need a CAD Notebook/ | 2022-03-28 12:13 | - | |
| HELP! 5560 screen & MC problems after install/ | 2022-03-28 12:13 | - | |
| HELP! Acer 5920G HDMI out do not work/ | 2022-03-28 12:13 | - | |
| HELP! BIOS/ | 2022-03-28 12:13 | - | |
| HELP! Battery Confusion over Acer 5315-2153/ | 2022-03-28 12:13 | - | |
| HELP! Boot Problems/ | 2022-03-28 12:13 | - | |
| HELP! Done restore to factory setings with empowering technology. will no longer start/ | 2022-03-28 12:13 | - | |
| HELP! Fn +F5 key not working to access S-Video/ | 2022-03-28 12:13 | - | |
| HELP! Hidden Partition Recover/ | 2022-03-28 12:13 | - | |
| HELP! Hidden partition gone/ | 2022-03-28 12:13 | - | |
| HELP! I deleted my audio driver by mistake/ | 2022-03-28 12:13 | - | |
| HELP! Just received new 6920G. Problem with webcam, Blue-ray and a speakers query too!/ | 2022-03-28 12:13 | - | |
| HELP! Laptop just freezes - even after clean XP install/ | 2022-03-28 12:13 | - | |
| HELP! My Acer Aspire 5630 w Windows XP is having serious driver issues/ | 2022-03-28 12:13 | - | |
| HELP! My Acer Doesn't Recognize It's Bluetooth Anymore!!/ | 2022-03-28 12:13 | - | |
| HELP!Need Acer Aspire 4920G OS XP All Drivers/ | 2022-03-28 12:13 | - | |
| HELP! New Drivers/ | 2022-03-28 12:13 | - | |
| HELP! Recovery problems!/ | 2022-03-28 12:13 | - | |
| HELP! Stuck in Reverse Display (Aspire Vista)/ | 2022-03-28 12:13 | - | |
| HELP! Touchpad suddenly stopped working/ | 2022-03-28 12:13 | - | |
| HELP! needed with Acer's 5 in 1 Card Reader/ | 2022-03-28 12:13 | - | |
| HELP! need pll for ACER EXTENSA 5620-4801/ | 2022-03-28 12:13 | - | |
| HELP, Need to download Acer 5672 Mat a driver/ | 2022-03-28 12:13 | - | |
| HELP - 2nd External Drive Won't Mount/ | 2022-03-28 12:12 | - | |
| HELP- 3002wlci Windows Xp Home Recovery Discs!!!/ | 2022-03-28 12:13 | - | |
| HELP - 3820TG with 6550M graphic problems/ | 2022-03-28 12:12 | - | |
| HELP- How to burn recovery discs/ | 2022-03-28 12:13 | - | |
| HELP - Laptop LCD Problem/ | 2022-03-28 12:12 | - | |
| HELP- Travelmate 7730 working OK - but screen black!/ | 2022-03-28 12:13 | - | |
| HELP - just loaded Win 7 on 4810 Timeline and now DVD drive does not work/ | 2022-03-28 12:12 | - | |
| HELP- portability issues with 2012WLMi/ | 2022-03-28 12:13 | - | |
| HELP 5610Z CD DVD Drive not working/ | 2022-03-28 12:12 | - | |
| HELP ACER DISCONTINUED MODELS/ | 2022-03-28 12:12 | - | |
| HELP Acer Aspire 8920-6671 headphones sound/ | 2022-03-28 12:12 | - | |
| HELP Acer aspire 3660 performance problems/ | 2022-03-28 12:12 | - | |
| HELP HELP reformatting acer/ | 2022-03-28 12:12 | - | |
| HELP I want need something like this! ASAP!/ | 2022-03-28 12:12 | - | |
| HELP MASTERS! Technical Manual/ | 2022-03-28 12:12 | - | |
| HELP My laptop = HELLEN KELLER/ | 2022-03-28 12:12 | - | |
| HELP Wanted, Memory for Aspire 5620 - any ideas/ | 2022-03-28 12:13 | - | |
| HELP laptop randomly turns off when doing a clean install/ | 2022-03-28 12:12 | - | |
| HELP please with 3690 beeping at start/ | 2022-03-28 12:12 | - | |
| HELP tm8204 turn on doesnt work/ | 2022-03-28 12:12 | - | |
| HELP touch pad dosent work/ | 2022-03-28 12:12 | - | |
| HELP with Aspire 9412 screen brightness/ | 2022-03-28 12:13 | - | |
| HEY, does my laptop have 1080p And empowering tech frivers for windows 7/ | 2022-03-28 12:13 | - | |
| HI,im new...question about the TM8204WLMI/ | 2022-03-28 12:13 | - | |
| HI, my name is Mr. confused/ | 2022-03-28 12:13 | - | |
| HI GUYS! New acer owner, emergency laptop purchase!/ | 2022-03-28 12:13 | - | |
| HL-DT-ST DVDRAM GT30N ATA Device/ | 2022-03-28 12:13 | - | |
| HL2 on Travelmate 4501WLMi/ | 2022-03-28 12:13 | - | |
| HOT NEW TOPIC ALL PROFESSIONALS POST NOWWWWWWW !!!/ | 2022-03-28 12:13 | - | |
| HP Envy 14 vs. Acer 3820TG/ | 2022-03-28 12:13 | - | |
| HP dv9335nr vs. acer aspire AS5920-6313/ | 2022-03-28 12:13 | - | |
| HP romless AMD M5950 GDDR5 - need help to get it work on Acer 7738g/ | 2022-03-28 12:13 | - | |
| HWmonitor showing only 1 core. Acer 6925g/ | 2022-03-28 12:13 | - | |
| Hack for converting basic disk to dynamic in 6930/ | 2022-03-28 12:12 | - | |
| Hair behind my screen, how do I disassemble a 6920G/ | 2022-03-28 12:12 | - | |
| Half Life 2 On Acer 2012 wlmi/ | 2022-03-28 12:12 | - | |
| HalfLife 2 and Apire 5672/ | 2022-03-28 12:12 | - | |
| Half Life 2 on Aspire 2012/ | 2022-03-28 12:12 | - | |
| Halo 2 BSOD on startup with my 5920G/ | 2022-03-28 12:12 | - | |
| Happy New Year/ | 2022-03-28 12:12 | - | |
| Happy new owner of a 8204!!!/ | 2022-03-28 12:12 | - | |
| Hard-disk in optical Bay on as2930. Possible/ | 2022-03-28 12:12 | - | |
| HardDisk Drive Problems/ | 2022-03-28 12:12 | - | |
| Hard Disk Partitioning/ | 2022-03-28 12:12 | - | |
| Hard Disk replacement/ | 2022-03-28 12:12 | - | |
| Hard Drive/ | 2022-03-28 12:12 | - | |
| Hard Drive Clicking. Need Second Opionion Please!!/ | 2022-03-28 12:12 | - | |
| Hard Drive Dead/ | 2022-03-28 12:12 | - | |
| Hard Drive Partition Flags/ | 2022-03-28 12:12 | - | |
| Hard Drive configuration and format/ | 2022-03-28 12:12 | - | |
| Hard Drive for Acer Aspire 6930G/ | 2022-03-28 12:12 | - | |
| Hard Drive question/ | 2022-03-28 12:12 | - | |
| Hard disk Partition in 5740g/ | 2022-03-28 12:12 | - | |
| Harddisk falls asleep too fast/ | 2022-03-28 12:12 | - | |
| Hard disk working even when inactive/ | 2022-03-28 12:12 | - | |
| Hard drive..too hot to handle/ | 2022-03-28 12:12 | - | |
| Harddrive for Aspire 8920/ | 2022-03-28 12:12 | - | |
| Hard drive install Acer 2300/ | 2022-03-28 12:12 | - | |
| Hard drive issue with Aspire 5050/ | 2022-03-28 12:12 | - | |
| Hard drive question on my acer aspire 5742/ | 2022-03-28 12:12 | - | |
| Hard time installing XP on Aspire 5740G-6979 -/ | 2022-03-28 12:12 | - | |
| Hardware-Problem, who know/ | 2022-03-28 12:12 | - | |
| Hardware help/ | 2022-03-28 12:12 | - | |
| Hardware test programs/ | 2022-03-28 12:12 | - | |
| Hardware upgrade on a Aspire 9300/ | 2022-03-28 12:12 | - | |
| Has ACER keyboard quality deteriorated with latest models/ | 2022-03-28 12:12 | - | |
| Has Acer dropped Bluetooth on all their 3810-series laptops/ | 2022-03-28 12:12 | - | |
| Has Anyone Been Able to Boot from UFD/ | 2022-03-28 12:12 | - | |
| Has Anyone Replaced A Matte Screen on Their Acer with a Glossy Screen/ | 2022-03-28 12:12 | - | |
| Has anybody applied for Windows Vista Upgrade Kit/ | 2022-03-28 12:12 | - | |
| Has anyone figured out the touchpad scroll issue for the 7720 on windows 10/ | 2022-03-28 12:12 | - | |
| Has anyone here modded their AAO with a touchscreen/ | 2022-03-28 12:12 | - | |
| Has anyone managed to increase Onboard sound past 100% I have a 5920g, the volume is nowhere near reaching capacity of the speakr/ | 2022-03-28 12:12 | - | |
| Has anyone opened up their Acer Aspire 5100 Where or what, is the motherboard manufacturer and model/ | 2022-03-28 12:12 | - | |
| Has anyone overclocked the Acer 6920g CPU/ | 2022-03-28 12:12 | - | |
| Has anyone received thier free Win 7 Upgrade from Acer yet/ | 2022-03-28 12:12 | - | |
| Has anyone tried playing Oblivion on an Acer 5672/ | 2022-03-28 12:12 | - | |
| Has anyone tried to run TWO external monitors on their Acer laptop/ | 2022-03-28 12:12 | - | |
| Has anyone try OMEGA 6.9 drivers yet/ | 2022-03-28 12:12 | - | |
| Have I killed my graphics card/ | 2022-03-28 12:12 | - | |
| Have I lost my e-Recovery/ | 2022-03-28 12:12 | - | |
| Have any one try shipping a notebook to Canada/ | 2022-03-28 12:12 | - | |
| Have i damaged the port on my ACER aspire P193W Desktop/ | 2022-03-28 12:12 | - | |
| Have i messed up/ | 2022-03-28 12:12 | - | |
| Haven't seen this here before/ | 2022-03-28 12:12 | - | |
| Have you replaced Vista w XP/ | 2022-03-28 12:12 | - | |
| Having an odd problem/ | 2022-03-28 12:12 | - | |
| Having a scrolling issue from the touchpad, please help!!/ | 2022-03-28 12:12 | - | |
| Having lockups and blue screen of death issues with wifi adapter on Aspire 8943g/ | 2022-03-28 12:12 | - | |
| Having problems after updating 6920g sound driver/ | 2022-03-28 12:12 | - | |
| Having problems with finding Russian keaboard drivers for my ACER laptop/ | 2022-03-28 12:12 | - | |
| Having trouble loading new bios update on 5920g/ | 2022-03-28 12:12 | - | |
| Having trouble watching 3D on my new vizio from Acer Aspire 5750Z-4877/ | 2022-03-28 12:12 | - | |
| Having trouble with DVDs/ | 2022-03-28 12:12 | - | |
| Hd-dvd 5920g/ | 2022-03-28 12:12 | - | |
| Hdd Locked after updating bios/ | 2022-03-28 12:12 | - | |
| Hdd upgrade/ | 2022-03-28 12:12 | - | |
| Hdmi + X3100/ | 2022-03-28 12:12 | - | |
| Hdmi Cable = No Surround Sound/ | 2022-03-28 12:12 | - | |
| Headphones noise with the backlight on, 2012wlmi/ | 2022-03-28 12:12 | - | |
| Headset Problem/ | 2022-03-28 12:12 | - | |
| Headset mic and earphones not working/ | 2022-03-28 12:12 | - | |
| Headset recommendation for Acer 1810T/ | 2022-03-28 12:12 | - | |
| Heat Monitoring Program/ | 2022-03-28 12:12 | - | |
| Heating Problems!!- Travelmate 8006/ | 2022-03-28 12:12 | - | |
| Heatsink screw stuck/ | 2022-03-28 12:12 | - | |
| Heeeelp, Heat Issues/ | 2022-03-28 12:12 | - | |
| He got his way. We bought the Second hand one/ | 2022-03-28 12:12 | - | |
| Height of the TravelMate 8204/ | 2022-03-28 12:12 | - | |
| Hel!!! Acer Travelmate 5720 Died after 13 months/ | 2022-03-28 12:12 | - | |
| Hello!!! Acer aspire 5050-3785 upgrade question/ | 2022-03-28 12:12 | - | |
| Hello! I am new to this forum, and have a few questions. - )/ | 2022-03-28 12:12 | - | |
| Hello, aspire 3000 keyboard,not working wireless light not appearing!!!/ | 2022-03-28 12:12 | - | |
| Hello Fellow Acer owners/ | 2022-03-28 12:12 | - | |
| Helo Aspire AS7104WSMi/ | 2022-03-28 12:12 | - | |
| Help!!! Acer 1410/ | 2022-03-28 12:13 | - | |
| Help!!! Aspire Ethos 8951G - Very Slow Boot with OCZ Vertex 4 SSD/ | 2022-03-28 12:13 | - | |
| Help!!! Help!!! OMG Help!!!/ | 2022-03-28 12:13 | - | |
| Help!!! My 5920G could not even boot. -(/ | 2022-03-28 12:13 | - | |
| Help! !/ | 2022-03-28 12:13 | - | |
| Help!!/ | 2022-03-28 12:13 | - | |
| Help!! Acer Recovery Disc Issues -(/ | 2022-03-28 12:13 | - | |
| Help!! Dire need of 4672wlmi heatsink fan/ | 2022-03-28 12:13 | - | |
| Help!! I'm new and fairly rubbish!/ | 2022-03-28 12:13 | - | |
| Help!! Travelmate froze when doing recovery/ | 2022-03-28 12:13 | - | |
| Help! - Removed bloatware now Blu Ray doesn't work/ | 2022-03-28 12:13 | - | |
| Help!/ | 2022-03-28 12:13 | - | |
| Help! 12 Cell Battery for Acer Extensa 4620z/ | 2022-03-28 12:13 | - | |
| Help! AS1410 keyboard getting stiff!/ | 2022-03-28 12:13 | - | |
| Help! Acer 2012 Cracked Hinge and Display Problem/ | 2022-03-28 12:13 | - | |
| Help! Acer 5100/ | 2022-03-28 12:13 | - | |
| Help! Acer 8950G bios update failure/ | 2022-03-28 12:13 | - | |
| Help! Acer Aspire 4755G can not Output to HDTV once in Windows 7!/ | 2022-03-28 12:13 | - | |
| Help! Acer Aspire 5100 Help Needed!/ | 2022-03-28 12:13 | - | |
| Help! Acer Aspire 5739G Irregularly Crashes/ | 2022-03-28 12:13 | - | |
| Help ! Acer eRecovery software/ | 2022-03-28 12:12 | - | |
| Help! Aspire 3003 Problem/ | 2022-03-28 12:13 | - | |
| Help! Aspire 5739G Win7 Desktop Lock Up/ | 2022-03-28 12:13 | - | |
| Help! Aspire Acer keyboard/ | 2022-03-28 12:13 | - | |
| Help!Bug has killed my attempt at system recovery/ | 2022-03-28 12:13 | - | |
| Help! Can't Boot from CD on Acer Aspire 2920!!!!!!!!!!!!!!!!/ | 2022-03-28 12:13 | - | |
| Help! Can't Get NIC to work!/ | 2022-03-28 12:13 | - | |
| Help! Dvdrw Acer 5315/ | 2022-03-28 12:13 | - | |
| Help! Fan sounds like its rubbing against the bottom cover!/ | 2022-03-28 12:13 | - | |
| Help! Garbled display on ATI 9700!!!/ | 2022-03-28 12:13 | - | |
| Help! Help!! Help!!!/ | 2022-03-28 12:13 | - | |
| Help! Laptop screen frozen/ | 2022-03-28 12:13 | - | |
| Help! Laptop will not charge/ | 2022-03-28 12:13 | - | |
| Help! My 5740G won't boot!/ | 2022-03-28 12:13 | - | |
| Help! Need 64bit drivers for Aspire 7520 dvdrom drive/ | 2022-03-28 12:13 | - | |
| Help! Need Acer 6920G bios 1.04 or 1.02/ | 2022-03-28 12:13 | - | |
| Help! Need Acer Vista Installation cd/ | 2022-03-28 12:13 | - | |
| Help! Need Aspire 5670 recovery DVD/ | 2022-03-28 12:13 | - | |
| Help! Noisy recording from built in Microphone in 6930G/ | 2022-03-28 12:13 | - | |
| Help! Overheating/ | 2022-03-28 12:13 | - | |
| Help! Problems with installing Nvidia drivers on my Aspire 5920/ | 2022-03-28 12:13 | - | |
| Help! Problems with starting laptop/ | 2022-03-28 12:13 | - | |
| Help! Re-install Vista for Travelmate 6292/ | 2022-03-28 12:13 | - | |
| Help! Regarding eRecovery Management/ | 2022-03-28 12:13 | - | |
| Help! Restoring 5103 from PQSERVICE after Ubuntu repartitioning/ | 2022-03-28 12:13 | - | |
| Help! SD Card slot driving me bananas/ | 2022-03-28 12:13 | - | |
| Help! Very annoying keyboard problem/ | 2022-03-28 12:13 | - | |
| Help! What should be here (Pic.) 5100/ | 2022-03-28 12:13 | - | |
| Help! Where to order a keyboard for an Aspire/ | 2022-03-28 12:13 | - | |
| Help! Windows vista Activation message (Acer 5315-2122)/ | 2022-03-28 12:13 | - | |
| Help! my Aspire 5920g cant detect the Nvidia 8600M gs graphics card after re-formatting/ | 2022-03-28 12:13 | - | |
| Help! recovery issue in my new Aspire 5920G/ | 2022-03-28 12:13 | - | |
| Help, Acer Aspire 3000 Alt +F10 disaster!/ | 2022-03-28 12:13 | - | |
| Help, How can I upgrade Bluetooth on Acer Aspire2K/ | 2022-03-28 12:13 | - | |
| Help, Random laptop freeze, Running out of ideas!!!/ | 2022-03-28 12:13 | - | |
| Help, disassembly (video or pdf) guide for 1810T needed!/ | 2022-03-28 12:13 | - | |
| Help, guys! Acer V3-571G BIOS flash issue/ | 2022-03-28 12:13 | - | |
| Help, just bought an Acer Aspire 6920/ | 2022-03-28 12:13 | - | |
| Help -)/ | 2022-03-28 12:12 | - | |
| Help - Acer 1700 Power up Problem/ | 2022-03-28 12:12 | - | |
| Help- Acer Aspire 2010 reset BIOS/ | 2022-03-28 12:13 | - | |
| Help- Acer aspire 9302awsmi defect dvddrive/ | 2022-03-28 12:13 | - | |
| Help- Battery recalibration 6920g/ | 2022-03-28 12:13 | - | |
| Help- Clean Install on a new laptop/ | 2022-03-28 12:13 | - | |
| Help-How to enable hardware virtualization in Acer Travelmate 4740/ | 2022-03-28 12:13 | - | |
| Help- Looking for Aspire 1410 replacement charger/ | 2022-03-28 12:13 | - | |
| Help - Looking for a Manual/ | 2022-03-28 12:12 | - | |
| Help- Multi Monitor On Acer Aspire 5536/ | 2022-03-28 12:13 | - | |
| Help- My Model - Acer Aspire Z5610/ | 2022-03-28 12:13 | - | |
| Help- NIT Backup and NTI Media Maker dependencies/ | 2022-03-28 12:13 | - | |
| Help- Need live help with Gparted. Anyone around/ | 2022-03-28 12:13 | - | |
| Help - Photos of external tv antenna from Acer/ | 2022-03-28 12:12 | - | |
| Help-Problem about Disk2Disk vista recovery(Extensa 4620Z)/ | 2022-03-28 12:13 | - | |
| Help - Read Error causes HDtune to abort test!/ | 2022-03-28 12:12 | - | |
| Help- Recover Office 2007 Trial only, from factory backup/ | 2022-03-28 12:13 | - | |
| Help- Resize C drive and delete Hidden partition/ | 2022-03-28 12:13 | - | |
| Help- Selective Re-Install of Factory Software/ | 2022-03-28 12:13 | - | |
| Help- Suggestions for a free uninstall program/ | 2022-03-28 12:13 | - | |
| Help- What does eRecovery back up Hidden partition or C Drive/ | 2022-03-28 12:13 | - | |
| Help - Which Laptop Model Is This/ | 2022-03-28 12:12 | - | |
| Help- Why HDD light flashes when computer is idle/ | 2022-03-28 12:13 | - | |
| Help - are these terminal signs (Acer aspire 1690)/ | 2022-03-28 12:12 | - | |
| Help-changing CPU in Acer 5315/ | 2022-03-28 12:13 | - | |
| Help- eRecovery after repartition C drive/ | 2022-03-28 12:13 | - | |
| Help- headphones and external speaker don't work/ | 2022-03-28 12:13 | - | |
| Help- why is my defrag taking so long/ | 2022-03-28 12:13 | - | |
| Help- windows xp pro and aspire 5630 (5633wlmi)/ | 2022-03-28 12:13 | - | |
| Help... again/ | 2022-03-28 12:13 | - | |
| Help. BIOS Mod to disable onboard devices/ | 2022-03-28 12:13 | - | |
| Help/ | 2022-03-28 12:12 | - | |
| Help 3810tz/ | 2022-03-28 12:12 | - | |
| Help Acer 1360 Sloooooowww!!/ | 2022-03-28 12:12 | - | |
| Help Acer 3623 does not power up/ | 2022-03-28 12:12 | - | |
| Help Acer 5102 Error/ | 2022-03-28 12:12 | - | |
| Help Acer 5710/ | 2022-03-28 12:12 | - | |
| Help Acer 5920 buttons/ | 2022-03-28 12:12 | - | |
| Help Acer Aspire 5050 Serious Problem! AND I MEAN SERIOUS/ | 2022-03-28 12:12 | - | |
| Help Acer Aspire 8930G sound problem/ | 2022-03-28 12:12 | - | |
| Help Acer Extenza 5630 EZ/ | 2022-03-28 12:12 | - | |
| Help After Vista Upgrade/ | 2022-03-28 12:12 | - | |
| Help Backup New Laptop/ | 2022-03-28 12:12 | - | |
| Help Big Time Please/ | 2022-03-28 12:12 | - | |
| Help Difference Between Aspire 1691 1691wlmi/ | 2022-03-28 12:12 | - | |
| Help Help/ | 2022-03-28 12:12 | - | |
| Help I've Fallen and i Can't get up/ | 2022-03-28 12:12 | - | |
| Help I can't boot my Timeline/ | 2022-03-28 12:12 | - | |
| Help Me!!!!/ | 2022-03-28 12:12 | - | |
| Help Me/ | 2022-03-28 12:12 | - | |
| Help Me Acer Aspire Aoa150/ | 2022-03-28 12:12 | - | |
| Help Me Please!!!/ | 2022-03-28 12:12 | - | |
| Help Me Please!!/ | 2022-03-28 12:12 | - | |
| Help Me Pleeeeease!!!!!!/ | 2022-03-28 12:12 | - | |
| Help Me Pls/ | 2022-03-28 12:12 | - | |
| Help Me Select Which One/ | 2022-03-28 12:12 | - | |
| Help Needed For a Huge Problem With My Acer Aspire 5100/ | 2022-03-28 12:12 | - | |
| Help Needed To Convince Parents That Acer Laptops Are Good/ | 2022-03-28 12:12 | - | |
| Help Please!!!!/ | 2022-03-28 12:12 | - | |
| Help Please- Dead AS 1652LMI/ | 2022-03-28 12:12 | - | |
| Help Please Or Im Screwed!!!/ | 2022-03-28 12:12 | - | |
| Help Please with Purchase Decision/ | 2022-03-28 12:12 | - | |
| Help Plz! How to use recovery disks w 5920g/ | 2022-03-28 12:12 | - | |
| Help Reducing heat on ASpire 5100/ | 2022-03-28 12:12 | - | |
| Help Required..ACER TRAVELMATE 4070/ | 2022-03-28 12:12 | - | |
| Help TravelMate 803 vs Aspire 2023/ | 2022-03-28 12:12 | - | |
| Help Urgent! Anyone Please!/ | 2022-03-28 12:13 | - | |
| Help Utilizing Recovery Partition without eRecovery/ | 2022-03-28 12:13 | - | |
| Help WEBCAM USB connection in-out by itself/ | 2022-03-28 12:13 | - | |
| Help Wanted With acer aspire e5-752g bios unlock/ | 2022-03-28 12:13 | - | |
| Help Wanted with Bios Acer 3810T/ | 2022-03-28 12:13 | - | |
| Help Webcam acting strange!/ | 2022-03-28 12:13 | - | |
| Help With A New ACER 6930G/ | 2022-03-28 12:13 | - | |
| Help With Acer Aspire 5610z Ethernet Driver/ | 2022-03-28 12:13 | - | |
| Help With Acer Ferrari 3200!/ | 2022-03-28 12:13 | - | |
| Help With BIOS Aspire 5101/ | 2022-03-28 12:13 | - | |
| Help With Bluetooth Voip/ | 2022-03-28 12:13 | - | |
| Help With Recovery And More/ | 2022-03-28 12:13 | - | |
| Help With Wireless on Acer Aspire 6530/ | 2022-03-28 12:13 | - | |
| Help acer aspire 7730/ | 2022-03-28 12:12 | - | |
| Help and suggestions for upgrading my 5920G/ | 2022-03-28 12:12 | - | |
| Help buying an Acer in the UK/ | 2022-03-28 12:12 | - | |
| Help checking if keyboard connector is ok on 5920g/ | 2022-03-28 12:12 | - | |
| Help connecting wirelessly with my 8006lmi/ | 2022-03-28 12:12 | - | |
| Help diagnosing a fault acer aspire one happy 2dqpp/ | 2022-03-28 12:12 | - | |
| Help finding a 5920 in WA/ | 2022-03-28 12:12 | - | |
| Help flashing modded 5738g bios, im stuck/ | 2022-03-28 12:12 | - | |
| Help for Acer Aspire 5720ZG-2A2G16Mi/ | 2022-03-28 12:12 | - | |
| Help for Factory Restore/ | 2022-03-28 12:12 | - | |
| Help friends Acer aspire 5610z/ | 2022-03-28 12:12 | - | |
| Help from 5920G USERS PLS!!!/ | 2022-03-28 12:12 | - | |
| Help from European 8943G Owners/ | 2022-03-28 12:12 | - | |
| Help from Travelmate 8210 owners/ | 2022-03-28 12:12 | - | |
| Help from those who have done a clean install/ | 2022-03-28 12:12 | - | |
| Help guys, M6809 vs. 1662WLMi/ | 2022-03-28 12:12 | - | |
| Help high pitch beeping while loading windows/ | 2022-03-28 12:12 | - | |
| Help identify hardware 5680/ | 2022-03-28 12:12 | - | |
| Help identifying these base system devices (win7 upgrade)/ | 2022-03-28 12:12 | - | |
| Help in Dissassembly of 1810T-Keyboard Replace/ | 2022-03-28 12:12 | - | |
| Help in acer aspire 5738G/ | 2022-03-28 12:12 | - | |
| Help installing Acer/ | 2022-03-28 12:12 | - | |
| Help me! My new ultrabook V15 nitro got too hot when use nvidia GPU/ | 2022-03-28 12:12 | - | |
| Help me banish the bloat from my new 3830tg/ | 2022-03-28 12:12 | - | |
| Help me convert to ntfs/ | 2022-03-28 12:12 | - | |
| Help me decide...Aspire 2930-6850/ | 2022-03-28 12:12 | - | |
| Help me find a BIOS supporting Intel ® Virtualization (VT-x) for Acer Aspire 5738zg/ | 2022-03-28 12:12 | - | |
| Help me fix a screen backlight problem for a Aspire 5251-1805/ | 2022-03-28 12:12 | - | |
| Help me get the motherboard out of my 7535g/ | 2022-03-28 12:12 | - | |
| Help me put a stop to that fan (acer)/ | 2022-03-28 12:12 | - | |
| Help me to decide between these two/ | 2022-03-28 12:12 | - | |
| Help me with my Acer 8204/ | 2022-03-28 12:12 | - | |
| Help my fan won't move!/ | 2022-03-28 12:12 | - | |
| Help needed! Which Driver is SATA/ | 2022-03-28 12:12 | - | |
| Help needed- ACER Aspire 5504 WXMI shuts down on its own/ | 2022-03-28 12:12 | - | |
| Help needed acer recovery locked in loop/ | 2022-03-28 12:12 | - | |
| Help needed on Acer aspire 8920g/ | 2022-03-28 12:12 | - | |
| Help needed with Acer 5820T/ | 2022-03-28 12:12 | - | |
| Help needed with Acer Aspire 5735/ | 2022-03-28 12:12 | - | |
| Help on 'Clean install' on new Travelmate 4072/ | 2022-03-28 12:12 | - | |
| Help on Acer 3002Lci/ | 2022-03-28 12:12 | - | |
| Help on Acer 5100 RAM upgrade!/ | 2022-03-28 12:12 | - | |
| Help on Aspire 5710. Acer official support didn't/ | 2022-03-28 12:12 | - | |
| Help on Extensa 5620 Bio's upgrade/ | 2022-03-28 12:12 | - | |
| Help on adding memory Acer 5570/ | 2022-03-28 12:12 | - | |
| Help on a firmware issue AKA K.I.A/ | 2022-03-28 12:12 | - | |
| Help please! My laptop keeps restart itself- Acer Aspire 5633WLMI/ | 2022-03-28 12:12 | - | |
| Help please! Problem with QtZgAcer.exe/ | 2022-03-28 12:12 | - | |
| Help please. Acer Aspire 5810T hanging on Acer Empower people black screen/ | 2022-03-28 12:12 | - | |
| Help please for a newb/ | 2022-03-28 12:12 | - | |
| Help please with Aspire 7750G ram upgrade/ | 2022-03-28 12:12 | - | |
| Help putting an acer aspire one hard drive in another acer aspire one/ | 2022-03-28 12:12 | - | |
| Help removing stuff/ | 2022-03-28 12:12 | - | |
| Help replacing DVD Rom drive on Aspire 5920!/ | 2022-03-28 12:12 | - | |
| Help request Update BIOS on 5920/ | 2022-03-28 12:12 | - | |
| Help required- Acer 2012WLMi with mobilemeter/ | 2022-03-28 12:12 | - | |
| Help required please re - Bluetooth settings/ | 2022-03-28 12:12 | - | |
| Help restoring to a new hard disk/ | 2022-03-28 12:12 | - | |
| Help setting up external monitor/ | 2022-03-28 12:12 | - | |
| Help the PQSERVICE partition on my Aspire 5633 is corrupt/ | 2022-03-28 12:12 | - | |
| Help the n00b- Acer 8930G/ | 2022-03-28 12:12 | - | |
| Help tweak my new Aspire 3050/ | 2022-03-28 12:12 | - | |
| Help understanding TM resolutions (4404 and 4402)/ | 2022-03-28 12:13 | - | |
| Help updating backing up laptop BIOS on Acer 7560G due to pausing issues/ | 2022-03-28 12:13 | - | |
| Help using ACfancontrol acer v3-571g/ | 2022-03-28 12:13 | - | |
| Help with 3680. got used. no info/ | 2022-03-28 12:13 | - | |
| Help with 5610z touchpad/ | 2022-03-28 12:13 | - | |
| Help with 5920g prob/ | 2022-03-28 12:13 | - | |
| Help with ACER CPU thermal pad/ | 2022-03-28 12:13 | - | |
| Help with Acer 2012WLMI - Pro's and Con's/ | 2022-03-28 12:13 | - | |
| Help with Acer 4520g - Won't start up (Just black screen) because of ATI tool/ | 2022-03-28 12:13 | - | |
| Help with Acer Aspire 3000 Recovery/ | 2022-03-28 12:13 | - | |
| Help with Acer Aspire 3003 LCI/ | 2022-03-28 12:13 | - | |
| Help with Acer Aspire 4830T Screen Upgrade/ | 2022-03-28 12:13 | - | |
| Help with Acer Aspire M5-583P disassembly/ | 2022-03-28 12:13 | - | |
| Help with Acer Inspire 6920G/ | 2022-03-28 12:13 | - | |
| Help with Acer TravelMate 2420 Bios Password/ | 2022-03-28 12:13 | - | |
| Help with Acer Travelmate 2200/ | 2022-03-28 12:13 | - | |
| Help with Aspire 1662/ | 2022-03-28 12:13 | - | |
| Help with Aspire 1804 BIOS/ | 2022-03-28 12:13 | - | |
| Help with Aspire 1830T wifi/ | 2022-03-28 12:13 | - | |
| Help with Aspire 5050 series please!/ | 2022-03-28 12:13 | - | |
| Help with Aspire 5672wLMI/ | 2022-03-28 12:13 | - | |
| Help with Aspire 5700z/ | 2022-03-28 12:13 | - | |
| Help with Aspire5920 MM keys!/ | 2022-03-28 12:13 | - | |
| Help with E-Recovery Hard drive Config/ | 2022-03-28 12:13 | - | |
| Help with M5 20gb mSata Setup/ | 2022-03-28 12:13 | - | |
| Help with Msn - Acer Aspire 9300/ | 2022-03-28 12:13 | - | |
| Help with RAM issues on Acer Aspire 5601/ | 2022-03-28 12:13 | - | |
| Help with Standby/ | 2022-03-28 12:13 | - | |
| Help with Videocard upgrade!/ | 2022-03-28 12:13 | - | |
| Help with Virus/ | 2022-03-28 12:13 | - | |
| Help with acer 6920G bios/ | 2022-03-28 12:13 | - | |
| Help with acer aspire 5920G/ | 2022-03-28 12:13 | - | |
| Help with aspire timeline 4820T/ | 2022-03-28 12:13 | - | |
| Help with audio + Speakers! 5672/ | 2022-03-28 12:13 | - | |
| Help with bios Acer Extensa 5220 =[/ | 2022-03-28 12:13 | - | |
| Help with burning Recovery Disk/ | 2022-03-28 12:13 | - | |
| Help with cleaning/ | 2022-03-28 12:13 | - | |
| Help with converting to NTFS/ | 2022-03-28 12:13 | - | |
| Help with downgrading from Vista to Xp/ | 2022-03-28 12:13 | - | |
| Help with drive problem and LAN problem/ | 2022-03-28 12:13 | - | |
| Help with external display on Aspire 1650 with x300/ | 2022-03-28 12:13 | - | |
| Help with internal 3G modem on Acer Aspire 751H/ | 2022-03-28 12:13 | - | |
| Help with my Acer Aspire 6920G/ | 2022-03-28 12:13 | - | |
| Help with overclocking a Acer 6530G/ | 2022-03-28 12:13 | - | |
| Help with password/ | 2022-03-28 12:13 | - | |
| Help with power charger/ | 2022-03-28 12:13 | - | |
| Help with recovery, please/ | 2022-03-28 12:13 | - | |
| Help with recovery/ | 2022-03-28 12:13 | - | |
| Help with taking apart an Acer Aspire 5738ZG/ | 2022-03-28 12:13 | - | |
| Help with the LCD!/ | 2022-03-28 12:13 | - | |
| Help with the fingerprint - it wont recognise it/ | 2022-03-28 12:13 | - | |
| Help with undervolting 1810t w su7300 and rmclock/ | 2022-03-28 12:13 | - | |
| Help with upgrading Vista to XP on laptop/ | 2022-03-28 12:13 | - | |
| Help with weird hangs in 8920G Vista HP64/ | 2022-03-28 12:13 | - | |
| Help w problem Sprint Broadband Card not wrkg - NEC PCI to USB Open Host not working/ | 2022-03-28 12:13 | - | |
| Hey 8920 8930G Owners!/ | 2022-03-28 12:13 | - | |
| Hey guys! need some help!/ | 2022-03-28 12:13 | - | |
| Hey guys first post. Quick question/ | 2022-03-28 12:13 | - | |
| Hi, I have an Acer3620 and my Alt+F10 doesnt works !! PLEASE HELP/ | 2022-03-28 12:13 | - | |
| Hi, Vista and JavaRT on my Acer notebook/ | 2022-03-28 12:13 | - | |
| Hi How do you creat Vista restor disk/ | 2022-03-28 12:13 | - | |
| Hi all - Acer TM 8101WLMi upgrade hopes/ | 2022-03-28 12:13 | - | |
| Hibernate vs sleep What is different/ | 2022-03-28 12:13 | - | |
| Hibernation Problem/ | 2022-03-28 12:13 | - | |
| Hidden Mousepad Feature-1662WLMi/ | 2022-03-28 12:13 | - | |
| Hidden Partition question/ | 2022-03-28 12:13 | - | |
| Hidden partition 15GB/ | 2022-03-28 12:13 | - | |
| Hide the PQSERVICE partition/ | 2022-03-28 12:13 | - | |
| Hi everybody, just joined today/ | 2022-03-28 12:13 | - | |
| Hi everyone, I'm Vlad. I'm a newbie here and hoping for some help with my Extensa 5635/ | 2022-03-28 12:13 | - | |
| High Pitch Noise on my Acer Aspire 3003/ | 2022-03-28 12:13 | - | |
| High Pitched Noise From Intel Duo Core/ | 2022-03-28 12:13 | - | |
| High capacity battery for Acer 3680/ | 2022-03-28 12:13 | - | |
| High capacity spare battery for acer aspire 5680/ | 2022-03-28 12:13 | - | |
| Higher Capacity Batttery for 5315 laptop/ | 2022-03-28 12:13 | - | |
| Higher resolution LCD for Acer Aspire 5733z/ | 2022-03-28 12:13 | - | |
| Higher resolution screen for the 4810/ | 2022-03-28 12:13 | - | |
| Higher res panel/ | 2022-03-28 12:13 | - | |
| Higher voltage required to run Windows 7/ | 2022-03-28 12:13 | - | |
| Highest 3DMark scores for X1400 and How!/ | 2022-03-28 12:13 | - | |
| Highest Capacity Battery for 5672/ | 2022-03-28 12:13 | - | |
| High pitched noise on maximum performance (Acer TM3002)/ | 2022-03-28 12:13 | - | |
| High pitch sound generated from aspire 1690 series notebooks/ | 2022-03-28 12:13 | - | |
| High temperature/ | 2022-03-28 12:13 | - | |
| High temperature on Acer Aspire TimelineX 4820TG/ | 2022-03-28 12:13 | - | |
| Hinge Acer Aspire 2023/ | 2022-03-28 12:13 | - | |
| Hinge Problem... How much $$$/ | 2022-03-28 12:13 | - | |
| Hinges on acer travelmate 4500/ | 2022-03-28 12:13 | - | |
| Hinges wearing out!/ | 2022-03-28 12:13 | - | |
| Hint Before Buying ACER Laptop/ | 2022-03-28 12:13 | - | |
| Hitachi 7k200 HD Vs WD 80gb/ | 2022-03-28 12:13 | - | |
| Hiya go another offer for my 6920g for Toshiba 650/ | 2022-03-28 12:13 | - | |
| Hl-dt-st Bddvdrw Ct10n Driver/ | 2022-03-28 12:13 | - | |
| Hmm.. Ultimate for nothing/ | 2022-03-28 12:13 | - | |
| Hooking up Ext. Monitor to Acer TravelMate 2300/ | 2022-03-28 12:13 | - | |
| Horizontal and vertical refresh on Ferrari 5000/ | 2022-03-28 12:13 | - | |
| Horizontal wave-like distortions (5930G 9600M GT)/ | 2022-03-28 12:13 | - | |
| Horrible saturation and colour contrast on my new Acer Aspire 7 15/ | 2022-03-28 12:13 | - | |
| Hot Aspire 5520M CPU and speed problems/ | 2022-03-28 12:13 | - | |
| Hot Power Supply Brick/ | 2022-03-28 12:13 | - | |
| Hotkey (keyboard) driver for Aspire 5601/ | 2022-03-28 12:13 | - | |
| Hotkey Buttons Not Working/ | 2022-03-28 12:13 | - | |
| How's Su9400 for Multi-tasking/ | 2022-03-28 12:13 | - | |
| How's quality of Acer lagtop/ | 2022-03-28 12:13 | - | |
| How-to replace hard drive/ | 2022-03-28 12:13 | - | |
| How Does Acer inform of driver updates/ | 2022-03-28 12:13 | - | |
| How HOT is your Acer Aspire ONE/ | 2022-03-28 12:13 | - | |
| How I Can Control Pentium M 745 Speed/ | 2022-03-28 12:13 | - | |
| How I Tackled and Solved My Restore Failed Error 0xf0000024/ | 2022-03-28 12:13 | - | |
| How I fixed WiFi on my Acer Aspire One/ | 2022-03-28 12:13 | - | |
| How I solved my LCD noise problem. - Acer 8204/ | 2022-03-28 12:13 | - | |
| How Is the Acer AS5736Z-4016/ | 2022-03-28 12:13 | - | |
| How Many Years Do Your Acer Working/ | 2022-03-28 12:13 | - | |
| How To's- Acer Aspire 5672/ | 2022-03-28 12:13 | - | |
| How To Create A Boot Disk For Acer 5920/ | 2022-03-28 12:13 | - | |
| How To Downgrade BIOS/ | 2022-03-28 12:13 | - | |
| How To Format Pqservice Partition/ | 2022-03-28 12:13 | - | |
| How To Get HDMI output to work on a 7735 laptop/ | 2022-03-28 12:13 | - | |
| How To Install Win Xp On A New Harddrive In An Acer Laptop/ | 2022-03-28 12:13 | - | |
| How To Overclock CPU For Acer Aspire 5920G/ | 2022-03-28 12:13 | - | |
| How To Recover Acer Hidden Partition Without Napp Dvd/ | 2022-03-28 12:13 | - | |
| How To Replace New DVD RW on Aspire 5610/ | 2022-03-28 12:13 | - | |
| How To Reset Password Acer/ | 2022-03-28 12:13 | - | |
| How To TEST A System/ | 2022-03-28 12:13 | - | |
| How To Turn Off The Touch Pad/ | 2022-03-28 12:13 | - | |
| How To Wipe Acer Laptop/ | 2022-03-28 12:13 | - | |
| How To check Power Adapter and Battary is Genuine ACER/ | 2022-03-28 12:13 | - | |
| How about TravelMate 4011WLCI/ | 2022-03-28 12:13 | - | |
| How acer aspire5021 battery time/ | 2022-03-28 12:13 | - | |
| How are Acers Looking for something light. BB deals/ | 2022-03-28 12:13 | - | |
| How are those new Aspire TimelineX models/ | 2022-03-28 12:13 | - | |
| How can I back up files from my seemly broken Acer Aspire 5920 that won't start/ | 2022-03-28 12:13 | - | |
| How can I disable internal microphone on Acer Aspire 5920G/ | 2022-03-28 12:13 | - | |
| How can I fix this!/ | 2022-03-28 12:13 | - | |
| How can I get Factory settings without eRecovery or CD/ | 2022-03-28 12:13 | - | |
| How can I get mic jack to work as stereo jack/ | 2022-03-28 12:13 | - | |
| How can I recreate Recovery Partition/ | 2022-03-28 12:13 | - | |
| How can I reset my acer aspire to factory settings/ | 2022-03-28 12:13 | - | |
| How can I restore my Acer Aspire One/ | 2022-03-28 12:13 | - | |
| How can I turn off BIOS password/ | 2022-03-28 12:13 | - | |
| How can I upgrade my Acer 1810TZ (maybe 8GB RAM)/ | 2022-03-28 12:13 | - | |
| How can I upgrade the processor of the aspire 4720z/ | 2022-03-28 12:13 | - | |
| How can I use a VOIP/ | 2022-03-28 12:13 | - | |
| How can i get more volume out of my 5920G/ | 2022-03-28 12:13 | - | |
| How can i make my laptop display the volume level/ | 2022-03-28 12:13 | - | |
| How can i reach the fan on an Acer Aspire V3-772G/ | 2022-03-28 12:13 | - | |
| How can i remove BIOS password in acer aspire 4920/ | 2022-03-28 12:13 | - | |
| How can one loose administrator privilege/ | 2022-03-28 12:13 | - | |
| How can you allocate more sys memory to GS45 video chipset on 3810TZ/ | 2022-03-28 12:13 | - | |
| How could I replace the 11.6 LCD 40 pins with a 11.6 30 pins LCD TOUCH SCREEN to the Acer Timeline 1830T/ | 2022-03-28 12:13 | - | |
| How do I Remove keyboard of my Acer Aspire 5672 laptop/ | 2022-03-28 12:13 | - | |
| How do I activate the multimedia controls on my laptop/ | 2022-03-28 12:13 | - | |
| How do I change the keyboard on an ACER TM 240/ | 2022-03-28 12:13 | - | |
| How do I clean the dust underneath Acer Aspire 5749's keyboard/ | 2022-03-28 12:13 | - | |
| How do I create a recovery cd/ | 2022-03-28 12:13 | - | |
| How do I disable the notebook's speakers/ | 2022-03-28 12:13 | - | |
| How do I fix battery wear/ | 2022-03-28 12:13 | - | |
| How do I get acer 1825ptz in north america/ | 2022-03-28 12:13 | - | |
| How do I get into the RAID menu on an Acer Aspire S5-391/ | 2022-03-28 12:13 | - | |
| How do I get my built in web cam to video stuff/ | 2022-03-28 12:13 | - | |
| How do I get the Bluetooth working on my Acer laptop/ | 2022-03-28 12:13 | - | |
| How do I get to the CPU processor/ | 2022-03-28 12:13 | - | |
| How do I install windows 7 onto a new hard drive/ | 2022-03-28 12:13 | - | |
| How do I integrate a VBIOS into an Acer Aspire 5935G/ | 2022-03-28 12:13 | - | |
| How do I know if moduslink has recieved my e-mail of my proof of purchase for me to get Vista/ | 2022-03-28 12:13 | - | |
| How do I perform a BIOS update on my 6930g/ | 2022-03-28 12:13 | - | |
| How do I perform a Clean Install/ | 2022-03-28 12:13 | - | |
| How do I permanently disable the touch pad/ | 2022-03-28 12:13 | - | |
| How do I recalibrate my Acer Aspire 5749's battery cause it's shutting down at 25%/ | 2022-03-28 12:13 | - | |
| How do I reformat my acer aspire 1810tz please/ | 2022-03-28 12:13 | - | |
| How do I reformat the computer w o the installation cds/ | 2022-03-28 12:13 | - | |
| How do I reformat to remove all content/ | 2022-03-28 12:13 | - | |
| How do I remove dual boot screen/ | 2022-03-28 12:13 | - | |
| How do I remove my Acer Aspire 5672 optical drive/ | 2022-03-28 12:13 | - | |
| How do I replace the Hard disc in Acer Aspire 5610z/ | 2022-03-28 12:13 | - | |
| How do I replace the RAM of Acer Aspire 5749/ | 2022-03-28 12:13 | - | |
| How do I resize or merge partitions on Acer Laptop/ | 2022-03-28 12:13 | - | |
| How do I set Dolby OFF by default on Acer Aspire 5920 G/ | 2022-03-28 12:13 | - | |
| How do I stop ePower without uninstalling/ | 2022-03-28 12:13 | - | |
| How do I turn off touchpad tapping on Timeline X 4830T/ | 2022-03-28 12:13 | - | |
| How do I under clock my Acer Aspire One/ | 2022-03-28 12:13 | - | |
| How do I undo a BIOS update/ | 2022-03-28 12:13 | - | |
| How do I update my 5749's build-in 3d card drivers/ | 2022-03-28 12:13 | - | |
| How do I update my video card (have an acer aspire 5672)/ | 2022-03-28 12:13 | - | |
| How do I use a projector with my Acer 9300/ | 2022-03-28 12:13 | - | |
| How do I use my Acer 6920g TV Tuner/ | 2022-03-28 12:13 | - | |
| How does Acer package new and refurbished computers/ | 2022-03-28 12:13 | - | |
| How does Acer rank in terms of its competitors/ | 2022-03-28 12:13 | - | |
| How does Colin Mcrae DIRT play on ur Aspire 5920G/ | 2022-03-28 12:13 | - | |
| How does eRecovery work with DVDs/ | 2022-03-28 12:13 | - | |
| How does the Acer 8930 differ from the 8920/ | 2022-03-28 12:13 | - | |
| How does the s3 20GB ssd work/ | 2022-03-28 12:13 | - | |
| How does the screen of Acer Aspire compare to Lenovo Y50 and Toshiba P55T/ | 2022-03-28 12:13 | - | |
| How do i Downgrade AcerAspire 5720 vista to xp/ | 2022-03-28 12:13 | - | |
| How do i access turbo cache of the 8600m GT/ | 2022-03-28 12:13 | - | |
| How do i boot into the recovery partition/ | 2022-03-28 12:13 | - | |
| How do i format my acer aspire 6920g/ | 2022-03-28 12:13 | - | |
| How do i get a Netbooks CONNECTED Webcam to work when Windows says it isnt/ | 2022-03-28 12:13 | - | |
| How do i install W7 without loosing Vista recovery MBR/ | 2022-03-28 12:13 | - | |
| How do i monitor live from my mic e.g for karaoke purpose/ | 2022-03-28 12:13 | - | |
| How do you always enable wireless/ | 2022-03-28 12:13 | - | |
| How do you change the Graphics Driver safely/ | 2022-03-28 12:13 | - | |
| How do you close files, print, etc/ | 2022-03-28 12:13 | - | |
| How do you control the built-in webcam on AspireOne/ | 2022-03-28 12:13 | - | |
| How do you enable WiFi with Aspire 4520/ | 2022-03-28 12:13 | - | |
| How do you rate your Aspire 5920/ | 2022-03-28 12:13 | - | |
| How do you record with the camera/ | 2022-03-28 12:13 | - | |
| How do you send a Fax on your Aspire 5672 with Vista/ | 2022-03-28 12:13 | - | |
| How do you think Acer 4502WLMi Thanks/ | 2022-03-28 12:13 | - | |
| How do you upgrade Pioneer DVDRW DVR-K06RS Firmware/ | 2022-03-28 12:13 | - | |
| How do you upgrade the RAM on an Aspire AS5733-6650/ | 2022-03-28 12:13 | - | |
| How do you use Acer Arcade without Windows/ | 2022-03-28 12:13 | - | |
| How effective is DustDefender/ | 2022-03-28 12:13 | - | |
| How fast is the processor on the Acer Ferarri 3200/ | 2022-03-28 12:13 | - | |
| How good is Acer/ | 2022-03-28 12:13 | - | |
| How good is Acer Additional warranty/ | 2022-03-28 12:13 | - | |
| How good is TM4001 LMi(D)/ | 2022-03-28 12:13 | - | |
| How good is the LCD screen of Aspire series/ | 2022-03-28 12:13 | - | |
| How heavy is TM3200 series/ | 2022-03-28 12:13 | - | |
| How heavy is the 90W AC adapter of the Ferrari 4004WLMi/ | 2022-03-28 12:13 | - | |
| How hot does your 5672WLMi run/ | 2022-03-28 12:13 | - | |
| How hot is TOO hot (Ferrari)/ | 2022-03-28 12:13 | - | |
| How is Acer's reputation/ | 2022-03-28 12:13 | - | |
| How is it this time/ | 2022-03-28 12:13 | - | |
| How is the AO532 Netbook/ | 2022-03-28 12:13 | - | |
| How is the Acer Gemstone 2920/ | 2022-03-28 12:13 | - | |
| How is the aspire 1360 series/ | 2022-03-28 12:13 | - | |
| How is the fan speed controlled/ | 2022-03-28 12:13 | - | |
| How is the new Acer + AMD ULV/ | 2022-03-28 12:13 | - | |
| How is the screen on the TravelMate 4400/ | 2022-03-28 12:13 | - | |
| How is the screen quality of the Aspire 1410/ | 2022-03-28 12:13 | - | |
| How long can I leave the laptop on/ | 2022-03-28 12:13 | - | |
| How long do Acer repairs generally take/ | 2022-03-28 12:13 | - | |
| How long does it take to format a DVD-RW/ | 2022-03-28 12:13 | - | |
| How long does your Aspire 1810t take to charge from 0 battery/ | 2022-03-28 12:13 | - | |
| How long has your Acer lasted without repairs/ | 2022-03-28 12:13 | - | |
| How long have you had your Acer/ | 2022-03-28 12:13 | - | |
| How long usually it take for Acer to service laptop/ | 2022-03-28 12:13 | - | |
| How many Acer recovery disk(s)/ | 2022-03-28 12:13 | - | |
| How many Aspire 9810 owners/ | 2022-03-28 12:13 | - | |
| How many copies of the recovery disks can I make/ | 2022-03-28 12:13 | - | |
| How many fans do I have/ | 2022-03-28 12:13 | - | |
| How much/ | 2022-03-28 12:13 | - | |
| How much battery do you actually get out of your 1810TZ/ | 2022-03-28 12:13 | - | |
| How much did battery life increase using a SSD with your Timeline/ | 2022-03-28 12:13 | - | |
| How much heat does overclocking give/ | 2022-03-28 12:13 | - | |
| How much is my Acer aspire 5672 wlmi worth/ | 2022-03-28 12:13 | - | |
| How much is too much light leakage/ | 2022-03-28 12:13 | - | |
| How much noise does the Aspire 8935G generate/ | 2022-03-28 12:13 | - | |
| How much ram can I squeeze in a 5920G/ | 2022-03-28 12:13 | - | |
| How much ram do you have in your 5100/ | 2022-03-28 12:13 | - | |
| How much resources to use for background programs/ | 2022-03-28 12:13 | - | |
| How much should I expect to get (TM4402WLMi)/ | 2022-03-28 12:13 | - | |
| How often do Acer release new ATI drivers/ | 2022-03-28 12:13 | - | |
| How old are you as an Acer user/ | 2022-03-28 12:13 | - | |
| How remove top of Acer TM 240/ | 2022-03-28 12:13 | - | |
| How should I upgrade travelmate 2420/ | 2022-03-28 12:13 | - | |
| How slow does Canadian Acer update inventory/ | 2022-03-28 12:13 | - | |
| Hows this computer/ | 2022-03-28 12:13 | - | |
| How the heck do you open the case of the 1410/ | 2022-03-28 12:13 | - | |
| How the hell do you watch a DVD that totally fills your 15.4 inch laptop screen/ | 2022-03-28 12:13 | - | |
| How to Acer Aspire 5920G Monitor Resolution/ | 2022-03-28 12:13 | - | |
| How to Change my hard drive/ | 2022-03-28 12:13 | - | |
| How to DISABLE the AC connect disconnect Alert Sound (BEEP)/ | 2022-03-28 12:13 | - | |
| How to Disable Optical Output in ACER ASPIRE 7720G 832G25Mn/ | 2022-03-28 12:13 | - | |
| How to Disable the Annoying Blinking LED for the Wireless Adapter/ | 2022-03-28 12:13 | - | |
| How to MOD BIOS ACER ASPIRE 2920Z/ | 2022-03-28 12:13 | - | |
| How to Partition Acer AO751H (enable D2D)/ | 2022-03-28 12:13 | - | |
| How to Remove Acer Hidden Partition/ | 2022-03-28 12:13 | - | |
| How to Repair the Acer D2D Recovery/ | 2022-03-28 12:13 | - | |
| How to Replace Key on Acer Timeline 5810TZ/ | 2022-03-28 12:13 | - | |
| How to SET Acer Aspire brightness (and have it STAY put )/ | 2022-03-28 12:13 | - | |
| How to Upgrade BIOS from ver1.x to 2.x for Acer v5-171/ | 2022-03-28 12:13 | - | |
| How to access RAM in Aspire 5253/ | 2022-03-28 12:13 | - | |
| How to access recovery drive Extensa 5620z/ | 2022-03-28 12:13 | - | |
| How to activate HDMI on 5920G/ | 2022-03-28 12:13 | - | |
| How to add 2nd HD in Aspire 6930/ | 2022-03-28 12:13 | - | |
| How to add Bluetooth to your Timeline 3810T and other interesting tidbits with the machine/ | 2022-03-28 12:13 | - | |
| How to adjust contract and brightnes on 5940G external monitor/ | 2022-03-28 12:13 | - | |
| How to allow turbo mode on i5 540M/ | 2022-03-28 12:13 | - | |
| How to chang HyperMemory & VT/ | 2022-03-28 12:13 | - | |
| How to change OS [Win Vista to Win XP] on Acer Aspire 5720/ | 2022-03-28 12:13 | - | |
| How to change folder path for photos taken using Acer crystal eye webcam help/ | 2022-03-28 12:13 | - | |
| How to check battery quality 6935/ | 2022-03-28 12:13 | - | |
| How to check for signalup/ | 2022-03-28 12:13 | - | |
| How to clean an Aspire 6920G/ | 2022-03-28 12:13 | - | |
| How to clean install Win7 on Acer (WinXP) Aspire 5315/ | 2022-03-28 12:13 | - | |
| How to clean my 8920G/ | 2022-03-28 12:13 | - | |
| How to clear everything off of my Acer laptop and completley start over/ | 2022-03-28 12:13 | - | |
| How to clok down GPU on Aspire 5100/ | 2022-03-28 12:13 | - | |
| How to configure Launch Manager on Acer (8935G)/ | 2022-03-28 12:13 | - | |
| How to create a recovery DVD/ | 2022-03-28 12:13 | - | |
| How to decrypt the file MWL_PSD_drive.vmdf/ | 2022-03-28 12:13 | - | |
| How to delete hiberfil.sys (Acer Aspire, XP)/ | 2022-03-28 12:13 | - | |
| How to detect 'grey lines' !!!!/ | 2022-03-28 12:13 | - | |
| How to disable 5520 Touchpad/ | 2022-03-28 12:13 | - | |
| How to disable Fingerpint on windows startup/ | 2022-03-28 12:13 | - | |
| How to disable WiFi autostart/ | 2022-03-28 12:13 | - | |
| How to disable auto switching on 4820 when unplugged/ | 2022-03-28 12:13 | - | |
| How to disable onboard mic/ | 2022-03-28 12:13 | - | |
| How to disassemble Acer TM8003LCi/ | 2022-03-28 12:13 | - | |
| How to disassemble Extensa 4620z/ | 2022-03-28 12:13 | - | |
| How to disassemble the processor/ | 2022-03-28 12:13 | - | |
| How to disassembly an Acer 1690 series/ | 2022-03-28 12:13 | - | |
| How to discover the Serial Number of 5672/ | 2022-03-28 12:13 | - | |
| How to dismantle Acer Aspire 4741/ | 2022-03-28 12:13 | - | |
| How to dismantle a Aspire 5563/ | 2022-03-28 12:13 | - | |
| How to dismount the Acer Aspire 5672 hearsink system/ | 2022-03-28 12:13 | - | |
| How to do a clean install on a Acer laptop/ | 2022-03-28 12:13 | - | |
| How to do to recovery PQSERVICE partition/ | 2022-03-28 12:13 | - | |
| How to downgrad Bios on a 3810 tg/ | 2022-03-28 12:13 | - | |
| How to edit keyboard setting for 5920g/ | 2022-03-28 12:13 | - | |
| How to enable Bluetooth automatically on Aspire 8920G/ | 2022-03-28 12:13 | - | |
| How to enable Intel VT-X Support on Acer Aspire 5680 Laptop/ | 2022-03-28 12:13 | - | |
| How to enable VirTualization when Acer turned that option off in the BIOS/ | 2022-03-28 12:13 | - | |
| How to enable bluetooth on D150 without external bluetooth button under LED/ | 2022-03-28 12:13 | - | |
| How to find out if my Acer second hand is STOLEN or not/ | 2022-03-28 12:13 | - | |
| How to flash acer bios securely/ | 2022-03-28 12:13 | - | |
| How to format & partitioning Acer 5024/ | 2022-03-28 12:13 | - | |
| How to format Extensa 4220/ | 2022-03-28 12:13 | - | |
| How to format extensa 5420/ | 2022-03-28 12:13 | - | |
| How to format my Acer Aspire 5920 without the password/ | 2022-03-28 12:13 | - | |
| How to get Acer AS4820TG-7805/ | 2022-03-28 12:13 | - | |
| How to get OS disk from Acer/ | 2022-03-28 12:13 | - | |
| How to get XP drivers from the Vista hard drive/ | 2022-03-28 12:13 | - | |
| How to get acer Email LED flash with Mozilla Thunderbird/ | 2022-03-28 12:13 | - | |
| How to get a clean XP disk, Aspire 5100/ | 2022-03-28 12:13 | - | |
| How to get bigger than 1440x900 resolution/ | 2022-03-28 12:13 | - | |
| How to get bluetooth to turn on at boot/ | 2022-03-28 12:13 | - | |
| How to get inside 1694/ | 2022-03-28 12:13 | - | |
| How to improve the streaming video on a Timeline 4810T/ | 2022-03-28 12:13 | - | |
| How to increase 5920G RAM/ | 2022-03-28 12:13 | - | |
| How to increase allocated memory on TIMELINE/ | 2022-03-28 12:13 | - | |
| How to increase memory for video up to 64 mb on ACER TM 2350/ | 2022-03-28 12:13 | - | |
| How to instal internet card/ | 2022-03-28 12:13 | - | |
| How to install LAN network for Acer 5670/ | 2022-03-28 12:13 | - | |
| How to install OS on clean HD on Acer Aspire 9410/ | 2022-03-28 12:13 | - | |
| How to install Ubuntu on Acer 1410 1810/ | 2022-03-28 12:13 | - | |
| How to install Vista (minus Acer software) on Aspire 7720/ | 2022-03-28 12:13 | - | |
| How to install XP on Aspire 7720G/ | 2022-03-28 12:13 | - | |
| How to install a hard drive in Acer 6930/ | 2022-03-28 12:13 | - | |
| How to installa latest ATI Catalyst drivers/ | 2022-03-28 12:13 | - | |
| How to install bluetooth module in Aspire 6920G/ | 2022-03-28 12:13 | - | |
| How to install more RAM/ | 2022-03-28 12:13 | - | |
| How to install ram in acer 5920g/ | 2022-03-28 12:13 | - | |
| How to instal the drivers for Aspire 5560 helpp/ | 2022-03-28 12:13 | - | |
| How to jump-start an Acer Extensa 4420-5983/ | 2022-03-28 12:13 | - | |
| How to make 4920G faster Have 4Gb ram!/ | 2022-03-28 12:13 | - | |
| How to make 6930G webcam record video/ | 2022-03-28 12:13 | - | |
| How to make Acer 5745G max fan permenant/ | 2022-03-28 12:13 | - | |
| How to make Acer Arcade & TV function together/ | 2022-03-28 12:13 | - | |
| How to make Recovery DVD for Aspire 4520/ | 2022-03-28 12:13 | - | |
| How to make Restore disk for Aspire 5349-2481/ | 2022-03-28 12:13 | - | |
| How to manage heating options on Acer TM4502LMi/ | 2022-03-28 12:13 | - | |
| How to manually control the fans of Acer Aspire 4520/ | 2022-03-28 12:13 | - | |
| How to maximise Battery Lifespan/ | 2022-03-28 12:13 | - | |
| How to obtain AO522 warranty/ | 2022-03-28 12:13 | - | |
| How to open 5920G case/ | 2022-03-28 12:13 | - | |
| How to open 9104 WLMi/ | 2022-03-28 12:13 | - | |
| How to open Acer Timeline 3820 chassis/ | 2022-03-28 12:13 | - | |
| How to open Acer Travelmate 8372/ | 2022-03-28 12:13 | - | |
| How to open a Acer 5742G please/ | 2022-03-28 12:13 | - | |
| How to open the Acer Aspire 6920G/ | 2022-03-28 12:13 | - | |
| How to overclock the 5650 in the 4820TG/ | 2022-03-28 12:13 | - | |
| How to recover 5920/ | 2022-03-28 12:13 | - | |
| How to recover Vista after XP install/ | 2022-03-28 12:13 | - | |
| How to recover WIN XP for noob making a guide! help if u can!/ | 2022-03-28 12:13 | - | |
| How to recover a bad GFX bios flash/ | 2022-03-28 12:13 | - | |
| How to recover from restoration data after I upgrade the memory/ | 2022-03-28 12:13 | - | |
| How to reformat ACER 3680/ | 2022-03-28 12:13 | - | |
| How to remove TM 4024wlmi DVD-RW/ | 2022-03-28 12:13 | - | |
| How to remove case - Aspire 4730z/ | 2022-03-28 12:13 | - | |
| How to remove cover (Acer Aspire 3023)/ | 2022-03-28 12:13 | - | |
| How to remove hard drive from Acer Travelmate 4320 (disk, upgrade, replace)/ | 2022-03-28 12:13 | - | |
| How to remove keyboard from Acer 5920/ | 2022-03-28 12:13 | - | |
| How to remove original keyboard of 1810T or 751h/ | 2022-03-28 12:13 | - | |
| How to remove screen from acer aspire 6920/ | 2022-03-28 12:13 | - | |
| How to remove the finger print option on start-up/ | 2022-03-28 12:13 | - | |
| How to remove the pre-installed apps on 5920G/ | 2022-03-28 12:13 | - | |
| How to repair card reader board on 3820T-374G32nks/ | 2022-03-28 12:13 | - | |
| How to replace 3003LCI screen/ | 2022-03-28 12:13 | - | |
| How to replace Backlit keyboard on Acer 8951G/ | 2022-03-28 12:13 | - | |
| How to replace a HDDD in a Travelmate 510 series (514TE)/ | 2022-03-28 12:13 | - | |
| How to replace a HDD in a Travelmate 510 series (514TE)/ | 2022-03-28 12:13 | - | |
| How to replace a broken Aspire 5920 screen/ | 2022-03-28 12:13 | - | |
| How to replace a hinge on Acer Aspire 2000 series notebook/ | 2022-03-28 12:13 | - | |
| How to replace broken Aspire One 8.9 screen/ | 2022-03-28 12:13 | - | |
| How to replace cracked LCD on 5720z/ | 2022-03-28 12:13 | - | |
| How to rescue your Acer 7720G from bios update failure/ | 2022-03-28 12:13 | - | |
| How to restore machine from PQSERVICE/ | 2022-03-28 12:13 | - | |
| How to restore my Acer Aspire Revo r1600 Nettop (mini desktop) without the recovery partition or disk/ | 2022-03-28 12:13 | - | |
| How to revert back to official bios Travelmate 8371/ | 2022-03-28 12:13 | - | |
| How to run 40°C cooler on your 8940G/ | 2022-03-28 12:13 | - | |
| How to set max resolution/ | 2022-03-28 12:13 | - | |
| How to stop WoW from shutting down on me/ | 2022-03-28 12:13 | - | |
| How to tell how much RAM is being addressed/ | 2022-03-28 12:13 | - | |
| How to tell if refurb new/ | 2022-03-28 12:13 | - | |
| How to tell what wireless adapter in Aspire 3680/ | 2022-03-28 12:13 | - | |
| How to transfer programs from one internal hard drive to another/ | 2022-03-28 12:13 | - | |
| How to turn Acer Aspire 4730ZG to Karaoke Machine/ | 2022-03-28 12:13 | - | |
| How to turn off 3D acceleration for 5920g/ | 2022-03-28 12:13 | - | |
| How to turn off CPU power-saving features of Turion in Acer 5024/ | 2022-03-28 12:13 | - | |
| How to turn off WIFI/ | 2022-03-28 12:13 | - | |
| How tough is the A C power slot on the 5920g Has anyone broken it I think I'm close/ | 2022-03-28 12:13 | - | |
| How to unhide and delete Recovery partition in Acer Aspire 6920/ | 2022-03-28 12:13 | - | |
| How to update BIOS/ | 2022-03-28 12:13 | - | |
| How to upgrade BIOS on a 5720 aspire/ | 2022-03-28 12:13 | - | |
| How to upgrade P8400 to T9600 in Acer 5930g, and how to change the thermal grease (Step to step guide)/ | 2022-03-28 12:13 | - | |
| How to upgrade the 8204 DVD Writer/ | 2022-03-28 12:13 | - | |
| How to use Acer Aspire 5630 Hidden partition/ | 2022-03-28 12:13 | - | |
| How to use Aspire 6935G built in tv function help/ | 2022-03-28 12:13 | - | |
| How to use Orbicam with Acer screensaver/ | 2022-03-28 12:13 | - | |
| How to use a 5.1 speaker with 5920G/ | 2022-03-28 12:13 | - | |
| How to use bluetooth - Acer Aspire 3003WLCi/ | 2022-03-28 12:13 | - | |
| How to use built-in camera/ | 2022-03-28 12:13 | - | |
| How to use tv 0ut function (acer aspire 5021NWLCi)/ | 2022-03-28 12:13 | - | |
| How to you get a new bios Acer Aspire 5315/ | 2022-03-28 12:13 | - | |
| How ugly is 5920g How awesome is it/ | 2022-03-28 12:13 | - | |
| How upgradeable is the Acer Aspire Z5610/ | 2022-03-28 12:13 | - | |
| How well does eRecovey work/ | 2022-03-28 12:13 | - | |
| How would you rate these two laptops, Vista-wise/ | 2022-03-28 12:13 | - | |
| Hp Hstnn-pro7 & 5920g/ | 2022-03-28 12:13 | - | |
| Huge 5920G Startup Prob, Need Help!/ | 2022-03-28 12:13 | - | |
| Huge problems with Acer Aspire/ | 2022-03-28 12:13 | - | |
| Hyper-threading disable i5 480m caused bios brick/ | 2022-03-28 12:13 | - | |
| Hypermemory How to Acer 5943G/ | 2022-03-28 12:13 | - | |
| Hypermemory on Ferrari 4005/ | 2022-03-28 12:13 | - | |
| I'm STUPID...now what/ | 2022-03-28 12:13 | - | |
| I'm Worse Than A Newbie, I'm An Embryobie!/ | 2022-03-28 12:13 | - | |
| I'm back! Acer Predator Helios 300, and already modding it/ | 2022-03-28 12:13 | - | |
| I'm having trouble finding Acers - big 3/ | 2022-03-28 12:13 | - | |
| I'm in quite a dilemma about Acer. Help me out guys/ | 2022-03-28 12:13 | - | |
| I'm kind of baffled by this/ | 2022-03-28 12:13 | - | |
| I'm leaving to Hawaii in the morning!!/ | 2022-03-28 12:13 | - | |
| I'm sorry 8935G users, the 7738G wins again. (8 gigs of ram!)/ | 2022-03-28 12:13 | - | |
| I'm trying to undervolt my Acer 6920g with RMClock, but i get an error message even after dling the 64 bit driver/ | 2022-03-28 12:13 | - | |
| I've got a really big problem right here!/ | 2022-03-28 12:13 | - | |
| I've lost Bluetooth on my Travelmate 4202/ | 2022-03-28 12:13 | - | |
| I Bought A New [ ]/ | 2022-03-28 12:13 | - | |
| I Broke my Acer's inverter 6 pin connector/ | 2022-03-28 12:13 | - | |
| ICC profile for 3023WLMi display/ | 2022-03-28 12:13 | - | |
| I Could Use Your Help Because I've Got Those Acer 5580 Laptop ~ New SATA Hard Drive ~ Can't Re-Install My O S Blues/ | 2022-03-28 12:13 | - | |
| IDE drivers for Aspire 1662/ | 2022-03-28 12:13 | - | |
| IEEE1394 problems on 3201XCi/ | 2022-03-28 12:13 | - | |
| IEEE port - External Drive/ | 2022-03-28 12:13 | - | |
| IE version in Vista Home Basic Aspire 4530/ | 2022-03-28 12:13 | - | |
| I Got My Aspire 5920G ...I'm Impressed/ | 2022-03-28 12:13 | - | |
| INFO- How to make discrete images of your recovery partitions/ | 2022-03-28 12:13 | - | |
| I Need Help Before Buying !!!/ | 2022-03-28 12:13 | - | |
| I Need Motherboard for Acer Ferrari 4005/ | 2022-03-28 12:13 | - | |
| IPEX notebook ATI Radeon and Acer projector/ | 2022-03-28 12:13 | - | |
| IPS panels for E15 E5-575G series. part number/ | 2022-03-28 12:13 | - | |
| IRQL_NOT_LESS_OR_EQUAL blue screen on battery boot/ | 2022-03-28 12:13 | - | |
| IR does not work and neither the volume throttle since upgrading to W7 x64/ | 2022-03-28 12:13 | - | |
| IR how does it work/ | 2022-03-28 12:13 | - | |
| IR remote for the Ferrari series/ | 2022-03-28 12:13 | - | |
| ISO Mounting Software and Acer Recovery Partition/ | 2022-03-28 12:13 | - | |
| ITECIR Infrared Receiver (aspire 6920g)/ | 2022-03-28 12:13 | - | |
| Ia Acer 1810T keyboard equal to the 1410 one/ | 2022-03-28 12:13 | - | |
| I am about to buy an AS1691WLmi BUT/ | 2022-03-28 12:13 | - | |
| I am getting a new Hard drive...Help me please/ | 2022-03-28 12:13 | - | |
| I am looking for a parts laptop for my acer 5251/ | 2022-03-28 12:13 | - | |
| I am new here/ | 2022-03-28 12:13 | - | |
| I am new in formatting 5102 WLMI/ | 2022-03-28 12:13 | - | |
| I am selling my TL-66 (2,3Ghz)/ | 2022-03-28 12:13 | - | |
| I am thinking about getting an Acer Aspire 5570/ | 2022-03-28 12:13 | - | |
| I ask help Acer Predator G9-593/ | 2022-03-28 12:13 | - | |
| I beg for your help! dont know what to do/ | 2022-03-28 12:13 | - | |
| I bought Aspire 8940G/ | 2022-03-28 12:13 | - | |
| I bought this based on the video card... did I get ripped off/ | 2022-03-28 12:13 | - | |
| I broke a key off my 1810T-Can I fix it/ | 2022-03-28 12:13 | - | |
| I can't dual boot xp and vista/ | 2022-03-28 12:13 | - | |
| I can't find an Acer aspire 1714SMI/ | 2022-03-28 12:13 | - | |
| I can't go in windows/ | 2022-03-28 12:13 | - | |
| I can't play HD-DVD on Acer Arcade Deluxe!/ | 2022-03-28 12:13 | - | |
| I can't record with Orbicam/ | 2022-03-28 12:13 | - | |
| I can't shut off my laptop if I/ | 2022-03-28 12:13 | - | |
| I can confirm that Acer 5737Z supports 8GB RAM/ | 2022-03-28 12:13 | - | |
| I cannot use RECOVERY FUNCTION HELP PLEASE!/ | 2022-03-28 12:13 | - | |
| I cant install the camera on my 5672/ | 2022-03-28 12:13 | - | |
| I come to you for help- Acer Aspire 5810TZ Troubles/ | 2022-03-28 12:13 | - | |
| Iconia dual screen (Notebook or tablet )/ | 2022-03-28 12:13 | - | |
| Icons Increasing in Size When I Plug in Projector/ | 2022-03-28 12:13 | - | |
| Icons in task bar is fuzzy/ | 2022-03-28 12:13 | - | |
| I converted my C- and D- Partitions to NTFS - Can I use Acer eRecovery to restore/ | 2022-03-28 12:13 | - | |
| I could really use some advice with my aspire 5720/ | 2022-03-28 12:13 | - | |
| I could really use some help here guys/ | 2022-03-28 12:13 | - | |
| I could use some help ensuring I do all this correctly/ | 2022-03-28 12:13 | - | |
| Ideal Internal SSD Hard Drive for Acer Aspire/ | 2022-03-28 12:13 | - | |
| I despise Acer/ | 2022-03-28 12:13 | - | |
| I didnt burn a recovery disc/ | 2022-03-28 12:13 | - | |
| I did this only by using my Acer laptop!/ | 2022-03-28 12:13 | - | |
| If I/ | 2022-03-28 12:13 | - | |
| If I install my own XP Pro SP2/ | 2022-03-28 12:13 | - | |
| If I install my own copy of Windows/ | 2022-03-28 12:13 | - | |
| I finally got my 8104/ | 2022-03-28 12:13 | - | |
| If it is wise, plz compare TURION and DUAL CORE/ | 2022-03-28 12:13 | - | |
| I flashed my aspire 7745g bios and unlocked VT-x but app won't detect it. IT''s VT capable/ | 2022-03-28 12:13 | - | |
| If you could be ANY food, what food would you be/ | 2022-03-28 12:13 | - | |
| If you dont mess around your computer will live/ | 2022-03-28 12:13 | - | |
| If you have an Acer Aspire 6920G then enter please !!!!!!!!!!!!!!!!!!!!!!!/ | 2022-03-28 12:13 | - | |
| I get BSOD nd crashes sometimes on my acer/ | 2022-03-28 12:13 | - | |
| I get my Ferrari 4005 tomorrow/ | 2022-03-28 12:13 | - | |
| Ignore this thread ..done in error/ | 2022-03-28 12:13 | - | |
| I got it !!! HAHAHA!!! Although it's only 2012WLCi/ | 2022-03-28 12:13 | - | |
| I got my Acer 5315-2713 back from Acer!!!!/ | 2022-03-28 12:13 | - | |
| I hate acer, Replacement Laptops/ | 2022-03-28 12:13 | - | |
| I have 3 questions about my 5672. (infrared, media buttons, x1600 memory)/ | 2022-03-28 12:13 | - | |
| I have 8204 and I wanted the new 8210 Bluray drive, and i want it now!/ | 2022-03-28 12:13 | - | |
| I have Acer Apire 3680. Will this Firewire PCMCIA card work/ | 2022-03-28 12:13 | - | |
| I have a acer aspire 5050 notebook need help freeing disk space/ | 2022-03-28 12:13 | - | |
| I have a aspire 7720, want to resize partitions and remove bloatware/ | 2022-03-28 12:13 | - | |
| I have a problem with my graphics and I can't play a game. please help/ | 2022-03-28 12:13 | - | |
| I have a real damn problem. HELP !!!/ | 2022-03-28 12:13 | - | |
| I have removed CD tray and now laptop will not work - please help!/ | 2022-03-28 12:13 | - | |
| I have trouble using my in-built microphone in my Acer Laptop/ | 2022-03-28 12:13 | - | |
| I hope everyone reads this/ | 2022-03-28 12:13 | - | |
| I hope you can help me with this problem/ | 2022-03-28 12:13 | - | |
| I just did a reinstall of Windows XP on my acer aspire revo r1600 and the ethernet won't work. What can I do/ | 2022-03-28 12:13 | - | |
| I just placed my Order/ | 2022-03-28 12:13 | - | |
| I killed the motherboard in Acer 5315-2315 - what are my options/ | 2022-03-28 12:13 | - | |
| I knew I shoulda wiped... power saving options issue with 1810tz/ | 2022-03-28 12:13 | - | |
| I know this is strange but I can't see words when installing/ | 2022-03-28 12:13 | - | |
| I lost bios password/ | 2022-03-28 12:13 | - | |
| I love dogs, but is it a puppy/ | 2022-03-28 12:13 | - | |
| Im In Big Problem I Need Help On This!!/ | 2022-03-28 12:13 | - | |
| I m about to change the cpu but/ | 2022-03-28 12:13 | - | |
| Im at a lost/ | 2022-03-28 12:13 | - | |
| Im fat and i want to be ntfs!/ | 2022-03-28 12:13 | - | |
| Im goin huge! 9810 ordered!/ | 2022-03-28 12:13 | - | |
| Immense speed decrease in my Acer 8530G Notebook/ | 2022-03-28 12:13 | - | |
| Imminent Price drop on 8200/ | 2022-03-28 12:13 | - | |
| Important! For Those Who Would Like To Consider ACER/ | 2022-03-28 12:13 | - | |
| Important - Directly from acer support/ | 2022-03-28 12:13 | - | |
| Important drivers/ | 2022-03-28 12:13 | - | |
| Importing from U.S. to Canada/ | 2022-03-28 12:13 | - | |
| Importing video footage/ | 2022-03-28 12:13 | - | |
| Im pretty sure my 5920g's gpu died, looking for replacement GPU need help/ | 2022-03-28 12:13 | - | |
| Im sure I could squeeze a little more but/ | 2022-03-28 12:13 | - | |
| In English Please!- Step by step fresh install/ | 2022-03-28 12:13 | - | |
| Inactive 4500MHD inside the Acer Aspire 5738G/ | 2022-03-28 12:13 | - | |
| Incompetent Acer Technicians (an Acer Horror Story)/ | 2022-03-28 12:13 | - | |
| Increae graphics memory on Acer Travelmate 350 series/ | 2022-03-28 12:13 | - | |
| Increase battery life by a lot/ | 2022-03-28 12:13 | - | |
| Increase performance of the Aspire V15/ | 2022-03-28 12:13 | - | |
| Increase the 6920G's monitor refreshrate/ | 2022-03-28 12:13 | - | |
| Increasing shared videocard memory(Aspire 4315-300512Mi)/ | 2022-03-28 12:13 | - | |
| Increasing the Graphic Ram of 5732ZG/ | 2022-03-28 12:13 | - | |
| Index Rating performance drop with nvidia 162.18 Vista 32 Drivers & 5920G/ | 2022-03-28 12:13 | - | |
| I need 8930-6448 replacement lcd screen. Please help me!!!/ | 2022-03-28 12:13 | - | |
| I need a help to make a backup/ | 2022-03-28 12:13 | - | |
| I need an 8 cell battery for my Acer 3610LCi/ | 2022-03-28 12:13 | - | |
| I need an Acer Aspire 3680 mobo/ | 2022-03-28 12:13 | - | |
| I need an Aspire 5684WLMi service manual/ | 2022-03-28 12:13 | - | |
| I need comment about Aspire 2023!/ | 2022-03-28 12:13 | - | |
| I need help/ | 2022-03-28 12:13 | - | |
| I need help for overclocking my ACER/ | 2022-03-28 12:13 | - | |
| I need help in hanging problem in my laptop during Playing games/ | 2022-03-28 12:13 | - | |
| I need help on my ACER 2920/ | 2022-03-28 12:13 | - | |
| I need help on my Acer 5920G grahpics/ | 2022-03-28 12:13 | - | |
| I need help with Acer 6920G!!/ | 2022-03-28 12:13 | - | |
| I need help with Acer Aspire 9800 Vista/ | 2022-03-28 12:13 | - | |
| I need help with Purchasing options and Upgrading with 3820tg/ | 2022-03-28 12:13 | - | |
| I need help with a blue screen of death issue/ | 2022-03-28 12:13 | - | |
| I need help with my Aspire!/ | 2022-03-28 12:13 | - | |
| I need some Acer software/ | 2022-03-28 12:13 | - | |
| I need the help with acer gobi 2000/ | 2022-03-28 12:13 | - | |
| I need the tree structure of eRecovery DVD2 for Aspire 5610z/ | 2022-03-28 12:13 | - | |
| I need to find a replacement for the cord that connects the screen/ | 2022-03-28 12:13 | - | |
| I need to install XP in a Acer ApireOne with Linux without xternal cd/ | 2022-03-28 12:13 | - | |
| I need to reset Bios 5920G/ | 2022-03-28 12:13 | - | |
| I need up gradation information/ | 2022-03-28 12:13 | - | |
| Info Appreciated/ | 2022-03-28 12:13 | - | |
| Info on the 5739g/ | 2022-03-28 12:13 | - | |
| Information Please/ | 2022-03-28 12:13 | - | |
| Informations about TM3200/ | 2022-03-28 12:13 | - | |
| Infrared on Acer 5920g/ | 2022-03-28 12:13 | - | |
| Infrared port problem/ | 2022-03-28 12:13 | - | |
| In middle of replacing 6920G screen but have got stuck - HELP!/ | 2022-03-28 12:13 | - | |
| Input on my likely Purchase-4400/ | 2022-03-28 12:13 | - | |
| Inquiry about ACER ASPIRE 8920G/ | 2022-03-28 12:13 | - | |
| Insanely high Acer 4672 CPU temp/ | 2022-03-28 12:13 | - | |
| Instability/ | 2022-03-28 12:13 | - | |
