![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | £50 MIPS is a micro-computer running Android and Linux/ | 2022-03-28 16:09 | - | |
| !!!new!!! Bto Notebooks P book 15c27+/ | 2022-03-28 16:05 | - | |
| !Urgent! OmniPass Problem/ | 2022-03-28 16:05 | - | |
| $699 Sharp Actius MC24 at BestBuy/ | 2022-03-28 16:05 | - | |
| 'Jewel' notebooks/ | 2022-03-28 16:05 | - | |
| (Gammatech) Durabook 15TS with transflective (outdoor viewable) screen treatment/ | 2022-03-28 16:05 | - | |
| (H)EL80 81 & The Smart Battery Tool - Has anyone tried it/ | 2022-03-28 16:05 | - | |
| (H)EL 80 81 Heatsink - Compatible to Liquid Metal Pro/ | 2022-03-28 16:05 | - | |
| -) Dear Folks - I have some good news/ | 2022-03-28 16:05 | - | |
| -p HAPPY BIRTHDAY TO MY 6130!!!/ | 2022-03-28 16:05 | - | |
| 1.18 BIOS GPU Overclocking/ | 2022-03-28 16:05 | - | |
| 1GB Turbo memory available from Zepto/ | 2022-03-28 16:05 | - | |
| 1 month dead Fangbook/ | 2022-03-28 16:05 | - | |
| 1st post here- Couple of P1 Questions Sony Z/ | 2022-03-28 16:05 | - | |
| 2.0 Vs 2.2 Ghz processor 6625WD/ | 2022-03-28 16:05 | - | |
| 2.66ghz core i7 in 14 inch laptop/ | 2022-03-28 16:05 | - | |
| 2nd External Monitor Fuzzy/ | 2022-03-28 16:05 | - | |
| 2nd simple- how to deactivate touchpad CLICK only/ | 2022-03-28 16:05 | - | |
| 2 stupid questions/ | 2022-03-28 16:05 | - | |
| 3D Laptop for $3,299 gets bad review/ | 2022-03-28 16:05 | - | |
| 3 button presses/ | 2022-03-28 16:05 | - | |
| 3dmark/ | 2022-03-28 16:05 | - | |
| 3dmark06 shots of 4850 with p8600!!! 10000 points!!/ | 2022-03-28 16:05 | - | |
| 3d vantage and hl90 ibuypower/ | 2022-03-28 16:05 | - | |
| 3rd party 12 cell battery for Zepto 6224/ | 2022-03-28 16:05 | - | |
| 3th time for the win- my gfx is dead...again!/ | 2022-03-28 16:05 | - | |
| 3 weeks of waiting - RMA -(/ | 2022-03-28 16:05 | - | |
| 3xxx problems/ | 2022-03-28 16:05 | - | |
| 3 year warranty on compals/ | 2022-03-28 16:05 | - | |
| 4gb ram in an HGL30 and what ram works best/ | 2022-03-28 16:05 | - | |
| 4gigs of ram and 32bit vista/ | 2022-03-28 16:05 | - | |
| 5.1 + Fl90/ | 2022-03-28 16:05 | - | |
| 5.1 + Hel80 SPDIF/ | 2022-03-28 16:05 | - | |
| 5.1 Optical Speakers/ | 2022-03-28 16:05 | - | |
| 5.1 on 6625WD soundcard/ | 2022-03-28 16:05 | - | |
| 5.1 speakers not showing in vista/ | 2022-03-28 16:05 | - | |
| 5 time activation in Vista and Zepto/ | 2022-03-28 16:05 | - | |
| 6-cell vs 9-cell/ | 2022-03-28 16:05 | - | |
| 6 cell or 9 cell extra battery for the IFL90/ | 2022-03-28 16:05 | - | |
| 6 in 1 Media Reader, Why not on all laptop/ | 2022-03-28 16:05 | - | |
| 6x24W series - dynamic overclocking of CPU speed/ | 2022-03-28 16:05 | - | |
| 6x24w - what is the BIOS shortcut key/ | 2022-03-28 16:05 | - | |
| 8.12 Final - How-to install with all fullscreen resolutions - modded .inf inside/ | 2022-03-28 16:05 | - | |
| 8.12 official release !!/ | 2022-03-28 16:05 | - | |
| 8 gigs of ram possible in a fl92 with a bios flash/ | 2022-03-28 16:05 | - | |
| 8x00M Overclocking under Windows XP/ | 2022-03-28 16:05 | - | |
| 12 Cell Battery Delay/ | 2022-03-28 16:05 | - | |
| 12 Cell Battery On Zepto Website (6214W)/ | 2022-03-28 16:05 | - | |
| 12 Cell batteries 6224,6324,6024,6625,6025/ | 2022-03-28 16:05 | - | |
| 12 Cell battery activated on Zepto/ | 2022-03-28 16:05 | - | |
| 12 Cell battery gone/ | 2022-03-28 16:05 | - | |
| 14 ABS Core Duo/ | 2022-03-28 16:05 | - | |
| 14p 100GB Harddrive!!!/ | 2022-03-28 16:05 | - | |
| 15.4 @ WUXGA 1920x1200 - Would You Buy It/ | 2022-03-28 16:05 | - | |
| 15.4 Compal with numberpad/ | 2022-03-28 16:05 | - | |
| 15.4 Inch OCZ Whitebook GPU question/ | 2022-03-28 16:05 | - | |
| 15 Display - Orangegate/ | 2022-03-28 16:05 | - | |
| 15 Notebook for extreme situations (magnezium + rubber + sxga)/ | 2022-03-28 16:05 | - | |
| 15 athlon powered sager/ | 2022-03-28 16:05 | - | |
| 16bit color mode/ | 2022-03-28 16:05 | - | |
| 17 Zepto is pronounced!!!/ | 2022-03-28 16:05 | - | |
| 17 Zepto models!/ | 2022-03-28 16:05 | - | |
| 18.4 Graphics Designer Video ethusiast based Whitebook/ | 2022-03-28 16:05 | - | |
| 25% GST x.X/ | 2022-03-28 16:05 | - | |
| 33percents Compal EL80 Review/ | 2022-03-28 16:05 | - | |
| 64-bit vista on a HGL30/ | 2022-03-28 16:05 | - | |
| 64 Bit Vista now available/ | 2022-03-28 16:05 | - | |
| 64 Bit drivers/ | 2022-03-28 16:05 | - | |
| 100 GB (5400 rpm) or 80 GB (7200 rpm) for Zepto Znote 6314W/ | 2022-03-28 16:05 | - | |
| 120W DC Power Adapter at Compusa 40$/ | 2022-03-28 16:05 | - | |
| 128mb shared memory !/ | 2022-03-28 16:05 | - | |
| 156.16 zepto drivers for vista x64 missing resolutions/ | 2022-03-28 16:05 | - | |
| 177.26 Forceware/ | 2022-03-28 16:05 | - | |
| 322H1 and 3225HS/ | 2022-03-28 16:05 | - | |
| 662WD MSN Video issues/ | 2022-03-28 16:05 | - | |
| 802.11n/ | 2022-03-28 16:05 | - | |
| 1000 series/ | 2022-03-28 16:05 | - | |
| 1000 series lid removal/ | 2022-03-28 16:05 | - | |
| 1020 HDD upgrade- maximum recognized capacity/ | 2022-03-28 16:05 | - | |
| 1050,No Screen on Reboot, Wait, Then Normal Boot/ | 2022-03-28 16:05 | - | |
| 1280x768 on my 6224W/ | 2022-03-28 16:05 | - | |
| 1440x900 IFL90 screens/ | 2022-03-28 16:05 | - | |
| 1557GLS System Drivers/ | 2022-03-28 16:05 | - | |
| 1680x1050/ | 2022-03-28 16:05 | - | |
| 1680 x 1050 resolution/ | 2022-03-28 16:05 | - | |
| 2100 Series Drivers. Does anyone Have/ | 2022-03-28 16:05 | - | |
| 2100 Series Wont start!/ | 2022-03-28 16:05 | - | |
| 2100 Touchpad ribbon disconnected...help/ | 2022-03-28 16:05 | - | |
| 2100 series- Freezing when battery reaches about 50%/ | 2022-03-28 16:05 | - | |
| 2100 wont run w 1 gb ram stick/ | 2022-03-28 16:05 | - | |
| 2150-EH1 Turion 64 User Opinions (Happy with your lapop)/ | 2022-03-28 16:05 | - | |
| 2155 issues/ | 2022-03-28 16:05 | - | |
| 2225-eh1 lock up/ | 2022-03-28 16:05 | - | |
| 2225 build quality/ | 2022-03-28 16:05 | - | |
| 2300 - Blinking Charge Battery indicator/ | 2022-03-28 16:05 | - | |
| 2300 2370 mobo/ | 2022-03-28 16:05 | - | |
| 2300 LAN issue/ | 2022-03-28 16:05 | - | |
| 2300 Nvidia 6100 question/ | 2022-03-28 16:05 | - | |
| 2300 Series Turion 64 X2 TL-50 800mhz/ | 2022-03-28 16:05 | - | |
| 2300 Series will not boot up/ | 2022-03-28 16:05 | - | |
| 2300 Upgrades available/ | 2022-03-28 16:05 | - | |
| 2300 Vista Drivers Anyone/ | 2022-03-28 16:05 | - | |
| 2300 parting it out/ | 2022-03-28 16:05 | - | |
| 2300 series keyboards - new $24.99/ | 2022-03-28 16:05 | - | |
| 2300 series problems/ | 2022-03-28 16:05 | - | |
| 2300 series recovery disc/ | 2022-03-28 16:05 | - | |
| 2370-/ | 2022-03-28 16:05 | - | |
| 2370 Ethernet Driver Problem with XP/ | 2022-03-28 16:05 | - | |
| 2370 Headset Connection Problem/ | 2022-03-28 16:05 | - | |
| 2370 Vista Drivers - any updates/ | 2022-03-28 16:05 | - | |
| 2370 [Over]heating issue/ | 2022-03-28 16:05 | - | |
| 2370 extended battery/ | 2022-03-28 16:05 | - | |
| 2370 lan driver/ | 2022-03-28 16:05 | - | |
| 2370 no video/ | 2022-03-28 16:05 | - | |
| 2370 screen goes messed up/ | 2022-03-28 16:05 | - | |
| 2370 sleep turns into coma/ | 2022-03-28 16:05 | - | |
| 2370 warranty/ | 2022-03-28 16:05 | - | |
| 2370 will not start up DEAD execpt for power light/ | 2022-03-28 16:05 | - | |
| 2415w/ | 2022-03-28 16:05 | - | |
| 2425W @ 14.1 Wxga 1440 900/ | 2022-03-28 16:05 | - | |
| 2425W Fingerprint Scanner/ | 2022-03-28 16:05 | - | |
| 2500 owners, do you have touchpad problems/ | 2022-03-28 16:05 | - | |
| 3120V/ | 2022-03-28 16:05 | - | |
| 3120v DVD Drive/ | 2022-03-28 16:05 | - | |
| 3150HW/ | 2022-03-28 16:05 | - | |
| 3150 Repair Decision/ | 2022-03-28 16:05 | - | |
| 3150 or 3200 Laptop Optical Drive Issue/ | 2022-03-28 16:05 | - | |
| 3150p given 2nd life/ | 2022-03-28 16:05 | - | |
| 3200 - Loud Fan Issues!/ | 2022-03-28 16:05 | - | |
| 3200 battery life tweak/ | 2022-03-28 16:05 | - | |
| 3200 bios update/ | 2022-03-28 16:05 | - | |
| 3200 boot from cd/ | 2022-03-28 16:05 | - | |
| 3200 headphone jack volume fades/ | 2022-03-28 16:05 | - | |
| 3200 or 3300/ | 2022-03-28 16:05 | - | |
| 3200 or 3300 with Brightview soon/ | 2022-03-28 16:05 | - | |
| 3200 problem/ | 2022-03-28 16:05 | - | |
| 3200 series Ethernet problem/ | 2022-03-28 16:05 | - | |
| 3200 series Restore Disc/ | 2022-03-28 16:05 | - | |
| 3200 series black screen again! (backlight)/ | 2022-03-28 16:05 | - | |
| 3200 series case/ | 2022-03-28 16:05 | - | |
| 3200 static tinny sound/ | 2022-03-28 16:05 | - | |
| 3220H Cpu upgrade/ | 2022-03-28 16:05 | - | |
| 3220 Memory Upgrade/ | 2022-03-28 16:05 | - | |
| 3220 combo drive problems/ | 2022-03-28 16:05 | - | |
| 3220 motherboard & BIOS/ | 2022-03-28 16:05 | - | |
| 3225HS wireless utility pop up/ | 2022-03-28 16:05 | - | |
| 3225 fan going ape/ | 2022-03-28 16:05 | - | |
| 3250-tips on low volume/ | 2022-03-28 16:05 | - | |
| 3250 DC Power Board/ | 2022-03-28 16:05 | - | |
| 3250H1 - Disapointing performance/ | 2022-03-28 16:05 | - | |
| 3250HX1 - BIOS Recovery Procedure/ | 2022-03-28 16:05 | - | |
| 3250HX80 Has Barely Adequate Audio Volume/ | 2022-03-28 16:05 | - | |
| 3250HX80 Wireless Cannot See Hotspot/ | 2022-03-28 16:05 | - | |
| 3250HX replacement driver updates (3200 series)/ | 2022-03-28 16:05 | - | |
| 3250 Optical Drive - Reads But Not Write/ | 2022-03-28 16:05 | - | |
| 3250 Thermal Pad/ | 2022-03-28 16:05 | - | |
| 3250 VS 3270/ | 2022-03-28 16:05 | - | |
| 3250 dc jack replacement/ | 2022-03-28 16:05 | - | |
| 3250 memory reported is too low!/ | 2022-03-28 16:05 | - | |
| 3250 wifi upgrade/ | 2022-03-28 16:05 | - | |
| 3250 wireless slower than ethernet connection, just got Verizon FIOS/ | 2022-03-28 16:05 | - | |
| 3270 - Battery Calibration via BIOS/ | 2022-03-28 16:05 | - | |
| 3270- CPU Fan Dead - I guess this unit goes back/ | 2022-03-28 16:05 | - | |
| 3270- Hitachi Travelstar IC25N060ATMR04-0 clicking/ | 2022-03-28 16:05 | - | |
| 3270 3280 WLAN Driver is Ralink 11g-RT2500/ | 2022-03-28 16:05 | - | |
| 3270 DNS Acquistion assignment/ | 2022-03-28 16:05 | - | |
| 3270 DVD issues/ | 2022-03-28 16:05 | - | |
| 3270 and World of Warcraft/ | 2022-03-28 16:05 | - | |
| 3270 and athlon/ | 2022-03-28 16:05 | - | |
| 3270 graphic problems/ | 2022-03-28 16:05 | - | |
| 3270 power supply/ | 2022-03-28 16:05 | - | |
| 3270 vs 3360/ | 2022-03-28 16:05 | - | |
| 3280 hard drive where is it/ | 2022-03-28 16:05 | - | |
| 3300 series help/ | 2022-03-28 16:05 | - | |
| 3360 design problem/ | 2022-03-28 16:05 | - | |
| 3415W - Wont charge/ | 2022-03-28 16:05 | - | |
| 3415W Mute LED not lighting up any more!/ | 2022-03-28 16:05 | - | |
| 3415W Screen quality/ | 2022-03-28 16:05 | - | |
| 3415W with Hardware Virtualization or/ | 2022-03-28 16:05 | - | |
| 3415 or 6625/ | 2022-03-28 16:05 | - | |
| 3415w - Problems with the webcam and turbo memory/ | 2022-03-28 16:05 | - | |
| 3415w vs 6224w/ | 2022-03-28 16:05 | - | |
| 3700 Comparable Brands (bios MB) CPU to Tulrin/ | 2022-03-28 16:05 | - | |
| 3700 Series/ | 2022-03-28 16:05 | - | |
| 3700 Series and 3D Gaming/ | 2022-03-28 16:05 | - | |
| 3700 keyboard and touchpad died/ | 2022-03-28 16:05 | - | |
| 3700 power failure/ | 2022-03-28 16:05 | - | |
| 3715 Keyboard Problem -- Any Ideas/ | 2022-03-28 16:05 | - | |
| 3715 battery life/ | 2022-03-28 16:05 | - | |
| 3720- Is there something wrong with it Hot; Fan; Battery/ | 2022-03-28 16:05 | - | |
| 3780hd/ | 2022-03-28 16:05 | - | |
| 3790 in Silicon Valley/ | 2022-03-28 16:05 | - | |
| 3870 + crossfire/ | 2022-03-28 16:05 | - | |
| 4000 series VS 3000 series/ | 2022-03-28 16:05 | - | |
| 4000 series first impressions/ | 2022-03-28 16:05 | - | |
| 4155 Link/ | 2022-03-28 16:05 | - | |
| 4155 on sale at curcuit city/ | 2022-03-28 16:05 | - | |
| 4200 change graphic size/ | 2022-03-28 16:05 | - | |
| 4265 BIOS needed/ | 2022-03-28 16:05 | - | |
| 4265 cME error/ | 2022-03-28 16:05 | - | |
| 4270 @ Costco/ | 2022-03-28 16:05 | - | |
| 4270 Memory Upgrade/ | 2022-03-28 16:05 | - | |
| 4270 Optical Drive sticks out and fails!/ | 2022-03-28 16:05 | - | |
| 4670 in Compal FL90/ | 2022-03-28 16:05 | - | |
| 4965 + Jhl90/ | 2022-03-28 16:05 | - | |
| 5110HX good for video editing/ | 2022-03-28 16:05 | - | |
| 5400 Overheating/ | 2022-03-28 16:05 | - | |
| 5400 Series CD DVD/ | 2022-03-28 16:05 | - | |
| 5400 Will not boot Linux from USB stick/ | 2022-03-28 16:05 | - | |
| 6015WD screen specifications/ | 2022-03-28 16:05 | - | |
| 6024W + Turbo Memory (Robson)/ | 2022-03-28 16:05 | - | |
| 6024W - Hibernation problem/ | 2022-03-28 16:05 | - | |
| 6024W DPC latency problem - new bios in the works/ | 2022-03-28 16:05 | - | |
| 6024w memory upgrade/ | 2022-03-28 16:05 | - | |
| 6025,3214,3212 now online/ | 2022-03-28 16:05 | - | |
| 6025 6625 difference/ | 2022-03-28 16:05 | - | |
| 6100 - Internet Email buttons/ | 2022-03-28 16:05 | - | |
| 6100 Cleaning Nightmare!/ | 2022-03-28 16:05 | - | |
| 6100 Dual CPU Notebook/ | 2022-03-28 16:05 | - | |
| 6100HS mini review (tested with Linux and Win XP)/ | 2022-03-28 16:05 | - | |
| 6100 Series BIOS Help/ | 2022-03-28 16:05 | - | |
| 6100 Series Network Controller/ | 2022-03-28 16:05 | - | |
| 6100 WLAN troubles/ | 2022-03-28 16:05 | - | |
| 6100 screen backing/ | 2022-03-28 16:05 | - | |
| 6100 series, so many problems/ | 2022-03-28 16:05 | - | |
| 6100 series intel speed step drivers/ | 2022-03-28 16:05 | - | |
| 6100 series standby question/ | 2022-03-28 16:05 | - | |
| 6100 smoking/ | 2022-03-28 16:05 | - | |
| 6110 Help!!!!!/ | 2022-03-28 16:05 | - | |
| 6110 or 6240/ | 2022-03-28 16:05 | - | |
| 6128H1 and 6130H1/ | 2022-03-28 16:05 | - | |
| 6130's DVD+ -RW Drive - Issues/ | 2022-03-28 16:05 | - | |
| 6130-HS20/ | 2022-03-28 16:05 | - | |
| 6130-HS20 Recovery After HDD Replacement/ | 2022-03-28 16:05 | - | |
| 6130-HS Overheating/ | 2022-03-28 16:05 | - | |
| 6130 - Hard drive probs/ | 2022-03-28 16:05 | - | |
| 6130- Loosing Apps on Install of XP Pro/ | 2022-03-28 16:05 | - | |
| 6130.. low fps/ | 2022-03-28 16:05 | - | |
| 6130 Battery Life/ | 2022-03-28 16:05 | - | |
| 6130H1-01 and 6130H1/ | 2022-03-28 16:05 | - | |
| 6130HS-20 -- Upgrading to XP Pro/ | 2022-03-28 16:05 | - | |
| 6130HS-20 DIES TWICE - RETURNED DAMAGED/ | 2022-03-28 16:05 | - | |
| 6130HS-20 DVD Drive Problem/ | 2022-03-28 16:05 | - | |
| 6130HS-20 HD Access time/ | 2022-03-28 16:05 | - | |
| 6130HS-20 Hibernate Trouble/ | 2022-03-28 16:05 | - | |
| 6130HS-20 Suddenly Dead/ | 2022-03-28 16:05 | - | |
| 6130HS-20 USB Device Not Recognized/ | 2022-03-28 16:05 | - | |
| 6130HS Issue When Warm/ | 2022-03-28 16:05 | - | |
| 6130HS Media Reader Issues/ | 2022-03-28 16:05 | - | |
| 6130HS Screen Cleaner/ | 2022-03-28 16:05 | - | |
| 6130HS discontinued/ | 2022-03-28 16:05 | - | |
| 6130HS usb problems/ | 2022-03-28 16:05 | - | |
| 6130 Power Adapter Question!/ | 2022-03-28 16:05 | - | |
| 6130 S-Video Output/ | 2022-03-28 16:05 | - | |
| 6130 TV Out Problems/ | 2022-03-28 16:05 | - | |
| 6130 Touchpad/ | 2022-03-28 16:05 | - | |
| 6130 Ventilation/ | 2022-03-28 16:05 | - | |
| 6130 Video not working/ | 2022-03-28 16:05 | - | |
| 6130 and IR Remote Control/ | 2022-03-28 16:05 | - | |
| 6130 bios beeps/ | 2022-03-28 16:05 | - | |
| 6130 disk read error/ | 2022-03-28 16:05 | - | |
| 6130h1-10 Bios/ | 2022-03-28 16:05 | - | |
| 6130 h1 10 drivers/ | 2022-03-28 16:05 | - | |
