![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | (X-Post) My final update on eMachines M6811 lemon (Hellmanns!!!)/ | 2022-03-28 14:00 | - | |
| 1gb PC2700 for $109/ | 2022-03-28 14:00 | - | |
| 1gb memory for m6809/ | 2022-03-28 14:00 | - | |
| 1gig Memory For Only $114.00/ | 2022-03-28 14:00 | - | |
| 2 issues concerning my M6805/ | 2022-03-28 14:00 | - | |
| 3 year warrenty/ | 2022-03-28 14:00 | - | |
| 6 26- Amusing update on my emachines!/ | 2022-03-28 14:00 | - | |
| 7 10 UPDATE- M6811 woes RESOLVED!/ | 2022-03-28 14:00 | - | |
| 680x and UT2004/ | 2022-03-28 14:00 | - | |
| 5400 or 4200... I got the Hitachi/ | 2022-03-28 14:00 | - | |
| 6805 Full Upgrade/ | 2022-03-28 14:00 | - | |
| 6805 screen went dim/ | 2022-03-28 14:00 | - | |
| 6805 shutdown hibernation issue/ | 2022-03-28 14:00 | - | |
| 6807 wlan not found with Suse 9.2/ | 2022-03-28 14:00 | - | |
| 6809- is this a good cheap gaming notebook/ | 2022-03-28 14:00 | - | |
| 6809 BIOS upgrade/ | 2022-03-28 14:00 | - | |
| 6809 Firewire Audio Problem/ | 2022-03-28 14:00 | - | |
| 6809 Slimtype drive problems/ | 2022-03-28 14:00 | - | |
| 6809 hard drive replacement/ | 2022-03-28 14:00 | - | |
| 6809 now 6811 whats with the name change/ | 2022-03-28 14:00 | - | |
| 6809 output to monitor/ | 2022-03-28 14:00 | - | |
| 6810 Power Issue/ | 2022-03-28 14:00 | - | |
| 6810 no sound, processor changing speed...hinges cracked, flicker/ | 2022-03-28 14:00 | - | |
| 6811 Wireless Speed/ | 2022-03-28 14:00 | - | |
| 6811 now in Canada!/ | 2022-03-28 14:00 | - | |
| 6811 question/ | 2022-03-28 14:00 | - | |
| 7200 hd for m6809/ | 2022-03-28 14:00 | - | |
| 68909 vs. Mayhem G1 for gaming/ | 2022-03-28 14:00 | - | |
| AMD PowerNow installation walkthrough/ | 2022-03-28 14:00 | - | |
| ANyone interested in an ubuntu Linux Howto/ | 2022-03-28 14:00 | - | |
| ATI 9600/ | 2022-03-28 14:00 | - | |
| ATI 9600 Driver Update/ | 2022-03-28 14:00 | - | |
| ATI Catalyst 4.6 drivers/ | 2022-03-28 14:00 | - | |
| Accessing Internal Memory on M6811/ | 2022-03-28 14:00 | - | |
| Anybody change 6809 to 6811...and failed/ | 2022-03-28 14:00 | - | |
| Anyone flashed their emachines BIOS to Gateway/ | 2022-03-28 14:00 | - | |
| Anyone has some feedback on emachine M5405/ | 2022-03-28 14:00 | - | |
| Anyone have a review on the AMD Sempron Emachine/ | 2022-03-28 14:00 | - | |
| Anyone tried the Mobile Athlon 64 4000+/ | 2022-03-28 14:00 | - | |
| BEST BUY/ | 2022-03-28 14:00 | - | |
| BIOS Recovery on eMachines G640g - Crisis Recovery/ | 2022-03-28 14:00 | - | |
| BSoD (Boot Sector Related)/ | 2022-03-28 14:00 | - | |
| Bad Experience and Problems with eMachines Gateway/ | 2022-03-28 14:00 | - | |
| Best Buy has the M6805 for $1499 before rebate!/ | 2022-03-28 14:00 | - | |
| Best Deal For M6809 memory upgrade/ | 2022-03-28 14:00 | - | |
| Bestbuy has $150 rebate again for M6809/ | 2022-03-28 14:00 | - | |
| Bios hack for Emachine e525/ | 2022-03-28 14:00 | - | |
| Booting Problem/ | 2022-03-28 14:00 | - | |
| Booting from USB on M6810, and a possibly dead HDD/ | 2022-03-28 14:00 | - | |
| Booting from external usb question/ | 2022-03-28 14:00 | - | |
| Bought 1GB ram from frys for $159.99 but crashes/ | 2022-03-28 14:00 | - | |
| CNET has been bought by its advertisers!!!/ | 2022-03-28 14:00 | - | |
| Can't get back to 1280x800/ | 2022-03-28 14:00 | - | |
| Can M6805 utilize SATA hard drives/ | 2022-03-28 14:00 | - | |
| Can Thermal Compound Be Used/ | 2022-03-28 14:00 | - | |
| Chance to upgrade to M6809 should I/ | 2022-03-28 14:00 | - | |
| Changing Processor/ | 2022-03-28 14:00 | - | |
| Cheapest Place to Buy M68xx/ | 2022-03-28 14:00 | - | |
| City of Heroes... graphic artifacts/ | 2022-03-28 14:00 | - | |
| Com Ports in Device Manager/ | 2022-03-28 14:00 | - | |
| Contact Emachine Corporate about cracked hinge NOW/ | 2022-03-28 14:00 | - | |
| Cosmetic Cover, any ideas/ | 2022-03-28 14:00 | - | |
| Cracked Hinges Windows MCE/ | 2022-03-28 14:00 | - | |
| Cracked hinge Contact BBB or CA Attorney general!/ | 2022-03-28 14:00 | - | |
| Cracked hinges question/ | 2022-03-28 14:00 | - | |
| Cracked m6809 Hinge FIXED!!!/ | 2022-03-28 14:00 | - | |