| Install Acer 4820T Applications ON an Acer 4810T/ | 2022-03-28 12:13 | - | |
| Install Factory default, eRecovery/ | 2022-03-28 12:13 | - | |
| Install OS X Tiger on Acer Aspire 5021WLMI!/ | 2022-03-28 12:13 | - | |
| Install Windows 7 on Acer A715 and A717 NVMe SSD/ | 2022-03-28 12:13 | - | |
| Installation does not start from Factory DVD - Vista/ | 2022-03-28 12:13 | - | |
| Installation of faster HD on Acer 9502/ | 2022-03-28 12:13 | - | |
| Install bluetooth model on the 1410/ | 2022-03-28 12:13 | - | |
| Install drivers/ | 2022-03-28 12:13 | - | |
| Installed Bluetooth on my Aspire 5002WLMi!!/ | 2022-03-28 12:13 | - | |
| Installed Internal Bluetooth Adapter in My Acer 5580...Which Driver Package Should I Install/ | 2022-03-28 12:13 | - | |
| Installed Vista Ultimate and lost all ACER drivers!!! (wireless, em. tech button etc.)/ | 2022-03-28 12:13 | - | |
| Installed Vista Ultimate and now there is a Program Files (x86) folder/ | 2022-03-28 12:13 | - | |
| Installed Win 7 Pro wrong on my 1810TZ - Help!/ | 2022-03-28 12:13 | - | |
| Installed Windows 7 Ultimate (64 bit) on acer 8930G. Everything works apart from eAudio Management/ | 2022-03-28 12:13 | - | |
| Installed XP Aspire Gemstone blue/ | 2022-03-28 12:13 | - | |
| Installed XP on Aspire 5101 after HD failure what Acer Utilities do I need to Install/ | 2022-03-28 12:13 | - | |
| Installed a second OS and made unoperational/ | 2022-03-28 12:13 | - | |
| Installed wrong NVIDIA Graphics Driver/ | 2022-03-28 12:13 | - | |
| Installing 32bit Windows 7 on Acer Aspire with 64bit pre-installed/ | 2022-03-28 12:13 | - | |
| Installing 6920g Recovery Disk on new Hard Drive/ | 2022-03-28 12:13 | - | |
| Installing ATI Catalyst 10.7 on TimelineX 3820TG 4820TG 5820TG/ | 2022-03-28 12:13 | - | |
| Installing ATI HD 5650 card on an Acer 5820G/ | 2022-03-28 12:13 | - | |
| Installing Bluetooth Module - Aspire 9303/ | 2022-03-28 12:13 | - | |
| Installing CAT file drivers/ | 2022-03-28 12:13 | - | |
| Installing DVD burner in Acer 3610. Please help/ | 2022-03-28 12:13 | - | |
| Installing DirectX on Aspire 5920/ | 2022-03-28 12:13 | - | |
| Installing Factory Recovery Disk on New Hard Drive/ | 2022-03-28 12:13 | - | |
| Installing Memory in my Acer/ | 2022-03-28 12:13 | - | |
| Installing Ram on Aspire 5720/ | 2022-03-28 12:13 | - | |
| Installing SATA II SSD on Extensa 4420/ | 2022-03-28 12:13 | - | |
| Installing Vista Ultimate 64bit on Acer 5920g/ | 2022-03-28 12:13 | - | |
| Installing Win 7 in Acer 5720z/ | 2022-03-28 12:13 | - | |
| Installing Win7 on 3810TZ (no dvd drive)/ | 2022-03-28 12:13 | - | |
| Installing Win XP on Acer 5750Z laptop/ | 2022-03-28 12:13 | - | |
| Installing Windows 7 on an ACER 6920G- drivers, experience etc/ | 2022-03-28 12:13 | - | |
| Installing Windows 7 on my Acer/ | 2022-03-28 12:13 | - | |
| Installing Windows 7 unto a SD Card/ | 2022-03-28 12:13 | - | |
| Installing Windows XP Pro x32 on Acer TravelMate 4072WLMi/ | 2022-03-28 12:13 | - | |
| Installing XP is so easy/ | 2022-03-28 12:13 | - | |
| Installing XP on Acer Aspire 6930G/ | 2022-03-28 12:13 | - | |
| Installing XP on Acer Extenza 4620/ | 2022-03-28 12:13 | - | |
| Installing XP on Aspire 4730z/ | 2022-03-28 12:13 | - | |
| Installing XP on Aspire 5315 which came with Vista/ | 2022-03-28 12:13 | - | |
| Installing XP on Aspire 5739G/ | 2022-03-28 12:13 | - | |
| Installing XP on Aspire 6930G/ | 2022-03-28 12:13 | - | |
| Installing XP on a Vista Laptop (acer 5100)/ | 2022-03-28 12:13 | - | |
| Installing XP on the Acer Aspire One (D150)/ | 2022-03-28 12:13 | - | |
| Installing Xp On Acer Aspire 6920g/ | 2022-03-28 12:13 | - | |
| Installing a SSD in the Acer Aspire 8951G/ | 2022-03-28 12:13 | - | |
| Installing bluetooth in 7736z laptop/ | 2022-03-28 12:13 | - | |
| Installing clean install of Vista Buisness on my 5920 - Need Help/ | 2022-03-28 12:13 | - | |
| Installing factory default on new hard disk/ | 2022-03-28 12:13 | - | |
| Installing from Recovery CDs to another PC/ | 2022-03-28 12:13 | - | |
| Installing internal wireless card to Acer Travelmate 2410/ | 2022-03-28 12:13 | - | |
| Installing memory into Acer 5102... 2 locations or 1/ | 2022-03-28 12:13 | - | |
| Installing slimline Blu Ray drive/ | 2022-03-28 12:13 | - | |
| Installing the Acer 3680 Internal bluetooth module/ | 2022-03-28 12:13 | - | |
| Installing the Intel Turbo Memory On the 5920g/ | 2022-03-28 12:13 | - | |
| Installing the RADEON HD 4650 to my Aspire 5920g/ | 2022-03-28 12:13 | - | |
| Install keyboard for 3680 5570 5580/ | 2022-03-28 12:13 | - | |
| Install of latest BIOS/ | 2022-03-28 12:13 | - | |
| Install vista from recovery partition/ | 2022-03-28 12:13 | - | |
| Install windows 7 64bits on 5920G/ | 2022-03-28 12:13 | - | |
| Instructions on recovering a AS1681WLMI/ | 2022-03-28 12:13 | - | |
| Instructions to upgrade Aspire 5315 laptop/ | 2022-03-28 12:13 | - | |
| Insyde BIOS/ | 2022-03-28 12:13 | - | |
| Insyde BIOS MobilePro 4.20.10 (HQD70) on Acer Aspire 9500 - Change Boot Logo/ | 2022-03-28 12:13 | - | |
| Insyde BIOS modding discussions/ | 2022-03-28 12:13 | - | |
| Integrated Webcam/ | 2022-03-28 12:13 | - | |
| Intel® PRO Wireless 3945ABG question/ | 2022-03-28 12:13 | - | |
| Intel 5300 wireless card in Acer 5630/ | 2022-03-28 12:13 | - | |
| Intel 6200 upgrade for Acer AS7552G-6436/ | 2022-03-28 12:13 | - | |
| Intel Chipset drivers v8.6.0.1007/ | 2022-03-28 12:13 | - | |
| Intel Core Duo and ACer Wcpuid/ | 2022-03-28 12:13 | - | |
| Intel Extreme Graphics 82852 82855 overclock/ | 2022-03-28 12:13 | - | |
| Intel Integrated Graphics/ | 2022-03-28 12:13 | - | |
| Intel Processor ID ultility- 8930G/ | 2022-03-28 12:13 | - | |
| Intel Rapid Storage Technology on Acer 8943G/ | 2022-03-28 12:13 | - | |
| Intel Switchable Graphics and second HDD standby mode [Manual]/ | 2022-03-28 12:13 | - | |
| Intel TJ85/ | 2022-03-28 12:13 | - | |
| Intel Turbo Memory/ | 2022-03-28 12:13 | - | |
| Intel Turbo Memory in 5920/ | 2022-03-28 12:13 | - | |
| Intel Upgrade- Should I/ | 2022-03-28 12:13 | - | |
| Intel VT Enabled/ | 2022-03-28 12:13 | - | |
| Intel VT bios hack on Aspire 7720/ | 2022-03-28 12:13 | - | |
| Intel Wireless Display (TV)/ | 2022-03-28 12:13 | - | |
| Intel Wireless will not power up on Acer 5930G/ | 2022-03-28 12:13 | - | |
| Intel X9100 core stepping 8930G/ | 2022-03-28 12:13 | - | |
| Intel rapid storage technology - disk on port 1- removed/ | 2022-03-28 12:13 | - | |
| Intel turbo memory - Acer 5920G/ | 2022-03-28 12:13 | - | |
| Intel vs AMD 64 Support for SATA AHCI/ | 2022-03-28 12:13 | - | |
| Interchange batteries/ | 2022-03-28 12:13 | - | |
| Intergrated graphics/ | 2022-03-28 12:13 | - | |
| Intermittant pausing/ | 2022-03-28 12:13 | - | |
| Intermittant problem - Won't Start!!/ | 2022-03-28 12:13 | - | |
| Intermitten high pitch squeak from your Ferrari/ | 2022-03-28 12:13 | - | |
| Intermittent BSOD on 8204 while loading windows/ | 2022-03-28 12:13 | - | |
| Intermittent frustrations on an Acer laptop/ | 2022-03-28 12:13 | - | |
| Internal Bluetooth on Acers/ | 2022-03-28 12:13 | - | |
| International Warranty/ | 2022-03-28 12:13 | - | |
| Internet Connection Troubles on 5820TG/ | 2022-03-28 12:13 | - | |
| Interrupted Operation/ | 2022-03-28 12:13 | - | |
| Intigrated Graphics/ | 2022-03-28 12:13 | - | |
| Introduction - Hello -)/ | 2022-03-28 12:13 | - | |
| Invalid Partition Table/ | 2022-03-28 12:13 | - | |
| Invalid Partition Table when reinstalling Windows/ | 2022-03-28 12:13 | - | |
| InviLink Nplify For Windows 7/ | 2022-03-28 12:13 | - | |
| I ordered a Acer Aspire S3-951 (Advice Please)/ | 2022-03-28 12:13 | - | |
| I purchased T5200...for my Travelmate 2480/ | 2022-03-28 12:13 | - | |
| I really need bluetooth drivers for Acer Extensa 4420-5910!/ | 2022-03-28 12:13 | - | |
| I really need help bad with my display/ | 2022-03-28 12:13 | - | |
| I really need help with USB/ | 2022-03-28 12:13 | - | |
| I removed ESC on 1350/ | 2022-03-28 12:13 | - | |
| I replaced HD & kept f10 recovery/ | 2022-03-28 12:13 | - | |
| I replaced the 60hz display in y Acer Nitro 5 w Innolux N156HHE-GA1 and it gives em eye strain -(/ | 2022-03-28 12:13 | - | |
| I restored my 5044WLMi to factory settings and now it boots a LOT quicker/ | 2022-03-28 12:13 | - | |
| Irregular fan speed/ | 2022-03-28 12:13 | - | |
| Is 4810T right for me/ | 2022-03-28 12:13 | - | |
| Is 4820TG reliable/ | 2022-03-28 12:13 | - | |
| Is 5920G's screen good for creative work/ | 2022-03-28 12:13 | - | |
| Is ACER TravelMate 5760G worth of it/ | 2022-03-28 12:13 | - | |
| Is ACER a Good Laptop Manufacturer/ | 2022-03-28 12:13 | - | |
| Is Acer's build quality really that bad/ | 2022-03-28 12:13 | - | |
| Is Acer 3935 worth picking up/ | 2022-03-28 12:13 | - | |
| Is Acer Aspire 1691 WMLi can be upgrade Vga Ram/ | 2022-03-28 12:13 | - | |
| Is Acer Aspire 5562 battery compatible with tm6413, tm2480, tm4233, tm3012/ | 2022-03-28 12:13 | - | |
| Is Acer Gateway eMachines Support Really This Bad/ | 2022-03-28 12:13 | - | |
| Is Acer a good brand/ | 2022-03-28 12:13 | - | |
| Is Acer a good reliable brand/ | 2022-03-28 12:13 | - | |
| Is Acer a reliable laptop brand/ | 2022-03-28 12:13 | - | |
| Is Acer good and Quick/ | 2022-03-28 12:13 | - | |
| Is Acer the worst computer company in the world ...and other techincal questions/ | 2022-03-28 12:13 | - | |
| Is Dolby-optimized surround sound system any good in Acer Laptops/ | 2022-03-28 12:13 | - | |
| Is My Notebook Way Too Hot/ | 2022-03-28 12:13 | - | |
| Is NHC compatable with vista/ | 2022-03-28 12:13 | - | |
| Is SATA 3 [revision 3.0 (SATA 6 Gbit s)] Supported in New SandyBridge Aspire TimelineX AS4830t with HM65 Chipset/ | 2022-03-28 12:13 | - | |
| Is There Any Method to rebuild the hidden partition/ | 2022-03-28 12:13 | - | |
| Is a 5018 Turion X2 ZM80 reliable/ | 2022-03-28 12:13 | - | |
| Is a battery for 1830T compatible with 1810T/ | 2022-03-28 12:13 | - | |
| Is anyone know if someone is actually working on Acer's AMD switchable graphics problem/ | 2022-03-28 12:13 | - | |
| I seem to have lost Launch Manager/ | 2022-03-28 12:13 | - | |
| Is it bad to leave my LCD screen on all the time/ | 2022-03-28 12:13 | - | |
| Is it impossible to install new ATI drivers on an Acer/ | 2022-03-28 12:13 | - | |
| Is it just me or does the 5102 TFT have awful colour banding/ | 2022-03-28 12:13 | - | |
| Is it possible to buy the 5940g in the U.S/ | 2022-03-28 12:13 | - | |
| Is it possible to change Acer 1810 1410 keyboard for a thinkpad keyboard/ | 2022-03-28 12:13 | - | |
| Is it possible to change between integrated and dedicated graphics/ | 2022-03-28 12:13 | - | |
| Is it possible to get Bing background from Acer netbook to Acer notebook/ | 2022-03-28 12:13 | - | |
| Is it possible to install MAC OS on Acer Aspire 5920/ | 2022-03-28 12:13 | - | |
| Is it possible to install an SSD in a Ferrari 1000/ | 2022-03-28 12:13 | - | |
| Is it possible to put a PCI Ageia PhysX card into my 6920G/ | 2022-03-28 12:13 | - | |
| Is it possible to put a fingerprint scanner on this model/ | 2022-03-28 12:13 | - | |
| Is it possible to replace the eMMC of an Aspire ES1-331 with a SATAIII-SSD/ | 2022-03-28 12:13 | - | |
| Is it possible to upgrade the GPU in a 7720G/ | 2022-03-28 12:13 | - | |
| Is it possible to use one set of Acer Recovery DVDs for several computers/ | 2022-03-28 12:13 | - | |
| Is it worth getting Acer/ | 2022-03-28 12:13 | - | |
| Is it worth it Gaming 5520 ICY70 upgrade/ | 2022-03-28 12:13 | - | |
| Is it worth to spend 100 to fix my Acer Aspire 5920G/ | 2022-03-28 12:13 | - | |
| Is it worth upgrading from 5400 to 7200/ | 2022-03-28 12:13 | - | |
| Is me or does Gateways E-100M look like an acer 3000/ | 2022-03-28 12:13 | - | |
| Is my 6930g dying/ | 2022-03-28 12:13 | - | |
| Is my 7720G dead Can I resurrect it/ | 2022-03-28 12:13 | - | |
| Is my Acer Aspire 3003wlci LCD crystal bright/ | 2022-03-28 12:13 | - | |
| Is my Acer Aspire 5672WLMi broken/ | 2022-03-28 12:13 | - | |
| Is my Acer Aspire 5672 dead/ | 2022-03-28 12:13 | - | |
| Is my Acer Travel 6292 overheat/ | 2022-03-28 12:13 | - | |
| Is my Acer Travelmate eating batteries, or is it just me/ | 2022-03-28 12:13 | - | |
| Is my BIOS version capable of C2D/ | 2022-03-28 12:13 | - | |
| Is my DVD drive going bad/ | 2022-03-28 12:13 | - | |
| Is my Extensa 5620-6830 a done deal/ | 2022-03-28 12:13 | - | |
| Is my battery dead/ | 2022-03-28 12:13 | - | |
| Is my battery dead Aspire 1410/ | 2022-03-28 12:13 | - | |
| Is my gpu dying/ | 2022-03-28 12:13 | - | |
| Is my laptop dying -(/ | 2022-03-28 12:13 | - | |
| Is my laptop screen faulty/ | 2022-03-28 12:13 | - | |
| Is my latop battery dead/ | 2022-03-28 12:13 | - | |
| Is my motherboard dead Acer 5100/ | 2022-03-28 12:13 | - | |
| Is my new Aspire 4741G defective/ | 2022-03-28 12:13 | - | |
| Is my system better for gaming then this Acer Extensa/ | 2022-03-28 12:13 | - | |
| Is my video card or anotehr part of my laptop fried/ | 2022-03-28 12:13 | - | |
| Is putting my acer notebook on floor speaker ok/ | 2022-03-28 12:13 | - | |
| Is someone able to mod my InsydeH2O-Bios Need the Advanced features-/ | 2022-03-28 12:13 | - | |
| Is something wrong with my laptop/ | 2022-03-28 12:13 | - | |
| Issues with Acer Aspire 5253-BZ400/ | 2022-03-28 12:13 | - | |
| Issues with Battery at 60%/ | 2022-03-28 12:13 | - | |
| Issues with Stand By and Touchpad/ | 2022-03-28 12:13 | - | |
| Issues with Windows 7 on Acer 5570Z/ | 2022-03-28 12:13 | - | |
| Issues with screen/ | 2022-03-28 12:13 | - | |
| Issues with the new Acer Aspire AS8940g/ | 2022-03-28 12:13 | - | |
| Issue with 8600M GT/ | 2022-03-28 12:13 | - | |
| Issue with Acer Aspire 8730/ | 2022-03-28 12:13 | - | |
| Issue with Realtek Line In Device/ | 2022-03-28 12:13 | - | |
| Issue with Right Click/ | 2022-03-28 12:13 | - | |
| Is the 3830TG a viable m11x alternative replacement/ | 2022-03-28 12:13 | - | |
| Is the 5680 on the shelves/ | 2022-03-28 12:13 | - | |
| Is the 5920 series reliable/ | 2022-03-28 12:13 | - | |
| Is the AC adapter supposed to be this hot/ | 2022-03-28 12:13 | - | |
| Is the Acer 3810T-6415 Timeline Discontinued/ | 2022-03-28 12:13 | - | |
| Is the Acer 8930 a MXM type laptop (and other questions)/ | 2022-03-28 12:13 | - | |
| Is the Acer Aspire 4530-6823 compatible with XP/ | 2022-03-28 12:13 | - | |
| Is the Acer Aspire4715 Good/ | 2022-03-28 12:13 | - | |
| Is the Acer Aspire One memory built in/ | 2022-03-28 12:13 | - | |
| Is the Acer TravelMate 4501 LCi any good/ | 2022-03-28 12:13 | - | |
| Is the Acer ezDock compatible with the Acer Aspire AS5251-1805/ | 2022-03-28 12:13 | - | |
| Is the Aspire Quadro real/ | 2022-03-28 12:13 | - | |
| Is the Timeline 4810T due for a refresh/ | 2022-03-28 12:13 | - | |
| Is the new intel SSD sata II compatible with acer aspire 5520G/ | 2022-03-28 12:13 | - | |
| Is there CMOS battery in TM 4500 series/ | 2022-03-28 12:13 | - | |
| Is there a 4810t thread/ | 2022-03-28 12:13 | - | |
| Is there a fix for 4way rocker to be used in firefox/ | 2022-03-28 12:13 | - | |
| Is there an Acer 5935G with Nvidia GT240M/ | 2022-03-28 12:13 | - | |
| Is there any ACER software working on Win2k3/ | 2022-03-28 12:13 | - | |
| Is there any advanced software for the 5920G webcam/ | 2022-03-28 12:13 | - | |
| Is there any benefit with Acer Empowering software utility/ | 2022-03-28 12:13 | - | |
| Is there anyone that can play this H264 clip on Timeline SU3500 without 100% CPU load/ | 2022-03-28 12:13 | - | |
| Is there any place I can get a recover CD for my Acer Aspire 5100/ | 2022-03-28 12:13 | - | |
| Is there any unlocked BIOS for Acer Travelmate 5742g/ | 2022-03-28 12:13 | - | |
| Is there anyway to repaint this laptop/ | 2022-03-28 12:13 | - | |
| Is there a replacement battery for the 1714MSi/ | 2022-03-28 12:13 | - | |
| Is there a software which can share the video over wifi/ | 2022-03-28 12:13 | - | |
| Is there drivers for Windows 7 drivers and applications for Aspire 6530G/ | 2022-03-28 12:13 | - | |
| Is there free software to repartition the hard drive/ | 2022-03-28 12:13 | - | |
| Is there much diff between a 14 screen and 13.3 - looking at timelinex/ | 2022-03-28 12:13 | - | |
| Is the screen on Aspire 7745G that bad/ | 2022-03-28 12:13 | - | |
| Is this Synaptics memory usage normal/ | 2022-03-28 12:13 | - | |
| Is this a False Positive for Trojan.Agent at PLFSet.dll/ | 2022-03-28 12:13 | - | |
| Is this acceptable level of backlight bleeding for e-ips/ | 2022-03-28 12:13 | - | |
| Is this a good bargain- 4820TG for $1300/ | 2022-03-28 12:13 | - | |
| Is this a good deal/ | 2022-03-28 12:13 | - | |
| Is this a good gaming laptop I need help finding one/ | 2022-03-28 12:13 | - | |
| Is this a good setup (Aspire 1410 w su3500)/ | 2022-03-28 12:13 | - | |
| Is this a legit way of upgrading a 32-bit Acer OEM Vista/ | 2022-03-28 12:13 | - | |
| Is this an Acer remote for the 5920G/ | 2022-03-28 12:13 | - | |
| Is this a real product/ | 2022-03-28 12:13 | - | |
| Is this a scam Probably is/ | 2022-03-28 12:13 | - | |
| Is this common with Acer Ferrari 4000 laptops/ | 2022-03-28 12:13 | - | |
| Is this compatible SODIMM, DDR2/ | 2022-03-28 12:13 | - | |
| Is this excessive battery drain (while the laptop is TURNED OFF)/ | 2022-03-28 12:13 | - | |
| Is this fast enough Also old laptop comparison/ | 2022-03-28 12:13 | - | |
| Is this laptop any good/ | 2022-03-28 12:13 | - | |
| Is this model good enough for gaming/ | 2022-03-28 12:13 | - | |
| Is this overclock to much/ | 2022-03-28 12:13 | - | |
| Is this possible/ | 2022-03-28 12:13 | - | |
| Is this price real for a Ferrari 4005/ | 2022-03-28 12:13 | - | |
| Is this real/ | 2022-03-28 12:13 | - | |
| Is this worth a TRADE 6920g 7540/ | 2022-03-28 12:13 | - | |
| It's official- Acer now sucks/ | 2022-03-28 12:13 | - | |
| It arrived early!/ | 2022-03-28 12:13 | - | |
| I think I found a way to stop CPU downclocking for 6920G/ | 2022-03-28 12:13 | - | |
| I think a BIOS upgrade has stuffed XP/ | 2022-03-28 12:13 | - | |
| I think i Messed up my 5920G from disc clean-up of D drive/ | 2022-03-28 12:13 | - | |
| I think i need to overclock my cpu speed/ | 2022-03-28 12:13 | - | |
| I think my graphics card is borked - Aspire 3680/ | 2022-03-28 12:13 | - | |
| It is normal that 8930G cannot run without a battery/ | 2022-03-28 12:13 | - | |
| It takes a long time for my laptop to connect/ | 2022-03-28 12:13 | - | |
| Ivy Bridge CPU in a TimelineX 4830T/ | 2022-03-28 12:13 | - | |
| I wanna buy Acer - ASPIRE 5672WLMI/ | 2022-03-28 12:13 | - | |
| I wanna update my Bios in Acer Aspire 5920, please help!/ | 2022-03-28 12:13 | - | |
| I want my 4 GB ram recognized!/ | 2022-03-28 12:13 | - | |
| I want to install window 7 on my laptop once it comes out/ | 2022-03-28 12:13 | - | |
| I want to instal winXP on my aspire 5290g t7300/ | 2022-03-28 12:13 | - | |
| I want to remove all ACER softwares/ | 2022-03-28 12:13 | - | |
| I want to send files via bluetooth but acer atheros bluetooth won't let/ | 2022-03-28 12:13 | - | |
| I will be doing an extensive review of my 8930 on Saturday/ | 2022-03-28 12:13 | - | |
| I wish to buy an Acer aspire 5920WLMi/ | 2022-03-28 12:13 | - | |
| I wonder if i can use expresscard 34 in a expresscard 54 on an Acer Aspire 6935G/ | 2022-03-28 12:13 | - | |
| I would like to mod my 5315 with a Touch Screen/ | 2022-03-28 12:13 | - | |
| JKontherun.com Long-term review of the 8940G/ | 2022-03-28 12:13 | - | |
| Just A Little Help. ACER ASPIRE 5315/ | 2022-03-28 12:13 | - | |
| Just Ordered Ferrari 4005 WLMi from Zip Zoom Fly/ | 2022-03-28 12:13 | - | |
| Just Ordered a Costco i7 12GB RAM A5, Your Thoughts/ | 2022-03-28 12:13 | - | |
| Just Purchased Aspire 9810/ | 2022-03-28 12:13 | - | |
| Just Replaced Keyboard, Still not Working/ | 2022-03-28 12:13 | - | |
| Just bought 1681, now what about the HD/ | 2022-03-28 12:13 | - | |
| Just bought 3820TG need help/ | 2022-03-28 12:13 | - | |
| Just bought Acer 8204, Memory Question Help/ | 2022-03-28 12:13 | - | |
| Just bought Aspire 3693, Wireless isn't working/ | 2022-03-28 12:13 | - | |
| Just bought Aspire 5613/ | 2022-03-28 12:13 | - | |
| Just bought Aspire 5672 - Problems out the box/ | 2022-03-28 12:13 | - | |
| Just bought a 4820T/ | 2022-03-28 12:13 | - | |
| Just bought an AS5315/ | 2022-03-28 12:13 | - | |
| Just bought an Acer 5735-4624 and want to put XP on it/ | 2022-03-28 12:13 | - | |
| Just bought a new Acer..and I'm taking it back to the store/ | 2022-03-28 12:13 | - | |
| Just bought laptop.. wont start up/ | 2022-03-28 12:13 | - | |
| Just bought my new Acer 5630 last night/ | 2022-03-28 12:13 | - | |
| Just bought new AS5570-2067. A few/ | 2022-03-28 12:13 | - | |
| Just bought new Acer... reinstall Windows/ | 2022-03-28 12:13 | - | |
| Just bought the Acer 4820TG/ | 2022-03-28 12:13 | - | |
| Just checking something (re 8204)/ | 2022-03-28 12:13 | - | |
| Just got 5930g, but is it GDDR3/ | 2022-03-28 12:13 | - | |
| Just got 8204/ | 2022-03-28 12:13 | - | |
| Just got Acer Travelmate 8200, cleaning up/ | 2022-03-28 12:13 | - | |
| Just got a TimlineX 1830T! Which apps to uninstall/ | 2022-03-28 12:13 | - | |
| Just got a new Acer 1810T, display profiles and touchpad deadzone/ | 2022-03-28 12:13 | - | |
| Just got a new Acer laptop and need some help/ | 2022-03-28 12:13 | - | |
| Just got my Acer/ | 2022-03-28 12:13 | - | |
| Just got my Acer Timeline 3810T-6415!/ | 2022-03-28 12:13 | - | |
| Just got my Aspire 1694WLMI/ | 2022-03-28 12:13 | - | |
| Just got my new Acer 8204!/ | 2022-03-28 12:13 | - | |
| Just got my timelinex 3830/ | 2022-03-28 12:13 | - | |
| Just got the Acer Aspire 5315-2153,having some connection issues/ | 2022-03-28 12:13 | - | |
| Just order an Acer Aspire 6930-6455/ | 2022-03-28 12:13 | - | |
| Just ordered TM 4502/ | 2022-03-28 12:13 | - | |
| Just ordered an AS 8950 froM NewEgg/ | 2022-03-28 12:13 | - | |
| Just ordered my Aspire One/ | 2022-03-28 12:13 | - | |
| Just ran 3DMark05 with the 1.5ghz 5920/ | 2022-03-28 12:13 | - | |
| Just ran 3DMark06 with the 1.5ghz 5920/ | 2022-03-28 12:13 | - | |
| Just ran 3DMark2001se with the 1.5ghz 5920/ | 2022-03-28 12:13 | - | |
| Just stuck a SSD in my 6920g last week!/ | 2022-03-28 12:13 | - | |
| Just to confirm (8204 creating windows install disk)/ | 2022-03-28 12:13 | - | |
| Just to confirm, here's how to upgrade mem on 2012/ | 2022-03-28 12:13 | - | |
| Just wondering if my warranty will be void/ | 2022-03-28 12:13 | - | |
| KB943899 Again Comments please/ | 2022-03-28 12:13 | - | |
| Keep 9411AWSMI or get 5102WLMi/ | 2022-03-28 12:13 | - | |
| Keep It Or Get Rid Of/ | 2022-03-28 12:13 | - | |
| Keep getting terrible feedback when I close the lid -(/ | 2022-03-28 12:13 | - | |
| Keeping aspect ratios on widescreens/ | 2022-03-28 12:13 | - | |
| Keep or return $500 Acer Aspire 3690-2900/ | 2022-03-28 12:13 | - | |
| Keyboad and touchpad problem/ | 2022-03-28 12:13 | - | |
| Keyboard, Touchpad and various other hardware not working properly/ | 2022-03-28 12:13 | - | |
| Keyboard, touchpad and USB don't work/ | 2022-03-28 12:13 | - | |
| Keyboard Broken/ | 2022-03-28 12:13 | - | |
| Keyboard Freezes/ | 2022-03-28 12:13 | - | |
| Keyboard Issues with Acer 8920g/ | 2022-03-28 12:13 | - | |
| Keyboard Problem/ | 2022-03-28 12:13 | - | |
| Keyboard Touchpad issue. Hardware or software !/ | 2022-03-28 12:13 | - | |
| Keyboard behaves Strange funny on Acer 5670... !/ | 2022-03-28 12:13 | - | |
| Keyboard driver/ | 2022-03-28 12:13 | - | |
| Keyboard flex Screen flex/ | 2022-03-28 12:13 | - | |
| Keyboard hotkeys, ir Remote software drivers/ | 2022-03-28 12:13 | - | |
| Keyboard issues with 7720G/ | 2022-03-28 12:13 | - | |
| Keyboard issues with 7720G FIXED/ | 2022-03-28 12:13 | - | |
| Keyboard keys On Aspire 6920g/ | 2022-03-28 12:13 | - | |
| Keyboard keys give wrong characters!!!/ | 2022-03-28 12:13 | - | |
| Keyboard letter problem/ | 2022-03-28 12:13 | - | |
| Key board mouse & usb ports unresponsive/ | 2022-03-28 12:13 | - | |
| Keyboard noise when keys pressed 8204/ | 2022-03-28 12:13 | - | |
| Keyboard not typing/ | 2022-03-28 12:13 | - | |
| Keyboard on Gemstone blue way too tight/ | 2022-03-28 12:13 | - | |
| Keyboard problem (Extensa 5620)/ | 2022-03-28 12:13 | - | |
| Keyboard problem ACER ASPIRE 5920G is different from the other post seen around.. help appreciate/ | 2022-03-28 12:13 | - | |
| Keyboard randomly self-repeating on AS1410/ | 2022-03-28 12:13 | - | |
| Keyboard reconfiguration/ | 2022-03-28 12:13 | - | |
| Keyboard replacement dissasembly Aspire 8920g/ | 2022-03-28 12:13 | - | |
| Keyoard 'flex'/ | 2022-03-28 12:13 | - | |
| Key on Keyboard Problem/ | 2022-03-28 12:13 | - | |
| Keys coming off Aspire 3690/ | 2022-03-28 12:13 | - | |
| Key stopped working/ | 2022-03-28 12:13 | - | |
| Killed my speakers! help! (aspire 5672wlmi)/ | 2022-03-28 12:13 | - | |
| Kinda dumb question (regarding RAM)/ | 2022-03-28 12:13 | - | |
| Kingston ValueRAM or Corsair Value Series for my Acer Travelmate 7720/ | 2022-03-28 12:13 | - | |
| Know of a good docking station for Acer notebooks/ | 2022-03-28 12:13 | - | |
| LAN detection problem/ | 2022-03-28 12:13 | - | |
| LAN wont wake up/ | 2022-03-28 12:13 | - | |
| LApToP WaNTeD SOoN!/ | 2022-03-28 12:13 | - | |
| LCD Bending on Aspire 1681/ | 2022-03-28 12:13 | - | |
| LCD Display Questions/ | 2022-03-28 12:13 | - | |
| LCD Issue/ | 2022-03-28 12:13 | - | |
| LCD Screen - Backlight Only/ | 2022-03-28 12:13 | - | |
| LCD Time Display on a 1801/ | 2022-03-28 12:13 | - | |
| LCD brand/ | 2022-03-28 12:13 | - | |
| LCD disconnect on lid closing (Vista)/ | 2022-03-28 12:13 | - | |
| LCD has vertical coloured lines and crap/ | 2022-03-28 12:13 | - | |
| LCD not working after RAM upgrade/ | 2022-03-28 12:13 | - | |
| LCD or LED/ | 2022-03-28 12:13 | - | |
| LCD panel upgrade possible/ | 2022-03-28 12:13 | - | |
| LCD problem on my Travelmate 4002 LCi/ | 2022-03-28 12:13 | - | |
| LCD problems/ | 2022-03-28 12:13 | - | |
| LCD to bright on bottom - Aspire 5672/ | 2022-03-28 12:13 | - | |
| LF- Acer 7741G Service Manual or FRU/ | 2022-03-28 12:13 | - | |
| LINE IN on Acer TravelMate290 how to/ | 2022-03-28 12:13 | - | |
| LMS Service cannot connect to Intel(R) MEI driver/ | 2022-03-28 12:13 | - | |
| Lag Trouble With my Acer aspire 5100/ | 2022-03-28 12:13 | - | |
| Lag during DVD playback/ | 2022-03-28 12:13 | - | |
| Language change Bios/ | 2022-03-28 12:13 | - | |
| Lappy won't shut down. Help!/ | 2022-03-28 12:13 | - | |
| Laptop - Factory Reboot - New Hard Drive/ | 2022-03-28 12:13 | - | |
| Laptop BIOS question (mod)/ | 2022-03-28 12:13 | - | |
| Laptop Battery/ | 2022-03-28 12:13 | - | |
| Laptop Built in Speakers on WM2020 series/ | 2022-03-28 12:13 | - | |
| Laptop Crack! Help!/ | 2022-03-28 12:13 | - | |
| Laptop Death - ACER GEMSTONE 4920G (UK)/ | 2022-03-28 12:13 | - | |
| Laptop Death/ | 2022-03-28 12:13 | - | |
| Laptop Dying/ | 2022-03-28 12:13 | - | |
| Laptop Fan Issue/ | 2022-03-28 12:13 | - | |
| Laptop Freezes Constantly After BIOS Upgrade/ | 2022-03-28 12:13 | - | |
| Laptop HD connector/ | 2022-03-28 12:13 | - | |
| Laptop Noise/ | 2022-03-28 12:13 | - | |
| Laptop Sleeve for TM4002/ | 2022-03-28 12:13 | - | |
| Laptop Speakers not working, but headphones do/ | 2022-03-28 12:13 | - | |
| Laptop Wont turn Off/ | 2022-03-28 12:13 | - | |
| Laptop advice - 5741 or 5810T/ | 2022-03-28 12:13 | - | |
| Laptop aspire 5135 runs hot/ | 2022-03-28 12:13 | - | |
| Laptop buying is so confusing/ | 2022-03-28 12:13 | - | |
| Laptop connection with internet/ | 2022-03-28 12:13 | - | |
| Laptop display shifting to right (Aspire 5920G)/ | 2022-03-28 12:13 | - | |
| Laptop freezes up after installing Vista upgrade/ | 2022-03-28 12:13 | - | |
| Laptop giving me a very hard time/ | 2022-03-28 12:13 | - | |
| Laptop hinge clicked and grey screen/ | 2022-03-28 12:13 | - | |
| Laptop in airplane/ | 2022-03-28 12:13 | - | |
| Laptop internet stops responding after 4 hours - have to restart/ | 2022-03-28 12:13 | - | |
| Laptop issue (Acer Travelmate 5730)/ | 2022-03-28 12:13 | - | |
| Laptop keeps rebooting, monitor not coming on/ | 2022-03-28 12:13 | - | |
| Laptop keyboard and mouse not responding/ | 2022-03-28 12:13 | - | |
| Laptop making high-pitched whistling sound/ | 2022-03-28 12:13 | - | |
| Laptop not booting!/ | 2022-03-28 12:13 | - | |
| Laptop not recognising power input/ | 2022-03-28 12:13 | - | |
| Laptop or Desktop/ | 2022-03-28 12:13 | - | |
| Laptop overheating, BAD! 80-90 C/ | 2022-03-28 12:13 | - | |
| Laptop overheats and turns off during The Sims 3/ | 2022-03-28 12:13 | - | |
| Laptop playing strange music when lid closed/ | 2022-03-28 12:13 | - | |
| Laptop powers on shuts off repeats again/ | 2022-03-28 12:13 | - | |
| Laptop refuses to detect hard drive with CD drive in!/ | 2022-03-28 12:13 | - | |
| Laptop screen faded, washed out, ghosting & unresponsive (Acer Aspire 5315-2326)/ | 2022-03-28 12:13 | - | |
| Laptop screen problem. Help Please/ | 2022-03-28 12:13 | - | |
| Laptop shutting down unexpectedly below 50% discharge/ | 2022-03-28 12:13 | - | |
| Laptop shutting off after post/ | 2022-03-28 12:13 | - | |
| Laptop stops charging after a few seconds/ | 2022-03-28 12:13 | - | |
| Laptop stuck on a recovery page/ | 2022-03-28 12:13 | - | |
| Laptop suddenly not working/ | 2022-03-28 12:13 | - | |
| Laptop turning off/ | 2022-03-28 12:13 | - | |
| Laptop unresponsive (Acer Travelmate 2310)/ | 2022-03-28 12:13 | - | |
| Laptop wont power up/ | 2022-03-28 12:13 | - | |
| Larger battery (6935 5920 type)/ | 2022-03-28 12:13 | - | |
| Last BIOS for Aspire 5100 (5102WLMi)/ | 2022-03-28 12:13 | - | |
| Last decision, 4002WLMi or 1681WLMi/ | 2022-03-28 12:13 | - | |
| Late 2013 model Acer Travelmate p645 Thread (Haswell CPU, 14 , FHD IPS Touchscreen, 3.5 lbs, AMD 8750m GPU)/ | 2022-03-28 12:13 | - | |
| Latency Issues with Broadcom Drivers (Aspire 5750G)/ | 2022-03-28 12:13 | - | |
| Latest Acer Service Manuals/ | 2022-03-28 12:13 | - | |
| Latest BIOS update v3517 will not work with/ | 2022-03-28 12:13 | - | |
| Latest Nvidia drivers on Aspire 8920/ | 2022-03-28 12:13 | - | |
| Latest Synaptics driver modded for Acer MediaTouch/ | 2022-03-28 12:13 | - | |
| Latest word on TM8204 + ezDock/ | 2022-03-28 12:13 | - | |
| Launch Manager Missing Options/ | 2022-03-28 12:13 | - | |
| Launch Manager Not Working/ | 2022-03-28 12:13 | - | |
| Launch Manager and Google Chrome/ | 2022-03-28 12:13 | - | |
| Launch Manager pop up issue/ | 2022-03-28 12:13 | - | |
| Launch Manager soft. prob in aspire 1681 FWLMi/ | 2022-03-28 12:13 | - | |
| Lawsuit against Acer's Aspire 2000 series/ | 2022-03-28 12:13 | - | |
| Lean, mean geek machine/ | 2022-03-28 12:13 | - | |
| Leaving power on/ | 2022-03-28 12:13 | - | |
| Left-click button shaken loose out of place - really annoying/ | 2022-03-28 12:13 | - | |
| Left 4 Dead lag on Acer 6920/ | 2022-03-28 12:13 | - | |
| Left Hand Storage expansion slot not working and DM Problem/ | 2022-03-28 12:13 | - | |
| Left click quit,and touch pad drags a blue box/ | 2022-03-28 12:13 | - | |
| Left hand corner on 4101LMi clicking/ | 2022-03-28 12:13 | - | |
| Lenovo graphic card in Acer/ | 2022-03-28 12:13 | - | |
| Let's try this again, Anyone successful upgrading 5672 to xp pro sp2/ | 2022-03-28 12:13 | - | |
| Level 2 cache..1MB, 2MB/ | 2022-03-28 12:13 | - | |
| Li-ion Battery life/ | 2022-03-28 12:13 | - | |
| License Install question options reinstalling Vista on Vista from upgrade disc/ | 2022-03-28 12:13 | - | |
| Lifting ground on power supply/ | 2022-03-28 12:13 | - | |
| Light Leakage - problems with Aspire 5024 screen/ | 2022-03-28 12:13 | - | |
| Light Leakage for the 5672/ | 2022-03-28 12:13 | - | |
| Light on when Touchpad is off/ | 2022-03-28 12:13 | - | |
| Like Nitro 5 Spin, like Spin 5/ | 2022-03-28 12:13 | - | |
| Like new Acer Travelmate 4501 WLMi on Ebay/ | 2022-03-28 12:13 | - | |
| Line on Screen ACER 5100/ | 2022-03-28 12:13 | - | |
| Line out is broken on my Acer Extensa/ | 2022-03-28 12:13 | - | |
| Link for registering 1yr warranty for new acer laptop/ | 2022-03-28 12:13 | - | |
| Link to Acer best of best/ | 2022-03-28 12:13 | - | |
| Linux Acer Aspire 5315-2122/ | 2022-03-28 12:13 | - | |
| LinuxBIOS/ | 2022-03-28 12:13 | - | |
| Linux distribution/ | 2022-03-28 12:13 | - | |
| Linux on 5920/ | 2022-03-28 12:13 | - | |
| Linux on Acer 1410, 1810TZ and 1810T/ | 2022-03-28 12:13 | - | |
| Linux on Ferrari 4005/ | 2022-03-28 12:13 | - | |
| Linux on TravelMate 3002/ | 2022-03-28 12:13 | - | |
| Linux on VN7-592g/ | 2022-03-28 12:13 | - | |
| Linux to XP conversion, pls help/ | 2022-03-28 12:13 | - | |
| List of x1600 Acer laptop model numbers/ | 2022-03-28 12:13 | - | |
| Liteon DVD Drive SSM-8515S Firmware Updated - Thanks!/ | 2022-03-28 12:13 | - | |
| Lithium Ion Battery Care/ | 2022-03-28 12:13 | - | |
| Little disappointed I must admit/ | 2022-03-28 12:13 | - | |
| Little question about temp/ | 2022-03-28 12:13 | - | |
| Load XP on Aspire 5050-3785/ | 2022-03-28 12:13 | - | |
| Locating CMOS battery/ | 2022-03-28 12:13 | - | |
| Location of wifi antenna on aspire 5100/ | 2022-03-28 12:13 | - | |
| Lock laptop/ | 2022-03-28 12:13 | - | |
| Logitech or Bison/ | 2022-03-28 12:13 | - | |
| Long-Term Use Acer3680/ | 2022-03-28 12:13 | - | |
| Long startup time to POST on Aspire 5670 Series/ | 2022-03-28 12:13 | - | |
| Looking For Acer T'mate C300 Tech. Advice/ | 2022-03-28 12:13 | - | |
| Looking To Upgrade My Acer Aspire 6920G/ | 2022-03-28 12:13 | - | |
| Looking To upgrade graphics card/ | 2022-03-28 12:13 | - | |
| Looking after your battery/ | 2022-03-28 12:13 | - | |
| Looking at an 1810t w C2D; Virtualization enabled/ | 2022-03-28 12:13 | - | |
| Looking at getting a new HDD for my 6920G/ | 2022-03-28 12:13 | - | |
| Looking at the Acer Aspire E3-111 to replace an aging Dell XPS M1530/ | 2022-03-28 12:13 | - | |
| Looking at the Acer Ferrari 3200/ | 2022-03-28 12:13 | - | |
| Looking foe ENE Technoligies data sheet/ | 2022-03-28 12:13 | - | |
| Looking for 5520-5716 - XP 64-Bit Drivers/ | 2022-03-28 12:13 | - | |
| Looking for 9300-3642 disasembly instructions/ | 2022-03-28 12:13 | - | |
| Looking for ACPI Module (NHC) for ACER 5920G/ | 2022-03-28 12:13 | - | |
| Looking for Acer 5738G BIOS 1.16 (fast response please)/ | 2022-03-28 12:13 | - | |
| Looking for Acer 6935 6930G service manual!/ | 2022-03-28 12:13 | - | |
| Looking for Acer Aspire V3-372-57CW/ | 2022-03-28 12:13 | - | |
| Looking for Aspire 5000 service manual/ | 2022-03-28 12:13 | - | |
| Looking for Fan Control Utility for Acer V5-171/ | 2022-03-28 12:13 | - | |
| Looking for Genuine Acer battery/ | 2022-03-28 12:13 | - | |
| Looking for Information- AS5552/ | 2022-03-28 12:13 | - | |
| Looking for New Acer Notebook/ | 2022-03-28 12:13 | - | |
| Looking for Travelmate 6592 service manual/ | 2022-03-28 12:13 | - | |
| Looking for a 950GMA 1585 Vbios/ | 2022-03-28 12:13 | - | |
| Looking for a TV Tuner/ | 2022-03-28 12:13 | - | |
| Looking for acer parts, willing to pay/ | 2022-03-28 12:13 | - | |
| Looking for a full 4MB BIOS DUMP for Aspire 4820tg or 5820TG/ | 2022-03-28 12:13 | - | |
| Looking for a laptop, possibly a Acer/ | 2022-03-28 12:13 | - | |
| Looking for a laptop/ | 2022-03-28 12:13 | - | |
| Looking for an Acer Optiarc Firmware/ | 2022-03-28 12:13 | - | |
| Looking for an high performance acer/ | 2022-03-28 12:13 | - | |
| Looking for an old Acer heatsink/ | 2022-03-28 12:13 | - | |
| Looking for drivers/ | 2022-03-28 12:13 | - | |
| Looking for eNet Management v3/ | 2022-03-28 12:13 | - | |
| Looking for feedback from 8104 owners/ | 2022-03-28 12:13 | - | |
| Looking for info on this machine/ | 2022-03-28 12:13 | - | |
| Looking for internal schematics layout for TM 6292/ | 2022-03-28 12:13 | - | |
| Looking for replacement for Aspire 2003/ | 2022-03-28 12:13 | - | |
| Looking for replacement top cover for Aspire 9300/ | 2022-03-28 12:13 | - | |
| Looking for someone with a base factory install of MCE 2k5/ | 2022-03-28 12:13 | - | |
| Looking for the latest versions of this Acer software/ | 2022-03-28 12:13 | - | |
| Looking for v3 571 owners/ | 2022-03-28 12:13 | - | |
| Looking for xp version of acer vga driver/ | 2022-03-28 12:13 | - | |
| Looking into Timelinex (1830T) 11.6 vs Dellm101z/ | 2022-03-28 12:13 | - | |
| Looking to buy/ | 2022-03-28 12:13 | - | |
| Looking to buy an Acer/ | 2022-03-28 12:13 | - | |
| Looking to possibly get an Acer Aspire 5920-6959, need advice/ | 2022-03-28 12:13 | - | |
| Looking to upgrade acer aspire 5542g cpu, tear down help/ | 2022-03-28 12:13 | - | |
| Looks like 8600m GTX and 8700m GTX are on the way/ | 2022-03-28 12:13 | - | |
| Looks like the 5745 is getting a Fermi/ | 2022-03-28 12:13 | - | |
| Loose keys on an Acer Aspire 5940G/ | 2022-03-28 12:13 | - | |
| Losing wireless connection-Acer 5100/ | 2022-03-28 12:13 | - | |
| Lost Acer E Setting program on Acer 5102/ | 2022-03-28 12:13 | - | |
| Lost Acer Recovery Partition/ | 2022-03-28 12:13 | - | |
| Lost DVD Player/ | 2022-03-28 12:13 | - | |
| Lost IMD-0 drive/ | 2022-03-28 12:13 | - | |
| Lost connection/ | 2022-03-28 12:13 | - | |
| Lost data Aspire 1692WLMi/ | 2022-03-28 12:13 | - | |
| Lost my DVD NTI software/ | 2022-03-28 12:13 | - | |
| Lost power during System Restore now won't load to login screen! Please help, very important/ | 2022-03-28 12:13 | - | |
| Lost system password - Acer TravelMate 213TX/ | 2022-03-28 12:13 | - | |
| Lost the Acer Aspire TimelineX HDD mount -(/ | 2022-03-28 12:13 | - | |
| Loud Interference when close to the laptop (5570)/ | 2022-03-28 12:13 | - | |
| Loud Sound from my Acer 5672WLMi/ | 2022-03-28 12:13 | - | |
| Loved Acer 8943G Freezes above 25% - Any Advice/ | 2022-03-28 12:13 | - | |
| Love my 8930G, but any browsers are giving me problems/ | 2022-03-28 12:13 | - | |
| Love my Acer 1711(mini review)/ | 2022-03-28 12:13 | - | |
| Low DVD sound...other solutions/ | 2022-03-28 12:13 | - | |
| Low battery shutdown. Why is it classed Disruptive/ | 2022-03-28 12:13 | - | |
| Lower screen resolutions on TM 8204/ | 2022-03-28 12:13 | - | |
| Low fps in games - 6930G/ | 2022-03-28 12:13 | - | |
| Low memory on Aspire 5920/ | 2022-03-28 12:13 | - | |
| Low passmark on aspire 5003wlmi/ | 2022-03-28 12:13 | - | |
| Lubricate lid latch somehow/ | 2022-03-28 12:13 | - | |
| M-Systems DiskOnChip 2000/ | 2022-03-28 12:13 | - | |
| M5-481pt or V5-481p or V5-582p/ | 2022-03-28 12:13 | - | |
| M5-581T-6405 owners...Need input/ | 2022-03-28 12:13 | - | |
| MAJOR NVIDIA 9500m overclock/ | 2022-03-28 12:13 | - | |
| MBR issue......need help ASAP/ | 2022-03-28 12:13 | - | |
| MCE on Ferrari/ | 2022-03-28 12:13 | - | |
| MFD were is it/ | 2022-03-28 12:13 | - | |
| MS Pro Card Stuck in Card Reader! - HELP!/ | 2022-03-28 12:14 | - | |
| MXM II 9600M GT questions/ | 2022-03-28 12:14 | - | |
| MY 5920G won't boot up says a Windows Error Recover problem/ | 2022-03-28 12:14 | - | |
| MY acer 5315 experiance/ | 2022-03-28 12:14 | - | |
| Ma a SR8175 G025 Firmware update/ | 2022-03-28 12:13 | - | |
| MacBook Pro and Acer 5672WLMi Similarities/ | 2022-03-28 12:13 | - | |
| Mac OS X on 5742/ | 2022-03-28 12:13 | - | |
| Macbook Ram Work/ | 2022-03-28 12:13 | - | |
| Mac vs 5100/ | 2022-03-28 12:13 | - | |
| MagSafe for Acer/ | 2022-03-28 12:13 | - | |
| Maintaining aspect ration on 2012WLMi/ | 2022-03-28 12:13 | - | |
| Major Aspire 9814 problem/ | 2022-03-28 12:13 | - | |
| Major Flaw With Acer Notebooks/ | 2022-03-28 12:13 | - | |
| Major Problem - AC Power not working/ | 2022-03-28 12:13 | - | |
| Major Problems with my Aspire 5920G/ | 2022-03-28 12:13 | - | |
| Major Software Issue/ | 2022-03-28 12:13 | - | |
| Major differences between the Aspire 5672 and Aspire 9110/ | 2022-03-28 12:13 | - | |
| Major overheat problem, defective laptop/ | 2022-03-28 12:13 | - | |
| Make your own Napp CD and Restore Disk to to disk from you Restore Cd/ | 2022-03-28 12:13 | - | |
| Making A network setup CD/ | 2022-03-28 12:13 | - | |
| Making Recovery Disk -- Problems/ | 2022-03-28 12:13 | - | |
| Making a Recovery backup CD this easy/ | 2022-03-28 12:13 | - | |
| Making an Acer Recovery Partition/ | 2022-03-28 12:13 | - | |
| Making an external LCD monitor my primary/ | 2022-03-28 12:13 | - | |
| Manufacture Waranty/ | 2022-03-28 12:13 | - | |
| MapleStory Blue Screen of Death/ | 2022-03-28 12:13 | - | |
| Mass Storage Controller/ | 2022-03-28 12:13 | - | |
| Matching memory/ | 2022-03-28 12:13 | - | |
| Matshita UJ-845D Firmware/ | 2022-03-28 12:13 | - | |
| Matte 2 Glossy travelmate 2300/ | 2022-03-28 12:13 | - | |
| Matte Keyboard for 3810T/ | 2022-03-28 12:13 | - | |
| Max Mhz RAM compatible in an Acer 5742G/ | 2022-03-28 12:13 | - | |
| Max external monitor screen res. on Aspire 5022WLMi/ | 2022-03-28 12:13 | - | |
| Max external resolution 5672 (x1600)/ | 2022-03-28 12:13 | - | |
| Maximum HDD that can be placed in 5920G/ | 2022-03-28 12:13 | - | |
| Maximum RAM in upgraded Aspire 5315/ | 2022-03-28 12:13 | - | |
| Maximum output resolution on an Aspire 5100/ | 2022-03-28 12:13 | - | |
| Maximum ram size for 5672 (4gb possible )/ | 2022-03-28 12:13 | - | |
| Maximun memory for Acer 5672/ | 2022-03-28 12:13 | - | |
| Max memory of TimelineX 1830T/ | 2022-03-28 12:13 | - | |
| Maybe an alternative source of 6770Ms/ | 2022-03-28 12:13 | - | |
| May be it is time to buy new laptop/ | 2022-03-28 12:13 | - | |
| May have broken my Acer Aspire 5050 - help badly needed!/ | 2022-03-28 12:13 | - | |
| Mbrwrwin error/ | 2022-03-28 12:13 | - | |
| Media Control panel thingie stopped working(Gemstone Blue)/ | 2022-03-28 12:13 | - | |
| MediaTouch- reassign remote keyboard keys/ | 2022-03-28 12:13 | - | |
| Media keys in 5920/ | 2022-03-28 12:13 | - | |
| Memorize touchpad state on off after reboot/ | 2022-03-28 12:13 | - | |
| Memory 5610-2013/ | 2022-03-28 12:13 | - | |
| Memory Card Slot Problem/ | 2022-03-28 12:13 | - | |
| Memory Compartment/ | 2022-03-28 12:13 | - | |
| Memory Compatibility/ | 2022-03-28 12:13 | - | |
| Memory Issues on TM8204/ | 2022-03-28 12:13 | - | |
| Memory Reccomendation for Acer TimelineX. G.Skill vs Corsair vs Samsung Vs Kingston/ | 2022-03-28 12:13 | - | |
| Memory Retaining Clips -- BROKEN!/ | 2022-03-28 12:13 | - | |
| Memory Slot Aspire 7110/ | 2022-03-28 12:13 | - | |
| Memory Stick Pro in card reader/ | 2022-03-28 12:13 | - | |
| Memory Upgrade Question/ | 2022-03-28 12:13 | - | |
| Memory Upgrade Questions/ | 2022-03-28 12:13 | - | |
| Memory card reader/ | 2022-03-28 12:13 | - | |
| Memory errors/ | 2022-03-28 12:13 | - | |
| Memory for Acer Travelmate 2303LCI/ | 2022-03-28 12:13 | - | |
| Memory for an Aspire 5672, (533 or 667)/ | 2022-03-28 12:13 | - | |
| Memory increase worthwhile/ | 2022-03-28 12:13 | - | |
| Memory install - Aspire 5515/ | 2022-03-28 12:13 | - | |
| Memory leaks in aspire 9410/ | 2022-03-28 12:13 | - | |
| Memory problems/ | 2022-03-28 12:13 | - | |
| Memory questions on my Travelmate 4102WLMi/ | 2022-03-28 12:13 | - | |
| Memory replacement/ | 2022-03-28 12:13 | - | |
| Memory upgrade for Acer Aspire 2025/ | 2022-03-28 12:13 | - | |
| Memory upgrade for Extensa 4220/ | 2022-03-28 12:13 | - | |
| Memory upgrade for Travelmate 5623WSMi/ | 2022-03-28 12:13 | - | |
| Memory upgrade issue - How to open panel/ | 2022-03-28 12:13 | - | |
| Memory upgrade laptop (Acer 1353xc)/ | 2022-03-28 12:13 | - | |
| Memory upgrade surprise/ | 2022-03-28 12:13 | - | |
| Menu bar button is highlighted and pressed by itself!/ | 2022-03-28 12:13 | - | |
| Merge two partions/ | 2022-03-28 12:13 | - | |
| Merry Christmas !! To the unofficial ACER support Group/ | 2022-03-28 12:13 | - | |
| Mic issue/ | 2022-03-28 12:13 | - | |
| Microcenter.com and the 4820TG/ | 2022-03-28 12:13 | - | |
| Microcode Update/ | 2022-03-28 12:13 | - | |
| Microphone cable update - great service/ | 2022-03-28 12:13 | - | |
| Microphone switched of/ | 2022-03-28 12:13 | - | |
| Microsoft Got Hacked!!!/ | 2022-03-28 12:13 | - | |
| Microsoft Office Pro.MSI error/ | 2022-03-28 12:13 | - | |
| Microsoft works not working correctly/ | 2022-03-28 12:13 | - | |
| Minecraft on 3820TG - Does it work for you/ | 2022-03-28 12:13 | - | |
| Mini-PCI card upgradable in 800 series/ | 2022-03-28 12:13 | - | |
| Mini PCI Express on 1810T-8638/ | 2022-03-28 12:13 | - | |
| Mini PCIe HD decoder + Blu-ray + 5810TZ Timeline = successful mod/ | 2022-03-28 12:13 | - | |
| Mini pci/ | 2022-03-28 12:13 | - | |
| Minor- 5672 Function key speed and screen shutoff/ | 2022-03-28 12:13 | - | |
| Minor Issues After Upgrade To Windows 7/ | 2022-03-28 12:13 | - | |
| Minor problem with a driver/ | 2022-03-28 12:13 | - | |
| Missing Ram on 8930/ | 2022-03-28 12:13 | - | |
| Missing Screen Symbols/ | 2022-03-28 12:13 | - | |
| Missing brightness icon Acer launch manager/ | 2022-03-28 12:13 | - | |
| Missing eLock from Circuit City model 5102WLMi/ | 2022-03-28 12:13 | - | |
| Missing keys fixed with Omega Drivers/ | 2022-03-28 12:13 | - | |
| Missing text on buttons dialogue boxes - help!/ | 2022-03-28 12:13 | - | |
| Misterious sound issues repaired, Aspire 7520/ | 2022-03-28 12:13 | - | |
| Mobile Intel Graphics Media Accelerator x3100 and Warcraft 3/ | 2022-03-28 12:13 | - | |
| Mobililty Radeon X1400 drivers for Vista/ | 2022-03-28 12:13 | - | |
| Mobility Radeon 9700 TV-Out problem/ | 2022-03-28 12:13 | - | |
| Modded bios for Acer v5-571G/ | 2022-03-28 12:13 | - | |
| Modded bios for acer 3690 help/ | 2022-03-28 12:13 | - | |
| Model Pa-1650-02 Acer Aspire 610 Ac Adapter Needed/ | 2022-03-28 12:13 | - | |
| Models with 5400 rpm HD's/ | 2022-03-28 12:13 | - | |
| Modem - New dial up connection (WinXP)/ | 2022-03-28 12:13 | - | |
| Modem Issue TravelMate 4202WLMi/ | 2022-03-28 12:13 | - | |
| Modem Problem on 5672/ | 2022-03-28 12:13 | - | |
| Modem Problem on Aspire/ | 2022-03-28 12:13 | - | |
| Modem and Audio Not Dectected. When It was working before shut down...HELP!/ | 2022-03-28 12:13 | - | |
| Modem on High Definition Audio Bus-Please Help/ | 2022-03-28 12:13 | - | |
| Modem problems after reinstall/ | 2022-03-28 12:13 | - | |
| Modifications to Extensa 5620/ | 2022-03-28 12:13 | - | |
| Modified Bios for Acer Timeline 3810 & Travelmate 8371 (Lots of changes Improvements)/ | 2022-03-28 12:13 | - | |
| Modifying Aspire Timeline ShortCut Keys/ | 2022-03-28 12:13 | - | |
| Modifying Contrast and Brightness How Do I Do It/ | 2022-03-28 12:13 | - | |
| Modifying multimedia shortcut button target on aspire 5920g/ | 2022-03-28 12:13 | - | |
| Mods Overclock Acer 3810TZ/ | 2022-03-28 12:13 | - | |
| Monitor Cracked Need Replacing/ | 2022-03-28 12:13 | - | |
| Monitor Drivers/ | 2022-03-28 12:13 | - | |
| Monitor problems with acer timeline 3810T/ | 2022-03-28 12:13 | - | |
| Monitor question/ | 2022-03-28 12:13 | - | |
| Mono Sound/ | 2022-03-28 12:13 | - | |
| More Acer Ferrari 3200 Questions/ | 2022-03-28 12:13 | - | |
| More Acer Lcds tend to malfunction/ | 2022-03-28 12:13 | - | |
| More Acer critical information/ | 2022-03-28 12:13 | - | |
| More Problems/ | 2022-03-28 12:13 | - | |
| More QSI dvd-writer problems/ | 2022-03-28 12:13 | - | |
| More RAM than 4GB in Aspire 5517 - Possible/ | 2022-03-28 12:13 | - | |
| More TM8204 Fan Problems/ | 2022-03-28 12:13 | - | |
| More info on 7750G-2634G1TM/ | 2022-03-28 12:13 | - | |
| Morrowind - Acer Aspire 5315/ | 2022-03-28 12:13 | - | |
| Most popular upgrade for the 8920G/ | 2022-03-28 12:13 | - | |
| Motherboard/ | 2022-03-28 12:13 | - | |
| Motherboard Drivers/ | 2022-03-28 12:13 | - | |
| Motherboard ICL50 inside of an aspire 5100/ | 2022-03-28 12:14 | - | |
| Motherboard compatibility/ | 2022-03-28 12:13 | - | |
| Motherboard part numbers does anyone know/ | 2022-03-28 12:14 | - | |
| Motherboard reset switch/ | 2022-03-28 12:14 | - | |
| Mother board temp and CPU clock question/ | 2022-03-28 12:13 | - | |
| Mouse Keyboard sluggish/ | 2022-03-28 12:14 | - | |
| Mouse Pad/ | 2022-03-28 12:14 | - | |
| Mouse Zoom in Explorer/ | 2022-03-28 12:14 | - | |
| Mouse blinking problem/ | 2022-03-28 12:14 | - | |
| Mouse issue/ | 2022-03-28 12:14 | - | |
| Mouse lag/ | 2022-03-28 12:14 | - | |
| Mousepad/ | 2022-03-28 12:14 | - | |
| Mouse pad not working on Acer Aspire 5515/ | 2022-03-28 12:14 | - | |
| Mouse touchpad pointer stopped working on my Aspire 5630/ | 2022-03-28 12:14 | - | |
| Moving around RAM from two machines/ | 2022-03-28 12:14 | - | |
| Moving or deleting partion partition/ | 2022-03-28 12:14 | - | |
| Moving to XP - Need drivers!/ | 2022-03-28 12:14 | - | |
| Msata to M.2 adapter in Predator 17 G9-793-76/ | 2022-03-28 12:14 | - | |
| Much difference between 6920 and 6930/ | 2022-03-28 12:14 | - | |
| MultiBooting, EasyBCD and Recovery Partition/ | 2022-03-28 12:14 | - | |
| Multimedia Buttons/ | 2022-03-28 12:14 | - | |
| Multimedia Keys.. HELP!/ | 2022-03-28 12:14 | - | |
| Multimedia Touchpad on 8943G 8950G/ | 2022-03-28 12:14 | - | |
| Multimedia key problems in Vista/ | 2022-03-28 12:14 | - | |
| Multimedia without turning on laptop/ | 2022-03-28 12:14 | - | |
| Multiple Acer Aspire 5672 Questions/ | 2022-03-28 12:14 | - | |
| Multiple Monitors with ati 5650/ | 2022-03-28 12:14 | - | |
| Multiple errors on 1 month old Aspire 5315/ | 2022-03-28 12:14 | - | |
| Multiple issues with Aspire 5102/ | 2022-03-28 12:14 | - | |
| Multipule wee acer Aspire 3680 problems/ | 2022-03-28 12:14 | - | |
| Mushy flex in 1810tz variant keyboards/ | 2022-03-28 12:14 | - | |
| My ' FN ' functions buttons doesn't work/ | 2022-03-28 12:14 | - | |
| My 5315 Died -(/ | 2022-03-28 12:14 | - | |
| My 5610Z was not set up correctly, help me set it up/ | 2022-03-28 12:14 | - | |
| My 5920G HDD temp suddenly getting hot!/ | 2022-03-28 12:14 | - | |
| My 5920G is dead!/ | 2022-03-28 12:14 | - | |
| My 6920 and Win7 RAM/ | 2022-03-28 12:14 | - | |
| My 6920g and WoW/ | 2022-03-28 12:14 | - | |
| My 7738G thinks it's an 8935G!/ | 2022-03-28 12:14 | - | |
| My 8204 for Sale on eBay/ | 2022-03-28 12:14 | - | |
| My 8204 wont connect to the internet/ | 2022-03-28 12:14 | - | |
| My 8930g won't charge a new battery/ | 2022-03-28 12:14 | - | |
| My ACER 1410 HDD just died! What can i do/ | 2022-03-28 12:14 | - | |
| My ACER 4501 stutter when playing DVD/ | 2022-03-28 12:14 | - | |
| My Acer's DVD drive/ | 2022-03-28 12:14 | - | |
| My Acer 2450 does not go to sleep when I close the lid/ | 2022-03-28 12:14 | - | |
| My Acer 3680 Memory Upgrade experience/ | 2022-03-28 12:14 | - | |
| My Acer 3820T Review/ | 2022-03-28 12:14 | - | |
| My Acer 5102 finally breaks down/ | 2022-03-28 12:14 | - | |
| My Acer 5672 died on me after 2 years/ | 2022-03-28 12:14 | - | |
| My Acer 5920G won't charge/ | 2022-03-28 12:14 | - | |
| My Acer 6920g battery life goes from 100% to 4% in a matter of minutes/ | 2022-03-28 12:14 | - | |
| My Acer 6920g randomly died on me/ | 2022-03-28 12:14 | - | |
| My Acer 9300 Eats Screws For Breakfast/ | 2022-03-28 12:14 | - | |
| My Acer Apire 3620 won't read 4gb SD cards/ | 2022-03-28 12:14 | - | |
| My Acer Aspire 3004 WLCi's fan is making loud noises/ | 2022-03-28 12:14 | - | |
| My Acer Aspire 5315/ | 2022-03-28 12:14 | - | |
| My Acer Aspire 5600's 100GB IDE drive just died. Please help me find a reliable replacement for cheap, I'm broke after Christmas!/ | 2022-03-28 12:14 | - | |
| My Acer Aspire 5715Z doesn't recognize my optical drive anymore/ | 2022-03-28 12:14 | - | |
| My Acer Aspire 5920G is heating up after installing Windows 7 x64/ | 2022-03-28 12:14 | - | |
| My Acer Aspire 5920 died suddenly/ | 2022-03-28 12:14 | - | |
| My Acer Aspire 7745G goes in to sleepmode with win 10/ | 2022-03-28 12:14 | - | |
| My Acer Aspire 9410Z won't recognize CD-R disc/ | 2022-03-28 12:14 | - | |
| My Acer Aspire One AO751H-1948 (ZA3) unbox pics -)/ | 2022-03-28 12:14 | - | |
| My Acer Extensa 5620z webcam wont work/ | 2022-03-28 12:14 | - | |
| My Acer Laptop Screen Is Black!/ | 2022-03-28 12:14 | - | |
| My Acer Laptop is Turning on but Display is not coming/ | 2022-03-28 12:14 | - | |
| My Acer Nightmare/ | 2022-03-28 12:14 | - | |
| My Acer Tm4404 suddenly stuttering and slugish/ | 2022-03-28 12:14 | - | |
| My Acer TravelMate 5530 does not boot (even no BIOS)/ | 2022-03-28 12:14 | - | |
| My Acer aspire 5685 WLMi power off by itself ! Help PLZ/ | 2022-03-28 12:14 | - | |
| My Acer experience/ | 2022-03-28 12:14 | - | |
| My Acer laptop apparantly can't run Vista/ | 2022-03-28 12:14 | - | |
| My Acer notebook/ | 2022-03-28 12:14 | - | |
| My Aspire 1802WSMi, system hang up and nothing to display/ | 2022-03-28 12:14 | - | |
| My Aspire 2012WLMi performance based mini review!/ | 2022-03-28 12:14 | - | |
| My Aspire 3100 went bad/ | 2022-03-28 12:14 | - | |
| My Aspire 4810T won't restart/ | 2022-03-28 12:14 | - | |
| My Aspire 4935G assumes that external speakers are headphones/ | 2022-03-28 12:14 | - | |
| My Aspire 5000 keeps freezing in games/ | 2022-03-28 12:14 | - | |
| My Aspire 5920G hinge cracked/ | 2022-03-28 12:14 | - | |
| My Aspire 6930g Upgrade Adventure- Tutorials,How-tos,Softwares and much more!/ | 2022-03-28 12:14 | - | |
| My AspireOne!/ | 2022-03-28 12:14 | - | |
| My Aspire One's USB ports seem kind of loose/ | 2022-03-28 12:14 | - | |
| My Aspire One won't turn off!/ | 2022-03-28 12:14 | - | |
| My Aspire S7 stops responding for a few seconds once in a while, randomly/ | 2022-03-28 12:14 | - | |
| My BIOS doesn t provide VT setting in model Aspire 8930G/ | 2022-03-28 12:14 | - | |
| My BIOS is locked.. by default/ | 2022-03-28 12:14 | - | |
| My Bluetooth Places VISTA/ | 2022-03-28 12:14 | - | |
| My Brand New 6935G where is the 1080p/ | 2022-03-28 12:14 | - | |
| My Brand New 8204 and some issues/ | 2022-03-28 12:14 | - | |
| My CPU not showing the correct temperature/ | 2022-03-28 12:14 | - | |
| My Decision - Acer TravelMate TM4501WLMi/ | 2022-03-28 12:14 | - | |
| My First Acer Laptop/ | 2022-03-28 12:14 | - | |
| My First owned Laptop Acer 4810TZ & a small review/ | 2022-03-28 12:14 | - | |
| My Gemstone Blue... or how I got robbed/ | 2022-03-28 12:14 | - | |
| My Iconia W700's screen suddenly delaminated/ | 2022-03-28 12:14 | - | |
| My Love of acer notebooks/ | 2022-03-28 12:14 | - | |
| My Microphone Is Not Workin After Windows 7 Upgrade (acer Timeline 5810tz) Plz Help Me/ | 2022-03-28 12:14 | - | |
| My NEW 4501WLMI/ | 2022-03-28 12:14 | - | |
| My Netbook suddenly turned off/ | 2022-03-28 12:14 | - | |
| My New Acer 5580...a Surprise Right Out of the Box!/ | 2022-03-28 12:14 | - | |
| My New Aspire 9420 having Problems/ | 2022-03-28 12:14 | - | |
| My Next Internal Mod!/ | 2022-03-28 12:14 | - | |
| My Preliminary results with acer 5102 and Vista/ | 2022-03-28 12:14 | - | |
| My Travelmate 8204 Problems!!!!(HELP!)/ | 2022-03-28 12:14 | - | |
| My Travelmate is restarting after I pushed POWEROFF or HIBERNATE/ | 2022-03-28 12:14 | - | |
| My Wireless LAN symbol missing from task bar/ | 2022-03-28 12:14 | - | |
| My acer 3050 didn't come with a recovery CD/ | 2022-03-28 12:14 | - | |
| My acer 5000 series says 60 gb HD, but system info says/ | 2022-03-28 12:14 | - | |
| My acer Aspire 1410 doesn't turn off/ | 2022-03-28 12:14 | - | |
| My acer aspire 5732zg screen flashes when its on the internet. Please help!!!/ | 2022-03-28 12:14 | - | |
| My acer aspire 5755g webcam quality problem/ | 2022-03-28 12:14 | - | |
| My acer does not start/ | 2022-03-28 12:14 | - | |
| My apology. If any newbees feel I have offended them...post here/ | 2022-03-28 12:14 | - | |
| My aspire one laptop won't turn on after I took it apart. Still receives power. Helppp!/ | 2022-03-28 12:14 | - | |
| My aspire won't go into sleep mode anymore/ | 2022-03-28 12:14 | - | |
| My big laptop/ | 2022-03-28 12:14 | - | |
| My bluetooth is having some kind of problem please check/ | 2022-03-28 12:14 | - | |
| My computers performance is getting worse and worse/ | 2022-03-28 12:14 | - | |
| My dear 5920G laptop died - Bought a 6930G now/ | 2022-03-28 12:14 | - | |
| My eRecovery is a bit broken!/ | 2022-03-28 12:14 | - | |
| My fan seems to be contacting something within the case/ | 2022-03-28 12:14 | - | |
| My first e-support message to ACER/ | 2022-03-28 12:14 | - | |
| My laptop chasis is damaged !!!/ | 2022-03-28 12:14 | - | |
| My last hope goes to you guys/ | 2022-03-28 12:14 | - | |
| My late departed Acer 5634wmli/ | 2022-03-28 12:14 | - | |
| My new 5920G is bumming me out -(/ | 2022-03-28 12:14 | - | |
| My new Aspire 5742, what can i upgrade/ | 2022-03-28 12:14 | - | |
| My new TM8210/ | 2022-03-28 12:14 | - | |
| My new laptop display is squashed! And the HDMI output is warped!!/ | 2022-03-28 12:14 | - | |
| My notebook, an energy machine/ | 2022-03-28 12:14 | - | |
| My recovery DVD's won't work on new HD/ | 2022-03-28 12:14 | - | |
| My review of Acer 8204 and 8210/ | 2022-03-28 12:14 | - | |
| My screen buzzes when i type/ | 2022-03-28 12:14 | - | |
| My standby and hibernate button doesn't work most of the time/ | 2022-03-28 12:14 | - | |
| Mysterious hardware switch found inside my TimelineX 4830tg/ | 2022-03-28 12:14 | - | |
| Mystery Screen pixelation Please help!/ | 2022-03-28 12:14 | - | |
| Mystic ghost aspire 6530g/ | 2022-03-28 12:14 | - | |
| My temperatuers are good/ | 2022-03-28 12:14 | - | |
| My thoughts on Acer AS1410 (Comparison with Asus N10J)/ | 2022-03-28 12:14 | - | |
| My touchpad will not work. Help !/ | 2022-03-28 12:14 | - | |
| My trackpad died on me (8204)/ | 2022-03-28 12:14 | - | |
| My very sad 2310 travelmate/ | 2022-03-28 12:14 | - | |
| My wireless card would only get/ | 2022-03-28 12:14 | - | |
| My wireless seems to drop a bit much/ | 2022-03-28 12:14 | - | |
| NBR Acer forum - technical help success stories/ | 2022-03-28 12:14 | - | |
| NCIX 3820tg Help!/ | 2022-03-28 12:14 | - | |
| NCIX Grrrrr/ | 2022-03-28 12:14 | - | |
| NEED HELP PLEASE!! BSOD aspire 5672/ | 2022-03-28 12:14 | - | |
| NEED HElp whether I should buy Ferrari 4002 model/ | 2022-03-28 12:14 | - | |
| NEW 5670 Series BIOS 3234! WOW!!/ | 2022-03-28 12:14 | - | |
| NEW Laptop Replacement Under Acer Warranty/ | 2022-03-28 12:14 | - | |
| NEW MODEL 17'' INCH ACER/ | 2022-03-28 12:14 | - | |
| NEW Mobility Catalyst Drivers out! (Ver 7.1)/ | 2022-03-28 12:14 | - | |
| NEW Taiwan Aspire 5672 VS. US Aspire 5672/ | 2022-03-28 12:14 | - | |
| NHC ACPI files for TM8210/ | 2022-03-28 12:14 | - | |
| NHC ACPI module for Aspire 5562/ | 2022-03-28 12:14 | - | |
| NHC can't be used in Vista/ | 2022-03-28 12:14 | - | |
| NHC hard disk settings/ | 2022-03-28 12:14 | - | |
| NOW AVAILABLE for purchase - Acer Aspire TimelineU M3 released/ | 2022-03-28 12:14 | - | |
| NTFS - FERRARI -eek-/ | 2022-03-28 12:14 | - | |
| NTFS conversion cluster size question/ | 2022-03-28 12:14 | - | |
| NTFS issue/ | 2022-03-28 12:14 | - | |
| NTI Backup NOW! 4.7 problem/ | 2022-03-28 12:14 | - | |
| NTI CD DVD software for travelmate 4050/ | 2022-03-28 12:14 | - | |
| NT Kernel & system CPU problems with docking station in use/ | 2022-03-28 12:14 | - | |
| NTLDR is missing on my Acer Aspire One/ | 2022-03-28 12:14 | - | |
| NVIDIA geforce GT 120M 1GB on Acer 5920g/ | 2022-03-28 12:14 | - | |
| NVIDIA high definition output not connected/ | 2022-03-28 12:14 | - | |
| NVidia 8600M GT Issues (Acer 5920G)/ | 2022-03-28 12:14 | - | |
| Native resolution intermittently not available in external monitor/ | 2022-03-28 12:14 | - | |
| Near death experience, plus info for 5935g through to 5943g users/ | 2022-03-28 12:14 | - | |
| Need- Acer Arcade Deluxe/ | 2022-03-28 12:14 | - | |
| Need ACER 4741 service manual/ | 2022-03-28 12:14 | - | |
| Need Acer 5570z Recovery Disk/ | 2022-03-28 12:14 | - | |
| Need Acer 5735 vista drivers/ | 2022-03-28 12:14 | - | |
| Need Acer HELP!!/ | 2022-03-28 12:14 | - | |
| Need Acer laptop keyboard help Please HELP/ | 2022-03-28 12:14 | - | |
| Need Advice, Is my new Acer Overheated/ | 2022-03-28 12:14 | - | |
| Need Advice on Acer laptops/ | 2022-03-28 12:14 | - | |
| Need Aspire 9300 KB.ACF07.001 keyboard/ | 2022-03-28 12:14 | - | |
| Need Bios modded for Travelmate 8472G/ | 2022-03-28 12:14 | - | |
| Need CMOS Battery-Pls help-Urgent/ | 2022-03-28 12:14 | - | |
| Need Clarification About Acer Models/ | 2022-03-28 12:14 | - | |
| Need HD for Acer Travelmate 4000/ | 2022-03-28 12:14 | - | |
| Need HELP Wlan drivers not working/ | 2022-03-28 12:14 | - | |
| Need HELP with chosing the right notebook/ | 2022-03-28 12:14 | - | |
| Need Help!!! interrupted operation- insert recovery CD or other recovery media and reboot your PC/ | 2022-03-28 12:14 | - | |
| Need Help! Aspire 5672WLMi. Memory issue Vid memory Argh!/ | 2022-03-28 12:14 | - | |
| Need Help, clean install 5672/ | 2022-03-28 12:14 | - | |
| Need Help - acer aspire 6920 recovery/ | 2022-03-28 12:14 | - | |
| Need Help AMD Turion 64 Notebook/ | 2022-03-28 12:14 | - | |
| Need Help ASAP/ | 2022-03-28 12:14 | - | |
| Need Help Acer 6930 Shorts out/ | 2022-03-28 12:14 | - | |
| Need Help Choosing New Laptop/ | 2022-03-28 12:14 | - | |
| Need Help Please!/ | 2022-03-28 12:14 | - | |
| Need Help Please ! Amd Phenom S1 into a 5100 !/ | 2022-03-28 12:14 | - | |
| Need Help from Acer Aspire 5670 5672 Users (quik fix)/ | 2022-03-28 12:14 | - | |
| Need Help from Anyone who Owns 5920G/ | 2022-03-28 12:14 | - | |
| Need Help on Acer Aspire 5755g 5.1 surround sound/ | 2022-03-28 12:14 | - | |
| Need Help to Connect additional fan/ | 2022-03-28 12:14 | - | |
| Need Help with Acer/ | 2022-03-28 12:14 | - | |
| Need Help with Acer Aspire/ | 2022-03-28 12:14 | - | |
| Need Help with Aspire 5515 ATI Video Driver/ | 2022-03-28 12:14 | - | |
| Need Help with my Acer Aspire 1640/ | 2022-03-28 12:14 | - | |
| Need Info on core 2 duo(5672WLMi)/ | 2022-03-28 12:14 | - | |
| Need MBR and Partition Table of Aspire 9410/ | 2022-03-28 12:14 | - | |
| Need New 802.11g driver for Ferrari 3000/ | 2022-03-28 12:14 | - | |
| Need Opinions on Acer Aspire 1672/ | 2022-03-28 12:14 | - | |
| Need Original BIOS Acer 4741 (version 1.04)/ | 2022-03-28 12:14 | - | |
| Need Replacement Battery for Aspire One/ | 2022-03-28 12:14 | - | |
| Need Review - ACER Aspire AS9502WSMi/ | 2022-03-28 12:14 | - | |
| Need Some Help With Aspire v3-574g/ | 2022-03-28 12:14 | - | |
| Need Tv tuner driver for 5520/ | 2022-03-28 12:14 | - | |
| Need URGENT help please. Monitor select not working/ | 2022-03-28 12:14 | - | |
| Need Windows 7 drivers for Acer Aspire 3680/ | 2022-03-28 12:14 | - | |
| Need XP Driver for Acer Aspire 3680/ | 2022-03-28 12:14 | - | |
| Need Xp drivers/ | 2022-03-28 12:14 | - | |
| Need a BIOS-MOD for 8471G with insydeH2O Bios/ | 2022-03-28 12:14 | - | |
| Need a Mac HD 2400 XT VBIOS integrated into an Aspire 5710g. 3 Beeps 1 long 2 short/ | 2022-03-28 12:14 | - | |
| Need a New 8600m GT! Help/ | 2022-03-28 12:14 | - | |
| Need a Technical guide for Acer Ferrari/ | 2022-03-28 12:14 | - | |
| Need advice in Acer Helios 300/ | 2022-03-28 12:14 | - | |
| Need advice on which Aspire 8920/ | 2022-03-28 12:14 | - | |
| Need advice with 5720G/ | 2022-03-28 12:14 | - | |
| Need an Acer/ | 2022-03-28 12:14 | - | |
| Need a new sound card for Acer 5532/ | 2022-03-28 12:14 | - | |
| Need a quick link to the acer aspire 3002 battery upgrade/ | 2022-03-28 12:14 | - | |
| Need a quick notebook (Architecture Major)/ | 2022-03-28 12:14 | - | |
| Need backlight replaced. Experiences/ | 2022-03-28 12:14 | - | |
| Need battery/ | 2022-03-28 12:14 | - | |
| Need bios mod to enable VT Acer 5315/ | 2022-03-28 12:14 | - | |
| Need cheap Aspire One AC adapter... with L-shaped tip/ | 2022-03-28 12:14 | - | |
| Need cheese for a mouse trap for my 5920G!!/ | 2022-03-28 12:14 | - | |
| Need desperate help for Acer Travelmate 2410/ | 2022-03-28 12:14 | - | |
| Need driver for SD Card Reader Help/ | 2022-03-28 12:14 | - | |
| Need drivers for Aspire 3680/ | 2022-03-28 12:14 | - | |
| Need drivers for Windows XP/ | 2022-03-28 12:14 | - | |
| Need emergency help on buying a gaming laptop in canada/ | 2022-03-28 12:14 | - | |
| Need fan for Aspire 5100/ | 2022-03-28 12:14 | - | |
| Need fast advice re- running lower res's on 8104/ | 2022-03-28 12:14 | - | |
| Need for Updated Chipset Driver(s) for Acer 8943g corei5 x64/ | 2022-03-28 12:14 | - | |
| Need help! Disassemble Optical Drive off Acer Extensa 5420/ | 2022-03-28 12:14 | - | |
| Need help, Travelmate 2480 F5 + F5 Hot key not working/ | 2022-03-28 12:14 | - | |
| Need help, installed new ram. nearly crashed comp/ | 2022-03-28 12:14 | - | |
| Need help - Acer Aspire 5520G Upgrade to 9600MGT DDR3 512MB/ | 2022-03-28 12:14 | - | |
| Need help - Acer Aspire 5742 upgrade/ | 2022-03-28 12:14 | - | |
| Need help-acer click sound then stop/ | 2022-03-28 12:14 | - | |
| Need help - can't use removable storage/ | 2022-03-28 12:14 | - | |
| Need help About Centrino Buzz Sound( Urgent pls)/ | 2022-03-28 12:14 | - | |
| Need help Resetting everything to default/ | 2022-03-28 12:14 | - | |
| Need help about Acer 5920G/ | 2022-03-28 12:14 | - | |
| Need help adding memory to Aspire 3000/ | 2022-03-28 12:14 | - | |
| Need help black screen error message WIERD/ | 2022-03-28 12:14 | - | |