| 6130 high on 2 gig ram/ | 2022-03-28 16:05 | - | |
| 6130hs occasional slow boot/ | 2022-03-28 16:05 | - | |
| 6130 keyboard repair/ | 2022-03-28 16:05 | - | |
| 6130 windows xp home doesnt support hyperthreading/ | 2022-03-28 16:05 | - | |
| 6130 wireless problem fix/ | 2022-03-28 16:05 | - | |
| 6135HS-20 Lan speed/ | 2022-03-28 16:05 | - | |
| 6200---Way too much heat---Shuts it down( )---Killed mem!/ | 2022-03-28 16:05 | - | |
| 6200 Adapter... stuff/ | 2022-03-28 16:05 | - | |
| 6200H on sale at Best Buy this week. Buy or not/ | 2022-03-28 16:05 | - | |
| 6200 won't POST/ | 2022-03-28 16:05 | - | |
| 6210 S-Video Problem/ | 2022-03-28 16:05 | - | |
| 6214 - realtek audio 16 or 24bit/ | 2022-03-28 16:05 | - | |
| 6214 Optical Cable Speakers/ | 2022-03-28 16:05 | - | |
| 6214W, desktop replacement/ | 2022-03-28 16:05 | - | |
| 6214W 3DMark06 score/ | 2022-03-28 16:05 | - | |
| 6214W 3dmark scores! (Post your own)/ | 2022-03-28 16:05 | - | |
| 6214W Bluetooth driver problem/ | 2022-03-28 16:05 | - | |
| 6214W Dimensions Weight/ | 2022-03-28 16:05 | - | |
| 6214W GPU 7600 go died/ | 2022-03-28 16:05 | - | |
| 6214W Noisey/ | 2022-03-28 16:05 | - | |
| 6214W Overheating !/ | 2022-03-28 16:05 | - | |
| 6214W blue screen issues/ | 2022-03-28 16:05 | - | |
| 6214W bluetooth drivers for vista/ | 2022-03-28 16:05 | - | |
| 6214W glossy screen pics/ | 2022-03-28 16:05 | - | |
| 6214W needs parts/ | 2022-03-28 16:05 | - | |
| 6214W review/ | 2022-03-28 16:05 | - | |
| 6214W screen problem/ | 2022-03-28 16:05 | - | |
| 6214 dual channel/ | 2022-03-28 16:05 | - | |
| 6214w Geforce 7600 overheating/ | 2022-03-28 16:05 | - | |
| 6214w Resolution in games/ | 2022-03-28 16:05 | - | |
| 6214w charger beeping/ | 2022-03-28 16:05 | - | |
| 6214w fan problem/ | 2022-03-28 16:05 | - | |
| 6214w keyboard fit 6324w/ | 2022-03-28 16:05 | - | |
| 6224 - ESC key not functioning/ | 2022-03-28 16:05 | - | |
| 6224 6324W- Are u interested in a GPU Add-on cooler/ | 2022-03-28 16:05 | - | |
| 6224W(6324W)- 2x1GB or 1x2GB/ | 2022-03-28 16:05 | - | |
| 6224W, Temperature settings in BIOS (005)/ | 2022-03-28 16:05 | - | |
| 6224W - BlueSoleil can't find my bluetooth/ | 2022-03-28 16:05 | - | |
| 6224W - Videocard problems/ | 2022-03-28 16:05 | - | |
| 6224W- Vista- Freeze/ | 2022-03-28 16:05 | - | |
| 6224W- Zepto Zpro 300Mbit Wifi VS Intel Pro Wireless/ | 2022-03-28 16:05 | - | |
| 6224W 4Gb Ram vista 32bit/ | 2022-03-28 16:05 | - | |
| 6224W DVD-drive acting up/ | 2022-03-28 16:05 | - | |
| 6224W GPU temperature/ | 2022-03-28 16:05 | - | |
| 6224W Pictuers/ | 2022-03-28 16:05 | - | |
| 6224W batteries/ | 2022-03-28 16:05 | - | |
| 6224W black screen on boot/ | 2022-03-28 16:05 | - | |
| 6224W display don't turn on/ | 2022-03-28 16:05 | - | |
| 6224W how does it really look ! experience/ | 2022-03-28 16:05 | - | |
| 6224W installation problems/ | 2022-03-28 16:05 | - | |
| 6224W internal DC power issue/ | 2022-03-28 16:05 | - | |
| 6224W new cooling fan/ | 2022-03-28 16:05 | - | |
| 6224W new design (nooooo!)/ | 2022-03-28 16:05 | - | |
| 6224W reboots when shut down/ | 2022-03-28 16:05 | - | |
| 6224W review/ | 2022-03-28 16:05 | - | |
| 6224W won't load Vista/ | 2022-03-28 16:05 | - | |
| 6224`QLbutton/ | 2022-03-28 16:05 | - | |
| 6224 bad at gaming/ | 2022-03-28 16:05 | - | |
| 6224 bluetooth and nokia/ | 2022-03-28 16:05 | - | |
| 6224 cpu temperature/ | 2022-03-28 16:05 | - | |
| 6224 flashing battery light - possible dead battery/ | 2022-03-28 16:05 | - | |
| 6224 gone bad/ | 2022-03-28 16:05 | - | |
| 6224 keyboard/ | 2022-03-28 16:05 | - | |
| 6224 monitor/ | 2022-03-28 16:05 | - | |
| 6224 overheating with Bioshock/ | 2022-03-28 16:05 | - | |
| 6224 vista, gaming problems/ | 2022-03-28 16:05 | - | |
| 6224 vs 6324/ | 2022-03-28 16:05 | - | |
| 6224w - 2 unknown devices/ | 2022-03-28 16:05 | - | |
| 6224w - looses wireless connection when my friend shows up!!!/ | 2022-03-28 16:05 | - | |
| 6224w... 25% Gst/ | 2022-03-28 16:05 | - | |
| 6224w RAM memory question/ | 2022-03-28 16:05 | - | |
| 6224w Refunded after 3rd repair in 5 months/ | 2022-03-28 16:05 | - | |
| 6224w Review reopened/ | 2022-03-28 16:05 | - | |
| 6224w Speaker Replacement/ | 2022-03-28 16:05 | - | |
| 6224w and SD HC card problem/ | 2022-03-28 16:05 | - | |
| 6224w hardware question/ | 2022-03-28 16:05 | - | |
| 6224w keyboard waveynes fix/ | 2022-03-28 16:05 | - | |
| 6234 - Shutsdown During Games/ | 2022-03-28 16:05 | - | |
| 6234w chop shop/ | 2022-03-28 16:05 | - | |
| 6235-dl burning experience wanted/ | 2022-03-28 16:05 | - | |
| 6240 CPU upgradable/ | 2022-03-28 16:05 | - | |
| 6240 processor upgrade/ | 2022-03-28 16:05 | - | |
| 6314 on zepto.dk/ | 2022-03-28 16:05 | - | |
| 6314w- the better buy/ | 2022-03-28 16:05 | - | |
| 6314w coming soon to the UK/ | 2022-03-28 16:05 | - | |
| 6314w crytal clear/ | 2022-03-28 16:05 | - | |
| 6324 Broken Keyboard/ | 2022-03-28 16:05 | - | |
| 6324W, 6224W, 6414W - Numbers!/ | 2022-03-28 16:05 | - | |
| 6324W, Hot Touchpad + wont start/ | 2022-03-28 16:05 | - | |
| 6324W- Problems with starting up/ | 2022-03-28 16:05 | - | |
| 6324W Cooling question/ | 2022-03-28 16:05 | - | |
| 6324W GPU problem - green vertical lines appearing on the screen/ | 2022-03-28 16:05 | - | |
| 6324W HD-DVD or Blu-Ray upgrade/ | 2022-03-28 16:05 | - | |
| 6324W Nvidia Geforce 8600 GT 102C (HOT)/ | 2022-03-28 16:05 | - | |
| 6324W Touchpad problem/ | 2022-03-28 16:05 | - | |
| 6324W and 6625WD reviews/ | 2022-03-28 16:05 | - | |
| 6324W or 6625WD/ | 2022-03-28 16:05 | - | |
| 6324 and 6224 ukltra crsip screens UK buyer/ | 2022-03-28 16:05 | - | |
| 6324 and Bluetooth/ | 2022-03-28 16:05 | - | |
| 6324 backlight reset/ | 2022-03-28 16:05 | - | |
| 6324 freezes, shutsdown/ | 2022-03-28 16:05 | - | |
| 6324 lights go through lid/ | 2022-03-28 16:05 | - | |
| 6324w, slight background noise in headphones/ | 2022-03-28 16:05 | - | |
| 6324w Graphics problems/ | 2022-03-28 16:05 | - | |
| 6324w fan/ | 2022-03-28 16:05 | - | |
| 6324w pink stripes on zepto splash and crashes/ | 2022-03-28 16:05 | - | |
| 6500 series issue, pls help me !/ | 2022-03-28 16:05 | - | |
| 6515WD Suddenly shut down/ | 2022-03-28 16:05 | - | |
| 6615 + Vista + IrDA- working and not working/ | 2022-03-28 16:05 | - | |
| 6615 - Multiple errors/ | 2022-03-28 16:05 | - | |
| 6615W - Teething Troubles/ | 2022-03-28 16:05 | - | |
| 6615WD & Vista Ultimate Running Great/ | 2022-03-28 16:05 | - | |
| 6615WD (with slot-in dvd) and Vista/ | 2022-03-28 16:05 | - | |
| 6615WD, BIOS, Sleep Issues/ | 2022-03-28 16:05 | - | |
| 6615WD - computer freezes - and more/ | 2022-03-28 16:05 | - | |
| 6615WD - random button presses caused by overheating/ | 2022-03-28 16:05 | - | |
| 6615WD DVD watching/ | 2022-03-28 16:05 | - | |
| 6615WD Gfx driver issue problem/ | 2022-03-28 16:05 | - | |
| 6615WD Linux problem. Fatal IO error 104/ | 2022-03-28 16:05 | - | |
| 6615WD Networking is driving me mad/ | 2022-03-28 16:05 | - | |
| 6615WD Nvidia driverproblem/ | 2022-03-28 16:05 | - | |
| 6615WD Webcam/ | 2022-03-28 16:05 | - | |
| 6615WD bios upgrade 1.10/ | 2022-03-28 16:05 | - | |
| 6615WD dirt behind screen/ | 2022-03-28 16:05 | - | |
| 6615WD heat management cooling system/ | 2022-03-28 16:05 | - | |
| 6615WD or 2425W/ | 2022-03-28 16:05 | - | |
| 6615WD troubles/ | 2022-03-28 16:05 | - | |
| 6615WD with Merom on the way!/ | 2022-03-28 16:05 | - | |
| 6615WD won't boot - blinking white stripe/ | 2022-03-28 16:05 | - | |
| 6615 bluetooth problem/ | 2022-03-28 16:05 | - | |
| 6615 dvd drive/ | 2022-03-28 16:05 | - | |
| 6615 or 6214/ | 2022-03-28 16:05 | - | |
| 6615wd/ | 2022-03-28 16:05 | - | |
| 6615wd discount/ | 2022-03-28 16:05 | - | |
| 6624 Dead pixel/ | 2022-03-28 16:05 | - | |
| 6625 - cd dvd reads, won´t burn/ | 2022-03-28 16:05 | - | |
| 6625 CPU operates on very low voltage/ | 2022-03-28 16:05 | - | |
| 6625 Gfx/ | 2022-03-28 16:05 | - | |
| 6625 Misshap/ | 2022-03-28 16:05 | - | |
| 6625 Screen opinions/ | 2022-03-28 16:05 | - | |
| 6625WD - Lightroom/ | 2022-03-28 16:05 | - | |
| 6625WD- Screen fails to boot/ | 2022-03-28 16:05 | - | |
| 6625WD - cant connect external screen/ | 2022-03-28 16:05 | - | |
| 6625WD 3Dmark score way low !! help/ | 2022-03-28 16:05 | - | |
| 6625WD = Amiga + C64 emulation at 50Hz!/ | 2022-03-28 16:05 | - | |
| 6625WD AGN wireless connection speed/ | 2022-03-28 16:05 | - | |
| 6625WD CPU Load/ | 2022-03-28 16:05 | - | |
| 6625WD DDR2 or DDR3/ | 2022-03-28 16:05 | - | |
| 6625WD DPClatency high/ | 2022-03-28 16:05 | - | |
| 6625WD DVD-Drive problems with Vista/ | 2022-03-28 16:05 | - | |
| 6625WD DVD problem - won't allow vista64 boot/ | 2022-03-28 16:05 | - | |
| 6625WD EIST disabled BIOS/ | 2022-03-28 16:05 | - | |
| 6625WD Express card slot/ | 2022-03-28 16:05 | - | |
| 6625WD Firewire adaption/ | 2022-03-28 16:05 | - | |
| 6625WD GFX driver problems/ | 2022-03-28 16:05 | - | |
| 6625WD GPU died/ | 2022-03-28 16:05 | - | |
| 6625WD Gaming Screenshots/ | 2022-03-28 16:05 | - | |
| 6625WD Graphics Mouse issue/ | 2022-03-28 16:05 | - | |
| 6625WD New BIOS - when/ | 2022-03-28 16:05 | - | |
| 6625WD Optical Drives/ | 2022-03-28 16:05 | - | |
| 6625WD Processor upgrade VS temp/ | 2022-03-28 16:05 | - | |
| 6625WD RAM and HD questions/ | 2022-03-28 16:05 | - | |
| 6625 WD RMA case/ | 2022-03-28 16:05 | - | |
| 6625WD Service Manual or circuit diagram/ | 2022-03-28 16:05 | - | |
| 6625WD Slow on battery/ | 2022-03-28 16:05 | - | |
| 6625WD Undervolt CPU & Overclock GPU/ | 2022-03-28 16:05 | - | |
| 6625WD Unknown PCI Device/ | 2022-03-28 16:05 | - | |
| 6625WD Vista not recognizing dvd drive/ | 2022-03-28 16:05 | - | |
| 6625WD and (Mandriva) Linux review/ | 2022-03-28 16:05 | - | |
| 6625WD and Age of Conan/ | 2022-03-28 16:05 | - | |
| 6625WD and NWN2(securom).. problem!/ | 2022-03-28 16:05 | - | |
| 6625WD battery life/ | 2022-03-28 16:05 | - | |
| 6625WD dead screen/ | 2022-03-28 16:05 | - | |
| 6625WD dpc latency solution, oh yes!/ | 2022-03-28 16:05 | - | |
| 6625WD headphone jack/ | 2022-03-28 16:05 | - | |
| 6625WD in action from Assembly in Finland/ | 2022-03-28 16:05 | - | |
| 6625WD keyboard--flimsy, damp feeling/ | 2022-03-28 16:05 | - | |
| 6625WD keyboard workaround/ | 2022-03-28 16:05 | - | |
| 6625 WD noisy dvd-drive/ | 2022-03-28 16:05 | - | |
| 6625WD only running on one core with bios 004/ | 2022-03-28 16:05 | - | |
| 6625WD overheat/ | 2022-03-28 16:05 | - | |
| 6625WD owners Question/ | 2022-03-28 16:05 | - | |
| 6625WD power problem/ | 2022-03-28 16:05 | - | |
| 6625WD random slowdown resolution/ | 2022-03-28 16:05 | - | |
| 6625WD ready for order on zepto.dk/ | 2022-03-28 16:05 | - | |
| 6625 WD restarting by itself/ | 2022-03-28 16:05 | - | |
| 6625WD review/ | 2022-03-28 16:05 | - | |
| 6625WD starting on external monitor/ | 2022-03-28 16:05 | - | |
| 6625WD stuck scrolling/ | 2022-03-28 16:05 | - | |
| 6625WD with Zepto wireless and DPC latency/ | 2022-03-28 16:05 | - | |
| 6625W users please test/ | 2022-03-28 16:05 | - | |
| 6625 and CPU load/ | 2022-03-28 16:05 | - | |
| 6625 and external display/ | 2022-03-28 16:05 | - | |
| 6625 performance/ | 2022-03-28 16:05 | - | |
| 6625 stuttering and overheating - solution!( )/ | 2022-03-28 16:05 | - | |
| 6625wd & Windows Experience Index Score/ | 2022-03-28 16:05 | - | |
| 6625wd, under the hood/ | 2022-03-28 16:05 | - | |
| 6625wd- CPU Frequency has increased suddenly, and doesn't lower/ | 2022-03-28 16:05 | - | |
| 6625wd/ | 2022-03-28 16:05 | - | |
| 6625wd 7.1 sound/ | 2022-03-28 16:05 | - | |
| 6625wd BIOS 008/ | 2022-03-28 16:05 | - | |
| 6625wd BSOD x3 without a trace/ | 2022-03-28 16:05 | - | |
| 6625wd Battery/ | 2022-03-28 16:05 | - | |
| 6625wd TV tuner/ | 2022-03-28 16:05 | - | |
| 6625wd Vista sleep problem/ | 2022-03-28 16:05 | - | |
| 6625wd and Battlefield 2142/ | 2022-03-28 16:05 | - | |
| 6625wd battery replacement/ | 2022-03-28 16:05 | - | |
| 6625wd camera problem/ | 2022-03-28 16:05 | - | |
| 6625wd headphones socket/ | 2022-03-28 16:05 | - | |
| 6625wd processor @ gaming/ | 2022-03-28 16:05 | - | |
| 6625wd serious problem/ | 2022-03-28 16:05 | - | |
| 7100 Battery drain problem/ | 2022-03-28 16:05 | - | |
| 7100 series cooling fan operation/ | 2022-03-28 16:05 | - | |
| 7100 series dies/ | 2022-03-28 16:05 | - | |
| 7115 hinge problem- who to repair/ | 2022-03-28 16:05 | - | |
| 7600 Drivers/ | 2022-03-28 16:05 | - | |
| 7600GT in Hel-80 from ibuypower/ | 2022-03-28 16:05 | - | |
| 7600 Question!/ | 2022-03-28 16:05 | - | |
| 7600 Shares memory under vista/ | 2022-03-28 16:05 | - | |
| 7800 512mb w notebook/ | 2022-03-28 16:05 | - | |
| 8600/ | 2022-03-28 16:05 | - | |
| 8600M GT Drivers/ | 2022-03-28 16:05 | - | |
| 8600M GT Uber Thread (Clocks and more)/ | 2022-03-28 16:05 | - | |
| 8600M GT only DDR2/ | 2022-03-28 16:05 | - | |
| 8600M underclocked on 6625s/ | 2022-03-28 16:05 | - | |
| 8600m GT DDR3/ | 2022-03-28 16:05 | - | |
| 8600m GT sleepfix fails with 177.83 drivers/ | 2022-03-28 16:05 | - | |
| 8600m gt 512 mb drivers/ | 2022-03-28 16:05 | - | |
| 8600m gt broke again/ | 2022-03-28 16:05 | - | |
| 9300 or 9500/ | 2022-03-28 16:05 | - | |
| 9600m gt downclocking/ | 2022-03-28 16:05 | - | |
| 9650m gt clock problem/ | 2022-03-28 16:05 | - | |
| @ anybody who owns a s73/ | 2022-03-28 16:05 | - | |
| A 'cloud lump' on the screen/ | 2022-03-28 16:05 | - | |
| A5 on chipset part of the heatsink/ | 2022-03-28 16:05 | - | |
| ABS - Mayhem Z3 with 7600gt/ | 2022-03-28 16:05 | - | |
| ABS/ | 2022-03-28 16:05 | - | |
| ABS Computers/ | 2022-03-28 16:05 | - | |
| ABS G3 A47 Notebook/ | 2022-03-28 16:05 | - | |
| ABS Mahem/ | 2022-03-28 16:05 | - | |
| ABS Mayhem Mayhem G4 Revolution/ | 2022-03-28 16:05 | - | |
| ABook 3600TX ...another arima/ | 2022-03-28 16:05 | - | |
| AC ADapter for 6130hs/ | 2022-03-28 16:05 | - | |
| AC Adapter Beeping (Zepto Znote 6625WD)/ | 2022-03-28 16:05 | - | |
| AC Adaptor or Battery problem/ | 2022-03-28 16:05 | - | |
| ACER TM 4024WLMi/ | 2022-03-28 16:05 | - | |
| ACPI - knowledge please/ | 2022-03-28 16:05 | - | |
| ACPI in GL-30/ | 2022-03-28 16:05 | - | |
| AC and battery power/ | 2022-03-28 16:05 | - | |
| AD2P in 6324/ | 2022-03-28 16:05 | - | |
| A Few Questions/ | 2022-03-28 16:05 | - | |
| A Few Questions about the Whitebook/ | 2022-03-28 16:05 | - | |
| A Fresh 6615WD and BIOS/ | 2022-03-28 16:05 | - | |
| AJP notebook manufacturer/ | 2022-03-28 16:05 | - | |
| AL27 - Another Price Drop/ | 2022-03-28 16:05 | - | |
| AL27 Extended Battery/ | 2022-03-28 16:05 | - | |
| AL27 Recovery CD/ | 2022-03-28 16:05 | - | |
| AMD-TongFang PF4NU1F (No dGPU, Mechrevo S2 Air Tuxedo Pulse14/ | 2022-03-28 16:05 | - | |
| AMD-TongFang PF5NU1G (No dGPU, Mechrevo CODE 01 THINN-15 Via15Pro)/ | 2022-03-28 16:05 | - | |
| AMD 64 Vs P4 HT/ | 2022-03-28 16:05 | - | |
| AMD ATI starts shipping Mobility Radeon 4000 series GPUs/ | 2022-03-28 16:05 | - | |
| AMD Launches ATI Mobility Radeon HD 4000 Series Graphics for Notebooks/ | 2022-03-28 16:05 | - | |
| AMD notebooks, one with FX, coming from HyperSonic/ | 2022-03-28 16:05 | - | |
| AMD or Intel for Compal/ | 2022-03-28 16:05 | - | |
| AMS Sound Pro/ | 2022-03-28 16:05 | - | |
| ANDI Tablets/ | 2022-03-28 16:05 | - | |
| ARIMA M622-DK8X UK8X - the Centrino killer/ | 2022-03-28 16:05 | - | |