| D525 or D725 service manual needed/ | 2022-03-28 14:00 | - | |
| D620 memory upgrade/ | 2022-03-28 14:00 | - | |
| D728 disassemble guide/ | 2022-03-28 14:00 | - | |
| DVD-RW Drive problem! HELP!!/ | 2022-03-28 14:00 | - | |
| DVD-RW upgrade possible in 6805/ | 2022-03-28 14:00 | - | |
| DVD Burner Speed/ | 2022-03-28 14:00 | - | |
| DVD CDRW replacement help/ | 2022-03-28 14:00 | - | |
| DVD burner question/ | 2022-03-28 14:00 | - | |
| DVD drive opening/ | 2022-03-28 14:00 | - | |
| Daily Bluescreens/ | 2022-03-28 14:00 | - | |
| Display Problem with M6811/ | 2022-03-28 14:00 | - | |
| Do I need a surge protector/ | 2022-03-28 14:00 | - | |
| Does Any one know what this is/ | 2022-03-28 14:00 | - | |
| Does the M6811 have a power drop/ | 2022-03-28 14:00 | - | |
| Dont Buy Emachines!/ | 2022-03-28 14:00 | - | |
| Doom 3/ | 2022-03-28 14:00 | - | |
| Drivers for FX P7811/ | 2022-03-28 14:00 | - | |
| Dumb Question/ | 2022-03-28 14:00 | - | |
| E525 display/ | 2022-03-28 14:00 | - | |
| E620 successful upgrades (RAM, CPU, HDD)/ | 2022-03-28 14:00 | - | |
| E625 Upgrade to windows 7/ | 2022-03-28 14:00 | - | |
| E 627 Ram Upgrade/ | 2022-03-28 14:00 | - | |
| E627 upgrading/ | 2022-03-28 14:00 | - | |
| E725 & E525 wont shut down normally in winxp/ | 2022-03-28 14:00 | - | |
| E725 - change graphic video card/ | 2022-03-28 14:00 | - | |
| EMACHINE 6809 PROBLEM/ | 2022-03-28 14:00 | - | |
| EMACHINES M6xxx SERIES HINGE PROBLEM ReverendDC!/ | 2022-03-28 14:00 | - | |
| EMACHINES M2350 OPINIONS PLEASE!/ | 2022-03-28 14:00 | - | |
| EMACHINES ORIGINAL WARRANTY TRANSFERABLE/ | 2022-03-28 14:00 | - | |
| EMachine M6809 LCD Screen Model Manufacturer/ | 2022-03-28 14:00 | - | |
| EMachines 6810 shut down on fan issue/ | 2022-03-28 14:00 | - | |
| EMachines 6811 questions/ | 2022-03-28 14:00 | - | |
| ETA for next Emachines notebook/ | 2022-03-28 14:00 | - | |
| Em 350 Atom always full speed/ | 2022-03-28 14:00 | - | |
| Emachine 6810 stuck in Num Lock/ | 2022-03-28 14:00 | - | |
| Emachine D620 - SSD upgrade/ | 2022-03-28 14:00 | - | |
| Emachine E625 Disasssembly/ | 2022-03-28 14:00 | - | |
| Emachine Sticker Removal/ | 2022-03-28 14:00 | - | |
| Emachines 5312 shutting down/ | 2022-03-28 14:00 | - | |
| Emachines 6809 Wireless G/ | 2022-03-28 14:00 | - | |
| Emachines D620 MS2257 Bios Upgrade/ | 2022-03-28 14:00 | - | |
| Emachines Gateway (M3XX gateway W46XX emachines battery)/ | 2022-03-28 14:00 | - | |
| Emachines M5322/ | 2022-03-28 14:00 | - | |
| Emachines M6805...to fix or to sell and buy a new laptop/ | 2022-03-28 14:00 | - | |
| Emachines M6811 won't boot to windows/ | 2022-03-28 14:00 | - | |
| Emachines Overheat Class Action Suit/ | 2022-03-28 14:00 | - | |
| Emachines and XP PRO/ | 2022-03-28 14:00 | - | |
| Emachines battery life/ | 2022-03-28 14:00 | - | |
| Emachines d620 dimm2 location/ | 2022-03-28 14:00 | - | |
| Emachines heat issues/ | 2022-03-28 14:00 | - | |
| Emachines m5309/ | 2022-03-28 14:00 | - | |
| Experience with external battery/ | 2022-03-28 14:00 | - | |
| Extended Warranty/ | 2022-03-28 14:00 | - | |
| External HD enclosure, M6805/ | 2022-03-28 14:00 | - | |
| FAQ M6805 6807 6809 Updated with pics/ | 2022-03-28 14:00 | - | |
| FYI/ | 2022-03-28 14:00 | - | |
| FYI Fried M6811/ | 2022-03-28 14:00 | - | |
| Feedback-M2350 - $649.97 w Firewire at TigerDirect/ | 2022-03-28 14:00 | - | |
| Files and Settings Transfer Wizard/ | 2022-03-28 14:00 | - | |
| First week with my 6805/ | 2022-03-28 14:00 | - | |
| Flashed 6809 Bios to 0F08.P00/ | 2022-03-28 14:00 | - | |
| Fn-F8 and broken keyboard help for a 6810/ | 2022-03-28 14:00 | - | |
| Forgot Harddisk Password for E725-4520/ | 2022-03-28 14:00 | - | |
| Gateway Equivalent model to eMachines M6811/ | 2022-03-28 14:00 | - | |
| Gateway M-1625 Xp Drivers/ | 2022-03-28 14:00 | - | |
| Gateway T-6836 XP Drivers/ | 2022-03-28 14:00 | - | |
| Gateway emachines, replace headphone jack/ | 2022-03-28 14:00 | - | |
| General Gaming Performance of M68xx Series/ | 2022-03-28 14:00 | - | |
| Gulp! Is it Going to Die/ | 2022-03-28 14:00 | - | |
| HL2 on M680x/ | 2022-03-28 14:00 | - | |