| Need help buzzing like sound coming out of cpu when tilting/ | 2022-03-28 12:14 | - | |
| Need help by real experts! - Brandnew Acer Aspire Timeline 1810TZ G3-Switch not working after formating/ | 2022-03-28 12:14 | - | |
| Need help choosing laptop/ | 2022-03-28 12:14 | - | |
| Need help connecting laptop to tv/ | 2022-03-28 12:14 | - | |
| Need help finding Acer 3050 SATA Driver for XP Install/ | 2022-03-28 12:14 | - | |
| Need help finding a part/ | 2022-03-28 12:14 | - | |
| Need help finding parts for Aspire 5740/ | 2022-03-28 12:14 | - | |
| Need help finding spare locks for Aspire 5738/ | 2022-03-28 12:14 | - | |
| Need help finding the right 3.5mm audio socket for laptop/ | 2022-03-28 12:14 | - | |
| Need help for downgrade from vista to xp for AS5570/ | 2022-03-28 12:14 | - | |
| Need help formatting acer 2920!!!!!!/ | 2022-03-28 12:14 | - | |
| Need help from owners of Aspire 1652/ | 2022-03-28 12:14 | - | |
| Need help from the EXPERTS..!!/ | 2022-03-28 12:14 | - | |
| Need help getting my dongle to work with acer aspire z83/ | 2022-03-28 12:14 | - | |
| Need help hopfully a driver issue 6920g Via HDMI/ | 2022-03-28 12:14 | - | |
| Need help identify what laptop this one is called here/ | 2022-03-28 12:14 | - | |
| Need help in saving a hard drive/ | 2022-03-28 12:14 | - | |
| Need help on How to open Acer Aspire 5100 to check the mainboard/ | 2022-03-28 12:14 | - | |
| Need help on a Acer Aspire 6930-6809. Need schematic of motherboard so I can replace burned part/ | 2022-03-28 12:14 | - | |
| Need help on deciding which Acer Aspire 1692 spec to go for/ | 2022-03-28 12:14 | - | |
| Need help on overclock laptop monitor/ | 2022-03-28 12:14 | - | |
| Need help on sound issues/ | 2022-03-28 12:14 | - | |
| Need help please with the Orbicam on my Aspire 5112wlmi/ | 2022-03-28 12:14 | - | |
| Need help plz for acer aspire 5733/ | 2022-03-28 12:14 | - | |
| Need help re-creating MBR and finding rtmbr.bin/ | 2022-03-28 12:14 | - | |
| Need help recovering data from a SSD drive coming from an acer aspire one/ | 2022-03-28 12:14 | - | |
| Need help regarding upgrading RAM - Acer aspire 6930/ | 2022-03-28 12:14 | - | |
| Need help regarding wi fi driver for Acer Aspire 5738 with Windows 7 insttalled/ | 2022-03-28 12:14 | - | |
| Need help replacing Vista with XP on TM2480-2779/ | 2022-03-28 12:14 | - | |
| Need help to figure out why applications are struggling/ | 2022-03-28 12:14 | - | |
| Need help to open an Aspire 9302WSMI/ | 2022-03-28 12:14 | - | |
| Need help to re-install Windows on Aspire laptop/ | 2022-03-28 12:14 | - | |
| Need help to recover my new aspire g7700/ | 2022-03-28 12:14 | - | |
| Need help undervolting the 5021/ | 2022-03-28 12:14 | - | |
| Need help updating 8920G bios/ | 2022-03-28 12:14 | - | |
| Need help upgrading Aspire 4720G/ | 2022-03-28 12:14 | - | |
| Need help upgrading CPU in Aspire 6920G/ | 2022-03-28 12:14 | - | |
| Need help upgrading memory to 4gb on 5610/ | 2022-03-28 12:14 | - | |
| Need help upgrading to Blu-ray drive/ | 2022-03-28 12:14 | - | |
| Need help with Acer Aspire 5100 series laptop/ | 2022-03-28 12:14 | - | |
| Need help with Acer Aspire 5920G/ | 2022-03-28 12:14 | - | |
| Need help with Acer TM 291 Lci/ | 2022-03-28 12:14 | - | |
| Need help with Acer erecovery management on Aspire One D255 netbook!/ | 2022-03-28 12:14 | - | |
| Need help with Aspire 6920G -(/ | 2022-03-28 12:14 | - | |
| Need help with Aspire PLEASE!!/ | 2022-03-28 12:14 | - | |
| Need help with Audio port fix - Aspire 5315 series/ | 2022-03-28 12:14 | - | |
| Need help with acer extensa 5220/ | 2022-03-28 12:14 | - | |
| Need help with a new used 7735/ | 2022-03-28 12:14 | - | |
| Need help with bios upgrade on Aspire 5315/ | 2022-03-28 12:14 | - | |
| Need help with drivers for clean install/ | 2022-03-28 12:14 | - | |
| Need help with microphone on Aspire 5810TZ/ | 2022-03-28 12:14 | - | |
| Need help with my Acer Aspire/ | 2022-03-28 12:14 | - | |
| Need help with my Acer Aspire 5315/ | 2022-03-28 12:14 | - | |
| Need help with my new acer/ | 2022-03-28 12:14 | - | |
| Need help with my touchpad-ACER 7520-5185/ | 2022-03-28 12:14 | - | |
| Need help with new Acer computer, 5930/ | 2022-03-28 12:14 | - | |
| Need help with overclocking my Acer 6930Z/ | 2022-03-28 12:14 | - | |
| Need help with recovery disks for my Acer Aspire 5517 Laptop/ | 2022-03-28 12:14 | - | |
| Need help with temperature on comp/ | 2022-03-28 12:14 | - | |
| Need help with the Card Reader on 5672WLMi/ | 2022-03-28 12:14 | - | |
| Need icc color profile for Aspire 4520/ | 2022-03-28 12:14 | - | |
| Need info about the Acer AS1681WLMI/ | 2022-03-28 12:14 | - | |
| Need info for Aspire 7720/ | 2022-03-28 12:14 | - | |
| Need info on a acer laptop/ | 2022-03-28 12:14 | - | |
| Need info on games for 5102/ | 2022-03-28 12:14 | - | |
| Need information upgrading acer aspire ram/ | 2022-03-28 12:14 | - | |
| Need installation help AS1810TZ/ | 2022-03-28 12:14 | - | |
| Need iso for Aspire 9300/ | 2022-03-28 12:14 | - | |
| Need legal advice/ | 2022-03-28 12:14 | - | |
| Need major advice - Urgently - Please Reply/ | 2022-03-28 12:14 | - | |
| Need memory! Aspire 5672WLMi/ | 2022-03-28 12:14 | - | |
| Need new fan for my aspire 7720 laptop/ | 2022-03-28 12:14 | - | |
| Need new keyboard/ | 2022-03-28 12:14 | - | |
| Need of help to decide on a Motherbord/ | 2022-03-28 12:14 | - | |
| Need opinions reviews on Acer Aspire 4741/ | 2022-03-28 12:14 | - | |
| Need original partition info for Extensa 4420/ | 2022-03-28 12:14 | - | |
| Need quick help with Acer One series/ | 2022-03-28 12:14 | - | |
| Need replacement GPU for 5920G/ | 2022-03-28 12:14 | - | |
| Need schematic for Acer Aspire 6930G motherboard/ | 2022-03-28 12:14 | - | |
| Need serious help, Acer apsire 7551g not displaying/ | 2022-03-28 12:14 | - | |
| Need small help about Acer Aspire 5920G/ | 2022-03-28 12:14 | - | |
| Need some Acer repair advice, failed component just after warranty ended/ | 2022-03-28 12:14 | - | |
| Need some advice - 5672 vs 5674/ | 2022-03-28 12:14 | - | |
| Need some advice/ | 2022-03-28 12:14 | - | |
| Need some feedback from 4402 owners (about graphics card)/ | 2022-03-28 12:14 | - | |
| Need some ferrari info/ | 2022-03-28 12:14 | - | |
| Need some guidance/ | 2022-03-28 12:14 | - | |
| Need some help!/ | 2022-03-28 12:14 | - | |
| Need some help/ | 2022-03-28 12:14 | - | |
| Need some help Plz! Acer TM 4404 or 4402/ | 2022-03-28 12:14 | - | |
| Need some help about Acer Aspire V3-571G/ | 2022-03-28 12:14 | - | |
| Need some help and advice/ | 2022-03-28 12:14 | - | |
| Need some help with Acer Disc Formatting/ | 2022-03-28 12:14 | - | |
| Need some help with a 5610Z/ | 2022-03-28 12:14 | - | |
| Need some help with an Acer Inspire 5610Z/ | 2022-03-28 12:14 | - | |
| Need some help with an acer aspire 5251 -1513/ | 2022-03-28 12:14 | - | |
| Need some help with eRecovery Management/ | 2022-03-28 12:14 | - | |
| Need some serious help for my Acer 8920G/ | 2022-03-28 12:14 | - | |
| Need suggestions on CPU Upgrade on Acer Aspire 4736z/ | 2022-03-28 12:14 | - | |
| Need the right model number/ | 2022-03-28 12:14 | - | |
| Need to find a motherboard for an Acer Aspire 5630-6544/ | 2022-03-28 12:14 | - | |
| Need to fix and upgrade an Aspire 5740/ | 2022-03-28 12:14 | - | |
| Need to know H-sync and V-sync of aspire 5024WLMI/ | 2022-03-28 12:14 | - | |
| Need to locate my Hard Drive/ | 2022-03-28 12:14 | - | |
| Need to remove DVD drive...Help/ | 2022-03-28 12:14 | - | |
| Need to replace board for Aspire 3050/ | 2022-03-28 12:14 | - | |
| Need to replace vid card in 8935g/ | 2022-03-28 12:14 | - | |
| Need to unlock all features of Phoenix Bios Acer 5610z/ | 2022-03-28 12:14 | - | |
| Need working Acer Webcam Drv XP SP3/ | 2022-03-28 12:14 | - | |
| Need your Help, ACER 4520, upgrade 4GB of RAM/ | 2022-03-28 12:14 | - | |
| Need your help/ | 2022-03-28 12:14 | - | |
| Negative To Start/ | 2022-03-28 12:14 | - | |
| Nervous about getting my NEW Acer back from repairs/ | 2022-03-28 12:14 | - | |
| Netbook NO Bootable Drive Problem/ | 2022-03-28 12:14 | - | |
| Network Adaptor Name under device manager on 5920/ | 2022-03-28 12:14 | - | |
| Network Disconnet/ | 2022-03-28 12:14 | - | |
| Network adapter is missing after installing Win7 Ultimate/ | 2022-03-28 12:14 | - | |
| Network drivers problem/ | 2022-03-28 12:14 | - | |
| Networking Keeps Going In and Out Aspire 5610/ | 2022-03-28 12:14 | - | |
| Networking problem/ | 2022-03-28 12:14 | - | |
| Network not available 4820TG/ | 2022-03-28 12:14 | - | |
| Network performance problem/ | 2022-03-28 12:14 | - | |
| Network problem Acer Aspire 7730z/ | 2022-03-28 12:14 | - | |
| Never a dumb question, Acer 5560G/ | 2022-03-28 12:14 | - | |
| New 11.6 AMD Notebooks/ | 2022-03-28 12:14 | - | |
| New 1410-2285 su2300 wireless speed conectivity issues/ | 2022-03-28 12:14 | - | |
| New 1691WLMi - Warranty Question/ | 2022-03-28 12:14 | - | |
| New 1810T- Touchpad buttons not even/ | 2022-03-28 12:14 | - | |
| New 1810T Help Requested!!!!!/ | 2022-03-28 12:14 | - | |
| New 3201XCI Problem/ | 2022-03-28 12:14 | - | |
| New 4011--won't burn backup dvd/ | 2022-03-28 12:14 | - | |
| New 4810T, what are my expansion options/ | 2022-03-28 12:14 | - | |
| New 5730z, Error, freezing/ | 2022-03-28 12:14 | - | |
| New 5920G - HighSpec Model Out/ | 2022-03-28 12:14 | - | |
| New 5920G Bios/ | 2022-03-28 12:14 | - | |
| New 5920G do i need to/ | 2022-03-28 12:14 | - | |
| New 7200 Drive for Acer 5920G/ | 2022-03-28 12:14 | - | |
| New 8204 BIOS - 3315 (Slow down hard drive )/ | 2022-03-28 12:14 | - | |
| New 8930-6448 and HUGE PROBLEM!/ | 2022-03-28 12:14 | - | |
| New 8930 no wifi (anymore)/ | 2022-03-28 12:14 | - | |
| New AS1410 2GB Memory Question/ | 2022-03-28 12:14 | - | |
| New AS8920-6671/ | 2022-03-28 12:14 | - | |
| New ATI driver on Acer d loads/ | 2022-03-28 12:14 | - | |
| New Acer - Battery does not charge past 70%/ | 2022-03-28 12:14 | - | |
| New Acer/ | 2022-03-28 12:14 | - | |
| New Acer 11.6/ | 2022-03-28 12:14 | - | |
| New Acer 12.1 pretty decent/ | 2022-03-28 12:14 | - | |
| New Acer 18.4 AS8951-G9600 Review/ | 2022-03-28 12:14 | - | |
| New Acer 1414WLCI Notebook/ | 2022-03-28 12:14 | - | |
| New Acer 1691 display problem/ | 2022-03-28 12:14 | - | |
| New Acer 3204xmi is out in two weeks!/ | 2022-03-28 12:14 | - | |
| New Acer 4005- speaker dosn't work/ | 2022-03-28 12:14 | - | |
| New Acer 4420 - 5963 - Remove Pre-Installed/ | 2022-03-28 12:14 | - | |
| New Acer 5920G - How should I set it up/ | 2022-03-28 12:14 | - | |
| New Acer 5920G User/ | 2022-03-28 12:14 | - | |
| New Acer 5920G tips/ | 2022-03-28 12:14 | - | |
| New Acer 5930 touchpad problem/ | 2022-03-28 12:14 | - | |
| New Acer 6930 randomly shutting down on me during Windows Updates/ | 2022-03-28 12:14 | - | |
| New Acer Aspire 3 A315-51-51SL display issue/ | 2022-03-28 12:14 | - | |
| New Acer Aspire 1430Z/ | 2022-03-28 12:14 | - | |
| New Acer Aspire 4315-2963/ | 2022-03-28 12:14 | - | |
| New Acer Aspire 4740 Drivers Question/ | 2022-03-28 12:14 | - | |
| New Acer Aspire 5740G with intel i3 i5 i7 + Ati Mobility 5650/ | 2022-03-28 12:14 | - | |
| New Acer Aspire 5920 Review/ | 2022-03-28 12:14 | - | |
| New Acer Aspire M5620 Desktop PC - Internal Modem Is Always Busy Prior To Connecting To Internet...Any Rookies/ | 2022-03-28 12:14 | - | |
| New Acer Aspire S5 Ultrabook/ | 2022-03-28 12:14 | - | |
| New Acer Aspire TimelineX 4830T not achieving maximum turbo boost speed of 2.9 ghz/ | 2022-03-28 12:14 | - | |
| New Acer Aspire V5 561P brings the optical drive back from the dead News - is it available in the UK/ | 2022-03-28 12:14 | - | |
| New Acer Aspire VN7 591, is it suppose to be that hot/ | 2022-03-28 12:14 | - | |
| New Acer Aspire V Nitro series/ | 2022-03-28 12:14 | - | |
| New Acer Dead Pixel Policy/ | 2022-03-28 12:14 | - | |
| New Acer Ethos Notebooks/ | 2022-03-28 12:14 | - | |
| New Acer Extensa 5430 computer freezing with router/ | 2022-03-28 12:14 | - | |
| New Acer Ferrari.. when/ | 2022-03-28 12:14 | - | |
| New Acer Ferrari/ | 2022-03-28 12:14 | - | |
| New Acer Ferrari 2010 Calendar/ | 2022-03-28 12:14 | - | |
| New Acer Laptop Acer Recovery Management/ | 2022-03-28 12:14 | - | |
| New Acer M5 Touchscreen/ | 2022-03-28 12:14 | - | |
| New Acer Nitro and Predator Notebooks Announced/ | 2022-03-28 12:14 | - | |
| New Acer Notebooks/ | 2022-03-28 12:14 | - | |
| New Acer Predator Helios 300 with 9th gen cpu and gtx 1660 ti/ | 2022-03-28 12:14 | - | |
| New Acer TM 3000 released/ | 2022-03-28 12:14 | - | |
| New Acer TM3002wtci 3.1 pounds, bluetooth, gigabit/ | 2022-03-28 12:14 | - | |
| New Acer WebCam Software/ | 2022-03-28 12:14 | - | |
| New Acer aspire one 751 - Brightness cd m2/ | 2022-03-28 12:14 | - | |
| New Acer ePowerMgt/ | 2022-03-28 12:14 | - | |
| New Acer ferrari 1100/ | 2022-03-28 12:14 | - | |
| New Acer issues/ | 2022-03-28 12:14 | - | |
| New Acer laptop -- Battery AC Adapter question/ | 2022-03-28 12:14 | - | |
| New Acer laptop keeps freezing/ | 2022-03-28 12:14 | - | |
| New Acer laptops and SSD/ | 2022-03-28 12:14 | - | |
| New Acer user...some questions please/ | 2022-03-28 12:14 | - | |
| New Alvinso Sonoma Dell Laptops (centrino 2)/ | 2022-03-28 12:14 | - | |
| New Aspire/ | 2022-03-28 12:14 | - | |
| New Aspire 1353 - microphone plug doesn't work/ | 2022-03-28 12:14 | - | |
| New Aspire 1644WLMi looks awesome. Cheap price but need more details/ | 2022-03-28 12:14 | - | |
| New Aspire 2025 has video lockups w 9700 HELP!!/ | 2022-03-28 12:14 | - | |
| New Aspire 3830TG-6412 not completing initial setup/ | 2022-03-28 12:14 | - | |
| New Aspire 5612 not starting/ | 2022-03-28 12:14 | - | |
| New Aspire 5734Z clicky hard drive/ | 2022-03-28 12:14 | - | |
| New Aspire AS1522 LMI-XPP/ | 2022-03-28 12:14 | - | |
| New Aspire shows only half mhz/ | 2022-03-28 12:14 | - | |
| New BIOS 1.20 for 3810t/ | 2022-03-28 12:14 | - | |
| New BIOS Update for 5920G v1.3813/ | 2022-03-28 12:14 | - | |
| New BIOS for 5750 querry/ | 2022-03-28 12:14 | - | |
| New BIOS v1.17 for Acer 5560/ | 2022-03-28 12:14 | - | |
| New BIOS v1.18 available for TM4402 from Acer America/ | 2022-03-28 12:14 | - | |
| New Battery Dilemma/ | 2022-03-28 12:14 | - | |
| New Battery Stuck at 9 Precent charge/ | 2022-03-28 12:14 | - | |
| New Bios V1.08/ | 2022-03-28 12:14 | - | |
| New Bios for 5560 series/ | 2022-03-28 12:14 | - | |
| New Extensa 4620Z, No Recovery Disk/ | 2022-03-28 12:14 | - | |
| New Ferrari X2 Models/ | 2022-03-28 12:14 | - | |
| New Folio design/ | 2022-03-28 12:14 | - | |
| New Formatting Of Acer 5720/ | 2022-03-28 12:14 | - | |
| New GForce Beta Drivers for 5920G/ | 2022-03-28 12:14 | - | |
| New Germstone Laptops keyboard/ | 2022-03-28 12:14 | - | |
| New HDD in Acer 6920g/ | 2022-03-28 12:14 | - | |
| New HP Touchpad Driver that Unlocks Multi-Touch on older Touchpad/ | 2022-03-28 12:14 | - | |
| New Hard Drive/ | 2022-03-28 12:14 | - | |
| New Hard Drive Help/ | 2022-03-28 12:14 | - | |
| New Hdd for Aspire 8920g - transfer from old to new Hdd/ | 2022-03-28 12:14 | - | |
| New Here, Little Help Please/ | 2022-03-28 12:14 | - | |
| New Intel Turbo Memory Update/ | 2022-03-28 12:14 | - | |
| New Keyboard for Acer Aspire 1360... Help/ | 2022-03-28 12:14 | - | |
| New Laptop- Acer Extensa 4420-5237/ | 2022-03-28 12:14 | - | |
| New Laptop Battery Wont Charge HELP!!/ | 2022-03-28 12:14 | - | |
| New Laptop Hard Drive Question/ | 2022-03-28 12:14 | - | |
| New Models Are Up on the Acer US Site/ | 2022-03-28 12:14 | - | |
| New NVidia driver offered via Windows Update. Should I, shouldn't I/ | 2022-03-28 12:14 | - | |
| New Nvidia Driver (7.15.11.5680) fixed my HD-DVD playback issues on 5920-6313.. Maybe this help someone else/ | 2022-03-28 12:14 | - | |
| New Nvidia notebook driver 179.48/ | 2022-03-28 12:14 | - | |
| New ProFile design chassis/ | 2022-03-28 12:14 | - | |
| New Project- Converting erecovery XP-home to PRO/ | 2022-03-28 12:14 | - | |
| New Sata Laptops have major problems installing Windows XP/ | 2022-03-28 12:14 | - | |
| New TIMELINE ULTRA models !/ | 2022-03-28 12:14 | - | |
| New TM 8204WLMi hard disk erase/ | 2022-03-28 12:14 | - | |
| New Timeline 14 and 15.6 inch Laptops anytime soon/ | 2022-03-28 12:14 | - | |
| New TimelineX 13.3 Display and Audio/ | 2022-03-28 12:14 | - | |
| New TimelineX announcement/ | 2022-03-28 12:14 | - | |
| New Timeline laptops $699-$899/ | 2022-03-28 12:14 | - | |
| New To Acer!!/ | 2022-03-28 12:14 | - | |
| New Travelmate 8172 - Want to do SSD upgrade/ | 2022-03-28 12:14 | - | |
| New Travelmate Series/ | 2022-03-28 12:14 | - | |
| New User - pitiful battery life/ | 2022-03-28 12:14 | - | |
| New Win7 install/ | 2022-03-28 12:14 | - | |
| New Zealand version of AS5672WLMi/ | 2022-03-28 12:14 | - | |
| New acer aspire 5050 help/ | 2022-03-28 12:14 | - | |
| New acer password/ | 2022-03-28 12:14 | - | |
| New and AWESOME Windows 7 drivers!/ | 2022-03-28 12:14 | - | |
| New aspire 7720. im liking it!/ | 2022-03-28 12:14 | - | |
| New battery Issues/ | 2022-03-28 12:14 | - | |
| New benches/ | 2022-03-28 12:14 | - | |
| Newbie Alert! Help with poss Acer5360 upgrades/ | 2022-03-28 12:14 | - | |
| Newbie Recovery Question/ | 2022-03-28 12:14 | - | |
| Newbie needs help - Acer Extensa 4620Z does it have blue lights/ | 2022-03-28 12:14 | - | |
| Newbie needs help -P/ | 2022-03-28 12:14 | - | |
| Newbie with Acer 5517 Having bad luck with reinstall or BIOS/ | 2022-03-28 12:14 | - | |
| Newbie with some questions/ | 2022-03-28 12:14 | - | |
| New bios (3813) for 5920/ | 2022-03-28 12:14 | - | |
| New bios for 7720 1.42/ | 2022-03-28 12:14 | - | |
| New bios for AS6935g - ver 1.14/ | 2022-03-28 12:14 | - | |
| New cpu for TM533XV/ | 2022-03-28 12:14 | - | |
| Newegg.com Laptop Shipping/ | 2022-03-28 12:14 | - | |
| Newegg Acer 8930 - Is this for real/ | 2022-03-28 12:14 | - | |
| Newegg vs ZipZoomfly for buying Acer Ferrari 4000 (plus warranty question)/ | 2022-03-28 12:14 | - | |
| New firmware for Aspire 169X/ | 2022-03-28 12:14 | - | |
| New graphic card acer 5920g advice/ | 2022-03-28 12:14 | - | |
| New guy- Acer 5536 cpu & ram upgrade/ | 2022-03-28 12:14 | - | |
| New hdd for acer 6935g - Seagate Momentus 7200.4 500gb st9500420asg/ | 2022-03-28 12:14 | - | |
| New here and new laptop!!!/ | 2022-03-28 12:14 | - | |
| New install of Vista on 5920g/ | 2022-03-28 12:14 | - | |
| New member, question about 5672/ | 2022-03-28 12:14 | - | |
| New notebook, ACER7745, new guy. Need help starting up/ | 2022-03-28 12:14 | - | |
| New nvidia graphic card not works with Aspire 7720G/ | 2022-03-28 12:14 | - | |
| New owner of an AS5742-6811/ | 2022-03-28 12:14 | - | |
| New problem! 5315 Touchpad is unresponsive/ | 2022-03-28 12:14 | - | |
| New realtek sound driver for 6920g/ | 2022-03-28 12:14 | - | |
| New to Acer/ | 2022-03-28 12:14 | - | |
| New to Travelmate 4402wlmi/ | 2022-03-28 12:14 | - | |
| New version of Emanager and Launcher Manager/ | 2022-03-28 12:14 | - | |
| Next Acer Upgrade/ | 2022-03-28 12:14 | - | |
| Next TG Generation/ | 2022-03-28 12:14 | - | |
| Nitro 5 AN515-42 AMD edition/ | 2022-03-28 12:14 | - | |
| Nitro 5 AN515-54 - High cpu temp/ | 2022-03-28 12:14 | - | |
| Nitro 5 AN515-54 ram upgrade/ | 2022-03-28 12:14 | - | |
| Nitro 5 Spin NP515-51, Battery/ | 2022-03-28 12:14 | - | |
| Nitro 5 backlight bleed/ | 2022-03-28 12:14 | - | |
| Nitro 7 - AN715-52-715S/ | 2022-03-28 12:14 | - | |
| No 14.1 laptops anymore/ | 2022-03-28 12:14 | - | |
| No AC3 DTS over hdmi in latest Realtek driver under win7/ | 2022-03-28 12:14 | - | |
| No Acer logo/ | 2022-03-28 12:14 | - | |
| No Backlight on LED screen/ | 2022-03-28 12:14 | - | |
| No Bios black screen on acer 9300 and wasnt tryin to flash/ | 2022-03-28 12:14 | - | |
| No Blu-Ray Sound through HDMI/ | 2022-03-28 12:14 | - | |
| No Blu-ray from 6935g to projector/ | 2022-03-28 12:14 | - | |
| No Display System will not POST Aspire 4520/ | 2022-03-28 12:14 | - | |
| No Display on aspire 4736z/ | 2022-03-28 12:14 | - | |
| No Dissassemble/ | 2022-03-28 12:14 | - | |
| No Firewire Help on Acer A5739G- Need to Transfer Video from Camcorder/ | 2022-03-28 12:14 | - | |
| No Graphics White ScreenAcer Aspire 5735/ | 2022-03-28 12:14 | - | |
| No LAN Network controller found/ | 2022-03-28 12:14 | - | |
| No Power - Aspire 5050/ | 2022-03-28 12:14 | - | |
| No Quiet Boot in Bios for Acer/ | 2022-03-28 12:14 | - | |
| No Screen On Start Up Help!!/ | 2022-03-28 12:14 | - | |
| No Shutdown On 5920 With XP Solution/ | 2022-03-28 12:14 | - | |
| No Sound from Headphone Jack acer Aspire 3680/ | 2022-03-28 12:14 | - | |
| No Sound when using headphones/ | 2022-03-28 12:14 | - | |
| No Turion MT laptops/ | 2022-03-28 12:14 | - | |
| No VGA port output/ | 2022-03-28 12:14 | - | |
| No Windows Disk/ | 2022-03-28 12:14 | - | |
| No Wireless on 7730Z with XP/ | 2022-03-28 12:14 | - | |
| No disks with notebook/ | 2022-03-28 12:14 | - | |
| No display on notebook screen, but external monitor works/ | 2022-03-28 12:14 | - | |
| No eRecovery Management after recovery/ | 2022-03-28 12:14 | - | |
| No hard drives/ | 2022-03-28 12:14 | - | |
| No indicator lights!/ | 2022-03-28 12:14 | - | |
| Noise LEVEL FOR 3000LMI/ | 2022-03-28 12:14 | - | |
| Noiseproblem with the 3201XCi/ | 2022-03-28 12:14 | - | |
| Noise through the earphones/ | 2022-03-28 12:14 | - | |
| Noise upon closing the lid of Aspire 5920G/ | 2022-03-28 12:14 | - | |
| Noise when opening Aspire 4520/ | 2022-03-28 12:14 | - | |
| Noisy recording via line-in (5101AWLMi)/ | 2022-03-28 12:14 | - | |
| Non-functioning of Acer Travelmate 2410/ | 2022-03-28 12:14 | - | |
| None of the sound jacks work on 5920G/ | 2022-03-28 12:14 | - | |
| Noob - Help with XP audio driver for Acer 4315-2490/ | 2022-03-28 12:14 | - | |
| Noob Quetion/ | 2022-03-28 12:14 | - | |
| Noob driver updates help please/ | 2022-03-28 12:14 | - | |
| Noob help!/ | 2022-03-28 12:14 | - | |
| Noobie need help/ | 2022-03-28 12:14 | - | |
| Noob question reagrding Acer Extensa 5620G-5A3G32Mi/ | 2022-03-28 12:14 | - | |
| No power ACER TM 2423WCXi/ | 2022-03-28 12:14 | - | |
| No power after bios echec on acer one/ | 2022-03-28 12:14 | - | |
| No power without Battery connected/ | 2022-03-28 12:14 | - | |
| No recovery CD!!!!/ | 2022-03-28 12:14 | - | |
| No restart from hibernate/ | 2022-03-28 12:14 | - | |
| Normal temps for an Aspire 5735Z/ | 2022-03-28 12:14 | - | |
| Norton 360 Re-installation/ | 2022-03-28 12:14 | - | |
| No serial port on 5920G/ | 2022-03-28 12:14 | - | |
| No shut down option/ | 2022-03-28 12:14 | - | |
| No sound! Help/ | 2022-03-28 12:14 | - | |
| No sound from headphones/ | 2022-03-28 12:14 | - | |
| No sound from speakers (headphones ok)/ | 2022-03-28 12:14 | - | |
| No sound over hdmi on 5741a/ | 2022-03-28 12:14 | - | |
| No stereo sound from the Headhone jack in my Aspire 5100/ | 2022-03-28 12:14 | - | |
| No support!/ | 2022-03-28 12:14 | - | |
| Not a big fan of glossy screen/ | 2022-03-28 12:14 | - | |
| Not able to run empowering technology programs or run network settings/ | 2022-03-28 12:14 | - | |
| Not booting to disc, only a little flicker!/ | 2022-03-28 12:14 | - | |
| Notd2d Acer 4920/ | 2022-03-28 12:14 | - | |
| Not detecting HDMI/ | 2022-03-28 12:14 | - | |
| Notebook Acer 5920g - Faulty VGA nvidia 8600m - Black screen/ | 2022-03-28 12:14 | - | |
| Notebook Acer Aspire 4315-2259 - CPU Upgrade/ | 2022-03-28 12:14 | - | |
| Notebook Aris 8050 = to ACER/ | 2022-03-28 12:14 | - | |
| Notebook Hardware Control/ | 2022-03-28 12:14 | - | |
| Notebook Screen Refreshes Flashes/ | 2022-03-28 12:14 | - | |
| Notebook Warranty help - ServiceNet vs WaCA vs Acer Advantage/ | 2022-03-28 12:14 | - | |
| Notebook battery question/ | 2022-03-28 12:14 | - | |
| Notebook help as 6930G/ | 2022-03-28 12:14 | - | |
| Notebook plugin all the time/ | 2022-03-28 12:14 | - | |
| Notebook recommandation/ | 2022-03-28 12:14 | - | |
| Notebooks Without Reflective Coating/ | 2022-03-28 12:14 | - | |
| Notebook upgrade/ | 2022-03-28 12:14 | - | |
| Notebook widescreens/ | 2022-03-28 12:14 | - | |
| Nothing on screen when powered up/ | 2022-03-28 12:14 | - | |
| Notification.dll/ | 2022-03-28 12:14 | - | |
| Novel eRecovery Issues/ | 2022-03-28 12:14 | - | |
| No video on Acer Arcade Deluxe/ | 2022-03-28 12:14 | - | |
| No video on projector via hdmi from 6395g/ | 2022-03-28 12:14 | - | |
| Now, I have to know - 4gb RAM in Aspire 5610Z/ | 2022-03-28 12:14 | - | |
| Now Aspire 5670 5620 ,TravelMate4670 4270 service manual/ | 2022-03-28 12:14 | - | |
| No warranty for Acer TimelineX 3820TG if I buy in different country/ | 2022-03-28 12:14 | - | |
| No weekend Acer Support/ | 2022-03-28 12:14 | - | |
| No wifi acer 5920g Windows 10/ | 2022-03-28 12:14 | - | |
| Now i fixed the iphone, another problem occured/ | 2022-03-28 12:14 | - | |
| No wireless adapter recognized......4420-5963/ | 2022-03-28 12:14 | - | |
| Now what/ | 2022-03-28 12:14 | - | |
| Nvidia 9650m GT DDR3 Acer Bios/ | 2022-03-28 12:14 | - | |
| Nvidia Driver update/ | 2022-03-28 12:14 | - | |
| Nvidia GeForce 8600M GT screen blinks flickers/ | 2022-03-28 12:14 | - | |
| Nvidia Geforce9600m gt temperature on Aspire5930G/ | 2022-03-28 12:14 | - | |
| Nvidia Memory in 6935G/ | 2022-03-28 12:14 | - | |
| Nvidia Quadro on Acer Aspire 7720G Problem/ | 2022-03-28 12:14 | - | |
| OC-Freak's quick review- Acer Aspire V5-573G, i5 haswell, Nvidia GT750M and FullHD IPS/ | 2022-03-28 12:14 | - | |
| OC-Freaks Acer Ethos 5943G with ATI HD5850 Review/ | 2022-03-28 12:14 | - | |
| OC on 8204's X1600 - add your set clock values/ | 2022-03-28 12:14 | - | |
| OC results for Ati 5850 GDDR3 in Acer 8942g/ | 2022-03-28 12:14 | - | |
| ODD HDD Caddy 4820TG/ | 2022-03-28 12:14 | - | |
| OEM Netflix with Starturl.exe/ | 2022-03-28 12:14 | - | |
| OH MY GOD!!!acer/ | 2022-03-28 12:14 | - | |
| OK, I Take It Back/ | 2022-03-28 12:14 | - | |
| OK, Im gonna update my BIOS, i need to know how to backup my existing BIOS/ | 2022-03-28 12:14 | - | |
| ONE (AOA 150-1570) - Wher are the eEmpower applications/ | 2022-03-28 12:14 | - | |
| OSD problem/ | 2022-03-28 12:14 | - | |
| OS Setup AS8930/ | 2022-03-28 12:14 | - | |
| OSX86 on Aspire 6920G/ | 2022-03-28 12:14 | - | |
| OSX86 on Timeline 1410 1810/ | 2022-03-28 12:14 | - | |
| OSX Snow Leopard on 8930G/ | 2022-03-28 12:14 | - | |
| OSX on the 1810tz/ | 2022-03-28 12:14 | - | |
| OS and Driver CD/ | 2022-03-28 12:14 | - | |
| OS will not load ( Vista )/ | 2022-03-28 12:14 | - | |
| OUCH! New Acer Laptop VISTA Hoops.. All better now!!/ | 2022-03-28 12:14 | - | |
| Odd Acer 8951G Battery Issue/ | 2022-03-28 12:14 | - | |
| Odd Acer Aspire 6920g Intermittent Backlight/ | 2022-03-28 12:14 | - | |
| Odd Wireless Adapter Problem (Acer Aspire One D260)/ | 2022-03-28 12:14 | - | |
| Odd networking issues/ | 2022-03-28 12:14 | - | |
| Odd noise when Aspire One starts up/ | 2022-03-28 12:14 | - | |
| Official 5920 nvidia drivers 156.72 available/ | 2022-03-28 12:14 | - | |
| Official 6920 & 8920 x64 modem drivers/ | 2022-03-28 12:14 | - | |
| Official ACER x64-x86 Windows 7 Drivers for Aspire 5738/ | 2022-03-28 12:14 | - | |
| Official Acer Aspire 5739G Owner's Lounge/ | 2022-03-28 12:14 | - | |
| Official Acer Spin 5 SP513-51 Owner´s Lounge/ | 2022-03-28 12:14 | - | |
| Official Charger for Acer Aspire 5003WLMi/ | 2022-03-28 12:14 | - | |
| Og god no... Please help/ | 2022-03-28 12:14 | - | |
| Oh, This Is Interesting!/ | 2022-03-28 12:14 | - | |
| Oh God, that is sooooooooo much better sigh of relief/ | 2022-03-28 12:14 | - | |
| Oh the difference a batch makes/ | 2022-03-28 12:14 | - | |
| Ok Acer you win.. enough ... we love timelines... we love timelines... -)/ | 2022-03-28 12:14 | - | |
| Okay, stupid question/ | 2022-03-28 12:14 | - | |
| Okay to replace orig. HD with another type/ | 2022-03-28 12:14 | - | |
| Old Acer Aspire 1690 Sound (hardware) problem/ | 2022-03-28 12:14 | - | |
| Old Aspire 1690 WLMi + new Hard drive vs. New Laptop/ | 2022-03-28 12:14 | - | |
| Old Aspire 5580 in need of Help/ | 2022-03-28 12:14 | - | |
| Old Aspire won't turn on, orange charging light blinking 5 times/ | 2022-03-28 12:14 | - | |
| Omega drivers for the 8204's X1600/ | 2022-03-28 12:14 | - | |
| On Starting Acer Aspre One 532h, Black Screen with Solid Cursor Remains Forever/ | 2022-03-28 12:14 | - | |
| One Note & Eclipse on Acer Aspire One/ | 2022-03-28 12:14 | - | |
| One last question about resolution and screen size/ | 2022-03-28 12:14 | - | |
| Online Orders and TAXES/ | 2022-03-28 12:14 | - | |
| Online Store - Canada - New Revisions/ | 2022-03-28 12:14 | - | |
| Open Acer Travelmate 5740g and renew thermal paste/ | 2022-03-28 12:14 | - | |
| OpenGL and Aspire 5315/ | 2022-03-28 12:14 | - | |
| Open Ports/ | 2022-03-28 12:14 | - | |
| OpenSuse Vista on Aspire 9420/ | 2022-03-28 12:14 | - | |
| Open and close/ | 2022-03-28 12:14 | - | |
| Opening Acer TM 2350/ | 2022-03-28 12:14 | - | |
| Opening Up my Acer/ | 2022-03-28 12:14 | - | |
| Opening an Acer 5102/ | 2022-03-28 12:14 | - | |
| Opening my Acer 6930G/ | 2022-03-28 12:14 | - | |
| Opening the Aspire 4315/ | 2022-03-28 12:14 | - | |
| Opening up TravelMate 5520/ | 2022-03-28 12:14 | - | |
| Open up acer aspire 2012/ | 2022-03-28 12:14 | - | |
| Operating system not found/ | 2022-03-28 12:14 | - | |
| Operating system not found Acer laptop/ | 2022-03-28 12:14 | - | |
| Opinion- Acer Aspire 5737Z-343G25Mn/ | 2022-03-28 12:14 | - | |
| Opinion on 2001WLCI/ | 2022-03-28 12:14 | - | |
| Opinions PLEASE!/ | 2022-03-28 12:14 | - | |
| Opinions on Acer Aspire AS3050-1150/ | 2022-03-28 12:14 | - | |
| Opinions on a refurb S7-392-5401/ | 2022-03-28 12:14 | - | |
| Opinions on the Acer Aspire AS6930-6560/ | 2022-03-28 12:14 | - | |
| Opinions on this Acer please/ | 2022-03-28 12:14 | - | |
| Optical Drive Bezel/ | 2022-03-28 12:14 | - | |
| Optical Drive Device Locked/ | 2022-03-28 12:14 | - | |
| Optical Drive Power Management for 4810T/ | 2022-03-28 12:14 | - | |
| Optical Drive doesnt recognize RECORDED CDs DVDs/ | 2022-03-28 12:14 | - | |
| Optical Drive plays DVDs but not CDs, CD-ROM/ | 2022-03-28 12:14 | - | |
| Optical Drives' short life span/ | 2022-03-28 12:14 | - | |
| Optical bay HDD caddy troubles/ | 2022-03-28 12:14 | - | |
| Optical drive in 5820TG refuse to read discs/ | 2022-03-28 12:14 | - | |
| Optimal settings for downvoltage ACER Aspire 5670/ | 2022-03-28 12:14 | - | |
| Optimizing 8204/ | 2022-03-28 12:14 | - | |
| Optimizing AMD Acer notebooks/ | 2022-03-28 12:14 | - | |
| Options about a wireless router/ | 2022-03-28 12:14 | - | |
| Options if I can not get a 3820TG/ | 2022-03-28 12:14 | - | |
| Optmizing battery life on 5102/ | 2022-03-28 12:14 | - | |
| Orange & Green Lights -)/ | 2022-03-28 12:14 | - | |
| Orange Screen after logon/ | 2022-03-28 12:14 | - | |
| OrbiCam Blurred/ | 2022-03-28 12:14 | - | |
| OrbiCam missing after Vista Express Upgrade/ | 2022-03-28 12:14 | - | |
| OrbiCam not saving videos/ | 2022-03-28 12:14 | - | |
| OrbiCam problems after WinXP Pro/ | 2022-03-28 12:14 | - | |
| OrbiCams on Aspires and Travelmates/ | 2022-03-28 12:14 | - | |
| Orbicam Acer aspire 3680/ | 2022-03-28 12:14 | - | |
| Orbicam Bison not work on xp with my acer 5/ | 2022-03-28 12:14 | - | |
| Orbicam Driver FIX/ | 2022-03-28 12:14 | - | |
| Orbicam Help!!/ | 2022-03-28 12:14 | - | |
| Orbicam Missing/ | 2022-03-28 12:14 | - | |
| Orbicam Problems!!!/ | 2022-03-28 12:14 | - | |
| Orbicam Resolution Quality/ | 2022-03-28 12:14 | - | |
| Orbicam Upside Down/ | 2022-03-28 12:14 | - | |
| Orbicam and 8204/ | 2022-03-28 12:14 | - | |
| Orbicam hassels again thread/ | 2022-03-28 12:14 | - | |
| Orbicam issue...please help -)/ | 2022-03-28 12:14 | - | |
| Orbicam problem -)/ | 2022-03-28 12:14 | - | |
| Ordered 3810T Want to install win 7 64bit/ | 2022-03-28 12:14 | - | |
| Ordered My Acer TM4501 !!!!/ | 2022-03-28 12:14 | - | |
| Ordered my 8204 Today!/ | 2022-03-28 12:14 | - | |
| Ordered my Acer TM4501!/ | 2022-03-28 12:14 | - | |
| Ordered my new TM 6592-6963!/ | 2022-03-28 12:14 | - | |
| Ordering 3201xmi from UK/ | 2022-03-28 12:14 | - | |
| Ordering From Acer, (Please Read)/ | 2022-03-28 12:14 | - | |
| Other questions about Acer TM 3201 and 4501/ | 2022-03-28 12:14 | - | |
| Ouch!!/ | 2022-03-28 12:14 | - | |
| Out-of-warranty repairs- Caveat Emptor/ | 2022-03-28 12:14 | - | |
| Outlook crashes when waking up from standby/ | 2022-03-28 12:14 | - | |
| Outside battery/ | 2022-03-28 12:14 | - | |
| Overclock - Acer 7738G PIN MODE/ | 2022-03-28 12:14 | - | |
| Overclock 5112 using Clockgen/ | 2022-03-28 12:14 | - | |
| Overclock 9600M GT on Acer 6935G/ | 2022-03-28 12:14 | - | |
| Overclock Acer 5920G/ | 2022-03-28 12:14 | - | |
| Overclock T9300 to T9500/ | 2022-03-28 12:14 | - | |
| Overclock X600 Radeon Mobility on Aspire 1801/ | 2022-03-28 12:14 | - | |
| Overclock a 6920G Can it be done And How!/ | 2022-03-28 12:14 | - | |
| Overclocking, how is this done/ | 2022-03-28 12:14 | - | |
| Overclocking/ | 2022-03-28 12:14 | - | |
| Overclocking 3810T with core2 solo/ | 2022-03-28 12:14 | - | |
| Overclocking 5672 x1400/ | 2022-03-28 12:14 | - | |
| Overclocking 5742zg with p6100/ | 2022-03-28 12:14 | - | |
| Overclocking 5920G/ | 2022-03-28 12:14 | - | |
| Overclocking 5943g with HD5850/ | 2022-03-28 12:14 | - | |
| Overclocking 9600M GT/ | 2022-03-28 12:14 | - | |
| Overclocking AMD64 Turion/ | 2022-03-28 12:14 | - | |
| Overclocking ASPIRE 1820PTZ/ | 2022-03-28 12:14 | - | |
| Overclocking Acer 5810 timeline/ | 2022-03-28 12:14 | - | |
| Overclocking Acer 8935g/ | 2022-03-28 12:14 | - | |
| Overclocking Acer Timeline with SU3500 results/ | 2022-03-28 12:14 | - | |
| Overclocking Acer laptops. Nobody seems to be doing it/ | 2022-03-28 12:14 | - | |
| Overclocking Aspire 1691 to 1.9/ | 2022-03-28 12:14 | - | |
| Overclocking Aspire 5943 720qm 5850/ | 2022-03-28 12:14 | - | |
| Overclocking Aspire 6920 GPU. Safe/ | 2022-03-28 12:14 | - | |
| Overclocking GPU and upgrading performance/ | 2022-03-28 12:14 | - | |
| Overclocking GeForce 9500M GS on Aspire 7720G/ | 2022-03-28 12:14 | - | |
| Overclocking Intel X9100/ | 2022-03-28 12:14 | - | |
| Overclocking Phenom II X4 (N930)/ | 2022-03-28 12:14 | - | |
| Overclocking Ram/ | 2022-03-28 12:14 | - | |
| Overclocking T5600 in 3680/ | 2022-03-28 12:14 | - | |
| Overclocking an 8930G/ | 2022-03-28 12:14 | - | |
| Overclocking an Aspire 5570/ | 2022-03-28 12:14 | - | |
| Overclocking and overvolting acer aspire 6920g GPU and CPU/ | 2022-03-28 12:14 | - | |
| Overclocking in 8920g Is Possible/ | 2022-03-28 12:14 | - | |
| Overclocking issue onmy 5920G/ | 2022-03-28 12:14 | - | |
| Overclocking my Acer 8943G I7 720QM/ | 2022-03-28 12:14 | - | |
| Overclocking on Acer Aspire 9300/ | 2022-03-28 12:14 | - | |
| Overclocking or Underclocking Acer Aspire One Netbook/ | 2022-03-28 12:14 | - | |
| Overclocking problem/ | 2022-03-28 12:14 | - | |
| Overclocking the Geforce 7600 SE in the 5685wlmi/ | 2022-03-28 12:14 | - | |
| Overclock intel Atom N260 on AAO D-250/ | 2022-03-28 12:14 | - | |
| Overclock memory Acer Aspire 8930G/ | 2022-03-28 12:14 | - | |
| Overclock questions about 1810T-8968 SU7300 4G/ | 2022-03-28 12:14 | - | |
| Overclock the CPU o Acer/ | 2022-03-28 12:14 | - | |
| Overheat!!/ | 2022-03-28 12:14 | - | |
| Overheating + Thermic Paste/ | 2022-03-28 12:14 | - | |
| Overheating 7000 Series Travelmate/ | 2022-03-28 12:14 | - | |
| Overheating 8204/ | 2022-03-28 12:14 | - | |
| Overheating Problem -- Requesting Help/ | 2022-03-28 12:14 | - | |
| Overheating and disassembly issues on Aspire 8943G/ | 2022-03-28 12:14 | - | |
| Overheating ati GPU on acer 7745G/ | 2022-03-28 12:14 | - | |
| Overheating problems with Aspire 5500Z/ | 2022-03-28 12:14 | - | |
| Overheating shutdown/ | 2022-03-28 12:14 | - | |
| Overheat problems 7738G/ | 2022-03-28 12:14 | - | |
| Overpriced TravelMate 8100 in Australia/ | 2022-03-28 12:14 | - | |
| Overseas C110 use english recovery cd/ | 2022-03-28 12:14 | - | |
| Owners of Acer 5672 WLMi..Rate it!/ | 2022-03-28 12:14 | - | |
| Owners of V3-472P-324J 14 , i3 - advice/ | 2022-03-28 12:14 | - | |
| P4 USB boot option/ | 2022-03-28 12:14 | - | |
| P8400 cpu speeds/ | 2022-03-28 12:14 | - | |
| P8400 vs P8600 (vs T9400)/ | 2022-03-28 12:14 | - | |
| PATA or SATA/ | 2022-03-28 12:14 | - | |
| PC2 6400 in 5315 RAM games/ | 2022-03-28 12:14 | - | |
| PCI Express 54 slot/ | 2022-03-28 12:14 | - | |
| PCI express HDD (6935g) in tv card slot/ | 2022-03-28 12:14 | - | |
| PCI express x1/ | 2022-03-28 12:14 | - | |
| PC Wizard reading of Acer 3680-2633 chipset/ | 2022-03-28 12:14 | - | |
| PC World best buy/ | 2022-03-28 12:14 | - | |
| PC to 8930G/ | 2022-03-28 12:14 | - | |
| PLEASE HELP!!! Volume throttle doesn't work after a W7 x64 clean install/ | 2022-03-28 12:14 | - | |
| PLEASE HELP with 4420!!!!....please/ | 2022-03-28 12:14 | - | |
| PLEASE help me find the Aspire 3023!!/ | 2022-03-28 12:14 | - | |
| PLEEEAASE aspire 5100 i.explorer shutdown desktop freeze !!/ | 2022-03-28 12:14 | - | |
| PN# for Replacement LCD Screen on AS1410-2801/ | 2022-03-28 12:14 | - | |
| POLL- How is the 3820TG in terms of build quality/ | 2022-03-28 12:14 | - | |
| PQSERVICE & MBR Problems/ | 2022-03-28 12:14 | - | |
| PQSERVICE - Do I need it/ | 2022-03-28 12:14 | - | |
| PQSERVICE - recover install/ | 2022-03-28 12:14 | - | |
| PQSERVICE DELETED HELP!!! acer 5102/ | 2022-03-28 12:14 | - | |
| PQSERVICE Partition... Do I need it anymore/ | 2022-03-28 12:14 | - | |
| PQSERVICE Patition Question/ | 2022-03-28 12:14 | - | |
| PQSERVICE Rebuild/ | 2022-03-28 12:14 | - | |
| PQSERVICE factory setting problem/ | 2022-03-28 12:14 | - | |
| PQSERVICE restore/ | 2022-03-28 12:14 | - | |
| PQSERVICE will not boot Plz help/ | 2022-03-28 12:14 | - | |
| PQService Partition and Vista/ | 2022-03-28 12:14 | - | |
| PQservice/ | 2022-03-28 12:14 | - | |
| PROS and CONS of Acer 1681 and 1662/ | 2022-03-28 12:14 | - | |
| PSD Problems/ | 2022-03-28 12:14 | - | |
| PUNISH Buy.com/ | 2022-03-28 12:14 | - | |
| PWR button malfunctioning/ | 2022-03-28 12:14 | - | |
| Packard Bell gx-n10/ | 2022-03-28 12:14 | - | |
| Pages opening very slowly/ | 2022-03-28 12:14 | - | |
| Palmrest spare part for 1810t/ | 2022-03-28 12:14 | - | |
| Paper weight laptop. Acer Aspire 7736z/ | 2022-03-28 12:14 | - | |
| Partition Merge Extend/ | 2022-03-28 12:14 | - | |
| Partition c- drive (Acer 5740g)/ | 2022-03-28 12:14 | - | |
| Partitioning Help 5930G/ | 2022-03-28 12:14 | - | |
| Partitioning Problem!!/ | 2022-03-28 12:14 | - | |
| Partitioning and reinstalling windows/ | 2022-03-28 12:14 | - | |
| Partition problem/ | 2022-03-28 12:14 | - | |
| Partition question/ | 2022-03-28 12:14 | - | |
| Partitions ( )/ | 2022-03-28 12:14 | - | |
| Partitions/ | 2022-03-28 12:14 | - | |
| Partitions and System Restore/ | 2022-03-28 12:14 | - | |
| Part of Laptop Screen Looks Broken/ | 2022-03-28 12:14 | - | |
| Parts Upgrade for Acer 5920G/ | 2022-03-28 12:14 | - | |
| Parts for Acer AS1410 (1810T) or gateway equivalent/ | 2022-03-28 12:14 | - | |
| Password/ | 2022-03-28 12:14 | - | |
| Password Bank Question/ | 2022-03-28 12:14 | - | |
| Password for Setup (F2)/ | 2022-03-28 12:14 | - | |
| Password removal on Notebook Acer Travelmate T200/ | 2022-03-28 12:14 | - | |
| Pasting screen images/ | 2022-03-28 12:14 | - | |
| Pease/ | 2022-03-28 12:14 | - | |
| Pen Pressure now possible on Aspire R7-572 and 32-bit Photoshop/ | 2022-03-28 12:14 | - | |
| Pentium t3200/ | 2022-03-28 12:14 | - | |
| People who know about or own a Ferrari 4000 please look here/ | 2022-03-28 12:14 | - | |
| Perception of 8204 weight and heat on lap/ | 2022-03-28 12:14 | - | |
| Performance of 5024 against 5022/ | 2022-03-28 12:14 | - | |
| Performance of Acer notebooks with HD 2300 2400/ | 2022-03-28 12:14 | - | |
| Performance review of the Swift 3 with 2700U/ | 2022-03-28 12:14 | - | |
| Permanent VT-enabling mod for ACER 5315/ | 2022-03-28 12:14 | - | |
| Permanently enable bluetooth on an 8930G/ | 2022-03-28 12:14 | - | |
| Persistent Storage folder/ | 2022-03-28 12:14 | - | |
| Personal Memo to Myself/ | 2022-03-28 12:14 | - | |
| Personal Secure Disk/ | 2022-03-28 12:14 | - | |
| Pfn_list_corrupt/ | 2022-03-28 12:14 | - | |
| Phantom Space/ | 2022-03-28 12:14 | - | |
| Phoenix SecureCore problem/ | 2022-03-28 12:14 | - | |
| Phone Jack/ | 2022-03-28 12:14 | - | |
| Physical Memory Dump/ | 2022-03-28 12:14 | - | |
| Physical impressions of a few subnotebooks (Acer 4820 Vaio Z EA Lenovo Y460)/ | 2022-03-28 12:14 | - | |
| Physically replacing CPU on Acer 3830TG/ | 2022-03-28 12:14 | - | |
| Picked up a Aspire 5551-2036 for $50/ | 2022-03-28 12:14 | - | |
| Pics and Info on 10 Aspire One/ | 2022-03-28 12:14 | - | |
| Pics of Acer 2012 keyboard/ | 2022-03-28 12:14 | - | |
| Pictures of Acer 6292 needed/ | 2022-03-28 12:14 | - | |
| Pictures of Aspire AS3003WLCi/ | 2022-03-28 12:14 | - | |
| Pimp My 3680/ | 2022-03-28 12:14 | - | |
| PinMod Pentium M 735 Extensa 2600 Aspire 3610/ | 2022-03-28 12:14 | - | |
| Pixel Shader2.0 availability/ | 2022-03-28 12:14 | - | |
| Places that sell Acer notebooks/ | 2022-03-28 12:14 | - | |
| Places to buy TM4402 in Buffalo/ | 2022-03-28 12:14 | - | |
| Planning of purchase of new Acer/ | 2022-03-28 12:14 | - | |
| Planning to move from XP to Vista on 5920/ | 2022-03-28 12:14 | - | |
| Plastic clip required for connecting touchpad ribbon to motherboard/ | 2022-03-28 12:14 | - | |
| Plastic retaining clips for ribbon to motherboard attachment required/ | 2022-03-28 12:14 | - | |
| Plastic underneath ventilation holes (Dust Flap )/ | 2022-03-28 12:14 | - | |
| Play Movie update/ | 2022-03-28 12:14 | - | |
| Play Pause button in Acer Aspire 4710z problem/ | 2022-03-28 12:14 | - | |
| Playing DVD s/ | 2022-03-28 12:14 | - | |
| Playing games on SXGA+/ | 2022-03-28 12:14 | - | |
| Playmovie disappeared/ | 2022-03-28 12:14 | - | |
| Please Enter Current password/ | 2022-03-28 12:14 | - | |
| Please HELP ! 1410 - SU2300 vs My SU3500/ | 2022-03-28 12:14 | - | |
| Please Help! I have no sound!! acer aspire 5332/ | 2022-03-28 12:14 | - | |
| Please Help, Windows Not Logging In/ | 2022-03-28 12:14 | - | |
| Please Help - Driver Issue!!/ | 2022-03-28 12:14 | - | |
| Please Help About My Aspire 5103 Internal Cam/ | 2022-03-28 12:14 | - | |
| Please Help Me Find Battery For My Acer Aspire/ | 2022-03-28 12:14 | - | |
| Please Help acer , aspire 5920g/ | 2022-03-28 12:14 | - | |
| Please Please Help me!!!/ | 2022-03-28 12:14 | - | |
| Please Please help/ | 2022-03-28 12:14 | - | |
| Please advise on 5100 series/ | 2022-03-28 12:14 | - | |
| Please help!! Is my AS5630-6895 defective/ | 2022-03-28 12:14 | - | |
| Please help, need info asap!!!/ | 2022-03-28 12:14 | - | |
| Please help- Acer 3860 will not boot/ | 2022-03-28 12:14 | - | |
| Please help. Acer Aspire 7720 problems, booting and sound/ | 2022-03-28 12:14 | - | |
| Please help. Acer aspire 1652wlmi bios failure/ | 2022-03-28 12:14 | - | |
| Please help 6920g XP People/ | 2022-03-28 12:14 | - | |
| Please help acer extensa 5235 died after bad bios flash/ | 2022-03-28 12:14 | - | |
| Please help can no longer play DVD on aspire 3680/ | 2022-03-28 12:14 | - | |
| Please help driver problem/ | 2022-03-28 12:14 | - | |
| Please help me!/ | 2022-03-28 12:14 | - | |
| Please help me...falled in love with a 1672/ | 2022-03-28 12:14 | - | |
| Please help me go from vista to XP!!/ | 2022-03-28 12:14 | - | |
| Please help me regarding 5920G recovery Disc/ | 2022-03-28 12:14 | - | |
| Please help me urgently...deeep trouble/ | 2022-03-28 12:14 | - | |
| Please help me with my wireless issue/ | 2022-03-28 12:14 | - | |
| Please help tech savy me diagnose laptop/ | 2022-03-28 12:14 | - | |
| Please help to choose- TM4001lmi or Dell 600m (510m)/ | 2022-03-28 12:14 | - | |
| Please help with IAMT-driver/ | 2022-03-28 12:14 | - | |
| Please link me to Acer x700 mobility drivers/ | 2022-03-28 12:14 | - | |
| Please provide me some ideas/ | 2022-03-28 12:14 | - | |
| Please read this I need your help!/ | 2022-03-28 12:14 | - | |
| Please review the new A8-3500M APU Quad Core Acer Aspire AS5560G-SB485/ | 2022-03-28 12:14 | - | |
| Please someone help!!! with this here Acer laptop/ | 2022-03-28 12:14 | - | |
| Pls HELP me choose!!!/ | 2022-03-28 12:14 | - | |
| Pls Help..how can i format my acer laptop/ | 2022-03-28 12:14 | - | |
| Pls Help with my acer aspire 1 4710z/ | 2022-03-28 12:14 | - | |
| Pls advice me..which ACER laptop to buy/ | 2022-03-28 12:14 | - | |
| Pls a little help needed/ | 2022-03-28 12:14 | - | |
| Plugged in not charging/ | 2022-03-28 12:14 | - | |
| Plugged in not charging Acer 5738ZG/ | 2022-03-28 12:14 | - | |
| Plz Help/ | 2022-03-28 12:14 | - | |
| Plz Help me decide Acer 4601lmi v s 4601wlmi/ | 2022-03-28 12:14 | - | |
| Plz help concerning connection in Acer 5672 WLMI !!!!/ | 2022-03-28 12:14 | - | |
| Poll- Acer After sales Warranty and Support/ | 2022-03-28 12:14 | - | |
| Poll... How high do you run the brightness... any problem's/ | 2022-03-28 12:14 | - | |
| Poor VGA output - TM3200/ | 2022-03-28 12:14 | - | |
| Poor display on Acer 8930g/ | 2022-03-28 12:14 | - | |
| Poor games performance on 5920G - any owners able to help/ | 2022-03-28 12:14 | - | |
| Poor performance/ | 2022-03-28 12:14 | - | |
| Poor quality music (MP3s) coming from Acer Aspire laptop/ | 2022-03-28 12:14 | - | |
| Populated memory slots on TM4402/ | 2022-03-28 12:14 | - | |
| Porbs installing drivers after fresh install/ | 2022-03-28 12:14 | - | |
| Port Replicator III/ | 2022-03-28 12:14 | - | |
| Portable Laptop power scheme in XP/ | 2022-03-28 12:14 | - | |
| Portable Slim USB DVD Drive Recommendation/ | 2022-03-28 12:14 | - | |
| Possibility to upgrade Graphics Card [Aspire 6920G]/ | 2022-03-28 12:14 | - | |
| Possible Acer Battery Recall - TravelMate & Aspires from 5 2004-11 2006/ | 2022-03-28 12:14 | - | |
| Possible Hard Disk Problem With Acer 5102/ | 2022-03-28 12:14 | - | |
| Possible Lid Switch problems with 3 Extensa 5430's/ | 2022-03-28 12:14 | - | |
| Possible Memory leak in Vista/ | 2022-03-28 12:14 | - | |
| Possible compatibility issue with acer aspire 5736z hdd upgrade/ | 2022-03-28 12:14 | - | |
| Possible issue between AVG 2011 and Arcade Deluxe/ | 2022-03-28 12:14 | - | |
| Possible to add Blu-ray to 6920-6864/ | 2022-03-28 12:14 | - | |
| Possible to add TV tuner to Acer Aspire 5920g/ | 2022-03-28 12:14 | - | |
| Possible to install a intel quad core mobile Q9000 in the acer 6930G/ | 2022-03-28 12:14 | - | |
| Possible to replace a plastic motherboard ribbon lock (4820tg)/ | 2022-03-28 12:14 | - | |
| Possible to replace the screen for a better one on an Aspire 5750G/ | 2022-03-28 12:14 | - | |
| Possible to turn off one core on CPU/ | 2022-03-28 12:14 | - | |
| Possible to upgrade built in wirelesscard on 5100/ | 2022-03-28 12:14 | - | |
| Possible to upgrade the 5920`s hd/ | 2022-03-28 12:14 | - | |
| Possibly Overclocking an Unclockable 3820TG/ | 2022-03-28 12:14 | - | |
| Possibly faulty temperature sensor on Acer 7741G/ | 2022-03-28 12:14 | - | |
| Post AS5672 Info Only No Questions Please/ | 2022-03-28 12:14 | - | |
| Post Acer Disk Formatter CD/ | 2022-03-28 12:14 | - | |
| Post Acer Disk Formatter CD ISO Image/ | 2022-03-28 12:14 | - | |
| Post XP Install - SATA drivers 5315-2122/ | 2022-03-28 12:14 | - | |
| Post which processes are running when your laptop is first booted/ | 2022-03-28 12:14 | - | |
| Power Aadaptor for the car/ | 2022-03-28 12:14 | - | |
| Power Adapter Question/ | 2022-03-28 12:14 | - | |
| Power Li9ght Blinks Blue, Doesn't Charge/ | 2022-03-28 12:14 | - | |
| Power Options Aspire 5610/ | 2022-03-28 12:14 | - | |
| Power Supply Question...PLEASE HELP!/ | 2022-03-28 12:14 | - | |
| Power Supply on the Ferrari 3200 and Aspire 2012/ | 2022-03-28 12:14 | - | |
| Power adapter for Extensa 4620-4605/ | 2022-03-28 12:14 | - | |
| Power button doesn't always work immediately/ | 2022-03-28 12:14 | - | |
| Power button stopped working!!/ | 2022-03-28 12:14 | - | |
| Power connection/ | 2022-03-28 12:14 | - | |
| Power consumption/ | 2022-03-28 12:14 | - | |
| Power consumption on 8204/ | 2022-03-28 12:14 | - | |
| Power cycle flash bios/ | 2022-03-28 12:14 | - | |
| Powering Problem -confused-/ | 2022-03-28 12:14 | - | |
| Power issue helppp/ | 2022-03-28 12:14 | - | |
| Power issue on my 6920G. Help/ | 2022-03-28 12:14 | - | |
| Power issues/ | 2022-03-28 12:14 | - | |
| Power issues with TM8104WLMi/ | 2022-03-28 12:14 | - | |
| Power issue with acer 5315/ | 2022-03-28 12:14 | - | |
| Powermanagement trouble/ | 2022-03-28 12:14 | - | |
| Power probs with aspire 7736Z/ | 2022-03-28 12:14 | - | |
| Power recharge area is tweaky/ | 2022-03-28 12:14 | - | |
| Power supply dead/ | 2022-03-28 12:14 | - | |
| Power turns on, but not screen/ | 2022-03-28 12:14 | - | |
| Pqservice 5741g/ | 2022-03-28 12:14 | - | |
| Pre Santa Rosa release bargain/ | 2022-03-28 12:14 | - | |
| Pred Triton 500 Reinstalled Windows - How do I get the turbo button to work/ | 2022-03-28 12:14 | - | |
| Predator 17x (GX-792) i7-7820HK clocks locked when battery reaches 30%/ | 2022-03-28 12:14 | - | |
| Predator 17x 1080gtx owners lounge/ | 2022-03-28 12:14 | - | |
| Predator 17x GX 792-7448 low scores/ | 2022-03-28 12:14 | - | |
| Predator G9-973 with 1070 and kaby lake cup, is it running too hot or too loud/ | 2022-03-28 12:14 | - | |
| Predator GX-792 (i7-7820HK and gtx1080)/ | 2022-03-28 12:14 | - | |
| Predator Helios 300 G3-571-77QK Screen Display model/ | 2022-03-28 12:14 | - | |
| Predator Helios 300 Power Loss while gaming/ | 2022-03-28 12:14 | - | |
| PredatorSence won't change calibration/ | 2022-03-28 12:14 | - | |
| Predator laptop/ | 2022-03-28 12:14 | - | |
| Predatorsense/ | 2022-03-28 12:14 | - | |
| Preparing for a repair job/ | 2022-03-28 12:14 | - | |
| Prevent Aspire 5610 from downclocking the CPU/ | 2022-03-28 12:14 | - | |
| Price drop/ | 2022-03-28 12:14 | - | |
| Primary IDE Channel PIO MODE ONLY/ | 2022-03-28 12:14 | - | |
| Priority setting/ | 2022-03-28 12:14 | - | |
| Prob 5920g blackscreen/ | 2022-03-28 12:14 | - | |
| Problem 5810TZG and HD4330/ | 2022-03-28 12:14 | - | |
| Problem 8935G -- HD 6770M/ | 2022-03-28 12:14 | - | |
| Problem Acer Aspire 5742G/ | 2022-03-28 12:14 | - | |
| Problem Acer Travelmate 7720G-602G50Mn/ | 2022-03-28 12:14 | - | |
| Problem Booting Xp Acer Ferrari 4003WLM/ | 2022-03-28 12:14 | - | |
| Problem With My 5920g cooling fan/ | 2022-03-28 12:14 | - | |
| Problem With My Acer After BIOS Upgrade/ | 2022-03-28 12:14 | - | |
| Problem With acer Travel Mate/ | 2022-03-28 12:14 | - | |
| Problem accessing remote screen/ | 2022-03-28 12:14 | - | |
| Problem acer 5920g upgrading to 8600m gt/ | 2022-03-28 12:14 | - | |
| Problem adding 2nd HDD on TravelMate 7520G/ | 2022-03-28 12:14 | - | |
| Problem booting 7735zg/ | 2022-03-28 12:14 | - | |
| Problem changing boot order!!!/ | 2022-03-28 12:14 | - | |
| Problem during initial boot up with aspire 5530 notebook/ | 2022-03-28 12:14 | - | |
| Problem finding drivers after format Acer TM C112Tci/ | 2022-03-28 12:14 | - | |
| Problem getting network internet connection (in China)/ | 2022-03-28 12:14 | - | |
| Problem in Empowering Key/ | 2022-03-28 12:14 | - | |
| Problem installing AHCI Drivers for windows xp/ | 2022-03-28 12:14 | - | |
| Problem installing Acer Aspire 3682 Laptop/ | 2022-03-28 12:14 | - | |
| Problem installing Trial Version of Adobe LR 3.2/ | 2022-03-28 12:14 | - | |
| Problem installing Windows XP on Acer Aspire7535/ | 2022-03-28 12:14 | - | |
| Problem installing Windows on newly bought Aspire 2920z/ | 2022-03-28 12:14 | - | |
| Problem installing webcam on my laptop/ | 2022-03-28 12:14 | - | |
| Problem loading Windows 7/ | 2022-03-28 12:14 | - | |
| Problem of Acer 6935G output to LCDTV/ | 2022-03-28 12:14 | - | |
| Problem reading DVD's on hd dvd on 5920g/ | 2022-03-28 12:14 | - | |
| Problem recognize devices Acer Aspire 5101awlmi/ | 2022-03-28 12:14 | - | |
| Problem running eRecovery/ | 2022-03-28 12:14 | - | |
| Problems With XP on 5920g aspire/ | 2022-03-28 12:14 | - | |
| Problems adding Ram/ | 2022-03-28 12:14 | - | |
| Problems after RAM upgrade [5750g]/ | 2022-03-28 12:14 | - | |
| Problems connecting laptop to LCD TV/ | 2022-03-28 12:14 | - | |
| Problems connecting to internet/ | 2022-03-28 12:14 | - | |
| Problems following format and new install....pls help!/ | 2022-03-28 12:14 | - | |
| Problems installing XP on an ASPIRE 4530/ | 2022-03-28 12:14 | - | |
| Problems installing new GFX driver/ | 2022-03-28 12:14 | - | |
| Problems restoring factory image 5610-2273/ | 2022-03-28 12:14 | - | |
| Problems with 1681 DVD-Dual- QSI SDW-042/ | 2022-03-28 12:14 | - | |
| Problems with 5672WLMI/ | 2022-03-28 12:14 | - | |
| Problems with 8935G upgrade to HD6770/ | 2022-03-28 12:14 | - | |
| Problems with ACER TIMELINE 3810/ | 2022-03-28 12:14 | - | |
| Problems with AS5520/ | 2022-03-28 12:14 | - | |
| Problems with ATi HD4670 MXM and 5920G/ | 2022-03-28 12:14 | - | |
| Problems with Acer 6920 - Constant Freezing Problems/ | 2022-03-28 12:14 | - | |
| Problems with Acer 8943G keyboard/ | 2022-03-28 12:14 | - | |
| Problems with Acer Aspire 1694 (freezes)/ | 2022-03-28 12:14 | - | |
| Problems with Acer Aspire 4315...Help please!/ | 2022-03-28 12:14 | - | |
| Problems with Acer Aspire 7720G WLan and booting after sleep/ | 2022-03-28 12:14 | - | |
| Problems with Acer Ferrari 3000!!/ | 2022-03-28 12:14 | - | |
| Problems with Acer Travelmate 4674/ | 2022-03-28 12:14 | - | |
| Problems with Acer eRecovery Managment/ | 2022-03-28 12:14 | - | |
| Problems with Aspire 1691WLCI DVD RW/ | 2022-03-28 12:14 | - | |
| Problems with Aspire 3023LMi/ | 2022-03-28 12:14 | - | |
| Problems with Aspire 5542G/ | 2022-03-28 12:14 | - | |
| Problems with CD DVD drive of Acer 1640/ | 2022-03-28 12:14 | - | |
| Problems with DVD drive ACER 5670/ | 2022-03-28 12:14 | - | |
| Problems with Fifa 2006 on Acer Travelmate 8101/ | 2022-03-28 12:14 | - | |
| Problems with Firewire PCMCIA card and 5315/ | 2022-03-28 12:14 | - | |
| Problems with LAN/ | 2022-03-28 12:14 | - | |
| Problems with Laptop turning into a microphone/ | 2022-03-28 12:14 | - | |
| Problems with Partition on 3690/ | 2022-03-28 12:14 | - | |
| Problems with Win MCE on Aspire 5634/ | 2022-03-28 12:14 | - | |
| Problems with acer wireless/ | 2022-03-28 12:14 | - | |
| Problems with an Acer Aspire 3000/ | 2022-03-28 12:14 | - | |
| Problems with completing the installation on Acer Aspire 5920. Please help!/ | 2022-03-28 12:14 | - | |
| Problems with external monitor and travelmate 3012/ | 2022-03-28 12:14 | - | |
| Problems with my 6920/ | 2022-03-28 12:14 | - | |
| Problems with my Acer 5630 webcam/ | 2022-03-28 12:14 | - | |
| Problems with my Aspire 5050/ | 2022-03-28 12:14 | - | |
| Problems with recovery disks on Ferrari 3400/ | 2022-03-28 12:14 | - | |
| Problems with the DVD Drive and eRecovery 5920G/ | 2022-03-28 12:14 | - | |
| Problems with touchpad/ | 2022-03-28 12:14 | - | |
| Problem to play the EA games using Acer Notebook/ | 2022-03-28 12:14 | - | |
| Problem transfering files/ | 2022-03-28 12:14 | - | |
| Problem updating the driver for geforce 8600m Gt 512 on a 5920g/ | 2022-03-28 12:14 | - | |
| Problem with 6 screens/ | 2022-03-28 12:14 | - | |
| Problem with 3810T monitor/ | 2022-03-28 12:14 | - | |
| Problem with 5620Z with external LG monitor/ | 2022-03-28 12:14 | - | |
| Problem with 6920g soundcard/ | 2022-03-28 12:14 | - | |
| Problem with 9814wkmi!!!/ | 2022-03-28 12:14 | - | |
| Problem with ACER 5630-6803 video brightness/ | 2022-03-28 12:14 | - | |
| Problem with ACER VCM on the 8204/ | 2022-03-28 12:14 | - | |
| Problem with AS1681/ | 2022-03-28 12:14 | - | |
| Problem with Ace Aspire 8951g/ | 2022-03-28 12:14 | - | |
| Problem with Acer 3680 laptop/ | 2022-03-28 12:14 | - | |
| Problem with Acer 3810TZ and Bluetooth Dongle/ | 2022-03-28 12:14 | - | |
| Problem with Acer 5102 only 60hz/ | 2022-03-28 12:14 | - | |
| Problem with Acer 5310 and Vista SP-1/ | 2022-03-28 12:14 | - | |
| Problem with Acer 5536G/ | 2022-03-28 12:14 | - | |
| Problem with Acer 5560 after clean install/ | 2022-03-28 12:14 | - | |
| Problem with Acer 5630/ | 2022-03-28 12:14 | - | |
| Problem with Acer 5630G!/ | 2022-03-28 12:14 | - | |
| Problem with Acer Aspire/ | 2022-03-28 12:14 | - | |
| Problem with Acer Aspire 4720z/ | 2022-03-28 12:14 | - | |
| Problem with Acer Aspire 5920 CPU swap/ | 2022-03-28 12:14 | - | |
| Problem with Acer Aspire 5920g/ | 2022-03-28 12:14 | - | |
| Problem with Acer Aspire 8930/ | 2022-03-28 12:14 | - | |
| Problem with Acer Extensa 5420 corruption files/ | 2022-03-28 12:14 | - | |
| Problem with Acer Extensa 5630g/ | 2022-03-28 12:14 | - | |
| Problem with Acer S7-391/ | 2022-03-28 12:14 | - | |
| Problem with Acer TouchPortal/ | 2022-03-28 12:14 | - | |
| Problem with Acer Travelmate C110, possible BIOS failure/ | 2022-03-28 12:14 | - | |
| Problem with Acer Vista eRecovery/ | 2022-03-28 12:14 | - | |
| Problem with Acer aspire 5535-6637, turns on but will not run/ | 2022-03-28 12:14 | - | |
| Problem with Acer eRecovery/ | 2022-03-28 12:14 | - | |
| Problem with Acer notebook - unmountable boot volume/ | 2022-03-28 12:14 | - | |
| Problem with Acer screen turning off/ | 2022-03-28 12:14 | - | |
| Problem with Aspire 1350/ | 2022-03-28 12:14 | - | |
| Problem with Aspire 1520 - Can anyone help, please/ | 2022-03-28 12:14 | - | |
| Problem with Aspire 2023- No Display!!/ | 2022-03-28 12:14 | - | |
| Problem with Aspire 5610/ | 2022-03-28 12:14 | - | |
| Problem with Aspire 5632/ | 2022-03-28 12:14 | - | |
| Problem with BIOS after new Hard Disk Install/ | 2022-03-28 12:14 | - | |
| Problem with BIOS password/ | 2022-03-28 12:14 | - | |
| Problem with CD burning/ | 2022-03-28 12:14 | - | |
| Problem with Connecting Predator 15 to Samsung KU6300 4K TV/ | 2022-03-28 12:14 | - | |
| Problem with DVD writing (8930)/ | 2022-03-28 12:14 | - | |
| Problem with Empowering Framework/ | 2022-03-28 12:14 | - | |
| Problem with GTX 860m/ | 2022-03-28 12:14 | - | |
| Problem with NAPP/ | 2022-03-28 12:14 | - | |
| Problem with Notebook Lid Switch - Screen turns off automatically/ | 2022-03-28 12:14 | - | |
| Problem with RTKHDAUD.SYS on new 8204/ | 2022-03-28 12:14 | - | |
| Problem with Screen - Acer Aspire 4320 Laptop/ | 2022-03-28 12:14 | - | |
| Problem with Sound/ | 2022-03-28 12:14 | - | |
| Problem with Sound Regulation on Touchpad on 8930G/ | 2022-03-28 12:14 | - | |
| Problem with Vista on my Aspire 5630/ | 2022-03-28 12:14 | - | |
| Problem with acer aspire 1640/ | 2022-03-28 12:14 | - | |
| Problem with acer aspire 3935 monitor/ | 2022-03-28 12:14 | - | |
| Problem with acer travelmate 5310/ | 2022-03-28 12:14 | - | |
| Problem with aspire one/ | 2022-03-28 12:14 | - | |
| Problem with bios flash Acer 5672WLMi/ | 2022-03-28 12:14 | - | |
| Problem with boot menu/ | 2022-03-28 12:14 | - | |
| Problem with built-in microphone/ | 2022-03-28 12:14 | - | |
| Problem with card reader Acer Aspire 4520/ | 2022-03-28 12:14 | - | |
| Problem with display in Aspire 2023/ | 2022-03-28 12:14 | - | |
| Problem with hard disk reading/ | 2022-03-28 12:14 | - | |
| Problem with installing ATI driver X700/ | 2022-03-28 12:14 | - | |
| Problem with installing new laptop driver!/ | 2022-03-28 12:14 | - | |
| Problem with intalling OS/ | 2022-03-28 12:14 | - | |
| Problem with internet connection/ | 2022-03-28 12:14 | - | |
| Problem with keyboard and touch pad/ | 2022-03-28 12:14 | - | |
| Problem with microprocessor/ | 2022-03-28 12:14 | - | |
| Problem with my 5920g/ | 2022-03-28 12:14 | - | |
| Problem with my Acer Aspire 5680/ | 2022-03-28 12:14 | - | |
| Problem with my Acer Travelmate 3044WTMi/ | 2022-03-28 12:14 | - | |
| Problem with my acer 2420 notebook/ | 2022-03-28 12:14 | - | |
| Problem with my keyboard on Acer Aspire 5670!!!!!!/ | 2022-03-28 12:14 | - | |
| Problem with reading CDs/ | 2022-03-28 12:14 | - | |
| Problem with sleep on vista/ | 2022-03-28 12:14 | - | |
| Problem with switchable graphics on the V5 561G/ | 2022-03-28 12:14 | - | |
| Problem with system boot on aspire 1362 WLMi/ | 2022-03-28 12:14 | - | |
| Problem with the CD-ROM drive/ | 2022-03-28 12:14 | - | |
| Problem with the D2D recovery/ | 2022-03-28 12:14 | - | |
| Problem with viewing video at full screen/ | 2022-03-28 12:14 | - | |
| Problem with volume, bluetooth, internet signals/ | 2022-03-28 12:14 | - | |
| Problem with wifi/ | 2022-03-28 12:14 | - | |
| Problem with x1600 graphics (on 8204 laptop)/ | 2022-03-28 12:14 | - | |
| Processor/ | 2022-03-28 12:14 | - | |
| Processor and usb Porblem/ | 2022-03-28 12:14 | - | |
| Processor sound(fan sound) is coming from my lappy acer aspire 5920/ | 2022-03-28 12:14 | - | |
| Processor up-grade for Aspire 3050/ | 2022-03-28 12:14 | - | |
| Processor upgradability/ | 2022-03-28 12:14 | - | |
| Processor upgrade question regarding Aspire 5920/ | 2022-03-28 12:14 | - | |
| Program for Product key/ | 2022-03-28 12:14 | - | |
| Proper Thermal pad for Acer Predator 15 (G9-593)/ | 2022-03-28 12:14 | - | |
| Protective Battery Compartment Cover/ | 2022-03-28 12:14 | - | |
| Proving the Netbooks Can't Run Windows 7 myth WRONG!!!/ | 2022-03-28 12:14 | - | |
| Pulling my hair out with HDD problems on Acer Aspire 6930g/ | 2022-03-28 12:14 | - | |
| PunkThis - In an Acer (Computex 2011)/ | 2022-03-28 12:14 | - | |
| Purchased an 5920-6313/ | 2022-03-28 12:14 | - | |
| Purchasing 8204 in June-July/ | 2022-03-28 12:14 | - | |
| Purchasing Acer Triton 700 soon. Anything I should know about before buying/ | 2022-03-28 12:14 | - | |
| Purchasing Notebook from overseas/ | 2022-03-28 12:14 | - | |
| Put a Geforce 9650m GT in my Acer 7720g/ | 2022-03-28 12:14 | - | |
| Put old SSD in 3820TG, slow boot and missing miniport/ | 2022-03-28 12:14 | - | |
| Putting key back on acer aspire 5610/ | 2022-03-28 12:14 | - | |
| Q9000 in 6920/ | 2022-03-28 12:14 | - | |
| Q9100, Q9200 in 8930G (1.14 bios) possible/ | 2022-03-28 12:14 | - | |
| QX9300 in 5935g 8935g/ | 2022-03-28 12:14 | - | |
| Q about Overclocking my Laptop/ | 2022-03-28 12:14 | - | |
| Quadro FX 770M not work Acer 7720G/ | 2022-03-28 12:14 | - | |
| Quality of Parts in Acers/ | 2022-03-28 12:14 | - | |
| Queries on Acer 4502Wlmi/ | 2022-03-28 12:14 | - | |
| Query concerning heat vent in Acer Travelmate 4220/ | 2022-03-28 12:14 | - | |
| Ques - 3820TG screen n small review/ | 2022-03-28 12:14 | - | |
| Question- Acer's tech support TM 4502LMI/ | 2022-03-28 12:14 | - | |
| Question- Graphic Cards and screen TM8200 VS 5670/ | 2022-03-28 12:14 | - | |
| Question- Intel 855GME drivers/ | 2022-03-28 12:14 | - | |
| Question- Just bought an Acer Extensa 5620-4020 laptop/ | 2022-03-28 12:14 | - | |
| Question- Reformatting the Acer TravelMate4502LMi/ | 2022-03-28 12:14 | - | |
| Question - Vista 32 upgrade Iso on acer ftp server/ | 2022-03-28 12:14 | - | |
| Question- Will AC power affect battery life/ | 2022-03-28 12:14 | - | |
| Question/ | 2022-03-28 12:14 | - | |
| Question Acer 3100-3102/ | 2022-03-28 12:14 | - | |
| Question Aspire 5100 bios/ | 2022-03-28 12:14 | - | |
| Question For Acer TimelineX 1830T Owners/ | 2022-03-28 12:14 | - | |
| Question Please/ | 2022-03-28 12:14 | - | |
| Question abour a Hard Drive/ | 2022-03-28 12:14 | - | |
| Question about 'write cache' of hard disk acer5920g/ | 2022-03-28 12:14 | - | |
| Question about 8104WLMI/ | 2022-03-28 12:14 | - | |
| Question about 8204 Noise/ | 2022-03-28 12:14 | - | |
| Question about Acer's display/ | 2022-03-28 12:14 | - | |
| Question about Acer's supply of parts/ | 2022-03-28 12:14 | - | |
| Question about Acer 5253 - BZ602/ | 2022-03-28 12:14 | - | |
| Question about Acer Aspire 3022WLMi/ | 2022-03-28 12:14 | - | |
| Question about Acer Aspire 7530 bluetooth/ | 2022-03-28 12:14 | - | |
| Question about Acer Windows 7 upgrade kit/ | 2022-03-28 12:14 | - | |
| Question about Acer general setup (Partitions Recovery )/ | 2022-03-28 12:14 | - | |
| Question about Acer screen saver !!!/ | 2022-03-28 12:14 | - | |
| Question about Aspire 5135/ | 2022-03-28 12:14 | - | |
| Question about Audio on 5100/ | 2022-03-28 12:14 | - | |
| Question about Ferrari 3200/ | 2022-03-28 12:14 | - | |
| Question about System Restore CD's/ | 2022-03-28 12:14 | - | |
| Question about an Acer Aspire 4720Z/ | 2022-03-28 12:14 | - | |
| Question about bloatware and the Acer 5920g/ | 2022-03-28 12:14 | - | |
| Question about drivers/ | 2022-03-28 12:14 | - | |
| Question about modifying GPU BIOS/ | 2022-03-28 12:14 | - | |
| Question about my notebook's memory/ | 2022-03-28 12:14 | - | |
| Question about new E 11 fanless notebooks/ | 2022-03-28 12:14 | - | |
| Question about new battery/ | 2022-03-28 12:14 | - | |
| Question about playing Farcry with 5672WLMi/ | 2022-03-28 12:14 | - | |
| Question about replacing Acer laptop's keyboard/ | 2022-03-28 12:14 | - | |
| Question about screen/ | 2022-03-28 12:14 | - | |
| Question about the 4501/ | 2022-03-28 12:14 | - | |
| Question about the Acer Aspire 5951G/ | 2022-03-28 12:14 | - | |