| ASI FL92 needs bluetooth and harness/ | 2022-03-28 16:05 | - | |
| ASI Notebooks in Canada/ | 2022-03-28 16:05 | - | |
| ASI Whitebook Notebook Model A1710/ | 2022-03-28 16:05 | - | |
| ASUS G2S Extreme/ | 2022-03-28 16:05 | - | |
| ASUS N550jv or Lenovo Y510/ | 2022-03-28 16:05 | - | |
| ASUS config to order at Portable One, again/ | 2022-03-28 16:05 | - | |
| ATI's 9.1 Driver, Finally available!/ | 2022-03-28 16:05 | - | |
| ATI 8.12 Beta - You gotta see this! Benchmark results inside/ | 2022-03-28 16:05 | - | |
| ATI 3870 on whitebook with XP/ | 2022-03-28 16:05 | - | |
| ATI 4870 Now shipping to retailers!/ | 2022-03-28 16:05 | - | |
| ATI Far Cry 2 and Stalker Clear Sky HotFix/ | 2022-03-28 16:05 | - | |
| ATI HD3650 MXM II 256mb DDR3 Vbios/ | 2022-03-28 16:05 | - | |
| ATI HD4670 at mxm-upgrade/ | 2022-03-28 16:05 | - | |
| ATI Mobility Radeon HD 4000 with OCZ Whitebook - Is it possible/ | 2022-03-28 16:05 | - | |
| ATI USB2 TUNER PROBLEMS/ | 2022-03-28 16:05 | - | |
| ATI X1400 in FL90 (hurry please!)/ | 2022-03-28 16:05 | - | |
| AV 1000 series- HowTo open the case (and what's inside)/ | 2022-03-28 16:05 | - | |
| AV 1000 series- HowTo program the multimedia button/ | 2022-03-28 16:05 | - | |
| AV1020-ED2 802.11g MinPCI wireless driver update/ | 2022-03-28 16:05 | - | |
| AV3225HS VS. AV3150 Battery Life/ | 2022-03-28 16:05 | - | |
| AV3225HS playing games/ | 2022-03-28 16:05 | - | |
| AV3250HX80 - Q about Quality/ | 2022-03-28 16:05 | - | |
| AV 3250 Hx cpu temp moniter/ | 2022-03-28 16:05 | - | |
| AV3360-EG1/ | 2022-03-28 16:05 | - | |
| AV 3715-ED1 Machine Check Exception/ | 2022-03-28 16:05 | - | |
| AV5428HX/ | 2022-03-28 16:05 | - | |
| AV5500-EA1 Opinions information needed/ | 2022-03-28 16:05 | - | |
| AV5500-EA1 and WinXP SP2/ | 2022-03-28 16:05 | - | |
| AV6110-EH1 Card Reader/ | 2022-03-28 16:05 | - | |
| AV6130H1-10 Benchmark & Performance Issues ! !/ | 2022-03-28 16:05 | - | |
| AV6130HS-20 Power Adapter/ | 2022-03-28 16:05 | - | |
| AV 6200/ | 2022-03-28 16:05 | - | |
| AV6235 rebooting when playing DVDs/ | 2022-03-28 16:05 | - | |
| AV 6240 Touchpad and Software Upgrades/ | 2022-03-28 16:05 | - | |
| AVERATEC (3280 Series) - Extra Memory Slot/ | 2022-03-28 16:05 | - | |
| AVERATEC- The worst brand EVER!/ | 2022-03-28 16:05 | - | |
| AVERATEC 6200 Issue (re- Fan, but not noise)/ | 2022-03-28 16:05 | - | |
| AVERATEC PRODUCT DEFECTIVE VERY POOR SERVICE/ | 2022-03-28 16:05 | - | |
| A Zepto Znote question/ | 2022-03-28 16:05 | - | |
| A big resolution favour please anyone/ | 2022-03-28 16:05 | - | |
| About G736 ECS/ | 2022-03-28 16:05 | - | |
| About HEL80 built-in speaker;)/ | 2022-03-28 16:05 | - | |
| About time! I just ordered my HEL80/ | 2022-03-28 16:05 | - | |
| About to buy/ | 2022-03-28 16:05 | - | |
| About to buy Zepto in AUS/ | 2022-03-28 16:05 | - | |
| About to purchase a Zepto Nox A14/ | 2022-03-28 16:05 | - | |
| Accessing the WiFi Module in the OCZ Whitebook - How-to/ | 2022-03-28 16:05 | - | |
| Accidently turned on NumLock/ | 2022-03-28 16:05 | - | |
| A couple of question about Zepto/ | 2022-03-28 16:05 | - | |
| A couple questions/ | 2022-03-28 16:05 | - | |
| Acpi File/ | 2022-03-28 16:05 | - | |
| Actius AL27 Drivers/ | 2022-03-28 16:05 | - | |
| Actius AL27 Memory upgrade/ | 2022-03-28 16:05 | - | |
| Actius MP30/ | 2022-03-28 16:05 | - | |
| Actius RD20, any opinions/ | 2022-03-28 16:05 | - | |
| Activate WiFi on TongFang GK5CN6Z using an external USB keyboard/ | 2022-03-28 16:05 | - | |
| Activation/ | 2022-03-28 16:05 | - | |
| Adapters for a zepto/ | 2022-03-28 16:05 | - | |
| Adding 2GB memory to 3250/ | 2022-03-28 16:05 | - | |
| Adding RAM to a JFL92/ | 2022-03-28 16:05 | - | |
| Adding more RAM to the 6625/ | 2022-03-28 16:05 | - | |
| Additional Passive Cooling for MXM II/ | 2022-03-28 16:05 | - | |
| A different heat problem/ | 2022-03-28 16:05 | - | |
| Adjust gamma settings For Go 7600/ | 2022-03-28 16:05 | - | |
| Advent/ | 2022-03-28 16:05 | - | |
| Advent 4211-B web cam problem/ | 2022-03-28 16:05 | - | |
| Advent 4211C/ | 2022-03-28 16:05 | - | |
| Advent 5401/ | 2022-03-28 16:05 | - | |
| Advent 7083 Help/ | 2022-03-28 16:05 | - | |
| Advent 8112 ECS S20II Bios Update/ | 2022-03-28 16:05 | - | |
| Advent 8555, 7555, 6555/ | 2022-03-28 16:05 | - | |
| Advent 9112/ | 2022-03-28 16:05 | - | |
| Advent 9315 Another Problem/ | 2022-03-28 16:05 | - | |
| Advent 9315 Problem/ | 2022-03-28 16:05 | - | |
| Advent Roma 3001 no power/ | 2022-03-28 16:05 | - | |
| Advent Roma laptop loud beeping sound/ | 2022-03-28 16:05 | - | |
| Advent laptop problem/ | 2022-03-28 16:05 | - | |
| Advice on creating boot disk for 6200/ | 2022-03-28 16:05 | - | |
| A few 6224W problems/ | 2022-03-28 16:05 | - | |
| A few 6615WD questions/ | 2022-03-28 16:05 | - | |
| A few WSXGA+ MATTE screens are available for the PowerPro P 11-15 (Compal IFL92) - PLUS Special Promotions on Cases and Shipping/ | 2022-03-28 16:05 | - | |
| A few Znote 3415W questions/ | 2022-03-28 16:05 | - | |
| A few little bugs on IFL90/ | 2022-03-28 16:05 | - | |
| A few pre zepto laptop purchase questions/ | 2022-03-28 16:05 | - | |
| A few question about Zepto/ | 2022-03-28 16:05 | - | |
| A few questions about my 6224W/ | 2022-03-28 16:05 | - | |
| Aftermarket upgrade of HEL80 screen/ | 2022-03-28 16:05 | - | |
| After seeing this section of the board, I'm reconsidering/ | 2022-03-28 16:05 | - | |
| Aftershock PC/ | 2022-03-28 16:05 | - | |
| Aftershock PC Forge 15 PRO/ | 2022-03-28 16:05 | - | |
| Again, pointless heralding of ordered laptops/ | 2022-03-28 16:05 | - | |
| Ah. Barebones socket p suggestions/ | 2022-03-28 16:05 | - | |
| Ah soo louddd hel80/ | 2022-03-28 16:05 | - | |
| Air Circulation In The Znote 6625WD/ | 2022-03-28 16:05 | - | |
| Airline adapter for 6130/ | 2022-03-28 16:05 | - | |
| Akoya EX widescreen wallpapers/ | 2022-03-28 16:05 | - | |
| Alienware M17 OCZ Whitebook. The best way to solve your sound shuttering problem -- Undervolt the CPU, or downclock it/ | 2022-03-28 16:05 | - | |
| Alienware M17 reviewed in Notebookcheck/ | 2022-03-28 16:05 | - | |
| Alienware or Hypersonic/ | 2022-03-28 16:05 | - | |
| Alienware using OCZ DIY/ | 2022-03-28 16:05 | - | |
| All 200 pin memory interchangable/ | 2022-03-28 16:05 | - | |
| All Vista Machines ship with SP1 now/ | 2022-03-28 16:05 | - | |
| All my personal Zepto Znote 6224W pictures and benchmarks!/ | 2022-03-28 16:05 | - | |
| All the Zepto benchmarks I found/ | 2022-03-28 16:05 | - | |
| Alps Touchpad Drivers/ | 2022-03-28 16:05 | - | |
| Alternative audio drivers for IFL90 Vista x64/ | 2022-03-28 16:05 | - | |
| Alternative for Sidewalker/ | 2022-03-28 16:05 | - | |
| Alternative to Averatec 6130/ | 2022-03-28 16:05 | - | |
| Amazing Sale Price!/ | 2022-03-28 16:05 | - | |
| Amazing service - where else can I sing the praise of P1/ | 2022-03-28 16:05 | - | |
| A memory question/ | 2022-03-28 16:05 | - | |
| American Chassis builders/ | 2022-03-28 16:05 | - | |
| Amoi notebook (impressive!)/ | 2022-03-28 16:05 | - | |
| An Ode to the Sager 2090 (IFL90)/ | 2022-03-28 16:05 | - | |
| An Stupid Question about IFL90's battery/ | 2022-03-28 16:05 | - | |
| Analysis of Compal integrated camera problem/ | 2022-03-28 16:05 | - | |
| And then it just stopped working (wireless issue)/ | 2022-03-28 16:05 | - | |
| A new memeber needs help!/ | 2022-03-28 16:05 | - | |
| An experience voltmoding Intel EIST enabled CPU/ | 2022-03-28 16:05 | - | |
| Announcement for Finnish customers regarding sales and service/ | 2022-03-28 16:05 | - | |
| Annoying Taskbar Icons/ | 2022-03-28 16:05 | - | |
| A note about PowerNotebooks.com service/ | 2022-03-28 16:05 | - | |
| Another BIOS warning/ | 2022-03-28 16:05 | - | |
| Another Dead Averatec 2370/ | 2022-03-28 16:05 | - | |
| Another Problem. hel80. wavy lines of doom!/ | 2022-03-28 16:05 | - | |
| Another Zenote Success story/ | 2022-03-28 16:05 | - | |
| Another Zepto experience/ | 2022-03-28 16:05 | - | |
| Another proud Compel HEL80 owner on board/ | 2022-03-28 16:05 | - | |
| Another satisfied customer..Can't go wrong with p1/ | 2022-03-28 16:05 | - | |
| Antenna Input/ | 2022-03-28 16:05 | - | |
| Anti-glare filter, need help from Zepto staff/ | 2022-03-28 16:05 | - | |
| Any 9 12-cell batteries avaliable for 6x1-notebooks/ | 2022-03-28 16:05 | - | |
| Any 6224 6324W overclocked 8600GT 3dmark06 scores/ | 2022-03-28 16:05 | - | |
| Any GOOD comments about the AV4155/ | 2022-03-28 16:05 | - | |
| Any Linux (Ubuntu) Users/ | 2022-03-28 16:05 | - | |
| Any OLPC owners here/ | 2022-03-28 16:05 | - | |
| Any P-1 UX Series Users Out There!/ | 2022-03-28 16:05 | - | |
| Any Update on a New UX model/ | 2022-03-28 16:05 | - | |
| Any Update on new P1 laptops/ | 2022-03-28 16:05 | - | |
| Anybody actually own a WidowPC/ | 2022-03-28 16:05 | - | |
| Anybody have an OCZ SSD/ | 2022-03-28 16:05 | - | |
| Anybody knows about Balance computers/ | 2022-03-28 16:05 | - | |
| Anybody knows anything about laptops 1 BEYOND/ | 2022-03-28 16:05 | - | |
| Any conclusions about Robson memory/ | 2022-03-28 16:05 | - | |
| Any difference between FL90 and IFL90/ | 2022-03-28 16:05 | - | |
| Any experience with Medion x6817 or x6819/ | 2022-03-28 16:05 | - | |
| Any experience with Vigor/ | 2022-03-28 16:05 | - | |
| Any guides to undervolt IFL90/ | 2022-03-28 16:05 | - | |
| Any heat issue with the GL30/ | 2022-03-28 16:05 | - | |
| Any info on the new core duo Quantas/ | 2022-03-28 16:05 | - | |
| Any musicians using the HEL80 Audigy users/ | 2022-03-28 16:05 | - | |
| Any news on a Compal Sandy Bridge laptop/ | 2022-03-28 16:05 | - | |
| Any news on the 6324W (white 6224W)/ | 2022-03-28 16:05 | - | |
| Anyone Own a Balance CN1401/ | 2022-03-28 16:05 | - | |
| Anyone Use Pcsx2 and or ePSXe/ | 2022-03-28 16:05 | - | |
| Anyone actually recieved their 6224 or 6625/ | 2022-03-28 16:05 | - | |
| Anyone bought a Laptop from Vigor Gaming/ | 2022-03-28 16:05 | - | |
| Anyone bought the HGL30 from MilestonePC (canada)/ | 2022-03-28 16:05 | - | |
| Anyone else having problems with Vista product activation/ | 2022-03-28 16:05 | - | |
| Anyone elses 3200 series get REALLY HOT/ | 2022-03-28 16:05 | - | |
| Anyone else using NHC/ | 2022-03-28 16:05 | - | |
| Anyone else with Nec Versa p9110/ | 2022-03-28 16:05 | - | |
| Anyone ever heard of EUROCOM/ | 2022-03-28 16:05 | - | |
| Anyone familiar with Jetbooks They look amazing/ | 2022-03-28 16:05 | - | |
| Anyone familiar with ZT Systems Notebooks/ | 2022-03-28 16:05 | - | |
| Anyone figure out how to get the White Keyboard lights on/ | 2022-03-28 16:05 | - | |
| Anyone get their IFL90 yet/ | 2022-03-28 16:05 | - | |
| Anyone got Jetbook 9620/ | 2022-03-28 16:05 | - | |
| Anyone got any details on new compal notebooks/ | 2022-03-28 16:05 | - | |
| Anyone have a guide to replace keyboard for Compal NBLB2 laptop/ | 2022-03-28 16:05 | - | |
| Anyone have any experience with Cyberpower/ | 2022-03-28 16:05 | - | |
| Anyone have restore disc(s) for AV3715-EH1 please/ | 2022-03-28 16:05 | - | |
| Anyone is willing to test a game/ | 2022-03-28 16:05 | - | |
| Anyone know about a Mitac 7321 Bios upgrade/ | 2022-03-28 16:05 | - | |
| Anyone know a deal for 3220H or 3225H/ | 2022-03-28 16:05 | - | |
| Anyone know a thing about Chembooks/ | 2022-03-28 16:05 | - | |
| Anyone know a way to change the kiss noise on the fingerprint reader/ | 2022-03-28 16:05 | - | |
| Anyone know how to get the fingerprint reader to work with Ubuntu/ | 2022-03-28 16:05 | - | |
| Anyone know of a reseller that ships to non-US customers/ | 2022-03-28 16:05 | - | |
| Anyone knows who makes this/ | 2022-03-28 16:05 | - | |
| Anyone know what the RAM specs are on these coming from Xoticpc/ | 2022-03-28 16:05 | - | |
| Anyone know where to get a lid logo button/ | 2022-03-28 16:05 | - | |
| Anyone need a broken Zepto 6324W (bad GFX card)/ | 2022-03-28 16:05 | - | |
| Anyone own a Quanta TW3A/ | 2022-03-28 16:05 | - | |
| Anyone own a Seanix/ | 2022-03-28 16:05 | - | |
| Anyone put Windows 8 on a CT14-a0 yet/ | 2022-03-28 16:05 | - | |
| Anyone read Danish/ | 2022-03-28 16:05 | - | |
| Anyone seen the Averatec 6210 notebook/ | 2022-03-28 16:05 | - | |
| Anyone tried System76/ | 2022-03-28 16:05 | - | |
| Anyone unhappy with their HEL80/ | 2022-03-28 16:05 | - | |
| Anyone use 2 OSs on their HEL 80/ | 2022-03-28 16:05 | - | |
| Anyone used the S pdif to connect to optical input/ | 2022-03-28 16:05 | - | |
| Anyone used the Trio-View screen outdoors for work/ | 2022-03-28 16:05 | - | |
| Anyone using BenQ Joybook S41/ | 2022-03-28 16:05 | - | |
| Anyone using their Hel-80 to record play music/ | 2022-03-28 16:05 | - | |
| Anyone who order HGL30/ | 2022-03-28 16:05 | - | |
| Anyone with IFL90 running Windows XP/ | 2022-03-28 16:05 | - | |
| Anyone with personal experience with a Quanta MW1/ | 2022-03-28 16:05 | - | |
| Any opinions on the SR2/ | 2022-03-28 16:05 | - | |
| Any positive experiences with 6625WD/ | 2022-03-28 16:05 | - | |
| Any reason not to buy Averatec/ | 2022-03-28 16:05 | - | |
| Any suggestions for Advent 7060 ( or something)/ | 2022-03-28 16:05 | - | |
| Any thoughts on winbook/ | 2022-03-28 16:05 | - | |
| Anyway of controlling Zepto Fans/ | 2022-03-28 16:05 | - | |
| Anyway to disable DVD eject button/ | 2022-03-28 16:05 | - | |
| Any way to find parts somewhere for the Zepto Nox A14/ | 2022-03-28 16:05 | - | |
| Any way to make my AV3250HX compatible with Google Earth/ | 2022-03-28 16:05 | - | |
| Any word on the next UX/ | 2022-03-28 16:05 | - | |
| Aopen 1557 keyboard problem!!/ | 2022-03-28 16:05 | - | |
| Aprox. 50% of the keyboard doesnt work on jft00/ | 2022-03-28 16:05 | - | |
| AquaMark Score/ | 2022-03-28 16:05 | - | |
| A question about waking up the computer/ | 2022-03-28 16:05 | - | |
| Archos 10/ | 2022-03-28 16:05 | - | |
| Arctic Silver/ | 2022-03-28 16:05 | - | |
| Are Hypersonic laptops any good/ | 2022-03-28 16:05 | - | |
| Are Rizeon still around/ | 2022-03-28 16:05 | - | |
| Are all other Averatec forums dead/ | 2022-03-28 16:05 | - | |
| Are averatecs reliable even more specific the 2200 series/ | 2022-03-28 16:05 | - | |
| Are some better driver than 97.92 drivers for Go 7600/ | 2022-03-28 16:05 | - | |
| Are we ever going to see an official review on the whitebook/ | 2022-03-28 16:05 | - | |
| Are you happy with your Compal/ | 2022-03-28 16:05 | - | |
| Are you happy with your HGL30/ | 2022-03-28 16:05 | - | |
| Are you satified with your zepto/ | 2022-03-28 16:05 | - | |
| Are you waiting for faster procs on the 14 ers/ | 2022-03-28 16:05 | - | |
| Are you willing to send complaints (IFL90)/ | 2022-03-28 16:05 | - | |
| Arghh! What does THIS mean/ | 2022-03-28 16:05 | - | |
| Arghhh! 6130-HS harddrive + CDROM problems/ | 2022-03-28 16:05 | - | |
| Arima/ | 2022-03-28 16:05 | - | |
| Arima 17 inch Sli notebook ! !/ | 2022-03-28 16:05 | - | |
| Arima W830-DA- 17 SLI Laptop/ | 2022-03-28 16:05 | - | |
| Arima W840 DI questions/ | 2022-03-28 16:05 | - | |
| Arima W840 temps/ | 2022-03-28 16:05 | - | |
| Arrow keys going nuts/ | 2022-03-28 16:05 | - | |
| Artefacts on 6214W/ | 2022-03-28 16:05 | - | |
| Asking 6224W owners a favor. (Regarding fan noises when laptop's idle)/ | 2022-03-28 16:05 | - | |
| A small thank you/ | 2022-03-28 16:05 | - | |
| Assembly-Guide Manual for whitebook/ | 2022-03-28 16:05 | - | |