| Hard Drive Replacement/ | 2022-03-28 14:00 | - | |
| Hard Drive Swap Questions/ | 2022-03-28 14:00 | - | |
| Hardware monitoring on M6811/ | 2022-03-28 14:00 | - | |
| Has anyone had problems Emailing Emachines/ | 2022-03-28 14:00 | - | |
| Has anyone heard of the eMachines D730G/ | 2022-03-28 14:00 | - | |
| Help finding ATI Omega Drivers/ | 2022-03-28 14:00 | - | |
| Help resetting 6805 keyboard defaults/ | 2022-03-28 14:00 | - | |
| Help with crappy game graphics on 6805/ | 2022-03-28 14:00 | - | |
| Here is a link showing the internals of the M6805/ | 2022-03-28 14:00 | - | |
| Hinge Cracks/ | 2022-03-28 14:00 | - | |
| Hinge Cracks All 680X models - major design flaw/ | 2022-03-28 14:00 | - | |
| Hinge issues - whar are my options/ | 2022-03-28 14:00 | - | |
| Hitachi 80GB 5400rpm/ | 2022-03-28 14:00 | - | |
| How High A Processor Can M6805 Hold/ | 2022-03-28 14:00 | - | |
| How can I fix the interferance with the touch pad/ | 2022-03-28 14:00 | - | |
| How do I remove an M6809 Keyboard/ | 2022-03-28 14:00 | - | |
| How much Ram/ | 2022-03-28 14:00 | - | |
| How to disable mouse pad/ | 2022-03-28 14:00 | - | |
| How to get new notebook from Best Buy/ | 2022-03-28 14:00 | - | |
| How to get rid o the 800Mhz on batt problem in XP/ | 2022-03-28 14:00 | - | |
| How to loosen screen hinges/ | 2022-03-28 14:00 | - | |
| How to question/ | 2022-03-28 14:00 | - | |
| How to reinstall WinXP when internal DVD drive non-functional/ | 2022-03-28 14:00 | - | |
| I DID IT!/ | 2022-03-28 14:00 | - | |
| I Go Juice Adapter/ | 2022-03-28 14:00 | - | |
| I Need help with my 6809/ | 2022-03-28 14:00 | - | |
| I have a problem somone can help me/ | 2022-03-28 14:00 | - | |
| I just bought an M6811 last night/ | 2022-03-28 14:00 | - | |
| Important M6811 Wireless driver Question/ | 2022-03-28 14:00 | - | |
| I need help w Omega drivers/ | 2022-03-28 14:00 | - | |
| Infinity eMachines Hi-Grade 330 Disassembly/ | 2022-03-28 14:00 | - | |
| In need of Emachine M2105 restore disk/ | 2022-03-28 14:00 | - | |
| Installed a AMD 3400/ | 2022-03-28 14:00 | - | |
| Instructions for M6805/ | 2022-03-28 14:00 | - | |
| Internal replacement drives for M6805 09/ | 2022-03-28 14:00 | - | |
| Is This a Good Deal on M6809/ | 2022-03-28 14:00 | - | |
| Is eMachine a US brand/ | 2022-03-28 14:00 | - | |
| Just Bought M6809/ | 2022-03-28 14:00 | - | |
| Just Purchased M6809 - Installing XP Pro/ | 2022-03-28 14:00 | - | |
| Just a single quick answer needed/ | 2022-03-28 14:00 | - | |
| Just bought the M6805 and a question/ | 2022-03-28 14:00 | - | |
| Just got a M6809/ | 2022-03-28 14:00 | - | |
| Just got my replacement 6811/ | 2022-03-28 14:00 | - | |
| Keyboard Mod [ctrl & Fn]/ | 2022-03-28 14:00 | - | |
| Keyboard Problem/ | 2022-03-28 14:00 | - | |
| Keyboard Spillguard Protector/ | 2022-03-28 14:00 | - | |
| Keyboard covers for M68xx/ | 2022-03-28 14:00 | - | |
| Laptop shuts off. Hard and Randomly/ | 2022-03-28 14:00 | - | |
| Laptop will not load up Vista/ | 2022-03-28 14:00 | - | |
| Latest ATi Catalyst Beta and 64 Vista/ | 2022-03-28 14:00 | - | |
| Linux Newbie - Best Distro for m6809/ | 2022-03-28 14:00 | - | |
| Liteon SDW-431S replacement/ | 2022-03-28 14:00 | - | |
| Longer lasting batteries/ | 2022-03-28 14:00 | - | |
| Looking for PowerDVD/ | 2022-03-28 14:00 | - | |
| Loose Mouse Button/ | 2022-03-28 14:00 | - | |
| Lower than 800MHz on battery/ | 2022-03-28 14:00 | - | |
| M6XXX video problems and omega drivers/ | 2022-03-28 14:00 | - | |
| M68xx/ | 2022-03-28 14:00 | - | |
| M68xx with Radeon 9800/ | 2022-03-28 14:00 | - | |
| M2105/ | 2022-03-28 14:00 | - | |
| M2350 - no serial number - no recovery discs!!/ | 2022-03-28 14:00 | - | |
| M2350 Drivers/ | 2022-03-28 14:00 | - | |
| M2350 IS WORKING LIKE A CHARM/ | 2022-03-28 14:00 | - | |
| M2350 Restore CDs/ | 2022-03-28 14:00 | - | |
| M2350 gaming/ | 2022-03-28 14:00 | - | |
| M2352 No Sound, Drivers installed/ | 2022-03-28 14:00 | - | |
| M2352 Power Supply Issue/ | 2022-03-28 14:00 | - | |
| M5309 vs 6805 which is best value/ | 2022-03-28 14:00 | - | |
| M5310 Screen/ | 2022-03-28 14:00 | - | |
| M5310 fan doesn't start/ | 2022-03-28 14:00 | - | |