| Question about the Acer Empowering Technology/ | 2022-03-28 12:14 | - | |
| Question about the Acer T2080 from Best Buy/ | 2022-03-28 12:14 | - | |
| Question about the Acer TravelMate 4011WLCI/ | 2022-03-28 12:14 | - | |
| Question about the processor in Acer Aspire 5810TZ-4657/ | 2022-03-28 12:14 | - | |
| Question about this laptop's video card/ | 2022-03-28 12:14 | - | |
| Question for 8920g owners/ | 2022-03-28 12:14 | - | |
| Question for 8943G owners/ | 2022-03-28 12:14 | - | |
| Question for Ferrari owners/ | 2022-03-28 12:14 | - | |
| Question on Acer 6920/ | 2022-03-28 12:14 | - | |
| Question on CPU upgrade/ | 2022-03-28 12:14 | - | |
| Question on motherboard compatibility/ | 2022-03-28 12:14 | - | |
| Question on startup programs/ | 2022-03-28 12:14 | - | |
| Question on the AS5672WLMi....how long does the battery lasts/ | 2022-03-28 12:14 | - | |
| Question re Get Quicker Internet Confirmation Tweak/ | 2022-03-28 12:14 | - | |
| Question regarding 8930G-644G32MN LX.ADT0X.275/ | 2022-03-28 12:14 | - | |
| Question regarding ACER Notebooks/ | 2022-03-28 12:14 | - | |
| Question regarding the Acer Aspire 1414WLCi-XPH/ | 2022-03-28 12:14 | - | |
| Questions - Acer Aspire Intel Core 2 Duo T5450 1.66GHz Laptop (EX5620-6389)/ | 2022-03-28 12:14 | - | |
| Questions- Changing flashing the bios for a clean install + fixing Acer partitions eRecovery/ | 2022-03-28 12:14 | - | |
| Questions About The Acer Aspire 3003LCi/ | 2022-03-28 12:14 | - | |
| Questions about 8943g/ | 2022-03-28 12:14 | - | |
| Questions about ACER/ | 2022-03-28 12:14 | - | |
| Questions about NTFS/ | 2022-03-28 12:14 | - | |
| Questions about TM 3212/ | 2022-03-28 12:14 | - | |
| Questions about aspire 5738PG-6306/ | 2022-03-28 12:14 | - | |
| Questions about my new Aspire 6930G/ | 2022-03-28 12:14 | - | |
| Questions about ram, hdd. overclocking/ | 2022-03-28 12:14 | - | |
| Questions about the AS1691WLMI/ | 2022-03-28 12:14 | - | |
| Questions about the Aspire 4820TG/ | 2022-03-28 12:14 | - | |
| Questions before buying an Acer !/ | 2022-03-28 12:14 | - | |
| Questions for Acer Ferrari 4005 Buyers/ | 2022-03-28 12:14 | - | |
| Questions in GPU and CPU/ | 2022-03-28 12:14 | - | |
| Questions on PQ Service partition and others/ | 2022-03-28 12:14 | - | |
| Questions on acer aspire 5942g/ | 2022-03-28 12:14 | - | |
| Questions on new Acers/ | 2022-03-28 12:14 | - | |
| Questions on the Acer Aspire/ | 2022-03-28 12:14 | - | |
| Questions on the Aspire AS5542G/ | 2022-03-28 12:14 | - | |
| Questions on touchpad (Elan )/ | 2022-03-28 12:14 | - | |
| Questions regarding Acer service and what they reinstall on a replacement HDD/ | 2022-03-28 12:14 | - | |
| Questions regarding clean install/ | 2022-03-28 12:14 | - | |
| Questions regarding possible Acer AS4715 CPU upgrade/ | 2022-03-28 12:14 | - | |
| Questions to Acer 1410 owners (crapware removal & extended warranty)/ | 2022-03-28 12:14 | - | |
| Question with Acer TM 3201XCi/ | 2022-03-28 12:14 | - | |
| Quick 5935G upgrade advice/ | 2022-03-28 12:14 | - | |
| Quick Battery Charge Question/ | 2022-03-28 12:14 | - | |
| Quick Q- Which Acer 6920G BIOS/ | 2022-03-28 12:14 | - | |
| Quick Stupid Question/ | 2022-03-28 12:14 | - | |
| Quickly switching touchpad configurations - is there a way/ | 2022-03-28 12:14 | - | |
| Quick note to 7738G quad upgraders/ | 2022-03-28 12:14 | - | |
| Quick post... benefit of FAT32 partitions/ | 2022-03-28 12:14 | - | |
| Quick question/ | 2022-03-28 12:14 | - | |
| Quick question about RMA/ | 2022-03-28 12:14 | - | |
| Quick question about videocard 8930G/ | 2022-03-28 12:14 | - | |
| QuietHDD won't start on startup/ | 2022-03-28 12:14 | - | |
| Quieter fan for Aspire 2012/ | 2022-03-28 12:14 | - | |
| Quite Laptops/ | 2022-03-28 12:14 | - | |
| RAM Not showing up/ | 2022-03-28 12:14 | - | |
| RAM Questions/ | 2022-03-28 12:14 | - | |
| RAM Upgrade - 4820tg/ | 2022-03-28 12:14 | - | |
| RAM Upgrade. Two questions/ | 2022-03-28 12:14 | - | |
| RAM Upgrading for 8005LMi TarvelMate/ | 2022-03-28 12:14 | - | |
| RAM in ACER TM2800/ | 2022-03-28 12:14 | - | |
| RAM information discrepancy/ | 2022-03-28 12:14 | - | |
| RAM manufacturer/ | 2022-03-28 12:14 | - | |
| RAM or Harddrive HeLP!!!/ | 2022-03-28 12:14 | - | |
| RAM question/ | 2022-03-28 12:14 | - | |
| RAM question about aspire 5102wlmi/ | 2022-03-28 12:14 | - | |
| RAM slots/ | 2022-03-28 12:14 | - | |
| RAM upgrade for Aspire 5315-2895 (not sure which one)/ | 2022-03-28 12:14 | - | |
| RAM upgrade help for Acer30004WLCi/ | 2022-03-28 12:14 | - | |
| RAM upgrade problem/ | 2022-03-28 12:14 | - | |
| READ BEFORE POSTING The Ultimate ACER Resource Thread/ | 2022-03-28 12:14 | - | |
| REALLY strange boot issue on Acer Aspire 2930 laptop - corrupted BIOS/ | 2022-03-28 12:14 | - | |
| REQ- needed a pic of a 1410 1810 after TME mod/ | 2022-03-28 12:15 | - | |
| REQUEST Acer Aspire 6920 Bios Unlock/ | 2022-03-28 12:15 | - | |
| RM Clock utility 1.6 in lieu of 2.25/ | 2022-03-28 12:15 | - | |
| ROM chip information for Acer Aspire 2930/ | 2022-03-28 12:15 | - | |
| ROM drive takes 20 seconds to POST/ | 2022-03-28 12:15 | - | |
| RS232 and Parallel port for Travelmate 4000/ | 2022-03-28 12:15 | - | |
| RTC Battery (Cmos battery) Acer/ | 2022-03-28 12:15 | - | |
| RTHDCPL.EXE - Illegal System DLL Relocation/ | 2022-03-28 12:15 | - | |
| Radeon 3650 M86M vs M86ME (VG.86M06.004)/ | 2022-03-28 12:14 | - | |
| Radeon 9700 64 mb vs. Radeon 9200 128 mb/ | 2022-03-28 12:14 | - | |
| Radeon driver for Extensa 4420-5910/ | 2022-03-28 12:14 | - | |
| Ram/ | 2022-03-28 12:14 | - | |
| Ram Upgrade/ | 2022-03-28 12:14 | - | |
| Ram Upgrade 5672/ | 2022-03-28 12:14 | - | |
| Ram Upgrade on Acer Aspire 5610z (4GB)/ | 2022-03-28 12:14 | - | |
| Ram upgrade on Acer 5920G/ | 2022-03-28 12:14 | - | |
| Ram upgrade problem on Aspire 9815/ | 2022-03-28 12:14 | - | |
| Ram upgrade question (AS 5942g)/ | 2022-03-28 12:14 | - | |
| Ram upgrade worth it/ | 2022-03-28 12:14 | - | |
| Random Acer 1690 questions/ | 2022-03-28 12:14 | - | |
| Random BSOD Acer aspire 8940g/ | 2022-03-28 12:14 | - | |
| Random Beeping/ | 2022-03-28 12:14 | - | |
| Random Cursor Movement/ | 2022-03-28 12:14 | - | |
| Random annoying beep solved/ | 2022-03-28 12:14 | - | |
| Random characters on screen - Acer 5601AWLMi/ | 2022-03-28 12:14 | - | |
| Random freeze with Timeline 4810TZ/ | 2022-03-28 12:14 | - | |
| Random shutdowns after Vista SP2 install/ | 2022-03-28 12:14 | - | |
| Re- Aspire 9120/ | 2022-03-28 12:14 | - | |
| Re- Need Help in obtaining information about Aspire 5050-3785/ | 2022-03-28 12:14 | - | |
| Re-create the MBR or Clean Install XP (can't make up my mind, PLEASE HELP)/ | 2022-03-28 12:14 | - | |
| Re-installation of XP/ | 2022-03-28 12:14 | - | |
| Re-installed W7 on 1410, now no internet!/ | 2022-03-28 12:14 | - | |
| ReInstall Vista/ | 2022-03-28 12:15 | - | |
| Read this before buying Acer!/ | 2022-03-28 12:14 | - | |
| ReadyBoost in SD/ | 2022-03-28 12:14 | - | |
| Really Bad Sound Perfomace on 5610/ | 2022-03-28 12:14 | - | |
| Really Stupid Notebook Question/ | 2022-03-28 12:15 | - | |
| Really weird inbuilt microphone problem/ | 2022-03-28 12:15 | - | |
| Really weird partitions/ | 2022-03-28 12:15 | - | |
| Realtek 2.56 x-fi/ | 2022-03-28 12:15 | - | |
| Realtek Audio Driver not working!/ | 2022-03-28 12:15 | - | |
| Realtek Audio driver isssue on Acer Aspire 5920G running Windows 7 ultimate 64 Bit/ | 2022-03-28 12:15 | - | |
| Realtek Audio on my 8204 WLMI/ | 2022-03-28 12:15 | - | |
| Realtek Drivers/ | 2022-03-28 12:15 | - | |
| Realtek HD Audio - Cannot set as input source/ | 2022-03-28 12:15 | - | |
| Realtek audio, no sound. New notebook Accer extenssa 5220/ | 2022-03-28 12:15 | - | |
| Realtek audio problems with aspire 3003!/ | 2022-03-28 12:15 | - | |
| Realtek gone wrong on Aspire 6935G/ | 2022-03-28 12:15 | - | |
| Realtek setting Microphone... what have I done/ | 2022-03-28 12:15 | - | |
| Real world battery life with 4820TG-3195/ | 2022-03-28 12:14 | - | |
| Reboot/ | 2022-03-28 12:15 | - | |
| Rebooting from recovery partition aspire 3620/ | 2022-03-28 12:15 | - | |
| Rebooting with 5672/ | 2022-03-28 12:15 | - | |
| Reboot loop/ | 2022-03-28 12:15 | - | |
| Reboot problem!/ | 2022-03-28 12:15 | - | |
| Recieved the wrong laptop. Ordered an Aspire 5750g, got an Aspire v3-571/ | 2022-03-28 12:15 | - | |
| Recommended RAM for as5520 running Vista/ | 2022-03-28 12:15 | - | |
| Recommended new NVidia Drivers 175.70 Vista 32-bit/ | 2022-03-28 12:15 | - | |
| Reconfigure DVD-buttons on Aspire 1804/ | 2022-03-28 12:15 | - | |
| Reconfiguring OS setup etc. on new travelmate didnt work!/ | 2022-03-28 12:15 | - | |
| Reconstructing the hidden recovery partition with the DVD/ | 2022-03-28 12:15 | - | |
| Record radio with Aspire 5100/ | 2022-03-28 12:15 | - | |
| Recover alt+f10 by having dual boot/ | 2022-03-28 12:15 | - | |
| Recovering OS from hidden partition/ | 2022-03-28 12:15 | - | |
| Recovering data from USB drive/ | 2022-03-28 12:15 | - | |
| Recover lost files from PSD/ | 2022-03-28 12:15 | - | |
| Recovery- Need original partitions sizes/ | 2022-03-28 12:15 | - | |
| Recovery/ | 2022-03-28 12:15 | - | |
| Recovery32 Type Mismatch/ | 2022-03-28 12:15 | - | |
| Recovery Aspire 5735Z/ | 2022-03-28 12:15 | - | |
| Recovery CD's HELP!/ | 2022-03-28 12:15 | - | |
| Recovery CD Needed/ | 2022-03-28 12:15 | - | |
| Recovery CD Needed for Acer Aspire 3100 series please/ | 2022-03-28 12:15 | - | |
| Recovery CD and Master Boot Record/ | 2022-03-28 12:15 | - | |
| Recovery CD doesnt boot.. cant recover the OS/ | 2022-03-28 12:15 | - | |
| Recovery CDs burned from comp are faulty/ | 2022-03-28 12:15 | - | |
| Recovery CDs for Acer 290/ | 2022-03-28 12:15 | - | |
| Recovery Disc question/ | 2022-03-28 12:15 | - | |
| Recovery Disk/ | 2022-03-28 12:15 | - | |
| Recovery Disk Question/ | 2022-03-28 12:15 | - | |
| Recovery Disks/ | 2022-03-28 12:15 | - | |
| Recovery HELP, 5315-2153. LONG story/ | 2022-03-28 12:15 | - | |
| Recovery Partition - factory or current OS/ | 2022-03-28 12:15 | - | |
| Recovery Partition/ | 2022-03-28 12:15 | - | |
| Recovery Partition Structure/ | 2022-03-28 12:15 | - | |
| Recovery Problem/ | 2022-03-28 12:15 | - | |
| Recovery Problems/ | 2022-03-28 12:15 | - | |
| Recovery Questions on Vista on 3690/ | 2022-03-28 12:15 | - | |
| Recovery backup disk 2+ months later/ | 2022-03-28 12:15 | - | |
| Recovery console admin password/ | 2022-03-28 12:15 | - | |
| Recovery disc/ | 2022-03-28 12:15 | - | |
| Recovery disk creation/ | 2022-03-28 12:15 | - | |
| Recovery disk for Acer Aspire 5580/ | 2022-03-28 12:15 | - | |
| Recovery disk for Aspire 5315/ | 2022-03-28 12:15 | - | |
| Recovery disks bought from acer not working/ | 2022-03-28 12:15 | - | |
| Recovery disks for Acer Aspire 5251/ | 2022-03-28 12:15 | - | |
| Recovery doesn't work/ | 2022-03-28 12:15 | - | |
| Recovery help!!/ | 2022-03-28 12:15 | - | |
| Recovery of Travelmate 240/ | 2022-03-28 12:15 | - | |
| Recovery of an ACER Extensa 5420 with the recovery disks and no recovery partition/ | 2022-03-28 12:15 | - | |
| Recovery partition backup - howto/ | 2022-03-28 12:15 | - | |
| Recovery partition question/ | 2022-03-28 12:15 | - | |
| Recovery problems on Aspire 3002wlmi/ | 2022-03-28 12:15 | - | |
| Recreating the Acer recovery partition/ | 2022-03-28 12:15 | - | |
| Red light constantly on/ | 2022-03-28 12:15 | - | |
| Red line across display - Aspire 1520 series/ | 2022-03-28 12:15 | - | |
| Redoing Windows, Acer 5601 - Questions! SEARCHED/ | 2022-03-28 12:15 | - | |
| Redoing acer 6935g thermal compound/ | 2022-03-28 12:15 | - | |
| Red pixel on display, its stuck or dead pixel can it be fixed/ | 2022-03-28 12:15 | - | |
| Red record light on 5920g/ | 2022-03-28 12:15 | - | |
| Reducing Fan Speed/ | 2022-03-28 12:15 | - | |
| Reformating my acer labtop/ | 2022-03-28 12:15 | - | |
| Reformat new laptop/ | 2022-03-28 12:15 | - | |
| Reformatting/ | 2022-03-28 12:15 | - | |
| Reformatting ACER ASPIRE 5600AWLMi/ | 2022-03-28 12:15 | - | |
| Reformatting Acer 3680 To XP/ | 2022-03-28 12:15 | - | |
| Reformatting Acer 5920G/ | 2022-03-28 12:15 | - | |
| Reformatting a new Acer Aspire 9424/ | 2022-03-28 12:15 | - | |
| Reformatting drive/ | 2022-03-28 12:15 | - | |
| Refurb Ferrari 4006 WMLi - worth buying/ | 2022-03-28 12:15 | - | |
| Refurbed Unit & Wrong Battery - Am I Being Ripped Off/ | 2022-03-28 12:15 | - | |
| Refurbished Acer Aspire One 751H-1948 good enough for everyday tasks/ | 2022-03-28 12:15 | - | |
| Regarding - Acer Delux to boot from my acer 5920G/ | 2022-03-28 12:15 | - | |
| Regarding graphics card upgrade on acer laptops/ | 2022-03-28 12:15 | - | |
| Regarding possible purchase in Canada/ | 2022-03-28 12:15 | - | |
| Regarding the multiplier tool I was talking about/ | 2022-03-28 12:15 | - | |
| Region Free DVD 8204/ | 2022-03-28 12:15 | - | |
| Regret getting the TM 8204/ | 2022-03-28 12:15 | - | |
| Reinforcing build quality on 5672/ | 2022-03-28 12:15 | - | |
| Reinstall Vista on brother and laws computer/ | 2022-03-28 12:15 | - | |
| Reinstalled windows vista on 5100. No Acer software/ | 2022-03-28 12:15 | - | |
| Reinstalling Win XP on Aspire 5002/ | 2022-03-28 12:15 | - | |
| Reinstalling Windows/ | 2022-03-28 12:15 | - | |
| Reinstalling Windows MCE/ | 2022-03-28 12:15 | - | |
| Reinstalling Windows XP on a replacement HD/ | 2022-03-28 12:15 | - | |
| Reinstalling Windows on my Aspire 3050/ | 2022-03-28 12:15 | - | |
| Reinstalling windows 7 - 4810T/ | 2022-03-28 12:15 | - | |
| Re install software from external cd drive/ | 2022-03-28 12:14 | - | |
| Re intalling windows on an Acer Aspire 5024 WLMI/ | 2022-03-28 12:14 | - | |
| Reliability Update for Windows Vista Systems With Intel processors(KB936357)/ | 2022-03-28 12:15 | - | |
| Reload/ | 2022-03-28 12:15 | - | |
| Reloading OS problem, error 0x80070017/ | 2022-03-28 12:15 | - | |
| Remote Control/ | 2022-03-28 12:15 | - | |
| Remote control and Aspire 6930G/ | 2022-03-28 12:15 | - | |
| Remote notebook power-up-down/ | 2022-03-28 12:15 | - | |
| Remove all bloatware off an Acer Aspire/ | 2022-03-28 12:15 | - | |
| Remove c mos battery/ | 2022-03-28 12:15 | - | |
| Removed NTI media for 8920G, drive disappeared/ | 2022-03-28 12:15 | - | |
| Removed secret partition, Windows won't boot!/ | 2022-03-28 12:15 | - | |
| Removeing Boot Wallpaper/ | 2022-03-28 12:15 | - | |
| Remove notepad acer aspire 2010/ | 2022-03-28 12:15 | - | |
| Remove screws on Aspire 572/ | 2022-03-28 12:15 | - | |
| Removing Battery...Good Idea/ | 2022-03-28 12:15 | - | |
| Removing Bloatware from Acer laptops/ | 2022-03-28 12:15 | - | |
| Removing DVD drive from an Aspire 3003/ | 2022-03-28 12:15 | - | |
| Removing Extensa 5620 Optical Drive/ | 2022-03-28 12:15 | - | |
| Removing RAID 0 on Predator 17/ | 2022-03-28 12:15 | - | |
| Removing Useless Applications/ | 2022-03-28 12:15 | - | |
| Removing case from Aspire 'z3100 all in one'/ | 2022-03-28 12:15 | - | |
| Removing entries from Acer Welcome Centre (like Norton, MS Office upgrade)/ | 2022-03-28 12:15 | - | |
| Removing optical drive from acer 1692/ | 2022-03-28 12:15 | - | |
| Removing preinstalled programs/ | 2022-03-28 12:15 | - | |
| Removing the Acer igoogle home page Trojan virus/ | 2022-03-28 12:15 | - | |
| Removing the keyboard on Aspire 7741z/ | 2022-03-28 12:15 | - | |
| Removing the middle cover of an Acer Extensa 5230/ | 2022-03-28 12:15 | - | |
| Repairing Windows Installation/ | 2022-03-28 12:15 | - | |
| Repair turnaround time/ | 2022-03-28 12:15 | - | |
| Repartioning then Restoring!/ | 2022-03-28 12:15 | - | |
| Repartitioning the Acer 8943g/ | 2022-03-28 12:15 | - | |
| Replace 5740 motherboard with 5738/ | 2022-03-28 12:15 | - | |
| Replace ACER ASPIRE 5742Z screen with 1080p one/ | 2022-03-28 12:15 | - | |
| Replace Acer 3680 DC USB Board/ | 2022-03-28 12:15 | - | |
| Replace Acer AOD150 touchpad cable and fix battery problemS/ | 2022-03-28 12:15 | - | |
| Replace DVD drive in Acer 8930 with Blu Ray/ | 2022-03-28 12:15 | - | |
| Replace HDD, only 3 months warranty/ | 2022-03-28 12:15 | - | |
| Replace dead 8600m gt graphics card from Dell Vostro 1700 to acer 5920g/ | 2022-03-28 12:15 | - | |
| Replaced hard drive. HELP/ | 2022-03-28 12:15 | - | |
| Replaced my fan/ | 2022-03-28 12:15 | - | |
| Replaced the fan and my Acer 7720 still dies/ | 2022-03-28 12:15 | - | |
| Replaced video adapter on acer 8935g/ | 2022-03-28 12:15 | - | |
| Replace keyboard Aspire 7535/ | 2022-03-28 12:15 | - | |
| Replace keyboard on Acer Aspire 1692/ | 2022-03-28 12:15 | - | |
| Replace keyboard on Acer Aspire 5930/ | 2022-03-28 12:15 | - | |
| Replacement 1683WLMi for a AS1642ZWLMi/ | 2022-03-28 12:15 | - | |
| Replacement Aspire 5735Z Screen/ | 2022-03-28 12:15 | - | |
| Replacement Battery/ | 2022-03-28 12:15 | - | |
| Replacement DVD Burner for acer aspire 9300/ | 2022-03-28 12:15 | - | |
| Replacement Drives 80GB in Extensa 6602WLMi/ | 2022-03-28 12:15 | - | |
| Replacement Keyboard for an Acer Aspire One D250/ | 2022-03-28 12:15 | - | |
| Replacement Warranty Stickers/ | 2022-03-28 12:15 | - | |
| Replacement battery for Aspire 5020 series/ | 2022-03-28 12:15 | - | |
| Replacement front bezel for M5-581TG/ | 2022-03-28 12:15 | - | |
| Replacement of my cpu... compatibility/ | 2022-03-28 12:15 | - | |
| Replacement plastic parts (Acer 1810T)/ | 2022-03-28 12:15 | - | |
| Replace my TN screen by IPS one on Acer E1-572G/ | 2022-03-28 12:15 | - | |
| Replace screen on Acer Aspire 5733Z/ | 2022-03-28 12:15 | - | |
| Replacing 5943g's HD5850 to another gfx/ | 2022-03-28 12:15 | - | |
| Replacing 8920G screen/ | 2022-03-28 12:15 | - | |
| Replacing 8935G's Keyboard/ | 2022-03-28 12:15 | - | |
| Replacing 9300m with 9600m GT 7720g How to remove cover/ | 2022-03-28 12:15 | - | |
| Replacing Acer Aspire 5738DG Power Jack Help please/ | 2022-03-28 12:15 | - | |
| Replacing Acer Aspire 5942G Keyboard/ | 2022-03-28 12:15 | - | |
| Replacing Acer Gemstone keyboard/ | 2022-03-28 12:15 | - | |
| Replacing DVD unit in Acer Aspire 1660 Series/ | 2022-03-28 12:15 | - | |
| Replacing DVD with HDD, adapters available/ | 2022-03-28 12:15 | - | |
| Replacing Fixing 3810 touchpad/ | 2022-03-28 12:15 | - | |
| Replacing HDD in Acer Aspire 5720/ | 2022-03-28 12:15 | - | |
| Replacing HD in a Travelmate 800, need advice/ | 2022-03-28 12:15 | - | |
| Replacing HardDrive (Aspire 5102)/ | 2022-03-28 12:15 | - | |
| Replacing Keyboard On Acer Aspire 5750/ | 2022-03-28 12:15 | - | |
| Replacing Keyboard on Aspire 5920/ | 2022-03-28 12:15 | - | |
| Replacing Predator Helios 300 microphone/ | 2022-03-28 12:15 | - | |
| Replacing Ricoh 1394 controller chipset with TI/ | 2022-03-28 12:15 | - | |
| Replacing Wireless Card Adding internal Bluetooth AO531/ | 2022-03-28 12:15 | - | |
| Replacing a TravelMate 8000 hard drive/ | 2022-03-28 12:15 | - | |
| Replacing adapter on 7738g/ | 2022-03-28 12:15 | - | |
| Replacing a hard drive in the TM8204/ | 2022-03-28 12:15 | - | |
| Replacing an Acer 8942G motherboard/ | 2022-03-28 12:15 | - | |
| Replacing battery/ | 2022-03-28 12:15 | - | |
| Replacing hard drive for Aspire 5100 - How to transfer recovery image/ | 2022-03-28 12:15 | - | |
| Replacing just the fan/ | 2022-03-28 12:15 | - | |
| Replacing keyboard - do Acer publish hardware maintenance manuals/ | 2022-03-28 12:15 | - | |
| Replacing keyboard in Acer Aspire 6935g/ | 2022-03-28 12:15 | - | |
| Replacing keyboard on Acer Aspire 7738G/ | 2022-03-28 12:15 | - | |
| Replacing the optical DVD drive for TM290/ | 2022-03-28 12:15 | - | |
| Replacing the screen on Aspire 5332/ | 2022-03-28 12:15 | - | |
| Reprogramming media buttons 5920G/ | 2022-03-28 12:15 | - | |
| Reputable stores that can ship a Timeline 1810T to Japan/ | 2022-03-28 12:15 | - | |
| Request- Aspire 5920 Recovery Partion/ | 2022-03-28 12:15 | - | |
| Request Acer5742 Bios 1.29 Unlock/ | 2022-03-28 12:15 | - | |
| Reset Button on 6935/ | 2022-03-28 12:15 | - | |
| Reset button on 8930G/ | 2022-03-28 12:15 | - | |
| Reset my Acer to Factory settings/ | 2022-03-28 12:15 | - | |
| Residue on bezel around screen from sticker/ | 2022-03-28 12:15 | - | |
| Resizing partitions/ | 2022-03-28 12:15 | - | |
| Resolution Discrepancies/ | 2022-03-28 12:15 | - | |
| Resolution Problem (HD)/ | 2022-03-28 12:15 | - | |
| Response time Acer Aspire 15.4 TFT/ | 2022-03-28 12:15 | - | |
| Ressurection of an abused laptop/ | 2022-03-28 12:15 | - | |
| Restart Problem/ | 2022-03-28 12:15 | - | |
| Restore/ | 2022-03-28 12:15 | - | |
| Restore Acer Aspire 1650 to factory settings/ | 2022-03-28 12:15 | - | |
| Restore Acer Recovery Partition/ | 2022-03-28 12:15 | - | |
| Restore Factory Default on the 5920G/ | 2022-03-28 12:15 | - | |
| Restore Factory Settings - Aspire 1642WLMi/ | 2022-03-28 12:15 | - | |
| Restore Factory Settings w o recovery CD and eRecovery/ | 2022-03-28 12:15 | - | |
| Restore Image/ | 2022-03-28 12:15 | - | |
| Restore Laptop Without DVDs/ | 2022-03-28 12:15 | - | |
| Restore MBR and partitions in Acer Aspire 3634 WLMi/ | 2022-03-28 12:15 | - | |
| Restore PQSERVICE/ | 2022-03-28 12:15 | - | |
| Restore Points/ | 2022-03-28 12:15 | - | |
| Restore System To Factory Default/ | 2022-03-28 12:15 | - | |
| Restore data from acer 8920 to new acer 8940/ | 2022-03-28 12:15 | - | |
| Restore discs AspireOne netbook/ | 2022-03-28 12:15 | - | |
| Restore disk issues/ | 2022-03-28 12:15 | - | |
| Restore points & partitions/ | 2022-03-28 12:15 | - | |
| Restoring 5920G/ | 2022-03-28 12:15 | - | |
| Restoring Acer's MBR/ | 2022-03-28 12:15 | - | |
| Restoring Acer Aspire TimelineU M5 to factory settings.. how/ | 2022-03-28 12:15 | - | |
| Restoring Acer Aspire to factory settings - HELP!!/ | 2022-03-28 12:15 | - | |
| Restoring Acer Aspire to factory settings make like new again/ | 2022-03-28 12:15 | - | |
| Restoring Aspire 5630 to Factory default!/ | 2022-03-28 12:15 | - | |
| Restoring Factory Defaults, Aspire 5930g/ | 2022-03-28 12:15 | - | |
| Restoring Vista from Backup Discs (7735z)/ | 2022-03-28 12:15 | - | |
| Restoring acer 7730z/ | 2022-03-28 12:15 | - | |
| Restoring backup partition with another OS on HDD/ | 2022-03-28 12:15 | - | |
| Restoring from discs on Aspire 5520/ | 2022-03-28 12:15 | - | |
| Retail Location for Acer/ | 2022-03-28 12:15 | - | |
| Returning my 8204/ | 2022-03-28 12:15 | - | |
| Return or use Warranty for 8204/ | 2022-03-28 12:15 | - | |
| Revamp of CPU Upgrade for 4620Z Anyone try this yet/ | 2022-03-28 12:15 | - | |
| Review- ACER 4002 WLMI/ | 2022-03-28 12:15 | - | |
| Review- Acer 5920G as Media Center/ | 2022-03-28 12:15 | - | |
| Review- Updated Acer Aspire V5-573G with GTX 850M/ | 2022-03-28 12:15 | - | |
| Review Request- Acer Aspire 5500/ | 2022-03-28 12:15 | - | |
| Review of Acer Aspire 9303 needed/ | 2022-03-28 12:15 | - | |
| Review of my 1681 Wlmi (long)/ | 2022-03-28 12:15 | - | |
| Reviews for 5560 series (5562WXMI)/ | 2022-03-28 12:15 | - | |
| Reviving a DOA 5050/ | 2022-03-28 12:15 | - | |
| Re widi on a Acer 5750/ | 2022-03-28 12:14 | - | |
| Rhythmtic clicking from hard drive and freezing computer/ | 2022-03-28 12:15 | - | |
| Ridiculous CPU temps after upgrade on 6930ZG/ | 2022-03-28 12:15 | - | |
| Ripped off by TigerDirect/ | 2022-03-28 12:15 | - | |
| RivaTuner v2.03 works with the newer 160 series of nvidia drivers!!/ | 2022-03-28 12:15 | - | |
| Rom Drive/ | 2022-03-28 12:15 | - | |
| Rotating Webcam Usage/ | 2022-03-28 12:15 | - | |
| Rubber seal missing on 8930G display/ | 2022-03-28 12:15 | - | |
| Rugged Laptop Case/ | 2022-03-28 12:15 | - | |
| Run 2 monitors from 8204/ | 2022-03-28 12:15 | - | |
| Running (Ran) Vista on a 5672/ | 2022-03-28 12:15 | - | |
| Running without external antivirus and firewall program/ | 2022-03-28 12:15 | - | |
| S-Video Problem (only when using power adapter)/ | 2022-03-28 12:15 | - | |
| S-Video out dead/ | 2022-03-28 12:15 | - | |
| S-Video to Composite Problems!/ | 2022-03-28 12:15 | - | |
| S-Video to TV Connection/ | 2022-03-28 12:15 | - | |
| S-video problem in 5672/ | 2022-03-28 12:15 | - | |
| S-video toggle screen problem with Acer 2920Z/ | 2022-03-28 12:15 | - | |
| S3 hard drive questions/ | 2022-03-28 12:15 | - | |
| S3 owners....your opinions on this notebook/ | 2022-03-28 12:15 | - | |
| S6F wireless problem after hibernate/ | 2022-03-28 12:15 | - | |
| S7-391 my problems with it and a question- how to un-raid the ssd/ | 2022-03-28 12:15 | - | |
| SATA 150 limit on ACER5810TZ/ | 2022-03-28 12:15 | - | |
| SATA Controller Spec/ | 2022-03-28 12:15 | - | |
| SATA HDD on PATA Aspire 5102 (or other)/ | 2022-03-28 12:15 | - | |
| SATA Hard Drive Driver For XP/ | 2022-03-28 12:15 | - | |
| SATA or PATA/ | 2022-03-28 12:15 | - | |
| SD Card in Acer 5672/ | 2022-03-28 12:15 | - | |
| SDHC and Acer 5672/ | 2022-03-28 12:15 | - | |
| SDHC card not recognized by Aspire 5570/ | 2022-03-28 12:15 | - | |
| SG manual/ | 2022-03-28 12:15 | - | |
| SHinza zeroshock for the 4501/ | 2022-03-28 12:15 | - | |
| SILENCE !/ | 2022-03-28 12:15 | - | |
| SIS M760GX and Windows Vista....!!/ | 2022-03-28 12:15 | - | |
| SLOW Startup after login 8204/ | 2022-03-28 12:15 | - | |
| SM bus controller Aspire 5100/ | 2022-03-28 12:15 | - | |
| SN on aspire 5536/ | 2022-03-28 12:15 | - | |
| SOLVED- Aspire 5100 (or any Vista & AMD computer) - Sleep Suspend Hibernate SCREENSAVER black screen or wake up or resume problem/ | 2022-03-28 12:15 | - | |
| SOS in Ferrari 1100/ | 2022-03-28 12:15 | - | |
| SPDIF Audio 'tinny and lifeless' [acer Aspire 3680]/ | 2022-03-28 12:15 | - | |
| SPDIF out on Ferrari/ | 2022-03-28 12:15 | - | |
| SPECS- New Acer Aspire 8942G/ | 2022-03-28 12:15 | - | |
| SSD for acer 1810tz/ | 2022-03-28 12:15 | - | |
| SSD install in AS4830t-6841/ | 2022-03-28 12:15 | - | |
| SSD on an Acer 2480-2968/ | 2022-03-28 12:15 | - | |
| SU2700 vs SU3500 battery life on Timeline/ | 2022-03-28 12:15 | - | |
| SU4100 vs SU7300 battery life difference/ | 2022-03-28 12:15 | - | |
| SU4100 vs su7300 in timeline/ | 2022-03-28 12:15 | - | |
| S Video colour to TV/ | 2022-03-28 12:15 | - | |
| SVideo to TV Problem!/ | 2022-03-28 12:15 | - | |
| Safe temperature for 5750G/ | 2022-03-28 12:15 | - | |
| Safe to plug in my 5920G(US-BestBuy) Adapter into a surge protector in China/ | 2022-03-28 12:15 | - | |
| Safe to stop admServ.exe/ | 2022-03-28 12:15 | - | |
| Sales/ | 2022-03-28 12:15 | - | |
| Same screen for 3810 , 4810 and 5810 timeline/ | 2022-03-28 12:15 | - | |
| Sandby or hibernate/ | 2022-03-28 12:15 | - | |
| Santa Rosa Refresh or Montevina for 5920G/ | 2022-03-28 12:15 | - | |
| Sata Port on Aspire 5003/ | 2022-03-28 12:15 | - | |
| Saturation for ATI 5650/ | 2022-03-28 12:15 | - | |
| Save My Aspire 5920/ | 2022-03-28 12:15 | - | |
| Saving recovery partitions/ | 2022-03-28 12:15 | - | |
| Saying goodbye to my Acer Aspire 6920/ | 2022-03-28 12:15 | - | |
| Says battery charging, but is not/ | 2022-03-28 12:15 | - | |
| Scared of an 8204, anything else similar 5650 in the USA/ | 2022-03-28 12:15 | - | |
| Scb5265/ | 2022-03-28 12:15 | - | |
| Schematic/ | 2022-03-28 12:15 | - | |
| Scratch On Laptop/ | 2022-03-28 12:15 | - | |
| Scratching Noise/ | 2022-03-28 12:15 | - | |
| Scratch on 6920 screen -/ | 2022-03-28 12:15 | - | |
| Screen Bezel Melting/ | 2022-03-28 12:15 | - | |
| Screen Brightness after Hibernate/ | 2022-03-28 12:15 | - | |
| Screen Brightness on resume wake-up/ | 2022-03-28 12:15 | - | |
| Screen Display Issue, Please Help/ | 2022-03-28 12:15 | - | |
| Screen Issues on Acer Netbook/ | 2022-03-28 12:15 | - | |
| Screen Problems - Moisture/ | 2022-03-28 12:15 | - | |
| Screen Replacement for Predator 15-G9-593/ | 2022-03-28 12:15 | - | |
| Screen Resolution on VISTA 32bit keep changing on Boot Up/ | 2022-03-28 12:15 | - | |
| Screen Stopped Working/ | 2022-03-28 12:15 | - | |
| Screen Turns Black when i install ATI Catalyst/ | 2022-03-28 12:15 | - | |
| Screen advise needed/ | 2022-03-28 12:15 | - | |
| Screen artefacts on Acer 3820TG/ | 2022-03-28 12:15 | - | |
| Screen brightness issue in aspire 5750G/ | 2022-03-28 12:15 | - | |
| Screen dims during Sims 3/ | 2022-03-28 12:15 | - | |
| Screen edges seems wider/ | 2022-03-28 12:15 | - | |
| Screen faded out/ | 2022-03-28 12:15 | - | |
| Screen flashing and computer crashing/ | 2022-03-28 12:15 | - | |
| Screen flash in vista/ | 2022-03-28 12:15 | - | |
| Screen flicker after installing Windows 7 x64/ | 2022-03-28 12:15 | - | |
| Screen flickering/ | 2022-03-28 12:15 | - | |
| Screen going blank every five seconds/ | 2022-03-28 12:15 | - | |
| Screen issue with Aspire 3630 - easy fix/ | 2022-03-28 12:15 | - | |
| Screen jitters when running on battery power. Any ideas what the problem could be/ | 2022-03-28 12:15 | - | |
| Screen or graphics problems 3023WLMi/ | 2022-03-28 12:15 | - | |
| Screen problem ( ) with my Acer Aspire 4810 TZ/ | 2022-03-28 12:15 | - | |
| Screen problem/ | 2022-03-28 12:15 | - | |
| Screen problems with 1642ZWLMI/ | 2022-03-28 12:15 | - | |
| Screen replacement for 4820tg/ | 2022-03-28 12:15 | - | |
| Screen resolution/ | 2022-03-28 12:15 | - | |
| Screen resolution advice on 9301/ | 2022-03-28 12:15 | - | |
| Screen resolution not as advertised/ | 2022-03-28 12:15 | - | |
| Screensaver on Acer 5672WLMi/ | 2022-03-28 12:15 | - | |
| Screen shadow/ | 2022-03-28 12:15 | - | |
| Screen suddenly refreshes/ | 2022-03-28 12:15 | - | |
| Screen went black (is it dead )/ | 2022-03-28 12:15 | - | |
| Screws for the Aspire 5610Z backpanels/ | 2022-03-28 12:15 | - | |
| Scroll button not working in W7/ | 2022-03-28 12:15 | - | |
| Scroll button problem/ | 2022-03-28 12:15 | - | |
| Searching for JP Japanese Keyboard for Acer Aspire 8930 8920 6530/ | 2022-03-28 12:15 | - | |
| Searching for PLL on Aspire 7741G-464G50Mnkk/ | 2022-03-28 12:15 | - | |
| Searching tools for undervolting and temp monitoring/ | 2022-03-28 12:15 | - | |
| Search of a cable/ | 2022-03-28 12:15 | - | |
| Second HDD in Acer Aspire 6530G/ | 2022-03-28 12:15 | - | |
| Second IDE in Acer Timeline 1810T/ | 2022-03-28 12:15 | - | |
| Second hard drive for 8200/ | 2022-03-28 12:15 | - | |
| Second screen stopped working/ | 2022-03-28 12:15 | - | |
| Secuirty help for acer/ | 2022-03-28 12:15 | - | |
| Sell as whole unit or parts/ | 2022-03-28 12:15 | - | |
| Selling My Acer Aspire 1690WLMi/ | 2022-03-28 12:15 | - | |
| Selling TravelMate 4502WLMi in parts or whole/ | 2022-03-28 12:15 | - | |
| Selling hi-end custom-built desktop for an Acer, but which (UK)/ | 2022-03-28 12:15 | - | |
| Selling my new tm4501WLMi/ | 2022-03-28 12:15 | - | |
| Sempron uprade to Turion in an Aspire 3000/ | 2022-03-28 12:15 | - | |
| Sending notebook back to Acer (formalities)/ | 2022-03-28 12:15 | - | |
| Sent in Acer repair with non original parts/ | 2022-03-28 12:15 | - | |
| Sent laptop into Acer on December 23rd, no word from Acer on status/ | 2022-03-28 12:15 | - | |
| Sent laptop to acer for screen repair, harddrive wiped/ | 2022-03-28 12:15 | - | |
| Serial Number in Acer Aspire 4730z/ | 2022-03-28 12:15 | - | |
| Serious Acer 5672 battery problems/ | 2022-03-28 12:15 | - | |
| Serious Battery Problems! pleaseeeeeee help/ | 2022-03-28 12:15 | - | |
| Serious Desktop Color Problem with ATI 5650/ | 2022-03-28 12:15 | - | |
| Serious Fustration/ | 2022-03-28 12:15 | - | |
| Serious Monitor Problem..PLZZZZ HELP/ | 2022-03-28 12:15 | - | |
| Serious help/ | 2022-03-28 12:15 | - | |
| Seriously Acer, Whats going on!/ | 2022-03-28 12:15 | - | |
| Serious problems/ | 2022-03-28 12:15 | - | |
| Serious problem with 5024 - possibly hdd related/ | 2022-03-28 12:15 | - | |
| Serious problem with my Acer Aspire 9301AWSMi laptop/ | 2022-03-28 12:15 | - | |
| Serious worries/ | 2022-03-28 12:15 | - | |
| Service Manual 3040 5040/ | 2022-03-28 12:15 | - | |
| Service Manual For 6935 and 6935G/ | 2022-03-28 12:15 | - | |
| Service Manual For Acer 5520_5920g_5930-5930G-5730ZG_ 6920_6930-6930G_7720-7720G/ | 2022-03-28 12:15 | - | |
| Service Manual for 1810T/ | 2022-03-28 12:15 | - | |
| Service Manual for 4620/ | 2022-03-28 12:15 | - | |
| Service Manual for Acer 6930G/ | 2022-03-28 12:15 | - | |
| Service Manual for Acer Travelmate 4502LMI/ | 2022-03-28 12:15 | - | |
| Service Manual for Aspire 3680-2682/ | 2022-03-28 12:15 | - | |
| Service Manual for acer 3683/ | 2022-03-28 12:15 | - | |
| Service Manuals - where are they/ | 2022-03-28 12:15 | - | |
| Service Manuals/ | 2022-03-28 12:15 | - | |
| Service Manuals for Acer notebooks (repository)/ | 2022-03-28 12:15 | - | |
| Service manual for aspire 9300 my graphics card is lose/ | 2022-03-28 12:15 | - | |
| Service manual for travelmate 2300/ | 2022-03-28 12:15 | - | |
| Service problem with Aspire 5520/ | 2022-03-28 12:15 | - | |
| SetFSB PLL ID Error on the Acer Aspire One 11.6/ | 2022-03-28 12:15 | - | |
| SetFSB added support for ICS954310 and couple more/ | 2022-03-28 12:15 | - | |
| Setting Game configs for an Acer 5315/ | 2022-03-28 12:15 | - | |
| Setting partitions on ACER laptop - URGENT!/ | 2022-03-28 12:15 | - | |
| Setting up my new Ferrari 4005 out of the box/ | 2022-03-28 12:15 | - | |
| Several Keyboard keys in the wrong place!/ | 2022-03-28 12:15 | - | |
| Shared Memory/ | 2022-03-28 12:15 | - | |
| Shared Video memory/ | 2022-03-28 12:15 | - | |
| Shared graphics memory on 8930G/ | 2022-03-28 12:15 | - | |
| Share experience 8204 and Vista/ | 2022-03-28 12:15 | - | |
| Sharing SG's is illegal/ | 2022-03-28 12:15 | - | |
| Shift Keys not working properly on ACER notebook/ | 2022-03-28 12:15 | - | |
| Shopping for a new SSD, Need Some Opinions on These/ | 2022-03-28 12:15 | - | |
| Shopping the acer 3820tg in the middle east/ | 2022-03-28 12:15 | - | |
| Shortcut Hotkeys after Acer Recovery/ | 2022-03-28 12:15 | - | |
| Shot from the sky....TM4501/ | 2022-03-28 12:15 | - | |
| Should I Udate BIOS/ | 2022-03-28 12:15 | - | |
| Should I Wait/ | 2022-03-28 12:15 | - | |
| Should I buy a Travel Mate 8103 4/ | 2022-03-28 12:15 | - | |
| Should I buy extended warranty/ | 2022-03-28 12:15 | - | |
| Should I buy this/ | 2022-03-28 12:15 | - | |
| Should I extend my warranty/ | 2022-03-28 12:15 | - | |
| Should I get Acer Aspire 5739G/ | 2022-03-28 12:15 | - | |
| Should I get a 1410 or a 3810TZ/ | 2022-03-28 12:15 | - | |
| Should I get this Acer 8102WLCI/ | 2022-03-28 12:15 | - | |
| Should I install Vista PHE on my Acer Aspire 5685 over Win XP MCE Pros Cons/ | 2022-03-28 12:15 | - | |
| Should I keep this laptop/ | 2022-03-28 12:15 | - | |
| Should I make a disassemble video for the Acer Aspire 5742G Anyone have it/ | 2022-03-28 12:15 | - | |
| Should I update BIOS - Acer Aspire 4730Z/ | 2022-03-28 12:15 | - | |
| Should I upgrade mh HDD (mini pci-e )/ | 2022-03-28 12:15 | - | |
| Should I use Acer ezDock Lite with TM 8204/ | 2022-03-28 12:15 | - | |
| Should i Upgrade the Bios -5740DG/ | 2022-03-28 12:15 | - | |
| Should i swap my laptop for this gaming one/ | 2022-03-28 12:15 | - | |
| Should i take the battery out when at home/ | 2022-03-28 12:15 | - | |
| Should i upgrade my acer aspire 5672wlmi/ | 2022-03-28 12:15 | - | |
| Should the subwoofer be present... 5920g/ | 2022-03-28 12:15 | - | |
| Should you uninstall old drivers before installing new ones/ | 2022-03-28 12:15 | - | |
| Shut Down Problem/ | 2022-03-28 12:15 | - | |
| Shutdown issues with winxp & webcams/ | 2022-03-28 12:15 | - | |
| Shuting Off Acer Aspire 5741G on Battry - Not Overheating/ | 2022-03-28 12:15 | - | |
| Silly 5920G Shortcut Request!/ | 2022-03-28 12:15 | - | |
| Simple/ | 2022-03-28 12:15 | - | |
| Simple Question about Acer Aspire VN 7/ | 2022-03-28 12:15 | - | |
| Simple guide for new Acer owners/ | 2022-03-28 12:15 | - | |
| Simple question, 5870M 1GB GDDR5 yes or no/ | 2022-03-28 12:15 | - | |
| Simple question, can ACER 6920 Install Mac operating systeM/ | 2022-03-28 12:15 | - | |
| Sites for Acer notebooks/ | 2022-03-28 12:15 | - | |
| Site with FREE Acer service manuals!/ | 2022-03-28 12:15 | - | |
| Size of screws for turbo memory installation/ | 2022-03-28 12:15 | - | |
| Skype Quality/ | 2022-03-28 12:15 | - | |
| Skype on travelmate 290 - echoes/ | 2022-03-28 12:15 | - | |
| Sleeve Case for TM3000/ | 2022-03-28 12:15 | - | |
| Sleeve for TM8100 series/ | 2022-03-28 12:15 | - | |
| Sleeve for TM 8204/ | 2022-03-28 12:15 | - | |
| Sleeve for TravcelMate 4501WMLi/ | 2022-03-28 12:15 | - | |
| Sleeve style case for my 4810t/ | 2022-03-28 12:15 | - | |
| Slight battery dilemna/ | 2022-03-28 12:15 | - | |
| Slimtype DVDRW problem/ | 2022-03-28 12:15 | - | |
| Sloppy hinges on TM4230/ | 2022-03-28 12:15 | - | |
| Slow Acer 532h Netbook/ | 2022-03-28 12:15 | - | |
| Slow Boot on 4420/ | 2022-03-28 12:15 | - | |
| Slow Ssd In Acer Aspire One/ | 2022-03-28 12:15 | - | |
| Slow USB 2.0 speed on Aspire 5024wlmi/ | 2022-03-28 12:15 | - | |
| Slow brand new Acer Aspire 7530/ | 2022-03-28 12:15 | - | |
| Slow on battery power/ | 2022-03-28 12:15 | - | |
| Sluggish Acer Aspire 7720 after installing XP/ | 2022-03-28 12:15 | - | |
| Small Acer Aspire 6920 Mod/ | 2022-03-28 12:15 | - | |
| Small concern with Acer Aspire 6930G/ | 2022-03-28 12:15 | - | |
| Smallest (Screen size) Acer laptop with internal optical drive/ | 2022-03-28 12:15 | - | |
| Small issues with my acer aspire timeline 3820tg/ | 2022-03-28 12:15 | - | |
| Smart Card Help/ | 2022-03-28 12:15 | - | |
| Smart card on the 8204 - have you got it to work/ | 2022-03-28 12:15 | - | |
| Snap, crackle and pop sound - Acer Aspire 5738ZG/ | 2022-03-28 12:15 | - | |
| So, is anyone actually happy with their Acer's Quality/ | 2022-03-28 12:15 | - | |
| So, ordered a TM 2423WXCI today/ | 2022-03-28 12:15 | - | |
| So, what is Acer's International Traveler's Warranty for, anyway/ | 2022-03-28 12:15 | - | |
| So, where can I get discontinued Acer notebooks/ | 2022-03-28 12:15 | - | |
| So I bought an Acer Aspire R3 131T (R11) 2 in 1 notebook and it took a week but I think I like it/ | 2022-03-28 12:15 | - | |
| Socket M CPU Upgrade ( Acer Travelmate 5310 )/ | 2022-03-28 12:15 | - | |
| Software firmware upgrade/ | 2022-03-28 12:15 | - | |
| Software on CD Disc/ | 2022-03-28 12:15 | - | |
| Software overvolting Acer's ATI 5650 GPU/ | 2022-03-28 12:15 | - | |
| Software to control fan speeds (Acer 5315)/ | 2022-03-28 12:15 | - | |
| So here is stupid me----no Recovery CD/ | 2022-03-28 12:15 | - | |
| So i have joined the Acer family with the 5672 with x1600/ | 2022-03-28 12:15 | - | |
| So is the Acer Aspire 5672 Vista Ready/ | 2022-03-28 12:15 | - | |
| Solution for installing 2nd Hard drive (SSD) in Acer 8943g and with 0$ cost/ | 2022-03-28 12:15 | - | |
| Solution for soundproblem on Aspire 5024/ | 2022-03-28 12:15 | - | |
| Solution to Acer(hard drive) heating up!!!/ | 2022-03-28 12:15 | - | |
| Solution to Aspire 5738 7736 No-Power/ | 2022-03-28 12:15 | - | |
| Solve My Problem and Get Paid Money/ | 2022-03-28 12:15 | - | |
| Solving the 5672 Heat Issue/ | 2022-03-28 12:15 | - | |
| Some Acer 3810T questions/ | 2022-03-28 12:15 | - | |
| Some Acer LOVE!/ | 2022-03-28 12:15 | - | |
| Some Parts on Acer TM290 (CL51) Mainboard/ | 2022-03-28 12:15 | - | |
| Some crap in sound on 5930g/ | 2022-03-28 12:15 | - | |
| Some doubts with acer 5920g/ | 2022-03-28 12:15 | - | |
| Some grey colours missing on screen/ | 2022-03-28 12:15 | - | |
| Some issues with Acer VN7-591G, and downgrading to W7/ | 2022-03-28 12:15 | - | |
| Some kind of protector/ | 2022-03-28 12:15 | - | |
| Some memory tips for Acer 5102/ | 2022-03-28 12:15 | - | |
| Some more questions about some Acer Notebooks/ | 2022-03-28 12:15 | - | |
| Some on PUH-lease Help -(/ | 2022-03-28 12:15 | - | |
| Someone help me please!/ | 2022-03-28 12:15 | - | |
| Some problems with TM 4002LMi/ | 2022-03-28 12:15 | - | |
| Some problems with acer/ | 2022-03-28 12:15 | - | |
| Some problems with my acer 8920G/ | 2022-03-28 12:15 | - | |
| Some questions about Acer Extensa EX5620-4020/ | 2022-03-28 12:15 | - | |
| Some questions about the Acer 8930/ | 2022-03-28 12:15 | - | |
| Some questions about the Aspire 5920/ | 2022-03-28 12:15 | - | |
| Some questions on Acer 6291 softwares/ | 2022-03-28 12:15 | - | |
| Some questions regarding Acer Travelmate Timeline/ | 2022-03-28 12:15 | - | |
| Some strange thing in Acer 5930/ | 2022-03-28 12:15 | - | |
| Something like power manegment for ACER/ | 2022-03-28 12:15 | - | |
| Somethings Terribly Wrong with my Touch pad, please help ASAP!/ | 2022-03-28 12:15 | - | |
| Some thoughts on new 5536-5883 and maybe a couple questions -)/ | 2022-03-28 12:15 | - | |
| Sometimes boot acer deluxe/ | 2022-03-28 12:15 | - | |
| Sometimes slow to start up.Acer 5738Z/ | 2022-03-28 12:15 | - | |
| So my Acer Aspire 6920G just cought on fire what can I do/ | 2022-03-28 12:15 | - | |
| Soon to be the proud owner of a 6920G/ | 2022-03-28 12:15 | - | |
| Sorry Acer, three strikes and your out!/ | 2022-03-28 12:15 | - | |
| Sorry about all the questions/ | 2022-03-28 12:15 | - | |
| So slow to boot AOD255e/ | 2022-03-28 12:15 | - | |
| Sound (Speakers)/ | 2022-03-28 12:15 | - | |
| Sound Choping When Dvd Drive Accessed On Acer 5672wmli/ | 2022-03-28 12:15 | - | |
| Sound Popping when using my maya44usb/ | 2022-03-28 12:15 | - | |
| Sound Problem/ | 2022-03-28 12:15 | - | |
| Sound Problems on Aspire 5105A/ | 2022-03-28 12:15 | - | |
| Sound Problems with 6920G/ | 2022-03-28 12:15 | - | |
| Sound and Webcam troubles on my new Acer/ | 2022-03-28 12:15 | - | |
| Sound card on 8204/ | 2022-03-28 12:15 | - | |
| Sound drivers to aspire 5024/ | 2022-03-28 12:15 | - | |
| Sound glitching 6920 -/ | 2022-03-28 12:15 | - | |
| Sound issues/ | 2022-03-28 12:15 | - | |
| Sound issue with Ferrari 4005/ | 2022-03-28 12:15 | - | |
| Soundless keyboard/ | 2022-03-28 12:15 | - | |
| Sound level on 1682WLMi/ | 2022-03-28 12:15 | - | |
| Sound music on TM 8103/ | 2022-03-28 12:15 | - | |
| Sound on the Acer 5020 series/ | 2022-03-28 12:15 | - | |
| Sound problem on 5920G/ | 2022-03-28 12:15 | - | |
| Sound problems on Acer Aspire 5733Z-4851 and can't burn recovery disk/ | 2022-03-28 12:15 | - | |
| Sound volume on aspire 4741g 5454G50Mn/ | 2022-03-28 12:15 | - | |
| Source for CMOS batteries/ | 2022-03-28 12:15 | - | |
| Source for parts/ | 2022-03-28 12:15 | - | |
| Space Bar Problems/ | 2022-03-28 12:15 | - | |
| Space Problem!!/ | 2022-03-28 12:15 | - | |
| Space screensaver problem on Acer Aspire/ | 2022-03-28 12:15 | - | |
| Spdif of 1810T- optical or coaxial/ | 2022-03-28 12:15 | - | |
| Spdif output on Aspire 7745G/ | 2022-03-28 12:15 | - | |
| Speaker Switching Off Randomly/ | 2022-03-28 12:15 | - | |
| Speaker is vibrating !! Ahh help!/ | 2022-03-28 12:15 | - | |
| Speaker problem and Fn+F8 doesn't solve it/ | 2022-03-28 12:15 | - | |
| Speaker problem in 8930g/ | 2022-03-28 12:15 | - | |
| Speakers crackle =o/ | 2022-03-28 12:15 | - | |
| Speakers creak and sound changes when I click speakers properies/ | 2022-03-28 12:15 | - | |
| Speakers for Acer Aspire TimelineX 3820TG/ | 2022-03-28 12:15 | - | |
| Speculation as to next ferrari line release/ | 2022-03-28 12:15 | - | |
| Speedstep/ | 2022-03-28 12:15 | - | |
| Spilled Drink On Keyboard !/ | 2022-03-28 12:15 | - | |
| Spilt coke on Aspire 2012WLMi - help!/ | 2022-03-28 12:15 | - | |
| Sping Clean/ | 2022-03-28 12:15 | - | |
| Spots on 7740 lid/ | 2022-03-28 12:15 | - | |
| Sreenshot - Delete Acer's PQSERVICE partition and save 5Go, possible/ | 2022-03-28 12:15 | - | |
| Ssd/ | 2022-03-28 12:15 | - | |
| Stalling or Intermittent dead zone/ | 2022-03-28 12:15 | - | |
| Standby issue/ | 2022-03-28 12:15 | - | |
| Standby issues/ | 2022-03-28 12:15 | - | |
| Standby lasting only 6 hours/ | 2022-03-28 12:15 | - | |
| Standby problem with my Aspire 1694 WLMi/ | 2022-03-28 12:15 | - | |
| StartF.cmd in Acer FormatCD/ | 2022-03-28 12:15 | - | |
| Startup Error/ | 2022-03-28 12:15 | - | |
| Startup Items deleted/ | 2022-03-28 12:15 | - | |
| Startup Problem/ | 2022-03-28 12:15 | - | |
| Startup Repair Issue/ | 2022-03-28 12:15 | - | |
| Startup failure/ | 2022-03-28 12:15 | - | |
| Startup issues with the 8200/ | 2022-03-28 12:15 | - | |
| Startup problem Acer Aspire 1670 - Please Healp -(/ | 2022-03-28 12:15 | - | |
| Static on Max Volume 5920G/ | 2022-03-28 12:15 | - | |
| Step by step guide to changing 8204 hard disk/ | 2022-03-28 12:15 | - | |
| Step by step instructions -Aspire 5672 XP Home Pro Upgrade/ | 2022-03-28 12:15 | - | |
| Steps 2 remove dvd AS -1410 1680 1690 & TM 2300 4K/ | 2022-03-28 12:15 | - | |
| Steps before Factory Restore/ | 2022-03-28 12:15 | - | |
| Steps to boot from USB HDD Pen drive explained/ | 2022-03-28 12:15 | - | |
| Steps to take for a newb with a new 8204/ | 2022-03-28 12:15 | - | |
| Stereo Mix not working Realtek High Definition Audio Acer 6920g/ | 2022-03-28 12:15 | - | |
| Sticky keys/ | 2022-03-28 12:15 | - | |
| Still issues with Launch Manager and Windows 7 Enterprise/ | 2022-03-28 12:15 | - | |
| Still look for PM that can adjust LCD brightness/ | 2022-03-28 12:15 | - | |
| Still missing keys/ | 2022-03-28 12:15 | - | |
| Still speaker audio when headset is in/ | 2022-03-28 12:15 | - | |
| Straight PQSERVICE Question/ | 2022-03-28 12:15 | - | |
| Strange.. My 5920 cannot download .bmp images/ | 2022-03-28 12:15 | - | |
| Strange/ | 2022-03-28 12:15 | - | |
| Strange Acer Wake Problem/ | 2022-03-28 12:15 | - | |
| Strange DVD-problem/ | 2022-03-28 12:15 | - | |
| Strange Ports/ | 2022-03-28 12:15 | - | |
| Strange Screen Problem/ | 2022-03-28 12:15 | - | |
| Strange Standby Problem (Aspire 2026)/ | 2022-03-28 12:15 | - | |
| Strange behavior (lock up) Ferrari 4005/ | 2022-03-28 12:15 | - | |
| Strange behavior of acer 5920g/ | 2022-03-28 12:15 | - | |
| Strange buzzing and clicking noise from fan/ | 2022-03-28 12:15 | - | |
| Strange crash/ | 2022-03-28 12:15 | - | |
| Strange issue with ACER Aspire 5024/ | 2022-03-28 12:15 | - | |
| Strange music and car race sounds/ | 2022-03-28 12:15 | - | |
| Strange power boot issue/ | 2022-03-28 12:15 | - | |
| Strange problem with Acer in built microphone/ | 2022-03-28 12:15 | - | |
| Strange problem with audio Aspire 9500/ | 2022-03-28 12:15 | - | |
| Strange sound from my Aspire 9410/ | 2022-03-28 12:15 | - | |
| Strange sound still coming from my 5680/ | 2022-03-28 12:15 | - | |
| Strangest Problem Ever On ACER !/ | 2022-03-28 12:15 | - | |
| Strange thing in Acer 5930/ | 2022-03-28 12:15 | - | |
| Strange touchpad issue 3830TG/ | 2022-03-28 12:15 | - | |
| Streaming Video on Acer Timeline/ | 2022-03-28 12:15 | - | |
| Stripes and to stop running notebook/ | 2022-03-28 12:15 | - | |
| Stripes in screen/ | 2022-03-28 12:15 | - | |
| Stripped screw problem- acer ferrari 3200/ | 2022-03-28 12:15 | - | |
| Struggling to flash acer 5920g bios/ | 2022-03-28 12:15 | - | |
| Stuck removing bottom case lid for ram instalation -(/ | 2022-03-28 12:15 | - | |
| Stupid question..upgrading graphics card/ | 2022-03-28 12:15 | - | |
| Stuttering problem after T7500 upgrade on 5920/ | 2022-03-28 12:15 | - | |
| Su3500 Vs Ml-32/ | 2022-03-28 12:15 | - | |
| Sucessfully upgraded TravelMate 2480 Cpu!/ | 2022-03-28 12:15 | - | |
| Sudden 100% cpu usage issue with my 8935G/ | 2022-03-28 12:15 | - | |
| Sudden Lag 6920g/ | 2022-03-28 12:15 | - | |
| Suddenly No Microphone/ | 2022-03-28 12:15 | - | |
| Suddenly getting NVLDDMKM message 9301 running Vista HP/ | 2022-03-28 12:15 | - | |
| Suggestion for my sisters laptop/ | 2022-03-28 12:15 | - | |
| Suggest the best VGA driver for 8204/ | 2022-03-28 12:15 | - | |
| Super Disaster!!!!! Help!!!/ | 2022-03-28 12:15 | - | |
| Supports UDMA5, but only UDMA2 is active/ | 2022-03-28 12:15 | - | |
| Survey help reqd!/ | 2022-03-28 12:15 | - | |
| Suspend Problem with Aspire 5563/ | 2022-03-28 12:15 | - | |
| Swítch between Intel and ATI graphic/ | 2022-03-28 12:15 | - | |
| Swapping 5920 hard drive into 3680 need advise/ | 2022-03-28 12:15 | - | |
| Switch 5 release date/ | 2022-03-28 12:15 | - | |
| Switch 10 BT driver up to date or what's wrong here/ | 2022-03-28 12:15 | - | |
| Switch Off wireless build in adapter/ | 2022-03-28 12:15 | - | |
| Switchable graphics is not working on Acer Aspire 5745G - It appears to be stuck in Intel, even when plugged in/ | 2022-03-28 12:15 | - | |
| Switched from Vista to Xp, issues/ | 2022-03-28 12:15 | - | |
| Switching Batteries/ | 2022-03-28 12:15 | - | |
| Switching Fully to XP, Recovery question/ | 2022-03-28 12:15 | - | |
| Switching Primary Secondary Graphics Cards (Aspire 5742G)/ | 2022-03-28 12:15 | - | |
| Switching between graphic cards/ | 2022-03-28 12:15 | - | |
| Switching hard drive into new 1810T/ | 2022-03-28 12:15 | - | |
| Switching to windows 7/ | 2022-03-28 12:15 | - | |
| Synaptics - Delay, how to solve/ | 2022-03-28 12:15 | - | |
| Synaptics Driver 8.2.19.0 Settings Error w rundll32/ | 2022-03-28 12:15 | - | |
| Synaptics Gesture update for acer 3820tg/ | 2022-03-28 12:15 | - | |
| Synaptics Touchpad Scroll-Funtion not working properly/ | 2022-03-28 12:15 | - | |
| Synaptics or Elantech/ | 2022-03-28 12:15 | - | |
| Synaptic touchpad problem, Aspire 5102/ | 2022-03-28 12:15 | - | |
| Sync button on laptop/ | 2022-03-28 12:15 | - | |
| System Interrupts Eating CPU (1410 11.6 )/ | 2022-03-28 12:15 | - | |
| System Restore/ | 2022-03-28 12:15 | - | |
| System boot from USB/ | 2022-03-28 12:15 | - | |
| System start up - should I remove ALCMTR (Aspire 5672)/ | 2022-03-28 12:15 | - | |
| T (SU7300) vs. (TZ SU4100)/ | 2022-03-28 12:15 | - | |
| T2500 OCing/ | 2022-03-28 12:15 | - | |
| T3200 work in Acer Aspire 9410/ | 2022-03-28 12:15 | - | |
| T6600 in a 6920G/ | 2022-03-28 12:15 | - | |
| T7100 with X1700 Acer Travelmate 5720g/ | 2022-03-28 12:15 | - | |
| T9400 running on a 10.5 Multiplyer (6935G)/ | 2022-03-28 12:15 | - | |
| T9500 in an Aspire 6920G/ | 2022-03-28 12:15 | - | |
| T9500 on an Acer Aspire 5732ZG/ | 2022-03-28 12:15 | - | |
| TEST CHART- Power consumption of various activites on Acer Timeline 1810T!/ | 2022-03-28 12:15 | - | |
| TM240 wireless button help/ | 2022-03-28 12:15 | - | |
| TM280, BIOS recovery/ | 2022-03-28 12:15 | - | |
| TM290 - Can empty CMOS batteries cause trouble/ | 2022-03-28 12:15 | - | |
| TM290 - Harddisk empty after CMOS reset/ | 2022-03-28 12:15 | - | |
| TM291LCi upgrade questions/ | 2022-03-28 12:15 | - | |
| TM293LCi/ | 2022-03-28 12:15 | - | |
| TM 800- Can I use 128 GB HDD's/ | 2022-03-28 12:15 | - | |
| TM800 Refuses to boot after RAM install/ | 2022-03-28 12:15 | - | |
| TM 2200 - Installed generic XP - nothing works -(/ | 2022-03-28 12:15 | - | |
| TM 2312 wireless reception/ | 2022-03-28 12:15 | - | |
| TM2318 constant hard drive spin down issue/ | 2022-03-28 12:15 | - | |
| TM2423=upgrade CPU/ | 2022-03-28 12:15 | - | |
| TM 2500 Full service guide or help me upgrade hard drive/ | 2022-03-28 12:15 | - | |
| TM3000 - Fan Noise/ | 2022-03-28 12:15 | - | |
| TM3002 -- Dead Pixel/ | 2022-03-28 12:15 | - | |
| TM3002 -- New hard drive and FAT32 Issues/ | 2022-03-28 12:15 | - | |
| TM3002WTCI BATTREY/ | 2022-03-28 12:15 | - | |
| TM3002WTCi questions/ | 2022-03-28 12:15 | - | |
| TM3002 deadsilent in idle mode/ | 2022-03-28 12:15 | - | |
| TM3200 requires thumping to load xp/ | 2022-03-28 12:15 | - | |
| TM3200 series BT question/ | 2022-03-28 12:15 | - | |
| TM 3200xci or AS 1680wlmi/ | 2022-03-28 12:15 | - | |
| TM 3201 XCI ROCKS!!!!!/ | 2022-03-28 12:15 | - | |
| TM 3201Xmi harddisk & memory upgrade/ | 2022-03-28 12:15 | - | |
| TM 3201 rubber grips/ | 2022-03-28 12:15 | - | |
| TM 3201 vs Aspire 2012/ | 2022-03-28 12:15 | - | |
| TM3201 xci/ | 2022-03-28 12:15 | - | |
| TM 4000 problem with ps2 and usb/ | 2022-03-28 12:15 | - | |
| TM 4000 winxp install problems/ | 2022-03-28 12:15 | - | |
| TM 4001 HDD strange noise!/ | 2022-03-28 12:15 | - | |
| TM4001 or Aspire 1662/ | 2022-03-28 12:15 | - | |
| TM 4002LMi problem/ | 2022-03-28 12:15 | - | |
| TM4002WLMi and AS1681WLMi/ | 2022-03-28 12:15 | - | |
| TM4100 battery life/ | 2022-03-28 12:15 | - | |
| TM4101WLMi - Changed the HDD, not being detected in the bios anymore/ | 2022-03-28 12:15 | - | |
| TM 4102 or Aspire 4692/ | 2022-03-28 12:15 | - | |
| TM4202WLMI Core Duo T2300/ | 2022-03-28 12:15 | - | |
| TM4400 - is the video upgradable GPU socketed or soldered/ | 2022-03-28 12:15 | - | |
| TM4402 - Easy difficult to upgrade/ | 2022-03-28 12:15 | - | |
| TM4402 - acpi backlight issues/ | 2022-03-28 12:15 | - | |
| TM4501WLMI and CounterStrike Source/ | 2022-03-28 12:15 | - | |
| TM4501 and TM3201 lcd casing/ | 2022-03-28 12:15 | - | |
| TM4501 users opinion/ | 2022-03-28 12:15 | - | |
| TM4502WLMi memory/ | 2022-03-28 12:15 | - | |
| TM 4502WLMi or Aspire 1683WLMi/ | 2022-03-28 12:15 | - | |
| TM 4502Wlmi or Aspire 1691 Wlmi or TM 4601Wlmi/ | 2022-03-28 12:15 | - | |
| TM 4720-6336 6 or 9 cell battery/ | 2022-03-28 12:15 | - | |
| TM 5320 RAM question/ | 2022-03-28 12:15 | - | |
| TM 5530G with Turion ZM-87- thermal trip points too low/ | 2022-03-28 12:15 | - | |
| TM5720-6792 has problems with projectors/ | 2022-03-28 12:15 | - | |
| TM 5720 - card reader problems/ | 2022-03-28 12:15 | - | |
| TM 6292-6856 Info needed/ | 2022-03-28 12:15 | - | |
| TM6292 eRestore or clean install/ | 2022-03-28 12:15 | - | |
| TM6460- the next evolution of the TM8000 series/ | 2022-03-28 12:15 | - | |
| TM 6592, thoughts/ | 2022-03-28 12:15 | - | |
| TM7720G- Avivo features not working/ | 2022-03-28 12:15 | - | |
| TM8003LMi-2Mb vs. Aspire 2025WLMi/ | 2022-03-28 12:15 | - | |
| TM 8100 & Aspire 1689/ | 2022-03-28 12:15 | - | |
| TM 8100- which universal international AC adaptor/ | 2022-03-28 12:15 | - | |
| TM 8100 AC Adapter - HOT!/ | 2022-03-28 12:15 | - | |
| TM8100 Dim screen, not dark/ | 2022-03-28 12:15 | - | |
| TM 8103 just repaired by ACER but why won't headphone jack work/ | 2022-03-28 12:15 | - | |
| TM8104- Unexpected shut downs/ | 2022-03-28 12:15 | - | |
| TM 8104 and TM 3002/ | 2022-03-28 12:15 | - | |
| TM 8200 - Merom version - Pic/ | 2022-03-28 12:15 | - | |
| TM8200 Vista Drivers Released on 1 29/ | 2022-03-28 12:15 | - | |
| TM8200 display resolutions in Vista/ | 2022-03-28 12:15 | - | |
| TM 8200 grainy screen fixed/ | 2022-03-28 12:15 | - | |
| TM8200 successor/ | 2022-03-28 12:15 | - | |
| TM 8200 vs. Ferrari 4006- X1600 vs x700/ | 2022-03-28 12:15 | - | |
| TM8204 + EzDock + DVI = Buggy/ | 2022-03-28 12:15 | - | |
| TM8204, Identify this part/ | 2022-03-28 12:15 | - | |
| TM8204, speed of installed RAM/ | 2022-03-28 12:15 | - | |
| TM8204 - Anyone able to get multiple audio outputs/ | 2022-03-28 12:15 | - | |
| TM 8204- BF2 + HL2 Performace/ | 2022-03-28 12:15 | - | |
| TM 8204- Blinking Power Light/ | 2022-03-28 12:15 | - | |
| TM 8204 - Random CPU Spikes Driving me Crazy/ | 2022-03-28 12:15 | - | |
| TM8204 ATIx1600 Buzzing, fix using firmware update/ | 2022-03-28 12:15 | - | |
| TM8204 BIOS version 1.3315/ | 2022-03-28 12:15 | - | |
| TM 8204 Battery Down To 2 Hours/ | 2022-03-28 12:15 | - | |
| TM8204 Bluetooth problems/ | 2022-03-28 12:15 | - | |
| TM8204 Built-In BlueTooth Adapter Question(want to have a bluetooth stereo headphone)/ | 2022-03-28 12:15 | - | |
| TM 8204 Fan and Thermal Compound Cleaning/ | 2022-03-28 12:15 | - | |
| TM8204 Flash Card Reader Slow/ | 2022-03-28 12:15 | - | |
| TM8204 HSF Assembly Issues/ | 2022-03-28 12:15 | - | |
| TM 8204 Hard Drive CRC Errors - Again!/ | 2022-03-28 12:15 | - | |
| TM8204 RAM- CPU-Z shows 266MHz !/ | 2022-03-28 12:15 | - | |
| TM 8204 SDHC CPU RAM GPU and other questions/ | 2022-03-28 12:15 | - | |
| TM8204 Screen Backlight flicker/ | 2022-03-28 12:15 | - | |
| TM 8204 Sound CD Issues/ | 2022-03-28 12:15 | - | |
| TM8204WLMi- Why suddenly powered off/ | 2022-03-28 12:15 | - | |
| TM 8204WLMi Problem/ | 2022-03-28 12:15 | - | |
| TM8204WLMi boot problem/ | 2022-03-28 12:15 | - | |
| TM8204WLMi voip phone charge indicator/ | 2022-03-28 12:15 | - | |
| TM 8204 and bluetooth stereo/ | 2022-03-28 12:15 | - | |
| TM 8204 battery life/ | 2022-03-28 12:15 | - | |
| TM8204 disappointing/ | 2022-03-28 12:15 | - | |
| TM 8204 iTunes CD Ripping Performance/ | 2022-03-28 12:15 | - | |
| TM8204 on retail stores/ | 2022-03-28 12:15 | - | |
| TM 8204 sudden shutdown during sleep/ | 2022-03-28 12:15 | - | |
| TM8204 users- Background noise research/ | 2022-03-28 12:15 | - | |
| TM8204 v3517 BIOS question/ | 2022-03-28 12:15 | - | |
| TM8210 keyboard and Ferrai5000 keyboard compatibility/ | 2022-03-28 12:15 | - | |
| TM8215- how to lower voltage/ | 2022-03-28 12:15 | - | |
| TM C314XMi - GeForce Go 6200 Only 32Mb/ | 2022-03-28 12:15 | - | |
| TV-OUT for Acer Aspire 2920/ | 2022-03-28 12:15 | - | |
| TV-out Problem/ | 2022-03-28 12:15 | - | |
| TV Out n 1681/ | 2022-03-28 12:15 | - | |
| TV Tuner - Audio not working Plz Help/ | 2022-03-28 12:15 | - | |
| TV Tuner on Acer Aspire 8940G/ | 2022-03-28 12:15 | - | |
| TV Tuner w Remote for 5670 series/ | 2022-03-28 12:15 | - | |
| TV as a monitor/ | 2022-03-28 12:15 | - | |
| TV cable adapter for Acer laptop 5652/ | 2022-03-28 12:15 | - | |
| TV card no longer exists/ | 2022-03-28 12:15 | - | |
| TV in out and the Acer Travelmate 2420/ | 2022-03-28 12:15 | - | |
| TV on acer 8930G/ | 2022-03-28 12:15 | - | |
| TV out acer 5630/ | 2022-03-28 12:15 | - | |
| TV out working ONLY in clone mode. When single display (TV) is chosen both laptop and TV screen are blank/ | 2022-03-28 12:15 | - | |
| T Z G - What do they mean/ | 2022-03-28 12:15 | - | |
| Taking Apart Aspire 3000 series/ | 2022-03-28 12:15 | - | |
| Taking Laptop Apart/ | 2022-03-28 12:15 | - | |
| Taking apart an Acer Aspire 1694 WLMi/ | 2022-03-28 12:15 | - | |
| Taking apart an acer 8204/ | 2022-03-28 12:15 | - | |
| Taking apart travelmate 4402/ | 2022-03-28 12:15 | - | |
| Taking back off of laptop/ | 2022-03-28 12:15 | - | |
| Taking keys off 8204/ | 2022-03-28 12:15 | - | |
| Talk to me about the Spin 1 2-in-/ | 2022-03-28 12:15 | - | |
| Tapping touchpad sensitivity on Acer TM4501/ | 2022-03-28 12:15 | - | |
| Teardown guides for d255 or 532h/ | 2022-03-28 12:15 | - | |
| Technical manual for Aspire Revo R1600 netbook/ | 2022-03-28 12:15 | - | |
| TehSuigi's Driver Comparison! - 6920G 9500M GS/ | 2022-03-28 12:15 | - | |
| TehSuigi's Upgrade Experience!/ | 2022-03-28 12:15 | - | |
| Temperature Issues/ | 2022-03-28 12:15 | - | |
| Temperature [urgent]/ | 2022-03-28 12:15 | - | |
| Temperature concerns/ | 2022-03-28 12:15 | - | |
| Temperature cpu monitoring on Ferrari (4005)/ | 2022-03-28 12:15 | - | |
| Temperature in Acer 1810tz/ | 2022-03-28 12:15 | - | |
| Temperature monitor software for Acer !!/ | 2022-03-28 12:15 | - | |
| Temperature sensor on ATI HD3470 in Acers/ | 2022-03-28 12:15 | - | |
| Temporary Freezes since upgrading to Win7 Pro/ | 2022-03-28 12:15 | - | |
| Temprature in Aspire 5593 HELP !!!/ | 2022-03-28 12:15 | - | |
| Terrible !!!/ | 2022-03-28 12:15 | - | |
| Terrible sound quality on Aspire 8930/ | 2022-03-28 12:15 | - | |
| Terribly disapointed with Aspire 1802SWMi/ | 2022-03-28 12:15 | - | |
| Testing undervolting of GPU on Nitro 5 Ryzen/ | 2022-03-28 12:15 | - | |
| Thailand problems- Want Acer with Class 1 Graphics, must i get the 8920/ | 2022-03-28 12:15 | - | |
| Thaiphoon burner/ | 2022-03-28 12:15 | - | |
| Thanks for all the good tips and help/ | 2022-03-28 12:15 | - | |
| Thanks for the input Newbies/ | 2022-03-28 12:15 | - | |
| That ferrari mouse/ | 2022-03-28 12:15 | - | |
| The-spacebar-on-my-emachines510-won't-work/ | 2022-03-28 12:15 | - | |
| The 5740s with ATI 5XX0 GPUs/ | 2022-03-28 12:15 | - | |
| The 7738G Club/ | 2022-03-28 12:15 | - | |
| The 9410-4441/ | 2022-03-28 12:15 | - | |
| The Acer 5102 Thread/ | 2022-03-28 12:15 | - | |
| The Acer 5680 Thread/ | 2022-03-28 12:15 | - | |
| The Acer 5738g! Yay or Nay/ | 2022-03-28 12:15 | - | |
| The Acer 8920 looks amazing/ | 2022-03-28 12:15 | - | |
| The Acer Aspire 5100-3583/ | 2022-03-28 12:15 | - | |
| The Acer ThrottleStop Thread/ | 2022-03-28 12:15 | - | |
| The Acer TravelMate P645-S (2015 update) is upon us!/ | 2022-03-28 12:15 | - | |
| The Acer is a disappointment thread/ | 2022-03-28 12:15 | - | |
| The Acer rocks thread/ | 2022-03-28 12:15 | - | |
| The Aspire 5100 is dead. No power, no charging/ | 2022-03-28 12:15 | - | |
| The Complete guide to fix NUMPAD after bios update!!/ | 2022-03-28 12:15 | - | |
| The Definitive Guide to Acer Aspire Gemstone Blue Throttling Issues/ | 2022-03-28 12:15 | - | |
| The E button in Top right hand side/ | 2022-03-28 12:15 | - | |
| The Ferrari 4005 Prices and Places/ | 2022-03-28 12:15 | - | |
| The HDD Adaptor For TravelMate 350/ | 2022-03-28 12:15 | - | |
| The HORROR of Acer Australia and their cashback/ | 2022-03-28 12:15 | - | |
| The NEW Acer Aspire 8940G/ | 2022-03-28 12:15 | - | |
| The New Acer 8930g Coming Soon/ | 2022-03-28 12:15 | - | |
| The New Acer TM 4502 WLMi !/ | 2022-03-28 12:15 | - | |
| The Official Arrandale Timeline Thread/ | 2022-03-28 12:15 | - | |
| The REASON that ACER = SLOW! Solution inside/ | 2022-03-28 12:15 | - | |
| The Upgradability of the Aspire 7720-6395/ | 2022-03-28 12:15 | - | |
| The Upgradability of the Aspire 7730 zg/ | 2022-03-28 12:15 | - | |
| The Vista upgrade offer (yes, I waited a while)/ | 2022-03-28 12:15 | - | |
| The Way To Mod !/ | 2022-03-28 12:15 | - | |
| The aspire or the aspire timeline Please help me choose/ | 2022-03-28 12:15 | - | |
| The best 8930 deal/ | 2022-03-28 12:15 | - | |
| The best GPU Acer Aspire 8930g/ | 2022-03-28 12:15 | - | |
| The center button (4-way scroll button) on my laptop does not work. Can anyone please help/ | 2022-03-28 12:15 | - | |
| The complete collection of Service Repair Manuals Guides/ | 2022-03-28 12:15 | - | |
| The green keys on the keyboard/ | 2022-03-28 12:15 | - | |
| The legendary aspire 6920 problem/ | 2022-03-28 12:15 | - | |
| The most mysterious problem/ | 2022-03-28 12:15 | - | |
| The mysterious case of the disapearing DVD Drive/ | 2022-03-28 12:15 | - | |
| The name aspire/ | 2022-03-28 12:15 | - | |
| The new ACER ASPIRE 4755G/ | 2022-03-28 12:15 | - | |
| The new travelmate 3000 series/ | 2022-03-28 12:15 | - | |
| The pro's and con's of Acer software/ | 2022-03-28 12:15 | - | |
| The quality of Acer notebooks/ | 2022-03-28 12:15 | - | |
| The quality of Acer products/ | 2022-03-28 12:15 | - | |
| There's something wrong with the sound on my Aspire 5720/ | 2022-03-28 12:15 | - | |
| There goes my chance for most modded 7738g/ | 2022-03-28 12:15 | - | |
| Thermal Pad - Help!/ | 2022-03-28 12:15 | - | |
| Thermal Paste/ | 2022-03-28 12:15 | - | |
| Thermal pads for aspire 7720G/ | 2022-03-28 12:15 | - | |
| The search for Acer Aspire one 160gb six-cell/ | 2022-03-28 12:15 | - | |
| The stupid thing I did ... and how I want to fix it!/ | 2022-03-28 12:15 | - | |
| The various AS5920G models/ | 2022-03-28 12:15 | - | |
| They say...it's no good to always leave/ | 2022-03-28 12:15 | - | |
| Thin Line in Middle of Screen Acer tm 4002LCI 15/ | 2022-03-28 12:15 | - | |
| Things NOT to do with an Acer 5672!/ | 2022-03-28 12:15 | - | |
| Think I could get Windows 7 running on my Aspire One/ | 2022-03-28 12:15 | - | |
| Thinking Of Buying The Acer 8920-6837/ | 2022-03-28 12:15 | - | |
| Thinking Out Loud - 6920G Upgrade to 9650M GS/ | 2022-03-28 12:15 | - | |
| Thinking about Acer 5672, have some 's/ | 2022-03-28 12:15 | - | |
| Thinking about a Timeline 1810/ | 2022-03-28 12:15 | - | |
| Thinking about buying a AS5024/ | 2022-03-28 12:15 | - | |
| Thinking about buying an Acer Aspire 5560 - Need advice/ | 2022-03-28 12:15 | - | |
| Thinking about getting an Acer Aspire TimelineX 5820TG/ | 2022-03-28 12:15 | - | |
| Thinking about getting an Aspire AS6920/ | 2022-03-28 12:15 | - | |
| Thinking about getting the 5742G, should I/ | 2022-03-28 12:15 | - | |
| Thinking of buying 5672, should I get the extended warranty/ | 2022-03-28 12:15 | - | |
| Thinking of buying ACER TRAVELMATE/ | 2022-03-28 12:15 | - | |
| Thinking of buying an Acer!/ | 2022-03-28 12:15 | - | |
| Thinking of buying aspire 5535 bit more info is appreciated/ | 2022-03-28 12:15 | - | |
| Thinking of upgrading 4820tg ram/ | 2022-03-28 12:15 | - | |
| Thinking of upgrading my Acer Aspire 5672 and need advice as it's my first time/ | 2022-03-28 12:15 | - | |
| Thinkpad 3000 (12 subnotebook) dont boot any more. please help/ | 2022-03-28 12:15 | - | |
| This Acer 5720 - a Good Deal/ | 2022-03-28 12:15 | - | |
| This Is A Test Only A Test/ | 2022-03-28 12:15 | - | |
| This could be good processor upgrade news for 1.5ghz 5920G owners!!/ | 2022-03-28 12:15 | - | |
| This is bugging me/ | 2022-03-28 12:15 | - | |
| This is intimidating..but here it goes -(/ | 2022-03-28 12:15 | - | |
| This is the longest wait of my life!!!!!!!/ | 2022-03-28 12:15 | - | |
| This keyboard is funny (lol)/ | 2022-03-28 12:15 | - | |
| This really isn't normal/ | 2022-03-28 12:15 | - | |
| This should be the last time/ | 2022-03-28 12:15 | - | |
| Thoughts on Acer Aspire AS5732Z-4855/ | 2022-03-28 12:15 | - | |
| Thoughts on Aspire 5935G/ | 2022-03-28 12:15 | - | |
| Thoughts on Samsung MZVLW256HEHP PM961 256GB M.2 Internal SSD/ | 2022-03-28 12:15 | - | |