| Asus C90 screen problems/ | 2022-03-28 16:05 | - | |
| Asus Color Crystal Shine vs. Compal FL30/ | 2022-03-28 16:05 | - | |
| Asus Free 1 Year Accidental Coverage/ | 2022-03-28 16:05 | - | |
| Asus W3J/ | 2022-03-28 16:05 | - | |
| Asus W3V v. Portable One MX/ | 2022-03-28 16:05 | - | |
| Atheros card in compal hgl30/ | 2022-03-28 16:05 | - | |
| Athlon 64 Notebooks + PCI-E ... when/ | 2022-03-28 16:05 | - | |
| Audio DJ Media Buttons on HEL80/ | 2022-03-28 16:05 | - | |
| Audio driver philips x54/ | 2022-03-28 16:05 | - | |
| Audio drivers/ | 2022-03-28 16:05 | - | |
| Audio getting quieter on HEL80/ | 2022-03-28 16:05 | - | |
| Audio not working/ | 2022-03-28 16:05 | - | |
| Audio skipping on 6625/ | 2022-03-28 16:05 | - | |
| Authorized dealer/ | 2022-03-28 16:05 | - | |
| Automatically start bisoncam on startup/ | 2022-03-28 16:05 | - | |
| Av 3700 Hdd/ | 2022-03-28 16:05 | - | |
| Available Networks can't shutdown/ | 2022-03-28 16:05 | - | |
| Avell G1540 Max/ | 2022-03-28 16:05 | - | |
| Averatch Ac Adapter Won't connect/ | 2022-03-28 16:05 | - | |
| Averatec & no bluetooth/ | 2022-03-28 16:05 | - | |
| Averatec + Windows 7 beta/ | 2022-03-28 16:05 | - | |
| Averatec, Systemax, same company/ | 2022-03-28 16:05 | - | |
| Averatec.com website updated!/ | 2022-03-28 16:05 | - | |
| Averatec 1020-ED1 $700/ | 2022-03-28 16:05 | - | |
| Averatec 1020-ED drivers/ | 2022-03-28 16:05 | - | |
| Averatec 1020- No settings for Sleep Hibernate/ | 2022-03-28 16:05 | - | |
| Averatec 1020 ed2- Please Help Me!/ | 2022-03-28 16:05 | - | |
| Averatec 1020ed Fan Speed Controls/ | 2022-03-28 16:05 | - | |
| Averatec 1020 rubber feet needed/ | 2022-03-28 16:05 | - | |
| Averatec 1020 running HOOOOT!/ | 2022-03-28 16:05 | - | |
| Averatec 1020 touch pad button issues/ | 2022-03-28 16:05 | - | |
| Averatec 1020 which DVD-RW will fit/ | 2022-03-28 16:05 | - | |
| Averatec 1050 for $990/ | 2022-03-28 16:05 | - | |
| Averatec 1150 fan/ | 2022-03-28 16:05 | - | |
| Averatec 1500 coming on 19th, only $1300!/ | 2022-03-28 16:05 | - | |
| Averatec 1579 no where in stock!/ | 2022-03-28 16:05 | - | |
| Averatec 2100 Series Audio Download Help !!/ | 2022-03-28 16:05 | - | |
| Averatec 2100 Series USB issues/ | 2022-03-28 16:05 | - | |
| Averatec 2100 is MSI S270/ | 2022-03-28 16:05 | - | |
| Averatec 2150 Screen Problem/ | 2022-03-28 16:05 | - | |
| Averatec 2150 keyboard issue/ | 2022-03-28 16:05 | - | |
| Averatec 2150 sound quality/ | 2022-03-28 16:05 | - | |
| Averatec 2200 Bios Issue/ | 2022-03-28 16:05 | - | |
| Averatec 2200 Series -- Mousepad problem!/ | 2022-03-28 16:05 | - | |
| Averatec 2200 battery will not charge/ | 2022-03-28 16:05 | - | |
| Averatec 2260 Not Powering Up/ | 2022-03-28 16:05 | - | |
| Averatec 2300 (Amd Turion 64 x2)/ | 2022-03-28 16:05 | - | |
| Averatec 2300 AC Power Supply/ | 2022-03-28 16:05 | - | |
| Averatec 2300 Coprocessor, Mass Storage/ | 2022-03-28 16:05 | - | |
| Averatec 2300 Video Driver issues/ | 2022-03-28 16:05 | - | |
| Averatec 2300 Video Lan and Modem Driver/ | 2022-03-28 16:05 | - | |
| Averatec 2300 disassembly/ | 2022-03-28 16:05 | - | |
| Averatec 2300 series Video Driver Issue/ | 2022-03-28 16:05 | - | |
| Averatec 2300 series repair/ | 2022-03-28 16:05 | - | |
| Averatec 2370 -- power adapter/ | 2022-03-28 16:05 | - | |
| Averatec 2370 - Extremely HOT, and not in a good way/ | 2022-03-28 16:05 | - | |
| Averatec 2370/ | 2022-03-28 16:05 | - | |
| Averatec 2370 Image to TV/ | 2022-03-28 16:05 | - | |
| Averatec 2370 Major Problem! Please Help/ | 2022-03-28 16:05 | - | |
| Averatec 2370 Reviews Share/ | 2022-03-28 16:05 | - | |
| Averatec 2370 Video Out Resolution 1680x1050/ | 2022-03-28 16:05 | - | |
| Averatec 2370 and 4 Gb SD card compatibility/ | 2022-03-28 16:05 | - | |
| Averatec 2370 card reader drivers/ | 2022-03-28 16:05 | - | |
| Averatec 2370 close lid video issue/ | 2022-03-28 16:05 | - | |
| Averatec 2370 prompts for Phoenix on boot/ | 2022-03-28 16:05 | - | |
| Averatec 2371 Notebook PC power problem/ | 2022-03-28 16:05 | - | |
| Averatec2500 GPU issues/ | 2022-03-28 16:05 | - | |
| Averatec 2500 Series Can't Wake up/ | 2022-03-28 16:05 | - | |
| Averatec 2500 USB Driver Updates/ | 2022-03-28 16:05 | - | |
| Averatec 2500 series/ | 2022-03-28 16:05 | - | |
| Averatec 2573 2575 and Acer Ferrari 1100 cousins/ | 2022-03-28 16:05 | - | |
| Averatec 3150P Northbridge Fan Error/ | 2022-03-28 16:05 | - | |
| Averatec 3150 drivers/ | 2022-03-28 16:05 | - | |
| Averatec 3200 - Mobo issues/ | 2022-03-28 16:05 | - | |
| Averatec 3200 - will it run XP sp 3/ | 2022-03-28 16:05 | - | |
| Averatec 3200 A C power in problem/ | 2022-03-28 16:05 | - | |
| Averatec 3200 BSDO on startup/ | 2022-03-28 16:05 | - | |
| Averatec 3200 Beeping Every 15 Seconds/ | 2022-03-28 16:05 | - | |
| Averatec 3200 HDD problems ASAP/ | 2022-03-28 16:05 | - | |
| Averatec 3200 and multitaking with Design software/ | 2022-03-28 16:05 | - | |
| Averatec 3200 hard drive rewrite/ | 2022-03-28 16:05 | - | |
| Averatec 3220 CMOS battery/ | 2022-03-28 16:05 | - | |
| Averatec 3220HS Wi-Fi Issue/ | 2022-03-28 16:05 | - | |
| Averatec 3221H1 Wireless/ | 2022-03-28 16:05 | - | |
| Averatec 3250-H1 Dead Screen/ | 2022-03-28 16:05 | - | |
| Averatec 3250- Replacing the keyboard/ | 2022-03-28 16:05 | - | |
| Averatec 3250/ | 2022-03-28 16:05 | - | |
| Averatec 3250HX/ | 2022-03-28 16:05 | - | |
| Averatec 3250 Overheating Problems HELP/ | 2022-03-28 16:05 | - | |
| Averatec 3250 Question/ | 2022-03-28 16:05 | - | |
| Averatec 3260 - need help to install XP Home/ | 2022-03-28 16:05 | - | |
| Averatec 3260 SD card reader driver/ | 2022-03-28 16:05 | - | |
| Averatec 3270, need a new battery!/ | 2022-03-28 16:05 | - | |
| Averatec 3270-- YAY!Now does any1 have benchmarks/ | 2022-03-28 16:05 | - | |
| Averatec 3270 Questions/ | 2022-03-28 16:05 | - | |
| Averatec 3270 booting problem/ | 2022-03-28 16:05 | - | |
| Averatec 3270 graphic problem/ | 2022-03-28 16:05 | - | |
| Averatec 3360- Advice/ | 2022-03-28 16:05 | - | |
| Averatec 3360-eg1/ | 2022-03-28 16:05 | - | |
| Averatec 3360 EH1/ | 2022-03-28 16:05 | - | |
| Averatec 3700 - How to remove keyboard/ | 2022-03-28 16:05 | - | |
| Averatec 3700 Drivers PLEASE!!!!!!/ | 2022-03-28 16:05 | - | |
| Averatec 3715-EH1 network and VGA drivers/ | 2022-03-28 16:05 | - | |
| Averatec 4100 AV4155-EH1 Sound Card 2-ch to 4-ch/ | 2022-03-28 16:05 | - | |
| Averatec 4200 series clock speed problem/ | 2022-03-28 16:05 | - | |
| Averatec 4265 DVD Burning Issues/ | 2022-03-28 16:05 | - | |
| Averatec 4265 at staples/ | 2022-03-28 16:05 | - | |
| Averatec 5400/ | 2022-03-28 16:05 | - | |
| Averatec 5400 RAM increase/ | 2022-03-28 16:05 | - | |
| Averatec 5400 Review/ | 2022-03-28 16:05 | - | |
| Averatec 5400 Series/ | 2022-03-28 16:05 | - | |
| Averatec 5400 and SP3/ | 2022-03-28 16:05 | - | |
| Averatec 5400 ser CPU upgrade/ | 2022-03-28 16:05 | - | |
| Averatec 5400 wouldn't turn on. =(/ | 2022-03-28 16:05 | - | |
| Averatec 5428/ | 2022-03-28 16:05 | - | |
| Averatec 6100 - black screen/ | 2022-03-28 16:05 | - | |
| Averatec 6100/ | 2022-03-28 16:05 | - | |
| Averatec 6100 and SiS Wireless/ | 2022-03-28 16:05 | - | |
| Averatec 6100 for gaming Check out specs!/ | 2022-03-28 16:05 | - | |
| Averatec 6100 help me please/ | 2022-03-28 16:05 | - | |
| Averatec 6100 memory. PC2700 or PC3200/ | 2022-03-28 16:05 | - | |
| Averatec 6100 series model 6130H1-10 bios/ | 2022-03-28 16:05 | - | |
| Averatec 6100 shuts down after 3 or 4 sec/ | 2022-03-28 16:05 | - | |
| Averatec 6100 will not output on S-video/ | 2022-03-28 16:05 | - | |
| Averatec 6110 DVD-DL problem/ | 2022-03-28 16:05 | - | |
| Averatec 6110EH-1 from FutureShop/ | 2022-03-28 16:05 | - | |
| Averatec 6110 or 6100A/ | 2022-03-28 16:05 | - | |
| Averatec 6130H - Selling Parts/ | 2022-03-28 16:05 | - | |
| Averatec 6130HS - Sound Skipping Video Freeze/ | 2022-03-28 16:05 | - | |
| Averatec 6130HS Graphics Upgrade/ | 2022-03-28 16:05 | - | |
| Averatec 6130HS Wireless Problems/ | 2022-03-28 16:05 | - | |
| Averatec 6130 HS vs 6200/ | 2022-03-28 16:05 | - | |
| Averatec 6130 display issues/ | 2022-03-28 16:05 | - | |
| Averatec 6130 dropped 70 in price/ | 2022-03-28 16:05 | - | |
| Averatec 6130 shuts down by itself...help!!!/ | 2022-03-28 16:05 | - | |
| Averatec 6200 Series Audio driver/ | 2022-03-28 16:05 | - | |
| Averatec 6200 new model already !!!/ | 2022-03-28 16:05 | - | |
| Averatec 6200 series/ | 2022-03-28 16:05 | - | |
| Averatec 6200 wireless adaptor issues/ | 2022-03-28 16:05 | - | |
| Averatec 6210/ | 2022-03-28 16:05 | - | |
| Averatec 6210 Audio Problem.... Please Help!/ | 2022-03-28 16:05 | - | |
| Averatec 6210 Keyboard/ | 2022-03-28 16:05 | - | |
| Averatec 6210 vs. 5400/ | 2022-03-28 16:05 | - | |
| Averatec 6235 Review/ | 2022-03-28 16:05 | - | |
| Averatec 6235 won't charge past 1 %/ | 2022-03-28 16:05 | - | |
| Averatec 6240 - Can't Install Windows XP!/ | 2022-03-28 16:05 | - | |
| Averatec 6240 Rebuild Review/ | 2022-03-28 16:05 | - | |
| Averatec 6240 VISTA/ | 2022-03-28 16:05 | - | |
| Averatec 7100/ | 2022-03-28 16:05 | - | |
| Averatec 7100 17 notebook series/ | 2022-03-28 16:05 | - | |
| Averatec 7100 Dead/ | 2022-03-28 16:05 | - | |
| Averatec 7100 question/ | 2022-03-28 16:05 | - | |
| Averatec 7100 series, half starts/ | 2022-03-28 16:05 | - | |
| Averatec 32500 White Doc Service Manual/ | 2022-03-28 16:05 | - | |
| Averatec AHI UMPC/ | 2022-03-28 16:05 | - | |
| Averatec AMD 64 Notebook(AV6240-EH1)/ | 2022-03-28 16:05 | - | |
| Averatec AV2150-EH1 screen goes blank/ | 2022-03-28 16:05 | - | |
| Averatec AV3225HS or AV3250H1/ | 2022-03-28 16:05 | - | |
| Averatec AV3715-EH1 wireless flaky/ | 2022-03-28 16:05 | - | |
| Averatec AV5428HX/ | 2022-03-28 16:05 | - | |
| Averatec AV5500-EA1/ | 2022-03-28 16:05 | - | |
| Averatec AV6130PX/ | 2022-03-28 16:05 | - | |
| Averatec AV6235-EE1/ | 2022-03-28 16:05 | - | |
| Averatec Bad!!!!/ | 2022-03-28 16:05 | - | |
| Averatec C3500 Tablet Cmos Issue/ | 2022-03-28 16:05 | - | |
| Averatec Corporate Information/ | 2022-03-28 16:05 | - | |
| Averatec Launches New Line of Ultra-Thin Notebooks/ | 2022-03-28 16:05 | - | |
| Averatec N1231 Battery/ | 2022-03-28 16:05 | - | |
| Averatec Out of Business Market/ | 2022-03-28 16:05 | - | |
| Averatec Problem/ | 2022-03-28 16:05 | - | |
| Averatec Satisfaction Poll/ | 2022-03-28 16:05 | - | |
| Averatec Series N1000 HDD Error/ | 2022-03-28 16:05 | - | |
| Averatec USB 2.0/ | 2022-03-28 16:05 | - | |
| Averatec Wallpaper/ | 2022-03-28 16:05 | - | |
| Averatec Warranty/ | 2022-03-28 16:05 | - | |
| Averatec Wireless connection problem/ | 2022-03-28 16:05 | - | |
| Averatec any good/ | 2022-03-28 16:05 | - | |
| Averatec at Amazon!!/ | 2022-03-28 16:05 | - | |
| Averatec average temps-/ | 2022-03-28 16:05 | - | |
| Averatec case cracking issue/ | 2022-03-28 16:05 | - | |
| Averatec cheap b c it's a no name brand/ | 2022-03-28 16:05 | - | |
| Averatec error message/ | 2022-03-28 16:05 | - | |
| Averatec for college/ | 2022-03-28 16:05 | - | |
| Averatech 6100 series/ | 2022-03-28 16:05 | - | |
| Averatech 6200 series laptop - optical drive issue/ | 2022-03-28 16:05 | - | |
| Averatech Quality/ | 2022-03-28 16:05 | - | |
| Averatec help/ | 2022-03-28 16:05 | - | |
| Averatec laptop mouse problem/ | 2022-03-28 16:05 | - | |
| Averatec laptops and games/ | 2022-03-28 16:05 | - | |
| Averatec memory question/ | 2022-03-28 16:05 | - | |
| Averatec notebooks, good value for the basic user/ | 2022-03-28 16:05 | - | |
| Averatec now a label for Trigem/ | 2022-03-28 16:05 | - | |
| Averatec on the way out/ | 2022-03-28 16:05 | - | |
| Averatec power management/ | 2022-03-28 16:05 | - | |
| Averatec recovery disks/ | 2022-03-28 16:05 | - | |
| Averatec said I am no longer eligible for Vista upgrade/ | 2022-03-28 16:05 | - | |
| Averatec support- Motherboard backordered over 5 weeks - what to do/ | 2022-03-28 16:05 | - | |
| Averatec tech support - who are these guys/ | 2022-03-28 16:05 | - | |
| Averatec the new Packard Bell/ | 2022-03-28 16:05 | - | |
| Averatec to launch Eee PC type Netbook/ | 2022-03-28 16:05 | - | |
| Averatec usb is gone/ | 2022-03-28 16:05 | - | |
| Averatec users...hows your lappy durability/ | 2022-03-28 16:05 | - | |
| Averatec vs. Toshiba/ | 2022-03-28 16:05 | - | |
| Avertatec AD135 All-in-one/ | 2022-03-28 16:05 | - | |
| Avertec 2300 case squeaking/ | 2022-03-28 16:05 | - | |
| Avertec 3700 recovery disc/ | 2022-03-28 16:05 | - | |
| Avertec 6200 LAN Drivers/ | 2022-03-28 16:05 | - | |
| Avertec in Bestbuy/ | 2022-03-28 16:05 | - | |
| Avoid Zepto DK and SE at all cost!/ | 2022-03-28 16:05 | - | |
| A warning about ibuypower/ | 2022-03-28 16:05 | - | |
| A way to make more then 3GB RAM available in WinXP Pro SP2-3 32bit/ | 2022-03-28 16:05 | - | |
| A word of caution with bios 1.16/ | 2022-03-28 16:05 | - | |
| BBC Micro-bit officially launches as 29 partners join forces to get kids coding/ | 2022-03-28 16:05 | - | |
| BF2 problem/ | 2022-03-28 16:05 | - | |
| BIOS 1.20 available/ | 2022-03-28 16:05 | - | |
| BIOS CMOS Clear/ | 2022-03-28 16:05 | - | |
| BIOS Reset on IFL90/ | 2022-03-28 16:05 | - | |
| BIOS Update and RMClock/ | 2022-03-28 16:05 | - | |
| BIOS problem with XP, FL90/ | 2022-03-28 16:05 | - | |
| BIOS update/ | 2022-03-28 16:05 | - | |
| BOOT Logo/ | 2022-03-28 16:05 | - | |
| BSOD's with Mobility Modded drivers/ | 2022-03-28 16:05 | - | |
| BSOD at Boot/ | 2022-03-28 16:05 | - | |
| BSOD on new EL-80/ | 2022-03-28 16:05 | - | |
| BTO and Alternate/ | 2022-03-28 16:05 | - | |
| Backlight bleeding/ | 2022-03-28 16:05 | - | |
| Backlight keyboard in TongFang model GI5CN5E/ | 2022-03-28 16:05 | - | |
| Backpac for HEL 80/ | 2022-03-28 16:05 | - | |
| Backpack for my new Hel 80/ | 2022-03-28 16:05 | - | |
| Backspace problem/ | 2022-03-28 16:05 | - | |
| Back to looking for a good 14 Zepto Znote G14B/ | 2022-03-28 16:05 | - | |
| Backup battery for BIOS/ | 2022-03-28 16:05 | - | |
| Bad, awful 1440x800 screen quality on IFL90/ | 2022-03-28 16:05 | - | |
| Bad BIOS flash - Need help/ | 2022-03-28 16:05 | - | |
| Bad Memory causes 6130 overheating/ | 2022-03-28 16:05 | - | |
| Bad battery or laptop issue/ | 2022-03-28 16:05 | - | |
| Bad customer service from Zepto/ | 2022-03-28 16:05 | - | |
| Bad experience with Averatec 2370/ | 2022-03-28 16:05 | - | |
| Bad experience with an ECS notebook/ | 2022-03-28 16:05 | - | |
| Bag for IFL90/ | 2022-03-28 16:05 | - | |
| Bake my Laptop, BenQ S41 in Oven, Fixed the GPU Problem Mobo/ | 2022-03-28 16:05 | - | |
| Balance AMD Athlon 1.2GHz 40GB 256MB DVD-R CD-RW/ | 2022-03-28 16:05 | - | |
| Balance is now IC Power/ | 2022-03-28 16:05 | - | |
| Banned from OCZ forums/ | 2022-03-28 16:05 | - | |
| Barbones in the UK/ | 2022-03-28 16:05 | - | |
| Barebone 6615wd/ | 2022-03-28 16:05 | - | |
| Barebone System/ | 2022-03-28 16:05 | - | |
| Barebones GL-30 differences/ | 2022-03-28 16:05 | - | |
| Barebones Laptop Driver CD Lost Can Recover in Running Win/ | 2022-03-28 16:05 | - | |
| Bare bones or White book Zeptos/ | 2022-03-28 16:05 | - | |
| Barebone vs. Factory-built/ | 2022-03-28 16:05 | - | |
| Battalion 101 CZ-9 Ultra Notebook by Ibuypower/ | 2022-03-28 16:05 | - | |
| Battalion 101 G-600/ | 2022-03-28 16:05 | - | |
| Battalion 101 W150ERQ (A good buy )/ | 2022-03-28 16:05 | - | |