| M5312 memory upgrade/ | 2022-03-28 14:00 | - | |
| M6800s and Best Buy/ | 2022-03-28 14:00 | - | |
| M6800 video driver/ | 2022-03-28 14:00 | - | |
| M6805- XP64 Install Experiences/ | 2022-03-28 14:00 | - | |
| M6805. Steps on changing out the memory inside/ | 2022-03-28 14:00 | - | |
| M6805/ | 2022-03-28 14:00 | - | |
| M6805 800mhz on battery.. cant get it to work/ | 2022-03-28 14:00 | - | |
| M6805 Arima W720-K8/ | 2022-03-28 14:00 | - | |
| M6805 BIOS and CPU Upgrade/ | 2022-03-28 14:00 | - | |
| M6805 Case/ | 2022-03-28 14:00 | - | |
| M6805 Clock Speed/ | 2022-03-28 14:00 | - | |
| M6805 Mem upgrade question/ | 2022-03-28 14:00 | - | |
| M6805 OFFICIAL BIOS UPDATE!/ | 2022-03-28 14:00 | - | |
| M6805 display problem- white screen/ | 2022-03-28 14:00 | - | |
| M6805 does not support XP Pro !!!/ | 2022-03-28 14:00 | - | |
| M6805 power supply problem/ | 2022-03-28 14:00 | - | |
| M6805 stuff/ | 2022-03-28 14:00 | - | |
| M6805 with XP Pro64/ | 2022-03-28 14:00 | - | |
| M6805 won't recognize my mouse at start/ | 2022-03-28 14:00 | - | |
| M6809 + Best Buy = the worst headache I've ever had/ | 2022-03-28 14:00 | - | |
| M6809 + Linux/ | 2022-03-28 14:00 | - | |
| M6809 - Processor Question/ | 2022-03-28 14:00 | - | |
| M6809 Bios Update, AMD Powernow! and SP2 UPDATED/ | 2022-03-28 14:00 | - | |
| M6809 Boot from USB/ | 2022-03-28 14:00 | - | |
| M6809 Car Charger/ | 2022-03-28 14:00 | - | |
| M6809 DVD Burner troubles/ | 2022-03-28 14:00 | - | |
| M6809 DVD Drive Problems. Help Please/ | 2022-03-28 14:00 | - | |
| M6809 HDD RPM/ | 2022-03-28 14:00 | - | |
| M 6809 OVERHEATING !!! Help/ | 2022-03-28 14:00 | - | |
| M6809 Optimized/ | 2022-03-28 14:00 | - | |
| M6809 Owners Forum/ | 2022-03-28 14:00 | - | |
| M6809 Power Supply to Battery Lockup/ | 2022-03-28 14:00 | - | |
| M6809 Volume keys/ | 2022-03-28 14:00 | - | |
| M6809 autorestart w o adapter help plz!/ | 2022-03-28 14:00 | - | |
| M6809 availability/ | 2022-03-28 14:00 | - | |
| M6809 memory question/ | 2022-03-28 14:00 | - | |
| M6809 or M6811/ | 2022-03-28 14:00 | - | |
| M6809 upgrade to XPPro doesn't work/ | 2022-03-28 14:00 | - | |
| M6809 wireless/ | 2022-03-28 14:00 | - | |
| M6810 Misery -- Virus and Motherboard Trouble/ | 2022-03-28 14:00 | - | |
| M6811- Mobility Radeon 9600- Graphics Corruption/ | 2022-03-28 14:00 | - | |
| M6811- Problem with battery/ | 2022-03-28 14:00 | - | |
| M6811 - Video card problem/ | 2022-03-28 14:00 | - | |
| M6811- Video problems/ | 2022-03-28 14:00 | - | |
| M6811/ | 2022-03-28 14:00 | - | |
| M6811 CD-RW media/ | 2022-03-28 14:00 | - | |
| M6811 REVIEW PLEASE!/ | 2022-03-28 14:00 | - | |
| M6811 and Vista/ | 2022-03-28 14:00 | - | |
| M6811 and windows 7/ | 2022-03-28 14:00 | - | |
| M6811 antivirus/ | 2022-03-28 14:00 | - | |
| M6811 at Bestbuy.com/ | 2022-03-28 14:00 | - | |
| M6811 benchmarks/ | 2022-03-28 14:00 | - | |
| M6811 graphic driver update/ | 2022-03-28 14:00 | - | |
| M6811 harddrive size/ | 2022-03-28 14:00 | - | |
| M6811 modem/ | 2022-03-28 14:00 | - | |
| M6811 wireless/ | 2022-03-28 14:00 | - | |
| M6811 wireless driver update/ | 2022-03-28 14:00 | - | |
| MacUniverse/ | 2022-03-28 14:00 | - | |
| Media Card Reader Problems/ | 2022-03-28 14:00 | - | |
| Memory Stick Card Reader/ | 2022-03-28 14:00 | - | |
| Memory chipset properties for M6809/ | 2022-03-28 14:00 | - | |
| Mini pci wifi replacement for the 68xx/ | 2022-03-28 14:00 | - | |
| Minor Drivers Issues/ | 2022-03-28 14:00 | - | |
| Mobile AMD64 problem/ | 2022-03-28 14:00 | - | |
| Modem driver problem/ | 2022-03-28 14:00 | - | |
| Motherboard Question/ | 2022-03-28 14:00 | - | |
| Motherboard on m6811/ | 2022-03-28 14:00 | - | |
| My M6809 Crashed!/ | 2022-03-28 14:00 | - | |
| My abused M6807/ | 2022-03-28 14:00 | - | |
| My emachines W4620 review/ | 2022-03-28 14:00 | - | |
| Need A Drive For SCSI/ | 2022-03-28 14:00 | - | |
| Need Driver Help M-2350/ | 2022-03-28 14:00 | - | |
| Need IDT High Def Audio CODEC/ | 2022-03-28 14:00 | - | |
| Need M681x Internal Pictures/ | 2022-03-28 14:00 | - | |
| Need advice on a m6811 for replacement/ | 2022-03-28 14:00 | - | |