| Thoughts on this laptop - Acer 7750g-6871/ | 2022-03-28 12:15 | - | |
| Thoughts on this laptop/ | 2022-03-28 12:15 | - | |
| Thoughts on using Acer 17x as a traditional “lap”top/ | 2022-03-28 12:15 | - | |
| ThrottleStop on 6700hq with liquid metal cooling. Get better peformance/ | 2022-03-28 12:15 | - | |
| Throttlestop acer 8930g/ | 2022-03-28 12:15 | - | |
| Throttling fix, easy and simple!!!/ | 2022-03-28 12:15 | - | |
| TimeLineX 3820 for Canada buyer (advice pls)/ | 2022-03-28 12:15 | - | |
| Time for an upgrade Acer Intel Core Duo 15.4 ATI Radeon X1600 $1069/ | 2022-03-28 12:15 | - | |
| Time for new battery/ | 2022-03-28 12:15 | - | |
| Timeline + Broadcom CrystalHD/ | 2022-03-28 12:15 | - | |
| Timeline- Canadian avaliability/ | 2022-03-28 12:15 | - | |
| Timeline 1810TZ wakes up from standby/ | 2022-03-28 12:15 | - | |
| Timeline 3500 CULV vs. Pentium M/ | 2022-03-28 12:15 | - | |
| Timeline 3810T , 4810T with 9 cell battery/ | 2022-03-28 12:15 | - | |
| Timeline 3810TG Concurrent Keyboard Touchpad issue/ | 2022-03-28 12:15 | - | |
| Timeline 3810T TG Modified BIOS - Fix for both graphics cards powered on/ | 2022-03-28 12:15 | - | |
| Timeline 3810T avaiable with bigger cell battery/ | 2022-03-28 12:15 | - | |
| Timeline 3810T for outdoor use/ | 2022-03-28 12:15 | - | |
| Timeline 3810T hard drive & RAM/ | 2022-03-28 12:15 | - | |
| Timeline 3810t Recovery Partiton/ | 2022-03-28 12:15 | - | |
| Timeline 4810 German keyboard layout/ | 2022-03-28 12:15 | - | |
| Timeline 4810TG 3G/ | 2022-03-28 12:15 | - | |
| Timeline 4810TG Windows 7 battery issues/ | 2022-03-28 12:15 | - | |
| Timeline 4810TZ DVD not deactivating anymore under Windows 7/ | 2022-03-28 12:15 | - | |
| Timeline 4810TZ question/ | 2022-03-28 12:15 | - | |
| Timeline 4810T internals disassembly pics/ | 2022-03-28 12:15 | - | |
| Timeline 4810T wireless problems/ | 2022-03-28 12:15 | - | |
| Timeline 4810 have an msata port inside/ | 2022-03-28 12:15 | - | |
| Timeline 4810 new BIOS/ | 2022-03-28 12:15 | - | |
| Timeline 4810 strange noise/ | 2022-03-28 12:15 | - | |
| Timeline 4810 win7 battery (and other) issues/ | 2022-03-28 12:15 | - | |
| Timeline 5810T Visualization enabled yet/ | 2022-03-28 12:15 | - | |
| Timeline 5810TZ-4657 Info & Review/ | 2022-03-28 12:15 | - | |
| Timeline 5821TZ question/ | 2022-03-28 12:15 | - | |
| Timeline 7745g HDD connection problem/ | 2022-03-28 12:15 | - | |
| Timeline AS4810TZ-4474 vs. AS4810TZ-4508/ | 2022-03-28 12:15 | - | |
| Timeline Aspire 4810T CAPS LOCK on screen notification stopped to appear/ | 2022-03-28 12:15 | - | |
| Timeline Aspire namesake confusion/ | 2022-03-28 12:15 | - | |
| Timeline Constant Fan Anomaly/ | 2022-03-28 12:15 | - | |
| Timeline Intel graphics issue/ | 2022-03-28 12:15 | - | |
| Timeline Launch Manger issue (win 7)/ | 2022-03-28 12:15 | - | |
| Timeline SU2700 3500 vs. SU9400/ | 2022-03-28 12:15 | - | |
| Timeline SU2700 vs. SU3500/ | 2022-03-28 12:15 | - | |
| Timeline SU2700 vs SU3500 tight budget/ | 2022-03-28 12:15 | - | |
| Timeline Surround Sound output (5.1 Ac3 DD DTS)/ | 2022-03-28 12:15 | - | |
| Timeline TZG , do you have one INTEL+ATI graphics/ | 2022-03-28 12:15 | - | |
| Timeline Ultra M3 availability/ | 2022-03-28 12:15 | - | |
| Timeline Ultra M5 problem with plastic feet/ | 2022-03-28 12:15 | - | |
| TimelineX 3820T Acer OS/ | 2022-03-28 12:15 | - | |
| TimelineX 3820TG Sleep Problems/ | 2022-03-28 12:15 | - | |
| TimelineX 4820T - Upgrading Hard Drive/ | 2022-03-28 12:15 | - | |
| TimelineX 4820TG wireless problem/ | 2022-03-28 12:15 | - | |
| TimelineX 4830-6808- new battery- is it bad/ | 2022-03-28 12:15 | - | |
| TimelineX 4830TG - upgrade CPU possible and overclocking the GPU/ | 2022-03-28 12:15 | - | |
| TimelineX 5820T no power/ | 2022-03-28 12:15 | - | |
| TimelineX 5830TG webcam gone/ | 2022-03-28 12:15 | - | |
| TimelineX Powersmart problem/ | 2022-03-28 12:15 | - | |
| TimelineX are now available from Amazon/ | 2022-03-28 12:15 | - | |
| TimelineX release date/ | 2022-03-28 12:15 | - | |
| Timeline keyboard NOT working in BIOS, working in the OS/ | 2022-03-28 12:15 | - | |
| Timeline screen brightness goes up and down lol/ | 2022-03-28 12:15 | - | |
| Timeline with Nvidia's Optimus/ | 2022-03-28 12:15 | - | |
| Timeline with the intel x25-m SSD, which OS/ | 2022-03-28 12:15 | - | |
| Timelinex 3830TG Dead Battery/ | 2022-03-28 12:15 | - | |
| Timeline x 4830 question/ | 2022-03-28 12:15 | - | |
| Time to mod acer insyde bios/ | 2022-03-28 12:15 | - | |
| Timline 3810T not booting from USB drive/ | 2022-03-28 12:15 | - | |
| Tips and Tricks for Acer 7551-3464/ | 2022-03-28 12:15 | - | |
| Tips for Timeline Users/ | 2022-03-28 12:15 | - | |
| Tips for a new Extensa 5620G user/ | 2022-03-28 12:15 | - | |
| Tips on getting those damn stickers off/ | 2022-03-28 12:15 | - | |
| Tm4402 Vs Tm4404/ | 2022-03-28 12:15 | - | |
| Tm8204 Sata Hd/ | 2022-03-28 12:15 | - | |
| To Acer's owners who have Windows 7 and need Acer official drivers/ | 2022-03-28 12:15 | - | |
| To Anyone that bought an AcerTimeline with the SU9400/ | 2022-03-28 12:15 | - | |
| To Bios, or Not to Bios/ | 2022-03-28 12:15 | - | |
| To Sleep or not to Sleep/ | 2022-03-28 12:15 | - | |
| To Smartcard or not to Smartcard/ | 2022-03-28 12:15 | - | |
| To Warranty or Not To Warranty, that is/ | 2022-03-28 12:15 | - | |
| To buy or not to buy Aspire 5672/ | 2022-03-28 12:15 | - | |
| Tochpad problem/ | 2022-03-28 12:15 | - | |
| To everyone looking for an Acer TimelineX 4820TG/ | 2022-03-28 12:15 | - | |
| To get Vista/ | 2022-03-28 12:15 | - | |
| Took apart my 5680...need help please/ | 2022-03-28 12:15 | - | |
| Toshiba GT330m upgrade to Acer 6930g/ | 2022-03-28 12:15 | - | |
| Toshiba TS-L802A Drive Wanted/ | 2022-03-28 12:15 | - | |
| Toshiba romless MXM-II HD4650 DDR3 1 GB @ Acer 5920G soldering project for beginners/ | 2022-03-28 12:15 | - | |
| Total List of CPUS compatible with Acer Aspire 5315-2153/ | 2022-03-28 12:15 | - | |
| Total Memory 4094 MB instead of 4096 MB/ | 2022-03-28 12:15 | - | |
| Total Memory in task manager incorrect after upgrade to 4gb Aspire 5735/ | 2022-03-28 12:15 | - | |
| Total Notebook Protection/ | 2022-03-28 12:15 | - | |
| Totally Boned for a While/ | 2022-03-28 12:15 | - | |
| Totally confused...can I do this/ | 2022-03-28 12:15 | - | |
| Totally modding 5102 wlmi-need some input/ | 2022-03-28 12:15 | - | |
| To those with a 5920G/ | 2022-03-28 12:15 | - | |
| Touch Pad Mouse Buttons Aspire 9300-5317/ | 2022-03-28 12:15 | - | |
| TouchPad Synaptics Drivers v15.0.17.0 modded/ | 2022-03-28 12:15 | - | |
| Touch Pad not working/ | 2022-03-28 12:15 | - | |
| Touchpad (mouse) suddenly not working on acer 8930G/ | 2022-03-28 12:15 | - | |
| Touchpad - Issues and Impressions (Predator G9-791)/ | 2022-03-28 12:15 | - | |
| Touch pad 2420/ | 2022-03-28 12:15 | - | |
| Touchpad Cursor Stops Working/ | 2022-03-28 12:15 | - | |
| Touchpad Hangs/ | 2022-03-28 12:15 | - | |
| Touchpad Keyboard dead after SP1 update on Vista Business/ | 2022-03-28 12:15 | - | |
| Touchpad Scrolling & Firefox TM2414/ | 2022-03-28 12:15 | - | |
| Touchpad Sensitivity/ | 2022-03-28 12:15 | - | |
| Touchpad and Keyboard stutter on Acer 3680/ | 2022-03-28 12:15 | - | |
| Touchpad doesn't work - Acer TravelMate TM8573T/ | 2022-03-28 12:15 | - | |
| Touchpad for 5315/ | 2022-03-28 12:15 | - | |
| Touchpad help!!/ | 2022-03-28 12:15 | - | |
| Touchpad keyboard not working until battery removed on Aspire 3502/ | 2022-03-28 12:15 | - | |
| Touchpad lag Acer Aspire 5741Z/ | 2022-03-28 12:15 | - | |
| Touchpad not working-Travelmate 4150/ | 2022-03-28 12:15 | - | |
| Touchpad on Acer Aspire 3023wmli/ | 2022-03-28 12:15 | - | |
| Touchpad on TM 8204/ | 2022-03-28 12:15 | - | |
| Touchpad problem (Aspire 2930)/ | 2022-03-28 12:15 | - | |
| Touchpad problem, please help!/ | 2022-03-28 12:15 | - | |
| Touchpad problem on Aspire one ZG5/ | 2022-03-28 12:15 | - | |
| Touchpad problems/ | 2022-03-28 12:15 | - | |
| Touchpad scrolling problems on spire 7730/ | 2022-03-28 12:15 | - | |
| Touchpad scroll not working/ | 2022-03-28 12:15 | - | |
| Touchscreen mod for 1810T/ | 2022-03-28 12:15 | - | |
| Touch up paint/ | 2022-03-28 12:15 | - | |
| Tracking down a weird Aspire model # - help/ | 2022-03-28 12:15 | - | |
| Trackpad dead/ | 2022-03-28 12:15 | - | |
| Trackpad issues on Travelmate 3000/ | 2022-03-28 12:15 | - | |
| Trading my Acer Aspire 5102 for Toshiba Satellite a70 is it worth it/ | 2022-03-28 12:15 | - | |
| Travel Mate 230 280/ | 2022-03-28 12:15 | - | |
| TravelMate 230 Restore Disk/ | 2022-03-28 12:15 | - | |
| TravelMate 290/ | 2022-03-28 12:15 | - | |
| TravelMate 290E/ | 2022-03-28 12:15 | - | |
| TravelMate 290XCi NoteBook/ | 2022-03-28 12:15 | - | |
| TravelMate 330T/ | 2022-03-28 12:15 | - | |
| TravelMate 530 and new ram memory/ | 2022-03-28 12:15 | - | |
| TravelMate 533XV upgrade ram memory/ | 2022-03-28 12:15 | - | |
| TravelMate 800 lockdown/ | 2022-03-28 12:15 | - | |
| TravelMate 803LCi & 100GB HDD/ | 2022-03-28 12:15 | - | |
| TravelMate 803LCi & DVD+-RW drive/ | 2022-03-28 12:15 | - | |
| TravelMate 1682WLCi vs Aspire 4002LMi/ | 2022-03-28 12:15 | - | |
| TravelMate 2000 half speed/ | 2022-03-28 12:15 | - | |
| TravelMate 2000 temperature/ | 2022-03-28 12:15 | - | |
| TravelMate 2300 3dMark2001se/ | 2022-03-28 12:15 | - | |
| TravelMate 2303LC power up problem/ | 2022-03-28 12:15 | - | |
| TravelMate 2303Wlmi/ | 2022-03-28 12:15 | - | |
| TravelMate 2310 - Acer Manager issues/ | 2022-03-28 12:15 | - | |
| TravelMate 2312 poor battery/ | 2022-03-28 12:15 | - | |
| TravelMate 2420/ | 2022-03-28 12:15 | - | |
| TravelMate 2420 Bios problem/ | 2022-03-28 12:15 | - | |
| TravelMate 2420 problem/ | 2022-03-28 12:15 | - | |
| TravelMate 2428 Modem/ | 2022-03-28 12:15 | - | |
| TravelMate 2450 CPU Upgradeable Need Info!/ | 2022-03-28 12:15 | - | |
| TravelMate 2480-2779 Recovery/ | 2022-03-28 12:15 | - | |
| TravelMate 2490/ | 2022-03-28 12:15 | - | |
| TravelMate 2492WLMi power problems/ | 2022-03-28 12:15 | - | |
| TravelMate 3202XMi and Large Hard Drives/ | 2022-03-28 12:15 | - | |
| TravelMate 3250 Series - I feel like an orphan/ | 2022-03-28 12:15 | - | |
| TravelMate 3260 Series Thread/ | 2022-03-28 12:15 | - | |
| TravelMate 4000 No Sound/ | 2022-03-28 12:15 | - | |
| TravelMate 4000 won't turn on/ | 2022-03-28 12:15 | - | |
| TravelMate 4001 with Radeon 9700 64 Mb/ | 2022-03-28 12:15 | - | |
| TravelMate 4002WLMi Bluetooth/ | 2022-03-28 12:15 | - | |
| TravelMate 4062WLMi- Keyboard touchpad HELP/ | 2022-03-28 12:15 | - | |
| TravelMate 4200 or 8100/ | 2022-03-28 12:15 | - | |
| TravelMate 4202WLMI recovery problem/ | 2022-03-28 12:15 | - | |
| TravelMate 4280 - working but blank on boot/ | 2022-03-28 12:15 | - | |
| TravelMate 4400 U.S. release/ | 2022-03-28 12:15 | - | |
| TravelMate 4402 doesn't support Hyper Memory/ | 2022-03-28 12:15 | - | |
| TravelMate 4402 video problems/ | 2022-03-28 12:15 | - | |
| TravelMate 4502/ | 2022-03-28 12:15 | - | |
| TravelMate 4502WLMi - DVD-Dual/ | 2022-03-28 12:15 | - | |
| TravelMate 4650 GF Go6600/ | 2022-03-28 12:15 | - | |
| TravelMate 4740-5261 no Power/ | 2022-03-28 12:15 | - | |
| TravelMate 5310 CPU Upgrade/ | 2022-03-28 12:15 | - | |
| TravelMate 5510 losing DVD Drive/ | 2022-03-28 12:15 | - | |
| TravelMate 5520 SATA driver problem/ | 2022-03-28 12:15 | - | |
| TravelMate 5720 Grapnic drivers/ | 2022-03-28 12:15 | - | |
| TravelMate 5730 - Totally Dead !/ | 2022-03-28 12:15 | - | |
| TravelMate 5740 keyboard removal/ | 2022-03-28 12:15 | - | |
| TravelMate 6410 & 4gb RAM/ | 2022-03-28 12:15 | - | |
| TravelMate 7720/ | 2022-03-28 12:15 | - | |
| TravelMate 7750G Need keyboard replacement/ | 2022-03-28 12:15 | - | |
| TravelMate 8000 Availability In Canada/ | 2022-03-28 12:15 | - | |
| TravelMate 8100 & Apple Cinema Display 30 inches/ | 2022-03-28 12:15 | - | |
| TravelMate 8100 Windows XP Clean Install Issue/ | 2022-03-28 12:15 | - | |
| TravelMate 8103 VS 8104 differences/ | 2022-03-28 12:15 | - | |
| TravelMate 8103WLMi and Vista/ | 2022-03-28 12:15 | - | |
| TravelMate 8104 or Aspire 1693/ | 2022-03-28 12:15 | - | |
| TravelMate 8200 Price and Release date/ | 2022-03-28 12:15 | - | |
| TravelMate 8200 plastic or aluminum/ | 2022-03-28 12:15 | - | |
| TravelMate 8204 - funny buzzing noise from cooling fan/ | 2022-03-28 12:15 | - | |
| TravelMate 8204WLMI Keyboard problems - need help/ | 2022-03-28 12:15 | - | |
| TravelMate 8204WLMi dies/ | 2022-03-28 12:15 | - | |
| TravelMate 8210 (What is the difference between these model part numbers)/ | 2022-03-28 12:15 | - | |
| TravelMate 8210 - LAN doesn't work/ | 2022-03-28 12:15 | - | |
| TravelMate 8210 vs. old 8200/ | 2022-03-28 12:15 | - | |
| TravelMate 8215 Bluetooth phone and Smart Card Problem/ | 2022-03-28 12:15 | - | |
| TravelMate 8215WLMi/ | 2022-03-28 12:15 | - | |
| TravelMate 8215 periodic slow response and line flitting on display/ | 2022-03-28 12:15 | - | |
| TravelMate 8371 slow ethernet transfer speed/ | 2022-03-28 12:15 | - | |
| TravelMate 8473TG - throttling and modded vBIOS/ | 2022-03-28 12:15 | - | |
| TravelMate B1 vs. AO756/ | 2022-03-28 12:15 | - | |
| TravelMate Bluetooth Module/ | 2022-03-28 12:15 | - | |
| TravelMate C310 Keyboard Problems/ | 2022-03-28 12:15 | - | |
| TravelMate IDE Hard Drive Help/ | 2022-03-28 12:15 | - | |
| TravelMate Keyboard Replacement/ | 2022-03-28 12:15 | - | |
| TravelMate Laptop Problems/ | 2022-03-28 12:15 | - | |
| TravelMate S-Video Out to Tv Not Working/ | 2022-03-28 12:15 | - | |
| TravelMate TM2428AWXMi/ | 2022-03-28 12:15 | - | |
| TravelMate TM4502WLMi battery on Vista/ | 2022-03-28 12:15 | - | |
| TravelMate TM8104AWLMi vs. Aspire AS5672WLMi-120GB/ | 2022-03-28 12:15 | - | |
| TravelMate VS Aspire/ | 2022-03-28 12:15 | - | |
| TravelMate off to Texas for warranty work/ | 2022-03-28 12:15 | - | |
| TravelMate to Hell - Story of the 8204 damaged by protective plastic/ | 2022-03-28 12:15 | - | |
| Travelamte 8200 announced/ | 2022-03-28 12:15 | - | |
| Travelmate 240 - Wireless Card/ | 2022-03-28 12:15 | - | |
| Travelmate 240 250 series owners/ | 2022-03-28 12:15 | - | |
| Travelmate 240 CPU Upgrade - No Worky/ | 2022-03-28 12:15 | - | |
| Travelmate 240 dvd drive upgrade/ | 2022-03-28 12:15 | - | |
| Travelmate 244LM power supply overheating/ | 2022-03-28 12:15 | - | |
| Travelmate 250 need to recover bios/ | 2022-03-28 12:15 | - | |
| Travelmate 290 Problems- Help Requested/ | 2022-03-28 12:15 | - | |
| Travelmate 291 problem/ | 2022-03-28 12:15 | - | |
| Travelmate 370 [Problems with Vista]/ | 2022-03-28 12:15 | - | |
| Travelmate 370 scrambled video issue/ | 2022-03-28 12:15 | - | |
| Travelmate 371TCi/ | 2022-03-28 12:15 | - | |
| Travelmate 382TCi/ | 2022-03-28 12:15 | - | |
| Travelmate 510 series/ | 2022-03-28 12:15 | - | |
| Travelmate 540 help please/ | 2022-03-28 12:15 | - | |
| Travelmate 646x series- are there any experiences reviews/ | 2022-03-28 12:15 | - | |
| Travelmate 800 Clock Multiplier/ | 2022-03-28 12:15 | - | |
| Travelmate 800lci dvd upgrade/ | 2022-03-28 12:15 | - | |
| Travelmate 800 series Question/ | 2022-03-28 12:15 | - | |
| Travelmate 800 what can you tell me about it/ | 2022-03-28 12:15 | - | |
| Travelmate 803 - error when playing/ | 2022-03-28 12:15 | - | |
| Travelmate 2300 CD-ROM problem/ | 2022-03-28 12:15 | - | |
| Travelmate 2303WCLi RAM/ | 2022-03-28 12:15 | - | |
| Travelmate 2350/ | 2022-03-28 12:15 | - | |
| Travelmate 2400 - No Sound/ | 2022-03-28 12:15 | - | |
| Travelmate 2414WLMi & UJ-870 Panasonic DVD/ | 2022-03-28 12:15 | - | |
| Travelmate 2414WLMi largest HD side/ | 2022-03-28 12:15 | - | |
| Travelmate 2420 Acer's cellophane tape repair/ | 2022-03-28 12:15 | - | |
| Travelmate 2420 not booting/ | 2022-03-28 12:15 | - | |
| Travelmate 2420 won't recognize FireWire PC card/ | 2022-03-28 12:15 | - | |
| Travelmate 2423 - CPU-fan trouble/ | 2022-03-28 12:15 | - | |
| Travelmate 2423WXMi - need opinions/ | 2022-03-28 12:15 | - | |
| Travelmate 2428AWXCi - Need Help/ | 2022-03-28 12:15 | - | |
| Travelmate 2428 wifi problem/ | 2022-03-28 12:15 | - | |
| Travelmate 2450, How do i Reset the Bios/ | 2022-03-28 12:15 | - | |
| Travelmate 2450 bsod errors with 2x1gig sticks/ | 2022-03-28 12:15 | - | |
| Travelmate 2483 - Good Value/ | 2022-03-28 12:15 | - | |
| Travelmate 2490's keyboard/ | 2022-03-28 12:15 | - | |
| Travelmate 2490 CPU Upgrade - Failed/ | 2022-03-28 12:15 | - | |
| Travelmate 2490 Service Manual/ | 2022-03-28 12:15 | - | |
| Travelmate 2490 turns off suddenly/ | 2022-03-28 12:15 | - | |
| Travelmate 2700 Help!/ | 2022-03-28 12:15 | - | |
| Travelmate 3002/ | 2022-03-28 12:15 | - | |
| Travelmate 3004 WTMi does not read 2GB SD Card/ | 2022-03-28 12:15 | - | |
| Travelmate 3010 3012 3022 Infos/ | 2022-03-28 12:15 | - | |
| Travelmate 3200 + poor external video/ | 2022-03-28 12:15 | - | |
| Travelmate 3200/ | 2022-03-28 12:15 | - | |
| Travelmate 3200 Recovery CD/ | 2022-03-28 12:15 | - | |
| Travelmate 3200 replacement CD-ROM/ | 2022-03-28 12:15 | - | |
| Travelmate 3201XCi HDD issue/ | 2022-03-28 12:15 | - | |
| Travelmate 3201 and Bluetooth/ | 2022-03-28 12:15 | - | |
| Travelmate 3201 battery life/ | 2022-03-28 12:15 | - | |
| Travelmate 3203UXi/ | 2022-03-28 12:15 | - | |
| Travelmate 3204XMi/ | 2022-03-28 12:15 | - | |
| Travelmate 3270-6569 - A solid dissapointment/ | 2022-03-28 12:15 | - | |
| Travelmate 3290 screen brightness/ | 2022-03-28 12:15 | - | |
| Travelmate 4000 Repair Help/ | 2022-03-28 12:15 | - | |
| Travelmate 4001LCi repair question/ | 2022-03-28 12:15 | - | |
| Travelmate 4010 woe's/ | 2022-03-28 12:15 | - | |
| Travelmate 4060 Wireless Vista Problem/ | 2022-03-28 12:15 | - | |
| Travelmate 4062 Bluetooth module/ | 2022-03-28 12:15 | - | |
| Travelmate 4064WLMi power problem/ | 2022-03-28 12:15 | - | |
| Travelmate 4072NLCi Bios Update/ | 2022-03-28 12:15 | - | |
| Travelmate 4101Lmi display problem/ | 2022-03-28 12:15 | - | |
| Travelmate 4101WLMi - Noise level/ | 2022-03-28 12:15 | - | |
| Travelmate 4200 Screen Problems/ | 2022-03-28 12:15 | - | |
| Travelmate 4200 failing, don't know what part/ | 2022-03-28 12:15 | - | |
| Travelmate4220 audio device does not appear/ | 2022-03-28 12:15 | - | |
| Travelmate 4230 Windows .wav's missing/ | 2022-03-28 12:15 | - | |
| Travelmate 4400 Networking Issue/ | 2022-03-28 12:15 | - | |
| Travelmate 4401/ | 2022-03-28 12:15 | - | |
| Travelmate 4500 Display Issue/ | 2022-03-28 12:15 | - | |
| Travelmate 4500 vs Aspire 2020/ | 2022-03-28 12:15 | - | |
| Travelmate 4501LMi won't power up. Help!/ | 2022-03-28 12:15 | - | |
| Travelmate 4501 Questions/ | 2022-03-28 12:15 | - | |
| Travelmate 4501 and 3201 question/ | 2022-03-28 12:15 | - | |
| Travelmate 4501 problems/ | 2022-03-28 12:15 | - | |
| Travelmate 4502 or aspire 1682/ | 2022-03-28 12:15 | - | |
| Travelmate 4502 wireless problems/ | 2022-03-28 12:15 | - | |
| Travelmate 4600 - radeon X600 overheating problem - image gets blue&red noise/ | 2022-03-28 12:15 | - | |
| Travelmate 4600 Drivers - Install/ | 2022-03-28 12:15 | - | |
| Travelmate 4601WLMi getting quite hot/ | 2022-03-28 12:15 | - | |
| Travelmate 4602 hard drive nightmare/ | 2022-03-28 12:15 | - | |
| Travelmate 4603Wlci Good/ | 2022-03-28 12:15 | - | |
| Travelmate 4652 vs. Aspire 5024/ | 2022-03-28 12:15 | - | |
| Travelmate 4720 or Aspire 4736Z/ | 2022-03-28 12:15 | - | |
| Travelmate 4730 bios password issue/ | 2022-03-28 12:15 | - | |
| Travelmate 5320 - XPdrivers to soundcard/ | 2022-03-28 12:15 | - | |
| Travelmate 5320 Upgrade Help/ | 2022-03-28 12:15 | - | |
| Travelmate 5320 ram upgrade question/ | 2022-03-28 12:15 | - | |
| Travelmate 5520 Corrupt Bios/ | 2022-03-28 12:15 | - | |
| Travelmate 5520G HDMI audio/ | 2022-03-28 12:15 | - | |
| Travelmate 5520 internet problems/ | 2022-03-28 12:15 | - | |
| Travelmate 5610 Bluetooth Radio/ | 2022-03-28 12:15 | - | |
| Travelmate 5614-is this a lemon/ | 2022-03-28 12:15 | - | |
| Travelmate 5630 display issues/ | 2022-03-28 12:15 | - | |
| Travelmate 5720 + 22 Monitor/ | 2022-03-28 12:15 | - | |
| Travelmate 5720/ | 2022-03-28 12:15 | - | |
| Travelmate 5720 problem/ | 2022-03-28 12:15 | - | |
| Travelmate 5730 Hard disk noise at startup/ | 2022-03-28 12:15 | - | |
| Travelmate 5740 bsod/ | 2022-03-28 12:15 | - | |
| Travelmate 5744Z Driver XP/ | 2022-03-28 12:15 | - | |
| Travelmate 6003LMI card reader doesn't read MMC/ | 2022-03-28 12:15 | - | |
| Travelmate 6292/ | 2022-03-28 12:15 | - | |
| Travelmate 6292 RAM upgrade question/ | 2022-03-28 12:15 | - | |
| Travelmate 6413 lmi BIOS death/ | 2022-03-28 12:15 | - | |
| Travelmate 6593g/ | 2022-03-28 12:15 | - | |
| Travelmate 7520G 2400xt - 4650 DDR2 (MXM-II upgrade)/ | 2022-03-28 12:15 | - | |
| Travelmate 7520G and 800Mhz DDR2 problem/ | 2022-03-28 12:15 | - | |
| Travelmate 7530G Startup Problem/ | 2022-03-28 12:15 | - | |
| Travelmate 7720, 3-key keyboard shortcuts not working/ | 2022-03-28 12:15 | - | |
| Travelmate 7720g crystalBrite Screen Quality/ | 2022-03-28 12:15 | - | |
| Travelmate 8000, Only 15/ | 2022-03-28 12:15 | - | |
| Travelmate 8000 series lcd casing/ | 2022-03-28 12:15 | - | |
| Travelmate 8013 gfx problems when booting with cd/ | 2022-03-28 12:15 | - | |
| Travelmate 8100 (8104) Availability/ | 2022-03-28 12:15 | - | |
| Travelmate 8100 - Here comes SONOMA/ | 2022-03-28 12:15 | - | |
| Travelmate 8103 Failing IDE Controller/ | 2022-03-28 12:15 | - | |
| Travelmate 8104/ | 2022-03-28 12:15 | - | |
| Travelmate 8104 Battery Power Dying Horribly/ | 2022-03-28 12:15 | - | |
| Travelmate 8104WLMI power problems/ | 2022-03-28 12:15 | - | |
| Travelmate 8104 Wont burn some media at above 2x!/ | 2022-03-28 12:15 | - | |
| Travelmate 8104 screen problem/ | 2022-03-28 12:15 | - | |
| Travelmate 8200 'lost' AC'97 modem/ | 2022-03-28 12:15 | - | |
| Travelmate 8200 - blowing Power Supply units/ | 2022-03-28 12:15 | - | |
| Travelmate 8200/ | 2022-03-28 12:15 | - | |
| Travelmate 8200 Memory Upgrade/ | 2022-03-28 12:15 | - | |
| Travelmate 8200 Orbicam -- Who has had has problems/ | 2022-03-28 12:15 | - | |
| Travelmate 8200 available for pre-order/ | 2022-03-28 12:15 | - | |
| Travelmate 8200 reading SD card/ | 2022-03-28 12:15 | - | |
| Travelmate 8200 replacing hard drive/ | 2022-03-28 12:15 | - | |
| Travelmate 8200 vs Aspire 5670/ | 2022-03-28 12:15 | - | |
| Travelmate 8204, what PLL IC .. anyone opening their's up soon/ | 2022-03-28 12:15 | - | |
| Travelmate 8204 MASSIVE failure issue/ | 2022-03-28 12:15 | - | |
| Travelmate 8204 WLMi Sound Driver/ | 2022-03-28 12:15 | - | |
| Travelmate 8204 battery/ | 2022-03-28 12:15 | - | |
| Travelmate 8204 break down after 1 day/ | 2022-03-28 12:15 | - | |
| Travelmate 8204 output volume/ | 2022-03-28 12:15 | - | |
| Travelmate 8204 warning!/ | 2022-03-28 12:15 | - | |
| Travelmate 8215 - upgraded to vista, how can i restore to factory settings/ | 2022-03-28 12:15 | - | |
| Travelmate 8371, 8471 - business timeline/ | 2022-03-28 12:15 | - | |
| Travelmate 8371 USA market/ | 2022-03-28 12:15 | - | |
| Travelmate 8371 keyboard compatible with 3810/ | 2022-03-28 12:15 | - | |
| Travelmate 8371 vs Timeline T3810T-6415/ | 2022-03-28 12:15 | - | |
| Travelmate 8371 with SU9400 - TEST by Notebookjournal/ | 2022-03-28 12:15 | - | |
| Travelmate 8471 - user impressions/ | 2022-03-28 12:15 | - | |
| Travelmate 8472T nothing appens after Ctrl+Alt+Del/ | 2022-03-28 12:15 | - | |
| Travelmate 8741 New 7200 HDD GPU UPGRD/ | 2022-03-28 12:15 | - | |
| Travelmate ACER 2480/ | 2022-03-28 12:15 | - | |
| Travelmate C110 - Restore CD's will not restore/ | 2022-03-28 12:15 | - | |
| Travelmate C300 won't drive external display/ | 2022-03-28 12:15 | - | |
| Travelmate Cureved keyboard . How good is it/ | 2022-03-28 12:15 | - | |
| Travelmate P645-MG win8.1 Wifi LAN breaks sleep mode/ | 2022-03-28 12:15 | - | |
| Travelmate Problem/ | 2022-03-28 12:15 | - | |
| Travelmate Replacement Screen/ | 2022-03-28 12:15 | - | |
| Travelmate Timeline/ | 2022-03-28 12:15 | - | |
| Travelmate TimelineX 8372T-7925 Slim Battery/ | 2022-03-28 12:15 | - | |
| Travelmate Timeline vs Aspire Timeline Any real difference/ | 2022-03-28 12:15 | - | |
| Travelmate Webcam Gone Grey- Help!!/ | 2022-03-28 12:15 | - | |
| Travelmate drive cage modding queestions/ | 2022-03-28 12:15 | - | |
| Travelmate hd 3650 vs 3470xt/ | 2022-03-28 12:15 | - | |
| Travelmate notebook dead/ | 2022-03-28 12:15 | - | |
| Travelmate or Aspire/ | 2022-03-28 12:15 | - | |
| Trick with the VoIP 8204 Phone/ | 2022-03-28 12:15 | - | |
| Tried Forcing Win10 Update on Acer Aspire S7 392-installion failure/ | 2022-03-28 12:15 | - | |
| Triton 300 SE ......New 14” RTX 3060 laptop/ | 2022-03-28 12:15 | - | |
| Triton 500/ | 2022-03-28 12:15 | - | |
| Triton 500 VS Clevo P750TM-G/ | 2022-03-28 12:15 | - | |
| Trojan Horse/ | 2022-03-28 12:15 | - | |
| Trouble Acer 4736z/ | 2022-03-28 12:15 | - | |
| Trouble finding proper battery for Travelmate 4202WLMi/ | 2022-03-28 12:15 | - | |
| Trouble recording line in on ACER 5610Z/ | 2022-03-28 12:15 | - | |
| Trouble reinstalling Vista to Extensa 5420/ | 2022-03-28 12:15 | - | |
| Trouble updating video driver for a Travelmate 3002/ | 2022-03-28 12:15 | - | |
| Trouble with Recovery DVD/ | 2022-03-28 12:15 | - | |
| Trouble with TM291LMi/ | 2022-03-28 12:15 | - | |
| Trouble with burned CD media on Acer 8943G/ | 2022-03-28 12:15 | - | |
| True5.1-channel surround sound output/ | 2022-03-28 12:15 | - | |
| Trusted Core BIOS problem/ | 2022-03-28 12:15 | - | |
| Try Synaptics new Software Scrybe/ | 2022-03-28 12:15 | - | |
| Trying to decide between Acer and Asus/ | 2022-03-28 12:15 | - | |
| Trying to decide on 5672 or Compaq V4000t/ | 2022-03-28 12:15 | - | |
| Trying to disabe 5920G Vista start-up pop-ups/ | 2022-03-28 12:15 | - | |
| Trying to disassemble Aspire 7720-6536 and reset BIOS pass/ | 2022-03-28 12:15 | - | |
| Trying to lower fan speed on Acer Aspire 5536g/ | 2022-03-28 12:15 | - | |
| Trying to purchase an Acer 20xx/ | 2022-03-28 12:15 | - | |
| Trying to recover Acer 3500 with Alt + F10, nothing happens/ | 2022-03-28 12:15 | - | |
| Trying to repair dead graphics cards on Aspire 7720G, 7735G and 8930G/ | 2022-03-28 12:15 | - | |
| Trying to upgrade my 5920 HDD to SSD, need some help/ | 2022-03-28 12:15 | - | |
| Try this game on your 5920G...and See what this Laptop can really do!/ | 2022-03-28 12:15 | - | |
| Try to install new battery/ | 2022-03-28 12:15 | - | |
| Tuba Cinebass Subwoofer not working with Windows 7 !/ | 2022-03-28 12:15 | - | |
| Turbo-Memory Easily Added to the 5920G for Under $30.00!!!/ | 2022-03-28 12:15 | - | |
| Turion64 X2 and RAM upgrade/ | 2022-03-28 12:15 | - | |
| Turion 64X2 cpu lower frequency when AC powered/ | 2022-03-28 12:15 | - | |
| Turion MK36/ | 2022-03-28 12:15 | - | |
| Turion ML 34 vs Turion TL50x2/ | 2022-03-28 12:15 | - | |
| Turion X2 Ultra in place of TL-50. Is it possible/ | 2022-03-28 12:15 | - | |
| Turion X2 undervolting help/ | 2022-03-28 12:15 | - | |
| Turion X2 upgrade for F3400/ | 2022-03-28 12:15 | - | |
| Turion with X700 128Mb or centrino with X700 64Mb in an Acer/ | 2022-03-28 12:15 | - | |
| Turning OSD off on 2012WLMi/ | 2022-03-28 12:15 | - | |
| Turning off notebook monitor LCD/ | 2022-03-28 12:15 | - | |
| Turning off screen/ | 2022-03-28 12:15 | - | |
| Turn off ---- Hibernation/ | 2022-03-28 12:15 | - | |
| Turn off the screen manually on 5920G/ | 2022-03-28 12:15 | - | |
| Tutorial- How to replace the 3820TG with a new SSD HDD (Photos inside)/ | 2022-03-28 12:15 | - | |
| Tv Tuner Install Acer 6930G/ | 2022-03-28 12:15 | - | |
| Tweaking 8930/ | 2022-03-28 12:15 | - | |
| Two FAT32 Partitions to NTFS/ | 2022-03-28 12:15 | - | |
| Two Finger Tapping/ | 2022-03-28 12:15 | - | |
| Two Questions/ | 2022-03-28 12:15 | - | |
| Two Thoughts/ | 2022-03-28 12:15 | - | |
| Two more questions, Aspire 1681/ | 2022-03-28 12:15 | - | |
| Two new 8204 questions/ | 2022-03-28 12:15 | - | |
| Two usb ports power off randomly/ | 2022-03-28 12:15 | - | |
| UEFI booting on 5810T - Does it still work/ | 2022-03-28 12:16 | - | |
| UK- Where to buy 5930g/ | 2022-03-28 12:16 | - | |
| UK AcerAdvantage extended Warranty problem/ | 2022-03-28 12:16 | - | |
| UK Ferrari 1000 info/ | 2022-03-28 12:16 | - | |
| UK Power Adaptor for Acer AS1810TZ/ | 2022-03-28 12:16 | - | |
| UK Release for ATI Timeline 3810T varient/ | 2022-03-28 12:16 | - | |
| UNABLE TO INSTALL WINDOWS XP OPERATING SYSTEM ON ACER ASPIRE 5102wlmi/ | 2022-03-28 12:16 | - | |
| UNlocked Gobi 2000/ | 2022-03-28 12:16 | - | |
| UPDATED- HELP! Acer AS3820TG vs Acer AS5820T graphics/ | 2022-03-28 12:16 | - | |
| URGENT! Acer 6935g assembly problem -p/ | 2022-03-28 12:16 | - | |
| URGENT - Fan Replacement on TM8204 (disregard other thread please)/ | 2022-03-28 12:16 | - | |
| URGENT HELP ! Replacing graphics card in acer 5024 !/ | 2022-03-28 12:16 | - | |
| URGENT HELP PLEASE - Acer TM8200 heatsink fan/ | 2022-03-28 12:16 | - | |
| URGENT Help Needed pls. Acer Travelmate 4062LMi Wont Boot/ | 2022-03-28 12:16 | - | |
| USB, Keyboard and Mouse problem!/ | 2022-03-28 12:16 | - | |
| USB 2.0 Problem/ | 2022-03-28 12:16 | - | |
| USB 2.0 before OS load, possible/ | 2022-03-28 12:16 | - | |
| USB Bus failure after Win 7 install/ | 2022-03-28 12:16 | - | |
| USB Controller on Acer Aspire 3000 notebook/ | 2022-03-28 12:16 | - | |
| USB Driver problem - doesn't recognised USB device/ | 2022-03-28 12:16 | - | |
| USB External Hard Drive Problem/ | 2022-03-28 12:16 | - | |
| USB Headset problems/ | 2022-03-28 12:16 | - | |
| USB Keypad issue on aspire 6920/ | 2022-03-28 12:16 | - | |
| USB Mouse on 5102WLMi/ | 2022-03-28 12:16 | - | |
| USB Port Replicator/ | 2022-03-28 12:16 | - | |
| USB Port looks different than usual/ | 2022-03-28 12:16 | - | |
| USB Ports lost power (5720G)/ | 2022-03-28 12:16 | - | |
| USB Problem on 5102/ | 2022-03-28 12:16 | - | |
| USB bug code error/ | 2022-03-28 12:16 | - | |
| USB drivers won't load/ | 2022-03-28 12:16 | - | |
| USB has become slow/ | 2022-03-28 12:16 | - | |
| USB malfunction due to short circuit!/ | 2022-03-28 12:16 | - | |
| USB or Bluetooth Logitech Mouse for Aspire 5610/ | 2022-03-28 12:16 | - | |
| USB ports losing power on aspire 5315/ | 2022-03-28 12:16 | - | |
| USB ports not working 5720 OH NO !/ | 2022-03-28 12:16 | - | |
| USB power stays on in sleep mode -(/ | 2022-03-28 12:16 | - | |
| USB problem/ | 2022-03-28 12:16 | - | |
| USER ERROR or APSIRE 5920G PROBLEM/ | 2022-03-28 12:16 | - | |
| USING partition magic with acer/ | 2022-03-28 12:16 | - | |
| US Tax Duty Importing from Singapore/ | 2022-03-28 12:16 | - | |
| US and CND acer laptop - whitout dedicated graphics!!/ | 2022-03-28 12:16 | - | |
| US release Dates/ | 2022-03-28 12:16 | - | |
| Ubuntu/ | 2022-03-28 12:15 | - | |
| Ubuntu Linux on a 6920G/ | 2022-03-28 12:15 | - | |
| Ubuntu UNR 9.10 (Linux) works wonderful on my 1810tz/ | 2022-03-28 12:16 | - | |
| Ubuntu on Aspire 5100 Wireless/ | 2022-03-28 12:15 | - | |
| Ubuntu on aspire 5100 broadcom wireless/ | 2022-03-28 12:15 | - | |
| Ubuntu on the Extensa 5230E/ | 2022-03-28 12:16 | - | |
| Uh oh the prices changed/ | 2022-03-28 12:16 | - | |
| Uk acer aspie 5051 spec/ | 2022-03-28 12:16 | - | |
| UltraBright Glossy Screen for TravelMate 2480/ | 2022-03-28 12:16 | - | |
| Unable to Create Recovery Disc/ | 2022-03-28 12:16 | - | |
| Unable to burn recovery dvd's/ | 2022-03-28 12:16 | - | |
| Unable to connect to internet on battery power/ | 2022-03-28 12:16 | - | |
| Unable to go beyond BIOS readout on travelmate 803LCI/ | 2022-03-28 12:16 | - | |
| Unable to install synaptics touchpad 14.0.6.0 on 5920g/ | 2022-03-28 12:16 | - | |
| Unable to remove huawei usb modem/ | 2022-03-28 12:16 | - | |
| Unassembling my Travelmate (NOT ASPIRE) 5735z/ | 2022-03-28 12:16 | - | |
| Underclocking with SoftFSB - what clock generator/ | 2022-03-28 12:16 | - | |
| Understanding the Recovery Partition Usage/ | 2022-03-28 12:16 | - | |
| Undervolting 4670/ | 2022-03-28 12:16 | - | |
| Undervolting 8204/ | 2022-03-28 12:16 | - | |
| Undervolting Acer 5920G/ | 2022-03-28 12:16 | - | |
| Undervolting Acer Aspire 1810TZ/ | 2022-03-28 12:16 | - | |
| Undervolting HARDWARE MOD 1810tz SU4100/ | 2022-03-28 12:16 | - | |
| Undervolting a Gemstone Blue/ | 2022-03-28 12:16 | - | |
| Undervolting didnt help/ | 2022-03-28 12:16 | - | |
| Undervolting the SU2300/ | 2022-03-28 12:16 | - | |
| Uneven LED backlight/ | 2022-03-28 12:16 | - | |
| Unfindable disk partition in brand new laptop/ | 2022-03-28 12:16 | - | |
| Unhide Bios Menu Amd-v Acer 4253/ | 2022-03-28 12:16 | - | |
| Uninstalling Acer eRecovery/ | 2022-03-28 12:16 | - | |
| Universal AC Adapters/ | 2022-03-28 12:16 | - | |
| Unknown Device- Location 1 (Internal High Definition Audio Bus)/ | 2022-03-28 12:16 | - | |
| Unknown hardware issue/ | 2022-03-28 12:16 | - | |
| Unknown process/ | 2022-03-28 12:16 | - | |
| Unlock Advanced Menu insydeH20 BIOS on laptop/ | 2022-03-28 12:16 | - | |
| Unlocking Advanced Features for Travelmate 8371 BIOS/ | 2022-03-28 12:16 | - | |
| Unlocking Multipier Acer Aspire 5720/ | 2022-03-28 12:16 | - | |
| Unlocking pipelines in geforce 8600m gs/ | 2022-03-28 12:16 | - | |
| Unlocking the Acer Aspre's 5672Wlmi's hidden secrets/ | 2022-03-28 12:16 | - | |
| Unlock the VT Technology on T7200/ | 2022-03-28 12:16 | - | |
| Unmapping hot keys/ | 2022-03-28 12:16 | - | |
| Unmatched RAM/ | 2022-03-28 12:16 | - | |
| Unnecessary Startup Progams/ | 2022-03-28 12:16 | - | |
| Unofficial Acer Predator 21X Owners Thread/ | 2022-03-28 12:16 | - | |
| Unofficial bios for 3690/ | 2022-03-28 12:16 | - | |
| Unsound 5102/ | 2022-03-28 12:16 | - | |
| Unspecified error/ | 2022-03-28 12:16 | - | |
| Unstable Video/ | 2022-03-28 12:16 | - | |
| Unsticking a Memory Stick/ | 2022-03-28 12:16 | - | |
| Unsure which one to get/ | 2022-03-28 12:16 | - | |
| Upcoming Acer Laptops/ | 2022-03-28 12:16 | - | |
| Upcoming Acer Notebooks/ | 2022-03-28 12:16 | - | |
| Update BIOS Acer Aspire/ | 2022-03-28 12:16 | - | |
| Update BIOS and got BSOD/ | 2022-03-28 12:16 | - | |
| Update a 80 SATA Hard disk Is it worth it/ | 2022-03-28 12:16 | - | |
| Updated ATI drivers for aspire 5101/ | 2022-03-28 12:16 | - | |
| Updated Realtek Driver/ | 2022-03-28 12:16 | - | |
| Updated drivers problem/ | 2022-03-28 12:16 | - | |
| Updated graphics drivers - now 3D 06 performance is worse/ | 2022-03-28 12:16 | - | |
| Update errors/ | 2022-03-28 12:16 | - | |
| Update regarding acer aspire Bios/ | 2022-03-28 12:16 | - | |
| Updating 5020 bios/ | 2022-03-28 12:16 | - | |
| Updating ATI 3470 driver/ | 2022-03-28 12:16 | - | |
| Updating Aspire 5738Z/ | 2022-03-28 12:16 | - | |
| Updating Ati 3470/ | 2022-03-28 12:16 | - | |
| Updating BIOS/ | 2022-03-28 12:16 | - | |
| Updating BIOS on Aspire 1692/ | 2022-03-28 12:16 | - | |
| Updating CPU for aAcer Aspire 3690 laptop! Would like Input!/ | 2022-03-28 12:16 | - | |
| Updating Drivers/ | 2022-03-28 12:16 | - | |
| Updating Vista on 5920G/ | 2022-03-28 12:16 | - | |
| Updating my Aspire 5720-6200/ | 2022-03-28 12:16 | - | |
| Updating my ancient travelmate 260 bios/ | 2022-03-28 12:16 | - | |
| Upgrade 3820TG WLAN to Intel Ultimate-N 6300AGN/ | 2022-03-28 12:16 | - | |
| Upgrade 5920G with Creative X-FI miniPCIe Module/ | 2022-03-28 12:16 | - | |
| Upgrade 5920g from 8600 256 ddr2 to hd 3650 512 ddr3/ | 2022-03-28 12:16 | - | |
| Upgrade 5920 to HD-DVD/ | 2022-03-28 12:16 | - | |
| Upgrade 6920G/ | 2022-03-28 12:16 | - | |
| Upgrade 8204 Screen/ | 2022-03-28 12:16 | - | |
| Up grade Acer 7720-6569/ | 2022-03-28 12:16 | - | |
| Upgrade Acer 7738G/ | 2022-03-28 12:16 | - | |
| Upgrade Acer Again/ | 2022-03-28 12:16 | - | |
| Upgrade Acer Aspire 3680 or buy a new laptop/ | 2022-03-28 12:16 | - | |
| Upgrade Acer Aspire 4920G/ | 2022-03-28 12:16 | - | |
| Upgrade Acer Aspire 8935g 8940g and NVIDIA QUADRO K2100M 2GB N15P-Q3-A1 GDDR5 Video Graphics Card/ | 2022-03-28 12:16 | - | |
| Upgrade Asipre 2000 wireless card to G/ | 2022-03-28 12:16 | - | |
| Upgrade Aspire 5740 LCD to 1600x900 or 1920x1080/ | 2022-03-28 12:16 | - | |
| Upgrade Available For The X700/ | 2022-03-28 12:16 | - | |
| Upgrade CPU 5230E/ | 2022-03-28 12:16 | - | |
| Upgrade CPU Acer Aspire 7720G 3A2G32MI/ | 2022-03-28 12:16 | - | |
| Upgrade CPU for Acer Aspire 5613/ | 2022-03-28 12:16 | - | |
| Upgrade CPU for Aspire 3023WLMi/ | 2022-03-28 12:16 | - | |
| Upgrade CPU of Aspire 5741. Is it possible/ | 2022-03-28 12:16 | - | |
| Upgrade CPU on Extensa 5420G/ | 2022-03-28 12:16 | - | |
| Upgrade Compatability Question/ | 2022-03-28 12:16 | - | |
| Upgrade Graphics Card (Apire 5920)/ | 2022-03-28 12:16 | - | |
| Upgrade Hard Drive to 320Gigs for $150!!!(ACER 4420)/ | 2022-03-28 12:16 | - | |
| Upgrade Intel Core 2 Duo T7100 to/ | 2022-03-28 12:16 | - | |
| Upgrade Internal Wifi/ | 2022-03-28 12:16 | - | |
| Upgrade Question/ | 2022-03-28 12:16 | - | |
| Upgrade Questions (RAM) and HDD Speed query (Acer Aspire 5044WLMi)/ | 2022-03-28 12:16 | - | |
| Upgrade RAM/ | 2022-03-28 12:16 | - | |
| Upgrade RAM in Aspire 5002/ | 2022-03-28 12:16 | - | |
| Upgrade Replace CPU in 8930/ | 2022-03-28 12:16 | - | |
| Upgrade Travelmate 5320 from celeron to core 2 duo mobile/ | 2022-03-28 12:16 | - | |
| Upgrade WFi card on 8920G/ | 2022-03-28 12:16 | - | |
| Upgradeable CPU for 5534-5410/ | 2022-03-28 12:16 | - | |
| Upgradeable CPU on the 5672/ | 2022-03-28 12:16 | - | |
| Upgradeable graphics or pci X in acer laptops/ | 2022-03-28 12:16 | - | |
| Upgrade acer 8930G-584G32Bn T5800, to T7400 or T9400 if possible/ | 2022-03-28 12:16 | - | |
| Upgrade bios - or not upgrade/ | 2022-03-28 12:16 | - | |
| Upgrade cpu Acer aspire 5315-102g12mi icl50/ | 2022-03-28 12:16 | - | |
| Upgraded 3050 to dual core - Battery problems!/ | 2022-03-28 12:16 | - | |
| Upgraded 5920G to a T7700 2.4ghz/ | 2022-03-28 12:16 | - | |
| Upgraded Acer 3680 Celeron CPU to a T5300!/ | 2022-03-28 12:16 | - | |
| Upgraded Acer 4310 Celeron CPU to a T2050!/ | 2022-03-28 12:16 | - | |
| Upgraded Aspire 5672 from X1400 to X1600 GPU/ | 2022-03-28 12:16 | - | |
| Upgraded Aspire 5930G/ | 2022-03-28 12:16 | - | |
| Upgraded Core Solo T1350 to Core 2 Duo T7200 on Aspire 5570 Guide/ | 2022-03-28 12:16 | - | |
| Upgraded SSD Drive - Help/ | 2022-03-28 12:16 | - | |
| Upgraded TravelMate 2480 Celeron to T5200!/ | 2022-03-28 12:16 | - | |
| Upgraded Video/ | 2022-03-28 12:16 | - | |
| Upgrade display on F5 573g/ | 2022-03-28 12:16 | - | |
| Upgraded ram in 6920g (from 4gb to 4gb) which is better/ | 2022-03-28 12:16 | - | |
| Upgraded to Seven, DO I need these apps from Acer/ | 2022-03-28 12:16 | - | |
| Upgraded to vista 64 but need acer software, how do i get it/ | 2022-03-28 12:16 | - | |
| Upgraded to windows 7 - Sub not working (6920)/ | 2022-03-28 12:16 | - | |
| Upgradeing a Black Friday Special AOD255-2331/ | 2022-03-28 12:16 | - | |
| Upgrade my Acer Aspire 5515 CPU/ | 2022-03-28 12:16 | - | |
| Upgrade my TravelMate 2410/ | 2022-03-28 12:16 | - | |
| Upgrade my acer 4315 cpu/ | 2022-03-28 12:16 | - | |
| Upgrade my aspire 5000/ | 2022-03-28 12:16 | - | |
| Upgrade of Acer Aspire Idea 510/ | 2022-03-28 12:16 | - | |
| Upgrade of Acer TravelMate 5520G/ | 2022-03-28 12:16 | - | |
| Upgrade or clean install Vista/ | 2022-03-28 12:16 | - | |
| Upgrade problem (TM800)/ | 2022-03-28 12:16 | - | |
| Upgrade processor/ | 2022-03-28 12:16 | - | |
| Upgrade processor hard drive in TM2480/ | 2022-03-28 12:16 | - | |
| Upgrade processor on the Notebook Acer/ | 2022-03-28 12:16 | - | |
| Upgrade question to 5ghz/ | 2022-03-28 12:16 | - | |
| Upgrades for Acer Aspire 5570Z, Compatability Questions, Everest Stats Included/ | 2022-03-28 12:16 | - | |
| Upgrades on Acer Aspire AS5739G-6959/ | 2022-03-28 12:16 | - | |
| Upgrade time, Acer Aspire AS7741G-7017 NoteBook/ | 2022-03-28 12:16 | - | |
| Upgrade to 4gb/ | 2022-03-28 12:16 | - | |
| Upgrade to a TL-52 but cant overclock/ | 2022-03-28 12:16 | - | |
| Upgrade travelmate 290 cpu/ | 2022-03-28 12:16 | - | |
| Upgrading 1313 BIOS/ | 2022-03-28 12:16 | - | |
| Upgrading 5044WLMi to Vista/ | 2022-03-28 12:16 | - | |
| Upgrading 5633WLMI hard drive/ | 2022-03-28 12:16 | - | |
| Upgrading 5920g GPU to hd 4650 from 8600m GT/ | 2022-03-28 12:16 | - | |
| Upgrading 5920g Help/ | 2022-03-28 12:16 | - | |
| Upgrading 7750G/ | 2022-03-28 12:16 | - | |
| Upgrading 8920G GPU/ | 2022-03-28 12:16 | - | |
| Upgrading 8920g to 64Bit/ | 2022-03-28 12:16 | - | |
| Upgrading Acer 4310 @celeron to T7200/ | 2022-03-28 12:16 | - | |
| Upgrading Acer 5820TG-7357/ | 2022-03-28 12:16 | - | |
| Upgrading Acer 6935 ram from 4GB to 6GB or 8GB/ | 2022-03-28 12:16 | - | |
| Upgrading Acer 7110 Celeron M 420 @ 1.6 GHz - Core Duo T2400 @1.83 GHz/ | 2022-03-28 12:16 | - | |
| Upgrading Acer 8930g GPU HELP!/ | 2022-03-28 12:16 | - | |
| Upgrading Acer Aspire 5100 laptop/ | 2022-03-28 12:16 | - | |
| Upgrading Acer Aspire 5738ZG/ | 2022-03-28 12:16 | - | |
| Upgrading Acer Aspire 5920 to 4850M Gpu/ | 2022-03-28 12:16 | - | |
| Upgrading Acer Aspire 6935G Video Card!/ | 2022-03-28 12:16 | - | |
| Upgrading Acer Aspire 8735G/ | 2022-03-28 12:16 | - | |
| Upgrading Acer aspire 7730G/ | 2022-03-28 12:16 | - | |
| Upgrading Acer one 0722 RAM voids warranty Due to Sticker on under plate/ | 2022-03-28 12:16 | - | |
| Upgrading Aspire 6930/ | 2022-03-28 12:16 | - | |
| Upgrading CPU RAM worth it/ | 2022-03-28 12:16 | - | |
| Upgrading CPU in 5920G/ | 2022-03-28 12:16 | - | |
| Upgrading CPU in Acer Aspire 7520/ | 2022-03-28 12:16 | - | |
| Upgrading CPU need an advice !/ | 2022-03-28 12:16 | - | |
| Upgrading CPU on 5100-3949/ | 2022-03-28 12:16 | - | |
| Upgrading CPU on Acer Aspire 3050- just one question/ | 2022-03-28 12:16 | - | |
| Upgrading Extensa/ | 2022-03-28 12:16 | - | |
| Upgrading Ferarri 3200/ | 2022-03-28 12:16 | - | |
| Upgrading GMA X3100 memory/ | 2022-03-28 12:16 | - | |
| Upgrading GPU in Aspire 7535g/ | 2022-03-28 12:16 | - | |
| Upgrading GPU on 5672WLMi x1600 Possible/ | 2022-03-28 12:16 | - | |
| Upgrading Graphics Card = NIGHTMARE!/ | 2022-03-28 12:16 | - | |
| Upgrading HDD in 4501 WLMI/ | 2022-03-28 12:16 | - | |
| Upgrading HDD in Acer Aspire 5740G/ | 2022-03-28 12:16 | - | |
| Upgrading Hard Drive on Aspire 5101 IDE SATA/ | 2022-03-28 12:16 | - | |
| Upgrading Help needed for Aspire 7738g/ | 2022-03-28 12:16 | - | |
| Upgrading Memory in Ferrari 5005/ | 2022-03-28 12:16 | - | |
| Upgrading Memory on my 5102Wlmi/ | 2022-03-28 12:16 | - | |
| Upgrading Mini PCIe Adapter/ | 2022-03-28 12:16 | - | |
| Upgrading Mobile Turion Processors/ | 2022-03-28 12:16 | - | |
| Upgrading My Harddrive Help!/ | 2022-03-28 12:16 | - | |
| Upgrading OS Acer Aspire 5920g/ | 2022-03-28 12:16 | - | |
| Upgrading Processor in Acer Aspire/ | 2022-03-28 12:16 | - | |
| Upgrading RAM/ | 2022-03-28 12:16 | - | |
| Upgrading RAM for 5610z/ | 2022-03-28 12:16 | - | |
| Upgrading RAM in Ferrari 3000/ | 2022-03-28 12:16 | - | |
| Upgrading RAM in Ferrari 4002WLMi/ | 2022-03-28 12:16 | - | |
| Upgrading RAM on 5920g - help please/ | 2022-03-28 12:16 | - | |
| Upgrading RAM on an Aspire 5610 (5612AWLMi)/ | 2022-03-28 12:16 | - | |
| Upgrading RAM on my Aspire 4520/ | 2022-03-28 12:16 | - | |
| Upgrading RAM problem, very strange/ | 2022-03-28 12:16 | - | |
| Upgrading RAM to Travelmate 6592g/ | 2022-03-28 12:16 | - | |
| Upgrading Ram on Aspire 3680-2022/ | 2022-03-28 12:16 | - | |
| Upgrading Turion X2 in Acer laptops/ | 2022-03-28 12:16 | - | |
| Upgrading Windows XP Windows Vista (2 Partitions, 1 PQService)/ | 2022-03-28 12:16 | - | |
| Upgrading a 5315-2153/ | 2022-03-28 12:16 | - | |
| Upgrading a 5672WLMi from XP Home to Professional/ | 2022-03-28 12:16 | - | |
| Upgrading a Acer Aspire 6920-6428 how Possible is It/ | 2022-03-28 12:16 | - | |
| Upgrading a TM4501LCi/ | 2022-03-28 12:16 | - | |
| Upgrading acer 6920G processor/ | 2022-03-28 12:16 | - | |
| Upgrading an acer 3690 cpu to C2D T7600/ | 2022-03-28 12:16 | - | |
| Upgrading aspire 30003wlci/ | 2022-03-28 12:16 | - | |
| Upgrading cpu for 4810TZ/ | 2022-03-28 12:16 | - | |
| Upgrading from HD 5400rpm to 7200rpm made no difference/ | 2022-03-28 12:16 | - | |
| Upgrading from a T9300 to T9500/ | 2022-03-28 12:16 | - | |
| Upgrading hard disk in 1410 - trouble removing old drive/ | 2022-03-28 12:16 | - | |
| Upgrading hard drive in Travelmate 8210/ | 2022-03-28 12:16 | - | |
| Upgrading hard drive in an Acer Aspire 3000/ | 2022-03-28 12:16 | - | |
| Upgrading memory on Acer Aspire 5002WLMi... is DDR 400 an option/ | 2022-03-28 12:16 | - | |
| Upgrading motherboard on Acer Aspire 3680/ | 2022-03-28 12:16 | - | |
| Upgrading my 4501 Wlmi Travelmate/ | 2022-03-28 12:16 | - | |
| Upgrading my Acer Aspire 5050/ | 2022-03-28 12:16 | - | |
| Upgrading my Acer Aspire 8935G/ | 2022-03-28 12:16 | - | |
| Upgrading my Acer Aspire 8935G PartII/ | 2022-03-28 12:16 | - | |
| Upgrading my Acer Travelmate 4003LCi/ | 2022-03-28 12:16 | - | |
| Upgrading my Aspire 5532/ | 2022-03-28 12:16 | - | |
| Upgrading my RAM in 5920 G/ | 2022-03-28 12:16 | - | |
| Upgrading ram + installing XP on 7520/ | 2022-03-28 12:16 | - | |
| Upgrading the BIOS of my 5315/ | 2022-03-28 12:16 | - | |
| Upgrading the CPU of the 1830T/ | 2022-03-28 12:16 | - | |
| Upgrading to Dual Core! Need help -)/ | 2022-03-28 12:16 | - | |
| Upgrading to Win 7 on NX.V7QAA.009/ | 2022-03-28 12:16 | - | |
| Upgrading to Windows 7/ | 2022-03-28 12:16 | - | |
| Upgrading to Windows XP PRO Acer Aspire 3680/ | 2022-03-28 12:16 | - | |
| Upgrading to XP Pro - Aspire 1694/ | 2022-03-28 12:16 | - | |
| Upgrading to a 250GB HDD, assistant needed/ | 2022-03-28 12:16 | - | |
| Upgrading your Acer/ | 2022-03-28 12:16 | - | |
| Upgrading your Acer Timeline to Windows 7/ | 2022-03-28 12:16 | - | |
| Upgrate gpu nv 9500m gs/ | 2022-03-28 12:16 | - | |
| Uphill battle with this rubbish blamed on Acer/ | 2022-03-28 12:16 | - | |
| Upped to DDR 400 in 5003 WLMi How to get the BIOS to detect/ | 2022-03-28 12:16 | - | |
| Uprading BIOS on Extensa 5630G-582G32Mn/ | 2022-03-28 12:16 | - | |
| Urgent! My Acer Aspire 5583 suddenly crash. Please help/ | 2022-03-28 12:16 | - | |
| Urgent-my Acer Aspire 5920g Crashed/ | 2022-03-28 12:16 | - | |
| Urgent Aspire Orbicam Problem --- Acer 5601 AWLMi/ | 2022-03-28 12:16 | - | |
| Urgent Bios Update Needed For Acer 6530/ | 2022-03-28 12:16 | - | |
| Urgent Decision - 1691 or 5021/ | 2022-03-28 12:16 | - | |
| Urgent Help, Restore Acer 5630 back to manufacture state/ | 2022-03-28 12:16 | - | |
| Urgent Help Needed- Acer Aspire 5733z series [Computer turned off automatically and i not coming on]/ | 2022-03-28 12:16 | - | |
| Urgent Help required for Acer Aspire 3000 ZL%/ | 2022-03-28 12:16 | - | |
| Urgent Install Cpu Help Please!!!/ | 2022-03-28 12:16 | - | |
| Urgent Problem - calling all Acer 3100 owners/ | 2022-03-28 12:16 | - | |
| Urgent advice needed on 2012WLMi/ | 2022-03-28 12:16 | - | |
| Urgent help!!! acer 5050. Keyboard problems/ | 2022-03-28 12:16 | - | |
| Urgent help in aspire 1640..please/ | 2022-03-28 12:16 | - | |
| Urgent help needed- Asus M6N vs. Acer 2012/ | 2022-03-28 12:16 | - | |
| Urgent help needed 9500!!/ | 2022-03-28 12:16 | - | |
| Urgent help needed please with keyboard/ | 2022-03-28 12:16 | - | |
| Urgent help needed with Acer Travelmate 4070/ | 2022-03-28 12:16 | - | |
| Urgent help required!!!!!!/ | 2022-03-28 12:16 | - | |
| Urgent help required - Acer 5613!!/ | 2022-03-28 12:16 | - | |
| Usb Boot With 1692wlmi/ | 2022-03-28 12:16 | - | |
| Usb Port Webcam Issue/ | 2022-03-28 12:16 | - | |
| Use RAM from Sony Vaio in Acer Aspire/ | 2022-03-28 12:16 | - | |
| Use a port replicator for a power supply problem/ | 2022-03-28 12:16 | - | |
| Use both cores in dual core Cpu/ | 2022-03-28 12:16 | - | |
| Used Acer Advice/ | 2022-03-28 12:16 | - | |
| Useful Software From Acer/ | 2022-03-28 12:16 | - | |
| Useless Wi-Fi range/ | 2022-03-28 12:16 | - | |
| Use of 3G SIM Card in Acer Aspire 150AOD1165 Netbook/ | 2022-03-28 12:16 | - | |
| User Recover DVD from win 7 cannot be restored in 5920G/ | 2022-03-28 12:16 | - | |
| User accounts on D- partition/ | 2022-03-28 12:16 | - | |
| User comments Reviews on Aspire 3680/ | 2022-03-28 12:16 | - | |
| Using 5810T screen as a monitor/ | 2022-03-28 12:16 | - | |
| Using 5920g as media center/ | 2022-03-28 12:16 | - | |
| Using Acer Aspire 5101 and 5102 with 256 shared memory/ | 2022-03-28 12:16 | - | |
| Using Acronis/ | 2022-03-28 12:16 | - | |
| Using Ghost 2003 on Aspire 5520/ | 2022-03-28 12:16 | - | |
| Using High Def TV as a Monitor/ | 2022-03-28 12:16 | - | |
| Using Leshcat drivers on 7750g. Can't get it to work/ | 2022-03-28 12:16 | - | |
| Using Recovery Partition/ | 2022-03-28 12:16 | - | |
| Using SPDIF/ | 2022-03-28 12:16 | - | |
| Using a 2nd monitor through a docking station/ | 2022-03-28 12:16 | - | |
| Using acer laptop to connect xbox to live/ | 2022-03-28 12:16 | - | |
| Using a connector to connect two speakers/ | 2022-03-28 12:16 | - | |
| Using another Acer timeline backup disk/ | 2022-03-28 12:16 | - | |
| Using aspire 6930 without the battery/ | 2022-03-28 12:16 | - | |
| Using eRecovery to install to a parition other than C-/ | 2022-03-28 12:16 | - | |
| Using headphones as rear speaker on Acer Aspire Blue/ | 2022-03-28 12:16 | - | |
| Using keyboard to go back in browser/ | 2022-03-28 12:16 | - | |
| Using the Euro key on Acer 5050/ | 2022-03-28 12:16 | - | |
| Using the mutimedia card reader in the acer aspire 5732z/ | 2022-03-28 12:16 | - | |
| Using touchpad on Acer V15 laptop/ | 2022-03-28 12:16 | - | |
| V3-771-6485 won't wake on lid open/ | 2022-03-28 12:16 | - | |
| V3-771G mSATA/ | 2022-03-28 12:16 | - | |
| V3-771g UEFI BIOS question/ | 2022-03-28 12:16 | - | |
| V3 571G LGD0323 or LP156WF4-SPB1/ | 2022-03-28 12:16 | - | |
| V3 772G - Install of 3rd disk failed/ | 2022-03-28 12:16 | - | |
| V5-573P Starts In BIOS Menu/ | 2022-03-28 12:16 | - | |
| V7-482PG Owner - Ask me anything/ | 2022-03-28 12:16 | - | |
| V7-582PG-6421 Touchpad Help/ | 2022-03-28 12:16 | - | |
| VERY TRICKY Failure Fixed Disk Error on Aspire 5100/ | 2022-03-28 12:16 | - | |
| VGA Driver - Acer Support vs AMD Support/ | 2022-03-28 12:16 | - | |
| VGA LCD problem I think/ | 2022-03-28 12:16 | - | |
| VGA output problem/ | 2022-03-28 12:16 | - | |
| VGA problem on Acer aspire 4530/ | 2022-03-28 12:16 | - | |
| VGA will kill me/ | 2022-03-28 12:16 | - | |
| VISTA Drivers- Acer TravelMate 4230/ | 2022-03-28 12:16 | - | |
| VISTA Upgrade/ | 2022-03-28 12:16 | - | |
| VN7 591G- Need LCD driver or INF or registry string/ | 2022-03-28 12:16 | - | |
| VOIP Headsets with Acer 6930G/ | 2022-03-28 12:16 | - | |
| VRAM upgrade for Acer's with ATI 9700 64MB/ | 2022-03-28 12:16 | - | |
| VT Hardware Virtualization in Travelmate 8000 series/ | 2022-03-28 12:16 | - | |
| Verifying if internal mic works/ | 2022-03-28 12:16 | - | |
| Vertical 1 thick bar on screen/ | 2022-03-28 12:16 | - | |
| Very Simple Question about Battery Light on Timeline 4810/ | 2022-03-28 12:16 | - | |
| Very Urgent!!! about 2012wlmi VGA connection/ | 2022-03-28 12:16 | - | |
| Very annoying sound problem with Aspire 6530/ | 2022-03-28 12:16 | - | |
| Very happy w $699.99 Acer 5003 WMLI/ | 2022-03-28 12:16 | - | |
| Very happy with Acer right now/ | 2022-03-28 12:16 | - | |
| Very low 3d mark 06 result -(/ | 2022-03-28 12:16 | - | |
| Very low microphone volume/ | 2022-03-28 12:16 | - | |
| Very slight water damage but laptop won't start properly/ | 2022-03-28 12:16 | - | |
| Very slow middle - top range 8930G!/ | 2022-03-28 12:16 | - | |
| Very slow ping response on LAN from 7720-6827/ | 2022-03-28 12:16 | - | |
| Very strange issue with video driver and forcing stand-by/ | 2022-03-28 12:16 | - | |
| Very weird HD problem/ | 2022-03-28 12:16 | - | |
| Vga Bios Problem On Acer 4741/ | 2022-03-28 12:16 | - | |
| Vibrating 4005/ | 2022-03-28 12:16 | - | |
| Video-out for 3000WLmi/ | 2022-03-28 12:16 | - | |
| Video Card drivers/ | 2022-03-28 12:16 | - | |
| Video Card for Acer Aspire 9410Z-2028/ | 2022-03-28 12:16 | - | |
| Video Card no longer detected or installing drivers!/ | 2022-03-28 12:16 | - | |
| Video Card not recognized/ | 2022-03-28 12:16 | - | |
| Video Corruption/ | 2022-03-28 12:16 | - | |
| Video Display Error/ | 2022-03-28 12:16 | - | |
| Video Podcast looks at the TM8200/ | 2022-03-28 12:16 | - | |
| Video Problems with 8204/ | 2022-03-28 12:16 | - | |
| Video RAM/ | 2022-03-28 12:16 | - | |
| Video RAM upgrade in a 5101WLMi possible/ | 2022-03-28 12:16 | - | |
| Video Ram locked in Bios!/ | 2022-03-28 12:16 | - | |
| Video card installation guide nvidia Geforce 9600m Gt ver.C1 1024mb Gddr3 on Acer Aspire 5920g/ | 2022-03-28 12:16 | - | |
| Video coferencing/ | 2022-03-28 12:16 | - | |
| Video drivers for Aspire 2000/ | 2022-03-28 12:16 | - | |
| Video memory allocation on Aspire 7520G/ | 2022-03-28 12:16 | - | |
| Videos not showing on External monitor conneted to Aspire 5105/ | 2022-03-28 12:16 | - | |
| Video software for 6920G webcam/ | 2022-03-28 12:16 | - | |
| Viewing angle seems off on Aspire 7740/ | 2022-03-28 12:16 | - | |
| Viewing area of a 16inch display/ | 2022-03-28 12:16 | - | |
| Virtual Memory/ | 2022-03-28 12:16 | - | |
| Virtualization/ | 2022-03-28 12:16 | - | |
| Virtualization Hyper-V on the Aspire 8920/ | 2022-03-28 12:16 | - | |
| Virtualization on AS5830TG-6614/ | 2022-03-28 12:16 | - | |
| Virtualization on Aspire One/ | 2022-03-28 12:16 | - | |
| Virus software/ | 2022-03-28 12:16 | - | |
| Visa on Acer 1410!!!/ | 2022-03-28 12:16 | - | |
| Visible and Invisible ACER software !!/ | 2022-03-28 12:16 | - | |
| Vista... Hasta la vista/ | 2022-03-28 12:16 | - | |
| Vista/ | 2022-03-28 12:16 | - | |
| Vista 64-bit Se7en 64-bit AS 6920G/ | 2022-03-28 12:16 | - | |
| Vista 64bit/ | 2022-03-28 12:16 | - | |
| Vista 64bit upgrade - Intel driver question/ | 2022-03-28 12:16 | - | |
| Vista 5102 Bison CAM Driver/ | 2022-03-28 12:16 | - | |
| Vista Clean Install on Acer 5520G/ | 2022-03-28 12:16 | - | |
| Vista Drivers & Applications Released/ | 2022-03-28 12:16 | - | |
| Vista Drivers For Acer Notebook/ | 2022-03-28 12:16 | - | |
| Vista Drivers for 5672WLMi from Rapidshare/ | 2022-03-28 12:16 | - | |
| Vista Drivers for the 5000/ | 2022-03-28 12:16 | - | |
| Vista Install DVD Recovery DVD/ | 2022-03-28 12:16 | - | |
| Vista OS Restore disks with Aspire 4920/ | 2022-03-28 12:16 | - | |
| Vista Product Key on NB versus sticker on NB/ | 2022-03-28 12:16 | - | |
| Vista Recovery Problem/ | 2022-03-28 12:16 | - | |
| Vista Reinstallation/ | 2022-03-28 12:16 | - | |
| Vista SP1 compatible drivers for certain Acer models/ | 2022-03-28 12:16 | - | |
| Vista SP2 installation failure 6935/ | 2022-03-28 12:16 | - | |
| Vista Service pack 1/ | 2022-03-28 12:16 | - | |
| Vista Ultimate on Aspire 5502/ | 2022-03-28 12:16 | - | |
| Vista Upgrade Help/ | 2022-03-28 12:16 | - | |
| Vista XP installed FINALLY!!!/ | 2022-03-28 12:16 | - | |
| Vista and XP Dual boot/ | 2022-03-28 12:16 | - | |
| Vista clean Installation/ | 2022-03-28 12:16 | - | |
| Vista clean install & Acer software/ | 2022-03-28 12:16 | - | |
| Vista clean install (Anytime Upgrade Disc)/ | 2022-03-28 12:16 | - | |
| Vista clean install without Acer junk/ | 2022-03-28 12:16 | - | |
| Vista drivers for Aspire 2025/ | 2022-03-28 12:16 | - | |
| Vista hibernation sleep issue with ACER TM 8204 (Intel 945PM)/ | 2022-03-28 12:16 | - | |
| Vista logo or XP Logo/ | 2022-03-28 12:16 | - | |
| Vista on 5672/ | 2022-03-28 12:16 | - | |
| Vista on Travelmate 4500/ | 2022-03-28 12:16 | - | |
| Vista power plan don't understand this default setting/ | 2022-03-28 12:16 | - | |
| Vista restore disk reinstalled bloatware/ | 2022-03-28 12:16 | - | |
| Vista retail or OEM/ | 2022-03-28 12:16 | - | |
| Vista to XP- Recommended Load Order for OS SP2, and Drivers/ | 2022-03-28 12:16 | - | |
| Vista to XP Aspire 5520/ | 2022-03-28 12:16 | - | |
| Vista to XP on 6920g/ | 2022-03-28 12:16 | - | |
| Vista to XP opinions wantd/ | 2022-03-28 12:16 | - | |
| Vista to Xp on Acer Aspire 3680/ | 2022-03-28 12:16 | - | |
| Vista update problems/ | 2022-03-28 12:16 | - | |
| Vista will not boot after recovery/ | 2022-03-28 12:16 | - | |
| Vista with Travelmate 5610/ | 2022-03-28 12:16 | - | |
| Vista won't Start, Screen Hangs at Flashing Cursor/ | 2022-03-28 12:16 | - | |
| Vista won't boot/ | 2022-03-28 12:16 | - | |
| Vista x64 on 5920G- 2 x Base System Driver/ | 2022-03-28 12:16 | - | |
| Vitamins From Nvidia to Overclockers/ | 2022-03-28 12:16 | - | |
| Volume Control Problems on Acer Aspire 8730/ | 2022-03-28 12:16 | - | |
| Volume Problems in Windows 7 - Acer Aspire 5920G/ | 2022-03-28 12:16 | - | |
| Volume suddenly automatically turns down/ | 2022-03-28 12:16 | - | |
| Volume wheel problem/ | 2022-03-28 12:16 | - | |
| W7 on a 5920G- what to do with the recovery partion XP partition/ | 2022-03-28 12:16 | - | |
| WARNING re- Acer Ferrari 4006/ | 2022-03-28 12:16 | - | |
| WDC WD600UE-22HCT0 Clicking Problem/ | 2022-03-28 12:16 | - | |
| WEBCAM HELP pls/ | 2022-03-28 12:16 | - | |
| WHERE CAN I GET TM4501/ | 2022-03-28 12:16 | - | |
| WHERE to BUY Acer Timeline 4810 from US/ | 2022-03-28 12:16 | - | |
| WIFI UPDATE on acer 5720G/ | 2022-03-28 12:16 | - | |
| WIFI intel 5100 for acer 5720g/ | 2022-03-28 12:16 | - | |
| WIFI upgrade options/ | 2022-03-28 12:16 | - | |
| WINDOWS 7 install - Worried about Acer timeline/ | 2022-03-28 12:16 | - | |
| WLAN Drivers - problem for Acer Aspire 5920/ | 2022-03-28 12:16 | - | |
| WLAN Drivers for Aspire 5100/ | 2022-03-28 12:16 | - | |
| WLAN net not seen with ACER TM 4050/ | 2022-03-28 12:16 | - | |
| WMP not streaming correctly through browsers/ | 2022-03-28 12:16 | - | |
| WOW Aspire 1800 series what a beast!/ | 2022-03-28 12:16 | - | |
| WSXGA+ Screen ... 125dpi ... jagged pixelated quickstart & tray icons/ | 2022-03-28 12:16 | - | |
| WTB- 3820tg i5 with radeon 5650 or 6550 graphics card/ | 2022-03-28 12:16 | - | |
| WTB ATI Mobility Radeon HD 4670/ | 2022-03-28 12:16 | - | |
| WTB Acer 3620 Recovery CDs/ | 2022-03-28 12:16 | - | |
| WTF- 1692 only has 1100 points/ | 2022-03-28 12:16 | - | |
| WTF... No 8600m GT selection at FutureMark ORB!!/ | 2022-03-28 12:16 | - | |
| Waiting for VISTA upgrade - please read/ | 2022-03-28 12:16 | - | |
| Waking Acer 8920G with Wireless Keyboard/ | 2022-03-28 12:16 | - | |
| Walmart Acer 348.00/ | 2022-03-28 12:16 | - | |
| Want 2nd battery for Aspire 5630/ | 2022-03-28 12:16 | - | |
| Wanted experience w Aspire 3502WLCi/ | 2022-03-28 12:16 | - | |
| Wanting a RAM Upgrade.. which do I need/ | 2022-03-28 12:16 | - | |
| Want to make Recovery records but have no external CD drive/ | 2022-03-28 12:16 | - | |
| Warning - Screen brightness will not adjust with Nvidia v195.55 driver/ | 2022-03-28 12:16 | - | |
| Warning 4101WLMi and X700 64mb!/ | 2022-03-28 12:16 | - | |
| Warranty & backlight leakage, gpu buzz/ | 2022-03-28 12:16 | - | |
| Warranty + ITW/ | 2022-03-28 12:16 | - | |
| Warranty- PQSERVICE and original OS/ | 2022-03-28 12:16 | - | |
| Warranty-Related Question/ | 2022-03-28 12:16 | - | |
| Warranty/ | 2022-03-28 12:16 | - | |
| Warranty Claim update- Acer Singapore and ITW plus some notebook bag safety tips/ | 2022-03-28 12:16 | - | |
| Warranty Registration problem/ | 2022-03-28 12:16 | - | |
| Warranty Repair Experience/ | 2022-03-28 12:16 | - | |
| Warranty question/ | 2022-03-28 12:16 | - | |
| Warranty void if Ram UPGRADED/ | 2022-03-28 12:16 | - | |
| Warrenty Repair Center And quality of Repair/ | 2022-03-28 12:16 | - | |
| Was about to buy Acer 3830tg until i got here/ | 2022-03-28 12:16 | - | |
| Washed out writing when hovering over icons & more/ | 2022-03-28 12:16 | - | |
| Watching HD-DVD's on Acer 9810-6829/ | 2022-03-28 12:16 | - | |
| Watching HD-DVDs with a 5920 at 1.5GHz/ | 2022-03-28 12:16 | - | |
| Way To Upgrade my CPU in my Acer Aspire 6920G/ | 2022-03-28 12:16 | - | |
| Wayy too hot/ | 2022-03-28 12:16 | - | |
| Weak Wireless with Acer Aspire 5745G/ | 2022-03-28 12:16 | - | |
| WebCam enabeling/ | 2022-03-28 12:16 | - | |
| Webcam Interchange & General Part's compatable cross platform acer notebook's & laptop's/ | 2022-03-28 12:16 | - | |
| Webcam crashes/ | 2022-03-28 12:16 | - | |
| Webcam driver Windows 7 for Acer Aspire 7110/ | 2022-03-28 12:16 | - | |
| Webcam exposure on 5742G/ | 2022-03-28 12:16 | - | |
| Webcam flickering/ | 2022-03-28 12:16 | - | |
| Webcam malfunctions/ | 2022-03-28 12:16 | - | |
| Webcam of 1810T awful awful awful/ | 2022-03-28 12:16 | - | |
| Webcam problem in Yahoo Messenger/ | 2022-03-28 12:16 | - | |
| Webpage display problems - AOD150 - HELP PLEASE/ | 2022-03-28 12:16 | - | |
| Weird ATI X1600 thing/ | 2022-03-28 12:16 | - | |
| Weird Alt characters on Acer 8930G/ | 2022-03-28 12:16 | - | |
| Weird Clicking Sound/ | 2022-03-28 12:16 | - | |
| Weird Keyboard On Acer 5720/ | 2022-03-28 12:16 | - | |
| Weird Process Running in Background/ | 2022-03-28 12:16 | - | |
| Weird Wireless Issue/ | 2022-03-28 12:16 | - | |
| Weird acer 6920 spooted at Costco Canada/ | 2022-03-28 12:16 | - | |
| Weird appearance KAV Rescue CD & Dr Web Live CD/ | 2022-03-28 12:16 | - | |
| Weird bars on screen on two Acer laptops!/ | 2022-03-28 12:16 | - | |
| Weird battery problem, Aspire 5024/ | 2022-03-28 12:16 | - | |
| Weird display problem with aspire 5630/ | 2022-03-28 12:16 | - | |
| Weird keyboard problem on 5920G/ | 2022-03-28 12:16 | - | |
| Weird kinda clicking noise coming from the fan area/ | 2022-03-28 12:16 | - | |
| Weird noise from Acer Travelmate/ | 2022-03-28 12:16 | - | |
| Weird partitions, need to factory restore/ | 2022-03-28 12:16 | - | |
| Weird problem with Acer TravelMate 5520/ | 2022-03-28 12:16 | - | |
| Weird screen display. Acer Aspire 4740/ | 2022-03-28 12:16 | - | |
| Weird sensitivity when typing/ | 2022-03-28 12:16 | - | |
| Welcome Message/ | 2022-03-28 12:16 | - | |
| Welcome to Acer eSupport Online Notebook Help/ | 2022-03-28 12:16 | - | |
| Well, I just ordered the 4820TG/ | 2022-03-28 12:16 | - | |
| Well finally made the plunge/ | 2022-03-28 12:16 | - | |
| Were could i find places to buy CPU for my aspire 6920g and how/ | 2022-03-28 12:16 | - | |
| Were the Acer Timelinex 13.3 AS3830TG-6424 and AS3830TG-6431 discontinued/ | 2022-03-28 12:16 | - | |
| What's Acer's stock blu ray software/ | 2022-03-28 12:16 | - | |
| What's Acer Aspire AS5739G's Battery Life Processor/ | 2022-03-28 12:16 | - | |
| What's causing this annoying pop up Please download the latest version of Flash Player/ | 2022-03-28 12:16 | - | |
| What's faster (not for games)- TM8104WLMi or Ferrari 4005WLMi/ | 2022-03-28 12:16 | - | |
| What's not to like of the Ferrari 4005/ | 2022-03-28 12:16 | - | |
| What's the Acer's driver update Policy/ | 2022-03-28 12:16 | - | |
| What's the best way to pack laptop to ship to acer repair/ | 2022-03-28 12:16 | - | |
| What's the correct part no. for Acer Aspire 5672WLMi heatsink+fan/ | 2022-03-28 12:16 | - | |
| What's the deal with Acer and drivers/ | 2022-03-28 12:16 | - | |
| What's the difference between the Acer Arcade and Windows Media Centre/ | 2022-03-28 12:16 | - | |
| What's the difference between these R7's/ | 2022-03-28 12:16 | - | |
| What's the point...eRecovery,hidden partition/ | 2022-03-28 12:16 | - | |
| What's this strange sound effect from my laptop/ | 2022-03-28 12:16 | - | |
| What's wrong with my battery/ | 2022-03-28 12:16 | - | |
| What's wrong with this BIOS/ | 2022-03-28 12:16 | - | |
| What ATI drives do you use for Mobility Radeon X1300/ | 2022-03-28 12:16 | - | |
| What Acer laptop models have Intel Virtualization Technology(ies) (VT) enabled/ | 2022-03-28 12:16 | - | |
| What Are These Connectors Called On ROM Drives/ | 2022-03-28 12:16 | - | |
| What Blu-ray drive is in the 5738/ | 2022-03-28 12:16 | - | |
| What CPU! can I upgrade! For Acer Aspire 5515!!/ | 2022-03-28 12:16 | - | |
| What DDR2 Ram/ | 2022-03-28 12:16 | - | |
| What Do You Think Of 6920's 8920's/ | 2022-03-28 12:16 | - | |
| What Driver do I need/ | 2022-03-28 12:16 | - | |
| What Driver do You recommend for my acer aspire 6920G/ | 2022-03-28 12:16 | - | |
| What LCD panel make does Acer use/ | 2022-03-28 12:16 | - | |
| What LCD screen for 14.1/ | 2022-03-28 12:16 | - | |
| What MiniPCI WLAN card can I upgrade on Acer Aspire 2000 series/ | 2022-03-28 12:16 | - | |
| What Taiwan-only 12-14 Acer models are in Taiwan/ | 2022-03-28 12:16 | - | |
| What am I Doing Wrong - Hard Drive/ | 2022-03-28 12:16 | - | |
| What am I doing wrong (8204 Acer)/ | 2022-03-28 12:16 | - | |
| What am i missing/ | 2022-03-28 12:16 | - | |
| What are Program settings/ | 2022-03-28 12:16 | - | |
| What are the Part Numbers/ | 2022-03-28 12:16 | - | |
| What are the Pros Cons for the Acer Aspire 6920G/ | 2022-03-28 12:16 | - | |
| What are the average temperatures you get with Aspire 5920G/ | 2022-03-28 12:16 | - | |
| What are this .enc files/ | 2022-03-28 12:16 | - | |
| What are your thoughts on this/ | 2022-03-28 12:16 | - | |
| What battery/ | 2022-03-28 12:16 | - | |
| What can I take off acer 2920/ | 2022-03-28 12:16 | - | |