| Battalion 101 cz-8 ultra 2/ | 2022-03-28 16:05 | - | |
| Battalion SL/ | 2022-03-28 16:05 | - | |
| Batteries for the 4100 series/ | 2022-03-28 16:05 | - | |
| Battery/ | 2022-03-28 16:05 | - | |
| Battery Icon Issue! Help !/ | 2022-03-28 16:05 | - | |
| Battery Life - HGL30/ | 2022-03-28 16:05 | - | |
| Battery Life/ | 2022-03-28 16:05 | - | |
| Battery Replacement/ | 2022-03-28 16:05 | - | |
| Battery Tech. for those interested/ | 2022-03-28 16:05 | - | |
| Battery Time/ | 2022-03-28 16:05 | - | |
| Battery Time Left in vista x64/ | 2022-03-28 16:05 | - | |
| Battery Trade!!/ | 2022-03-28 16:05 | - | |
| Battery care/ | 2022-03-28 16:05 | - | |
| Battery drains really fast/ | 2022-03-28 16:05 | - | |
| Battery for the Zepto 6214W/ | 2022-03-28 16:05 | - | |
| Battery is dead/ | 2022-03-28 16:05 | - | |
| Battery isn't charging/ | 2022-03-28 16:05 | - | |
| Battery meter going completely berserk (HGL-30)/ | 2022-03-28 16:05 | - | |
| Battery problem with CN15-A5 laptop/ | 2022-03-28 16:05 | - | |
| Battery problem with sharp al27/ | 2022-03-28 16:05 | - | |
| Battery question/ | 2022-03-28 16:05 | - | |
| Battery replacement for Vizio CT14/ | 2022-03-28 16:05 | - | |
| Battery time with a nox nexus mythos/ | 2022-03-28 16:05 | - | |
| Battlefield 3 Download/ | 2022-03-28 16:05 | - | |
| Be aware of Zepto Dennmark !!!/ | 2022-03-28 16:05 | - | |
| Belinea o.book 1 overclocking!/ | 2022-03-28 16:05 | - | |
| BenQ/ | 2022-03-28 16:05 | - | |
| BenQ Joybook A52 and linux/ | 2022-03-28 16:05 | - | |
| BenQ Joybook A52 upgrades/ | 2022-03-28 16:05 | - | |
| BenQ Joybook Lite u121 eco/ | 2022-03-28 16:05 | - | |
| BenQ S41 S42 motherboard/ | 2022-03-28 16:05 | - | |
| BenQ S41 VGA Error/ | 2022-03-28 16:05 | - | |
| BenQ S57 JoyBook Disassembly instructions/ | 2022-03-28 16:05 | - | |
| BenQ S57 service manual/ | 2022-03-28 16:05 | - | |
| BenQ S72/ | 2022-03-28 16:05 | - | |
| BenQ U101 problem/ | 2022-03-28 16:05 | - | |
| BenQ sucks; crazy fan and bad service/ | 2022-03-28 16:05 | - | |
| Benq - Help!!/ | 2022-03-28 16:05 | - | |
| Benq - S42/ | 2022-03-28 16:05 | - | |
| Benq 7000/ | 2022-03-28 16:05 | - | |
| Benq Joybook A52/ | 2022-03-28 16:05 | - | |
| Benq R55 - mainboard and graphic card broken/ | 2022-03-28 16:05 | - | |
| Benq S41 and multitouch/ | 2022-03-28 16:05 | - | |
| Benq S7000, and S52 (name not unknown)/ | 2022-03-28 16:05 | - | |
| Benq X31 13 LED with 8600GT/ | 2022-03-28 16:05 | - | |
| Benq joybook s73G fan problem/ | 2022-03-28 16:05 | - | |
| Benq laptops and Benq S72/ | 2022-03-28 16:05 | - | |
| Benq s73g bios flash recovery/ | 2022-03-28 16:05 | - | |
| Best Case Sleeve For Vizio CT14/ | 2022-03-28 16:05 | - | |
| Best HEL80 video drivers/ | 2022-03-28 16:05 | - | |
| Best IFL90 8600M GT Drivers that will play Audiosurf from laptopvideo2go/ | 2022-03-28 16:05 | - | |
| Best OC guidelines/ | 2022-03-28 16:05 | - | |
| Best TONGFANG GK5CN5Z laptop cooler/ | 2022-03-28 16:05 | - | |
| Best Way to Config IFL90 Within Budget/ | 2022-03-28 16:05 | - | |
| Best cooler pad cooler fan for the HEL80/ | 2022-03-28 16:05 | - | |
| Best cooling pad for the Tongfang GK5CN5Z/ | 2022-03-28 16:05 | - | |
| Best nVidia driver for HEL80/ | 2022-03-28 16:05 | - | |
| Best video driver for NVIDIA GeForce 8600M GT/ | 2022-03-28 16:05 | - | |
| Best way to OC a P9500 2.5mhz/ | 2022-03-28 16:05 | - | |
| Best way to clean the screen/ | 2022-03-28 16:05 | - | |
| Better Battery Life/ | 2022-03-28 16:05 | - | |
| Beware of Zepto!! Great Hardware, Horrible Service!!/ | 2022-03-28 16:05 | - | |
| Big Big Problem!!!/ | 2022-03-28 16:05 | - | |
| Big Problems Nox A14, Wlan Bluetooth/ | 2022-03-28 16:05 | - | |
| Big problem with PowerNotebooks, need advice please/ | 2022-03-28 16:05 | - | |
| Bind function key (fn) to something else/ | 2022-03-28 16:05 | - | |
| Biometric/ | 2022-03-28 16:05 | - | |
| Biometric Fingerprint Security Reader Functionality on Hel 80/ | 2022-03-28 16:05 | - | |
| Bios 1.19 - released/ | 2022-03-28 16:05 | - | |
| Bios Flash Problem/ | 2022-03-28 16:05 | - | |
| Bios Logo editing/ | 2022-03-28 16:05 | - | |
| Bios Update for 6130HS/ | 2022-03-28 16:05 | - | |
| Bios corrupted/ | 2022-03-28 16:05 | - | |
| Bioshock on a 6224, not as good as expected help me/ | 2022-03-28 16:05 | - | |
| Bios manual for 6024/ | 2022-03-28 16:05 | - | |
| Bios update for Averatec 5400's AN5W mobo/ | 2022-03-28 16:05 | - | |
| Bios update nox15 No battery detected + more/ | 2022-03-28 16:05 | - | |
| Bios upgrade/ | 2022-03-28 16:05 | - | |
| BisonCam/ | 2022-03-28 16:05 | - | |
| BisonCam Alternatives/ | 2022-03-28 16:05 | - | |
| Bit the bullet got an SC17/ | 2022-03-28 16:05 | - | |
| Bizcom-US Support page asking for login password/ | 2022-03-28 16:05 | - | |
| Bizcom/ | 2022-03-28 16:05 | - | |
| Black Linux 20GB EEE 900 Arriving/ | 2022-03-28 16:05 | - | |
| Black Screen/ | 2022-03-28 16:05 | - | |
| Black Screen Fix/ | 2022-03-28 16:05 | - | |
| Black screen, can i fix it/ | 2022-03-28 16:05 | - | |
| Black screen after uninstalling GPU drivers/ | 2022-03-28 16:05 | - | |
| Black screen problem on Zepto Znote G15b/ | 2022-03-28 16:05 | - | |
| Blank Screen Reprise/ | 2022-03-28 16:05 | - | |
| Blu-ray playing software/ | 2022-03-28 16:05 | - | |
| BluRay-optical in Zepto Znote 6224W/ | 2022-03-28 16:05 | - | |
| Blue Screen Windows Update/ | 2022-03-28 16:05 | - | |
| BlueSoleil 5/ | 2022-03-28 16:05 | - | |
| Blueray player now available from Zepto/ | 2022-03-28 16:05 | - | |
| Bluescreen Mania - 6625wd/ | 2022-03-28 16:05 | - | |
| Bluetooth/ | 2022-03-28 16:05 | - | |
| Bluetooth Audio HGL30 buzzing/ | 2022-03-28 16:05 | - | |
| Bluetooth Cable/ | 2022-03-28 16:05 | - | |
| Bluetooth and WiFi control/ | 2022-03-28 16:05 | - | |
| Bluetooth and WiFi interfering/ | 2022-03-28 16:05 | - | |
| Bluetooth dead after motherboard replacement/ | 2022-03-28 16:05 | - | |
| Bluetooth device not working/ | 2022-03-28 16:05 | - | |
| Bluetooth in 6224W/ | 2022-03-28 16:05 | - | |
| Bluetooth mouse problem with Inspiron 1520/ | 2022-03-28 16:05 | - | |
| Bluetooth problems with the 2425w/ | 2022-03-28 16:05 | - | |
| Bluetooth trouble/ | 2022-03-28 16:05 | - | |
| Bluetooth with IFL90/ | 2022-03-28 16:05 | - | |
| Bluooth in Znote 6224/ | 2022-03-28 16:05 | - | |
| Boot Problem/ | 2022-03-28 16:05 | - | |
| Bootable USB Flash Drive Made Easy/ | 2022-03-28 16:05 | - | |
| Boot from SD card/ | 2022-03-28 16:05 | - | |
| Boot from USB/ | 2022-03-28 16:05 | - | |
| BootlogoTools for IFL90/ | 2022-03-28 16:05 | - | |
| Boot time/ | 2022-03-28 16:05 | - | |
| Boot up problem on new whitebook/ | 2022-03-28 16:05 | - | |
| Boot up problems/ | 2022-03-28 16:05 | - | |
| Bought- Akasa Gemini cooler/ | 2022-03-28 16:05 | - | |
| Bought mine at/ | 2022-03-28 16:05 | - | |
| Boutique HEL80 Rebranding/ | 2022-03-28 16:05 | - | |
| Boutique gaming rigs and their respective ODMs/ | 2022-03-28 16:05 | - | |
| Brightness level goes down automatically on battery/ | 2022-03-28 16:05 | - | |
| Bright spot in my matte screen/ | 2022-03-28 16:05 | - | |
| Broadcom NetLink Ethernet on IFL90 JFL92. Is there a problem/ | 2022-03-28 16:05 | - | |
| Broken Compal HEL80 LCD Screen/ | 2022-03-28 16:05 | - | |
| Broken Usb Sockets on laptop/ | 2022-03-28 16:05 | - | |
| Bsod 6625wd/ | 2022-03-28 16:05 | - | |
| Bto P book 15c27+/ | 2022-03-28 16:05 | - | |
| Bugs In My Ifl90/ | 2022-03-28 16:05 | - | |
| Build Quality Reliability of 2370/ | 2022-03-28 16:05 | - | |
| Build Quality on the HGL-30/ | 2022-03-28 16:05 | - | |
| Building FL90/ | 2022-03-28 16:05 | - | |
| Building First Notebook I Have Questions About a Compal Can Someone Help Thanks!/ | 2022-03-28 16:05 | - | |
| Building IFL90. Anything I need to know/ | 2022-03-28 16:05 | - | |
| Building a IFL90/ | 2022-03-28 16:05 | - | |
| Building compal hel80 (need advice)/ | 2022-03-28 16:05 | - | |
| Build quality Asus G1s vs Compal IFL90 vs Sager 2090/ | 2022-03-28 16:05 | - | |
| Build quality of FL92/ | 2022-03-28 16:05 | - | |
| Built-in Multi-Region TV Tuner/ | 2022-03-28 16:05 | - | |
| Burn Dvd/ | 2022-03-28 16:05 | - | |
| Burner change for ft02 BENQ DS-8a1p/ | 2022-03-28 16:05 | - | |
| Burning DVDs to the 3270-EH1 Hard Drive/ | 2022-03-28 16:05 | - | |
| Burning smell/ | 2022-03-28 16:05 | - | |
| Buttons on the whitebooks/ | 2022-03-28 16:05 | - | |
| Buying 6625WD/ | 2022-03-28 16:05 | - | |
| Buying A Zepto/ | 2022-03-28 16:05 | - | |
| Buying Compal Barebone in Europe/ | 2022-03-28 16:05 | - | |
| Buying Components for a whitebook/ | 2022-03-28 16:05 | - | |
| Buying Customizing a 6214W (Germany)/ | 2022-03-28 16:05 | - | |
| Buying a Compal HGL30/ | 2022-03-28 16:05 | - | |
| Buying a HEL 80 barebone/ | 2022-03-28 16:05 | - | |
| Buying a NOX/ | 2022-03-28 16:05 | - | |
| Buying a Zepto 6224W/ | 2022-03-28 16:05 | - | |
| Buying a zepto as a barebones/ | 2022-03-28 16:05 | - | |
| Buying a zepto from the US-customs-taxes-duties and fees/ | 2022-03-28 16:05 | - | |
| Buying from Taiwan/ | 2022-03-28 16:05 | - | |
| Buying in Belgium/ | 2022-03-28 16:05 | - | |
| Buying new battery 3150H/ | 2022-03-28 16:05 | - | |
| Buy the HD3870/ | 2022-03-28 16:05 | - | |
| Buzz high pitch sound in headphone output/ | 2022-03-28 16:05 | - | |
| Buzzing display on 6324W/ | 2022-03-28 16:05 | - | |
| Buzzing noise from IFL90/ | 2022-03-28 16:05 | - | |
| C90 out in the UK/ | 2022-03-28 16:05 | - | |
| C3500 CMOS battery/ | 2022-03-28 16:05 | - | |
| C3500T and Windows 7/ | 2022-03-28 16:05 | - | |
| CBB Series/ | 2022-03-28 16:05 | - | |
| CD,DVD RW drive for compal dcy30/ | 2022-03-28 16:05 | - | |
| CD-Rom not showing up in Bios, but works in Windows/ | 2022-03-28 16:05 | - | |
| CD DVD Drive - HGL30/ | 2022-03-28 16:05 | - | |
| CDs refuse to self-boot/ | 2022-03-28 16:05 | - | |
| CL51 bios password, and fan/ | 2022-03-28 16:05 | - | |
| CL 51 fault/ | 2022-03-28 16:05 | - | |
| CL56 Corrupt BIOS/ | 2022-03-28 16:05 | - | |
| CL56 Wireless Switch (and wireless) not working/ | 2022-03-28 16:05 | - | |
| CL56 hibernated, now won't boot at all/ | 2022-03-28 16:05 | - | |
| CL56 or M6N/ | 2022-03-28 16:05 | - | |
| CL56 user, looking for similar notebook/ | 2022-03-28 16:05 | - | |
| CL56 vs. acer 2012 vs. cyberpower X64/ | 2022-03-28 16:05 | - | |
| CLEVO D900K w Dual Core AMD/ | 2022-03-28 16:06 | - | |
| CMOS battery BIOS reset on 6615WD/ | 2022-03-28 16:06 | - | |
| CN15-A1 Impressions/ | 2022-03-28 16:06 | - | |
| CN15-A2 Available from Vizio.com/ | 2022-03-28 16:06 | - | |
| CNET review of MX finally up/ | 2022-03-28 16:06 | - | |
| COMPAL EL80 Slow HD access/ | 2022-03-28 16:06 | - | |
| COMPAL HEL80 AND Linux/ | 2022-03-28 16:06 | - | |
| COMPAL HEL80 PCI Flash memory Vista drivers HELP!!!/ | 2022-03-28 16:06 | - | |
| COMPAL JHL90 BIOS password help!/ | 2022-03-28 16:06 | - | |
| COMPAQ Presario CQ71 Laptop/ | 2022-03-28 16:06 | - | |
| COMPUSA test markets Averatec 3150HD/ | 2022-03-28 16:06 | - | |
| CONSTANT overheating/ | 2022-03-28 16:06 | - | |
| CPU Cooler Software for 6130/ | 2022-03-28 16:06 | - | |
| CPU Temp on 6130hs/ | 2022-03-28 16:06 | - | |
| CPU Temps on high performance vista/ | 2022-03-28 16:06 | - | |
| CPU Upgrade/ | 2022-03-28 16:06 | - | |
| CPU Upgrade Question/ | 2022-03-28 16:06 | - | |
| CPU in 625wd/ | 2022-03-28 16:06 | - | |
| CPU temperature sensor/ | 2022-03-28 16:06 | - | |
| CPU throttle back when it's to hot/ | 2022-03-28 16:06 | - | |
| CPU to hot/ | 2022-03-28 16:06 | - | |
| CPU upgrade for my Medion laptop/ | 2022-03-28 16:06 | - | |
| CPU upgrading on IFL 90 (from T7100 to T9400 or T8400)/ | 2022-03-28 16:06 | - | |
| CS 1.6 Crashing with HGL30/ | 2022-03-28 16:06 | - | |
| CT-14A0 Fan Issue and couple of questions/ | 2022-03-28 16:06 | - | |
| CT14, surprised no forum reviews/ | 2022-03-28 16:06 | - | |
| CT14-A2 Keyboard problems/ | 2022-03-28 16:06 | - | |
| CT14-A4 - A couple questions about the screen/ | 2022-03-28 16:06 | - | |
| CT15-A2 speaker issue/ | 2022-03-28 16:06 | - | |
| CT15-A4- Anybody else have one yet/ | 2022-03-28 16:06 | - | |
| CX review/ | 2022-03-28 16:06 | - | |
| CX series/ | 2022-03-28 16:06 | - | |
| CY30 issues/ | 2022-03-28 16:06 | - | |
| Cable for 2150 eh1/ | 2022-03-28 16:05 | - | |
| Calibrating the screen/ | 2022-03-28 16:05 | - | |
| Call Of Duty Running Great on 6130/ | 2022-03-28 16:05 | - | |
| Calling all 6130-HS2 users!!!/ | 2022-03-28 16:05 | - | |
| Calling all Compal geeks! HEL80 screen is messed up!/ | 2022-03-28 16:05 | - | |
| Camera key doesn't take pictures/ | 2022-03-28 16:05 | - | |
| Camera on 6625wd/ | 2022-03-28 16:05 | - | |
| Can't Disable Standby Mode/ | 2022-03-28 16:05 | - | |
| Can't detect the HD/ | 2022-03-28 16:05 | - | |
| Can't enable ReadyDrive/ | 2022-03-28 16:05 | - | |
| Can't get audio to work on my FL90/ | 2022-03-28 16:05 | - | |
| Can't get new video card to work on Hel-80 Mobo/ | 2022-03-28 16:05 | - | |
| Can't install Windows 7 on Compal FL90/ | 2022-03-28 16:05 | - | |
| Can't install new 6625 BIOS/ | 2022-03-28 16:05 | - | |
| Can't run the LS Application & Support Disc/ | 2022-03-28 16:05 | - | |
| Can't see the OSD on my laptop, W576V Gigabyte Laptop/ | 2022-03-28 16:05 | - | |
| Can't update my bios/ | 2022-03-28 16:05 | - | |
| Can't use Wireless Select Switch in Windows 7/ | 2022-03-28 16:05 | - | |
| Can 6615 CD drive be replaced with battery HDD/ | 2022-03-28 16:05 | - | |
| Can Averatec 2370 boot from a SD card/ | 2022-03-28 16:05 | - | |
| Can Dual ATi 3870 in OCZ Whitebook support 30 2560x1600/ | 2022-03-28 16:05 | - | |
| Can I make the Camera key launch BisonCam/ | 2022-03-28 16:05 | - | |
| Can I operate my CT14-A0 with the lid closed/ | 2022-03-28 16:05 | - | |
| Can I put an Intel Core 2 Duo t7300 in OCZDIY17B1-US/ | 2022-03-28 16:05 | - | |
| Can I still buy a 6625WD battery/ | 2022-03-28 16:05 | - | |
| Can anyone tell me where PgUp PgDown are on these things/ | 2022-03-28 16:05 | - | |
| Cancelled my order/ | 2022-03-28 16:05 | - | |
| Can i get back deleted files from laptop/ | 2022-03-28 16:05 | - | |
| Cannot burn CD DVDs in Vista/ | 2022-03-28 16:05 | - | |
| Can not connect internet/ | 2022-03-28 16:05 | - | |
| Cannot resume from Standby (6625wd)/ | 2022-03-28 16:05 | - | |
| Cannot start at all (3200 series)/ | 2022-03-28 16:05 | - | |
| Can someone help me please/ | 2022-03-28 16:05 | - | |
| Cant decide between Zepto or rizeon! Plz Help/ | 2022-03-28 16:05 | - | |
| Cant find a battery for Compal JFW-91/ | 2022-03-28 16:05 | - | |
| Cant find the Bios update/ | 2022-03-28 16:05 | - | |
| Can the RAM memory be upgraded on the CT14-A0/ | 2022-03-28 16:05 | - | |
| Can we get a better out of dell or asus/ | 2022-03-28 16:05 | - | |
| Can we set DVD-ROM booktype on DVD+R via compal-hel80/ | 2022-03-28 16:05 | - | |
| Can we upgrade the RAM in CT14-A1/ | 2022-03-28 16:05 | - | |
| Can you help me decide between max-15 or mag-15 fusion 15/ | 2022-03-28 16:05 | - | |
| Capitability with HGL30/ | 2022-03-28 16:05 | - | |
| Caps lock on off on-screen display/ | 2022-03-28 16:05 | - | |
| Card Reader driver issue on 6224W with Windows 7/ | 2022-03-28 16:05 | - | |
| Card reader for znote 6224/ | 2022-03-28 16:05 | - | |
| Card reader speeds/ | 2022-03-28 16:05 | - | |
| Carrying Case Backpack/ | 2022-03-28 16:05 | - | |