| Need driver for my emachine M6810/ | 2022-03-28 14:00 | - | |
| Need external fans b c of overheating/ | 2022-03-28 14:00 | - | |
| Need help with reformatting/ | 2022-03-28 14:00 | - | |
| Need laptop screen/ | 2022-03-28 14:00 | - | |
| Need tech Support via Email/ | 2022-03-28 14:00 | - | |
| Need to know emachines twin/ | 2022-03-28 14:00 | - | |
| New 6810 @ 800 plugged in/ | 2022-03-28 14:00 | - | |
| New M6810 Owner - USB Question/ | 2022-03-28 14:00 | - | |
| Newbie question, i need help!/ | 2022-03-28 14:00 | - | |
| New emachines W4620 Notebook at Wal Mart/ | 2022-03-28 14:00 | - | |
| New line of eMachines Laptops today/ | 2022-03-28 14:00 | - | |
| No More Emachine Notebooks/ | 2022-03-28 14:00 | - | |
| Notebook Turns off...not a fan problem help/ | 2022-03-28 14:00 | - | |
| Oh Hellmans.... remember me (emachines m6811 repair hell update!)/ | 2022-03-28 14:00 | - | |
| Orion the Powernow patch isnt working on my M6809/ | 2022-03-28 14:00 | - | |
| Overclcocking help/ | 2022-03-28 14:00 | - | |
| Overclocking the CPU/ | 2022-03-28 14:00 | - | |
| Overclocking the M6809, 6810, 6811/ | 2022-03-28 14:00 | - | |
| Overheat & Cracked Hinge Covered OUT of Warranty/ | 2022-03-28 14:00 | - | |
| P-6831fx CPU upgrade/ | 2022-03-28 14:00 | - | |
| Permanent fix for hinges/ | 2022-03-28 14:00 | - | |
| Physically upgrading video memory, can it be done/ | 2022-03-28 14:00 | - | |
| Pictures of Cracks/ | 2022-03-28 14:00 | - | |
| Please help me diagnose/ | 2022-03-28 14:00 | - | |
| Plugging M68xx into an external LCD/ | 2022-03-28 14:00 | - | |
| Possible 6809 2.0Ghz on batts/ | 2022-03-28 14:00 | - | |
| Power Cords/ | 2022-03-28 14:00 | - | |
| PowerNow! Dashboard/ | 2022-03-28 14:00 | - | |
| Powernow! Registry Settings/ | 2022-03-28 14:00 | - | |
| Power problems with 6811/ | 2022-03-28 14:00 | - | |
| Power switching problems/ | 2022-03-28 14:00 | - | |
| Problems with usb reader/ | 2022-03-28 14:00 | - | |
| Problem with M6805/ | 2022-03-28 14:00 | - | |
| Problem with Screen Going Black/ | 2022-03-28 14:00 | - | |
| Problem with eMachines M6809/ | 2022-03-28 14:00 | - | |
| Problem with my laptop/ | 2022-03-28 14:00 | - | |
| Processor compatibility e725/ | 2022-03-28 14:00 | - | |
| Processor compatibility help!/ | 2022-03-28 14:00 | - | |
| QMAX LC-B200SFX for emachine Micro ATX Power Supply/ | 2022-03-28 14:00 | - | |
| Question About the eMac warrenty/ | 2022-03-28 14:00 | - | |
| Question with AMD 3200+ GHz issue (M6809)/ | 2022-03-28 14:00 | - | |
| Quick Summary/ | 2022-03-28 14:00 | - | |
| RAM in the M6811/ | 2022-03-28 14:00 | - | |
| Ram or Hardrive upgrade for 6809/ | 2022-03-28 14:00 | - | |
| Ram speed/ | 2022-03-28 14:00 | - | |
| Rebates Anyone/ | 2022-03-28 14:00 | - | |
| Recovery Discs/ | 2022-03-28 14:00 | - | |
| Remap FN key/ | 2022-03-28 14:00 | - | |
| Removing DVD-RW on M6809/ | 2022-03-28 14:00 | - | |
| Repaired hindges results/ | 2022-03-28 14:00 | - | |
| Restore CD not Working/ | 2022-03-28 14:00 | - | |
| Rubber Feet m68xx/ | 2022-03-28 14:00 | - | |
| Selling my M6805 to a friend and I wanted to give him a fair price. What do u think/ | 2022-03-28 14:00 | - | |
| Serial Number help/ | 2022-03-28 14:00 | - | |
| Shipping out!!!!/ | 2022-03-28 14:00 | - | |
| Should I sell M5310 for M6805/ | 2022-03-28 14:00 | - | |
| Slimtype DVDRW SDW-431S/ | 2022-03-28 14:00 | - | |
| Something wrong with M6805 video card (pics)/ | 2022-03-28 14:00 | - | |
| So this happened to me today/ | 2022-03-28 14:00 | - | |
| Sound problem in eMachine notebook/ | 2022-03-28 14:00 | - | |
| Spare battery available from Emachines now/ | 2022-03-28 14:00 | - | |
| Stable OCing/ | 2022-03-28 14:00 | - | |
| Standy Problem w 6809 & SP2/ | 2022-03-28 14:00 | - | |
| Sucess with external hard drive gaming/ | 2022-03-28 14:00 | - | |
| Switch 6809 to 6811 & have BB warr. plz. read/ | 2022-03-28 14:00 | - | |
| They Erased My Hard Drive! !/ | 2022-03-28 14:00 | - | |
| This Is Some Excellent Memory and Cheap/ | 2022-03-28 14:00 | - | |
| Touchpad disable via hotkey/ | 2022-03-28 14:00 | - | |
| USB 2.0 Controller Driver Updates/ | 2022-03-28 14:00 | - | |