| What can I upgrade to on my Acer Aspire 8930G/ | 2022-03-28 12:16 | - | |
| What can be done/ | 2022-03-28 12:16 | - | |
| What can i do with my Acer Travelmate 4150/ | 2022-03-28 12:16 | - | |
| What cards can be used in this slot/ | 2022-03-28 12:16 | - | |
| What caused this damage to my 3820tg (with pic)/ | 2022-03-28 12:16 | - | |
| What color is the Aspire 2000's LCD Buying Advice/ | 2022-03-28 12:16 | - | |
| What core 2 Duo cpu for 4315/ | 2022-03-28 12:16 | - | |
| What date is Acer Timeline 11.6 being released in Q2 2010/ | 2022-03-28 12:16 | - | |
| What do I need to do before sending it in/ | 2022-03-28 12:16 | - | |
| What do I need to download! ! !/ | 2022-03-28 12:16 | - | |
| What do all the Fn + F# combos do on the 1810T/ | 2022-03-28 12:16 | - | |
| What does ePerformance do, anyway/ | 2022-03-28 12:16 | - | |
| What does the laptop, this function/ | 2022-03-28 12:16 | - | |
| What do guys think about the new Acer Gemstone Blue/ | 2022-03-28 12:16 | - | |
| What do the G and Z suffixes stand for/ | 2022-03-28 12:16 | - | |
| What do the ending numbers on Acer's have to do with/ | 2022-03-28 12:16 | - | |
| What do you guys think about this ACER/ | 2022-03-28 12:16 | - | |
| What do you guys think of Acer/ | 2022-03-28 12:16 | - | |
| What do you run on your 64-bit processor/ | 2022-03-28 12:16 | - | |
| What do you think about ACER Aspire 1692 WLMi/ | 2022-03-28 12:16 | - | |
| What do you think about the Acer TravelMate/ | 2022-03-28 12:16 | - | |
| What do you think about this/ | 2022-03-28 12:16 | - | |
| What do you think of Acer/ | 2022-03-28 12:16 | - | |
| What do you think of this Acer laptop/ | 2022-03-28 12:16 | - | |
| What drivers and programs to install on a formatted Travelmate 8202/ | 2022-03-28 12:16 | - | |
| What games (if any) do you play on your 1810T 1810TZ/ | 2022-03-28 12:16 | - | |
| What graphics card is in these 17 Acer notebooks at Circuit City/ | 2022-03-28 12:16 | - | |
| What happened to the aspire 1800 series/ | 2022-03-28 12:16 | - | |
| What hard drive is in Ferrari 4005/ | 2022-03-28 12:16 | - | |
| What have I got Extensa 5513/ | 2022-03-28 12:16 | - | |
| What headphones are you using with the TM8204/ | 2022-03-28 12:16 | - | |
| What in the world happend/ | 2022-03-28 12:16 | - | |
| What in the world just happend/ | 2022-03-28 12:16 | - | |
| What is Acer's PowerGem/ | 2022-03-28 12:16 | - | |
| What is Acer Bluelight Shield/ | 2022-03-28 12:16 | - | |
| What is Acer Launcher any way/ | 2022-03-28 12:16 | - | |
| What is NB_AS_Turorial.exe in my Acer File on C Drive/ | 2022-03-28 12:16 | - | |
| What is Wrong!!!!!!!!/ | 2022-03-28 12:16 | - | |
| What is an Acer to do/ | 2022-03-28 12:16 | - | |
| What is a normal GPU Temp in 6930G/ | 2022-03-28 12:16 | - | |
| What is difference between 6935 and 6935G/ | 2022-03-28 12:16 | - | |
| What is going on DVD drive or HDD Ferrari 4000/ | 2022-03-28 12:16 | - | |
| What is hotkey for mouse buttons in Extensa 5630G/ | 2022-03-28 12:16 | - | |
| What is latest and best Nvidia drivers for 5920G (8600M GS)/ | 2022-03-28 12:16 | - | |
| What is most important in your laptop decision/ | 2022-03-28 12:16 | - | |
| What is my clock generator/ | 2022-03-28 12:16 | - | |
| What is probably a dumb question for 300 Alex/ | 2022-03-28 12:16 | - | |
| What is the Acer TM4654/ | 2022-03-28 12:16 | - | |
| What is the Hard Drive in a 5051AWXMi/ | 2022-03-28 12:16 | - | |
| What is the MIR ENE CIR receiver/ | 2022-03-28 12:16 | - | |
| What is the best Video Driver for 5920G/ | 2022-03-28 12:16 | - | |
| What is the best memory for the 1410 (SU2300)/ | 2022-03-28 12:16 | - | |
| What is the best processor upgrade/ | 2022-03-28 12:16 | - | |
| What is the difference/ | 2022-03-28 12:16 | - | |
| What is the difference between a Athlon & Turion Processor/ | 2022-03-28 12:16 | - | |
| What is the feeling of Acer Timeline 3810/ | 2022-03-28 12:16 | - | |
| What is the last model of acer with pos. to upgrade cpu, gpu,ram/ | 2022-03-28 12:16 | - | |
| What is the use of Consumer Infrared/ | 2022-03-28 12:16 | - | |
| What is the value of an Acer Aspire 5680/ | 2022-03-28 12:16 | - | |
| What is this LIGHTSCRIBE Process doing in my Aspire 5102/ | 2022-03-28 12:16 | - | |
| What is up with Acer 8930G and it battery/ | 2022-03-28 12:16 | - | |
| What is up with Acer in the 13 market/ | 2022-03-28 12:16 | - | |
| What is version of HDMI in Acer Aspire V Nitro VN7-592G 1.4 or 2.0/ | 2022-03-28 12:16 | - | |
| What is wrong with AMD/ | 2022-03-28 12:16 | - | |
| What is wrong with my TravelMate 4320/ | 2022-03-28 12:16 | - | |
| What just happened/ | 2022-03-28 12:16 | - | |
| What keys/ | 2022-03-28 12:16 | - | |
| What kind of docking station for the Aspire 5251/ | 2022-03-28 12:16 | - | |
| What know suitable notebook cooler for Acer 6930g/ | 2022-03-28 12:16 | - | |
| What laptop cooler do you use for your Ferrari/ | 2022-03-28 12:16 | - | |
| What model is this/ | 2022-03-28 12:16 | - | |
| What other notebook(s) shares the 5920G chassis/ | 2022-03-28 12:16 | - | |
| What physical thing is my ACPI/ | 2022-03-28 12:16 | - | |
| What processes can I end/ | 2022-03-28 12:16 | - | |
| What really is the model number shown on the unit/ | 2022-03-28 12:16 | - | |
| What replacement Hard Drive do I need/ | 2022-03-28 12:16 | - | |
| What retail stores have the 1410/ | 2022-03-28 12:16 | - | |
| Whats a good acer laptop for gaming/ | 2022-03-28 12:16 | - | |
| Whats going on/ | 2022-03-28 12:16 | - | |
| Whats going on with Acer no 1080p screens/ | 2022-03-28 12:16 | - | |
| What should I choose for my 5920G Express Card/ | 2022-03-28 12:16 | - | |
| What should i dl for my 5672 HELP!/ | 2022-03-28 12:16 | - | |
| What should i do next/ | 2022-03-28 12:16 | - | |
| Whats it worth/ | 2022-03-28 12:16 | - | |
| What size hard drive Acer emachine e510/ | 2022-03-28 12:16 | - | |
| What software comes with Acer TravelMate 4502LMi/ | 2022-03-28 12:16 | - | |
| Whats the best i can get out of my 6920g/ | 2022-03-28 12:16 | - | |
| Whats the correct battery to get for the AS1410 on ebay/ | 2022-03-28 12:16 | - | |
| Whats the deal with my video card on my extensa 5420/ | 2022-03-28 12:16 | - | |
| Whats the price of Acer Aspire 5920G in Dubai(UAE)/ | 2022-03-28 12:16 | - | |
| Whats this/ | 2022-03-28 12:16 | - | |
| Whats wrong with my Acer Aspire 4730z screen/ | 2022-03-28 12:16 | - | |
| Whats your acer boot up time/ | 2022-03-28 12:16 | - | |
| What the heck Bluetooth and Acer 3002 WTMI/ | 2022-03-28 12:16 | - | |
| What to buy TM 8104 or 8204/ | 2022-03-28 12:16 | - | |
| What to delete from hard drive/ | 2022-03-28 12:16 | - | |
| What to do when your New Acer Arrives/ | 2022-03-28 12:16 | - | |
| What to do with a HDMI problem port/ | 2022-03-28 12:16 | - | |
| What to do with my Acer Aspire 3003 LCi/ | 2022-03-28 12:16 | - | |
| What type SODIMM for my Ferarri 3000/ | 2022-03-28 12:16 | - | |
| What type of Antenna connector/ | 2022-03-28 12:16 | - | |
| What wholesaler/ | 2022-03-28 12:16 | - | |
| What wireless card is in my Aspire 155WLMi/ | 2022-03-28 12:16 | - | |
| When I open my new laptop what do I do first/ | 2022-03-28 12:16 | - | |
| When I shutdown my Acer Aspire 5750-6887 everything gets wiped/ | 2022-03-28 12:16 | - | |
| When are the Timeline's coming to the US/ | 2022-03-28 12:16 | - | |
| When does the Ethos 5943G come out in England/ | 2022-03-28 12:16 | - | |
| Whenever alt is pressed it thinks X is pressed aswell, right alt - thinks z is pressed/ | 2022-03-28 12:16 | - | |
| When is the Acer Aspie 9920 coming out/ | 2022-03-28 12:16 | - | |
| When is the new Folio coming/ | 2022-03-28 12:16 | - | |
| When will AS8935G be released in USA/ | 2022-03-28 12:16 | - | |
| When will Acer TimelineX 3820TG with HD5650 reach the USA/ | 2022-03-28 12:16 | - | |
| When will the 850M version of the V7-482PG come out/ | 2022-03-28 12:16 | - | |
| When will we have 2.1 sound for the 5920/ | 2022-03-28 12:16 | - | |
| Where Can I Buy Acer Timeline 3810/ | 2022-03-28 12:16 | - | |
| Where Can I find 5102WLMi PCI IDE CONTROLLER AND USB 2.0 Drivers/ | 2022-03-28 12:16 | - | |
| Where Can I find an AS4820TG/ | 2022-03-28 12:16 | - | |
| Where I can find CMOS battery/ | 2022-03-28 12:16 | - | |
| Where I can find a TravelMate 4500 WLMI series/ | 2022-03-28 12:16 | - | |
| Where Is The Cheapest 5672 In Uk/ | 2022-03-28 12:16 | - | |
| Where are Acer's sent if they need repair in Canada/ | 2022-03-28 12:16 | - | |
| Where are the Acer 3830TG owners Windows 8 driver question!/ | 2022-03-28 12:16 | - | |
| Where are the Acer Timeline's with Arrandale/ | 2022-03-28 12:16 | - | |
| Where are the Vista Installation files/ | 2022-03-28 12:16 | - | |
| Where can I buy ACER 4005 offline/ | 2022-03-28 12:16 | - | |
| Where can I buy a 4920G/ | 2022-03-28 12:16 | - | |
| Where can I buy an extended HDD cover for a 7750G/ | 2022-03-28 12:16 | - | |
| Where can I buy an external optical hard drive for my 3820TG/ | 2022-03-28 12:16 | - | |
| Where can I buy the 6920 Gemstone Blue in Canada/ | 2022-03-28 12:16 | - | |
| Where can I find a motherboard for ACER Aspire 1642LMi/ | 2022-03-28 12:16 | - | |
| Where can I find an Acer A5672 cooling unit/ | 2022-03-28 12:16 | - | |
| Where can I find an Acer Aspire 5920 Gemstone/ | 2022-03-28 12:16 | - | |
| Where can I find service manuals/ | 2022-03-28 12:16 | - | |
| Where can I get OEM XP home disk to install on an Acer/ | 2022-03-28 12:16 | - | |
| Where can I get a battery/ | 2022-03-28 12:16 | - | |
| Where can I get replacement parts for my acer timeline 1810t/ | 2022-03-28 12:16 | - | |
| Where can I get the Acer VCM (Video Conference Manager) software/ | 2022-03-28 12:16 | - | |
| Where can I get these/ | 2022-03-28 12:16 | - | |
| Where can i buy a 5920/ | 2022-03-28 12:16 | - | |
| Where can i buy clear protective sticker for my laptop/ | 2022-03-28 12:16 | - | |
| Where can i get Acer 5950g in Canada/ | 2022-03-28 12:16 | - | |
| Where can i get a 5920G Service Manual/ | 2022-03-28 12:16 | - | |
| Where can i get a new screen from (UK)/ | 2022-03-28 12:16 | - | |
| Where can i order an Acer Travelmate 3212/ | 2022-03-28 12:16 | - | |
| Where did all of you 8204 owners with the good build dates order from/ | 2022-03-28 12:16 | - | |
| Where did my RAM go/ | 2022-03-28 12:16 | - | |
| Where do I apply thermal compound to an Aspire 3000/ | 2022-03-28 12:16 | - | |
| Where do I buy the Acer TimelineX laptops/ | 2022-03-28 12:16 | - | |
| Where do I get an Acer Aspire 6920G battery/ | 2022-03-28 12:16 | - | |
| Where do buy Acer notebooks online/ | 2022-03-28 12:16 | - | |
| Where does Acer hide Vista Installation Media on the HDD/ | 2022-03-28 12:16 | - | |
| Where do i get this HP 9300M VBIOS/ | 2022-03-28 12:16 | - | |
| Where do i go to on my acer aspire 5920 laptop to make it play the Grid driving game/ | 2022-03-28 12:16 | - | |
| Where do you buy an Acer 4820T/ | 2022-03-28 12:16 | - | |
| Where do you buy your battery when acer is out of stock/ | 2022-03-28 12:16 | - | |
| Where is Hoggie/ | 2022-03-28 12:16 | - | |
| Where is everyone getting price figures and links for the 8202/ | 2022-03-28 12:16 | - | |
| Where is info for Acer Aspire F5-571 laptop on Acer's website/ | 2022-03-28 12:16 | - | |
| Where is located Acer warranty seal/ | 2022-03-28 12:16 | - | |
| Where is my Acer being shipped from/ | 2022-03-28 12:16 | - | |
| Where is the 3810T/ | 2022-03-28 12:16 | - | |
| Where is the 4202WLMi bios and documentation of changes/ | 2022-03-28 12:16 | - | |
| Where is the Acer intro thread/ | 2022-03-28 12:16 | - | |
| Where is the Bios Chip located aspire1700/ | 2022-03-28 12:16 | - | |
| Where is the DVD playing software/ | 2022-03-28 12:16 | - | |
| Where is the Memory on Aspire 5610/ | 2022-03-28 12:16 | - | |
| Where is the best place to buy a Timeline 3810T/ | 2022-03-28 12:16 | - | |
| Where is the hidden SO DIMM Ram/ | 2022-03-28 12:16 | - | |
| Where is the official forum for acer notework/ | 2022-03-28 12:16 | - | |
| Where is the wireless card located in 5100/ | 2022-03-28 12:16 | - | |
| Where so buy aspire one xp with 6 cell battery/ | 2022-03-28 12:16 | - | |
| Where the heck is my Windows 7 update/ | 2022-03-28 12:16 | - | |
| Where to DL eAudio Management (6935G)/ | 2022-03-28 12:16 | - | |
| Where to buy/ | 2022-03-28 12:16 | - | |
| Where to buy 2012wlmi/ | 2022-03-28 12:16 | - | |
| Where to buy AS1410 4400mAh 11.1V Battery/ | 2022-03-28 12:16 | - | |
| Where to buy Acer Aspire TimelineX AS4820TG-7805/ | 2022-03-28 12:16 | - | |
| Where to buy Acer Timeline 4820T in the US/ | 2022-03-28 12:16 | - | |
| Where to buy Acer at Boston/ | 2022-03-28 12:16 | - | |
| Where to buy Acer v15 Nitro laptops in the US/ | 2022-03-28 12:16 | - | |
| Where to buy TM 8204 or TM 8202 UK Midlands/ | 2022-03-28 12:16 | - | |
| Where to buy TimelineX notebooks/ | 2022-03-28 12:16 | - | |
| Where to buy acer 8100s/ | 2022-03-28 12:16 | - | |
| Where to buy acer motherboard/ | 2022-03-28 12:16 | - | |
| Where to buy an Acer/ | 2022-03-28 12:16 | - | |
| Where to buy original Acer laptop parts/ | 2022-03-28 12:16 | - | |
| Where to buy replacement Motherboard for acer 5002wlmi/ | 2022-03-28 12:16 | - | |
| Where to buy the 3820TG/ | 2022-03-28 12:16 | - | |
| Where to buy the Acer 1410 w su2300/ | 2022-03-28 12:16 | - | |
| Where to buy the Acer 3820TG with Core i7 in Singapore/ | 2022-03-28 12:16 | - | |
| Where to buy the TM 8104 in Canada/ | 2022-03-28 12:16 | - | |
| Where to download Acer 3g connection manager for Win7/ | 2022-03-28 12:16 | - | |
| Where to download Crystal Eye application for 6930g/ | 2022-03-28 12:16 | - | |
| Where to download launch manager keyboard driver for XP (Aspire 5315)/ | 2022-03-28 12:16 | - | |
| Where to find Acer notebooks/ | 2022-03-28 12:16 | - | |
| Where to find Conexant Ac-Link Audio Driver/ | 2022-03-28 12:16 | - | |
| Where to find TravelMate 3280/ | 2022-03-28 12:16 | - | |
| Where to find my clock generator and chipset name/ | 2022-03-28 12:16 | - | |
| Where to get Aspire 4710G crystal web cam driver for linux/ | 2022-03-28 12:16 | - | |
| Where to purchase Acer Warranty/ | 2022-03-28 12:16 | - | |
| Where to purchase Ferrari 3200/ | 2022-03-28 12:16 | - | |
| Where to purchase a Acer 16' Full HD laptop/ | 2022-03-28 12:16 | - | |
| Which -- Timeline 1810T vs Ferrari One -- to replacing ao751h netbook/ | 2022-03-28 12:16 | - | |
| Which 2GB ram module for 5920G to choose/ | 2022-03-28 12:16 | - | |
| Which 16 laptop feature would you rather have/ | 2022-03-28 12:16 | - | |
| Which 1410 or 1810 for best battery life/ | 2022-03-28 12:16 | - | |
| Which 4810 should I get/ | 2022-03-28 12:16 | - | |
| Which ATI Catalyst Suite version will provide/ | 2022-03-28 12:16 | - | |
| Which Acer/ | 2022-03-28 12:16 | - | |
| Which Acer 3680 comes with bonus DVD-RW drive/ | 2022-03-28 12:16 | - | |
| Which Acer 8006LMi or 2026WLM/ | 2022-03-28 12:16 | - | |
| Which Acer Notebook/ | 2022-03-28 12:16 | - | |
| Which Acer Notebook Suits me/ | 2022-03-28 12:16 | - | |
| Which Acer compares to Fujitsu S6210, HP zt3000/ | 2022-03-28 12:16 | - | |
| Which Acer for me/ | 2022-03-28 12:16 | - | |
| Which Acer is like the 2023WLMI/ | 2022-03-28 12:16 | - | |
| Which Acer should I buy/ | 2022-03-28 12:16 | - | |
| Which Aspire 5920 config do I have/ | 2022-03-28 12:16 | - | |
| Which BIOS/ | 2022-03-28 12:16 | - | |
| Which Bluetooth driver Aspire 1810T/ | 2022-03-28 12:16 | - | |
| Which DVD writer for your laptop/ | 2022-03-28 12:16 | - | |
| Which LG model comes with the Aspire 3680-2633/ | 2022-03-28 12:16 | - | |
| Which Motherboard/ | 2022-03-28 12:16 | - | |
| Which Network Adapter/ | 2022-03-28 12:16 | - | |
| Which OS for 1410/ | 2022-03-28 12:16 | - | |
| Which One! 5672/ | 2022-03-28 12:16 | - | |
| Which PLL on TM8215/ | 2022-03-28 12:16 | - | |
| Which RAM for 5920G/ | 2022-03-28 12:16 | - | |
| Which SATA driver or drivers should be used/ | 2022-03-28 12:16 | - | |
| Which budget Acer laptop should i buy/ | 2022-03-28 12:16 | - | |
| Which camera do I have/ | 2022-03-28 12:16 | - | |
| Which components off acer empower software can i uninstall,or which parts do i dont need of acer emp/ | 2022-03-28 12:16 | - | |
| Which cpus are compatible for 5739g/ | 2022-03-28 12:16 | - | |
| Which is faster/ | 2022-03-28 12:16 | - | |
| Which is my recovery Partition/ | 2022-03-28 12:16 | - | |
| Which is primary hdd on Aspire 8920/ | 2022-03-28 12:16 | - | |
| Which is the better option TravelMate 8210-6880 OR Ferrari 5005WLMi/ | 2022-03-28 12:16 | - | |
| Which is the exact keyboard sequence to switch an Acer Aspire 5920G to boot from CD/ | 2022-03-28 12:16 | - | |
| Which long length screwdrivers for Acer Aspire 5536/ | 2022-03-28 12:16 | - | |
| Which model of Acer Aspire 8920 has a TV Tuner/ | 2022-03-28 12:16 | - | |
| Which models offer X-brite or brightview/ | 2022-03-28 12:16 | - | |
| Which one do I buy/ | 2022-03-28 12:16 | - | |
| Which one is better/ | 2022-03-28 12:16 | - | |
| Which one to bye - Acer 1694 or Acer 5024/ | 2022-03-28 12:16 | - | |
| Which one would you pick/ | 2022-03-28 12:16 | - | |
| Which online retailer/ | 2022-03-28 12:16 | - | |
| Which power cable for Aspire 3680/ | 2022-03-28 12:16 | - | |
| Which ram for upgrading TM4501/ | 2022-03-28 12:16 | - | |
| Which screwdriver for opening Acer 5500/ | 2022-03-28 12:16 | - | |
| Which should I buy/ | 2022-03-28 12:16 | - | |
| Which skin for 1810T/ | 2022-03-28 12:16 | - | |
| Which to go for 5738 or 5735/ | 2022-03-28 12:16 | - | |
| Which touchpad driver to install/ | 2022-03-28 12:16 | - | |
| Which wireless modem/ | 2022-03-28 12:16 | - | |
| White Keyboard/ | 2022-03-28 12:16 | - | |
| White horizontal line across notebook screen/ | 2022-03-28 12:16 | - | |
| White laptop screen at random times/ | 2022-03-28 12:16 | - | |
| White line on laptop screen/ | 2022-03-28 12:16 | - | |
| White screen problem with Aspire 4710/ | 2022-03-28 12:16 | - | |
| Who Wants to Be Interviewed by a Newspaper About their Acer Notebook/ | 2022-03-28 12:16 | - | |
| Who actually makes Acer notebooks/ | 2022-03-28 12:16 | - | |
| Who can help me decipher AcerCare Singapore's reply/ | 2022-03-28 12:16 | - | |
| Who fixes Acer/ | 2022-03-28 12:16 | - | |
| Who is interested in a full disassembly guide for TM4400 and alike/ | 2022-03-28 12:16 | - | |
| Who makes what on my acer/ | 2022-03-28 12:16 | - | |
| Who removes the new stickers/ | 2022-03-28 12:16 | - | |
| Who sells Acer Timeline SSD in USA/ | 2022-03-28 12:16 | - | |
| Who want a travelmate 3201 XMI/ | 2022-03-28 12:16 | - | |
| Why's my Atom showing up as a dual-core CPU under Windows 7/ | 2022-03-28 12:16 | - | |
| Why 2 partitions on the 4501/ | 2022-03-28 12:16 | - | |
| Why Acer is cheaper compared to Dell/ | 2022-03-28 12:16 | - | |
| Why Can't My Acer 3830TG Play any games/ | 2022-03-28 12:16 | - | |
| Why Diskette 'Disabled' in BIOS/ | 2022-03-28 12:16 | - | |
| Why Fat32/ | 2022-03-28 12:16 | - | |
| Why I cant flash BIOS in 64 bit Windows 7/ | 2022-03-28 12:16 | - | |
| Why NBR works/ | 2022-03-28 12:16 | - | |
| Why avoid Acer/ | 2022-03-28 12:16 | - | |
| Why can I find NOTHING on Extensa2310/ | 2022-03-28 12:16 | - | |
| Why cant my Acer work with a Battery/ | 2022-03-28 12:16 | - | |
| Why did my laptop BSOD/ | 2022-03-28 12:16 | - | |
| Why do I have 2 hidden recovery partitions/ | 2022-03-28 12:16 | - | |
| Why does the keyboard flex/ | 2022-03-28 12:16 | - | |
| Why do you like Acer/ | 2022-03-28 12:16 | - | |
| Why is AS5024 cheaper than TM4402/ | 2022-03-28 12:16 | - | |
| Why is Acer's BIOS so limited/ | 2022-03-28 12:16 | - | |
| Why is it impossible to get a 5920G Service manual/ | 2022-03-28 12:16 | - | |
| Why is it so difficult to find any information on the Acer S3-392 (Haswell w dGPU)/ | 2022-03-28 12:16 | - | |
| Why is my Aspire 5112 performing worse than my 5024/ | 2022-03-28 12:16 | - | |
| Why is my Extensa 2000 slower than my Aspire 3630/ | 2022-03-28 12:16 | - | |
| Why is my acer laptop screen so rubbish !/ | 2022-03-28 12:16 | - | |
| Why is my cpu running at 800mhz another problem/ | 2022-03-28 12:16 | - | |
| Why is my laptop slowing down after a month/ | 2022-03-28 12:16 | - | |
| Why is my system not listed as Vista Compatible (even though I have the sticker) + I'm confused about the Express Upgrade!/ | 2022-03-28 12:16 | - | |
| Why is the Acer Aspire AS2012WLMi not for sale/ | 2022-03-28 12:16 | - | |
| Why is the the Acer 1694 so cheap (pricewise of course)/ | 2022-03-28 12:16 | - | |
| Why is this specific model (5315) so appreciated/ | 2022-03-28 12:16 | - | |
| Why me/ | 2022-03-28 12:16 | - | |
| Why no Acer high performance line/ | 2022-03-28 12:16 | - | |
| Why not understand your Acer first before you fiddle with it/ | 2022-03-28 12:16 | - | |
| Why this HD is so cheap ... overheat concern/ | 2022-03-28 12:16 | - | |
| Why won't my 7530g keep cool/ | 2022-03-28 12:16 | - | |
| Wi-Fi Blinking Led/ | 2022-03-28 12:16 | - | |
| Wich include in the backup/ | 2022-03-28 12:16 | - | |
| Wide Screen LCD with intel 950 GMA/ | 2022-03-28 12:16 | - | |
| Wide or Regular Display/ | 2022-03-28 12:16 | - | |
| Widescreen Resolution/ | 2022-03-28 12:16 | - | |
| Width and Weigh !/ | 2022-03-28 12:16 | - | |
| Wierd 8204 problem/ | 2022-03-28 12:16 | - | |
| Wierd Acer eRecovery problem/ | 2022-03-28 12:16 | - | |
| Wierd Thing (Power Button Blinking blue)/ | 2022-03-28 12:16 | - | |
| Wierd Wireless Problem Travelmate 5320/ | 2022-03-28 12:16 | - | |
| Wierdest lcd issue ever ! What to do/ | 2022-03-28 12:16 | - | |
| Wife frustrated with new laptop, which is never good for husband! please help!!!!/ | 2022-03-28 12:16 | - | |
| Wifi/ | 2022-03-28 12:16 | - | |
| Wifi Acer TM 240 hardware button/ | 2022-03-28 12:16 | - | |
| Wifi Bluetooth Volume HUD on 1810/ | 2022-03-28 12:16 | - | |
| Wifi Card driver of Travelmate 370 doesn't works on XP SP2/ | 2022-03-28 12:16 | - | |
| Wifi Problems/ | 2022-03-28 12:16 | - | |
| Wifi and Bluetooth buttons OSD says No Device/ | 2022-03-28 12:16 | - | |
| Wifi driver problems/ | 2022-03-28 12:16 | - | |
| Wifi program aspire 4730/ | 2022-03-28 12:16 | - | |
| Wifi toggle dead on Acer 1410, but BT still works... odd/ | 2022-03-28 12:16 | - | |
| Will 3GB work on AS1410 SU2300/ | 2022-03-28 12:16 | - | |
| Will 32bit W7HP Acer upgrade key activate 64bit W7HP iso/ | 2022-03-28 12:16 | - | |
| Will Acer AS6920-6875 and Vista32 work/ | 2022-03-28 12:16 | - | |
| Will Acer release a new 1920 x 1080 resolution laptop/ | 2022-03-28 12:16 | - | |
| Will CORE 2 DUO T7200 work on 3680-2682/ | 2022-03-28 12:16 | - | |
| Will Ferrari 4005 And Travelmate 8104 work with Vista/ | 2022-03-28 12:16 | - | |
| Will Intel 5300AGN WLAN work on 5920G/ | 2022-03-28 12:16 | - | |
| Will I shorten the life of my Acer/ | 2022-03-28 12:16 | - | |
| Will SU9400+X4500MHD be enough for Modo 401/ | 2022-03-28 12:16 | - | |
| Will This Fit In An Acer 8200/ | 2022-03-28 12:16 | - | |
| Will a Acer 5610Z processor work on my Acer 5315/ | 2022-03-28 12:16 | - | |
| Will a HD3650 from a 6920 fit a 5920g/ | 2022-03-28 12:16 | - | |
| Will a Q6600 Quad CPU work in 5315 laptop/ | 2022-03-28 12:16 | - | |
| Will acer release drivers for older laptops (aspire 5920G)/ | 2022-03-28 12:16 | - | |
| Will adding RAM increase my videogame's frames/ | 2022-03-28 12:16 | - | |
| Will allocating more RAM to my 5920 G's NVIDIA GeForce 8600 m GT graphics card improve performance/ | 2022-03-28 12:16 | - | |
| Will it work/ | 2022-03-28 12:16 | - | |
| Will not boot DVD 2nd Time/ | 2022-03-28 12:16 | - | |
| Will not sleep/ | 2022-03-28 12:16 | - | |
| Will removing the harddrive void my warrentee/ | 2022-03-28 12:16 | - | |
| Will the 6-cell battery fit on a 4-cell ONE/ | 2022-03-28 12:16 | - | |
| Will the 6920g support an x9000 cpu/ | 2022-03-28 12:16 | - | |
| Will the Asprie V3 Record Stereo Mix/ | 2022-03-28 12:16 | - | |
| Will the dual-channel work/ | 2022-03-28 12:16 | - | |
| Will the proc. from a compaq evo N800c fit my travelmate 2301/ | 2022-03-28 12:16 | - | |
| Will there be a Ferrari 6000/ | 2022-03-28 12:16 | - | |
| Will there be a successor to the 3820tg 3830tg/ | 2022-03-28 12:16 | - | |
| Will this RAM work with the 5920G/ | 2022-03-28 12:16 | - | |
| Will this battery work in Acer D270/ | 2022-03-28 12:16 | - | |
| Will this converter cable add tv-out to my Acer 3003/ | 2022-03-28 12:16 | - | |
| Will this laptop play LOTRO/ | 2022-03-28 12:16 | - | |
| Will this netbook be able to play HD video/ | 2022-03-28 12:16 | - | |
| Will this save me/ | 2022-03-28 12:16 | - | |
| Will this void my warranty [7750G]/ | 2022-03-28 12:16 | - | |
| Will this wifi card work on my 5551/ | 2022-03-28 12:16 | - | |
| Will using the restore partition fully clear my HDD/ | 2022-03-28 12:16 | - | |
| Win7 Drivers for older Aspire Models/ | 2022-03-28 12:16 | - | |
| Win 7 Reinstall - Lost Acer Volume Control on 5920G/ | 2022-03-28 12:16 | - | |
| Win 7 Video Issues/ | 2022-03-28 12:16 | - | |
| Win 7 dilema/ | 2022-03-28 12:16 | - | |
| Win 7 loader error/ | 2022-03-28 12:16 | - | |
| Win 7 upgrade - only 32 bit on disk/ | 2022-03-28 12:16 | - | |
| Win 7 upgrade timeline 3810T SU3500/ | 2022-03-28 12:16 | - | |
| Win 7 via RJ45 Null to XP to Internet via Sprint Tether/ | 2022-03-28 12:16 | - | |
| WinXP Install Problem/ | 2022-03-28 12:16 | - | |
| Win XP in a 5920G/ | 2022-03-28 12:16 | - | |
| Winch Camera on Acer model/ | 2022-03-28 12:16 | - | |
| Window 7 = no graphic card/ | 2022-03-28 12:16 | - | |
| Window Experience Index. How to improve/ | 2022-03-28 12:16 | - | |
| Window Vista Wireless Connection Issue/ | 2022-03-28 12:16 | - | |
| Window XP for NVIDIA Driver on Aspire 5720-6113/ | 2022-03-28 12:16 | - | |
| Windows7 & Acer Aspire 7520/ | 2022-03-28 12:16 | - | |
| Windows 7, 3 big problems/ | 2022-03-28 12:16 | - | |
| Windows 7 - inst. 32 or 64 bit/ | 2022-03-28 12:16 | - | |
| Windows 7 - subwoofer problems/ | 2022-03-28 12:16 | - | |
| Windows 7 - trying it out in dual-boot/ | 2022-03-28 12:16 | - | |
| Windows 7 32Bit or 64Bit for my Acer 6920G/ | 2022-03-28 12:16 | - | |
| Windows 7 64 and your experiences. How well Are you guys running windows 7 64bit on older NBs, 5920g, I dont see any benefits/ | 2022-03-28 12:16 | - | |
| Windows 7 Clean Install/ | 2022-03-28 12:16 | - | |
| Windows 7 Homepremium Remote Desktop/ | 2022-03-28 12:16 | - | |
| Windows 7 OEM retail DVD with OEM Serial from 1410/ | 2022-03-28 12:16 | - | |
| Windows 7 Professional/ | 2022-03-28 12:16 | - | |
| Windows 7 RC 64bit installed on 3810T... questions/ | 2022-03-28 12:16 | - | |
| Windows 7 Readiness in Acer Notebook/ | 2022-03-28 12:16 | - | |
| Windows 7 Ultimate Iconia w500/ | 2022-03-28 12:16 | - | |
| Windows 7 Upgrade Question/ | 2022-03-28 12:16 | - | |
| Windows 7 VM install/ | 2022-03-28 12:16 | - | |
| Windows 7 Welcome Screen on Acer 1410 Power draw/ | 2022-03-28 12:16 | - | |
| Windows 7 and Acer 6930G/ | 2022-03-28 12:16 | - | |
| Windows 7 and Acer Aspire 5739G/ | 2022-03-28 12:16 | - | |
| Windows 7 and Intel Mobile 965 express/ | 2022-03-28 12:16 | - | |
| Windows 7 and reduced Timeline battery/ | 2022-03-28 12:16 | - | |
| Windows 7 brightness control (8920g)/ | 2022-03-28 12:16 | - | |
| Windows 7 disks Est arrivé/ | 2022-03-28 12:16 | - | |
| Windows 7 for 5930g/ | 2022-03-28 12:16 | - | |
| Windows 7 has lost my partition!/ | 2022-03-28 12:16 | - | |
| Windows 7 is a coming to a Timeline near you !/ | 2022-03-28 12:16 | - | |
| Windows 7 not booting on new 4820TG/ | 2022-03-28 12:16 | - | |
| Windows 7 on Acer Aspire 4710/ | 2022-03-28 12:16 | - | |
| Windows 7 on Acer Aspire 6920-6621 issues/ | 2022-03-28 12:16 | - | |
| Windows 7 on Aspire 5520/ | 2022-03-28 12:16 | - | |
| Windows 7 on acer aspire 5520G, dvd not detectable/ | 2022-03-28 12:16 | - | |
| Windows 7 startup problem.(need help)/ | 2022-03-28 12:16 | - | |
| Windows 7 upgrade problems/ | 2022-03-28 12:16 | - | |
| Windows 7 upgrade without evidence of Vista/ | 2022-03-28 12:16 | - | |
| Windows 8 Problem/ | 2022-03-28 12:16 | - | |
| Windows 8 and switchable graphics dont work/ | 2022-03-28 12:16 | - | |
| Windows 8 bloatware removal/ | 2022-03-28 12:16 | - | |
| Windows 8 on 7730, no IR/ | 2022-03-28 12:16 | - | |
| Windows 8 upgrade/ | 2022-03-28 12:16 | - | |
| Windows 10 and CIR/ | 2022-03-28 12:16 | - | |
| Windows Blue Screen issue/ | 2022-03-28 12:16 | - | |
| Windows CD/ | 2022-03-28 12:16 | - | |
| Windows Checking!!/ | 2022-03-28 12:16 | - | |
| Windows Defender error/ | 2022-03-28 12:16 | - | |
| Windows Error log 501 since updating video drivers/ | 2022-03-28 12:16 | - | |
| Windows ME on Acer Aspire 5502WXMi (ATI Mobility Radeon X700 problem)/ | 2022-03-28 12:16 | - | |
| Windows Media Player/ | 2022-03-28 12:16 | - | |
| Windows OS on an SD card Is it bootable/ | 2022-03-28 12:16 | - | |
| Windows Vista 64 Bits....Acer Aspire 8920G/ | 2022-03-28 12:16 | - | |
| Windows Vista Feature Pack for Wireless. What about Acer/ | 2022-03-28 12:16 | - | |
| Windows Vista and Clean Install on 4810TZ/ | 2022-03-28 12:16 | - | |
| Windows Vista for ACER/ | 2022-03-28 12:16 | - | |
| Windows XP CD Key for 8200/ | 2022-03-28 12:16 | - | |
| Windows XP Mode/ | 2022-03-28 12:16 | - | |
| Windows XP OEM on Acer 6930/ | 2022-03-28 12:16 | - | |
| Windows XP drivers for Acer Aspire 5930G/ | 2022-03-28 12:16 | - | |
| Windows XP drivers for Aspire 5520 help please!/ | 2022-03-28 12:16 | - | |
| Windows XP dual core patch/ | 2022-03-28 12:16 | - | |
| Windows XP install problem, need help pls/ | 2022-03-28 12:16 | - | |
| Windows XP on 5920/ | 2022-03-28 12:16 | - | |
| Windows XP on Acer 5535 problem/ | 2022-03-28 12:16 | - | |
| Windows XP on Aspire 5730-4700/ | 2022-03-28 12:16 | - | |
| Windows has Recovered from an Unexpected Shutdown/ | 2022-03-28 12:16 | - | |
| Windows key code/ | 2022-03-28 12:16 | - | |
| Windows recommends I get a new Battery/ | 2022-03-28 12:16 | - | |
| Windows repair from Acer cds/ | 2022-03-28 12:16 | - | |
| Windows tax refund for Acer notebook (Acer Aspire 1410 1810T)/ | 2022-03-28 12:16 | - | |
| Windows update does not work on new Ferrari/ | 2022-03-28 12:16 | - | |
| Windows vista backup vs acer recovery/ | 2022-03-28 12:16 | - | |
| Windows won't boot!/ | 2022-03-28 12:16 | - | |
| Windows won't install/ | 2022-03-28 12:16 | - | |
| Windows wont boot after succssesful BIOS flash How to switch to AHCI mode, if windows already installed on IDE mode/ | 2022-03-28 12:16 | - | |
| Winner of Worst Laptop Award (Acer 5570z)/ | 2022-03-28 12:16 | - | |
| Winodws 7 no audio over HMDI/ | 2022-03-28 12:16 | - | |
| Wipe and reinstall 8204/ | 2022-03-28 12:16 | - | |
| Wipe laptop/ | 2022-03-28 12:16 | - | |
| Wiping out an Acer 2012 WLMI and installing/ | 2022-03-28 12:16 | - | |
| Wireless/ | 2022-03-28 12:16 | - | |
| Wireless Antenna/ | 2022-03-28 12:16 | - | |
| Wireless Card Replacement Acer 3004 Wli/ | 2022-03-28 12:16 | - | |
| Wireless Connection Problems(acer aspire 3000)/ | 2022-03-28 12:16 | - | |
| Wireless Connection on Startup - Acer 5020 Aspire/ | 2022-03-28 12:16 | - | |
| Wireless Driver/ | 2022-03-28 12:16 | - | |
| Wireless Driver Help!! 5570Z XP Pro Sp2/ | 2022-03-28 12:16 | - | |
| Wireless Issues with Aspire 5745g/ | 2022-03-28 12:16 | - | |
| Wireless LAN not recognised/ | 2022-03-28 12:16 | - | |
| Wireless LED inverted/ | 2022-03-28 12:16 | - | |
| Wireless Networking between 2 laptops/ | 2022-03-28 12:16 | - | |
| Wireless access/ | 2022-03-28 12:16 | - | |
| Wireless broadband on 5672/ | 2022-03-28 12:16 | - | |
| Wireless button enables after restart/ | 2022-03-28 12:16 | - | |
| Wireless connection/ | 2022-03-28 12:16 | - | |
| Wireless connection Aspire 5101AWLMI problems/ | 2022-03-28 12:16 | - | |
| Wireless connection disconnects, reconnects with other wireless/ | 2022-03-28 12:16 | - | |
| Wireless disconnects - 5920G Vista SP1/ | 2022-03-28 12:16 | - | |
| Wireless driver for Atheros AR5B93 Windows 7 x64/ | 2022-03-28 12:16 | - | |
| Wireless in conflict with audio (Aspire 4710z)/ | 2022-03-28 12:16 | - | |
| Wireless mouse/ | 2022-03-28 12:16 | - | |
| Wireless not connecting Broadcom adapter - Acer 3960/ | 2022-03-28 12:16 | - | |
| Wireless on Aspire 1410/ | 2022-03-28 12:16 | - | |
| Wireless problems on AOA150-1570/ | 2022-03-28 12:16 | - | |
| Wireless problem with Aspire 5100/ | 2022-03-28 12:16 | - | |
| Wireless stop working suddenly/ | 2022-03-28 12:16 | - | |
| Wireless switch on Acer 5670/ | 2022-03-28 12:16 | - | |
| Wireless switch problem/ | 2022-03-28 12:16 | - | |
| Wiring up and Internal Bluetooth adapter/ | 2022-03-28 12:16 | - | |
| Withdrawing TM3201/ | 2022-03-28 12:16 | - | |
| Wndows 8/ | 2022-03-28 12:16 | - | |
| WoW Worries!/ | 2022-03-28 12:16 | - | |
| Won't boot from Vista Ultimate Upgrade disk/ | 2022-03-28 12:16 | - | |
| Won't boot into Windows/ | 2022-03-28 12:16 | - | |
| Wondering how to use Recovery Partition to recover Acer Aspire 3600/ | 2022-03-28 12:16 | - | |
| Wondering if Acer Aspire 3600 FL50 could be upgraded/ | 2022-03-28 12:16 | - | |
| Wont Turn On/ | 2022-03-28 12:16 | - | |
| Wont play life on mars/ | 2022-03-28 12:16 | - | |
| Woofer upgrade in Aspire 4330, 3680, and similar/ | 2022-03-28 12:16 | - | |
| Worth Upgrading the processor (8930G)/ | 2022-03-28 12:16 | - | |
| Worthless Warranties/ | 2022-03-28 12:16 | - | |
| Worthwhile to upgrade ram Aspire 5612ZLMI/ | 2022-03-28 12:16 | - | |
| Would Anyone Know Where To Get A 9-cell (or better) Battery For An Acer Aspire AS5552-5898 Laptop (Details Inside!)/ | 2022-03-28 12:16 | - | |
| Would I be able to go to 32 bit vista on the 8930g/ | 2022-03-28 12:16 | - | |
| Would You Recomend a Acer Aspire 5920WSMi/ | 2022-03-28 12:16 | - | |
| Would a 11.6 inch Acer 1410 be Big Enough for me and is it the coolest laptop in the world/ | 2022-03-28 12:16 | - | |
| Would acer replace my LCD screen/ | 2022-03-28 12:16 | - | |
| Would anyone like to help me fix upgrade my Aspire 7520/ | 2022-03-28 12:16 | - | |
| Would it work to use identical laptop's recovery cd's/ | 2022-03-28 12:16 | - | |
| Would like to know a compatible DVD RW/ | 2022-03-28 12:16 | - | |
| Would love some help advice on upgrading my 6930g/ | 2022-03-28 12:16 | - | |
| Would this battery work in my Aspire/ | 2022-03-28 12:16 | - | |
| Would this screen be compatible with 5820TG/ | 2022-03-28 12:16 | - | |
| Would you buy Acer for Business/ | 2022-03-28 12:16 | - | |
| Would you recomend this/ | 2022-03-28 12:16 | - | |
| Wrong BIOS installed on Acer Aspire 1670/ | 2022-03-28 12:16 | - | |
| Wrong Video in laptop/ | 2022-03-28 12:16 | - | |
| Wrong hard drive install in laptop/ | 2022-03-28 12:16 | - | |
| Wrong ram, maybe clock In 5920G/ | 2022-03-28 12:16 | - | |
| X700 OC driver bug/ | 2022-03-28 12:16 | - | |
| X700 or X600/ | 2022-03-28 12:16 | - | |
| X9100 upgraded in 6930g- questions about temps!/ | 2022-03-28 12:16 | - | |
| XP 64-Bit/ | 2022-03-28 12:16 | - | |
| XP Drivers ACER ASPIRE 5536/ | 2022-03-28 12:16 | - | |
| XP Media Centre Edition hard disk conversion problems/ | 2022-03-28 12:16 | - | |
| XP SATA driver for 5920G/ | 2022-03-28 12:16 | - | |
| XP SP2 causing battery drain/ | 2022-03-28 12:16 | - | |
| XP SP3 Drivers for acer aspire 5315-2848/ | 2022-03-28 12:16 | - | |
| XP Standby Problem/ | 2022-03-28 12:16 | - | |
| XP Vista (Aspire 5920G)/ | 2022-03-28 12:16 | - | |
| XP Vista - confused/ | 2022-03-28 12:16 | - | |
| XP and Vista, dual-boot/ | 2022-03-28 12:16 | - | |
| XP and Vista on Aspire 5100/ | 2022-03-28 12:16 | - | |
| XP drivers for Travelmate 8471G/ | 2022-03-28 12:16 | - | |
| XP drivers needed for acer aspire 2920z/ | 2022-03-28 12:16 | - | |
| XP dual Processor update/ | 2022-03-28 12:16 | - | |
| XP for acer/ | 2022-03-28 12:16 | - | |
| XP home to Aspire 3100/ | 2022-03-28 12:16 | - | |
| XP in Aspire 5520-5148/ | 2022-03-28 12:16 | - | |
| XP install on Acer Aspire 6530g/ | 2022-03-28 12:16 | - | |
| XP instead of VISTA on ACER 8930G/ | 2022-03-28 12:16 | - | |
| XP mode on 1810TZ SU4100/ | 2022-03-28 12:16 | - | |
| XP on 5920- Mic Webcam problems/ | 2022-03-28 12:16 | - | |
| XP on 5930G/ | 2022-03-28 12:16 | - | |
| XP on 6935G problem!/ | 2022-03-28 12:16 | - | |
| XP on Acer 6935G/ | 2022-03-28 12:16 | - | |
| XP on Aspire 3810T/ | 2022-03-28 12:16 | - | |
| XP on Aspire 5610Z/ | 2022-03-28 12:16 | - | |
| XP on Aspire 5720/ | 2022-03-28 12:16 | - | |
| XP pro instalation 4501WLMI/ | 2022-03-28 12:16 | - | |
| Xp install on Acer Aspire/ | 2022-03-28 12:16 | - | |
| Xpress 1100 & IDE drivers which to use/ | 2022-03-28 12:16 | - | |
| YEY! another acer hit...cloud/ | 2022-03-28 12:16 | - | |
| Yahoooo.. Just scored 5920 w 8600m GT for $969.00!!/ | 2022-03-28 12:16 | - | |
| Yahooooo.. Bioshock Demo running great on my 5920G!!!/ | 2022-03-28 12:16 | - | |
| Yet another Ferrari browser/ | 2022-03-28 12:16 | - | |
| Yet another RAM question (5315)/ | 2022-03-28 12:16 | - | |
| Yet anouther Bluetooth Issue/ | 2022-03-28 12:16 | - | |
| Yo Bronsky!!! (3820TG)/ | 2022-03-28 12:16 | - | |
| You Want Power, Canada You Got It!/ | 2022-03-28 12:16 | - | |
| Your Acer Notebook LIFE SPAN/ | 2022-03-28 12:16 | - | |
| Your Crysis, UT3 and COD4 settings (Acer 5920G owners)/ | 2022-03-28 12:16 | - | |
| Your Opinion on the 2nd Generation Gemstone lineup/ | 2022-03-28 12:16 | - | |
| Your experience with MediaBay HDs/ | 2022-03-28 12:16 | - | |
| Your experience with the Acer Aspire Timeline AS1810TZ/ | 2022-03-28 12:16 | - | |
| Your input please- Should I buy the 5672WLMi X1600/ | 2022-03-28 12:16 | - | |
| Your thoughts please! Acer Aspire 5253... Thx-)/ | 2022-03-28 12:16 | - | |
| Yupiii!! Upgraded my Acer Aspire 3050 to Turion X2/ | 2022-03-28 12:16 | - | |
| Z35P/ | 2022-03-28 12:16 | - | |
| Z5610 MXM-A Upgrade 4670 6770M/ | 2022-03-28 12:16 | - | |
| ZG5 Doesn't Power On/ | 2022-03-28 12:16 | - | |
| ZH7 (Acer 1410 and 1810) hardware hacking and resources/ | 2022-03-28 12:16 | - | |
| Zalman Cooler with an Acer Aspire 6930G/ | 2022-03-28 12:16 | - | |
| Zit possible Acer A1 could be running 1 2 speed/ | 2022-03-28 12:16 | - | |
| [3820TG] Extended Battery life Bios/ | 2022-03-28 12:16 | - | |
| [3820tray] Hardware Control PowerProfiles CPUMonitor/ | 2022-03-28 12:16 | - | |
| [4820TG] Getting graphical errors in game(s), where to troubleshoot/ | 2022-03-28 12:16 | - | |
| [5672] ePower Management install issue/ | 2022-03-28 12:16 | - | |
| [5920g]What type of adapter for the optical audio/ | 2022-03-28 12:16 | - | |
| [5920g]Will my HDMI output also work as an input/ | 2022-03-28 12:16 | - | |
| [ACER ASPIRE 5570-ZR1] Won't boot without battery/ | 2022-03-28 12:16 | - | |
| [ASK]Acer Aspire 4741G ePower Management Application/ | 2022-03-28 12:16 | - | |
| [ASK] Acer Aspire 5920G very hot when playing game/ | 2022-03-28 12:16 | - | |
| [ASK]TravelMate 4730/ | 2022-03-28 12:16 | - | |
| [Acer 1410 1810T 1810TZ] Successful webcam update!/ | 2022-03-28 12:16 | - | |
| [Acer 3690] Burning recovery DVD restoring recovery image/ | 2022-03-28 12:16 | - | |
| [Acer 5920g] 8600m GT GDDR3/ | 2022-03-28 12:16 | - | |
| [Acer Aspire 1410 1810t 1810tz] Timeline Tweaks (2)/ | 2022-03-28 12:16 | - | |
| [Acer Aspire 1694Wlmi] Screen Problem!/ | 2022-03-28 12:16 | - | |
| [Acer Aspire 4810TZ] Default Partitition Table/ | 2022-03-28 12:16 | - | |
| [Acer Aspire 5600] Screen randomly turns a solid color when operating on battery power/ | 2022-03-28 12:16 | - | |
| [Advice] Acer 5920g 9600M GT upgrade/ | 2022-03-28 12:16 | - | |
| [Driver]Help me/ | 2022-03-28 12:16 | - | |
| [GUIDE] Clean install of Windows 7 on Acer/ | 2022-03-28 12:16 | - | |
| [HELP] - Acer Asipre V15 Nitro - Won't Power Up on Battery/ | 2022-03-28 12:16 | - | |
| [HELP] Acer 5 -4 Windows Doesn't start sometimes/ | 2022-03-28 12:16 | - | |
| [HELP]Acer Extensa 5620z/ | 2022-03-28 12:16 | - | |
| [HELP] How to Upgrade Acer Aspire 6935G Bios/ | 2022-03-28 12:16 | - | |
| [HELP] V15 Nitro Black Edition won't turn on after installing SSD/ | 2022-03-28 12:16 | - | |
| [HELP] how to format partition new hdd using Acer Recovery CD/ | 2022-03-28 12:16 | - | |
| [Help] Acer TravelMate 2480 CPU upgrade/ | 2022-03-28 12:16 | - | |
| [Help] Acer Travelmate 3273wxmi Modem Driver/ | 2022-03-28 12:16 | - | |
| [Help] Recover Bios Travelmate 250/ | 2022-03-28 12:16 | - | |
| [Help] The XP freezes on TravelMate 5720, after downgrading from Vista to XP/ | 2022-03-28 12:16 | - | |
| [Help] What's kind of my chipset/ | 2022-03-28 12:16 | - | |
| [Info] Updating ATI Drivers on Switchable Systems While Preserving Switching Functions/ | 2022-03-28 12:16 | - | |
| [NEED ADVICE]ANTI-GLARE FILM FOR ACER EXTENSA 5620z/ | 2022-03-28 12:16 | - | |
| [Official Thread] Acer Aspire Timeline Ultra M3-581TG Ultrabook/ | 2022-03-28 12:16 | - | |
| [POLL]Hard drive noise on TM8204/ | 2022-03-28 12:16 | - | |
| [PROBLEM] Acer Aspire 6935G Games Problem/ | 2022-03-28 12:16 | - | |
| [Q] Acer Aspire 5920G Southbridge Intel 82801HBM (ICH8-ME) rev. version/ | 2022-03-28 12:16 | - | |
| [Question] Acer Aspire 5720, Fan Noise/ | 2022-03-28 12:16 | - | |
| [REQUEST] Acer Aspire 5935G fully unlocked BIOS/ | 2022-03-28 12:16 | - | |
| [REQUEST]Acer aspire 4930G insydeH20 bios unlock or mod/ | 2022-03-28 12:16 | - | |
| [Request]TM4402 DVD installation guide/ | 2022-03-28 12:16 | - | |
| [SOLVED] Acer Aspire 5920G and Windows 8.1 (problem with drivers)/ | 2022-03-28 12:16 | - | |
| [This thread again] HD DVD Software/ | 2022-03-28 12:16 | - | |
| [Timeline] How to extract a bootable Vista DVD/ | 2022-03-28 12:16 | - | |
| [TravelMate 5510] Audio not working on a brand new winXP/ | 2022-03-28 12:16 | - | |
| [Urgent]Changing CPU on 1691wlmi/ | 2022-03-28 12:16 | - | |
| [WTA] Acer MPAD-MSAE Reference Board/ | 2022-03-28 12:16 | - | |
| []HEEEEELP[] Cant see wireless network -_-/ | 2022-03-28 12:16 | - | |
| [acer 5742g] speedfan poroblem/ | 2022-03-28 12:16 | - | |
| [ask] Acer Aspire 5935G Windows7 VGA Driver/ | 2022-03-28 12:16 | - | |
| [ask]Acer ePower Management Acer PowerSmart Manager/ | 2022-03-28 12:16 | - | |
| [ask]Aspire 4720 driver on windows 7/ | 2022-03-28 12:16 | - | |
| [battery life] how much mah should the battery hold/ | 2022-03-28 12:16 | - | |
| [help]Aspire 5742 VRAM!/ | 2022-03-28 12:16 | - | |
| [request] Travelmate 8200 or 8210 service manual/ | 2022-03-28 12:16 | - | |
| a bit of help with aspire 5670 wireless switch/ | 2022-03-28 12:05 | - | |
| abourt ram speed/ | 2022-03-28 12:05 | - | |
| about ACER/ | 2022-03-28 12:05 | - | |
| about Acer laptop/ | 2022-03-28 12:06 | - | |
| about acer predator 15 gtx 1070 please come in/ | 2022-03-28 12:06 | - | |
| about n81vp-d1 and n81vp-d2/ | 2022-03-28 12:06 | - | |
| about super - pi calculation- owners of aspire 5102/ | 2022-03-28 12:06 | - | |
| about to cry please help/ | 2022-03-28 12:06 | - | |
| absent from device manager/ | 2022-03-28 12:06 | - | |
| ac adapter power cord question/ | 2022-03-28 12:06 | - | |
| ac adaptor/ | 2022-03-28 12:06 | - | |
| accer 5750G, which version is chipset/ | 2022-03-28 12:06 | - | |
| accer 5810T - display lid split apart/ | 2022-03-28 12:06 | - | |
| accer apsire 8735g 6198 second hard drive/ | 2022-03-28 12:06 | - | |
| ace 9410r aspire/ | 2022-03-28 12:06 | - | |
| acer -AS1711SCi-V64MB - is this one good for me/ | 2022-03-28 12:06 | - | |
| acer...registration.....serial number/ | 2022-03-28 12:10 | - | |
| acer 220 upgrade/ | 2022-03-28 12:06 | - | |
| acer 313t help for insall windows/ | 2022-03-28 12:06 | - | |
| acer 721 - any battery upgrade options/ | 2022-03-28 12:07 | - | |
| acer 1350 ugraded to 2gb/ | 2022-03-28 12:06 | - | |
| acer 1410- how to remove hard drive/ | 2022-03-28 12:06 | - | |
| acer 1410 XP hotkey issue. Can't dim brightness/ | 2022-03-28 12:06 | - | |
| acer 1410 broken hinge - options/ | 2022-03-28 12:06 | - | |
| acer 1410 driver problem/ | 2022-03-28 12:06 | - | |
| acer1410 su2300 win7 64bit 4gb memory issue/ | 2022-03-28 12:10 | - | |
| acer 1462 lm problem please help!/ | 2022-03-28 12:06 | - | |
| acer 1500 battery noise/ | 2022-03-28 12:06 | - | |
| acer 1501LC SERVICE MANUAL HELP PLEASE ANY ONE/ | 2022-03-28 12:06 | - | |
| acer 1551 update video driver help/ | 2022-03-28 12:06 | - | |
| acer 1642Z/ | 2022-03-28 12:06 | - | |
| acer 1642wlmi/ | 2022-03-28 12:06 | - | |
| acer 1690 - 8104/ | 2022-03-28 12:06 | - | |
| acer 1691 and microsoft wireless notebook optical mouse/ | 2022-03-28 12:06 | - | |
| acer 1692 crack hinges repaired free by acer/ | 2022-03-28 12:06 | - | |
| acer 1692 hard drive problems/ | 2022-03-28 12:06 | - | |
| acer 1692 wlmi questions/ | 2022-03-28 12:06 | - | |
| acer 1694wlmi/ | 2022-03-28 12:06 | - | |
| acer 1703esc problems- v. long startup, audio-Q/ | 2022-03-28 12:06 | - | |
| acer 1800 servies and mini-pci tv card/ | 2022-03-28 12:06 | - | |
| acer 1801wsmi/ | 2022-03-28 12:06 | - | |
| acer 1810tz display on HDMI problem/ | 2022-03-28 12:06 | - | |
| acer 1820,acer 1825 or 1830/ | 2022-03-28 12:06 | - | |
| acer 2012 wlci help! nothing at startup/ | 2022-03-28 12:06 | - | |
| acer 2300 travelmate CPU fan on bust/ | 2022-03-28 12:06 | - | |
| acer 2420 travelmate NTLDR is Missing! C-/ | 2022-03-28 12:06 | - | |
| acer 3003 to tv help/ | 2022-03-28 12:06 | - | |
| acer 3050/ | 2022-03-28 12:06 | - | |
| acer 3050 boot problem/ | 2022-03-28 12:06 | - | |
| acer 3054 USB Stick not reconised issue/ | 2022-03-28 12:06 | - | |
| acer 3100 keyboard not respond/ | 2022-03-28 12:06 | - | |
| acer 3201 or ibm r51/ | 2022-03-28 12:06 | - | |
| acer 3201 pictures needed/ | 2022-03-28 12:06 | - | |
| acer 3212 review/ | 2022-03-28 12:06 | - | |
| acer 3630 recovery/ | 2022-03-28 12:06 | - | |
| acer 3662wlmi dvd-rw not recognised & pxe-rom e61 error at boot/ | 2022-03-28 12:06 | - | |
| acer 3680-2633 wont charge/ | 2022-03-28 12:06 | - | |
| acer 3680 - video capturing/ | 2022-03-28 12:06 | - | |
| acer 3680/ | 2022-03-28 12:06 | - | |
| acer 3680 BSOD fix/ | 2022-03-28 12:06 | - | |
| acer 3680 audio driver for xp/ | 2022-03-28 12:06 | - | |
| acer 3680 dvd drive burning probem/ | 2022-03-28 12:06 | - | |
| acer3680 how to enable intel vt/ | 2022-03-28 12:10 | - | |
| acer 3680 internet/ | 2022-03-28 12:06 | - | |
| acer 3680 limited or no connectivity/ | 2022-03-28 12:06 | - | |
| acer 3680 to tv/ | 2022-03-28 12:06 | - | |
| acer 3680 upgrade to 5580 lcd and orbicam/ | 2022-03-28 12:06 | - | |
| acer 3680 wifi driver!/ | 2022-03-28 12:06 | - | |
| acer 3810t + halflife1/ | 2022-03-28 12:06 | - | |
| acer 3810tg vs 3820tg/ | 2022-03-28 12:06 | - | |
| acer 3810tz bios clock keeps losing an hour/ | 2022-03-28 12:06 | - | |
| acer 3810 with vista ultimate help please/ | 2022-03-28 12:06 | - | |
| acer 3820tg BSOD after Ati Update/ | 2022-03-28 12:06 | - | |
| acer 3830tg bluetooth driver/ | 2022-03-28 12:06 | - | |
| acer 4010 power problem/ | 2022-03-28 12:06 | - | |
| acer 4060 notebook/ | 2022-03-28 12:06 | - | |
| acer 4102wlmi/ | 2022-03-28 12:06 | - | |
| acer4315 have bios password/ | 2022-03-28 12:10 | - | |
| acer 4501 mobo, processor upgrade/ | 2022-03-28 12:06 | - | |
| acer 4520 downgrade to xp/ | 2022-03-28 12:06 | - | |
| acer 4530 network adapter was not detected/ | 2022-03-28 12:06 | - | |
| acer 4602/ | 2022-03-28 12:06 | - | |
| acer 4620Z power jack replace/ | 2022-03-28 12:06 | - | |
| acer 4620z power problem/ | 2022-03-28 12:06 | - | |
| acer 4720z problem please help/ | 2022-03-28 12:06 | - | |
| acer 4736G Dead/ | 2022-03-28 12:06 | - | |
| acer 4736G no Power turn on/ | 2022-03-28 12:06 | - | |
| acer 4810t and core 2 solo/ | 2022-03-28 12:06 | - | |
| acer 4810tz-4120 white colored bars on screen/ | 2022-03-28 12:06 | - | |
| acer 4820TG system freezing/ | 2022-03-28 12:06 | - | |
| acer 4937g...can anyone explain this !!!/ | 2022-03-28 12:06 | - | |
| acer 5004, is that bad/ | 2022-03-28 12:06 | - | |
| acer 5024 oblivion/ | 2022-03-28 12:06 | - | |
| acer 5044 wireless networking not working sice upgrade/ | 2022-03-28 12:06 | - | |
| acer 5050 - extended battery/ | 2022-03-28 12:06 | - | |
| acer 5050 5554/ | 2022-03-28 12:06 | - | |
| acer 5050 aspire yellow/ | 2022-03-28 12:06 | - | |
| acer 5050 battery metre problems/ | 2022-03-28 12:06 | - | |
| acer 5050 keyboard hotkeys/ | 2022-03-28 12:06 | - | |
| acer 5052 battery change/ | 2022-03-28 12:06 | - | |
| acer 5100/ | 2022-03-28 12:06 | - | |
| acer5100 Start up issues/ | 2022-03-28 12:10 | - | |
| acer 5100 bought display unit, no pswrd for vista cant get into vista now, no rec. disc came with it/ | 2022-03-28 12:06 | - | |
| acer 5100 has a problem/ | 2022-03-28 12:06 | - | |
| acer 5100 memory upgrade/ | 2022-03-28 12:06 | - | |
| acer 5101awlmi/ | 2022-03-28 12:06 | - | |
| acer 5101 orbicam problems/ | 2022-03-28 12:06 | - | |
| acer 5102 crashes weekly, have to wait 30 mins to restart/ | 2022-03-28 12:06 | - | |
| acer 5102 drivers wanted/ | 2022-03-28 12:06 | - | |
| acer 5102 wlmi orbicam/ | 2022-03-28 12:06 | - | |
| acer 5315-2013 need 2 files/ | 2022-03-28 12:06 | - | |
| acer 5315-2875 blue tooth/ | 2022-03-28 12:06 | - | |
| acer 5315 2gb ram only reading 1gb ..HELP/ | 2022-03-28 12:06 | - | |
| acer 5315 and acer 5720g no boot to bios bsd.help/ | 2022-03-28 12:06 | - | |
| acer 5315 big problems/ | 2022-03-28 12:06 | - | |
| acer 5315 cpu upgrade/ | 2022-03-28 12:06 | - | |
| acer 5315 cpu upgrades/ | 2022-03-28 12:06 | - | |
| acer 5315 few q's/ | 2022-03-28 12:06 | - | |
| acer 5315 fix shutdown overheating issues. no dont thank me -)/ | 2022-03-28 12:06 | - | |
| acer 5315 flex bad contact - freezes/ | 2022-03-28 12:06 | - | |
| acer 5315 ram upgrade help/ | 2022-03-28 12:06 | - | |
| acer 5315 reinstall/ | 2022-03-28 12:06 | - | |
| acer 5315 strange wlan-driver problem/ | 2022-03-28 12:06 | - | |
| acer 5315 support SATa2/ | 2022-03-28 12:06 | - | |
| acer 5315 with 4 gig ram/ | 2022-03-28 12:06 | - | |
| acer 5315 won't start up/ | 2022-03-28 12:06 | - | |
| acer 5333 booting problem/ | 2022-03-28 12:06 | - | |
| acer 5335 Wireless Internet Problems/ | 2022-03-28 12:06 | - | |
| acer 5335 hard drive/ | 2022-03-28 12:06 | - | |
| acer 5430 vista audio port scan/ | 2022-03-28 12:06 | - | |
| acer 5515 graphics card/ | 2022-03-28 12:06 | - | |
| acer 5517 and amd Turion 64 TMDTL56HAX5DC/ | 2022-03-28 12:06 | - | |
| acer 5517 upgrade to windows 7/ | 2022-03-28 12:06 | - | |
| acer 5517 volume too low! How adjust/ | 2022-03-28 12:06 | - | |
| acer 5520-5865 help please/ | 2022-03-28 12:06 | - | |
| acer 5534-1096 cpu upgrade/ | 2022-03-28 12:06 | - | |
| acer 5534 xp pro drivers/ | 2022-03-28 12:06 | - | |
| acer 5562 battery usage/ | 2022-03-28 12:06 | - | |
| acer 5570z erecovery help/ | 2022-03-28 12:06 | - | |
| acer 5600 screen issues/ | 2022-03-28 12:06 | - | |
| acer 5601 partition problem/ | 2022-03-28 12:06 | - | |
| acer 5602 -Windows vista RTM issue/ | 2022-03-28 12:06 | - | |
| acer5610...orbicam not working/ | 2022-03-28 12:10 | - | |
| acer 5610z/ | 2022-03-28 12:06 | - | |
| acer 5610z cmos battery!/ | 2022-03-28 12:06 | - | |
| acer 5610z sound problem/ | 2022-03-28 12:06 | - | |
| acer 5610z video bios tweak/ | 2022-03-28 12:06 | - | |
| acer 5623or4/ | 2022-03-28 12:06 | - | |
| acer 5630 help please/ | 2022-03-28 12:06 | - | |
| acer 5633/ | 2022-03-28 12:06 | - | |
| acer 5652 and sound card/ | 2022-03-28 12:06 | - | |
| acer 5670 5672 which one better!!/ | 2022-03-28 12:06 | - | |
| acer 5672 - VGA DVI S-vid problem/ | 2022-03-28 12:06 | - | |
| acer 5672 - buzzing fan noise/ | 2022-03-28 12:06 | - | |
| acer 5672 - odd wireless problem on battery/ | 2022-03-28 12:06 | - | |
| acer 5672 - the audio drivers do nothing!!/ | 2022-03-28 12:06 | - | |
| acer5672 HElp/ | 2022-03-28 12:10 | - | |
| acer 5672 cover lcd part number/ | 2022-03-28 12:06 | - | |
| acer 5672 died/ | 2022-03-28 12:06 | - | |
| acer 5672 keyboard and touchpad not working (other drivers too)/ | 2022-03-28 12:06 | - | |
| acer 5672 laptop fan/ | 2022-03-28 12:06 | - | |
| acer 5672 opinions/ | 2022-03-28 12:06 | - | |
| acer5672 orbicam video preview failure/ | 2022-03-28 12:10 | - | |
| acer 5672 question - heat buildquality/ | 2022-03-28 12:06 | - | |
| acer 5672wlmi mic/ | 2022-03-28 12:06 | - | |
| acer 5672wlmi video in/ | 2022-03-28 12:06 | - | |
| acer 5720 fine screen lines/ | 2022-03-28 12:06 | - | |
| acer 5720 making a clicking noise/ | 2022-03-28 12:06 | - | |
| acer 5730 disaster/ | 2022-03-28 12:06 | - | |
| acer 5733z headphone jack/ | 2022-03-28 12:06 | - | |
| acer 5735-4774 card reader won't show up/ | 2022-03-28 12:06 | - | |
| acer 5735 start up problems/ | 2022-03-28 12:06 | - | |
| acer 5735 wont run games/ | 2022-03-28 12:06 | - | |
| acer 5738ZG HDD partitions problem/ | 2022-03-28 12:06 | - | |
| acer 5738g no power apparently dead/ | 2022-03-28 12:06 | - | |
| acer 5738g or 5536g,im so frustrated!!/ | 2022-03-28 12:06 | - | |
| acer 5738z not power on/ | 2022-03-28 12:06 | - | |
| acer 5739g/ | 2022-03-28 12:06 | - | |
| acer 5740G Laptop/ | 2022-03-28 12:06 | - | |
| acer 5740g ati hd5470 graphical corruption/ | 2022-03-28 12:06 | - | |
| acer 5742g Driver/ | 2022-03-28 12:06 | - | |
| acer 5750g problem with Epower managment/ | 2022-03-28 12:06 | - | |
| acer 5810T/ | 2022-03-28 12:06 | - | |
| acer 5820T-6825 cant get a ssd drive to fit/ | 2022-03-28 12:06 | - | |
| acer 5820T-6825 no ssd drive fits/ | 2022-03-28 12:06 | - | |
| acer 5820tg VGA problem/ | 2022-03-28 12:06 | - | |
| acer 5920, vibration/ | 2022-03-28 12:06 | - | |
| acer 5920 - audio driver update- Microsoft/ | 2022-03-28 12:06 | - | |
| acer 5920/ | 2022-03-28 12:06 | - | |
| acer 5920G Black screen/ | 2022-03-28 12:06 | - | |
| acer 5920G headset/ | 2022-03-28 12:06 | - | |
| acer5920G recovery/ | 2022-03-28 12:10 | - | |
| acer 5920 cpu upgrade/ | 2022-03-28 12:06 | - | |
| acer 5920g and nvidia 9650m gt problems/ | 2022-03-28 12:06 | - | |
| acer 5920g black screen problem/ | 2022-03-28 12:06 | - | |
| acer 5920g boot problem/ | 2022-03-28 12:06 | - | |
| acer 5920g dissapointing gameplay/ | 2022-03-28 12:06 | - | |
| acer 5920g gpu chipset replacement/ | 2022-03-28 12:06 | - | |
| acer 5920g modem missing, changed video card ..still no video/ | 2022-03-28 12:06 | - | |
| acer5920g recovery disks/ | 2022-03-28 12:10 | - | |
| acer 5920g thermal paste replacement/ | 2022-03-28 12:06 | - | |
| acer 5920g white shiny screen,no video/ | 2022-03-28 12:06 | - | |
| acer 5920g works only with external monitor, help/ | 2022-03-28 12:06 | - | |
| acer 5920 mxm i swap/ | 2022-03-28 12:06 | - | |
| acer 5920 webcam problem/ | 2022-03-28 12:06 | - | |
| acer 5920 wireless problem/ | 2022-03-28 12:06 | - | |
| acer 5920 xp internet connectivity/ | 2022-03-28 12:06 | - | |
| acer 5920 xp no wired lan card/ | 2022-03-28 12:06 | - | |
| acer 5930 disassemble/ | 2022-03-28 12:06 | - | |
| acer 5930g - win 7/ | 2022-03-28 12:06 | - | |
| acer 6530g charging/ | 2022-03-28 12:06 | - | |
| acer 6920 GPU Upgradable/ | 2022-03-28 12:06 | - | |
| acer 6920G bd drive not reading Bluray/ | 2022-03-28 12:06 | - | |
| acer 6920G help gpu replacement/ | 2022-03-28 12:06 | - | |
| acer 6920 disk drive/ | 2022-03-28 12:06 | - | |
| acer 6920 drivers for xp/ | 2022-03-28 12:06 | - | |
| acer 6920g Optical drive won't burn (win 7)/ | 2022-03-28 12:06 | - | |
| acer 6920g battery/ | 2022-03-28 12:06 | - | |
| acer 6920g blank screen with flashing cursor/ | 2022-03-28 12:06 | - | |
| acer 6920g graphic card life over/ | 2022-03-28 12:06 | - | |
| acer 6920g low fps problem/ | 2022-03-28 12:06 | - | |
| acer 6920g problems/ | 2022-03-28 12:06 | - | |
| acer 6920g problem upgrade to intel 5300 wifi/ | 2022-03-28 12:06 | - | |
| acer 6920g screen dilema/ | 2022-03-28 12:06 | - | |
| acer 6920g setfsb overclock and upgrade - 9600 + ssd + overclock = happy/ | 2022-03-28 12:06 | - | |
| acer 6920g video card upgrade/ | 2022-03-28 12:06 | - | |
| acer 6920 issues/ | 2022-03-28 12:06 | - | |
| acer 6920 service manual/ | 2022-03-28 12:06 | - | |
| acer 6920 video card/ | 2022-03-28 12:06 | - | |
| acer 6930G unhide hidden erecovery partition/ | 2022-03-28 12:06 | - | |
| acer 6930 and arcade easy launch button/ | 2022-03-28 12:06 | - | |
| acer6930g...pls help/ | 2022-03-28 12:10 | - | |
| acer 6930g GPU 9600GT 1GB dedicated memory/ | 2022-03-28 12:06 | - | |
| acer 6930g charger question/ | 2022-03-28 12:06 | - | |
| acer6930g how do i reboot without a disc/ | 2022-03-28 12:10 | - | |
| acer 6930 touch buttons/ | 2022-03-28 12:06 | - | |
| acer 6930 wireless problem/ | 2022-03-28 12:06 | - | |
| acer 6935g Always dim/ | 2022-03-28 12:06 | - | |
| acer 6935g back light problem/ | 2022-03-28 12:06 | - | |
| acer 6935g doesn't boot/ | 2022-03-28 12:06 | - | |
| acer 6935g upgrade to win 7 and acer utilitys/ | 2022-03-28 12:06 | - | |
| acer 7004wsmi/ | 2022-03-28 12:07 | - | |
| acer 7250 keyboard period key not working/ | 2022-03-28 12:07 | - | |
| acer 7520/ | 2022-03-28 12:07 | - | |
| acer 7530/ | 2022-03-28 12:07 | - | |
| acer 7535g, can it do anything/ | 2022-03-28 12:07 | - | |
| acer 7720-6155/ | 2022-03-28 12:07 | - | |
| acer 7720 Win7 drivers/ | 2022-03-28 12:07 | - | |
| acer 7720g 9500m gs to 9300m gs no internal screen/ | 2022-03-28 12:07 | - | |
| acer 7720g new videocard. now always shuts down after boot/ | 2022-03-28 12:07 | - | |
| acer 7720g wireless disconnecting/ | 2022-03-28 12:07 | - | |
| acer 7730 - no fingerprint scanner/ | 2022-03-28 12:07 | - | |
| acer 7730 doesn't boot.........HELP!/ | 2022-03-28 12:07 | - | |
| acer 7745 battery problem/ | 2022-03-28 12:07 | - | |
| acer 8202 keys not working!/ | 2022-03-28 12:07 | - | |
| acer 8202 voip bt phone/ | 2022-03-28 12:07 | - | |
| acer 8202 wont charge/ | 2022-03-28 12:07 | - | |
| acer 8204 HELP!/ | 2022-03-28 12:07 | - | |
| acer 8204 cases/ | 2022-03-28 12:07 | - | |
| acer 8204 cpu temp and battery availability/ | 2022-03-28 12:07 | - | |
| acer 8204wlmi dead/ | 2022-03-28 12:07 | - | |
| acer 8371 incorrect resolution/ | 2022-03-28 12:07 | - | |
| acer 8730- which pll on mainboard bigbear2/ | 2022-03-28 12:07 | - | |
| acer 8735 mxm update/ | 2022-03-28 12:07 | - | |
| acer 8920/ | 2022-03-28 12:07 | - | |
| acer 8920 cinedash help/ | 2022-03-28 12:07 | - | |
| acer 8920 display gone/ | 2022-03-28 12:07 | - | |
| acer 8920 with t9500/ | 2022-03-28 12:07 | - | |
| acer 8930G core 2 quad/ | 2022-03-28 12:07 | - | |
| acer 8930G power supply (charger)/ | 2022-03-28 12:07 | - | |
| acer8930g/ | 2022-03-28 12:10 | - | |
| acer 8930g cpu gpu upgrade/ | 2022-03-28 12:07 | - | |
| acer 8930g gpu upgrade/ | 2022-03-28 12:07 | - | |
| acer 8930g laptop power supply/ | 2022-03-28 12:07 | - | |
| acer 8935G laptop/ | 2022-03-28 12:07 | - | |
| acer 8935g owners - I need advice/ | 2022-03-28 12:07 | - | |
| acer 8935g problem with ati card/ | 2022-03-28 12:07 | - | |
| acer 9300-5005 dvd burning problem/ | 2022-03-28 12:07 | - | |
| acer 9300-5317 memory upgrade/ | 2022-03-28 12:07 | - | |
| acer 9300 memory/ | 2022-03-28 12:07 | - | |
| acer 9300 selling price/ | 2022-03-28 12:07 | - | |
| acer 9301 will not boot with 2x 2gb of ram/ | 2022-03-28 12:07 | - | |
| acer AS5680-6516 for 611.68 with free shipping/ | 2022-03-28 12:07 | - | |
| acer Aspire 1355XV/ | 2022-03-28 12:07 | - | |
| acer Aspire 3830TG - does the throttling occur in every case or only with video overcharge/ | 2022-03-28 12:07 | - | |
| acer Aspire 4720z have booting problem/ | 2022-03-28 12:07 | - | |
| acer Aspire 5602NWLMi VGA question/ | 2022-03-28 12:07 | - | |
| acer Aspire 5671AWLMi CoreDuo T2050/ | 2022-03-28 12:07 | - | |
| acer DVD RAM SDVD8821/ | 2022-03-28 12:09 | - | |
| acer R7 572G. problem with digitazer/ | 2022-03-28 12:09 | - | |
| acer TM 2702WLMi-blue screen of death/ | 2022-03-28 12:09 | - | |
| acer TM 4001WLMI/ | 2022-03-28 12:09 | - | |
| acer TM EX 6600/ | 2022-03-28 12:09 | - | |
| acer aapire 5532 problem with webcam not working/ | 2022-03-28 12:07 | - | |
| acer accs/ | 2022-03-28 12:07 | - | |
| acer and projector/ | 2022-03-28 12:07 | - | |
| acer any ware 1120NX/ | 2022-03-28 12:07 | - | |
| acer arcade deluxe drive won't burn/ | 2022-03-28 12:07 | - | |
| acer arcade dlx/ | 2022-03-28 12:07 | - | |
| acer arcade on 1694/ | 2022-03-28 12:07 | - | |
| acer as 1644, battery problems/ | 2022-03-28 12:07 | - | |
| acer as 1692 wlmi united kingdom - problem with linkig with tv via s-video/ | 2022-03-28 12:07 | - | |
| acer as1692wlmi vs as1654wlmi/ | 2022-03-28 12:07 | - | |
| acer as5002 with ddr400/ | 2022-03-28 12:07 | - | |
| acer as7745g secondary hdd issue/ | 2022-03-28 12:07 | - | |
| acer aspir 5672wlmi help - vista update/ | 2022-03-28 12:07 | - | |
| acer aspire, password recovery recovery discs/ | 2022-03-28 12:09 | - | |
| acer aspire 1350/ | 2022-03-28 12:07 | - | |
| acer aspire 1511lmi has got cracks on hinges/ | 2022-03-28 12:07 | - | |
| acer aspire 1640/ | 2022-03-28 12:07 | - | |
| acer aspire 1652WLMI Bios updated... and DEAD/ | 2022-03-28 12:07 | - | |
| acer aspire 1691/ | 2022-03-28 12:07 | - | |
| acer aspire 1691WLMi or 1683WNLMi/ | 2022-03-28 12:07 | - | |
| acer aspire 1691 wlmi battery/ | 2022-03-28 12:07 | - | |
| acer aspire 1692WLMi/ | 2022-03-28 12:07 | - | |
| acer aspire 1692 or ferrari 4002/ | 2022-03-28 12:07 | - | |
| acer aspire 1693wlmi/ | 2022-03-28 12:07 | - | |
| acer aspire 1694 wlmi - 5.1 speakers/ | 2022-03-28 12:07 | - | |
| acer aspire 1694wlmi mobility radeon x700 fan is always on/ | 2022-03-28 12:07 | - | |
| acer aspire 1703sc Bios Problem!!!! URGENT/ | 2022-03-28 12:07 | - | |
| acer aspire 1705smi/ | 2022-03-28 12:07 | - | |
| acer aspire 1710 extended desktop/ | 2022-03-28 12:07 | - | |
| acer aspire 1800 vertical stripe/ | 2022-03-28 12:07 | - | |
| acer aspire 2010/ | 2022-03-28 12:07 | - | |
| acer aspire 2026wlmi or 1804wsmi/ | 2022-03-28 12:07 | - | |
| acer aspire 2920 driver help/ | 2022-03-28 12:07 | - | |
| acer aspire 2930z/ | 2022-03-28 12:07 | - | |
| acer aspire 3000ZL5 no power/ | 2022-03-28 12:07 | - | |
| acer aspire 3000 problem help!!!/ | 2022-03-28 12:07 | - | |
| aceraspire 3002 problems/ | 2022-03-28 12:10 | - | |
| acer aspire 3004wlmi/ | 2022-03-28 12:07 | - | |
| acer aspire 3100 usb problem (help)/ | 2022-03-28 12:07 | - | |
| acer aspire 3610 screen problem/ | 2022-03-28 12:07 | - | |
| acer aspire 3680 help/ | 2022-03-28 12:07 | - | |
| acer aspire 3680 service manual needed/ | 2022-03-28 12:07 | - | |
| acer aspire 3680 upgrading the processor/ | 2022-03-28 12:07 | - | |
| acer aspire 3690 failing to power on/ | 2022-03-28 12:07 | - | |
| acer aspire 4270 drivers/ | 2022-03-28 12:07 | - | |
| acer aspire 4310 ram upgrade problem/ | 2022-03-28 12:07 | - | |
| acer aspire 4315-2097/ | 2022-03-28 12:07 | - | |
| acer aspire 4352/ | 2022-03-28 12:07 | - | |
| acer aspire 4530 auto shut down/ | 2022-03-28 12:07 | - | |
| acer aspire 4820tg-488g75mnkk CPU UPGRADE TO I7 740QM/ | 2022-03-28 12:07 | - | |
| acer aspire 4920/ | 2022-03-28 12:07 | - | |
| acer aspire 4935 empowering technology installer for xp/ | 2022-03-28 12:07 | - | |
| acer aspire 5000 battery/ | 2022-03-28 12:07 | - | |
| acer aspire 5000 lcd brightness problemm/ | 2022-03-28 12:07 | - | |
| acer aspire 5050, broken sata controller/ | 2022-03-28 12:07 | - | |
| acer aspire 5050-3785 wireless help/ | 2022-03-28 12:07 | - | |
| acer aspire 5050/ | 2022-03-28 12:07 | - | |
| acer aspire 5050 restore disk problem/ | 2022-03-28 12:07 | - | |
| acer aspire 5100-5764 doesn't start up !!help/ | 2022-03-28 12:07 | - | |
| acer aspire 5100 mouse problem/ | 2022-03-28 12:07 | - | |
| acer aspire 5100 owner's manual needed/ | 2022-03-28 12:07 | - | |
| acer aspire 5100 upgrade/ | 2022-03-28 12:07 | - | |
| acer aspire 5102 frozen on user-name page/ | 2022-03-28 12:07 | - | |
| acer aspire 5110/ | 2022-03-28 12:07 | - | |
| acer aspire 5112 start up problem!/ | 2022-03-28 12:07 | - | |
| acer aspire 5253-bz492/ | 2022-03-28 12:07 | - | |
| acer aspire 5315-2013 restore dvds/ | 2022-03-28 12:07 | - | |
| acer aspire 5315-2153 problems/ | 2022-03-28 12:07 | - | |
| acer aspire 5315-2153 upgrade help/ | 2022-03-28 12:07 | - | |
| acer aspire 5315 dead graphics. need help/ | 2022-03-28 12:07 | - | |
| acer aspire 5315 question bios upgrade/ | 2022-03-28 12:07 | - | |
| acer aspire 5315 recovery...not able to activate recovery disks/ | 2022-03-28 12:07 | - | |
| acer aspire 5315 wont boot up/ | 2022-03-28 12:07 | - | |
| acer aspire 5315 wont turn on/ | 2022-03-28 12:07 | - | |
| acer aspire 5336/ | 2022-03-28 12:07 | - | |
| acer aspire 5500 series HELP!!!!/ | 2022-03-28 12:07 | - | |
| acer aspire 5515 installing windows xp/ | 2022-03-28 12:07 | - | |
| acer aspire 5516/ | 2022-03-28 12:07 | - | |
| acer aspire 5517 cardreader/ | 2022-03-28 12:07 | - | |
| acer aspire 5520. Downgrade from vista to xp/ | 2022-03-28 12:07 | - | |
| acer aspire 5520/ | 2022-03-28 12:07 | - | |
| acer aspire 5520g/ | 2022-03-28 12:07 | - | |
| acer aspire 5520 laptop/ | 2022-03-28 12:07 | - | |
| acer aspire 5520 replacement dc jack part/ | 2022-03-28 12:07 | - | |
| acer aspire 5535 HELP!/ | 2022-03-28 12:07 | - | |