| Case Cracks/ | 2022-03-28 16:05 | - | |
| Case study- People with dead (or issues) IFL90 FL90 because installing Penryn please report it here/ | 2022-03-28 16:05 | - | |
| Casing for 4000 aluminum, magnesium or plastic/ | 2022-03-28 16:05 | - | |
| Catalyst 8.12 leaked!!/ | 2022-03-28 16:05 | - | |
| Catalyst 8.12 testing game for desktop (be similar to mobile vga)/ | 2022-03-28 16:05 | - | |
| Catalyst 9.2 - out now/ | 2022-03-28 16:05 | - | |
| Causes of Laptop Overheating/ | 2022-03-28 16:05 | - | |
| Centrino 2 Compal/ | 2022-03-28 16:05 | - | |
| Change CPU & graphics card in 6324/ | 2022-03-28 16:05 | - | |
| Change CPU and HDD Compal IFL90/ | 2022-03-28 16:05 | - | |
| Change Mythos case to black one/ | 2022-03-28 16:05 | - | |
| Change hotkeys/ | 2022-03-28 16:05 | - | |
| Changes made to UK website including payment options/ | 2022-03-28 16:05 | - | |
| Changes to 6224W order/ | 2022-03-28 16:05 | - | |
| Change the hard drive on Zepto/ | 2022-03-28 16:05 | - | |
| Changing DVD Drive/ | 2022-03-28 16:05 | - | |
| Changing Wireess card 4965AGN/ | 2022-03-28 16:05 | - | |
| Changing display brightness profile/ | 2022-03-28 16:05 | - | |
| Changing the resolution on a wsxga/ | 2022-03-28 16:05 | - | |
| Charger DEAD/ | 2022-03-28 16:05 | - | |
| Charger for 6615WD/ | 2022-03-28 16:05 | - | |
| Chaz can you tell us/ | 2022-03-28 16:05 | - | |
| Cheap Averetec/ | 2022-03-28 16:05 | - | |
| Cheap carry case for 2370 2371/ | 2022-03-28 16:05 | - | |
| Cheapest Clevo notebook (Sager ProStar HyperSonic)/ | 2022-03-28 16:05 | - | |
| Cheapest HGL-30 barebone/ | 2022-03-28 16:05 | - | |
| Cheapest place to configure a HEL80/ | 2022-03-28 16:05 | - | |
| Cheap to buy, expensive to own/ | 2022-03-28 16:05 | - | |
| Check CPU, HD and GPU temperatures HEL80/ | 2022-03-28 16:05 | - | |
| Check Znote 3415W Specs Please!/ | 2022-03-28 16:05 | - | |
| Check my 6324 order/ | 2022-03-28 16:05 | - | |
| Check out the About Zepto video!/ | 2022-03-28 16:05 | - | |
| Check out this keyboard/ | 2022-03-28 16:05 | - | |
| Check out this pole/ | 2022-03-28 16:05 | - | |
| Chembook 2030, an alternative to the W3V/ | 2022-03-28 16:05 | - | |
| Chinese brands/ | 2022-03-28 16:05 | - | |
| Choppy Game -(/ | 2022-03-28 16:05 | - | |
| Cicero Notebook/ | 2022-03-28 16:05 | - | |
| Cisnet Laptop Nascar Edition/ | 2022-03-28 16:05 | - | |
| Clacking Hard Drive 3150P/ | 2022-03-28 16:06 | - | |
| Clarification on discontinuation/ | 2022-03-28 16:06 | - | |
| Clasus Dynamic NWT 256 a clone of Compal HEL80/ | 2022-03-28 16:06 | - | |
| Cleaning the buttons beneath the touchpad/ | 2022-03-28 16:06 | - | |
| Clean install of windows xp on JFL92 problems/ | 2022-03-28 16:06 | - | |
| Clean tools/ | 2022-03-28 16:06 | - | |
| Clevo- any 15.6 HasWell 'in 750m touch 6lbs/ | 2022-03-28 16:06 | - | |
| Clevo 9860 from Sager, HS, AW...or/ | 2022-03-28 16:06 | - | |
| Clevo D470K Service Manual - Where/ | 2022-03-28 16:06 | - | |
| Clevo M400/ | 2022-03-28 16:06 | - | |
| Clevo M550J with NVidia C51MV chipset/ | 2022-03-28 16:06 | - | |
| Clevo M570A/ | 2022-03-28 16:06 | - | |
| Clevo M590KE is out in Japan/ | 2022-03-28 16:06 | - | |
| Clicking rattling noise from inside 6625/ | 2022-03-28 16:06 | - | |
| Cn15 a2 ordered/ | 2022-03-28 16:06 | - | |
| Cnet review of the IFL90 6.5 10 Merely adequate 3D performance WTF/ | 2022-03-28 16:06 | - | |
| Collecting Averatec2500 BIOS/ | 2022-03-28 16:06 | - | |
| Combo Dual Layer SuperMulti 8x8x4x2.4x + - DVD R RW/ | 2022-03-28 16:06 | - | |
| Comments on AV 4155/ | 2022-03-28 16:06 | - | |
| Comments on a HGL30/ | 2022-03-28 16:06 | - | |
| Compal & 3DMark06/ | 2022-03-28 16:06 | - | |
| Compal & Intel Montevina Platform/ | 2022-03-28 16:06 | - | |
| Compal's 176.31 Forceware drivers/ | 2022-03-28 16:06 | - | |
| Compal's Two basic Faults/ | 2022-03-28 16:06 | - | |
| Compal's hel80 spare parts,exist/ | 2022-03-28 16:06 | - | |
| Compal (h)EL8x (and probably (i)FL9x) squeeky flexy keyboard solution/ | 2022-03-28 16:06 | - | |
| Compal - Hitachi/ | 2022-03-28 16:06 | - | |
| Compal - Which one/ | 2022-03-28 16:06 | - | |
| Compal 90 91 Specifications/ | 2022-03-28 16:06 | - | |
| Compal 4091 Series FL91 Barebone Laptop Motherboard/ | 2022-03-28 16:06 | - | |
| Compal BIOS upgrades - a simple HOWTO/ | 2022-03-28 16:06 | - | |
| Compal CL56 Winbond Card Reader - ReadyBoost/ | 2022-03-28 16:06 | - | |
| Compal CL56 hardware/ | 2022-03-28 16:06 | - | |
| Compal CY30-15 Drive spares help/ | 2022-03-28 16:06 | - | |
| Compal Camera/ | 2022-03-28 16:06 | - | |
| Compal Cooler tips/ | 2022-03-28 16:06 | - | |
| Compal DFY30-15 info/ | 2022-03-28 16:06 | - | |
| Compal EL80 (and compatible) SCREEN MODELS/ | 2022-03-28 16:06 | - | |
| Compal EL80 Audio Stuttering/ | 2022-03-28 16:06 | - | |
| Compal EL80 LCD Panel replacement/ | 2022-03-28 16:06 | - | |
| Compal EL80 bios digging temperature sensors/ | 2022-03-28 16:06 | - | |
| Compal EL80 tunning and upgrading/ | 2022-03-28 16:06 | - | |
| Compal EL80 video 'smears' on LCD/ | 2022-03-28 16:06 | - | |
| Compal EL81 & SATA/ | 2022-03-28 16:06 | - | |
| Compal EL81- New BIOS v1.22/ | 2022-03-28 16:06 | - | |
| Compal ENE CIR (IFL90)/ | 2022-03-28 16:06 | - | |
| Compal EU cotumer support/ | 2022-03-28 16:06 | - | |
| Compal FL & IFL BIOS Flash Guide with USB-KEY/ | 2022-03-28 16:06 | - | |
| Compal FL90 (Santa Rosa Model) Will be shipping in June/ | 2022-03-28 16:06 | - | |
| Compal FL90 + Intel T9300 9500/ | 2022-03-28 16:06 | - | |
| Compal FL90, IFL90, FL92, JFL92 Benchmark Result/ | 2022-03-28 16:06 | - | |
| Compal FL90. Increasing ram memory from 2GB to 4GB or 8GB/ | 2022-03-28 16:06 | - | |
| Compal FL90 BSOD/ | 2022-03-28 16:06 | - | |
| Compal FL90 Black screen/ | 2022-03-28 16:06 | - | |
| Compal FL90 Boot problem/ | 2022-03-28 16:06 | - | |
| Compal FL90 GPU replacement questions/ | 2022-03-28 16:06 | - | |
| Compal FL90 Replacement parts/ | 2022-03-28 16:06 | - | |
| Compal FL90 Smart Battery Windows 7 64 bit/ | 2022-03-28 16:06 | - | |
| Compal FL90 Touchpad Flat Flex Cable/ | 2022-03-28 16:06 | - | |
| Compal FL90 USB bios update not working/ | 2022-03-28 16:06 | - | |
| Compal FL90 Webcam/ | 2022-03-28 16:06 | - | |
| Compal FL90 and NVIDIA 8600M GT/ | 2022-03-28 16:06 | - | |
| Compal FL90 and Radeon HD3650 problem/ | 2022-03-28 16:06 | - | |
| Compal FL90 drivers/ | 2022-03-28 16:06 | - | |
| Compal FL90 geforce 8600gt ddr3 or ddr2/ | 2022-03-28 16:06 | - | |
| Compal FL90 needs repair... which/ | 2022-03-28 16:06 | - | |
| Compal FL90 problem/ | 2022-03-28 16:06 | - | |
| Compal FL90 project! Fun Fun/ | 2022-03-28 16:06 | - | |
| Compal FL90 spares/ | 2022-03-28 16:06 | - | |
| Compal FL92 Barebones/ | 2022-03-28 16:06 | - | |
| Compal FL92 and Windows 7/ | 2022-03-28 16:06 | - | |
| Compal FL92 vs. Sager NP2096 (JLH90)/ | 2022-03-28 16:06 | - | |
| Compal FL92 works with 8Gb RAM/ | 2022-03-28 16:06 | - | |
| Compal Fl90 - Did my video card just fry/ | 2022-03-28 16:06 | - | |
| Compal GL30 HDD Upgrade Will this Work/ | 2022-03-28 16:06 | - | |
| Compal H80 Ram/ | 2022-03-28 16:06 | - | |
| Compal HE(L) 80; 4gb/ | 2022-03-28 16:06 | - | |
| Compal HEL-80 battery life/ | 2022-03-28 16:06 | - | |
| Compal HEL-80 palm rest squeaks/ | 2022-03-28 16:06 | - | |
| Compal HEL-80 won't post/ | 2022-03-28 16:06 | - | |
| Compal HEL 30 build quality/ | 2022-03-28 16:06 | - | |
| Compal HEL80 + Logitech G5 weirdness/ | 2022-03-28 16:06 | - | |
| Compal HEL80 + SPDIF optical electrical/ | 2022-03-28 16:06 | - | |
| Compal HEL80 - Case Design Question/ | 2022-03-28 16:06 | - | |
| Compal HEL80 - Discounts/ | 2022-03-28 16:06 | - | |
| Compal HEL80 4gb ram/ | 2022-03-28 16:06 | - | |
| Compal HEL80=PCClub enpower 680/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Accesory questions/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Assembly Questions/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Bag/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Bluetooth Problem/ | 2022-03-28 16:06 | - | |
| Compal HEL80 CMOS Battery/ | 2022-03-28 16:06 | - | |
| Compal HEL80 DISassembly/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Disassembly guide - anyone/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Drivers/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Geforce Go 7600 OC Results/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Ghosting/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Memory/ | 2022-03-28 16:06 | - | |
| Compal HEL80 Standby Broken/ | 2022-03-28 16:06 | - | |
| Compal HEL80 and HEL81 Problems--/ | 2022-03-28 16:06 | - | |
| Compal HEL80 and HGL30 Questions/ | 2022-03-28 16:06 | - | |
| Compal HEL 80 and other/ | 2022-03-28 16:06 | - | |
| Compal HEL80 audio stuttering problem while play Counter-Strike/ | 2022-03-28 16:06 | - | |
| Compal HEL 80 compatabilty problems/ | 2022-03-28 16:06 | - | |
| Compal HEL80 drivercd/ | 2022-03-28 16:06 | - | |
| Compal HEL80 marketed by any of the big names/ | 2022-03-28 16:06 | - | |
| Compal HEL80 vs ASUS Z96Js/ | 2022-03-28 16:06 | - | |
| Compal HEL80 with Core 2 Duo in route!/ | 2022-03-28 16:06 | - | |
| Compal HEL 81 and HGL31 battery life/ | 2022-03-28 16:06 | - | |
| Compal HGL-30 BIOS and 4GB RAM/ | 2022-03-28 16:06 | - | |
| Compal HGL-30 Battery Issue/ | 2022-03-28 16:06 | - | |
| Compal HGL-30 Owners Lounge/ | 2022-03-28 16:06 | - | |
| Compal HGL-30 Touchpad/ | 2022-03-28 16:06 | - | |
| Compal HGL30 (Nvidia Go 7600)/ | 2022-03-28 16:06 | - | |
| Compal HGL30 31/ | 2022-03-28 16:06 | - | |
| Compal HGL30 116A Bios Anyone Try It/ | 2022-03-28 16:06 | - | |
| Compal HGL30 Bluetooth info needed!/ | 2022-03-28 16:06 | - | |
| Compal HGL30 CD Drive Problem/ | 2022-03-28 16:06 | - | |
| Compal HGL30 Vista Drivers/ | 2022-03-28 16:06 | - | |
| Compal HGL30 battery/ | 2022-03-28 16:06 | - | |
| Compal HGL30 just arrived!/ | 2022-03-28 16:06 | - | |
| Compal HGL30 microphone/ | 2022-03-28 16:06 | - | |
| Compal HGL30 what processor/ | 2022-03-28 16:06 | - | |
| Compal HGL30 w nVIDIA 7600 w 256MB is available for pre-order/ | 2022-03-28 16:06 | - | |
| Compal HGL 31 Heat Issues/ | 2022-03-28 16:06 | - | |
| Compal HGL31 on linux/ | 2022-03-28 16:06 | - | |
| Compal HGLS32-S, your thoughts/ | 2022-03-28 16:06 | - | |
| Compal HGl30 fan control/ | 2022-03-28 16:06 | - | |
| Compal HL90 HL91 BIOS v1.17/ | 2022-03-28 16:06 | - | |
| Compal Hel-80 Wireless Modem Driver/ | 2022-03-28 16:06 | - | |
| Compal Hel80/ | 2022-03-28 16:06 | - | |
| Compal Hel80 81/ | 2022-03-28 16:06 | - | |
| Compal Hel80 Nvidia Geforce Go 7600 Video Driver Problem on Window 7/ | 2022-03-28 16:06 | - | |
| Compal Hel80 Overheating Problems/ | 2022-03-28 16:06 | - | |
| Compal Hel80 VBI Camera Windows 2003/ | 2022-03-28 16:06 | - | |
| Compal Hel80 and Fedora Linux/ | 2022-03-28 16:06 | - | |
| Compal Hel80 current value/ | 2022-03-28 16:06 | - | |
| Compal Hel80 powers on but doesn't do anything/ | 2022-03-28 16:06 | - | |
| Compal Hel El 80 Bluetooth issue/ | 2022-03-28 16:06 | - | |
| Compal IFL-90 TV Tuner/ | 2022-03-28 16:06 | - | |
| Compal IFL-90 car battery charger/ | 2022-03-28 16:06 | - | |
| Compal IFL90 & 9600M GT/ | 2022-03-28 16:06 | - | |
| Compal IFL90 (FORCE 3297) Updated Pricing and Promotion for Pre-Orders/ | 2022-03-28 16:06 | - | |
| Compal IFL90 (Powernotebooks one) Bios update/ | 2022-03-28 16:06 | - | |
| Compal IFL90, perfect/ | 2022-03-28 16:06 | - | |
| Compal IFL90 - 2nd RMA/ | 2022-03-28 16:06 | - | |
| Compal IFL 90 - Deferred Procedure Calls (DPCs) in Vista Ultimate 32/ | 2022-03-28 16:06 | - | |
| Compal IFL90 - Need Help Locating Drivers/ | 2022-03-28 16:06 | - | |
| Compal IFL90 - replacing 8600M GT with one from Acer/ | 2022-03-28 16:06 | - | |
| Compal IFL90/ | 2022-03-28 16:06 | - | |
| Compal IFL90 8600GT 512mb benchmark/ | 2022-03-28 16:06 | - | |
| Compal IFL90 BIOS history/ | 2022-03-28 16:06 | - | |
| Compal IFL 90 DEP Bios/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Graphics Card OC results/ | 2022-03-28 16:06 | - | |
| Compal IFL90 More Advanced Bios Options/ | 2022-03-28 16:06 | - | |
| Compal IFL 90 NMI error/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Overheating/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Power HDD/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Sager2090 Cooling Pad Neccesarry/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Sager 2090 Where How to download new drivers and Bios!/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Sager NP2090 Disassembly Guide/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Sager NP2090 Fan/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Sager NP2090 stutters in DOTA/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Sager NP2090 warranty questions/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Screen Face/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Unpacking Photos Benchmarks [56k Warning]/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Video Review/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Vista, CIR Infrared doesn't work/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Won't Start (black screen)/ | 2022-03-28 16:06 | - | |
| Compal IFL90 Zepto 3415w/ | 2022-03-28 16:06 | - | |
| Compal IFL90 by Zepto (Europe)/ | 2022-03-28 16:06 | - | |
| Compal IFL90 cpu selection/ | 2022-03-28 16:06 | - | |
| Compal IFL90 from Cyberpowerpc/ | 2022-03-28 16:06 | - | |
| Compal IFL90 max capacity 4GB or 2GB RAM/ | 2022-03-28 16:06 | - | |
| Compal IFL90 now comes with 8600gt/ | 2022-03-28 16:06 | - | |
| Compal IFL90 pictures 56K warning/ | 2022-03-28 16:06 | - | |
| Compal IFL90 shell badge ! !/ | 2022-03-28 16:06 | - | |
| Compal IFL90 vs C90 vs G1S vs Dell 1520/ | 2022-03-28 16:06 | - | |
| Compal I FL90 vs H EL80/ | 2022-03-28 16:06 | - | |
| Compal IFL90 with LightScribe Possible/ | 2022-03-28 16:06 | - | |
| Compal IFL90 wont boot up Screen not turning on Please Help!/ | 2022-03-28 16:06 | - | |
| Compal IFL90 wsxga+ screen brand model/ | 2022-03-28 16:06 | - | |
| Compal ILF90 + Ubuntu/ | 2022-03-28 16:06 | - | |
| Compal ILF90 Sager NP2090 GPU Replacement/ | 2022-03-28 16:06 | - | |
| Compal IfL90 Drivers Bios help am noob -(/ | 2022-03-28 16:06 | - | |
| Compal Ifl90 -- help noob with general install advice plz!/ | 2022-03-28 16:06 | - | |
| Compal Ifl90 Bios Chip Replacement/ | 2022-03-28 16:06 | - | |
| Compal JAW91 - any news any tests/ | 2022-03-28 16:06 | - | |
| Compal JFL92 - XOTICPC.com Quick Review - BAD/ | 2022-03-28 16:06 | - | |
| Compal JFL92 BIOS 119S/ | 2022-03-28 16:06 | - | |
| Compal JFL92 Latest Bios/ | 2022-03-28 16:06 | - | |
| Compal JFL92 Linux compatibility/ | 2022-03-28 16:06 | - | |
| Compal JFL92 biometric reader not working/ | 2022-03-28 16:06 | - | |
| Compal JFT00/ | 2022-03-28 16:06 | - | |
| Compal JHL90 - temperature issues - technical help appreciated!!!/ | 2022-03-28 16:06 | - | |
| Compal JHL90/ | 2022-03-28 16:06 | - | |
| Compal JHL90 Alps Touchpad/ | 2022-03-28 16:06 | - | |
| Compal JHL90 battery issue/ | 2022-03-28 16:06 | - | |
| Compal JHL90 hardware question/ | 2022-03-28 16:06 | - | |
| Compal JHL90 not starting/ | 2022-03-28 16:06 | - | |
| Compal JHL90 vs MSI 1651 Build Quality/ | 2022-03-28 16:06 | - | |
| Compal J HLB2/ | 2022-03-28 16:06 | - | |
| Compal Jft00 - Wlan 4965agn Issue/ | 2022-03-28 16:06 | - | |