| USB 2.0 Problems with M6811/ | 2022-03-28 14:00 | - | |
| Under one of the hatches m6805/ | 2022-03-28 14:00 | - | |
| Unlocking Resetting the DVD Region Code/ | 2022-03-28 14:00 | - | |
| Update- eMachines W4620- same case, design as Gateway M320S/ | 2022-03-28 14:00 | - | |
| Update Software For Slow Running DVD Burners/ | 2022-03-28 14:00 | - | |
| Upgrade 6805 frome Home to XP PRO - Drivers/ | 2022-03-28 14:00 | - | |
| Upgrade the m6805 Radeon/ | 2022-03-28 14:00 | - | |
| Upgrading E627 LCD to higher res/ | 2022-03-28 14:00 | - | |
| Upgrading M6809 processor/ | 2022-03-28 14:00 | - | |
| Upgrading RAM for M68xx/ | 2022-03-28 14:00 | - | |
| Upgrading to a Kingmax Memory/ | 2022-03-28 14:00 | - | |
| VPU freezing/ | 2022-03-28 14:00 | - | |
| Vibrating DVD Drive, anyone having this problem/ | 2022-03-28 14:00 | - | |
| Video Drivers/ | 2022-03-28 14:00 | - | |
| Volume Keys Question/ | 2022-03-28 14:00 | - | |
| Voodoo vs. eMachines/ | 2022-03-28 14:00 | - | |
| Walmart Black Friday sale on eME528-2325/ | 2022-03-28 14:00 | - | |
| Wardriving with my M6809/ | 2022-03-28 14:00 | - | |
| Watch National Television/ | 2022-03-28 14:00 | - | |
| What's the deal with these ! &#@! EMachines/ | 2022-03-28 14:00 | - | |
| What Brand of DVD Burner Comes with the other mod/ | 2022-03-28 14:00 | - | |
| What software do I need for 6809/ | 2022-03-28 14:00 | - | |
| Whats up with the Processor Speed/ | 2022-03-28 14:00 | - | |
| Who Builds 68XX/ | 2022-03-28 14:00 | - | |
| Who can I contact to get additional HD bezels/ | 2022-03-28 14:00 | - | |
| Who has tried Windows 64 bit XP/ | 2022-03-28 14:00 | - | |
| Who has upgraded their HD/ | 2022-03-28 14:00 | - | |
| Who is still using his hers m68xx/ | 2022-03-28 14:00 | - | |
| Why Me Lord/ | 2022-03-28 14:00 | - | |
| Why buy and emachines laptop/ | 2022-03-28 14:00 | - | |
| Windows7 Home Premium format using XP professional/ | 2022-03-28 14:00 | - | |
| Windows 64 ati drivers/ | 2022-03-28 14:00 | - | |
| Windows Vista on W4620/ | 2022-03-28 14:00 | - | |
| Windows XP 64-bit Edition/ | 2022-03-28 14:00 | - | |
| Wired to Wireless network and vice versa/ | 2022-03-28 14:00 | - | |
| Wireless Antenna/ | 2022-03-28 14:00 | - | |
| Wireless NIC in M6809/ | 2022-03-28 14:00 | - | |
| Wireless newbie/ | 2022-03-28 14:00 | - | |
| Wireless problem with SP3 on M6805/ | 2022-03-28 14:00 | - | |
| XP SP2 is out/ | 2022-03-28 14:00 | - | |
| XP SP3 and AMD/ | 2022-03-28 14:00 | - | |
| XP Svc Pack 2 comments (+)/ | 2022-03-28 14:00 | - | |
| Z71V Optical drive/ | 2022-03-28 14:00 | - | |
| anyone else have their laptop's DVD+-RW drive die/ | 2022-03-28 14:00 | - | |
| anyone upgrade to 3700+/ | 2022-03-28 14:00 | - | |
| battery life on the m6809/ | 2022-03-28 14:00 | - | |
| bios upgrades/ | 2022-03-28 14:00 | - | |
| brand new m6811 optimize/ | 2022-03-28 14:00 | - | |
| cannot remover outer case to clean fan/ | 2022-03-28 14:00 | - | |
| can you upgrade cpu in a eMD620-5777/ | 2022-03-28 14:00 | - | |
| cardreader problem/ | 2022-03-28 14:00 | - | |
| clicking noise m6805/ | 2022-03-28 14:00 | - | |
| compatible memory for D620/ | 2022-03-28 14:00 | - | |
| disassemble an emachine e725/ | 2022-03-28 14:00 | - | |
| drivers needed to install winxp pro on m6809/ | 2022-03-28 14:00 | - | |
| e627 ram upgrade/ | 2022-03-28 14:00 | - | |
| eMACHINE - Your opinion/ | 2022-03-28 14:00 | - | |
| eMD620 cpu& hd upgrade q's/ | 2022-03-28 14:00 | - | |
| eME520-2496 memory upgrade/ | 2022-03-28 14:00 | - | |
| eMachine's BIOS update for M6805/ | 2022-03-28 14:00 | - | |
| eMachine Customer Support = worthless/ | 2022-03-28 14:00 | - | |
| eMachine M5405 BIOS For Evaluation Only, Not For Resale/ | 2022-03-28 14:00 | - | |
| eMachines 64-bit Available @ BestBuy.com/ | 2022-03-28 14:00 | - | |
| eMachines 250-1162/ | 2022-03-28 14:00 | - | |
| eMachines Corporate Office Phone No/ | 2022-03-28 14:00 | - | |
| eMachines D620 Laptop Not Working Properly with MS Webcam/ | 2022-03-28 14:00 | - | |
| eMachines E625 damaged USB-ports repar/ | 2022-03-28 14:00 | - | |
| eMachines E627 DVD RW Driver/ | 2022-03-28 14:00 | - | |