| acer aspire 5542 hangs erratically/ | 2022-03-28 12:07 | - | |
| acer aspire 5552 broken screen/ | 2022-03-28 12:07 | - | |
| acer aspire 5552g with xp/ | 2022-03-28 12:07 | - | |
| acer aspire 5570-2052 xp screen blinking/ | 2022-03-28 12:07 | - | |
| acer aspire 5570-2052 xp sound solution/ | 2022-03-28 12:07 | - | |
| acer aspire 5570Z problem...help!!!/ | 2022-03-28 12:07 | - | |
| acer aspire 5570z/ | 2022-03-28 12:07 | - | |
| acer aspire 5570z problems/ | 2022-03-28 12:07 | - | |
| acer aspire 5580/ | 2022-03-28 12:07 | - | |
| acer aspire 5583 audio/ | 2022-03-28 12:07 | - | |
| acer aspire 5584 dismantle/ | 2022-03-28 12:07 | - | |
| acer aspire 5584 graphics card upgradeable/ | 2022-03-28 12:07 | - | |
| acer aspire 5584 heatsink/ | 2022-03-28 12:07 | - | |
| acer aspire 5610-2328 built in web cam/ | 2022-03-28 12:07 | - | |
| acer aspire 5610 4537 memory upgrade/ | 2022-03-28 12:07 | - | |
| acer aspire 5633 bluetooth/ | 2022-03-28 12:07 | - | |
| acer aspire 5633 overheating/ | 2022-03-28 12:07 | - | |
| acer aspire 5672wlmi says i have the wrong battery/ | 2022-03-28 12:07 | - | |
| acer aspire 5672 wont boot/ | 2022-03-28 12:07 | - | |
| acer aspire 5715z/ | 2022-03-28 12:07 | - | |
| acer aspire 5720... is it any good/ | 2022-03-28 12:08 | - | |
| acer aspire 5720/ | 2022-03-28 12:08 | - | |
| acer aspire 5720Z major problems/ | 2022-03-28 12:08 | - | |
| acer aspire 5720 gpu questions/ | 2022-03-28 12:08 | - | |
| acer aspire 5720z hard drive usage/ | 2022-03-28 12:08 | - | |
| acer aspire 5735z screen and battery trouble/ | 2022-03-28 12:08 | - | |
| acer aspire 5738ZG/ | 2022-03-28 12:08 | - | |
| acer aspire 5738ZG OS problem/ | 2022-03-28 12:08 | - | |
| acer aspire 5738z eGPU/ | 2022-03-28 12:08 | - | |
| acer aspire 5738z webcam problem/ | 2022-03-28 12:08 | - | |
| acer aspire 5740G microphone problem/ | 2022-03-28 12:08 | - | |
| acer aspire 5740g BIOS PROBLEM/ | 2022-03-28 12:08 | - | |
| acer aspire 5740g strange problem/ | 2022-03-28 12:08 | - | |
| acer aspire 5741 owners lounge/ | 2022-03-28 12:08 | - | |
| acer aspire 5742 black screen/ | 2022-03-28 12:08 | - | |
| acer aspire 5742 no display problem/ | 2022-03-28 12:08 | - | |
| acer aspire 5745g-6323/ | 2022-03-28 12:08 | - | |
| acer aspire 5810tz-4761/ | 2022-03-28 12:08 | - | |
| acer aspire 5920 beeps/ | 2022-03-28 12:08 | - | |
| acer aspire5920g, dead/ | 2022-03-28 12:09 | - | |
| acer aspire 5920g - DMA failure/ | 2022-03-28 12:08 | - | |
| acer aspire 5920g/ | 2022-03-28 12:08 | - | |
| acer aspire 5920g Call of Duty 4/ | 2022-03-28 12:08 | - | |
| acer aspire 5920g advise to uninstall preinstalled programs/ | 2022-03-28 12:08 | - | |
| acer aspire 5920g tweaks/ | 2022-03-28 12:08 | - | |
| acer aspire 5920 power failure/ | 2022-03-28 12:08 | - | |
| acer aspire 5920 ram upgrade/ | 2022-03-28 12:08 | - | |
| acer aspire 5920 upgrade bios to 3813 and problem with the last driver of nvidia geforce 8600 gs/ | 2022-03-28 12:08 | - | |
| acer aspire 5930G HELP!!!!/ | 2022-03-28 12:08 | - | |
| acer aspire 5935g - bluray driver problem/ | 2022-03-28 12:08 | - | |
| acer aspire 6530g wont power on at all/ | 2022-03-28 12:08 | - | |
| acer aspire 6920 bios 1.16moded flashing/ | 2022-03-28 12:08 | - | |
| acer aspire 6920g conflicts/ | 2022-03-28 12:08 | - | |
| acer aspire 6920 turning off randomly/ | 2022-03-28 12:08 | - | |
| acer aspire 6930Z power on/ | 2022-03-28 12:08 | - | |
| acer aspire 6930g/ | 2022-03-28 12:08 | - | |
| acer aspire 6930g upgrate ati 4650 ddr3/ | 2022-03-28 12:08 | - | |
| acer aspire 6930 to 6930g mobo swap/ | 2022-03-28 12:08 | - | |
| acer aspire 6930 won't boot/ | 2022-03-28 12:08 | - | |
| acer aspire 6935/ | 2022-03-28 12:08 | - | |
| acer aspire 6935g 8930g questions/ | 2022-03-28 12:08 | - | |
| acer aspire 7004wsmi/ | 2022-03-28 12:08 | - | |
| acer aspire 7520-5185 CPU %100! help/ | 2022-03-28 12:08 | - | |
| acer aspire 7520 battery problem/ | 2022-03-28 12:08 | - | |
| acer aspire 7520 custom drill hole question for overheating/ | 2022-03-28 12:08 | - | |
| acer aspire 7530/ | 2022-03-28 12:08 | - | |
| acer aspire 7551-3464 's/ | 2022-03-28 12:08 | - | |
| acer aspire 7552g problem/ | 2022-03-28 12:08 | - | |
| acer aspire 7720 and hard drive capacity/ | 2022-03-28 12:08 | - | |
| acer aspire 7720 audio issues/ | 2022-03-28 12:08 | - | |
| acer aspire 7720g bios update to enable intel virtualization technology/ | 2022-03-28 12:08 | - | |
| acer aspire 7730/ | 2022-03-28 12:08 | - | |
| acer aspire 7730 gfx/ | 2022-03-28 12:08 | - | |
| acer aspire 7730 hdd connector/ | 2022-03-28 12:08 | - | |
| acer aspire 7735zg crystaleye webcam driver/ | 2022-03-28 12:08 | - | |
| acer aspire 7736G help!/ | 2022-03-28 12:08 | - | |
| acer aspire 7740zg/ | 2022-03-28 12:08 | - | |
| acer aspire 8530g sees very poor ram/ | 2022-03-28 12:08 | - | |
| acer aspire 8730z/ | 2022-03-28 12:08 | - | |
| acer aspire 8930G Bios rollack/ | 2022-03-28 12:08 | - | |
| acer aspire 8930G install xp/ | 2022-03-28 12:08 | - | |
| acer aspire 8942G keys/ | 2022-03-28 12:08 | - | |
| acer aspire 9410 screen problems/ | 2022-03-28 12:08 | - | |
| acer aspire 9410z is connected to the internet but can't display the webpage/ | 2022-03-28 12:08 | - | |
| acer aspire 9815wkhi bios virtualization mod request/ | 2022-03-28 12:08 | - | |
| acer aspire AS5002WLMI drive bay battery/ | 2022-03-28 12:08 | - | |
| acer aspire AS9504/ | 2022-03-28 12:08 | - | |
| acer aspire V3 771G/ | 2022-03-28 12:08 | - | |
| acer aspire compatable motherboards/ | 2022-03-28 12:08 | - | |
| acer aspire cpu and video card upgrade/ | 2022-03-28 12:08 | - | |
| acer aspire freezing up/ | 2022-03-28 12:08 | - | |
| acer aspire help/ | 2022-03-28 12:08 | - | |
| acer aspire laptop buzzing noise ear phones/ | 2022-03-28 12:08 | - | |
| acer aspire m5 - cd drive won't read disks/ | 2022-03-28 12:08 | - | |
| acer aspire mouse problems/ | 2022-03-28 12:08 | - | |
| acer aspire not recognizing ram/ | 2022-03-28 12:08 | - | |
| acer aspire one... totally screwed it up/ | 2022-03-28 12:08 | - | |
| acer aspire one A052H (PLEASE HELP)/ | 2022-03-28 12:08 | - | |
| acer aspire one D150-1165 graphics/ | 2022-03-28 12:08 | - | |
| acer aspire one driver help/ | 2022-03-28 12:08 | - | |
| acer aspire one problems - 1 year warranty/ | 2022-03-28 12:08 | - | |
| acer aspire one screen res. problem/ | 2022-03-28 12:08 | - | |
| acer aspire one touch pad isue/ | 2022-03-28 12:08 | - | |
| acer aspire one with aaxa m2 led projector/ | 2022-03-28 12:08 | - | |
| acer aspire one wont boot/ | 2022-03-28 12:08 | - | |
| acer aspire question/ | 2022-03-28 12:08 | - | |
| acer aspire recovery dvd/ | 2022-03-28 12:08 | - | |
| acer aspire screen going white/ | 2022-03-28 12:08 | - | |
| acer aspire screen problem/ | 2022-03-28 12:08 | - | |
| acer aspire v5/ | 2022-03-28 12:08 | - | |
| acer aspire v15 keyboard/ | 2022-03-28 12:08 | - | |
| acer aspiron 5050 power issue/ | 2022-03-28 12:09 | - | |
| acer athlon duo on HD/ | 2022-03-28 12:09 | - | |
| acer backspin billards comes with a trojan/ | 2022-03-28 12:09 | - | |
| acer being sold through futureshop (a subsidiary of bestbuy in canada)/ | 2022-03-28 12:09 | - | |
| acer big boy the bomb/ | 2022-03-28 12:09 | - | |
| acer blue screen !!!!!!!!!! 0x000000f4/ | 2022-03-28 12:09 | - | |
| acer blue screen/ | 2022-03-28 12:09 | - | |
| acer c100 tablet with no restore cds/ | 2022-03-28 12:09 | - | |
| acer c300 wi-fi trouble/ | 2022-03-28 12:09 | - | |
| acer cashback/ | 2022-03-28 12:09 | - | |
| acer charging problems/ | 2022-03-28 12:09 | - | |
| acer crystal eye webcam!!!/ | 2022-03-28 12:09 | - | |
| acer crystal eye web cam compatible with windows 7/ | 2022-03-28 12:09 | - | |
| acer d250 no display until windows loads/ | 2022-03-28 12:09 | - | |
| acer differences/ | 2022-03-28 12:09 | - | |
| acer disk formatter cd iso image NEEDED/ | 2022-03-28 12:09 | - | |
| acer drive formats/ | 2022-03-28 12:09 | - | |
| acer driver check/ | 2022-03-28 12:09 | - | |
| acer driver help/ | 2022-03-28 12:09 | - | |
| acer dynavivid graphic dock/ | 2022-03-28 12:09 | - | |
| acer e-recovery/ | 2022-03-28 12:09 | - | |
| acer ePerformance on aspire 3003/ | 2022-03-28 12:09 | - | |
| acer eRecovery/ | 2022-03-28 12:09 | - | |
| acer empowering framework 2.5/ | 2022-03-28 12:09 | - | |
| acer empower technolog for acer aspire 5920g has a lot of problems with other software programs/ | 2022-03-28 12:09 | - | |
| acer empower technology software for acer aspire 5920g/ | 2022-03-28 12:09 | - | |
| acer empwering technology framework unable to launch/ | 2022-03-28 12:09 | - | |
| acer erecovery help/ | 2022-03-28 12:09 | - | |
| acer erecovery management issue/ | 2022-03-28 12:09 | - | |
| acer erecovery not installed/ | 2022-03-28 12:09 | - | |
| acer extensa4220 problems/ | 2022-03-28 12:09 | - | |
| acer extensa 4220 upgrade to t2390/ | 2022-03-28 12:09 | - | |
| acer extensa 4420-5910 help/ | 2022-03-28 12:09 | - | |
| acer extensa 4420-5963 cpu swap/ | 2022-03-28 12:09 | - | |
| acer extensa 4420/ | 2022-03-28 12:09 | - | |
| acer extensa 4420 laptop problem staring up/ | 2022-03-28 12:09 | - | |
| acer extensa 4620z screen replacement problems/ | 2022-03-28 12:09 | - | |
| acer extensa 4630z bios problem/ | 2022-03-28 12:09 | - | |
| acer extensa 4630z wlan and bluetooth switches not working/ | 2022-03-28 12:09 | - | |
| acer extensa 5210/ | 2022-03-28 12:09 | - | |
| acer extensa 5220 powers on only with battery but wont charge either/ | 2022-03-28 12:09 | - | |
| acer extensa 5235 fault . help needed/ | 2022-03-28 12:09 | - | |
| acer extensa 5420 problem/ | 2022-03-28 12:09 | - | |
| acer extensa 5620-4801/ | 2022-03-28 12:09 | - | |
| acer extensa 5620/ | 2022-03-28 12:09 | - | |
| acer extensa 5620 and bios upgrade 1.31/ | 2022-03-28 12:09 | - | |
| acer extensa 5620 os reinstall issues/ | 2022-03-28 12:09 | - | |
| acer extensa 5620 queries/ | 2022-03-28 12:09 | - | |
| acer extensa 5635g/ | 2022-03-28 12:09 | - | |
| acer fanless with eSATA/ | 2022-03-28 12:09 | - | |
| acer ferrari 200/ | 2022-03-28 12:09 | - | |
| acer ferrari 1004/ | 2022-03-28 12:09 | - | |
| acer ferrari 1004wtmi/ | 2022-03-28 12:09 | - | |
| acer ferrari 4002 - AC adapter Issue/ | 2022-03-28 12:09 | - | |
| acer ferrari 4005 comments/ | 2022-03-28 12:09 | - | |
| acer ferrari netbook hdmi/ | 2022-03-28 12:09 | - | |
| acer ferrari one. 32 or 64 bit/ | 2022-03-28 12:09 | - | |
| acer ferrari turning off randomly/ | 2022-03-28 12:09 | - | |
| acer free upgrade/ | 2022-03-28 12:09 | - | |
| acer gaming laptop predator 21x/ | 2022-03-28 12:09 | - | |
| acer grief/ | 2022-03-28 12:09 | - | |
| acer hard drive question/ | 2022-03-28 12:09 | - | |
| acer hard drive speeds/ | 2022-03-28 12:09 | - | |
| acer help/ | 2022-03-28 12:09 | - | |
| acer hidden partition/ | 2022-03-28 12:09 | - | |
| acer international warranty question/ | 2022-03-28 12:09 | - | |
| acer inverter broken/ | 2022-03-28 12:09 | - | |
| acer is shipping my laptop back/ | 2022-03-28 12:09 | - | |
| acer keyboards quality/ | 2022-03-28 12:09 | - | |
| acer laptop - battery life/ | 2022-03-28 12:09 | - | |
| acer laptop/ | 2022-03-28 12:09 | - | |
| acer laptop buying ideas/ | 2022-03-28 12:09 | - | |
| acer laptop cannot startup in any mode, says automatic repair, help !/ | 2022-03-28 12:09 | - | |
| acer laptop help/ | 2022-03-28 12:09 | - | |
| acer laptop making noise/ | 2022-03-28 12:09 | - | |
| acer laptop model 3100-1718 Cmos Battery/ | 2022-03-28 12:09 | - | |
| acer laptop upgrades/ | 2022-03-28 12:09 | - | |
| acer launch manager for windows 7/ | 2022-03-28 12:09 | - | |
| acer mammoths/ | 2022-03-28 12:09 | - | |
| acer media bay 2nd hdd module bracket caddy/ | 2022-03-28 12:09 | - | |
| acer netbook for $100/ | 2022-03-28 12:09 | - | |
| acer noisy hards/ | 2022-03-28 12:09 | - | |
| acer noob questions/ | 2022-03-28 12:09 | - | |
| acer notebook first timer aspire 1410/ | 2022-03-28 12:09 | - | |
| acernote light/ | 2022-03-28 12:10 | - | |
| acer one black camera/ | 2022-03-28 12:09 | - | |
| acer one flash bios/ | 2022-03-28 12:09 | - | |
| acer one keyboard problem/ | 2022-03-28 12:09 | - | |
| acer orbicam 5610-2328 problems/ | 2022-03-28 12:09 | - | |
| acer orbicam troubleshoot,i can make a get picture option/ | 2022-03-28 12:09 | - | |
| acer orbit cam/ | 2022-03-28 12:09 | - | |
| acer power inlet/ | 2022-03-28 12:09 | - | |
| acer power problems/ | 2022-03-28 12:09 | - | |
| acer power smart manager and 3810TZ/ | 2022-03-28 12:09 | - | |
| acer pqservice/ | 2022-03-28 12:09 | - | |
| acer recovery and windows re-installation/ | 2022-03-28 12:09 | - | |
| acer reformat from partition/ | 2022-03-28 12:09 | - | |
| acer repair in Dubai, UAE/ | 2022-03-28 12:09 | - | |
| acer revo 1600 updating bios/ | 2022-03-28 12:09 | - | |
| acer screen/ | 2022-03-28 12:09 | - | |
| acer screens/ | 2022-03-28 12:09 | - | |
| acer screensaver/ | 2022-03-28 12:09 | - | |
| acer service manual/ | 2022-03-28 12:09 | - | |
| acer software/ | 2022-03-28 12:09 | - | |
| acer speaker problem/ | 2022-03-28 12:09 | - | |
| acer standard warranty doesn't cover non-working trackpad/ | 2022-03-28 12:09 | - | |
| acer sucks/ | 2022-03-28 12:09 | - | |
| acer tavelmate 2410 bios password problem/ | 2022-03-28 12:09 | - | |
| acer tavelmate 8200 help/ | 2022-03-28 12:09 | - | |
| acer timeline (3810t 4810t 5810t) blue tint screen/ | 2022-03-28 12:09 | - | |
| acer timeline 3810t XP battery usage/ | 2022-03-28 12:09 | - | |
| acer timeline 4810 touch pad question/ | 2022-03-28 12:09 | - | |
| acer timeline laptops - white noise question/ | 2022-03-28 12:09 | - | |
| acer timeline m3/ | 2022-03-28 12:09 | - | |
| acer timelinex 4820tg ram upgrade BSD problem with Kingston/ | 2022-03-28 12:09 | - | |
| acer tm 204 fan problem/ | 2022-03-28 12:09 | - | |
| acer tm2300 battery problem/ | 2022-03-28 12:09 | - | |
| acer tm8204 verses tm8205/ | 2022-03-28 12:10 | - | |
| acer tmc301xci hinge trouble/ | 2022-03-28 12:10 | - | |
| acer travelmate 270 and 530/ | 2022-03-28 12:10 | - | |
| acer travel mate 290 bluetooth/ | 2022-03-28 12:10 | - | |
| acer travelmate 290 keyboard replacement/ | 2022-03-28 12:10 | - | |
| acer travelmate 800 display problem/ | 2022-03-28 12:10 | - | |
| acer travelmate 2200/ | 2022-03-28 12:10 | - | |
| acer travelmate 2200 bios/ | 2022-03-28 12:10 | - | |
| acer travelmate2200 bios update/ | 2022-03-28 12:10 | - | |
| acer travelmate 2200 power issue/ | 2022-03-28 12:10 | - | |
| acer travel mate 2300 black screen/ | 2022-03-28 12:10 | - | |
| acer travelmate 2300 processor upgrade/ | 2022-03-28 12:10 | - | |
| acer travelmate 2303LCi/ | 2022-03-28 12:10 | - | |
| acer travelmate 2303L ci/ | 2022-03-28 12:10 | - | |
| acer travelmate 2420 issue/ | 2022-03-28 12:10 | - | |
| acer travelmate 2420 whashed out picture/ | 2022-03-28 12:10 | - | |
| acer travelmate 2440/ | 2022-03-28 12:10 | - | |
| acer travelmate 2500 wireless antenna/ | 2022-03-28 12:10 | - | |
| acer travelmate 2700/ | 2022-03-28 12:10 | - | |
| acer travelmate 2702wlmi bluetooth!!!/ | 2022-03-28 12:10 | - | |
| acer travelmate 3000 series REVIEW (3004WTMi)/ | 2022-03-28 12:10 | - | |
| acer travelmate 4002 usb boot/ | 2022-03-28 12:10 | - | |
| acer travelmate 4002wlmi/ | 2022-03-28 12:10 | - | |
| acer travelmate 4010 power button blinking orange and green/ | 2022-03-28 12:10 | - | |
| acer travelmate 4021 or 4020/ | 2022-03-28 12:10 | - | |
| acer travelmate 4050/ | 2022-03-28 12:10 | - | |
| acer travelmate 4060/ | 2022-03-28 12:10 | - | |
| acer travelmate 4102WLMi/ | 2022-03-28 12:10 | - | |
| acer travelmate 4150/ | 2022-03-28 12:10 | - | |
| acer travelmate 4230 touchpad problems/ | 2022-03-28 12:10 | - | |
| acer travelmate 4280 data interface driver/ | 2022-03-28 12:10 | - | |
| acer travelmate 5720 tv-out `/ | 2022-03-28 12:10 | - | |
| acer travelmate 5730/ | 2022-03-28 12:10 | - | |
| acer travelmate 6293 hangs up/ | 2022-03-28 12:10 | - | |
| acer travelmate 8210 problems/ | 2022-03-28 12:10 | - | |
| acer travelmate 8571 freezing/ | 2022-03-28 12:10 | - | |
| acer travelmate 8572g freezes on sleep/ | 2022-03-28 12:10 | - | |
| acer travel mete bios dead please help/ | 2022-03-28 12:10 | - | |
| acer triton 700 gtx 1060 battery is charging slow/ | 2022-03-28 12:10 | - | |
| acer tuba making nasty noises/ | 2022-03-28 12:10 | - | |
| acer users , how du u update your radeon drivers/ | 2022-03-28 12:10 | - | |
| acer vantage gardian extended warranty/ | 2022-03-28 12:10 | - | |
| acerwarranty.co.uk/ | 2022-03-28 12:10 | - | |
| acer warranty turnaround/ | 2022-03-28 12:10 | - | |
| acer warrany inquiry/ | 2022-03-28 12:10 | - | |
| acer web cam/ | 2022-03-28 12:10 | - | |
| acer webcam corrupted or missing!/ | 2022-03-28 12:10 | - | |
| acer windows language/ | 2022-03-28 12:10 | - | |
| acer with a matte screen/ | 2022-03-28 12:10 | - | |
| acer wont charge/ | 2022-03-28 12:10 | - | |
| acer zg8 cleaning info off before sale of netbook/ | 2022-03-28 12:10 | - | |
| a common question I think...location of 5920G XP drivers/ | 2022-03-28 12:05 | - | |
| a couple of upgrade questions for 5290g/ | 2022-03-28 12:05 | - | |
| acronis can't boot on acer!/ | 2022-03-28 12:10 | - | |
| activate bluetooth device on acer aspire 9304WSMi/ | 2022-03-28 12:10 | - | |
| activating webcam/ | 2022-03-28 12:10 | - | |
| add a 2nd HD to Acer TM8000/ | 2022-03-28 12:10 | - | |
| adding SDD to old Acer 3810tz/ | 2022-03-28 12:10 | - | |
| adding bluetooth module to acer 3003/ | 2022-03-28 12:10 | - | |
| adding bluetooth to 8920g/ | 2022-03-28 12:10 | - | |
| advice on a 5500, plz help/ | 2022-03-28 12:10 | - | |
| advice on aspire 5500 (I'm considering buying one)/ | 2022-03-28 12:10 | - | |
| a few Acer Ferrari 3400 question.. help ya/ | 2022-03-28 12:05 | - | |
| a few questions about Acer 8930g/ | 2022-03-28 12:05 | - | |
| a few questions on the acer 8930/ | 2022-03-28 12:05 | - | |
| agent.exe/ | 2022-03-28 12:10 | - | |
| air vents thin laptops/ | 2022-03-28 12:10 | - | |
| all games not in full resolution on aspire 5672/ | 2022-03-28 12:10 | - | |
| alt+f10 not working PLEASE HELP/ | 2022-03-28 12:10 | - | |
| amd c-50 overclocking and 6250/ | 2022-03-28 12:10 | - | |
| a newbie question/ | 2022-03-28 12:05 | - | |
| annoying fool mis-advertises laptop (video)/ | 2022-03-28 12:10 | - | |
| annoying pause during boot-up/ | 2022-03-28 12:10 | - | |
| a notebook with Cyrillic characters/ | 2022-03-28 12:05 | - | |
| any 3810s (TZ) with Windows 7/ | 2022-03-28 12:10 | - | |
| any AS7552G-5107 or similar model users/ | 2022-03-28 12:10 | - | |
| any Acer Travelmate 8481 successor/ | 2022-03-28 12:10 | - | |
| any acer aspire 6920g owners undervolt before/ | 2022-03-28 12:10 | - | |
| any acer notebook with merom processors 4mb cache in the us/ | 2022-03-28 12:10 | - | |
| any copper mod for Acer/ | 2022-03-28 12:10 | - | |
| any good Acer authorized re sellers/ | 2022-03-28 12:10 | - | |
| any hidden bios/ | 2022-03-28 12:10 | - | |
| any idea/ | 2022-03-28 12:10 | - | |
| any luck on a sandybridge refresh of 11 timelineX/ | 2022-03-28 12:10 | - | |
| any merom news/ | 2022-03-28 12:10 | - | |
| any news on 6930/ | 2022-03-28 12:10 | - | |
| any offers for my turion tl-50 cpu/ | 2022-03-28 12:10 | - | |
| anyone know if the dual drive s3 has two physical drives or is the 20gb ssd on board/ | 2022-03-28 12:10 | - | |
| anyone know where i can find a laptop sleeve for my acer aspire 4810tz/ | 2022-03-28 12:10 | - | |
| anyone know where to get an Acer 5112/ | 2022-03-28 12:10 | - | |
| anyone out there using a TM4202wlmi/ | 2022-03-28 12:10 | - | |
| any one succesful with BT headset and skype on Win7 1810TZ/ | 2022-03-28 12:10 | - | |
| anyone that can help with my bios would be gretly appreciated/ | 2022-03-28 12:10 | - | |
| anyone use hdmi/ | 2022-03-28 12:10 | - | |
| any plan for successor of 1830T/ | 2022-03-28 12:10 | - | |
| any problems if putting laptop away after use/ | 2022-03-28 12:10 | - | |
| any views on the 64bit 1500 series/ | 2022-03-28 12:10 | - | |
| any way to configure 5920G remote/ | 2022-03-28 12:10 | - | |
| anyway to remove all the Acer bloatware/ | 2022-03-28 12:10 | - | |
| anywhere to buy acer cheap/ | 2022-03-28 12:10 | - | |
| a problem about my dvd driver in 5930g/ | 2022-03-28 12:05 | - | |
| a problem regarding AS5672 WLMi/ | 2022-03-28 12:05 | - | |
| a real 5920 review/ | 2022-03-28 12:05 | - | |
| are the 5720G's as upgrade friendly as the 5920G's/ | 2022-03-28 12:10 | - | |
| are the aspire 1642 and 1642z mainboards interchangeable/ | 2022-03-28 12:10 | - | |
| are there any acer 1691 1694 close-looks/ | 2022-03-28 12:10 | - | |
| as1410 screen issue/ | 2022-03-28 12:10 | - | |
| as1410 webcam help please!/ | 2022-03-28 12:10 | - | |
| as5002 sound only on left speaker/ | 2022-03-28 12:10 | - | |
| ask about acer upgrade kit/ | 2022-03-28 12:10 | - | |
| asoire's 7738g GT 240M problem/ | 2022-03-28 12:10 | - | |
| asphire 1681WLCi usb problem/ | 2022-03-28 12:10 | - | |
| aspire 20XX - wanna email button blinking/ | 2022-03-28 12:10 | - | |
| aspire 1350/ | 2022-03-28 12:10 | - | |
| aspire 1350 drivers/ | 2022-03-28 12:10 | - | |
| aspire 1414 - ERROR, resource conflict/ | 2022-03-28 12:10 | - | |
| aspire 1511- anybody using it/ | 2022-03-28 12:10 | - | |
| aspire 1524 wlmi vs 1691 wlmi/ | 2022-03-28 12:10 | - | |
| aspire 1642 bios update/ | 2022-03-28 12:10 | - | |
| aspire 1670 faulty power jack/ | 2022-03-28 12:10 | - | |
| aspire 1680 usb power surge when plugging in ac/ | 2022-03-28 12:10 | - | |
| aspire 1681 refurb opinion/ | 2022-03-28 12:10 | - | |
| aspire 1690 system disc/ | 2022-03-28 12:10 | - | |
| aspire 1692wlmi problem/ | 2022-03-28 12:10 | - | |
| aspire 1694wlmi terribly noisy!/ | 2022-03-28 12:10 | - | |
| aspire 1804/ | 2022-03-28 12:10 | - | |
| aspire 1804wsmi bios password locked/ | 2022-03-28 12:10 | - | |
| aspire 2010 startup problem/ | 2022-03-28 12:10 | - | |
| aspire 2012 fan wierdness/ | 2022-03-28 12:10 | - | |
| aspire 2025- touchpad and hard drive question/ | 2022-03-28 12:10 | - | |
| aspire 2930z motherboard dead/ | 2022-03-28 12:10 | - | |
| aspire 3000 HD interface/ | 2022-03-28 12:10 | - | |
| aspire 3000 is sick (help)/ | 2022-03-28 12:10 | - | |
| aspire3000 keyboard-battery problem/ | 2022-03-28 12:11 | - | |
| aspire 3002 memory/ | 2022-03-28 12:10 | - | |
| aspire 3003lci/ | 2022-03-28 12:10 | - | |
| aspire 3050 problems/ | 2022-03-28 12:10 | - | |
| aspire 3100 not powering up/ | 2022-03-28 12:10 | - | |
| aspire 3610- wiped harddrive, installed XP Pro, no power management/ | 2022-03-28 12:10 | - | |
| aspire 3620 bios/ | 2022-03-28 12:10 | - | |
| aspire 3623/ | 2022-03-28 12:10 | - | |
| aspire 3630 external keyboard problems/ | 2022-03-28 12:10 | - | |
| aspire 3660 series bluetooth help ! ! !/ | 2022-03-28 12:10 | - | |
| aspire 3662wlmi battery fault/ | 2022-03-28 12:10 | - | |
| aspire3680-2626 no spdif output/ | 2022-03-28 12:11 | - | |
| aspire 3680 not compatible with YM/ | 2022-03-28 12:10 | - | |
| aspire 3680 reformat trouble/ | 2022-03-28 12:10 | - | |
| aspire 3680 service manual/ | 2022-03-28 12:10 | - | |
| aspire 3680 unable to recover system/ | 2022-03-28 12:10 | - | |
| aspire 3680 with broadcom wireless in XP/ | 2022-03-28 12:10 | - | |
| aspire 3682 won't boot/ | 2022-03-28 12:10 | - | |
| aspire 3690- orbicam troubleshooting and software conflict/ | 2022-03-28 12:10 | - | |
| aspire 3690 camara driver/ | 2022-03-28 12:10 | - | |
| aspire 4520-5846/ | 2022-03-28 12:10 | - | |
| aspire 4530 camera problem/ | 2022-03-28 12:10 | - | |
| aspire 4530 volume wheel dosent work/ | 2022-03-28 12:10 | - | |
| aspire 4535G black screen/ | 2022-03-28 12:10 | - | |
| aspire 4710 hibernate problem.HELP/ | 2022-03-28 12:10 | - | |
| aspire 4715z 4315 series/ | 2022-03-28 12:10 | - | |
| aspire 4720z, drivers problems/ | 2022-03-28 12:10 | - | |
| aspire 4720z problem installing drivers/ | 2022-03-28 12:10 | - | |
| aspire 4730Z fan issue/ | 2022-03-28 12:10 | - | |
| aspire 4730z - computer chump needs advice/ | 2022-03-28 12:10 | - | |
| aspire 4736z bluetooth/ | 2022-03-28 12:10 | - | |
| aspire 4736z wlan issues/ | 2022-03-28 12:10 | - | |
| aspire 4937g WWAN compatible/ | 2022-03-28 12:10 | - | |
| aspire 4937 keyboard/ | 2022-03-28 12:10 | - | |
| aspire 5002/ | 2022-03-28 12:10 | - | |
| aspire 5002 64bit drivers/ | 2022-03-28 12:10 | - | |
| aspire 5003 battery problem/ | 2022-03-28 12:10 | - | |
| aspire 5020 motherboard repair/ | 2022-03-28 12:10 | - | |
| aspire 5024 temp fluctuating/ | 2022-03-28 12:10 | - | |
| aspire 5044 bluetooth issue/ | 2022-03-28 12:10 | - | |
| aspire 5052/ | 2022-03-28 12:10 | - | |
| aspire 5100 - recovery failed/ | 2022-03-28 12:10 | - | |
| aspire 5100 CD DVD drive/ | 2022-03-28 12:10 | - | |
| aspire 5100 bios conflic/ | 2022-03-28 12:10 | - | |
| aspire 5100 blue screen/ | 2022-03-28 12:10 | - | |
| aspire 5100 lags on every game/ | 2022-03-28 12:10 | - | |
| aspire 5100 memory stick/ | 2022-03-28 12:10 | - | |
| aspire 5102wlmi crashes on XP splash screen during start up HELP!!!!!!/ | 2022-03-28 12:10 | - | |
| aspire 5102 wlmi usb problems/ | 2022-03-28 12:10 | - | |
| aspire 5315 battery 11.1v/ | 2022-03-28 12:10 | - | |
| aspire 5315 boot problem/ | 2022-03-28 12:10 | - | |
| aspire 5315 mic problem/ | 2022-03-28 12:10 | - | |
| aspire 5315 recovery !/ | 2022-03-28 12:10 | - | |
| aspire 5315 recovery help/ | 2022-03-28 12:10 | - | |
| aspire 5315 speakers/ | 2022-03-28 12:10 | - | |
| aspire 5315 webcam msn/ | 2022-03-28 12:10 | - | |
| aspire 5335-2238 reset/ | 2022-03-28 12:10 | - | |
| aspire 5502Z sound driver for XP does not install/ | 2022-03-28 12:10 | - | |
| aspire 5504 drive/ | 2022-03-28 12:10 | - | |
| aspire 5515 to tv/ | 2022-03-28 12:10 | - | |
| aspire 5520G-graphics upgrade/ | 2022-03-28 12:10 | - | |
| aspire 5520 sound problem/ | 2022-03-28 12:10 | - | |
| aspire 5532 choppy mkv playback/ | 2022-03-28 12:10 | - | |
| aspire 5532 webcam/ | 2022-03-28 12:10 | - | |
| aspire 5538 heat issue/ | 2022-03-28 12:10 | - | |
| aspire 5570z/ | 2022-03-28 12:10 | - | |
| aspire 5590 and 5680 release dates/ | 2022-03-28 12:10 | - | |
| aspire 5610Z ethernet and network controller .inf or .exe missing for driver install/ | 2022-03-28 12:11 | - | |
| aspire 5610z front lights/ | 2022-03-28 12:11 | - | |
| aspire 5670 complaints/ | 2022-03-28 12:11 | - | |
| aspire 5670 dvd burner/ | 2022-03-28 12:11 | - | |
| aspire 5670 full cover ! please help/ | 2022-03-28 12:11 | - | |
| aspire 5672WLMi + War3 DOTA error/ | 2022-03-28 12:11 | - | |
| aspire 5672 and linux/ | 2022-03-28 12:11 | - | |
| aspire 5672 keyboard problem/ | 2022-03-28 12:11 | - | |
| aspire 5672 prob/ | 2022-03-28 12:11 | - | |
| aspire 5672 screen whine/ | 2022-03-28 12:11 | - | |
| aspire 5672 sound prob/ | 2022-03-28 12:11 | - | |
| aspire 5672 why is tv out not working/ | 2022-03-28 12:11 | - | |
| aspire 5720/ | 2022-03-28 12:11 | - | |
| aspire 5730 = aspire 5735/ | 2022-03-28 12:11 | - | |
| aspire 5730zg problem/ | 2022-03-28 12:11 | - | |
| aspire 5732z/ | 2022-03-28 12:11 | - | |
| aspire 5735 help/ | 2022-03-28 12:11 | - | |
| aspire 5741g recovery problem/ | 2022-03-28 12:11 | - | |
| aspire5745G motherboard/ | 2022-03-28 12:11 | - | |
| aspire 5750g serious problem/ | 2022-03-28 12:11 | - | |
| aspire 5920-302G16N/ | 2022-03-28 12:11 | - | |
| aspire 5920-6990 downgrade to windows XP/ | 2022-03-28 12:11 | - | |
| aspire 5920g GPU/ | 2022-03-28 12:11 | - | |
| aspire 5920g upgrade help! is it worth it/ | 2022-03-28 12:11 | - | |
| aspire 5920g white monitor and black lines/ | 2022-03-28 12:11 | - | |
| aspire 5920 insides pictures wanted/ | 2022-03-28 12:11 | - | |
| aspire 5920 screen is black/ | 2022-03-28 12:11 | - | |
| aspire 5920 to 5920g compatability/ | 2022-03-28 12:11 | - | |
| aspire 6920G video playback/ | 2022-03-28 12:11 | - | |
| aspire 6920 fingerprint reader/ | 2022-03-28 12:11 | - | |
| aspire 6920g graphics question/ | 2022-03-28 12:11 | - | |
| aspire 6920g screen upgrade/ | 2022-03-28 12:11 | - | |
| aspire 6920 problems fixed/ | 2022-03-28 12:11 | - | |
| aspire 6920 series battery rebuild reset/ | 2022-03-28 12:11 | - | |
| aspire 6930G/ | 2022-03-28 12:11 | - | |
| aspire 6930g running t7700 cpu and radeon hd 4650/ | 2022-03-28 12:11 | - | |
| aspire 6930z has preinstalled bluetooth software but no hardware/ | 2022-03-28 12:11 | - | |
| aspire 6935G - unlock bios settings/ | 2022-03-28 12:11 | - | |
| aspire 6935g won't boot/ | 2022-03-28 12:11 | - | |
| aspire 7520 and Empowering technology/ | 2022-03-28 12:11 | - | |
| aspire 7520 came back a 7220/ | 2022-03-28 12:11 | - | |
| aspire 7520g unlocked bios/ | 2022-03-28 12:11 | - | |
| aspire 7530g/ | 2022-03-28 12:11 | - | |
| aspire 7535g/ | 2022-03-28 12:11 | - | |
| aspire 7535g 2nd hdd/ | 2022-03-28 12:11 | - | |
| aspire 7552g wireless network problems/ | 2022-03-28 12:11 | - | |
| aspire 7720 High capacity battery/ | 2022-03-28 12:11 | - | |
| aspire 8730g device manager updates/ | 2022-03-28 12:11 | - | |
| aspire 8920 series/ | 2022-03-28 12:11 | - | |
| aspire 8920 startup problem/ | 2022-03-28 12:11 | - | |
| aspire 8930g charging problem/ | 2022-03-28 12:11 | - | |
| aspire 8930g microphone problem/ | 2022-03-28 12:11 | - | |
| aspire 8942g, what's the max cpu it can take/ | 2022-03-28 12:11 | - | |
| aspire 9300 drivers needed (installed XP64 instead of Vista)/ | 2022-03-28 12:11 | - | |
| aspire 9300 locked overclock/ | 2022-03-28 12:11 | - | |
| aspire 9303wsmi/ | 2022-03-28 12:11 | - | |
| aspire 9410-2597 upgrading help/ | 2022-03-28 12:11 | - | |
| aspire 9410 bios settings/ | 2022-03-28 12:11 | - | |
| aspire 9410z problem..plz help/ | 2022-03-28 12:11 | - | |
| aspire 9502 self-restart/ | 2022-03-28 12:11 | - | |
| aspire 9510 hard drive upgrade/ | 2022-03-28 12:11 | - | |
| aspire 9810 problem- black screen/ | 2022-03-28 12:11 | - | |
| aspireONE blackscrn, possible GPU overheat/ | 2022-03-28 12:11 | - | |
| aspire S5 , release date/ | 2022-03-28 12:11 | - | |
| aspire V3 771g-9456 question/ | 2022-03-28 12:11 | - | |
| aspire and vista temporary internet files/ | 2022-03-28 12:11 | - | |
| aspire as4530 graphics expandibility/ | 2022-03-28 12:11 | - | |
| aspire battery life/ | 2022-03-28 12:11 | - | |
| aspire notebook 5720 dolby but no bass !/ | 2022-03-28 12:11 | - | |
| aspire one- removing LCD bezel/ | 2022-03-28 12:11 | - | |
| aspire one d250 3 cell battery, who actually gets 3.5 hours ridiculous lie/ | 2022-03-28 12:11 | - | |
| aspire one netbooks pretty rugged/ | 2022-03-28 12:11 | - | |
| aspire one users, is your power button sort of recessed/ | 2022-03-28 12:11 | - | |
| aspire timeline 5810tz won't boot, can't access setup or bios/ | 2022-03-28 12:11 | - | |
| aspre 5650 slowdown/ | 2022-03-28 12:11 | - | |
| asprire 3690/ | 2022-03-28 12:11 | - | |
| atheros ar5006x aspire 3680/ | 2022-03-28 12:11 | - | |
| ati catalyst 6.8 won't install/ | 2022-03-28 12:11 | - | |
| ati mobilityx600 and ati mobility 9700 128mb/ | 2022-03-28 12:11 | - | |
| ati radeon x600 128mbor nvidia 6200 128mb/ | 2022-03-28 12:11 | - | |
| ati x1250 mobility driver/ | 2022-03-28 12:11 | - | |
| audio jacked up/ | 2022-03-28 12:11 | - | |
| audio problem on aspire 7720zg (choppy sound)/ | 2022-03-28 12:11 | - | |
| audio problems/ | 2022-03-28 12:11 | - | |
| autoplay problem on 5920/ | 2022-03-28 12:11 | - | |
| b Acer Travelmate 5740 Motherboard Power Connector/ | 2022-03-28 12:11 | - | |
| backlight keeps turning off (8920G)/ | 2022-03-28 12:11 | - | |
| backlit keyboards for aspire 7720 and timeline 4810t/ | 2022-03-28 12:11 | - | |
| backup of original soft/ | 2022-03-28 12:11 | - | |
| bad pixels/ | 2022-03-28 12:11 | - | |
| batery recharging on Acer TM4500/ | 2022-03-28 12:11 | - | |
| battery Cell Problem/ | 2022-03-28 12:11 | - | |
| battery charging issue!/ | 2022-03-28 12:11 | - | |
| battery differences/ | 2022-03-28 12:11 | - | |
| battery for 8204/ | 2022-03-28 12:11 | - | |
| battery for the AOD150/ | 2022-03-28 12:11 | - | |
| battery for zg5/ | 2022-03-28 12:11 | - | |
| battery life, and travelmate 2413WLCI/ | 2022-03-28 12:11 | - | |
| battery wear level wrong/ | 2022-03-28 12:11 | - | |
| beep sounds/ | 2022-03-28 12:11 | - | |
| best bios for aspire 6920g/ | 2022-03-28 12:11 | - | |
| best deals on 3820tg within EU/ | 2022-03-28 12:11 | - | |
| best driver for acer-nvidia 9500m gs/ | 2022-03-28 12:11 | - | |
| best nvidia drivers for AS 6920G 8920g/ | 2022-03-28 12:11 | - | |
| best source for Acer accessories/ | 2022-03-28 12:11 | - | |
| best wireless internet drivers for aspire 5672/ | 2022-03-28 12:11 | - | |
| betrayal!!!/ | 2022-03-28 12:11 | - | |
| better value than the ferrari/ | 2022-03-28 12:11 | - | |
| bigO is back finally... sorry for the absence/ | 2022-03-28 12:11 | - | |
| big XP sound driver problem, on a 5920G/ | 2022-03-28 12:11 | - | |
| bigfrank/ | 2022-03-28 12:11 | - | |
| bio-protection fingerprint reader help please/ | 2022-03-28 12:11 | - | |
| bios 5920G error/ | 2022-03-28 12:11 | - | |
| bios acer 7741 recovery need help/ | 2022-03-28 12:11 | - | |
| bios acer travelmate 2420 v 1.04/ | 2022-03-28 12:11 | - | |
| bios dump file/ | 2022-03-28 12:11 | - | |
| bios going crazy/ | 2022-03-28 12:11 | - | |
| bioshock on 5920 w Intel (GMA) X3100/ | 2022-03-28 12:11 | - | |
| bios mod a 5251 from a Radeon Mobility 4250 to 4290/ | 2022-03-28 12:11 | - | |
| bios mod acer 5920g nx bit/ | 2022-03-28 12:11 | - | |
| bios mod for aspire ao756/ | 2022-03-28 12:11 | - | |
| bios password 8935G/ | 2022-03-28 12:11 | - | |
| bios recovery usb floppy/ | 2022-03-28 12:11 | - | |
| bios update/ | 2022-03-28 12:11 | - | |
| bios update to 1.34/ | 2022-03-28 12:11 | - | |
| bios upgrade for acer travelmate 2200/ | 2022-03-28 12:11 | - | |
| bios upgrade problem with 5610z/ | 2022-03-28 12:11 | - | |
| bison or suyin/ | 2022-03-28 12:11 | - | |
| black dim screen/ | 2022-03-28 12:11 | - | |
| black screen/ | 2022-03-28 12:11 | - | |
| blackscreen alt+f10 failure [noexecute=optin/ | 2022-03-28 12:11 | - | |
| black screen on aspire 5920 -/ | 2022-03-28 12:11 | - | |
| black start menu problem on 8204/ | 2022-03-28 12:11 | - | |
| bloths in 3 corners of my LCD/ | 2022-03-28 12:11 | - | |
| blu-ray not working plz help/ | 2022-03-28 12:11 | - | |
| blue glossy playback on media player/ | 2022-03-28 12:11 | - | |
| bluetooth 6920G can't find device/ | 2022-03-28 12:11 | - | |
| bluetooth acer aspire 6920g/ | 2022-03-28 12:11 | - | |
| bluetooth dongle/ | 2022-03-28 12:11 | - | |
| bluetooth fo my travelmate 4500/ | 2022-03-28 12:11 | - | |
| bluetooth module/ | 2022-03-28 12:11 | - | |
| bluetooth not working/ | 2022-03-28 12:11 | - | |
| bluetooth on 3201XCi/ | 2022-03-28 12:11 | - | |
| bluetooth on acer aspire 6930/ | 2022-03-28 12:11 | - | |
| bluetooth on my timeline 4810 olympic edtion/ | 2022-03-28 12:11 | - | |
| bluetooth problem for TM 4064wlmi/ | 2022-03-28 12:11 | - | |
| bluetooth range/ | 2022-03-28 12:11 | - | |
| bluetooth yes or no. (aspire 6930g)/ | 2022-03-28 12:11 | - | |
| blu ray player knocked out/ | 2022-03-28 12:11 | - | |
| boot-up problem/ | 2022-03-28 12:11 | - | |
| boot/ | 2022-03-28 12:11 | - | |
| bootable installation disk/ | 2022-03-28 12:11 | - | |
| booting from USB for travelmate 290e/ | 2022-03-28 12:11 | - | |
| booting issues after sleeping hibernating - Asire Aspire 4810TZ/ | 2022-03-28 12:11 | - | |
| bootmgr missing on brand new laptop/ | 2022-03-28 12:11 | - | |
| boot problem with 5672/ | 2022-03-28 12:11 | - | |
| bought a geforce go 6600 to downgrade from 8600m gs doesn't boot though/ | 2022-03-28 12:11 | - | |
| brand new 4504LMi with high pitched whine/ | 2022-03-28 12:11 | - | |
| brand new laptop, very slow ! !/ | 2022-03-28 12:11 | - | |
| broken DC jack on AA1's/ | 2022-03-28 12:11 | - | |
| broken hinges on my acer travelmate 4150/ | 2022-03-28 12:11 | - | |
| browsing Acers--terrible website/ | 2022-03-28 12:11 | - | |
| bt (Unknown Device) on Aspire 1640/ | 2022-03-28 12:11 | - | |
| built in microphone/ | 2022-03-28 12:11 | - | |
| burning problems with Aspire 4520/ | 2022-03-28 12:11 | - | |
| busted wire going to display on acer aspire 8920 g/ | 2022-03-28 12:11 | - | |
| called tiawan last night 1712smi/ | 2022-03-28 12:11 | - | |
| cam acer 5570Z/ | 2022-03-28 12:11 | - | |
| camera doesnot work on 5672, Please help!/ | 2022-03-28 12:11 | - | |
| camera don't work/ | 2022-03-28 12:11 | - | |
| camera not found/ | 2022-03-28 12:11 | - | |
| can't access HD partition/ | 2022-03-28 12:11 | - | |
| can't find the last screw/ | 2022-03-28 12:11 | - | |
| can't find win-xp sata driver for aspire-3050/ | 2022-03-28 12:11 | - | |
| can't finish formatting acer 5100 because it keeps on turning off/ | 2022-03-28 12:11 | - | |
| can't get 5.1 dts sound out of my Acer 1410/ | 2022-03-28 12:11 | - | |
| can't get my 3100-1718 to work/ | 2022-03-28 12:11 | - | |
| can't update catalyst driver/ | 2022-03-28 12:11 | - | |
| can't use FN+F5 keys on acer laptop/ | 2022-03-28 12:11 | - | |
| can't use full screen for games/ | 2022-03-28 12:11 | - | |
| can Aspire 1802WSMi use DDR2 533 Memory/ | 2022-03-28 12:11 | - | |
| can I boot from a USB CD or jump drive aspire 3610/ | 2022-03-28 12:11 | - | |
| can I get a faster charger for my 1810TZ/ | 2022-03-28 12:11 | - | |
| can I keep it on 24 7/ | 2022-03-28 12:11 | - | |
| can acer aspire 6920g be downgraded to windows XP/ | 2022-03-28 12:11 | - | |
| can an acer laptop be overclocked how/ | 2022-03-28 12:11 | - | |
| can anybody help me/ | 2022-03-28 12:11 | - | |
| can anyone help me/ | 2022-03-28 12:11 | - | |
| can any one help me in this problem in acer aspire 6930 g plzzzzzzz/ | 2022-03-28 12:11 | - | |
| can anyone recommend a DC car charger for the Timeline 3810T/ | 2022-03-28 12:11 | - | |
| can eRecovery burn the recovery disc into a image/ | 2022-03-28 12:11 | - | |
| can i change dvd drive on 5920/ | 2022-03-28 12:11 | - | |
| can i flash acer extensa 5220 bios from DOS/ | 2022-03-28 12:11 | - | |
| can i swap a i7 2630qm CPU into the Acer Aspire AS7741G-6426/ | 2022-03-28 12:11 | - | |
| cannot do partitioning on my acer aspire 5100/ | 2022-03-28 12:11 | - | |
| can not install properly run Empowering t.-((/ | 2022-03-28 12:11 | - | |
| cannot play fallout 3 on acer aspire 6920g/ | 2022-03-28 12:11 | - | |
| cannot select user in windows 7 log on/ | 2022-03-28 12:11 | - | |
| can someone check if bios upgrade removes password/ | 2022-03-28 12:11 | - | |
| can some one tell me in acer aspire 5315 a dual core/ | 2022-03-28 12:11 | - | |
| cant connect to wifi with my acer aspire 5515 2007 model/ | 2022-03-28 12:11 | - | |
| can the fan temp setting be lowered/ | 2022-03-28 12:11 | - | |
| can u help me acer 6920g/ | 2022-03-28 12:11 | - | |
| can you change cpu in Acer Aspire 5672Wlmi/ | 2022-03-28 12:11 | - | |
| can you change graphics cards in an acer/ | 2022-03-28 12:11 | - | |
| can you change graphics cards in an acer 5517 Orange Caulk/ | 2022-03-28 12:11 | - | |
| can you make clockgen keep its settings everytime boot up your notebook/ | 2022-03-28 12:11 | - | |
| capslock notification/ | 2022-03-28 12:11 | - | |
| car Chargeable/ | 2022-03-28 12:11 | - | |
| card reader not working on 8940g/ | 2022-03-28 12:11 | - | |
| card reader on aspire 1681/ | 2022-03-28 12:11 | - | |
| card reader problem Aspire 5101awlmi/ | 2022-03-28 12:11 | - | |
| car wax or polish/ | 2022-03-28 12:11 | - | |
| catalyst 6.2 windows 98 does not detect laptop screen properly/ | 2022-03-28 12:11 | - | |
| catalyst drivers for windows xp/ | 2022-03-28 12:11 | - | |
| cdrom and recovery missing/ | 2022-03-28 12:11 | - | |
| cer travelmate 4002wlmi/ | 2022-03-28 12:11 | - | |
| change keybard on acer ferrari 1000/ | 2022-03-28 12:11 | - | |
| changing 3201xci HDD/ | 2022-03-28 12:11 | - | |
| changing LEDs on a Acer aspire 8920g/ | 2022-03-28 12:11 | - | |
| changing graphics memory on 5102/ | 2022-03-28 12:11 | - | |
| changing primary monitor (acer 5672)/ | 2022-03-28 12:11 | - | |
| changing the function of the bluetooth key/ | 2022-03-28 12:11 | - | |
| charger for acer 8930G/ | 2022-03-28 12:11 | - | |
| charge your laptop in the car!/ | 2022-03-28 12:11 | - | |
| charging battery/ | 2022-03-28 12:11 | - | |
| charmy/ | 2022-03-28 12:11 | - | |
| cheap acer core duo/ | 2022-03-28 12:11 | - | |
| cheapest acer 3000/ | 2022-03-28 12:11 | - | |
| check out these acer prices lol/ | 2022-03-28 12:11 | - | |
| choosing headake 3692 or 5101 noise fan/ | 2022-03-28 12:11 | - | |
| cinedash with vlc on an 8920/ | 2022-03-28 12:11 | - | |
| cinedash won't respond..8920/ | 2022-03-28 12:11 | - | |
| ciruit city sale bought the 5100..q's PLEASE/ | 2022-03-28 12:12 | - | |
| citation/ | 2022-03-28 12:12 | - | |
| cleaning 5920g/ | 2022-03-28 12:12 | - | |
| cleaning acer 5672 wlmi screen help/ | 2022-03-28 12:12 | - | |
| cleaning aspire 5930g air vents/ | 2022-03-28 12:12 | - | |
| cleaning inside touchpad Travelmate 800/ | 2022-03-28 12:12 | - | |
| cleaning my 5920G startup/ | 2022-03-28 12:12 | - | |
| clean up/ | 2022-03-28 12:12 | - | |
| cmos batery/ | 2022-03-28 12:12 | - | |
| combo change acer aspire 1705 smi/ | 2022-03-28 12:12 | - | |
| combo drive detection error in BIOS/ | 2022-03-28 12:12 | - | |
| compatibility issue VG.86M06.004 of 8920G - is it MXM III/ | 2022-03-28 12:12 | - | |
| components downwards compatible/ | 2022-03-28 12:12 | - | |
| computer broken help please -(/ | 2022-03-28 12:12 | - | |
| computer restarting automatically- error/ | 2022-03-28 12:12 | - | |
| computer shop's messed up my Acer 5630, help/ | 2022-03-28 12:12 | - | |
| confused about acer timeline/ | 2022-03-28 12:12 | - | |
| confused in Canada about new acer released ! help on specs please/ | 2022-03-28 12:12 | - | |
| confused with acer's quality/ | 2022-03-28 12:12 | - | |
| connecting 8920g to a DLP tv/ | 2022-03-28 12:12 | - | |
| connect to network projector/ | 2022-03-28 12:12 | - | |
| connect your laptop to your pc via usb/ | 2022-03-28 12:12 | - | |
| consider replacing battery/ | 2022-03-28 12:12 | - | |
| converting file systems/ | 2022-03-28 12:12 | - | |
| cooler nt working/ | 2022-03-28 12:12 | - | |
| cooling down the heat/ | 2022-03-28 12:12 | - | |
| core 2 duo vs i3/ | 2022-03-28 12:12 | - | |
| core duo logo + carbon fiber for 1680x1050/ | 2022-03-28 12:12 | - | |
| could anyone please post bios dump for pheonix bios/ | 2022-03-28 12:12 | - | |
| cpu Upgrade aspire 7738g/ | 2022-03-28 12:12 | - | |
| cpu aspire 9301awsmi upgrade/ | 2022-03-28 12:12 | - | |
| cpu cool seems to work on 5672 (fan control)/ | 2022-03-28 12:12 | - | |
| cpu overclocking on 5920/ | 2022-03-28 12:12 | - | |
| cpu problem in aspire 8930G/ | 2022-03-28 12:12 | - | |
| cpu running at 100%/ | 2022-03-28 12:12 | - | |
| cpu temperature problem/ | 2022-03-28 12:12 | - | |
| cpu upgrade- t2700 vs t7400/ | 2022-03-28 12:12 | - | |
| cpu upgrade/ | 2022-03-28 12:12 | - | |
| cpu upgrade failure for acer aspire 3690/ | 2022-03-28 12:12 | - | |
| cpu upgrade for a Acer Extensa 4220/ | 2022-03-28 12:12 | - | |
| cpu upgrade for aspire 3502 WLCi/ | 2022-03-28 12:12 | - | |
| crack goes my Acer. Ouch. Time to get a new LCD from eBay/ | 2022-03-28 12:12 | - | |
| crackling noises on video calls/ | 2022-03-28 12:12 | - | |
| crack on the lcdsupport/ | 2022-03-28 12:12 | - | |
| cracks by the hinges of my aspire/ | 2022-03-28 12:12 | - | |
| crashes tm 8204/ | 2022-03-28 12:12 | - | |
| crystal eye webcam pinout/ | 2022-03-28 12:12 | - | |
| current ATI radeon driver/ | 2022-03-28 12:12 | - | |
| customize media buttons for 5930G/ | 2022-03-28 12:12 | - | |
| damaged laptop/ | 2022-03-28 12:12 | - | |
| ddr2 ram for acer 3683 laptop/ | 2022-03-28 12:12 | - | |
| dead acer aspire 5920g/ | 2022-03-28 12:12 | - | |
| dead pixels/ | 2022-03-28 12:12 | - | |
| dead pixels on acers/ | 2022-03-28 12:12 | - | |
| default brightness on external monitor (Aspire 5920)/ | 2022-03-28 12:12 | - | |
| delete 5920G recovery parition/ | 2022-03-28 12:12 | - | |
| dell internal bluetooth module for aspire/ | 2022-03-28 12:12 | - | |
| desktop image for acer3000/ | 2022-03-28 12:12 | - | |
| desperately need help/ | 2022-03-28 12:12 | - | |
| desperatly in need for recovery 3690/ | 2022-03-28 12:12 | - | |
| detection of my bluetooth device/ | 2022-03-28 12:12 | - | |
| did laptop have a duration baterry/ | 2022-03-28 12:12 | - | |
| difference between 8200 & 8204/ | 2022-03-28 12:12 | - | |
| difficulty putting together acer 9300 series laptop/ | 2022-03-28 12:12 | - | |
| dim screen/ | 2022-03-28 12:12 | - | |
| directx and Aspire 3000, do I need it/ | 2022-03-28 12:12 | - | |
| disable windows media player in touch pad/ | 2022-03-28 12:12 | - | |
| disabling devices from the Bios in 6930G - Help/ | 2022-03-28 12:12 | - | |
| disassembling an acer aspire 3050/ | 2022-03-28 12:12 | - | |
| disk dive not working/ | 2022-03-28 12:12 | - | |
| disk drive management HELP!/ | 2022-03-28 12:12 | - | |
| display problem/ | 2022-03-28 12:12 | - | |
| dissambled TM2700 2200 or Aspire1670 -- bios socket/ | 2022-03-28 12:12 | - | |
| do ACER sell an 5920 with an 8600M GT/ | 2022-03-28 12:12 | - | |
| does 3820TG have 2 heatsinks fans and 4820 5820 do not ! !/ | 2022-03-28 12:12 | - | |
| does Acer have 14 WXGA laptop with good graphics/ | 2022-03-28 12:12 | - | |
| does Acer make a hardy business class laptop/ | 2022-03-28 12:12 | - | |
| does a faulty motherboard cause a screen to go blank/ | 2022-03-28 12:12 | - | |
| does all the laptops come with original xp/ | 2022-03-28 12:12 | - | |
| does anyone know what powerful laptop is coming next from acer/ | 2022-03-28 12:12 | - | |
| does the 4315 support intel vt with the t7xxx cpus/ | 2022-03-28 12:12 | - | |
| does the aspire 4720z have a built in bluetooth/ | 2022-03-28 12:12 | - | |
| does the aspire AS5552-3465 have a built in mic/ | 2022-03-28 12:12 | - | |
| do laptop2go drivers void your warrenty/ | 2022-03-28 12:12 | - | |
| dolby sound system problem/ | 2022-03-28 12:12 | - | |
| don't use new intel website wireless drivers on 8204/ | 2022-03-28 12:12 | - | |
| do new acer laptop batteries work right off/ | 2022-03-28 12:12 | - | |
| dont know what to do!/ | 2022-03-28 12:12 | - | |
| do the hacked nV drivers kill the Acer Crystal Eye webcam/ | 2022-03-28 12:12 | - | |
| double click on touchpad on 9300/ | 2022-03-28 12:12 | - | |
| downgrade AS 5583's Vista to Xp/ | 2022-03-28 12:12 | - | |
| downgraded from vista to xp home on acer 3690/ | 2022-03-28 12:12 | - | |
| downgrade from vista to XP (acer 5315)/ | 2022-03-28 12:12 | - | |
| downgrade to XP and partitions/ | 2022-03-28 12:12 | - | |
| downgrade vista to XP on 5710/ | 2022-03-28 12:12 | - | |
| downgrading from vista home premium to XP/ | 2022-03-28 12:12 | - | |
| downgrading to windows xp (aspire 5630)/ | 2022-03-28 12:12 | - | |
| downloading acer arcade deluxe/ | 2022-03-28 12:12 | - | |
| download the new Acer Empowering Technology(tested with as5672) for vista&xp/ | 2022-03-28 12:12 | - | |
| dox or acer, which one is better for 8920/ | 2022-03-28 12:12 | - | |
| driver for volume wheel/ | 2022-03-28 12:12 | - | |
| driver problem/ | 2022-03-28 12:12 | - | |
| drivers/ | 2022-03-28 12:12 | - | |
| drivers do not work!/ | 2022-03-28 12:12 | - | |
| drivers for acer 5810T/ | 2022-03-28 12:12 | - | |
| drivers for aspire 5573/ | 2022-03-28 12:12 | - | |
| drivers issues/ | 2022-03-28 12:12 | - | |
| drivers question/ | 2022-03-28 12:12 | - | |
| dropped Aspire 3680 - just the screen, or other hw broken/ | 2022-03-28 12:12 | - | |
| dual core (su9400) in 4810t or 5810t...when/ | 2022-03-28 12:12 | - | |
| dual monitor for acer 4820tg/ | 2022-03-28 12:12 | - | |
| dual monitor problem/ | 2022-03-28 12:12 | - | |
| dumb question - does the aspire AS5552-3465 have a built in mic/ | 2022-03-28 12:12 | - | |
| dvd-rw noise/ | 2022-03-28 12:12 | - | |
| dvd playback stuttering pausing when on battery/ | 2022-03-28 12:12 | - | |
| dvd players and acer arcade/ | 2022-03-28 12:12 | - | |
| dvd region free/ | 2022-03-28 12:12 | - | |
| dvd rom missing/ | 2022-03-28 12:12 | - | |
| dvd writer/ | 2022-03-28 12:12 | - | |
| dvi-d output with 8104 - help!/ | 2022-03-28 12:12 | - | |
| e-Recovery help... Aspire 3680/ | 2022-03-28 12:12 | - | |
| e-recovery/ | 2022-03-28 12:12 | - | |
| e-recovery deleted/ | 2022-03-28 12:12 | - | |
| e-recovery help please/ | 2022-03-28 12:12 | - | |
| eDSLoader.exe - Unable to Locate Component/ | 2022-03-28 12:12 | - | |
| eDSloader problem/ | 2022-03-28 12:12 | - | |
| eDataSecurity doesn't work--get rid of it/ | 2022-03-28 12:12 | - | |
| eGPU for my as4830tg possible/ | 2022-03-28 12:12 | - | |
| eLocked out, Acer Aspire 9300/ | 2022-03-28 12:12 | - | |
| eMachines 355 netbook - WiFi problem/ | 2022-03-28 12:12 | - | |
| eMachines eMD620-5777 (basically a Acer 4420)/ | 2022-03-28 12:12 | - | |
| eMail LED- Vista/ | 2022-03-28 12:12 | - | |
| eManager- Fan Always Enabled/ | 2022-03-28 12:12 | - | |
| eMpowering utilities/ | 2022-03-28 12:12 | - | |
| eNet Management/ | 2022-03-28 12:12 | - | |
| eNet management doesn't recognize wireless adapter/ | 2022-03-28 12:12 | - | |
| ePowerManagement + SpeedStep/ | 2022-03-28 12:12 | - | |
| ePowerManagement/ | 2022-03-28 12:12 | - | |
| ePower Management alternative/ | 2022-03-28 12:12 | - | |
| ePower Management and Hibernation/ | 2022-03-28 12:12 | - | |
| ePowerManagement and Speedstep in Aspire 5601/ | 2022-03-28 12:12 | - | |
| ePower Management and new US 1810TZ Windows 7/ | 2022-03-28 12:12 | - | |
| ePower for 1810/ | 2022-03-28 12:12 | - | |
| ePower in clean Win7 64 install/ | 2022-03-28 12:12 | - | |
| ePower management/ | 2022-03-28 12:12 | - | |
| ePower management vs native management xp/ | 2022-03-28 12:12 | - | |
| ePower problems [timeline 5810T]/ | 2022-03-28 12:12 | - | |
| eRecovery & Recovery CDs - How to Make Those CDs and Regain The Hidden Partition/ | 2022-03-28 12:12 | - | |
| eRecovery/ | 2022-03-28 12:12 | - | |
| eRecovery Alt + F10 question/ | 2022-03-28 12:12 | - | |
| eRecovery Backups/ | 2022-03-28 12:12 | - | |
| eRecovery Custom Backup vs Factory Default Backup/ | 2022-03-28 12:12 | - | |
| eRecovery Failed/ | 2022-03-28 12:12 | - | |
| eRecovery Hangs/ | 2022-03-28 12:12 | - | |
| eRecovery Management/ | 2022-03-28 12:12 | - | |
| eRecovery Management Installation/ | 2022-03-28 12:12 | - | |
| eRecovery Management Questions/ | 2022-03-28 12:12 | - | |
| eRecovery Management doesnt work/ | 2022-03-28 12:12 | - | |
| eRecovery Management failed to produce system discs/ | 2022-03-28 12:12 | - | |
| eRecovery Manangement Problem/ | 2022-03-28 12:12 | - | |
| eRecovery Problem- URGENT!!/ | 2022-03-28 12:12 | - | |
| eRecovery Software will not install/ | 2022-03-28 12:12 | - | |
| eRecovery and D-(DATA) partition/ | 2022-03-28 12:12 | - | |
| eRecovery backup image/ | 2022-03-28 12:12 | - | |
| eRecovery can not be installed - 1.Bootable File/ | 2022-03-28 12:12 | - | |
| eRecovery directory path error/ | 2022-03-28 12:12 | - | |
| eRecovery doesn't complete of recovery/ | 2022-03-28 12:12 | - | |
| eRecovery not working/ | 2022-03-28 12:12 | - | |
| eRecovery poll/ | 2022-03-28 12:12 | - | |
| eRecovery problem/ | 2022-03-28 12:12 | - | |
| eRovery program for acer aspireone zg5/ | 2022-03-28 12:12 | - | |
| easynote tj74 help/ | 2022-03-28 12:12 | - | |
| editing dvmt/ | 2022-03-28 12:12 | - | |
| edsl problem/ | 2022-03-28 12:12 | - | |
| ello guys/ | 2022-03-28 12:12 | - | |
| elusive 1711 1712/ | 2022-03-28 12:12 | - | |
| emPowering Framework on startup/ | 2022-03-28 12:12 | - | |
| emachine 350 - unlock video memory in insyde bios/ | 2022-03-28 12:12 | - | |
| emachines E732 keyboard problem/ | 2022-03-28 12:12 | - | |
| empowering software/ | 2022-03-28 12:12 | - | |
| empowering technolgy/ | 2022-03-28 12:12 | - | |
| empowering technology for aspire 7720/ | 2022-03-28 12:12 | - | |
| empowering technology framework 2/ | 2022-03-28 12:12 | - | |
| empowering technology recovery questions/ | 2022-03-28 12:12 | - | |
| empty bay/ | 2022-03-28 12:12 | - | |
| enable aero on a 6930/ | 2022-03-28 12:12 | - | |
| enable bluetooth without the butten in front/ | 2022-03-28 12:12 | - | |
| enter bios on TM 290/ | 2022-03-28 12:12 | - | |
| epower management and celeron/ | 2022-03-28 12:12 | - | |
| epowermanagement annoyances/ | 2022-03-28 12:12 | - | |
| erecovery and NAPP/ | 2022-03-28 12:12 | - | |
| erecovery error 0xc0000003 no way to backup/ | 2022-03-28 12:12 | - | |
| erecovery factory default DVD burn fails/ | 2022-03-28 12:12 | - | |
| erecovery failing to restore/ | 2022-03-28 12:12 | - | |
| erecovery on cloned hard disk problem/ | 2022-03-28 12:12 | - | |
| error 0xf0000024/ | 2022-03-28 12:12 | - | |
| error1303, hardest problem possible/ | 2022-03-28 12:12 | - | |
| error code 0x80070052 witt MP3 transfer to Mini SD card/ | 2022-03-28 12:12 | - | |
| error message 02F0- CPU ID- 55 No Microcode Update Loaded for Alternate Processor Press f1 to resume/ | 2022-03-28 12:12 | - | |
| esata on aspire 5739G/ | 2022-03-28 12:12 | - | |
| ethernet controller does not work! 5672 HELP!/ | 2022-03-28 12:12 | - | |
| explorer.exe end process/ | 2022-03-28 12:12 | - | |
| expresscard 34 for Acer 5100-3357/ | 2022-03-28 12:12 | - | |
| express upgrade to vista through moduslink/ | 2022-03-28 12:12 | - | |
| extended warantee on Acer Aspire One/ | 2022-03-28 12:12 | - | |
| extensa 4620 as desktop/ | 2022-03-28 12:12 | - | |
| extensa 5210 broadcom driver/ | 2022-03-28 12:12 | - | |
| extensa 5420 help/ | 2022-03-28 12:12 | - | |
| extensa 5420 no device bluetooth after reinstall vista/ | 2022-03-28 12:12 | - | |
| extensa 5620 problem with graphic card driver/ | 2022-03-28 12:12 | - | |
| extensa 5620z keyboard help/ | 2022-03-28 12:12 | - | |
| external monitor not working/ | 2022-03-28 12:12 | - | |
| external power banks for acer laptops/ | 2022-03-28 12:12 | - | |
| factory formatting/ | 2022-03-28 12:12 | - | |
| factory settings/ | 2022-03-28 12:12 | - | |
| faded product key; acer support/ | 2022-03-28 12:12 | - | |
| false temps/ | 2022-03-28 12:12 | - | |
| fan control/ | 2022-03-28 12:12 | - | |
| fan is running constantly/ | 2022-03-28 12:12 | - | |
| fan noise normal on AA1/ | 2022-03-28 12:12 | - | |
| fan noise travelmate 4504/ | 2022-03-28 12:12 | - | |
| fan problems acer 5920g/ | 2022-03-28 12:12 | - | |
| fan wont run on batt/ | 2022-03-28 12:12 | - | |
| fat32 driver!!!/ | 2022-03-28 12:12 | - | |
| fat32 opposed to ntfs on acer c300/ | 2022-03-28 12:12 | - | |
| faulty hdmi port on acer aspire 5741, what can i do/ | 2022-03-28 12:12 | - | |
| ferrari 1000 and windows 7/ | 2022-03-28 12:12 | - | |
| ferrari 3000 cpu speed/ | 2022-03-28 12:12 | - | |
| ferrari3000 vs 800 series/ | 2022-03-28 12:12 | - | |
| ferrari 3200 V.S. ferrari 3400/ | 2022-03-28 12:12 | - | |
| ferrari 4000 not turning on/ | 2022-03-28 12:12 | - | |
| ferrari 4005, LX.FR406.035/ | 2022-03-28 12:12 | - | |
| ferrari 4005/ | 2022-03-28 12:12 | - | |
| ferrari 4005 integrated SD card reader not working/ | 2022-03-28 12:12 | - | |
| ferrari 4005 scroll button/ | 2022-03-28 12:12 | - | |
| ferrari and dual screen display/ | 2022-03-28 12:12 | - | |
| ferrari cpu upgrade help!/ | 2022-03-28 12:12 | - | |
| ferrari wallpaper/ | 2022-03-28 12:12 | - | |
| few more little questions/ | 2022-03-28 12:12 | - | |
| few questions ... new Acer user -)/ | 2022-03-28 12:12 | - | |
| few questions about the extensa/ | 2022-03-28 12:12 | - | |
| final decisions on as6920g upgrade/ | 2022-03-28 12:12 | - | |
| find instructions for orbicam aspire5050-5430/ | 2022-03-28 12:12 | - | |
| firmware for DVDR-K04RA/ | 2022-03-28 12:12 | - | |
| first laptop/ | 2022-03-28 12:12 | - | |
| first time/ | 2022-03-28 12:12 | - | |
| first time use language problem/ | 2022-03-28 12:12 | - | |
| first upgrade on my 1681/ | 2022-03-28 12:12 | - | |
| flash bios/ | 2022-03-28 12:12 | - | |
| flash drive boot esata drive boot/ | 2022-03-28 12:12 | - | |
| flashed bios, now won't can't or power on acer laptop/ | 2022-03-28 12:12 | - | |
| flickering screen/ | 2022-03-28 12:12 | - | |
| forget the Acer 4750G BIOS password who can help me/ | 2022-03-28 12:12 | - | |
| format/ | 2022-03-28 12:12 | - | |
| format HD 5672, clean install/ | 2022-03-28 12:12 | - | |
| format acer aspire 5610 problem/ | 2022-03-28 12:12 | - | |
| format and partitioning/ | 2022-03-28 12:12 | - | |
| fps drops at 60°C/ | 2022-03-28 12:12 | - | |
| freeze after startup/ | 2022-03-28 12:12 | - | |
| fresh install/ | 2022-03-28 12:12 | - | |
| fresh install of win 7, should I install epower utility !/ | 2022-03-28 12:12 | - | |
| fresh install worth it/ | 2022-03-28 12:12 | - | |
| fried motherboard on aspire 3003nlc/ | 2022-03-28 12:12 | - | |
| fully remove bottom of 5670 for dvd drive swap/ | 2022-03-28 12:12 | - | |
| function key alternative on usb keyboard/ | 2022-03-28 12:12 | - | |
| funny problem on Acer Ferrari 5000/ | 2022-03-28 12:12 | - | |
| future plans/ | 2022-03-28 12:12 | - | |
| games 5920G/ | 2022-03-28 12:12 | - | |
| games= to widescreen/ | 2022-03-28 12:12 | - | |
| geforce go7600 drive update/ | 2022-03-28 12:12 | - | |
| get a clean vista installation disk from pre-installed acer/ | 2022-03-28 12:12 | - | |
| get into acers hidden partition/ | 2022-03-28 12:12 | - | |
| getting ACER vs dell/ | 2022-03-28 12:12 | - | |
| getting dos to recognise my USB hdd/ | 2022-03-28 12:12 | - | |
| getting recovery disk to work/ | 2022-03-28 12:12 | - | |
| glitch- 8930g system time & date/ | 2022-03-28 12:12 | - | |
| glorious day for 6920 x64 users/ | 2022-03-28 12:12 | - | |
| glossy reflective screen or a matte non-glossy screen/ | 2022-03-28 12:12 | - | |
| gma driver install 1810t/ | 2022-03-28 12:12 | - | |
| good places to buy acer 1693wlmi from melbourne, australia/ | 2022-03-28 12:12 | - | |
| good system monitor - temp - votage - fanspeed/ | 2022-03-28 12:12 | - | |
| got my 1681wlmi/ | 2022-03-28 12:12 | - | |
| gparted and PQSERVICE partition and ubuntu/ | 2022-03-28 12:12 | - | |
| graphic card 8600M GS/ | 2022-03-28 12:12 | - | |
| graphic chip card/ | 2022-03-28 12:12 | - | |
| graphic problems 82852 82855/ | 2022-03-28 12:12 | - | |
| graphics card/ | 2022-03-28 12:12 | - | |
| graphics driver for Acer 5920G/ | 2022-03-28 12:12 | - | |
| graphics help/ | 2022-03-28 12:12 | - | |
| graphics problem/ | 2022-03-28 12:12 | - | |
| graphics problems/ | 2022-03-28 12:12 | - | |
| hacked via WIFI/ | 2022-03-28 12:12 | - | |
| harddisk RPM for Acer 1681 WLMi/ | 2022-03-28 12:12 | - | |
| hard disk overheating/ | 2022-03-28 12:12 | - | |
| hard drive + memory upgrade on travelmate 8000/ | 2022-03-28 12:12 | - | |
| hard drive clone using a 3rd usb ext drive/ | 2022-03-28 12:12 | - | |
| hard drive icon keeps blinking/ | 2022-03-28 12:12 | - | |
| hard drive partition/ | 2022-03-28 12:12 | - | |
| hard drive problem/ | 2022-03-28 12:12 | - | |
| hard drive upgrade/ | 2022-03-28 12:12 | - | |
| has anyone the 9600m gs gddr3 bios/ | 2022-03-28 12:12 | - | |
| hazy line. Normal or not/ | 2022-03-28 12:12 | - | |
| hd 3650 drivers problem on acer 5920g/ | 2022-03-28 12:12 | - | |
| hdd head parking/ | 2022-03-28 12:12 | - | |
| hdd not showing/ | 2022-03-28 12:12 | - | |
| hdd over heating/ | 2022-03-28 12:12 | - | |
| hdmi/ | 2022-03-28 12:12 | - | |
| hdmi output displaying blurry/ | 2022-03-28 12:12 | - | |
| hdmi sound/ | 2022-03-28 12:12 | - | |
| headphone jack not working on 5920/ | 2022-03-28 12:12 | - | |
| headphones help please.........annoying/ | 2022-03-28 12:12 | - | |
| heat problem/ | 2022-03-28 12:12 | - | |
| heavy flickering with ATI 4650 of Acer 8730G/ | 2022-03-28 12:12 | - | |
| hello/ | 2022-03-28 12:12 | - | |
| help!!!!noob to the site but not to computers/ | 2022-03-28 12:13 | - | |
| help!!!travelmate 6493 Dead after 2 failed windows Bios Update/ | 2022-03-28 12:13 | - | |
| help! acer travelmate 3043 trouble/ | 2022-03-28 12:13 | - | |
| help! need xp drivers for acer/ | 2022-03-28 12:13 | - | |
| help- TM 8204 + external DVI monitor won't work over 1200x800/ | 2022-03-28 12:13 | - | |
| help - digital tv - how to turn off subtitles/ | 2022-03-28 12:12 | - | |
| help - hddvd will not play/ | 2022-03-28 12:12 | - | |
| help - keyboard/ | 2022-03-28 12:12 | - | |
| help-my line out does not work/ | 2022-03-28 12:13 | - | |
| help.. aspice 6920 rom vista to xp/ | 2022-03-28 12:13 | - | |
| help 5580 failed update bios/ | 2022-03-28 12:12 | - | |
| help Acer 5315-2713 shutoff now screen bottom is white/ | 2022-03-28 12:12 | - | |
| help acer6930g/ | 2022-03-28 12:12 | - | |
| help after Aspire 5310 Processor replacement/ | 2022-03-28 12:12 | - | |
| help battery manager for acer/ | 2022-03-28 12:12 | - | |
| help error 0232 on Acer 5920/ | 2022-03-28 12:12 | - | |
| help help ~~~~online waiting~!!/ | 2022-03-28 12:12 | - | |
| help me decide/ | 2022-03-28 12:12 | - | |
| help me my acer aspire 5570Z/ | 2022-03-28 12:12 | - | |
| help me pleeease!/ | 2022-03-28 12:12 | - | |
| help me understand this string for recovery/ | 2022-03-28 12:12 | - | |
| help me with this. deciding whether to buy this 20 acer monitor at $280 shipped/ | 2022-03-28 12:12 | - | |
| help my acer comp wont install anything!/ | 2022-03-28 12:12 | - | |
| help my acer travelmate 3000/ | 2022-03-28 12:12 | - | |
| help needed! acer 5315 display problems!!/ | 2022-03-28 12:12 | - | |
| help needed/ | 2022-03-28 12:12 | - | |
| help needed acer empowerment technology missing/ | 2022-03-28 12:12 | - | |
| help needed fast please guys/ | 2022-03-28 12:12 | - | |
| help need empowering toolbar for xp pro 5315/ | 2022-03-28 12:12 | - | |
| help on a aspire 1650Z/ | 2022-03-28 12:12 | - | |
| help on acer aspire 5570z driver/ | 2022-03-28 12:12 | - | |
| help on starting windows on aspire 1690/ | 2022-03-28 12:12 | - | |
| helpp/ | 2022-03-28 12:13 | - | |
| help please/ | 2022-03-28 12:12 | - | |
| help pls/ | 2022-03-28 12:12 | - | |
| help reformatting acer 4315/ | 2022-03-28 12:12 | - | |
| help removing dvd drive aspire 1694/ | 2022-03-28 12:12 | - | |
| help spainish to english/ | 2022-03-28 12:12 | - | |
| help to find acer aspire 2020 series parts.my daugher decided to use my shyning lapto/ | 2022-03-28 12:12 | - | |
| help volume in 6920G not work/ | 2022-03-28 12:13 | - | |
| help wanted for travelmate 4202!!!!!/ | 2022-03-28 12:13 | - | |
| help with aspire 5610z/ | 2022-03-28 12:13 | - | |
| help with aspire 8935g/ | 2022-03-28 12:13 | - | |
| help with aspire 9402 wiindows installation/ | 2022-03-28 12:13 | - | |
| help with changing name on acer laptop/ | 2022-03-28 12:13 | - | |
| help with external monitor!/ | 2022-03-28 12:13 | - | |
| help with fat to ntfs conversion/ | 2022-03-28 12:13 | - | |
| help with grounding fsb pin and overclocking/ | 2022-03-28 12:13 | - | |
| help with my 3830TG/ | 2022-03-28 12:13 | - | |
| help with my Aspire 5720, won't turn on/ | 2022-03-28 12:13 | - | |
| help with my acer 8920g/ | 2022-03-28 12:13 | - | |
| help with my acer aspire 7735z/ | 2022-03-28 12:13 | - | |
| help with orbicam/ | 2022-03-28 12:13 | - | |
| help with system restore 3810TG SU9400/ | 2022-03-28 12:13 | - | |
| help with the acer napp cd/ | 2022-03-28 12:13 | - | |
| help with travelmate/ | 2022-03-28 12:13 | - | |
| help with update bios for acer aspire 7740/ | 2022-03-28 12:13 | - | |
| help with warrenty repair issue with acer uk/ | 2022-03-28 12:13 | - | |
| hey, any one bought the 6920G/ | 2022-03-28 12:13 | - | |
| hey guys need help on my acer aspire 4315/ | 2022-03-28 12:13 | - | |
| hi all i am new to this and a bit old 63/ | 2022-03-28 12:13 | - | |
| high picth on my acer tm 8104/ | 2022-03-28 12:13 | - | |
| high pitch buzz when touchpad touched on my 5672/ | 2022-03-28 12:13 | - | |
| high temperature problem after bios update/ | 2022-03-28 12:13 | - | |
| hi im new with this stuff help plz/ | 2022-03-28 12:13 | - | |
| hitachi 7k200 upgrade for 5920g/ | 2022-03-28 12:13 | - | |
| hmmmm i wonder... HELP/ | 2022-03-28 12:13 | - | |
| hotkeys on acer 5012 wlmi/ | 2022-03-28 12:13 | - | |
| how's acer's tech support/ | 2022-03-28 12:13 | - | |
| how 2 m ake a videos using acer orbicam(build in cam) in my acer aspire laptop/ | 2022-03-28 12:13 | - | |
| how can I find out if my other hard drive has a built in OS/ | 2022-03-28 12:13 | - | |
| how can I switch from 800Mhz to 1.6Ghz/ | 2022-03-28 12:13 | - | |
| how can i clean acer aspire 6920g keyboard/ | 2022-03-28 12:13 | - | |
| how can i connect my Laptop(Aspire 6920g) to my T.V/ | 2022-03-28 12:13 | - | |
| how can i disassemble an acer Travelmate 4000/ | 2022-03-28 12:13 | - | |
| how can i turn off the touch pad/ | 2022-03-28 12:13 | - | |
| how do I open Travelmate 2420/ | 2022-03-28 12:13 | - | |
| how do I start with my numlock on/ | 2022-03-28 12:13 | - | |
| how does one determine the system build date/ | 2022-03-28 12:13 | - | |
| how do i burn Vista on a dvd disc (Acer 5315)/ | 2022-03-28 12:13 | - | |
| how do i cahnge my keyboard settngs/ | 2022-03-28 12:13 | - | |