| Compal KHLB2 (Sager 2098) Processor upgrade worth it/ | 2022-03-28 16:06 | - | |
| Compal KHLB2, new battery and ram upgrade/ | 2022-03-28 16:06 | - | |
| Compal KHLB2 Users/ | 2022-03-28 16:06 | - | |
| Compal KHLB2 in Canada/ | 2022-03-28 16:06 | - | |
| Compal KHLB2 with MR 4670/ | 2022-03-28 16:06 | - | |
| Compal NBLB2/ | 2022-03-28 16:06 | - | |
| Compal NBLB2 fresh build starts but no visual and quick reboot/ | 2022-03-28 16:06 | - | |
| Compal NBLB5 Owners Lounge/ | 2022-03-28 16:06 | - | |
| Compal NBLB5 Switchable Grahpics, (Need other Bios)/ | 2022-03-28 16:06 | - | |
| Compal New Models/ | 2022-03-28 16:06 | - | |
| Compal PBL21 BIOS/ | 2022-03-28 16:06 | - | |
| Compal PBL21 barebone built - black screen but stays on/ | 2022-03-28 16:06 | - | |
| Compal PCM10/ | 2022-03-28 16:06 | - | |
| Compal Part Info/ | 2022-03-28 16:06 | - | |
| Compal Purchase/ | 2022-03-28 16:06 | - | |
| Compal QAL-51-HD questions/ | 2022-03-28 16:06 | - | |
| Compal QAL 51 bios - enable Intel HD 4000 Graphics/ | 2022-03-28 16:06 | - | |
| Compal Rizeon JHL90/ | 2022-03-28 16:06 | - | |
| Compal Satisfaction Poll/ | 2022-03-28 16:06 | - | |
| Compal Software version/ | 2022-03-28 16:06 | - | |
| Compal VGA driver update + Laptop badge/ | 2022-03-28 16:06 | - | |
| Compal Website - no driver downloads/ | 2022-03-28 16:06 | - | |
| Compal and 45nm AMD/ | 2022-03-28 16:06 | - | |
| Compal and Aesthetics/ | 2022-03-28 16:06 | - | |
| Compal and Intel/ | 2022-03-28 16:06 | - | |
| Compal cy30-15 cd drive/ | 2022-03-28 16:06 | - | |
| Compal dealer/ | 2022-03-28 16:06 | - | |
| Compal durability/ | 2022-03-28 16:06 | - | |
| Compal fl90 problem detecting video memory/ | 2022-03-28 16:06 | - | |
| Compal fl92 and upgrade to win7 issues/ | 2022-03-28 16:06 | - | |
| Compal freezes when starting XP/ | 2022-03-28 16:06 | - | |
| Compal from EU/ | 2022-03-28 16:06 | - | |
| Compal from Xotic/ | 2022-03-28 16:06 | - | |
| Compal hangs after stand-by/ | 2022-03-28 16:06 | - | |
| Compal hel80 proccesor 84ºC and death/ | 2022-03-28 16:06 | - | |
| Compal in Canada/ | 2022-03-28 16:06 | - | |
| Compal in Hong Kong/ | 2022-03-28 16:06 | - | |
| Compal jhl-90 usb power button/ | 2022-03-28 16:06 | - | |
| Compal laptop/ | 2022-03-28 16:06 | - | |
| Compal laptops information/ | 2022-03-28 16:06 | - | |
| Compal not recognized on Crucial Website/ | 2022-03-28 16:06 | - | |
| Compals In canada (clevos too i guess)/ | 2022-03-28 16:06 | - | |
| Compal troubles/ | 2022-03-28 16:06 | - | |
| Compal utilities under Windows 7 x64/ | 2022-03-28 16:06 | - | |
| Compal vs Vestel/ | 2022-03-28 16:06 | - | |
| Compal website BIOS on VBI version of the Compal EL80/ | 2022-03-28 16:06 | - | |
| Compamerica/ | 2022-03-28 16:06 | - | |
| Compaq C751nr shuts down/ | 2022-03-28 16:06 | - | |
| Compaq Presario f700 wireless doesn't work, what do I have to do !/ | 2022-03-28 16:06 | - | |
| Compaq armada v300/ | 2022-03-28 16:06 | - | |
| Compaq is spelled with a Q!!!/ | 2022-03-28 16:06 | - | |
| Comparisonpictures of the 6625WD vs. the 6224W/ | 2022-03-28 16:06 | - | |
| Compatibility of DVD drives with 6220/ | 2022-03-28 16:06 | - | |
| Compatibility with Samsung HM250JI 250GB HDD/ | 2022-03-28 16:06 | - | |
| Compatible Heatsink/ | 2022-03-28 16:06 | - | |
| Compel HGL30 Pics/ | 2022-03-28 16:06 | - | |
| Complete list of 6130HS-20 Fixes/ | 2022-03-28 16:06 | - | |
| Compls if90 xp drivers/ | 2022-03-28 16:06 | - | |
| Computer Clock malfunction/ | 2022-03-28 16:06 | - | |
| Computer Latency and DPC/ | 2022-03-28 16:06 | - | |
| Computer boots but Screen is scrambled/ | 2022-03-28 16:06 | - | |
| Computer keeps locking up/ | 2022-03-28 16:06 | - | |
| Concerning the Olivetti Echos 24c/ | 2022-03-28 16:06 | - | |
| Configuring my FL90 E- help me decide what to sacrifice!/ | 2022-03-28 16:06 | - | |
| Confirmation email/ | 2022-03-28 16:06 | - | |
| Congratulations, Compal has its own forum!/ | 2022-03-28 16:06 | - | |
| Connecting HEL80 to Full HD Monitor/ | 2022-03-28 16:06 | - | |
| Considering IFL90, questionsss/ | 2022-03-28 16:06 | - | |
| Considering Vista Ultimate 64bit to XP Pro 64bit Downgrade, what do you think/ | 2022-03-28 16:06 | - | |
| Considering buying a Notus/ | 2022-03-28 16:06 | - | |
| Consider ordering from dennedusa.com Read this first/ | 2022-03-28 16:06 | - | |
| Constant flicker and stutter when using dual displays IFL90/ | 2022-03-28 16:06 | - | |
| Contacting/ | 2022-03-28 16:06 | - | |
| Control volume with P1 and P2 buttons/ | 2022-03-28 16:06 | - | |
| Cooling Pad for JFL92/ | 2022-03-28 16:06 | - | |
| Cooling for the JHL90/ | 2022-03-28 16:06 | - | |
| Coolingpaste amount in 6214W/ | 2022-03-28 16:06 | - | |
| Cooling the 6615WD - Any Tips/ | 2022-03-28 16:06 | - | |
| Core 2 Duo/ | 2022-03-28 16:06 | - | |
| Core 2 duo and compal hel80. Do i need a yonah/ | 2022-03-28 16:06 | - | |
| Core Duo MX W3J/ | 2022-03-28 16:06 | - | |
| Core Duo version of Sharp M4000/ | 2022-03-28 16:06 | - | |
| Core i7 needs Tri-Channel, Laptops have Dual channel/ | 2022-03-28 16:06 | - | |
| Corrupted Download Problem/ | 2022-03-28 16:06 | - | |
| Cost for Replacement Battery; New Price at LA Store/ | 2022-03-28 16:06 | - | |
| Could someone help my identify a Clevo model/ | 2022-03-28 16:06 | - | |
| Could you check over my order/ | 2022-03-28 16:06 | - | |
| Couple Whitebook xotic Questions/ | 2022-03-28 16:06 | - | |
| Couple driver program issues with Windows 7 and IFL90/ | 2022-03-28 16:06 | - | |
| Couple of 6625 Questions/ | 2022-03-28 16:06 | - | |
| Couple of FL90 questions/ | 2022-03-28 16:06 | - | |
| Couple of rookie questions on overclocking a QX9300/ | 2022-03-28 16:06 | - | |
| Crack around screen of HGL30/ | 2022-03-28 16:06 | - | |
| Cracked screen hinge (HEL-80)!/ | 2022-03-28 16:06 | - | |
| Crashing- I Want to Be Sure my Graphic Drivers are Current/ | 2022-03-28 16:06 | - | |
| Crashing during NFSMW/ | 2022-03-28 16:06 | - | |
| Create Recovery DVD from Recovery Partition/ | 2022-03-28 16:06 | - | |
| Credit-card sized plastic sticker in the 6214W/ | 2022-03-28 16:06 | - | |
| Cricket sound/ | 2022-03-28 16:06 | - | |
| CrossFire Cable/ | 2022-03-28 16:06 | - | |
| Crossfire + multiple monitors/ | 2022-03-28 16:06 | - | |
| Cross thread off topic posts/ | 2022-03-28 16:06 | - | |
| Crysis Benchmarks for ocz whitebook are out/ | 2022-03-28 16:06 | - | |
| Crysis on an HEL80/ | 2022-03-28 16:06 | - | |
| Crystal Clear 6615 screen/ | 2022-03-28 16:06 | - | |
| Curious ResellerRatings Facts/ | 2022-03-28 16:06 | - | |
| Current Vista Compatibility Status/ | 2022-03-28 16:06 | - | |
| Current computer vs. New laptop/ | 2022-03-28 16:06 | - | |
| Curse of the dead pixel/ | 2022-03-28 16:06 | - | |
| Cursor in Vista Media Centre/ | 2022-03-28 16:06 | - | |
| Cursor jumping around/ | 2022-03-28 16:06 | - | |
| Custom Alienware M9700 lid on Whitebook/ | 2022-03-28 16:06 | - | |
| Custom BIOS splash/ | 2022-03-28 16:06 | - | |
| Custom Painted Red Compal HEL80/ | 2022-03-28 16:06 | - | |
| Custom Painting & Cover/ | 2022-03-28 16:06 | - | |
| Custom Painting the Hel80/ | 2022-03-28 16:06 | - | |
| CyberPower/ | 2022-03-28 16:06 | - | |
| Cyber Power Notebooks/ | 2022-03-28 16:06 | - | |
| Cyber Power and customer service/ | 2022-03-28 16:06 | - | |
| Cyber Power gaming laptop/ | 2022-03-28 16:06 | - | |
| Cyberlink software not liking vista/ | 2022-03-28 16:06 | - | |
| Cyberpower Hel80 NOT a Hel80/ | 2022-03-28 16:06 | - | |
| CyberpowerPC Gamer Xplorer X5-7930 Bad/ | 2022-03-28 16:06 | - | |
| Cyberpower PC Laptop/ | 2022-03-28 16:06 | - | |
| CyberpowerPC Tracer 3/ | 2022-03-28 16:06 | - | |
| CyberpowerPC X7-100 ordered and set to deliver 26FEB/ | 2022-03-28 16:06 | - | |
| CyberpowerPc desktop/ | 2022-03-28 16:06 | - | |
| Cyberpower Systems any good/ | 2022-03-28 16:06 | - | |
| Cyberpower Tracer V I15E/ | 2022-03-28 16:06 | - | |
| Cyberpower X5-6000 and X64-8000/ | 2022-03-28 16:06 | - | |
| Cyberpower X5 Laptop good or bad/ | 2022-03-28 16:06 | - | |
| Cyberpower and Ibuypower thoughts/ | 2022-03-28 16:06 | - | |
| Cyberpower inc. !!/ | 2022-03-28 16:06 | - | |
| Cyberpower notebooks/ | 2022-03-28 16:06 | - | |
| Cyberpowerpc's compal fl90/ | 2022-03-28 16:06 | - | |
| Cyberpowerpc Vector II-Z VR disassembly/ | 2022-03-28 16:06 | - | |
| Cyberpower screens, matte or glossy/ | 2022-03-28 16:06 | - | |
| Cyberpower uk/ | 2022-03-28 16:06 | - | |
| DDR2-667 SODIMM Gaming Memory/ | 2022-03-28 16:06 | - | |
| DFY30 and antenna on off control/ | 2022-03-28 16:06 | - | |
| DISGO Net Browser 3000 for less than £100/ | 2022-03-28 16:06 | - | |
| DIY buying TV Tuner & Bluetooth Module/ | 2022-03-28 16:06 | - | |
| DL76 motherboard/ | 2022-03-28 16:06 | - | |
| DNA 8.11 Beta w M88 support/ | 2022-03-28 16:06 | - | |
| DO NOT update to Nvidia driver 496.76 on Eluktronics Laptops with a MUX!/ | 2022-03-28 16:06 | - | |
| DTV tuner/ | 2022-03-28 16:06 | - | |
| DVD+ -RW RMA or recalibration/ | 2022-03-28 16:06 | - | |
| DVD Burner on 6130hs/ | 2022-03-28 16:06 | - | |
| DVD Burning Issues/ | 2022-03-28 16:06 | - | |
| DVD CD drive not working/ | 2022-03-28 16:06 | - | |
| DVD Decoder included/ | 2022-03-28 16:06 | - | |
| DVD Player/ | 2022-03-28 16:06 | - | |
| DVD burning/ | 2022-03-28 16:06 | - | |
| DVD media/ | 2022-03-28 16:06 | - | |
| DVD not working/ | 2022-03-28 16:06 | - | |
| DVD playback problem (sound, video, drive questions inside)/ | 2022-03-28 16:06 | - | |
| DVD power calibration error. RMA/ | 2022-03-28 16:06 | - | |
| Damaged tft screen 6224/ | 2022-03-28 16:06 | - | |
| Damn... I think I made a mistake/ | 2022-03-28 16:06 | - | |
| Dark Smiley Systems/ | 2022-03-28 16:06 | - | |
| Dark Smiley Systems Criterion/ | 2022-03-28 16:06 | - | |
| Dark section of screen/ | 2022-03-28 16:06 | - | |
| Dead CMOS Battery/ | 2022-03-28 16:06 | - | |
| Dead Cyberpower Laptop/ | 2022-03-28 16:06 | - | |
| Dead Laptop -'(/ | 2022-03-28 16:06 | - | |
| Dead Nvidia 8600M/ | 2022-03-28 16:06 | - | |
| Dear Folks - I have some bad bad bad news/ | 2022-03-28 16:06 | - | |
| Decided on this 3415W - thoughts/ | 2022-03-28 16:06 | - | |
| Deciding between the new MX or MacBook Pro/ | 2022-03-28 16:06 | - | |
| Default Audio Card Distorted After Hibernate Standby/ | 2022-03-28 16:06 | - | |
| Default installtion or AHCI Intel driver/ | 2022-03-28 16:06 | - | |
| Default voltages on Nexus (P8400)/ | 2022-03-28 16:06 | - | |
| Defective Model Advice Please!/ | 2022-03-28 16:06 | - | |
| Delay in Connecting To My Wireless Network....Anyone Else/ | 2022-03-28 16:06 | - | |
| Delivery Issues/ | 2022-03-28 16:06 | - | |
| Demand for IFL90 WXGA+ Matte screen in UK/ | 2022-03-28 16:06 | - | |
| Desastre con Philips freevents 55 PC City/ | 2022-03-28 16:06 | - | |
| Desktop case for Raspberry Pi/ | 2022-03-28 16:06 | - | |
| Desperately need help with 2300 series/ | 2022-03-28 16:06 | - | |
| Detailed 6324W Pictures/ | 2022-03-28 16:06 | - | |
| Detailed dimensions/ | 2022-03-28 16:06 | - | |
| Details of TV-Out in 6625/ | 2022-03-28 16:06 | - | |
| Diabloo W2600 P-M 735 60GB 7200RPM 512MB ATI 9700/ | 2022-03-28 16:06 | - | |
| Dial up Grayed Out in New Connection Wizard/ | 2022-03-28 16:06 | - | |
| Did I just get a bum one or... hellllp please/ | 2022-03-28 16:06 | - | |
| Did You IFL90 work with 4GB RAM TEST IT!! It will be bad surprise for those who want to upgrade/ | 2022-03-28 16:06 | - | |
| Did Zepto lie to me/ | 2022-03-28 16:06 | - | |
| Did Zepto use the defective NVIDIA 8600M chips/ | 2022-03-28 16:06 | - | |
| Did anbody find how to change Startup BIOS boot logo to COMPAL/ | 2022-03-28 16:06 | - | |
| Did anyone own a Tiny laptop/ | 2022-03-28 16:06 | - | |
| Difference IFL90 - FL90/ | 2022-03-28 16:06 | - | |
| Difference IFL90 VBI and non-VBI/ | 2022-03-28 16:06 | - | |
| Difference between 6224w and 6324w/ | 2022-03-28 16:06 | - | |
| Difference between HEL80 and EL80/ | 2022-03-28 16:06 | - | |
| Different 3D cards/ | 2022-03-28 16:06 | - | |
| Difficulty installing nvidia graphic drivers (7600 - Hel80)/ | 2022-03-28 16:06 | - | |
| Difficulty of Putting Laptop Together Yourself/ | 2022-03-28 16:06 | - | |
| Diffrent Graphic cards in GL30/ | 2022-03-28 16:06 | - | |
| Digital Audio Wave (DAW) Nightmare/ | 2022-03-28 16:06 | - | |
| Direct media buttons and remote, HEL80/ | 2022-03-28 16:06 | - | |
| Disable Touchpad (IFL90)/ | 2022-03-28 16:06 | - | |
| Disable Turbo Memory since Windows XP doesn't support it/ | 2022-03-28 16:06 | - | |
| Disabled the microphone and I dont know how to get it back!/ | 2022-03-28 16:06 | - | |
| Disable the touchpad 5720-V/ | 2022-03-28 16:06 | - | |
| Disabling mouse click/ | 2022-03-28 16:06 | - | |
| Disabling speedstep on an IFL 90/ | 2022-03-28 16:06 | - | |
| Disabling the touchpad/ | 2022-03-28 16:06 | - | |
| Disassemble Zepto 6314/ | 2022-03-28 16:06 | - | |
| Disassemble Zepto Znote 6324W/ | 2022-03-28 16:06 | - | |
| Disassemble zepto znote 6625wd (6515wd)/ | 2022-03-28 16:06 | - | |
| Disassembly Guide Fl90/ | 2022-03-28 16:06 | - | |
| Disassembly of 3225 - Power jack repair/ | 2022-03-28 16:06 | - | |
| Disc Exchange IFL 90/ | 2022-03-28 16:06 | - | |
| Discountlaptops.com vs Pctorque.com Customer Service/ | 2022-03-28 16:06 | - | |
| Discussion for cooling the 6625wd/ | 2022-03-28 16:06 | - | |
| Disillusioned/ | 2022-03-28 16:06 | - | |
| Dismantling 6200 help/ | 2022-03-28 16:06 | - | |
| Display Backlight Flickering- TONGFANG GK5CN5Z GK5CN6Z GK5CQ7Z GK5CP0Z/ | 2022-03-28 16:06 | - | |
| Display Cleaning/ | 2022-03-28 16:06 | - | |
| Display Flickering - TongFang GK7 (Eluktronics Mech-17)/ | 2022-03-28 16:06 | - | |
| Display Upgrades for FL90/ | 2022-03-28 16:06 | - | |
| Display problem/ | 2022-03-28 16:06 | - | |
| Dissasemble Nox A15/ | 2022-03-28 16:06 | - | |
| Diy/ | 2022-03-28 16:06 | - | |
| Do I have the temperature bug or not/ | 2022-03-28 16:06 | - | |
| Do I need to update the BIOS of 6224w/ | 2022-03-28 16:06 | - | |
| Do I need updated AGA driver/ | 2022-03-28 16:06 | - | |
| Do NOT give up!/ | 2022-03-28 16:06 | - | |
| Do Not Buy Benq/ | 2022-03-28 16:06 | - | |
| Do You Prefer Vista or XP Pro/ | 2022-03-28 16:06 | - | |
| Docking Station/ | 2022-03-28 16:06 | - | |
| Docking Station for HGL 30/ | 2022-03-28 16:06 | - | |
| Docking Stations for the compal/ | 2022-03-28 16:06 | - | |
| Dockingstation/ | 2022-03-28 16:06 | - | |
| Docking station 6625wd/ | 2022-03-28 16:06 | - | |
| Docking station for 6224W/ | 2022-03-28 16:06 | - | |
| Docking station for Linux on HEL80/ | 2022-03-28 16:06 | - | |
| Dockingstation for Znote 6XX5WD/ | 2022-03-28 16:06 | - | |
| Doe anyone own the compal ifl90 elite/ | 2022-03-28 16:06 | - | |
| Does 3220 work well as portable DVD player/ | 2022-03-28 16:06 | - | |
| Does 6615 support DVD+RW (plus RW)/ | 2022-03-28 16:06 | - | |
| Does Bluetooth in HEL80 support A2DP/ | 2022-03-28 16:06 | - | |
| Does Boxx still make laptop computers/ | 2022-03-28 16:06 | - | |
| Does Disabling AHCI hurt performance/ | 2022-03-28 16:06 | - | |
| Does FL90 Have TPM/ | 2022-03-28 16:06 | - | |
| Does HEL-80 have a modum/ | 2022-03-28 16:06 | - | |
| Does HEL80 support new Merom- cpu/ | 2022-03-28 16:06 | - | |
| Does OCZ WB Barebones have TV tuner/ | 2022-03-28 16:06 | - | |
| Does P1 Offer Upgrading Service/ | 2022-03-28 16:06 | - | |