| eMachines E627 DVD install tips/ | 2022-03-28 14:00 | - | |
| eMachines E644G/ | 2022-03-28 14:00 | - | |
| eMachines E730G- Any guides on how to open the notebook to clean cooling fans of dust/ | 2022-03-28 14:00 | - | |
| eMachines Getting Out Of Notebooks/ | 2022-03-28 14:00 | - | |
| eMachines Hinge Cracked/ | 2022-03-28 14:00 | - | |
| eMachines Interface OSD Software Needed/ | 2022-03-28 14:00 | - | |
| eMachines M2105 laptop drivers needed, have M2350/ | 2022-03-28 14:00 | - | |
| eMachines M2350 Maximum ram/ | 2022-03-28 14:00 | - | |
| eMachines M5309 Laptop DVD Drive Upgrade/ | 2022-03-28 14:00 | - | |
| eMachines M5310/ | 2022-03-28 14:00 | - | |
| eMachines M5405/ | 2022-03-28 14:00 | - | |
| eMachines M6809 laptop question/ | 2022-03-28 14:00 | - | |
| eMachines MX4624 AMD Sempron 3300 Worth Puchasing/ | 2022-03-28 14:00 | - | |
| eMachines Question/ | 2022-03-28 14:00 | - | |
| eMachines Repair Turnaround time/ | 2022-03-28 14:00 | - | |
| eMachines eME625-5192 and windows 7/ | 2022-03-28 14:00 | - | |
| eMachines m6811 where can you buy it/ | 2022-03-28 14:00 | - | |
| eMachines removed from Best Buy/ | 2022-03-28 14:00 | - | |
| em250 mini PCIe installation/ | 2022-03-28 14:00 | - | |
| emachine's wireless card/ | 2022-03-28 14:00 | - | |
| emachine 5405 graphic card/ | 2022-03-28 14:00 | - | |
| emachine D620- any power management driver/ | 2022-03-28 14:00 | - | |
| emachine M5124 drivers needed urgently/ | 2022-03-28 14:00 | - | |
| e machine bios password/ | 2022-03-28 14:00 | - | |
| emachine e520 motherboard/ | 2022-03-28 14:00 | - | |
| emachine eMD620-5777 upgrades so far!/ | 2022-03-28 14:00 | - | |
| emachines 627/ | 2022-03-28 14:00 | - | |
| emachines 6811/ | 2022-03-28 14:00 | - | |
| emachines D620- CPU Upgrade/ | 2022-03-28 14:00 | - | |
| emachines M68xx cases/ | 2022-03-28 14:00 | - | |
| emachines M6811 quality/ | 2022-03-28 14:00 | - | |
| emachines N-10 laptop charger problems/ | 2022-03-28 14:00 | - | |
| emachines d730 screen broken need help/ | 2022-03-28 14:00 | - | |
| emachines drivers/ | 2022-03-28 14:00 | - | |
| emachines em350 needs keyboard exchange/ | 2022-03-28 14:00 | - | |
| emachines good quality/ | 2022-03-28 14:00 | - | |
| emachines laptop m5310 - xp sp2 help!/ | 2022-03-28 14:00 | - | |
| emachines m6811/ | 2022-03-28 14:00 | - | |
| emachines m6811 with win2k or 2003/ | 2022-03-28 14:00 | - | |
| emachines next 68xx model/ | 2022-03-28 14:00 | - | |
| emd620 laptop dead after reset bios password ..helppp/ | 2022-03-28 14:00 | - | |
| emd620 new BIOS 1.03/ | 2022-03-28 14:00 | - | |
| flickering screen/ | 2022-03-28 14:00 | - | |
| found card reader driver source/ | 2022-03-28 14:00 | - | |
| game recommendation for my emd620 3gbRAM/ | 2022-03-28 14:00 | - | |
| gaming question/ | 2022-03-28 14:00 | - | |
| hd upgrade/ | 2022-03-28 14:00 | - | |
| heat/ | 2022-03-28 14:00 | - | |
| help for wireless noob/ | 2022-03-28 14:00 | - | |
| help needed with m6811/ | 2022-03-28 14:00 | - | |
| help with RAM/ | 2022-03-28 14:00 | - | |
| help with m6805/ | 2022-03-28 14:00 | - | |
| how can the Realtek sound solution be improved/ | 2022-03-28 14:00 | - | |
| how do you all like your emachines notebook/ | 2022-03-28 14:00 | - | |
| how to disable touchpad scrolling/ | 2022-03-28 14:00 | - | |
| how to make a poll/ | 2022-03-28 14:00 | - | |
| how to remove keyboard/ | 2022-03-28 14:00 | - | |
| how to upgrade memory in emachines eMD620-5777 m5777, can't open the bottom panel, all unscrewed/ | 2022-03-28 14:00 | - | |
| i just bought a gateway 7510 gx, it seems/ | 2022-03-28 14:00 | - | |
| installing XP64 on an emchines E725/ | 2022-03-28 14:00 | - | |
| is anyone using windows xp x64/ | 2022-03-28 14:00 | - | |
| is it 800Mhz or 1.8 Ghz/ | 2022-03-28 14:00 | - | |
| keeping CPU overclock active - question/ | 2022-03-28 14:00 | - | |
| kyboad/ | 2022-03-28 14:00 | - | |
| lappy turns off out of nowhere... !/ | 2022-03-28 14:00 | - | |
| laptop to tv/ | 2022-03-28 14:00 | - | |
| link 2 New Emachine coming in April I heard/ | 2022-03-28 14:00 | - | |
![[TXT]](/icons/text.gif) | log.txt | 2022-01-30 16:16 | 0 | |
| log.txt.lck | 2022-01-30 16:16 | 0 | |