| how do i clean my aspire 6920g from dust/ | 2022-03-28 12:13 | - | |
| how do i disable BIOS memory options (caching or shadowing)/ | 2022-03-28 12:13 | - | |
| how do i disable the Tap to click feature on vista/ | 2022-03-28 12:13 | - | |
| how do i format d drive on acer aspire 6920g/ | 2022-03-28 12:13 | - | |
| how do i format my pc like i just got it from the store/ | 2022-03-28 12:13 | - | |
| how do i install xp again using my back up disks/ | 2022-03-28 12:13 | - | |
| how do i know if i got an accident DVD burner/ | 2022-03-28 12:13 | - | |
| how do i know if my Guts in myaspire 6920g is dieing and will it reduce system performance/ | 2022-03-28 12:13 | - | |
| how do i put acer 6920g back to factory settings please...i don't have disks/ | 2022-03-28 12:13 | - | |
| how do i reinstall windows xp in my acer travelmate 2420/ | 2022-03-28 12:13 | - | |
| how do i type a pounds symbol/ | 2022-03-28 12:13 | - | |
| how do i use nvidia device setting to overclock/ | 2022-03-28 12:13 | - | |
| how do i use the acer erocvery to reformat to factory default/ | 2022-03-28 12:13 | - | |
| how do people have Acer Aspire TimelineX 3820T with Raden HD 5650/ | 2022-03-28 12:13 | - | |
| how do u remove hdd on acer 1692/ | 2022-03-28 12:13 | - | |
| how far have you taken your 5315 apart/ | 2022-03-28 12:13 | - | |
| how good are the comfyview displays for a designer (aspire v3-571g)/ | 2022-03-28 12:13 | - | |
| how good is the Acer Aspire 5680-6123/ | 2022-03-28 12:13 | - | |
| how hot does you Computer get/ | 2022-03-28 12:13 | - | |
| how is Acer as a brand, and opinions on Acer 8103/ | 2022-03-28 12:13 | - | |
| how is BattleField 2 on the Ferrari 4005/ | 2022-03-28 12:13 | - | |
| how is acer as a brand/ | 2022-03-28 12:13 | - | |
| how is your as5670wlmi working/ | 2022-03-28 12:13 | - | |
| how long does it take ACER to repair something Usually/ | 2022-03-28 12:13 | - | |
| how long to charge battery/ | 2022-03-28 12:13 | - | |
| how much battery life do you get on your Acer/ | 2022-03-28 12:13 | - | |
| how much difference is the 64bit version of xp from the 32 bit one/ | 2022-03-28 12:13 | - | |
| how switch between gpu in 5750g/ | 2022-03-28 12:13 | - | |
| how to DIY format a hopeless acer ferrari 3000LMi/ | 2022-03-28 12:13 | - | |
| how to add VT-x to Aspire 5920 bios/ | 2022-03-28 12:13 | - | |
| how to adjust vga memory/ | 2022-03-28 12:13 | - | |
| how to change Ferrari 4005 POST picture/ | 2022-03-28 12:13 | - | |
| how to change acer aspire s3 to ssd/ | 2022-03-28 12:13 | - | |
| how to change battery bios - old Acer 610 CD/ | 2022-03-28 12:13 | - | |
| how to change ram/ | 2022-03-28 12:13 | - | |
| how to clean 5920G completely from dust/ | 2022-03-28 12:13 | - | |
| how to delete impossiple to delete files/ | 2022-03-28 12:13 | - | |
| how to disable power switch on Acer/ | 2022-03-28 12:13 | - | |
| how to disassemble an Aspire 4935/ | 2022-03-28 12:13 | - | |
| how to download eRecovery for aspire one/ | 2022-03-28 12:13 | - | |
| how to enable 5738g intel VT/ | 2022-03-28 12:13 | - | |
| how to enable vistual machine acer aspire 6935G/ | 2022-03-28 12:13 | - | |
| how to get cover off 5672/ | 2022-03-28 12:13 | - | |
| how to get password for recovery partition on aspire 5100/ | 2022-03-28 12:13 | - | |
| how to get to acer aspire 3000's CPU/ | 2022-03-28 12:13 | - | |
| how to get visualize program back on Acer arcade/ | 2022-03-28 12:13 | - | |
| how to install 5672 lan/ | 2022-03-28 12:13 | - | |
| how to install install Windows XP on acer travelmate 5310/ | 2022-03-28 12:13 | - | |
| how to install touch portal on acer 5738pg/ | 2022-03-28 12:13 | - | |
| how to install windows xp professional instead/ | 2022-03-28 12:13 | - | |
| how to install xp on acer travelmate 4720/ | 2022-03-28 12:13 | - | |
| how to intigrate software with os/ | 2022-03-28 12:13 | - | |
| how to kill defrag!!/ | 2022-03-28 12:13 | - | |
| how to make my lcd tv my primary display/ | 2022-03-28 12:13 | - | |
| how to open Windows Media Center on 5920G/ | 2022-03-28 12:13 | - | |
| how to open acer aspire 4935/ | 2022-03-28 12:13 | - | |
| how to overclock 1691/ | 2022-03-28 12:13 | - | |
| how to preserve battery life/ | 2022-03-28 12:13 | - | |
| how to put off on an inbuild mic/ | 2022-03-28 12:13 | - | |
| how to recognize refurbished models/ | 2022-03-28 12:13 | - | |
| how to reformat acer extensa 5635z/ | 2022-03-28 12:13 | - | |
| how to reinstall an acer aspire one a150 without acer erecovery/ | 2022-03-28 12:13 | - | |
| how to reinstall dolby home theatre/ | 2022-03-28 12:13 | - | |
| how to remove acer trash/ | 2022-03-28 12:13 | - | |
| how to replace acer aspire 5100 hard drive/ | 2022-03-28 12:13 | - | |
| how to replace keyboard on Aspire 3002LCi/ | 2022-03-28 12:13 | - | |
| how to replace keyboard on my 5672/ | 2022-03-28 12:13 | - | |
| how to replace power jack on acer emachines d620/ | 2022-03-28 12:13 | - | |
| how to restore backup after partition crash on 5920/ | 2022-03-28 12:13 | - | |
| how to solve lcd problems/ | 2022-03-28 12:13 | - | |
| how to switch from 64 to 32 bits/ | 2022-03-28 12:13 | - | |
| how to take apart the Acer Aspire 5003 WLMi/ | 2022-03-28 12:13 | - | |
| how to take out 6920g gpu area connected to motherboard/ | 2022-03-28 12:13 | - | |
| how to take out acer aspire 6920g dvd-r out/ | 2022-03-28 12:13 | - | |
| how to test what is dead in laptop acer 5100/ | 2022-03-28 12:13 | - | |
| how to turn on a camera/ | 2022-03-28 12:13 | - | |
| how to update Acer aspire 4820TG video card/ | 2022-03-28 12:13 | - | |
| how to update BIOS without AC 6920g/ | 2022-03-28 12:13 | - | |
| hp millenium edition/ | 2022-03-28 12:13 | - | |
| http- www.laptopsdirect.co.uk/ | 2022-03-28 12:13 | - | |
| hw upgrade and 3 warranty extension/ | 2022-03-28 12:13 | - | |
| hybrid graphics- switching gpu/ | 2022-03-28 12:13 | - | |
| i've broken my friends 'new' notebook/ | 2022-03-28 12:13 | - | |
| i3-370m temperatures/ | 2022-03-28 12:13 | - | |
| i3 Cpu replacement on acer 4820TG/ | 2022-03-28 12:13 | - | |
| i5-420M and i5-450M, performance difference/ | 2022-03-28 12:13 | - | |
| i5-460m/ | 2022-03-28 12:13 | - | |
| i7-3612QM (or QE) compatible with Aspire 7750G/ | 2022-03-28 12:13 | - | |
| i7 720QM or i7 2630QM, which one to choose/ | 2022-03-28 12:13 | - | |
| i assume my ram works on 667, but suppose to be on 800mhz/ | 2022-03-28 12:13 | - | |
| i badly need help with may acer aspire 5710/ | 2022-03-28 12:13 | - | |
| i bought an Acer/ | 2022-03-28 12:13 | - | |
| i cannot install the product key/ | 2022-03-28 12:13 | - | |
| i can run cs-s on my acer aspire 6920g right/ | 2022-03-28 12:13 | - | |
| i cant get into my power management/ | 2022-03-28 12:13 | - | |
| i dont believe it ...arghhhhh/ | 2022-03-28 12:13 | - | |
| i dont know why but i can not get my lap top to burn a cd, can anyone help me I know this series will burn them, but not for me/ | 2022-03-28 12:13 | - | |
| if it is possible to install a Windows 7 home premium on my acer 5610Z/ | 2022-03-28 12:13 | - | |
| if possible 2 upgrade my acer aspire5580 laptop video card/ | 2022-03-28 12:13 | - | |
| i got some questions plz help/ | 2022-03-28 12:13 | - | |
| im after a graphics driver better than one that came with te 5102 anyone a link to one/ | 2022-03-28 12:13 | - | |
| importing a 8920 to OZ, need advice/ | 2022-03-28 12:13 | - | |
| im stuck/ | 2022-03-28 12:13 | - | |
| incompatible IBM mouse/ | 2022-03-28 12:13 | - | |
| inconsistent battery - ePM and windows_pm/ | 2022-03-28 12:13 | - | |
| increase resolution on 2012WLMi/ | 2022-03-28 12:13 | - | |
| i need drivers for aspire 5102wlmi windows xp os/ | 2022-03-28 12:13 | - | |
| i need help to flash bios on acer 5920g/ | 2022-03-28 12:13 | - | |
| i need soluion of this problems/ | 2022-03-28 12:13 | - | |
| i need the expert advice plz/ | 2022-03-28 12:13 | - | |
| info needed on 7740g-6969/ | 2022-03-28 12:13 | - | |
| initial impression of acer 8935g/ | 2022-03-28 12:13 | - | |
| install MSFT bluetooth on 8204/ | 2022-03-28 12:13 | - | |
| installed xp on 5315 wifi running at half speed/ | 2022-03-28 12:13 | - | |
| installed xp on acer 5100 and my wireless internet isnt working/ | 2022-03-28 12:13 | - | |
| installing HDD on Acer 6930/ | 2022-03-28 12:13 | - | |
| installing a dvd+rw in aspire 3000/ | 2022-03-28 12:13 | - | |
| installing modded nvidia drivers for 5920/ | 2022-03-28 12:13 | - | |
| installing windows 7 on tm4720/ | 2022-03-28 12:13 | - | |
| installing windows xp pro/ | 2022-03-28 12:13 | - | |
| installing xp on acer aspire 5741, can it be done/ | 2022-03-28 12:13 | - | |
| installing xp on aspire 5715z/ | 2022-03-28 12:13 | - | |
| install xp on 8920g/ | 2022-03-28 12:13 | - | |
| integrated sound in Aspire 6920/ | 2022-03-28 12:13 | - | |
| intel 310 ssd/ | 2022-03-28 12:13 | - | |
| intel 965 chipset cpu overclock as6920g/ | 2022-03-28 12:13 | - | |
| intel extreme graphics/ | 2022-03-28 12:13 | - | |
| intel pro 2915 vista 64bit driver/ | 2022-03-28 12:13 | - | |
| intel su3500 vs intel su9400/ | 2022-03-28 12:13 | - | |
| intel t9300 fits 6920g/ | 2022-03-28 12:13 | - | |
| intel turbo memory adapters for my 5920g Will any work/ | 2022-03-28 12:13 | - | |
| interactive logon process initialization has failed/ | 2022-03-28 12:13 | - | |
| interesting GeForce driver update (5920)/ | 2022-03-28 12:13 | - | |
| intermittent display trouble/ | 2022-03-28 12:13 | - | |
| intermittent vacuum cleaner-like fan noise, normal on 4820T/ | 2022-03-28 12:13 | - | |
| internal blutooth install for acer 2920/ | 2022-03-28 12:13 | - | |
| internet connection/ | 2022-03-28 12:13 | - | |
| internet explorer on ferrari 4000`/ | 2022-03-28 12:13 | - | |
| intrest check- Acer abandoning mxm/ | 2022-03-28 12:13 | - | |
| in your S7 391, the SSD shows as one 128 256G or two 64 128G/ | 2022-03-28 12:13 | - | |
| i really need help/ | 2022-03-28 12:13 | - | |
| is ACER warranty transferable/ | 2022-03-28 12:13 | - | |
| is a aspire 4315 motherboard upgrade possible/ | 2022-03-28 12:13 | - | |
| is acer a reliable brand/ | 2022-03-28 12:13 | - | |
| is acer coming out with any new notebooks thinking of getting a 5920g/ | 2022-03-28 12:13 | - | |
| is acer support website working for anyone/ | 2022-03-28 12:13 | - | |
| is it possible to disconnect a pcmcia reader on an aspire 1711smi/ | 2022-03-28 12:13 | - | |
| is it possible to upgrade screen resolution on aspire 5750G/ | 2022-03-28 12:13 | - | |
| is it possible to upgrade the cpu on the 5102/ | 2022-03-28 12:13 | - | |
| is it safe to keep using a HDD connector that is broken and wires exposed/ | 2022-03-28 12:13 | - | |
| is it safe to run my laptop using AC Power (charger) ONLY [without battery]/ | 2022-03-28 12:13 | - | |
| is it worth to keep the 5762 wmli for $999/ | 2022-03-28 12:13 | - | |
| is my ac adapter dead/ | 2022-03-28 12:13 | - | |
| isntalling linux on AOD 270, warranty question/ | 2022-03-28 12:13 | - | |
| issues burning with ACER Aspire 6920/ | 2022-03-28 12:13 | - | |
| issues with rixing acer mbr/ | 2022-03-28 12:13 | - | |
| is the i5-450M upgrade from i3-350M worth 100 dollars/ | 2022-03-28 12:13 | - | |
| is there any guides on how to tweak my 5102 on wondows xp/ | 2022-03-28 12:13 | - | |
| is there any way to fix my notebook/ | 2022-03-28 12:13 | - | |
| is there a way to recover or change this/ | 2022-03-28 12:13 | - | |
| is there such thing as a bag for the 8930 20/ | 2022-03-28 12:13 | - | |
| is the travelmate 804 any good/ | 2022-03-28 12:13 | - | |
| is this a good deal (Aspire 8930)/ | 2022-03-28 12:13 | - | |
| is this memory ok for my 5102/ | 2022-03-28 12:13 | - | |
| is this normal for my GPU to be doing this/ | 2022-03-28 12:13 | - | |
| i think acer arcade instanton messed up my drive/ | 2022-03-28 12:13 | - | |
| i think i know why laptops like the aspire 5024 arnt avaliabli in america/ | 2022-03-28 12:13 | - | |
| i wanted to sell my laptop/ | 2022-03-28 12:13 | - | |
| just a question about the acer backup/ | 2022-03-28 12:13 | - | |
| just bought the 3820tg i5... fan whine/ | 2022-03-28 12:13 | - | |
| just got this laptop/ | 2022-03-28 12:13 | - | |
| just one question/ | 2022-03-28 12:13 | - | |
| just ordered a 5672 wlmi questions/ | 2022-03-28 12:13 | - | |
| just swaped an acer 5735 for a 5536 (good deal )/ | 2022-03-28 12:13 | - | |
| keep 4810t or get one of these/ | 2022-03-28 12:13 | - | |
| keyboard fault/ | 2022-03-28 12:13 | - | |
| keyboard hijacks trackpad/ | 2022-03-28 12:13 | - | |
| keyboard layout messed up/ | 2022-03-28 12:13 | - | |
| keyboard malfunction/ | 2022-03-28 12:13 | - | |
| keyboard problem in 5943g/ | 2022-03-28 12:13 | - | |
| keyboard replacement 7000 series/ | 2022-03-28 12:13 | - | |
| keyboard replacement on Aspire 3002LCi/ | 2022-03-28 12:13 | - | |
| keyboard woes/ | 2022-03-28 12:13 | - | |
| laptop/ | 2022-03-28 12:13 | - | |
| laptop AS5570-4438 - is it right choice/ | 2022-03-28 12:13 | - | |
| laptop comes out of standby hibernate mode for no reason/ | 2022-03-28 12:13 | - | |
| laptop failes after a while/ | 2022-03-28 12:13 | - | |
| laptop flickering issue/ | 2022-03-28 12:13 | - | |
| laptop hanging/ | 2022-03-28 12:13 | - | |
| laptop just went blank/ | 2022-03-28 12:13 | - | |
| laptop running vista slow/ | 2022-03-28 12:13 | - | |
| laptops vs. tablets/ | 2022-03-28 12:13 | - | |
| laptop switches by itself from standby to hibernation/ | 2022-03-28 12:13 | - | |
| laptop too hot/ | 2022-03-28 12:13 | - | |
| laptop to pc/ | 2022-03-28 12:13 | - | |
| laptop to tv connection/ | 2022-03-28 12:13 | - | |
| laptop upgrade help/ | 2022-03-28 12:13 | - | |
| lates bios for the aspire 5103 wlmi/ | 2022-03-28 12:13 | - | |
| lcd inverter 5920/ | 2022-03-28 12:13 | - | |
| lcd is flickering/ | 2022-03-28 12:13 | - | |
| line-out not working on aspire 5670/ | 2022-03-28 12:13 | - | |
| linux/ | 2022-03-28 12:13 | - | |
| linux on 3201/ | 2022-03-28 12:13 | - | |
| linux on a 8103 Wlmi/ | 2022-03-28 12:13 | - | |
| linux on acer ferrari/ | 2022-03-28 12:13 | - | |
| locked bios = replace mobo/ | 2022-03-28 12:13 | - | |
![[TXT]](/icons/text.gif) | log.txt | 2022-01-29 13:15 | 24M | |
| looking for ACER ASPIRE 8530 owners/ | 2022-03-28 12:13 | - | |
| looking for AS5830T-6496/ | 2022-03-28 12:13 | - | |
| looking for Acer Aspire Timeline AS4810T with intel su9400 cpu/ | 2022-03-28 12:13 | - | |
| looking for an acer/ | 2022-03-28 12:13 | - | |
| looking for information about the Acer Predator 17 G9-793-79PE/ | 2022-03-28 12:13 | - | |
| looking for travelmate 2420 replacement parts/ | 2022-03-28 12:13 | - | |
| looking to buy a 5672 15.4in screen/ | 2022-03-28 12:13 | - | |
| looking to upgrade 8920g cpu/ | 2022-03-28 12:13 | - | |
| loose key on new laptop/ | 2022-03-28 12:13 | - | |
| loss of Fn-F5 switch on XP SP2 upgrade/ | 2022-03-28 12:13 | - | |
| lost bios password/ | 2022-03-28 12:13 | - | |
| lost hard drive space/ | 2022-03-28 12:13 | - | |
| lost menu bar and strange box appeared/ | 2022-03-28 12:13 | - | |
| lost most windows applications after restoring/ | 2022-03-28 12:13 | - | |
| m.2 SSD type for Acer Predator 17 G9-793/ | 2022-03-28 12:13 | - | |
| mSATA SSD on Aspire 5920G possible/ | 2022-03-28 12:14 | - | |
| m_a_t_s_h_i_t_a UJ-845 dont read CD DVD (R-RW)/ | 2022-03-28 12:14 | - | |
| make aspire 5532 faster/ | 2022-03-28 12:13 | - | |
| making aspire 6920g faster/ | 2022-03-28 12:13 | - | |
| manual/ | 2022-03-28 12:13 | - | |
| maximum ram speed for predator 17 X/ | 2022-03-28 12:13 | - | |
| max memory for extensa 4620-4605/ | 2022-03-28 12:13 | - | |
| mbr backup file/ | 2022-03-28 12:13 | - | |
| mbr contains probably unknown TSR.BOOT virus/ | 2022-03-28 12:13 | - | |
| mbrwrwin.exe and rtmbr.bin required for Acer 5735/ | 2022-03-28 12:13 | - | |
| media buttons on 5920/ | 2022-03-28 12:13 | - | |
| media center remote for 5290g/ | 2022-03-28 12:13 | - | |
| media panel volume not working 6920g/ | 2022-03-28 12:13 | - | |
| memory 5315/ | 2022-03-28 12:13 | - | |
| memory board/ | 2022-03-28 12:13 | - | |
| memory card reader on my acer laptop/ | 2022-03-28 12:13 | - | |
| memory falling/ | 2022-03-28 12:13 | - | |
| memory slots in Acer Aspire 1352LC/ | 2022-03-28 12:13 | - | |
| memory upgrade/ | 2022-03-28 12:13 | - | |
| memory upgrade advice for travelmate8215/ | 2022-03-28 12:13 | - | |
| memory upgrade aspire 5020/ | 2022-03-28 12:13 | - | |
| memory upgrade on acer 4001/ | 2022-03-28 12:13 | - | |
| memtest errors/ | 2022-03-28 12:13 | - | |
| merom upgrade for core duo/ | 2022-03-28 12:13 | - | |
| mini TV card for acer 1802/ | 2022-03-28 12:13 | - | |
| mini pci card/ | 2022-03-28 12:13 | - | |
| mini wireless cards/ | 2022-03-28 12:13 | - | |
| missing harddisk space for ACER Travelmate 6292/ | 2022-03-28 12:13 | - | |
| missing lan/ | 2022-03-28 12:13 | - | |
| missing webcam shortcut in desktop&windows explorer on my acer aspire note book/ | 2022-03-28 12:13 | - | |
| mobile meter/ | 2022-03-28 12:13 | - | |
| mobility radeon 3650 overheating/ | 2022-03-28 12:13 | - | |
| modded catalyst 9.12 for HD4330 and others/ | 2022-03-28 12:13 | - | |
| modded driver for 9650M GT in a aspire 8930G/ | 2022-03-28 12:13 | - | |
| modding insyde bios for overclocking/ | 2022-03-28 12:13 | - | |
| model differences 5920-6661 -6582/ | 2022-03-28 12:13 | - | |
| modem connection problems/ | 2022-03-28 12:13 | - | |
| modem driver for aspire 3680/ | 2022-03-28 12:13 | - | |
| mom.exe !!/ | 2022-03-28 12:13 | - | |
| monitoring temperature/ | 2022-03-28 12:13 | - | |
| more clues to F4005 issues/ | 2022-03-28 12:13 | - | |
| more memory for 1804wsmi (and new bios v2.90 out)/ | 2022-03-28 12:13 | - | |
| motherboard for 5738zg/ | 2022-03-28 12:13 | - | |
| motherboard information/ | 2022-03-28 12:14 | - | |
| multi-processor with XP Home/ | 2022-03-28 12:14 | - | |
| music recording and my acer 4520-ideas anyone/ | 2022-03-28 12:14 | - | |
| mxm vbios mod for AS6920g/ | 2022-03-28 12:14 | - | |
| my 1681 has stereo speakers/ | 2022-03-28 12:14 | - | |
| my 3610 acre aspire/ | 2022-03-28 12:14 | - | |
| my 5672 slows down to a grind out of the blue/ | 2022-03-28 12:14 | - | |
| my 5920G keyboard is ticking me off!/ | 2022-03-28 12:14 | - | |
| my Acer 5920G problems/ | 2022-03-28 12:14 | - | |
| my Aspire 3680 switched to XP!/ | 2022-03-28 12:14 | - | |
| my acer 3500 laptop wont turn on/ | 2022-03-28 12:14 | - | |
| my acer 6530g broken/ | 2022-03-28 12:14 | - | |
| my acer 6935g isnt working/ | 2022-03-28 12:14 | - | |
| my acer aspire 5742g goes to the startup repair screen/ | 2022-03-28 12:14 | - | |
| my acer aspire 6930G GPU/ | 2022-03-28 12:14 | - | |
| my acer as will not connect to my internet using my modem/ | 2022-03-28 12:14 | - | |
| my acer warrinty sticker problem..pleaseee help..there must be an option for me here/ | 2022-03-28 12:14 | - | |
| my laptopaspire 5738gis crashing can any one help/ | 2022-03-28 12:14 | - | |
| my laptop is finally mine/ | 2022-03-28 12:14 | - | |
| my mose pointer is jumping frequently/ | 2022-03-28 12:14 | - | |
| my new Acer 5630/ | 2022-03-28 12:14 | - | |
| my new acer 5610z , need help!/ | 2022-03-28 12:14 | - | |
| my programs keep closing/ | 2022-03-28 12:14 | - | |
| my screen is vibrating/ | 2022-03-28 12:14 | - | |
| my upgraded travelmate 2300...its great!/ | 2022-03-28 12:14 | - | |
| nVIDIA drivers shootout - 30 version tested!/ | 2022-03-28 12:14 | - | |
| nVIDIA driver update problem! Help!!!/ | 2022-03-28 12:14 | - | |
| nViDiA Quadro 1700 on 6920G/ | 2022-03-28 12:14 | - | |
| nVidia 8400 8600 GPU Defect/ | 2022-03-28 12:14 | - | |
| nVidia 9650M GT with aspire 5920g problem/ | 2022-03-28 12:14 | - | |
| nVidia GeForce 8600M GT 256MB MXM upgrade problem/ | 2022-03-28 12:14 | - | |
| nd some help here -(/ | 2022-03-28 12:14 | - | |
| need ATI 4670 driver/ | 2022-03-28 12:14 | - | |
| need Help!!can't install acer framework at my acer travelmate 3270/ | 2022-03-28 12:14 | - | |
| need XP inf for crystalbrite 15.4 lcd aspire 5315/ | 2022-03-28 12:14 | - | |
| need acer aspire 5100 service manual/ | 2022-03-28 12:14 | - | |
| need advice on buying 5536g 5938g/ | 2022-03-28 12:14 | - | |
| need a new lcd/ | 2022-03-28 12:14 | - | |
| need a recovery cd/ | 2022-03-28 12:14 | - | |
| need aspire 5672 wallpaper/ | 2022-03-28 12:14 | - | |
| need ethernet controller driver for aspire 5610/ | 2022-03-28 12:14 | - | |
| need feedback on this laptop/ | 2022-03-28 12:14 | - | |
| need guide to overclock my acer aspire 4743zg/ | 2022-03-28 12:14 | - | |
| need help!/ | 2022-03-28 12:14 | - | |
| need help -(/ | 2022-03-28 12:14 | - | |
| need help. acer 5920g dead gfx card/ | 2022-03-28 12:14 | - | |
| need help/ | 2022-03-28 12:14 | - | |
| need help Acer 7745G problem/ | 2022-03-28 12:14 | - | |
| need help cracking BIOS PASSWORD on Acer Aspire D260/ | 2022-03-28 12:14 | - | |
| need help finding a cooling pad for my 5672/ | 2022-03-28 12:14 | - | |
| need help in switching to alternate monitor before login/ | 2022-03-28 12:14 | - | |
| need help on Acer aspire 5755/ | 2022-03-28 12:14 | - | |
| need help recording video from webcam while playing music from the computer/ | 2022-03-28 12:14 | - | |
| need help to buy new acer laptop/ | 2022-03-28 12:14 | - | |
| need help to see/ | 2022-03-28 12:14 | - | |
| need help understanding clockgen/ | 2022-03-28 12:14 | - | |
| need help updating bios on 5102/ | 2022-03-28 12:14 | - | |
| need help updating my acer 6920g nvidia graphics card/ | 2022-03-28 12:14 | - | |
| need help w an aspire 5024 (hdd - i think...)/ | 2022-03-28 12:14 | - | |
| need help with TM530/ | 2022-03-28 12:14 | - | |
| need help with acer aspire one Netbook Green light flashing/ | 2022-03-28 12:14 | - | |
| need help with disk/ | 2022-03-28 12:14 | - | |
| need help with laptop keyboard/ | 2022-03-28 12:14 | - | |
| need help with my 5920G webcam/ | 2022-03-28 12:14 | - | |
| need help with my Aspire 5673/ | 2022-03-28 12:14 | - | |
| need help with my aspire one d260 so badly -(/ | 2022-03-28 12:14 | - | |
| need info replacing kboard acer aspire5536/ | 2022-03-28 12:14 | - | |
| need part number for Aspire 3600 series AC adapter/ | 2022-03-28 12:14 | - | |
| need part number for acer aspire 8930g webcam/ | 2022-03-28 12:14 | - | |
| need sata controller driver for win-xp/ | 2022-03-28 12:14 | - | |
| need solitude wallpaper/ | 2022-03-28 12:14 | - | |
| need some advice with this new acer laptop on the market/ | 2022-03-28 12:14 | - | |
| need some help PLEASE!!!/ | 2022-03-28 12:14 | - | |
| need some help with my aspire 3000/ | 2022-03-28 12:14 | - | |
| need to clear hard drive i guess/ | 2022-03-28 12:14 | - | |
| need to find best Graphics card for Acer notebook/ | 2022-03-28 12:14 | - | |
| need to reinstall Acer Aspire 1640Z Win XP/ | 2022-03-28 12:14 | - | |
| need urgent help/ | 2022-03-28 12:14 | - | |
| need win-xp drivers for aspire 3050/ | 2022-03-28 12:14 | - | |
| new 3930G/ | 2022-03-28 12:14 | - | |
| new 5672 purchaser and former overclocker/ | 2022-03-28 12:14 | - | |
| new 5672 x1600 benchmarks/ | 2022-03-28 12:14 | - | |
| new 5920 Bios update/ | 2022-03-28 12:14 | - | |
| new 6920g asks for password on startup/ | 2022-03-28 12:14 | - | |
| new 8930G missing the full stop!/ | 2022-03-28 12:14 | - | |
| new Acer ultra portable/ | 2022-03-28 12:14 | - | |
| new Atheros5007EG driver for XP!!!/ | 2022-03-28 12:14 | - | |
| new High Definition Audio v2.34/ | 2022-03-28 12:14 | - | |
| new Realtek driver (5242)/ | 2022-03-28 12:14 | - | |
| new acer 4103 travelmate/ | 2022-03-28 12:14 | - | |
| new acer user with aod250 netbook! need 6 cell battery from ebay please help -)/ | 2022-03-28 12:14 | - | |
| new aspire 1705 smi/ | 2022-03-28 12:14 | - | |
| newbie computer dolt needs direction...Acer1/ | 2022-03-28 12:14 | - | |
| newbie first question/ | 2022-03-28 12:14 | - | |
| newbie questions pls help/ | 2022-03-28 12:14 | - | |
| newbie with a problem/ | 2022-03-28 12:14 | - | |
| newegg.com no longer carrys the 5672wlmi!/ | 2022-03-28 12:14 | - | |
| new extensa 5620 problems/ | 2022-03-28 12:14 | - | |
| new gemstone 5920g !/ | 2022-03-28 12:14 | - | |
| new gravisense 1.0.0.10/ | 2022-03-28 12:14 | - | |
| new hard drive partitioning/ | 2022-03-28 12:14 | - | |
| new here ~~ acer 5920 restoring to factory settings problem/ | 2022-03-28 12:14 | - | |
| new keyboard for 5102/ | 2022-03-28 12:14 | - | |
| new laptop..old vga driver version !!!/ | 2022-03-28 12:14 | - | |
| new laptop/ | 2022-03-28 12:14 | - | |
| new laptop any good/ | 2022-03-28 12:14 | - | |
| new laptop opinion/ | 2022-03-28 12:14 | - | |
| new member, new laptop need help!!/ | 2022-03-28 12:14 | - | |
| new motherboard for 5720/ | 2022-03-28 12:14 | - | |
| new mouse no work on Acer/ | 2022-03-28 12:14 | - | |
| newpie question in acer batter/ | 2022-03-28 12:14 | - | |
| new synaptics driver for 5920G/ | 2022-03-28 12:14 | - | |
| new timelinex laptops... No removable battery/ | 2022-03-28 12:14 | - | |
| new to laptops/ | 2022-03-28 12:14 | - | |
| new to this MB, just bought Acer 1681WLMi/ | 2022-03-28 12:14 | - | |
| new touchpad for Acer Travelmate 2490/ | 2022-03-28 12:14 | - | |
| new user, 6930g questions/ | 2022-03-28 12:14 | - | |
| next ferrari notebook/ | 2022-03-28 12:14 | - | |
| next in the ferrari line/ | 2022-03-28 12:14 | - | |
| nlite slipstream problem/ | 2022-03-28 12:14 | - | |
| no DVD plaback/ | 2022-03-28 12:14 | - | |
| no advanced tab in aspire 3100 BIOS/ | 2022-03-28 12:14 | - | |
| no display and no hardisk activity/ | 2022-03-28 12:14 | - | |
| no more 4500's/ | 2022-03-28 12:14 | - | |
| no more acer laptop/ | 2022-03-28 12:14 | - | |
| no network adapter found under device manager/ | 2022-03-28 12:14 | - | |
| noob has question, acer 6935/ | 2022-03-28 12:14 | - | |
| no operating system found/ | 2022-03-28 12:14 | - | |
| no password to aspire5315/ | 2022-03-28 12:14 | - | |
| no registered JIT debugger was specified/ | 2022-03-28 12:14 | - | |
| no remote/ | 2022-03-28 12:14 | - | |
| norton antivirus/ | 2022-03-28 12:14 | - | |
| no sound/ | 2022-03-28 12:14 | - | |
| not D2D system, eRecovery cannot be installed/ | 2022-03-28 12:14 | - | |
| notebook acer aspire 6920G 9600/ | 2022-03-28 12:14 | - | |
| notebook hardware control vs empowering/ | 2022-03-28 12:14 | - | |
| notebook processor temperature problem/ | 2022-03-28 12:14 | - | |
| notebook slow after Recovery Console Bootfix, please help/ | 2022-03-28 12:14 | - | |
| notebook stuck in hibernation/ | 2022-03-28 12:14 | - | |
| not sure if acer problem/ | 2022-03-28 12:14 | - | |
| not using the battery!/ | 2022-03-28 12:14 | - | |
| no wireless card detected on win7 reinstall/ | 2022-03-28 12:14 | - | |
| ntdlr + pqservice/ | 2022-03-28 12:14 | - | |
| nvidia 9300mgs 256MB vs ati HD36-4650 ddr3 1GB for 5920g/ | 2022-03-28 12:14 | - | |
| nvidia driver for Vista 64bit/ | 2022-03-28 12:14 | - | |
| nvlddmkm.sys BSOD Acer 6920G/ | 2022-03-28 12:14 | - | |
| occasional black flash on 5633 aspire/ | 2022-03-28 12:14 | - | |
| of 6920g notebooks and messenger bags/ | 2022-03-28 12:14 | - | |
| oh crap. please help!/ | 2022-03-28 12:14 | - | |
| oh god.. help, i cant find my drivers!/ | 2022-03-28 12:14 | - | |
| oh no, acer extensa 4620 won't power up!/ | 2022-03-28 12:14 | - | |
| ok, i got my 5920G, what next/ | 2022-03-28 12:14 | - | |
| ok..READY to buy 8200.WHERE/ | 2022-03-28 12:14 | - | |
| one for the ram junkies. 2gb on a 943gml flashing 800mhz modules to run at compatible cas level/ | 2022-03-28 12:14 | - | |
| only 3GB RAM usable in 64bit Win7/ | 2022-03-28 12:14 | - | |
| opening travelmate 800 case/ | 2022-03-28 12:14 | - | |
| opinions on Acer Aspire 4720/ | 2022-03-28 12:14 | - | |
| opinions on TM 4674/ | 2022-03-28 12:14 | - | |
| opinions on a Ferrari 3200 comparison/ | 2022-03-28 12:14 | - | |
| opinions on buying/ | 2022-03-28 12:14 | - | |
| opinons on acer AS3003 WLMI/ | 2022-03-28 12:14 | - | |
| orbicam/ | 2022-03-28 12:14 | - | |
| orbicam HELP!!!/ | 2022-03-28 12:14 | - | |
| orbi cam problem/ | 2022-03-28 12:14 | - | |
| orbicam problem/ | 2022-03-28 12:14 | - | |
| ordinale 3171/ | 2022-03-28 12:14 | - | |
| original partition install problem/ | 2022-03-28 12:14 | - | |
| overclock 7520G/ | 2022-03-28 12:14 | - | |
| overclocking 5650 on 3820TG/ | 2022-03-28 12:14 | - | |
| overclocking 8600M GT/ | 2022-03-28 12:14 | - | |
| overclocking a acer 3003/ | 2022-03-28 12:14 | - | |
| overclocking acer 5050/ | 2022-03-28 12:14 | - | |
| overclocking acer laptop who have SLG8SP556V clock generator/ | 2022-03-28 12:14 | - | |
| overclock su2700 on acer 4810tz - can I/ | 2022-03-28 12:14 | - | |
| overheated Aspire 4935/ | 2022-03-28 12:14 | - | |
| overheating/ | 2022-03-28 12:14 | - | |
| owners of 6920g with 8-cell battery/ | 2022-03-28 12:14 | - | |
| packard bell easynote h5315 xp drivers/ | 2022-03-28 12:14 | - | |
| paint get off the laptop/ | 2022-03-28 12:14 | - | |
| panic! does Aspire 5920G have HDMI/ | 2022-03-28 12:14 | - | |
| partioning using acer eRecovery/ | 2022-03-28 12:14 | - | |
| partitioned hard drive/ | 2022-03-28 12:14 | - | |
| partition ghost/ | 2022-03-28 12:14 | - | |
| partitoning your disk for free/ | 2022-03-28 12:14 | - | |
| parts/ | 2022-03-28 12:14 | - | |
| password erecovery lost/ | 2022-03-28 12:14 | - | |
| password request/ | 2022-03-28 12:14 | - | |
| password reset file/ | 2022-03-28 12:14 | - | |
| pc gaming is naff/ | 2022-03-28 12:14 | - | |
| pci-memory controller/ | 2022-03-28 12:14 | - | |
| pci system error 00E0h on a acer aspire 9410/ | 2022-03-28 12:14 | - | |
| peep then CRASH!!/ | 2022-03-28 12:14 | - | |
| performance problems after 8204 ntfs reinstall/ | 2022-03-28 12:14 | - | |
| pes6 on the acer5100/ | 2022-03-28 12:14 | - | |
| pixel stuck at green color/ | 2022-03-28 12:14 | - | |
| place to buy/ | 2022-03-28 12:14 | - | |
| playing enhanced cd's/ | 2022-03-28 12:14 | - | |
| play music/ | 2022-03-28 12:14 | - | |
| please - I need 6930G original screen saver/ | 2022-03-28 12:14 | - | |
| please advice, recertified laptop/ | 2022-03-28 12:14 | - | |
| please advice me on aspire1681/ | 2022-03-28 12:14 | - | |
| please help!/ | 2022-03-28 12:14 | - | |
| please help! Acer aspire 3682/ | 2022-03-28 12:14 | - | |
| please help! tm 2428 fan always on!/ | 2022-03-28 12:14 | - | |
| please help, fast! 5738G Win7 refuses to boot after bios flash -(/ | 2022-03-28 12:14 | - | |
| please help/ | 2022-03-28 12:14 | - | |
| please help Overlocking 3810TZ/ | 2022-03-28 12:14 | - | |
| please help me!Acer Aspire 5610z problem/ | 2022-03-28 12:14 | - | |
| please help me out....going crazy ! !!!/ | 2022-03-28 12:14 | - | |
| please help me with ACER TravelMate 5513WLMi-how serious/ | 2022-03-28 12:14 | - | |
| please help with my travelmate 2350/ | 2022-03-28 12:14 | - | |
| pls advice(acer 1705)/ | 2022-03-28 12:14 | - | |
| plz give me some opinions on the japanese 13 timelinex 3820!/ | 2022-03-28 12:14 | - | |
| plz help!! NEED TO DOWNGRADE ACER ASPIRE 531 BIOS/ | 2022-03-28 12:14 | - | |
| plz help sensor/ | 2022-03-28 12:14 | - | |
| plz hlp me- problem Acer Aspire 6930G/ | 2022-03-28 12:14 | - | |
| poor battery performance problem 1810T/ | 2022-03-28 12:14 | - | |
| possible to adjust fan speed manually - 8940G/ | 2022-03-28 12:14 | - | |
| possible to lock disable arcade buttons/ | 2022-03-28 12:14 | - | |
| possible to remove film on 4820T bezel/ | 2022-03-28 12:14 | - | |
| possible videocard problem-5920g/ | 2022-03-28 12:14 | - | |
| possibly working 64bit drivers for 6920 and 8920 modem/ | 2022-03-28 12:14 | - | |
| post your 3dmark for the 5672wlmi/ | 2022-03-28 12:14 | - | |
| powering down fault/ | 2022-03-28 12:14 | - | |
| power mgmt for 4420 w XP/ | 2022-03-28 12:14 | - | |
| power on problem (aspire 5630)/ | 2022-03-28 12:14 | - | |
| power problem/ | 2022-03-28 12:14 | - | |
| power problems on ACer Aspire 5315/ | 2022-03-28 12:14 | - | |
| power surge on usb hub/ | 2022-03-28 12:14 | - | |
| pqservice totalled/ | 2022-03-28 12:14 | - | |
| pretty please/ | 2022-03-28 12:14 | - | |
| prices on acer website/ | 2022-03-28 12:14 | - | |
| problem/ | 2022-03-28 12:14 | - | |
| problem acer 5738G power smart with windows 7/ | 2022-03-28 12:14 | - | |
| problemas with temperature/ | 2022-03-28 12:14 | - | |
| problem booting..blue screen/ | 2022-03-28 12:14 | - | |
| problem in image display in acer aspire 5920/ | 2022-03-28 12:14 | - | |
| problem opening cd tray on 5102/ | 2022-03-28 12:14 | - | |
| problems after NTFS conversion/ | 2022-03-28 12:14 | - | |
| problems in upgrading bios/ | 2022-03-28 12:14 | - | |
| problems recovering my aspire 5520/ | 2022-03-28 12:14 | - | |
| problems typing quotation marks- Acer Laptop/ | 2022-03-28 12:14 | - | |
| problems with 2023 and service pack 2/ | 2022-03-28 12:14 | - | |
| problems with acer 4650 shutting down on its self/ | 2022-03-28 12:14 | - | |
| problems with acer aspire 8943G/ | 2022-03-28 12:14 | - | |
| problems with aspire 5670/ | 2022-03-28 12:14 | - | |
| problems with booting Windows after recovery/ | 2022-03-28 12:14 | - | |
| problems with my acer 4720z/ | 2022-03-28 12:14 | - | |
| problems with my new laptop/ | 2022-03-28 12:14 | - | |
| problem with Acer 5670- epower management/ | 2022-03-28 12:14 | - | |
| problem with Acer Aspire 7736z! help/ | 2022-03-28 12:14 | - | |
| problem with Empowering technology/ | 2022-03-28 12:14 | - | |
| problem with Multimedia in 8930/ | 2022-03-28 12:14 | - | |
| problem with WLAN Intel 4965 on Aspire 7720G (Vista Home)/ | 2022-03-28 12:14 | - | |
| problem with acer 5820tg help me!!!/ | 2022-03-28 12:14 | - | |
| problem with acer crystal eye webcam - 8940G/ | 2022-03-28 12:14 | - | |
| problem with acer start up!!!/ | 2022-03-28 12:14 | - | |
| problem with broken memory clips/ | 2022-03-28 12:14 | - | |
| problem with display of travelmate3280/ | 2022-03-28 12:14 | - | |
| problem with dvd drive of acer 5102/ | 2022-03-28 12:14 | - | |
| problem with extended monitor resolution/ | 2022-03-28 12:14 | - | |
| problem with me lap/ | 2022-03-28 12:14 | - | |
| problem with mike on acer 4500 - any advice/ | 2022-03-28 12:14 | - | |
| problem with mouse and keyboad/ | 2022-03-28 12:14 | - | |
| problem with my acer travelmate 2480-2705/ | 2022-03-28 12:14 | - | |
| problem with my aspire 5720z on XP/ | 2022-03-28 12:14 | - | |
| problem with my graphic card/ | 2022-03-28 12:14 | - | |
| problem with my new timelinex 5820/ | 2022-03-28 12:14 | - | |
| problem with my voip acer phone/ | 2022-03-28 12:14 | - | |
| problem with new devices on USB/ | 2022-03-28 12:14 | - | |
| problem with travelmate 351TEV/ | 2022-03-28 12:14 | - | |
| problem with webcam microphone/ | 2022-03-28 12:14 | - | |
| problem with windows 7 installation on aspire 7720g/ | 2022-03-28 12:14 | - | |
| processors and noise/ | 2022-03-28 12:14 | - | |
| processor upgrade on 5920G/ | 2022-03-28 12:14 | - | |
| processor upgrade on aspire 3050-1150/ | 2022-03-28 12:14 | - | |
| proc locked at 800mhz AOD150 netbook/ | 2022-03-28 12:14 | - | |
| program launch manager/ | 2022-03-28 12:14 | - | |
| projector problems/ | 2022-03-28 12:14 | - | |
| put X-Bracket for Nvidia GeForce 8400M GS 256MB on Video Card/ | 2022-03-28 12:14 | - | |
| putting an aspire 6935g motherboard into a 6920g chassis!/ | 2022-03-28 12:14 | - | |
| question about 5920G acer graphics/ | 2022-03-28 12:14 | - | |
| question about 6920g vents, i need help cleaning them/ | 2022-03-28 12:14 | - | |
| question about disabling a proccessor/ | 2022-03-28 12:14 | - | |
| question about laptop external boot w o video card/ | 2022-03-28 12:14 | - | |
| question about opening up laptop/ | 2022-03-28 12:14 | - | |
| question about screen acer 5920/ | 2022-03-28 12:14 | - | |
| question about slow boot time in acer aspire 6930 G/ | 2022-03-28 12:14 | - | |
| questiones about dual booting/ | 2022-03-28 12:14 | - | |
| question for anybody who have aspire 5672/ | 2022-03-28 12:14 | - | |
| question for the aspire specialist/ | 2022-03-28 12:14 | - | |
| question on cpu upgrade on Acer Aspire 4315-2963/ | 2022-03-28 12:14 | - | |
| question on the 5-in-1 card reader/ | 2022-03-28 12:14 | - | |
| question regarding acer aspire 7730g 664g100Mn/ | 2022-03-28 12:14 | - | |
| questions about acer aspire 5920/ | 2022-03-28 12:14 | - | |
| questions about buying Gateway laptop/ | 2022-03-28 12:14 | - | |
| questions about the aspire happy/ | 2022-03-28 12:14 | - | |
| question with AS5100/ | 2022-03-28 12:14 | - | |
| q x9100 in the 8920/ | 2022-03-28 12:14 | - | |
| radeon HD/ | 2022-03-28 12:14 | - | |
| ram interoperability/ | 2022-03-28 12:14 | - | |
| ram pc2-4200 or pc2-5400 on aspire 3003/ | 2022-03-28 12:14 | - | |
| random + signs and windows open up behind/ | 2022-03-28 12:14 | - | |
| rave reviews of Acer Aspire 2020/ | 2022-03-28 12:14 | - | |
| re-installing OS from external devices on Acer Travelmate 4000/ | 2022-03-28 12:14 | - | |
| reactivating the media console/ | 2022-03-28 12:14 | - | |
| reading temps on 5920/ | 2022-03-28 12:14 | - | |
| readyboost + 2 questions/ | 2022-03-28 12:14 | - | |
| really need your help/ | 2022-03-28 12:14 | - | |
| rebuilding aspire 5520 partitions/ | 2022-03-28 12:15 | - | |
| received my 1681/ | 2022-03-28 12:15 | - | |
| recommended a Acer LT to friend, good choice/ | 2022-03-28 12:15 | - | |
| record webcam/ | 2022-03-28 12:15 | - | |
| recovery cd and deleted partitions/ | 2022-03-28 12:15 | - | |
| recovery cd on bootable usb/ | 2022-03-28 12:15 | - | |
| recovery discs able to reinstall windows after dban use/ | 2022-03-28 12:15 | - | |
| recovery disc weird problem/ | 2022-03-28 12:15 | - | |
| recovery partition not work, Acer 5050/ | 2022-03-28 12:15 | - | |
| recovery windows/ | 2022-03-28 12:15 | - | |
| reformat my acer aspire 4715/ | 2022-03-28 12:15 | - | |
| regarding acer 4501/ | 2022-03-28 12:15 | - | |
| regarding acer 5745 laptop/ | 2022-03-28 12:15 | - | |
| reinstalling Win 7 on 1810TZ/ | 2022-03-28 12:15 | - | |
| reinstalling system from scratch/ | 2022-03-28 12:15 | - | |
| remote control 4520/ | 2022-03-28 12:15 | - | |
| removal of acer programs/ | 2022-03-28 12:15 | - | |
| remove a hard drive partition/ | 2022-03-28 12:15 | - | |
| removing bloat from my aspire 7720/ | 2022-03-28 12:15 | - | |
| removing keyboard/ | 2022-03-28 12:15 | - | |
| removing keyboard 9301awsmi/ | 2022-03-28 12:15 | - | |
| repairing Motherboard MOSFET possible/ | 2022-03-28 12:15 | - | |
| replace dvdrw in aspire 9300/ | 2022-03-28 12:15 | - | |
| replace keyboard on travelmate 4ooo/ | 2022-03-28 12:15 | - | |
| replacement AC adapter for Aspire 3003WLCi/ | 2022-03-28 12:15 | - | |
| replacement for 5920/ | 2022-03-28 12:15 | - | |
| replacement screen for 4736Z/ | 2022-03-28 12:15 | - | |
| replace or open Acer 8204 battery/ | 2022-03-28 12:15 | - | |
| replacing DVD CD-RW compo i Travelmate 290/ | 2022-03-28 12:15 | - | |
| replacing acer 5570 battery'/ | 2022-03-28 12:15 | - | |
| replacing an lcd on aspire 5315/ | 2022-03-28 12:15 | - | |
| replacing combo drive - heavy task/ | 2022-03-28 12:15 | - | |
| replacing hard drive on Acer 3201/ | 2022-03-28 12:15 | - | |
| replacing my optical drive (help)/ | 2022-03-28 12:15 | - | |
| replacing the su2700/ | 2022-03-28 12:15 | - | |
| replacing top lid on acer extensa 5420/ | 2022-03-28 12:15 | - | |
| replacing tray=load drive with slot-load drive/ | 2022-03-28 12:15 | - | |
| re recovery disc transfer from cds to dvd/ | 2022-03-28 12:14 | - | |
| resetting the cmos battery on a 69xx series/ | 2022-03-28 12:15 | - | |
| right side of screen black/ | 2022-03-28 12:15 | - | |
| rmclock/ | 2022-03-28 12:15 | - | |
| rmclock and the 1810tz/ | 2022-03-28 12:15 | - | |
| rotating video/ | 2022-03-28 12:15 | - | |
| rubber feet on 2025/ | 2022-03-28 12:15 | - | |
| saully/ | 2022-03-28 12:15 | - | |
| screen calibration/ | 2022-03-28 12:15 | - | |
| screen dims down for some reason (4810t)/ | 2022-03-28 12:15 | - | |
| screen gone/ | 2022-03-28 12:15 | - | |
| screen problem in Acer ASPIRE 5920/ | 2022-03-28 12:15 | - | |
| screen problem on my aspire 5920G/ | 2022-03-28 12:15 | - | |
| screen size problems/ | 2022-03-28 12:15 | - | |
| screen type on the 5100-5674/ | 2022-03-28 12:15 | - | |
| sd card won't respond in autoplay/ | 2022-03-28 12:15 | - | |
| searching for drivers/ | 2022-03-28 12:15 | - | |
| second hand aspire 5738/ | 2022-03-28 12:15 | - | |
| second mini-pcie in BB as5920g/ | 2022-03-28 12:15 | - | |
| security warning while i have mcafee anti spyware/ | 2022-03-28 12:15 | - | |
| seek recommendation of video card for non-gamer/ | 2022-03-28 12:15 | - | |
| selactivity/ | 2022-03-28 12:15 | - | |
| sell trade or... my laptop/ | 2022-03-28 12:15 | - | |
| sending whole laptop or dvd drive only/ | 2022-03-28 12:15 | - | |
| sensitivity/ | 2022-03-28 12:15 | - | |
| service/ | 2022-03-28 12:15 | - | |
| service manual 7720G/ | 2022-03-28 12:15 | - | |
| service manual for acer/ | 2022-03-28 12:15 | - | |
| service manual for aspire 1800/ | 2022-03-28 12:15 | - | |
| service tag number/ | 2022-03-28 12:15 | - | |
| several cracks in my lcd/ | 2022-03-28 12:15 | - | |
| shall i buy acer 6930/ | 2022-03-28 12:15 | - | |
| shared video memory 5634/ | 2022-03-28 12:15 | - | |
| short circuit-damaged adapter/ | 2022-03-28 12:15 | - | |
| should I RMA this/ | 2022-03-28 12:15 | - | |
| should i buy Aspire 6930/ | 2022-03-28 12:15 | - | |
| should i buy dis/ | 2022-03-28 12:15 | - | |
| should i buy the acer 8930G/ | 2022-03-28 12:15 | - | |
| shredder/ | 2022-03-28 12:15 | - | |
| shutting down alot/ | 2022-03-28 12:15 | - | |
| skins or protectors for the AA1/ | 2022-03-28 12:15 | - | |
| slow transfer of files/ | 2022-03-28 12:15 | - | |
| solder mxm slot onto Acer Aspire 5315/ | 2022-03-28 12:15 | - | |
| some advice needed/ | 2022-03-28 12:15 | - | |
| some questions about acer/ | 2022-03-28 12:15 | - | |
| something weird about this timeline/ | 2022-03-28 12:15 | - | |
| sonoma 3200 when/ | 2022-03-28 12:15 | - | |
| sony k17 vs. acer 3000--HELP!!!/ | 2022-03-28 12:15 | - | |
| sound driver + XP SP3 trouble!/ | 2022-03-28 12:15 | - | |
| sound driver aspire 5315/ | 2022-03-28 12:15 | - | |
| sound level travelmate 3273/ | 2022-03-28 12:15 | - | |
| sound of acer TM 4601WLMi/ | 2022-03-28 12:15 | - | |
| sound on aspire 5530G etc/ | 2022-03-28 12:15 | - | |
| sound problems with aspire 7520g and win7/ | 2022-03-28 12:15 | - | |
| sounds & mic/ | 2022-03-28 12:15 | - | |
| souping up a 9920G/ | 2022-03-28 12:15 | - | |
| space trouble/ | 2022-03-28 12:15 | - | |
| speaker probelm/ | 2022-03-28 12:15 | - | |
| speaker problem/ | 2022-03-28 12:15 | - | |
| specs-Acer AS5101/ | 2022-03-28 12:15 | - | |
| speculation on acer travelmate 8104/ | 2022-03-28 12:15 | - | |
| speedstep not working on aspire 2025/ | 2022-03-28 12:15 | - | |
| spillage i think do i need a new mobl or wat/ | 2022-03-28 12:15 | - | |
| splinter cell double agent on the 5672wlmi/ | 2022-03-28 12:15 | - | |
| squeeze 5920g/ | 2022-03-28 12:15 | - | |
| stiff lid/ | 2022-03-28 12:15 | - | |
| stop the hard drive thrashing in vista/ | 2022-03-28 12:15 | - | |
| strange 9600m gt for acer/ | 2022-03-28 12:15 | - | |
| strange sound/ | 2022-03-28 12:15 | - | |
| street fighter 4 on acer aspire 6920/ | 2022-03-28 12:15 | - | |
| stripped screw in 3820TG (or any acer stripped screw advice would help)/ | 2022-03-28 12:15 | - | |
| stuck trackpad mousepad button on AS1410/ | 2022-03-28 12:15 | - | |
| subwoofer on which Acer models/ | 2022-03-28 12:15 | - | |
| suggest online store for 1830T/ | 2022-03-28 12:15 | - | |
| switchable graphics problem/ | 2022-03-28 12:15 | - | |
| switch on my wlan - how/ | 2022-03-28 12:15 | - | |
| system clock acting weird. 3820TG/ | 2022-03-28 12:15 | - | |
| system cmos checksum bad/ | 2022-03-28 12:15 | - | |
| system partition question/ | 2022-03-28 12:15 | - | |
| system password keyboard error/ | 2022-03-28 12:15 | - | |
| t8300/ | 2022-03-28 12:15 | - | |
| t9300 on 6920g causing overheat/ | 2022-03-28 12:15 | - | |
| temperature utility suggestions/ | 2022-03-28 12:15 | - | |
| the 'lets tweak my 5920G' thread!/ | 2022-03-28 12:15 | - | |
| the 3810 with 3430!/ | 2022-03-28 12:15 | - | |
| the ACER Aspire AS1522LMi-XPP/ | 2022-03-28 12:15 | - | |
| the acer aspire 6920g music thing on the left wont work/ | 2022-03-28 12:15 | - | |
| the difference between travelmates/ | 2022-03-28 12:15 | - | |
| the ferrari 5000 is hot... good and bad/ | 2022-03-28 12:15 | - | |
| the most silent notebook/ | 2022-03-28 12:15 | - | |
| the new gemstone range/ | 2022-03-28 12:15 | - | |
| the new nvidia driver for battlefield 3/ | 2022-03-28 12:15 | - | |
| the powrfull of acer notebook/ | 2022-03-28 12:15 | - | |
| thermal conductive pad in Acer Aspire 5584/ | 2022-03-28 12:15 | - | |
| thermal pads acer 6930g/ | 2022-03-28 12:15 | - | |
| the screen of the 5739G/ | 2022-03-28 12:15 | - | |
| thickness of copper shim(GPU) for Aspire 4937G/ | 2022-03-28 12:15 | - | |
| thing about buy this acer/ | 2022-03-28 12:15 | - | |
| things to do when u get ur brand new laptop/ | 2022-03-28 12:15 | - | |
| this is not an acer system message/ | 2022-03-28 12:15 | - | |
| thoughts comments on Aspire 7741z-5731/ | 2022-03-28 12:15 | - | |
| thoughts on the new aspire AS5740G-6979 i5 laptop/ | 2022-03-28 12:15 | - | |
| timeline 3810T not recognising iPhone/ | 2022-03-28 12:15 | - | |
| timeline 4810T fan always on/ | 2022-03-28 12:15 | - | |
| timeline 5810T AC adapter damaged/ | 2022-03-28 12:15 | - | |
| timeline refurbs or open box/ | 2022-03-28 12:15 | - | |
| tl-64 only showing up 789mhz in windows properties/ | 2022-03-28 12:15 | - | |
| tm3002 ddr2 533, 667 compatible/ | 2022-03-28 12:15 | - | |
| tm3201 vs vaio s vs t42/ | 2022-03-28 12:15 | - | |
| to all acer aspire 2020 series owners need youhelp/ | 2022-03-28 12:15 | - | |
| toggle wifi with 8920/ | 2022-03-28 12:15 | - | |
| top 10 anti virus software with no problems on a acer aspire 5920g/ | 2022-03-28 12:15 | - | |
| toshiba satellite A40-SP151/ | 2022-03-28 12:15 | - | |
| touchapd driver/ | 2022-03-28 12:15 | - | |
| touch pad/ | 2022-03-28 12:15 | - | |
| touchpad button inop/ | 2022-03-28 12:15 | - | |
| touchpad is locked and mouse is not working---help me please/ | 2022-03-28 12:15 | - | |
| touchpad not working/ | 2022-03-28 12:15 | - | |
| touchpad problems on aspire 2025/ | 2022-03-28 12:15 | - | |
| to upgrade or not to upgrade/ | 2022-03-28 12:15 | - | |
| trailing lines in the monitor of an ACER laptop/ | 2022-03-28 12:15 | - | |
| trashbin/ | 2022-03-28 12:15 | - | |
| travelmate 240/ | 2022-03-28 12:15 | - | |
| travel mate 250 HDD not detected in bios/ | 2022-03-28 12:15 | - | |
| travelmate 250 bios recovery/ | 2022-03-28 12:15 | - | |
| travelmate 290 xvi/ | 2022-03-28 12:15 | - | |
| travelmate 802 vs. aspire 2012LMi/ | 2022-03-28 12:15 | - | |
| travelmate 2000/ | 2022-03-28 12:15 | - | |
| travelmate 2300/ | 2022-03-28 12:15 | - | |
| travelmate 2356XM Keyboard not working/ | 2022-03-28 12:15 | - | |
| travelmate 2410 LCD/ | 2022-03-28 12:15 | - | |
| travelmate 2413lci HELP/ | 2022-03-28 12:15 | - | |
| travelmate 2490 need a backup file/ | 2022-03-28 12:15 | - | |
| travelmate 2500 recovery after hdd failure problem/ | 2022-03-28 12:15 | - | |
| travelmate 3000 (3002wtci) too noisy/ | 2022-03-28 12:15 | - | |
| travelmate 3004 not boot/ | 2022-03-28 12:15 | - | |
| travelmate 3200 heat problem/ | 2022-03-28 12:15 | - | |
| travelmate 3201xmi review - my initial thoughts/ | 2022-03-28 12:15 | - | |
| travelmate 4000/ | 2022-03-28 12:15 | - | |
| travelmate4000/ | 2022-03-28 12:15 | - | |
| travelmate 4010/ | 2022-03-28 12:15 | - | |
| travelmate 4500, seeking reviews for new purchase/ | 2022-03-28 12:15 | - | |
| travelmate 4502 bluetooth/ | 2022-03-28 12:15 | - | |
| travelmate 4504LMi any last comments, suggestions/ | 2022-03-28 12:15 | - | |
| travelmate 4602/ | 2022-03-28 12:15 | - | |
| travelmate 5510 bios menu problem/ | 2022-03-28 12:15 | - | |
| travelmate 5520-5568/ | 2022-03-28 12:15 | - | |
| travelmate 5520g mircophone through speakers/ | 2022-03-28 12:15 | - | |
| travelmate 6293/ | 2022-03-28 12:15 | - | |
| travelmate 6463 vista upgradeand ercovery/ | 2022-03-28 12:15 | - | |
| travelmate 8100 touchpad pain/ | 2022-03-28 12:15 | - | |
| travelmate 8210 and ferrari 5000/ | 2022-03-28 12:15 | - | |
| travelmate 8371 - owners lounge/ | 2022-03-28 12:15 | - | |
| travelmate audio/ | 2022-03-28 12:15 | - | |
| travelmate c110 restore problem/ | 2022-03-28 12:15 | - | |
| travelmate touchpad does not work/ | 2022-03-28 12:15 | - | |
| troubles after clean xp pro install - 5672wlmi/ | 2022-03-28 12:15 | - | |
| troubles in power button on my acer aspire 5580 laptop/ | 2022-03-28 12:15 | - | |
| trouble watching DVD-Rs burned my Acer TM4501/ | 2022-03-28 12:15 | - | |
| trying to get dos aspi usb driver to recognize my other usb hdd and flash stick/ | 2022-03-28 12:15 | - | |
| trying to restore acer aspire 5320 to factory settings/ | 2022-03-28 12:15 | - | |
| trying to upgrade acer aspire 2026.wireless card.help/ | 2022-03-28 12:15 | - | |
| tsstcorp cd dvdw ts-l632d ata device/ | 2022-03-28 12:15 | - | |
| turbo cache video card for 5920/ | 2022-03-28 12:15 | - | |
| turion 3000 running kinda slow/ | 2022-03-28 12:15 | - | |
| turion tl50 to tl60 will i notice much difference/ | 2022-03-28 12:15 | - | |
| turn off the luminous logo/ | 2022-03-28 12:15 | - | |
| two-finger scroll on 6920g -)/ | 2022-03-28 12:15 | - | |
| two external monitors (1810 Timeline)/ | 2022-03-28 12:15 | - | |
| two problems with new machine/ | 2022-03-28 12:15 | - | |
| uhh guys....please help haha/ | 2022-03-28 12:16 | - | |
| unable to read blu-ray on Acer 6920g !! please help/ | 2022-03-28 12:16 | - | |
| unable to reformat my acer 5315/ | 2022-03-28 12:16 | - | |
| unable to turn travelmate 2500 after attempting to insert USB HELP !/ | 2022-03-28 12:16 | - | |
| underclocking Aspire 3000/ | 2022-03-28 12:16 | - | |
| undervolting 6920g/ | 2022-03-28 12:16 | - | |
| uneven speakers/ | 2022-03-28 12:16 | - | |
| uninstall Vista from ACER extensa 5210/ | 2022-03-28 12:16 | - | |
| uninstalling acer empower technology/ | 2022-03-28 12:16 | - | |
| unknown device after vista installation and rapid decrease in battery life in aspire 5672/ | 2022-03-28 12:16 | - | |
| unlock TME and PLL fsb 200-266 acer 6930g/ | 2022-03-28 12:16 | - | |
| unplugging power during backup/ | 2022-03-28 12:16 | - | |
| update my acer timeline/ | 2022-03-28 12:16 | - | |
| update on my 1681/ | 2022-03-28 12:16 | - | |
| updating driver for the x700/ | 2022-03-28 12:16 | - | |
| upgradation for acer aspire 5745G/ | 2022-03-28 12:16 | - | |
| upgrade 5920/ | 2022-03-28 12:16 | - | |
| upgrade Acer 5920G to Intel Core 2 Duo T8100/ | 2022-03-28 12:16 | - | |
| upgrade CPU in Aspire 6930g/ | 2022-03-28 12:16 | - | |
| upgrade acer 5738g/ | 2022-03-28 12:16 | - | |
| upgrade acer aspire 5315-100508mi/ | 2022-03-28 12:16 | - | |
| upgrade aspire 1700/ | 2022-03-28 12:16 | - | |
| upgrade bios ACER 5920g black screen/ | 2022-03-28 12:16 | - | |
| upgrade cpu on 4810t timeline/ | 2022-03-28 12:16 | - | |
| upgraded my 5102 cpu but comes up unknown unknown processor/ | 2022-03-28 12:16 | - | |
| upgrade graphics card/ | 2022-03-28 12:16 | - | |
| upgrade hard drive of Acer 5100/ | 2022-03-28 12:16 | - | |
| upgrade memory/ | 2022-03-28 12:16 | - | |
| upgrade options/ | 2022-03-28 12:16 | - | |
| upgrade problems with travelmate 6410/ | 2022-03-28 12:16 | - | |
| upgrade proccesor 1801/ | 2022-03-28 12:16 | - | |
| upgrade ram acer 7741g-6426/ | 2022-03-28 12:16 | - | |
| upgrade to dvd super multi/ | 2022-03-28 12:16 | - | |
| upgrade vga card acer 6930g/ | 2022-03-28 12:16 | - | |
| upgrade video card/ | 2022-03-28 12:16 | - | |
| upgrade vista acer aspire 8920G to windows 7/ | 2022-03-28 12:16 | - | |
| upgrading 8920 TV-mpci slot with micro SD mini-Card adapter/ | 2022-03-28 12:16 | - | |
| upgrading Acer Aspire 7720-4428/ | 2022-03-28 12:16 | - | |
| upgrading Memory... Acer 5100... wacky specs/ | 2022-03-28 12:16 | - | |
| upgrading T5250 to a T7700/ | 2022-03-28 12:16 | - | |
| upgrading acer laptop aspire 4920g graphics/ | 2022-03-28 12:16 | - | |
| upgrading aspire 5315 bios getting verify error/ | 2022-03-28 12:16 | - | |
| upgrading bios repairing acer aspire 5920g laptop/ | 2022-03-28 12:16 | - | |
| upgrading drivers/ | 2022-03-28 12:16 | - | |
| upgrading hhd in 6920g/ | 2022-03-28 12:16 | - | |
| upgrading my aspire 6920g/ | 2022-03-28 12:16 | - | |
| upgrading old laptop/ | 2022-03-28 12:16 | - | |
| upgrading ram on aspire 2025/ | 2022-03-28 12:16 | - | |
| upgrading ram plz help/ | 2022-03-28 12:16 | - | |
| upgrading sd flash card capacity/ | 2022-03-28 12:16 | - | |
| upon restart after any installation - error loading os/ | 2022-03-28 12:16 | - | |
| urgent Problems with Acer Aspire 6935G Urgent/ | 2022-03-28 12:16 | - | |
| urgent help needed/ | 2022-03-28 12:16 | - | |
| usb2 anybody/ | 2022-03-28 12:16 | - | |
| usb issue/ | 2022-03-28 12:16 | - | |
| usb malfunction during HDD CPU usage/ | 2022-03-28 12:16 | - | |
| user feedback 1810TZ/ | 2022-03-28 12:16 | - | |
| userinit.exe/ | 2022-03-28 12:16 | - | |
| using a mac address in a laptop/ | 2022-03-28 12:16 | - | |
| using bluetooth on ferrari 3200 with a cell phone/ | 2022-03-28 12:16 | - | |
| using partition mawith acer/ | 2022-03-28 12:16 | - | |
| v1.40 is out!!!/ | 2022-03-28 12:16 | - | |
| vBIOS for an overclockable 9300M GS/ | 2022-03-28 12:16 | - | |
| vBIOS recovery possible/ | 2022-03-28 12:16 | - | |
| vBios Mod VN7-593G GTX 1060/ | 2022-03-28 12:16 | - | |
| various questions about TM 4402/ | 2022-03-28 12:16 | - | |
| vbios reset/ | 2022-03-28 12:16 | - | |
| very excessive disk I O activity/ | 2022-03-28 12:16 | - | |
| very noob question/ | 2022-03-28 12:16 | - | |
| very slow dvd burn (hour) on a 3613wlmi (8x)/ | 2022-03-28 12:16 | - | |
| very unhappy/ | 2022-03-28 12:16 | - | |
| vga memory/ | 2022-03-28 12:16 | - | |
| virus scanners and spyware/ | 2022-03-28 12:16 | - | |
| vista 64 bit drivers for aspire 4730/ | 2022-03-28 12:16 | - | |
| vista RC1 has problem with Go 7300/ | 2022-03-28 12:16 | - | |
| vista and office/ | 2022-03-28 12:16 | - | |
| vista and screen savers/ | 2022-03-28 12:16 | - | |
| vista boot log/ | 2022-03-28 12:16 | - | |
| vista driver for acer aspire 5024/ | 2022-03-28 12:16 | - | |
| vista driver for acer aspire 5112/ | 2022-03-28 12:16 | - | |
| vista drivers/ | 2022-03-28 12:16 | - | |
| vista installation have old xp sp2 files under windows(old),if i delete the files or/ | 2022-03-28 12:16 | - | |
| vista takes for ever to shut down or reboot lateley/ | 2022-03-28 12:16 | - | |
| vista to xp/ | 2022-03-28 12:16 | - | |
| vlite question/ | 2022-03-28 12:16 | - | |
| volume buttons dont work on my acer 5044/ | 2022-03-28 12:16 | - | |
| volume control missing from taskbar/ | 2022-03-28 12:16 | - | |
| volume control won't show up on display, help please!/ | 2022-03-28 12:16 | - | |
| volume osd flicker on travelmate 2420/ | 2022-03-28 12:16 | - | |
| wanna reinstall windows XP thus deleting windows VISTA/ | 2022-03-28 12:16 | - | |
| want an Aspire 5745G Bios ROM/ | 2022-03-28 12:16 | - | |
| wanting to upgrade my 5920G/ | 2022-03-28 12:16 | - | |
| want to change HDD/ | 2022-03-28 12:16 | - | |
| want to know stable overclock for 9600gt ddr2/ | 2022-03-28 12:16 | - | |
| want to upgrade 5920G HD - recommendations/ | 2022-03-28 12:16 | - | |
| warning for underclockers on acer laptops/ | 2022-03-28 12:16 | - | |
| warranty issue/ | 2022-03-28 12:16 | - | |
| warranty on replacement laptops/ | 2022-03-28 12:16 | - | |
| watch dvds from hard drive with Acer arcade/ | 2022-03-28 12:16 | - | |
| watching movies on a 3810tz/ | 2022-03-28 12:16 | - | |
| webcam and LAN not working/ | 2022-03-28 12:16 | - | |
| web cam mic help/ | 2022-03-28 12:16 | - | |
| weird 8920G video problem/ | 2022-03-28 12:16 | - | |
| weird PQService partition/ | 2022-03-28 12:16 | - | |
| weird behavior on laptops/ | 2022-03-28 12:16 | - | |
| weird behaviour while using firefox on 4810/ | 2022-03-28 12:16 | - | |
| weird errors and final crash/ | 2022-03-28 12:16 | - | |
| weird grafic card problem on two Acer 5520G/ | 2022-03-28 12:16 | - | |
| weird issue with my new aspire 5741/ | 2022-03-28 12:16 | - | |
| weird problem - volume shortcut keys not working/ | 2022-03-28 12:16 | - | |
| weird problem in acer 5052/ | 2022-03-28 12:16 | - | |
| weird trouble with power supply battery on aspire 3000/ | 2022-03-28 12:16 | - | |
| were does the bluetooth module go in my aspire 5103wmli please/ | 2022-03-28 12:16 | - | |
| what's the 2nd partition for/ | 2022-03-28 12:16 | - | |
| what's the word on 5920G Penryn BIOS updates/ | 2022-03-28 12:16 | - | |
| what RAM do I need for 4810tz/ | 2022-03-28 12:16 | - | |
| what are not working in Acer aspire 8943G/ | 2022-03-28 12:16 | - | |
| what are the general thoughts on 3820tg vs 3830tg/ | 2022-03-28 12:16 | - | |
| what capacity hard drives 8940g/ | 2022-03-28 12:16 | - | |
| what could be the problem/ | 2022-03-28 12:16 | - | |
| what does it look like inside/ | 2022-03-28 12:16 | - | |
| what does the latest BIOS_Acer_1.14_A_AS3810T AS3410 do/ | 2022-03-28 12:16 | - | |
| what else do i uninstall/ | 2022-03-28 12:16 | - | |
| what happend to ftp- ftp.support.acer-euro.com notebook/ | 2022-03-28 12:16 | - | |
| what is/ | 2022-03-28 12:16 | - | |
| what is Acer MediaBay Does 4000 series have it/ | 2022-03-28 12:16 | - | |
| what is SQ partition on hard drive/ | 2022-03-28 12:16 | - | |
| what is a double layer optical drive/ | 2022-03-28 12:16 | - | |
| what is compPtcvui.exe/ | 2022-03-28 12:16 | - | |
| what is the Difference between Aspire 5050 and 5052 motherboard/ | 2022-03-28 12:16 | - | |
| what is the fastest processor i can upgrade my acer 6935g to/ | 2022-03-28 12:16 | - | |
| what is the newest graphic driver for the aspire 6920G/ | 2022-03-28 12:16 | - | |
| what model is better for gamin laptop/ | 2022-03-28 12:16 | - | |
| what model type SSD can i use for Acer Predator G9-793/ | 2022-03-28 12:16 | - | |
| what pre-installed software can I dump/ | 2022-03-28 12:16 | - | |
| what processors can be installed to an acer 8930g/ | 2022-03-28 12:16 | - | |
| what ram for as3690/ | 2022-03-28 12:16 | - | |
| what router would work best with 5920-6273 draft N wifi/ | 2022-03-28 12:16 | - | |
| what software can i remove from 6920/ | 2022-03-28 12:16 | - | |
| whats the best modem to work with the 5920/ | 2022-03-28 12:16 | - | |
| whats the difference/ | 2022-03-28 12:16 | - | |
| what to do with partition files/ | 2022-03-28 12:16 | - | |
| what type of DVD Burner/ | 2022-03-28 12:16 | - | |
| what will happen if i restore system to factory default settings/ | 2022-03-28 12:16 | - | |
| what wireless card to switch to on the 8950g/ | 2022-03-28 12:16 | - | |
| what would cause my start menu items to dissapear/ | 2022-03-28 12:16 | - | |
| when i lost a recovery/ | 2022-03-28 12:16 | - | |
| when i play the sims 2 it doesnt take up the whole screen -(/ | 2022-03-28 12:16 | - | |
| where's the bios/ | 2022-03-28 12:16 | - | |
| where are the minidumps/ | 2022-03-28 12:16 | - | |
| where can I buy a 9 cell battery for acer 4820tg/ | 2022-03-28 12:16 | - | |
| where can I get the Empowering technology software for the ASPIRE 5920G/ | 2022-03-28 12:16 | - | |
| where can i buy new keys for my keyboard/ | 2022-03-28 12:16 | - | |
| where can i download free driver agent/ | 2022-03-28 12:16 | - | |
| where can i found acer 5738G recovery/ | 2022-03-28 12:16 | - | |
| where does this wire go( pics included )/ | 2022-03-28 12:16 | - | |
| where is graphics for Aspire 5672/ | 2022-03-28 12:16 | - | |
| where to buy 3820TG-624G64N/ | 2022-03-28 12:16 | - | |
| where to buy 6920G with t9300 cpu in US/ | 2022-03-28 12:16 | - | |
| where to buy Acer 5820TG/ | 2022-03-28 12:16 | - | |
| where to buy acer parts/ | 2022-03-28 12:16 | - | |
| where to buy acer travelmate 8172 core i5 in the us/ | 2022-03-28 12:16 | - | |
| where to buy in Canada/ | 2022-03-28 12:16 | - | |
| where to download audio 5.1 driver for 8940G/ | 2022-03-28 12:16 | - | |
| where to download free restore disk for acer aspire 5315/ | 2022-03-28 12:16 | - | |
| where to find Napp cd 3.3. Kit/ | 2022-03-28 12:16 | - | |
| where to find Timeline Ultra M3-581TG Driver`s/ | 2022-03-28 12:16 | - | |
| which Intel wireless card is in the Acer Timeline 3810T/ | 2022-03-28 12:16 | - | |
| which SSD in the Acer Timeline 3810T-6775/ | 2022-03-28 12:16 | - | |
| which acer fits the spec/ | 2022-03-28 12:16 | - | |
| which is better acer acade delux or windows media center for the acer aspire 59209/ | 2022-03-28 12:16 | - | |
| which model/ | 2022-03-28 12:16 | - | |
| which one is overall system faster-aspire 3003 or extensa 6601/ | 2022-03-28 12:16 | - | |
| which type of ram is compatible with 4402/ | 2022-03-28 12:16 | - | |
| white screen on 6920g/ | 2022-03-28 12:16 | - | |
| who has the AS5672WLMi-ATI X1600/ | 2022-03-28 12:16 | - | |
| whoooo upgrading completed/ | 2022-03-28 12:16 | - | |
| why buy new then upgrade/ | 2022-03-28 12:16 | - | |
| why can't I find the travelmate 370 series/ | 2022-03-28 12:16 | - | |
| why can't i upgrade BIOS_ACER_1.15 on a lifetime AS3810T/ | 2022-03-28 12:16 | - | |
| why in Acer L100 vista can't recognize full 2G RAM/ | 2022-03-28 12:16 | - | |
| why is my ram clocked to just 100mhz instead of 200mhz and other questions/ | 2022-03-28 12:16 | - | |
| wierd problem with aspire 5102wlmi/ | 2022-03-28 12:16 | - | |
| wierd things running on my 5570/ | 2022-03-28 12:16 | - | |
| wierd wifi problem/ | 2022-03-28 12:16 | - | |
| wifi card question 4810tz/ | 2022-03-28 12:16 | - | |
| wifi doesn't work/ | 2022-03-28 12:16 | - | |
| will a tl-64 cpu overheat in my 5102/ | 2022-03-28 12:16 | - | |
| will installing Ubuntu screw up anything/ | 2022-03-28 12:16 | - | |
| will my Acer ASpire 6930G run Assassin Creed Brotherhood/ | 2022-03-28 12:16 | - | |
| will the 5102 take ddr2 800 memory/ | 2022-03-28 12:16 | - | |
| will the 5735-6694 or 4530+6823 run these games/ | 2022-03-28 12:16 | - | |
| will the T9300 cpu work in Aspire 5315 laptop/ | 2022-03-28 12:16 | - | |
| win2k on ferrari 3200/ | 2022-03-28 12:16 | - | |
| windows 7 and acer netbook/ | 2022-03-28 12:16 | - | |
| windows 7 and skype/ | 2022-03-28 12:16 | - | |
| windows 7 beta driver help please/ | 2022-03-28 12:16 | - | |
| windows 7 drivers for acer 5738g/ | 2022-03-28 12:16 | - | |
| windows 7 on 9500/ | 2022-03-28 12:16 | - | |
| windows 7 upgrade- is the Acer ugrade DVD necessary/ | 2022-03-28 12:16 | - | |
| windows 7 upgrade wont run acer 5517/ | 2022-03-28 12:16 | - | |
| windows 2003 drivers for 5920G/ | 2022-03-28 12:16 | - | |
| windows vista/ | 2022-03-28 12:16 | - | |
| windows vista and my acer laptop problem.plz I want help/ | 2022-03-28 12:16 | - | |
| windows won't load properly/ | 2022-03-28 12:16 | - | |
| windows wont recognize 2nd partition/ | 2022-03-28 12:16 | - | |
| windows xp reinstall problem in Acer 5670/ | 2022-03-28 12:16 | - | |
| wiping 8920 hard drive have questions/ | 2022-03-28 12:16 | - | |
| wireless TravelMate 2480 - how can I make work/ | 2022-03-28 12:16 | - | |
| wireless acer 2200/ | 2022-03-28 12:16 | - | |
| wireless conections/ | 2022-03-28 12:16 | - | |
| wireless not working since installing Windows 7/ | 2022-03-28 12:16 | - | |
| wireless on Aspire 1355LC/ | 2022-03-28 12:16 | - | |
| wireless on aspire 5570 problem/ | 2022-03-28 12:16 | - | |
| wireless problem/ | 2022-03-28 12:16 | - | |
| wireless switch/ | 2022-03-28 12:16 | - | |
| wirless lan/ | 2022-03-28 12:16 | - | |
| wondering if someone on here could help me fix my faulty extensa/ | 2022-03-28 12:16 | - | |
| wonky cinedash/ | 2022-03-28 12:16 | - | |
| wont install vista display driver on 5102/ | 2022-03-28 12:16 | - | |
| wont start/ | 2022-03-28 12:16 | - | |
| working 15 hours a day with my lpatop..any problem/ | 2022-03-28 12:16 | - | |
| working a lot of time on laptop Is Harmful/ | 2022-03-28 12:16 | - | |
| worse problems with aspire 2025/ | 2022-03-28 12:16 | - | |
| worth i5 for 150/ | 2022-03-28 12:16 | - | |
| would like opinions and info on aspire 5720/ | 2022-03-28 12:16 | - | |
| wrong forum delete/ | 2022-03-28 12:16 | - | |
| www.acerdirect.co.uk - good or bad/ | 2022-03-28 12:16 | - | |
| x700 drivers for the aspire 5024/ | 2022-03-28 12:16 | - | |
| x700 w 64mb/ | 2022-03-28 12:16 | - | |
| x1400 in 5672/ | 2022-03-28 12:16 | - | |
| x1600 3dmark05 scores/ | 2022-03-28 12:16 | - | |
| xpert advice needed/ | 2022-03-28 12:16 | - | |
| xp installed into acer aspire 5050-3785/ | 2022-03-28 12:16 | - | |
| xp license/ | 2022-03-28 12:16 | - | |
| xp on a vista acer/ | 2022-03-28 12:16 | - | |
| xp problems on aspire 5315/ | 2022-03-28 12:16 | - | |
| ~ $500 15.6 Notebook- HP ProBook 4510 vs. Aspire® 5517/ | 2022-03-28 12:16 | - | |
| ~2000$ of issues (Acer Predator), story of acception/ | 2022-03-28 12:16 | - | |
|
|---|