| m68-series upgrade/ | 2022-03-28 14:00 | - | |
| m5405 and wireless/ | 2022-03-28 14:00 | - | |
| m5405 laptop/ | 2022-03-28 14:00 | - | |
| m5405 running hotter than before/ | 2022-03-28 14:00 | - | |
| m5410/ | 2022-03-28 14:00 | - | |
| m6000 Series BIOS Update/ | 2022-03-28 14:00 | - | |
| m6805 Underclocking w Clockgen or other software/ | 2022-03-28 14:00 | - | |
| m6805 Video Card Dilemma/ | 2022-03-28 14:00 | - | |
| m6805 and 32-bit linux/ | 2022-03-28 14:00 | - | |
| m6805 faulty mobo vid card/ | 2022-03-28 14:00 | - | |
| m6805 with 250 GB hard drive/ | 2022-03-28 14:00 | - | |
| m6809- upgrade memory first or harddrive/ | 2022-03-28 14:00 | - | |
| m6809 Display Dead/ | 2022-03-28 14:00 | - | |
| m6809 Sound issues on Gentoo Linux/ | 2022-03-28 14:00 | - | |
| m6809 harddrive/ | 2022-03-28 14:00 | - | |
| m6809 running painfully slow/ | 2022-03-28 14:00 | - | |
| m6809 standby hibernation issues/ | 2022-03-28 14:00 | - | |
| m6810-11 Memory Upgrade/ | 2022-03-28 14:00 | - | |
| m6810 - problem with USB Mouse/ | 2022-03-28 14:00 | - | |
| m6810 @2.76 gig/ | 2022-03-28 14:00 | - | |
| m6810 serious issue/ | 2022-03-28 14:00 | - | |
| m6810 speeds/ | 2022-03-28 14:00 | - | |
| m6810 vs m6811/ | 2022-03-28 14:00 | - | |
| m6811 changed for a HP zv5340us/ | 2022-03-28 14:00 | - | |
| m6811 fedora64bit screen resolution/ | 2022-03-28 14:00 | - | |
| m6811 keyboard/ | 2022-03-28 14:00 | - | |
| m6811 monitor drivers/ | 2022-03-28 14:00 | - | |
| m6811 processor speed/ | 2022-03-28 14:00 | - | |
| mail-in rebates/ | 2022-03-28 14:00 | - | |
| media play and Dell Digital Jukebox/ | 2022-03-28 14:00 | - | |
| memory upgrade/ | 2022-03-28 14:00 | - | |
| mobile gfx question/ | 2022-03-28 14:00 | - | |
| motherboard monitor/ | 2022-03-28 14:00 | - | |
| mousepad paranoia/ | 2022-03-28 14:00 | - | |
| need help regarding EMachine 6811/ | 2022-03-28 14:00 | - | |
| new athlon64 driver/ | 2022-03-28 14:00 | - | |
| new emachine refurb, lame/ | 2022-03-28 14:00 | - | |
| new emachines/ | 2022-03-28 14:00 | - | |
| new hard drive/ | 2022-03-28 14:00 | - | |
| new screen/ | 2022-03-28 14:00 | - | |
| new technologies by August/ | 2022-03-28 14:00 | - | |
| one more problem/ | 2022-03-28 14:00 | - | |
| overclocking 6805/ | 2022-03-28 14:00 | - | |
| overheating m6811/ | 2022-03-28 14:00 | - | |
| problems with omega drivers!!!/ | 2022-03-28 14:00 | - | |
| quick HD replacement question/ | 2022-03-28 14:00 | - | |
| ram update problem/ | 2022-03-28 14:00 | - | |
| ready to fresh install winxp pro, what next/ | 2022-03-28 14:00 | - | |
| rebates - how to/ | 2022-03-28 14:00 | - | |
| reinstall on my 6805 (800mhz on AC power)/ | 2022-03-28 14:00 | - | |
| replaced keyboard, now a problem/ | 2022-03-28 14:00 | - | |
| review of my emachines M6805/ | 2022-03-28 14:00 | - | |
| screen tension/ | 2022-03-28 14:00 | - | |
| should i get the m6805 or the m6811/ | 2022-03-28 14:00 | - | |
| softmod ati M9600 to FreeFireGL T2/ | 2022-03-28 14:00 | - | |
| sold the M6811/ | 2022-03-28 14:00 | - | |
| tempted by the eMachines W4620/ | 2022-03-28 14:00 | - | |
| upgraded the 6809 today/ | 2022-03-28 14:00 | - | |
| upgrading the M680x/ | 2022-03-28 14:00 | - | |
| upgrading to Win XP Pro but ATI not being used/ | 2022-03-28 14:00 | - | |
| usb controller problem/ | 2022-03-28 14:00 | - | |
| video driver for ati x1250/ | 2022-03-28 14:00 | - | |
| video driver help/ | 2022-03-28 14:00 | - | |
| video driver question mobile 9600/ | 2022-03-28 14:00 | - | |
| wait/ | 2022-03-28 14:00 | - | |
| watching TV on M6805/ | 2022-03-28 14:00 | - | |
| web cam with the 64 bit processors/ | 2022-03-28 14:00 | - | |
| what brand is the factory hd for m2352/ | 2022-03-28 14:00 | - | |
| whats the deal with the new cpu drivers/ | 2022-03-28 14:00 | - | |
| where can you buy M6809/ | 2022-03-28 14:00 | - | |
| where to buy m6809/ | 2022-03-28 14:00 | - | |
| will the 6810 play quake 4/ | 2022-03-28 14:00 | - | |
| windows 64bit/ | 2022-03-28 14:00 | - | |
| wireless/ | 2022-03-28 14:00 | - | |
| wireless drivers/ | 2022-03-28 14:00 | - | |
| xp sp2 problem/ | 2022-03-28 14:00 | - | |
|
|---|