| Does Zepto still offer a student discount/ | 2022-03-28 16:06 | - | |
| Does anyone have a BenQ product/ | 2022-03-28 16:06 | - | |
| Does anyone have anything BAD to say about P1/ | 2022-03-28 16:06 | - | |
| Does anyone know anything about NEC notebooks/ | 2022-03-28 16:06 | - | |
| Does any one know the brand & model of this laptop/ | 2022-03-28 16:06 | - | |
| Does anyone know who makes this laptop/ | 2022-03-28 16:06 | - | |
| Does anyone own an IC Power Laptop/ | 2022-03-28 16:06 | - | |
| Doesn't this Notebook Cooler make the IFL90 hotter/ | 2022-03-28 16:06 | - | |
| Does reapplying thermal compound on Averatec 2370 help/ | 2022-03-28 16:06 | - | |
| Does the 8600 GT Stutter on JFL92/ | 2022-03-28 16:06 | - | |
| Does the HEL-80 support SDHC -SD cards/ | 2022-03-28 16:06 | - | |
| Does the Hel80 from MilestonePC Canada come with a TV Tuner and XP Pro/ | 2022-03-28 16:06 | - | |
| Does the Hgl30 has the alumnium brushing and keyboard/ | 2022-03-28 16:06 | - | |
| Does the IFL90 come with the 8600 GS or GT/ | 2022-03-28 16:06 | - | |
| Does the OCZDIY17A2 Support Turbo Memory/ | 2022-03-28 16:06 | - | |
| Does the ct14-a4 have the new windows 8 logo key/ | 2022-03-28 16:06 | - | |
| Does your little Averatec get hot too/ | 2022-03-28 16:06 | - | |
| Donald, HEL80, quality/ | 2022-03-28 16:06 | - | |
| Dont even know how to label this Monstrosity/ | 2022-03-28 16:06 | - | |
| DosPara Prime Note Cresion NA/ | 2022-03-28 16:06 | - | |
| Dos progress bar on boot-up/ | 2022-03-28 16:06 | - | |
| Downgrade BIOS/ | 2022-03-28 16:06 | - | |
| Download ATI 8.11 Vista64 Modded .inf to Enable Full Screen Resolutions/ | 2022-03-28 16:06 | - | |
| Do you need a recovery CD from Averatec/ | 2022-03-28 16:06 | - | |
| Do you own a Sager NP2090 or IFL90 in South Central Pennsylvania/ | 2022-03-28 16:06 | - | |
| Do you use S-Video on FL90 w Vistax86/ | 2022-03-28 16:06 | - | |
| Draining Residual Current/ | 2022-03-28 16:06 | - | |
| Driver & Software List 32Bits/ | 2022-03-28 16:06 | - | |
| Driver Issues after reformat. (2300)/ | 2022-03-28 16:06 | - | |
| Driver Page/ | 2022-03-28 16:06 | - | |
| Driver for Windows 7 on Znote 6224/ | 2022-03-28 16:06 | - | |
| Driver for Znote 6224W/ | 2022-03-28 16:06 | - | |
| Driver help Znote 6625WD/ | 2022-03-28 16:06 | - | |
| Driver problem/ | 2022-03-28 16:06 | - | |
| Drivers FL90 FT02 for Windows 7 x64/ | 2022-03-28 16:06 | - | |
| Drivers for 3415 in XP/ | 2022-03-28 16:06 | - | |
| Drivers for Averatec 2370/ | 2022-03-28 16:06 | - | |
| Drivers for Philips DVD-rom (sdvd 8441)/ | 2022-03-28 16:06 | - | |
| Drivers for averatec n1000 buddy/ | 2022-03-28 16:06 | - | |
| Drivers for the 2090/ | 2022-03-28 16:06 | - | |
| Drivers for the Chicony CNF6212 camera on IFL 90/ | 2022-03-28 16:06 | - | |
| Drivers for tvtuner/ | 2022-03-28 16:06 | - | |
| Drivers not working on Compal FL90/ | 2022-03-28 16:06 | - | |
| Drivers on IFL92 Sager NP2092/ | 2022-03-28 16:06 | - | |
| Dual-monitor flicker on external LCD HGL30/ | 2022-03-28 16:06 | - | |
| Dual Battery laptops/ | 2022-03-28 16:06 | - | |
| Dual Group laptop Model #PMD-5500/ | 2022-03-28 16:06 | - | |
| Dual boot- Windows Vista Windows 7/ | 2022-03-28 16:06 | - | |
| Dual core problem/ | 2022-03-28 16:06 | - | |
| Dummy battery for HEL80/ | 2022-03-28 16:06 | - | |
| Durabook 14k Turion64 MT-32 thermal issues/ | 2022-03-28 16:06 | - | |
| Dust in heatsink!/ | 2022-03-28 16:06 | - | |
| Dvd Drive Problems/ | 2022-03-28 16:06 | - | |
| Dvorak Keyboad/ | 2022-03-28 16:06 | - | |
| Dynamic drive causing Vista installation failure/ | 2022-03-28 16:06 | - | |
| Dynamic switching, i hate this thing/ | 2022-03-28 16:06 | - | |
| Dynamic switching not working on T7500/ | 2022-03-28 16:06 | - | |
| E-System 3116 BIOS password/ | 2022-03-28 16:06 | - | |
| E-system 3085 WiFi on at Startup/ | 2022-03-28 16:06 | - | |
| E-system 3115 laptop help/ | 2022-03-28 16:06 | - | |
| E-wrecked's Modded ATI Driver Collection for Whitebook - Performance enhanced, fullscreen scaling enabled!/ | 2022-03-28 16:06 | - | |
| E-wrecked - world record holder - go!/ | 2022-03-28 16:06 | - | |
| E-wrecked and the Whitebook community/ | 2022-03-28 16:06 | - | |
| E7222 Akoya Medion notebook/ | 2022-03-28 16:06 | - | |
| ECS 600 Sonoma w TV Tuner/ | 2022-03-28 16:06 | - | |
| ECS G420, Digging up information/ | 2022-03-28 16:06 | - | |
| ECS G420, new 14 dual core with an x1600/ | 2022-03-28 16:06 | - | |
| ECS G736/ | 2022-03-28 16:06 | - | |
| ECS G900 any opinion/ | 2022-03-28 16:06 | - | |
| ECS elitegroup g220/ | 2022-03-28 16:06 | - | |
| ECS laptops/ | 2022-03-28 16:06 | - | |
| EEE Eater/ | 2022-03-28 16:06 | - | |
| EL80 Extremely high DPC Latency/ | 2022-03-28 16:06 | - | |
| EL80 Linux Web Cam Driver/ | 2022-03-28 16:06 | - | |
| EL80 MXM based/ | 2022-03-28 16:06 | - | |
| EL80 Power Up Issue/ | 2022-03-28 16:06 | - | |
| EL80 Slow After Rollback to Windows XP/ | 2022-03-28 16:06 | - | |
| EL80 Win7 Wireless & Bluetooth Software Switch Fix/ | 2022-03-28 16:06 | - | |
| EL80 and video output/ | 2022-03-28 16:06 | - | |
| EL80 gets What resolutions on a external monitor/ | 2022-03-28 16:06 | - | |
| EL80 what optical drives work/ | 2022-03-28 16:06 | - | |
| EL81 Which MEROM cpus will work/ | 2022-03-28 16:06 | - | |
| EMSC.sys dll JHL90 cpl 0002 embedded control -(/ | 2022-03-28 16:06 | - | |
| E Ssytem 3082 keyboard removal/ | 2022-03-28 16:06 | - | |
| E System 3213 memory question/ | 2022-03-28 16:06 | - | |
| EUROCOM - Insight on their Core i laptops/ | 2022-03-28 16:06 | - | |
| EVGA Gaming Laptop/ | 2022-03-28 16:06 | - | |
| EVGA SC15 -- 15 GTX 1060 Laptop 120hz G-Sync/ | 2022-03-28 16:06 | - | |
| EVGA SC17 1080 finally available/ | 2022-03-28 16:06 | - | |
| EVGA SC17 GTX1070 Performance/ | 2022-03-28 16:06 | - | |
| EVOO “Walmart” and why I’m not covering it/ | 2022-03-28 16:06 | - | |
| EVOO EG-LP8-BK Questions/ | 2022-03-28 16:06 | - | |
| EX model from Portable One/ | 2022-03-28 16:06 | - | |
| Easy Driver Updates/ | 2022-03-28 16:06 | - | |
| EasyNote MB85-P-009/ | 2022-03-28 16:06 | - | |
| Easy overclocking of the Killer Notebooks Nagamaki/ | 2022-03-28 16:06 | - | |
| Easy to upgrade RAM and Hard Drive in M4000 MV70J MV50DS/ | 2022-03-28 16:06 | - | |
| Easy to use ISO file with BIOS update/ | 2022-03-28 16:06 | - | |
| Easy way to get inside touchpad of JFL92/ | 2022-03-28 16:06 | - | |
| Ecs/ | 2022-03-28 16:06 | - | |
| Ecs 600/ | 2022-03-28 16:06 | - | |
| Ego-lifestyle notebooks/ | 2022-03-28 16:06 | - | |
| Ei Systems 3090/ | 2022-03-28 16:06 | - | |
| Eight Alternatives to the Raspberry Pi/ | 2022-03-28 16:06 | - | |
| Elktronics 1660 ti video card bios/ | 2022-03-28 16:06 | - | |
| Eluktronicks Mech 15-G3 Covert Gamer Firmware bios request/ | 2022-03-28 16:06 | - | |
| Eluktronics, Xotic Pc, SAGER or Pro-Star Laptops/ | 2022-03-28 16:06 | - | |
| Eluktronics MAX series Laptops/ | 2022-03-28 16:06 | - | |
| Eluktronics MECH 15 What can these do/ | 2022-03-28 16:06 | - | |
| Eluktronics Mech 15 G2R cpu temp issue/ | 2022-03-28 16:06 | - | |
| Eluktronics Mech 15 G3 Bios request for TongFang locked down owners/ | 2022-03-28 16:06 | - | |
| Eluktronics Mech 17/ | 2022-03-28 16:06 | - | |
| Eluktronics Mech 17 Tongfang 17 in/ | 2022-03-28 16:06 | - | |
| Eluktronics max 17 only pulling 100w under load/ | 2022-03-28 16:06 | - | |
| Eluktronics mech 17 rtx sound problems with windows 1903/ | 2022-03-28 16:06 | - | |
| Eluktronics vs XMG vs Sager/ | 2022-03-28 16:06 | - | |
| Email & Internet easy buttons don't appear after installing bbLean/ | 2022-03-28 16:06 | - | |
| Email Button on IFL90/ | 2022-03-28 16:06 | - | |
| Enable hardware sound/ | 2022-03-28 16:06 | - | |
| Enabling AGP Fast Write on 6130/ | 2022-03-28 16:06 | - | |
| Enter and Win $1500 Sager's Gaming Graffiti Giveaway!!/ | 2022-03-28 16:06 | - | |
| Entire Disk Image for Averatec 2370/ | 2022-03-28 16:06 | - | |
| Epic Fail!/ | 2022-03-28 16:06 | - | |
| Epson Endeavour NA801/ | 2022-03-28 16:06 | - | |
| Ergo preceptor 5 keyboard issue/ | 2022-03-28 16:06 | - | |
| Ericsson Laptop/ | 2022-03-28 16:06 | - | |
| Error/ | 2022-03-28 16:06 | - | |
| Error 0x80070017/ | 2022-03-28 16:06 | - | |
| Error in Zeptos 6224 spec in regards to NVIDIA card/ | 2022-03-28 16:06 | - | |
| Escort E-note Xtreme --- Is it worthy/ | 2022-03-28 16:06 | - | |
| Eurocom support/ | 2022-03-28 16:06 | - | |
| European Whitebook resellers/ | 2022-03-28 16:06 | - | |
| European Zepto owners with outstanding warranty/ | 2022-03-28 16:06 | - | |
| European site for Rugged Notebooks/ | 2022-03-28 16:06 | - | |
| Everex 2053T Cannot find resources, HELP!/ | 2022-03-28 16:06 | - | |
| Everex Sa2052t/ | 2022-03-28 16:06 | - | |
| Everex Stepnote T2052 Processor upgrade/ | 2022-03-28 16:06 | - | |
| Everex brand/ | 2022-03-28 16:06 | - | |
| Everex customer support/ | 2022-03-28 16:06 | - | |
| Everex headed out of business/ | 2022-03-28 16:06 | - | |
| Evesham - any experience/ | 2022-03-28 16:06 | - | |
| Evesham/ | 2022-03-28 16:06 | - | |
| Evesham Novatech Tiny Time Mitac/ | 2022-03-28 16:06 | - | |
| Evesham Thoughts on new Notebook/ | 2022-03-28 16:06 | - | |
| Evesham Voyager C550/ | 2022-03-28 16:06 | - | |
| Evoo Gaming Tongfang GK5C6X - Very high package power/ | 2022-03-28 16:06 | - | |
| Excited HEL80 Owner/ | 2022-03-28 16:06 | - | |
| Experience on Vizio support and any idea how to get past the Vizio logo screen after boot/ | 2022-03-28 16:06 | - | |
| Experiences with 'xnotebooks'/ | 2022-03-28 16:06 | - | |
| Experience with Portable One/ | 2022-03-28 16:06 | - | |
| Experience with Vista/ | 2022-03-28 16:06 | - | |
| Expert advise on Zepto 6214W/ | 2022-03-28 16:06 | - | |
| Express Card IEEE 1394b in HEL-80/ | 2022-03-28 16:06 | - | |
| Expresscard doesn't work in Zepto 6324w/ | 2022-03-28 16:06 | - | |
| Expresscard slot dosnt work 6324/ | 2022-03-28 16:06 | - | |
| Exptoexperten.se having technical difficulties/ | 2022-03-28 16:06 | - | |
| Extended batteries for 4265/ | 2022-03-28 16:06 | - | |
| Extended warranty saves the day/ | 2022-03-28 16:06 | - | |
| Extending the Batterylife/ | 2022-03-28 16:06 | - | |
| External Batteries/ | 2022-03-28 16:06 | - | |
| External battery charger/ | 2022-03-28 16:06 | - | |
| External monitor/ | 2022-03-28 16:06 | - | |
| External monitor 6625WD/ | 2022-03-28 16:06 | - | |
| External monitor affected by AC Adapter/ | 2022-03-28 16:06 | - | |
| External monitor issue/ | 2022-03-28 16:06 | - | |
| External monitor on Compaq C-60/ | 2022-03-28 16:06 | - | |
| Extracting VBios on CompalQAL51-FHD/ | 2022-03-28 16:06 | - | |
| Extra disk for 6224W/ | 2022-03-28 16:06 | - | |
| Extra memory for 6625WD/ | 2022-03-28 16:06 | - | |
| Extreme 840 Arima wireless not working in windows 7/ | 2022-03-28 16:06 | - | |
| Eye Strain IFL92/ | 2022-03-28 16:06 | - | |
| FAN runs constantly on my HEL80/ | 2022-03-28 16:06 | - | |
| FAO Zepto people regarding a 3414W!/ | 2022-03-28 16:06 | - | |
| FE690 w GeForce GO7600/ | 2022-03-28 16:06 | - | |
| FL-92 LCD replacement/ | 2022-03-28 16:06 | - | |
| FL9x squealing problem!/ | 2022-03-28 16:06 | - | |
| FL90 + 8600GT Hynix Memos! what to do/ | 2022-03-28 16:06 | - | |
| FL90 + Linux Experiences/ | 2022-03-28 16:06 | - | |
| FL90 + SSD drive/ | 2022-03-28 16:06 | - | |
| FL90, ATI PowerPlay, and PCI express link width/ | 2022-03-28 16:06 | - | |
| FL90, Fingerprint reader software creates memory leaks in Vista x64 when playing games/ | 2022-03-28 16:06 | - | |
| FL90 - Firewire controller/ | 2022-03-28 16:06 | - | |
| FL90 - HD3650 - Fancontrol Problem/ | 2022-03-28 16:06 | - | |
| FL90 - Latest Nvidia Forceware can not be used, why/ | 2022-03-28 16:06 | - | |
| FL90 - Personal Review/ | 2022-03-28 16:06 | - | |
| FL 90 91 my bios and I want update !/ | 2022-03-28 16:06 | - | |
| FL90 Bluetooth - wtf is wrong/ | 2022-03-28 16:06 | - | |
| FL90 Broken LCD/ | 2022-03-28 16:06 | - | |
| FL90 Broken Screen/ | 2022-03-28 16:06 | - | |
| FL90 DVD-RW Drive/ | 2022-03-28 16:06 | - | |
| FL 90 Dead - Blank Screen - Help!/ | 2022-03-28 16:06 | - | |
| FL90 Fan Mod - trying to make fan run at 100% always/ | 2022-03-28 16:06 | - | |
| FL90 Fan Problem/ | 2022-03-28 16:06 | - | |
| FL90 Motherboard/ | 2022-03-28 16:06 | - | |
| FL90 Optical Drive/ | 2022-03-28 16:06 | - | |
| FL90 Ram Upgrade (Please Help)/ | 2022-03-28 16:06 | - | |
| FL90 Shutting Off after installing Windows 7/ | 2022-03-28 16:06 | - | |
| FL90 VDU problem/ | 2022-03-28 16:06 | - | |
| FL90 Wireless led color changed after BIOS update/ | 2022-03-28 16:06 | - | |
| FL90 and HD3650 DDR3, someone has it and VGA output works/ | 2022-03-28 16:06 | - | |
| FL90 and Kingston ValueRAM 4GB (2x2) - Compatible/ | 2022-03-28 16:06 | - | |
| FL90 and TPM driver for Vista 64/ | 2022-03-28 16:06 | - | |
| FL90 and games/ | 2022-03-28 16:06 | - | |
| FL90 bios 1.14/ | 2022-03-28 16:06 | - | |
| FL90 blue screen/ | 2022-03-28 16:06 | - | |
| FL90 driver issue/ | 2022-03-28 16:06 | - | |
| FL 90 hangs when trying to acces HD/ | 2022-03-28 16:06 | - | |
| FL90 headphones jack not working/ | 2022-03-28 16:06 | - | |
| FL90 just died - what could happen/ | 2022-03-28 16:06 | - | |
| FL90 memory/ | 2022-03-28 16:06 | - | |
| FL90 more stable bios n Xfx driver/ | 2022-03-28 16:06 | - | |
| FL90 penryn support/ | 2022-03-28 16:06 | - | |
| FL90 power and battery light flashing/ | 2022-03-28 16:06 | - | |
| FL90 power problems under load/ | 2022-03-28 16:06 | - | |
| FL90 screen problem, please advice/ | 2022-03-28 16:06 | - | |
| FL90 touchpad buttons sound like Trouble !!!/ | 2022-03-28 16:06 | - | |
| FL90 upgrade/ | 2022-03-28 16:06 | - | |
| FL90 upgrade issue/ | 2022-03-28 16:06 | - | |
| FL90 webcam/ | 2022-03-28 16:06 | - | |
| FL90 will be face out/ | 2022-03-28 16:06 | - | |
| FL90 will not boot with 4gb RAM & Vista64/ | 2022-03-28 16:06 | - | |
| FL90 won't power on after hibernate/ | 2022-03-28 16:06 | - | |
| FL91, Hyper-V & VT/ | 2022-03-28 16:06 | - | |
| FL91 Bluetooth problem/ | 2022-03-28 16:06 | - | |
| FL92 + upgraded 4650 no boot screen/ | 2022-03-28 16:06 | - | |
| FL92 Fan Control/ | 2022-03-28 16:06 | - | |
| FL92 Graphic Driver Help!/ | 2022-03-28 16:06 | - | |
| FL92 Service guide/ | 2022-03-28 16:06 | - | |
| FL92 disassembly guide/ | 2022-03-28 16:06 | - | |
| FL92 fingerprint reader board/ | 2022-03-28 16:06 | - | |
| FL92 question- replace optical drive with SATA HDD/ | 2022-03-28 16:06 | - | |
| FL92 specsheet/ | 2022-03-28 16:06 | - | |
| FL92 with X9000, compononent & bios questions/ | 2022-03-28 16:06 | - | |
| FL92 xp64 chipset drivers- Please help/ | 2022-03-28 16:06 | - | |
| FN CTRL-Key Switch Mod/ | 2022-03-28 16:06 | - | |
| FORCE 1656-ID4 (Built on the MSI-1656-ID4)/ | 2022-03-28 16:06 | - | |
| FORCE 3255 (Built on Compal FT00) Now Available/ | 2022-03-28 16:06 | - | |
| FORCE NBLB2 (Built on Compal NBLB2)/ | 2022-03-28 16:06 | - | |
| FPS issues with 6625WD/ | 2022-03-28 16:06 | - | |
| FPS on your Compal/ | 2022-03-28 16:06 | - | |
| FS T IFL90 Sager 2090 $850-512m 8600gt 1.8g t7100 2g ddr2-667 120g hd/ | 2022-03-28 16:06 | - | |
| FT02(JFT02) with t9300- Execute disable bit and enhanced halt state are disable/ | 2022-03-28 16:06 | - | |
| FYI- Prelim info on new P1 Wx!!/ | 2022-03-28 16:06 | - | |
| Factory Restore DVD for the 2200/ | 2022-03-28 16:06 | - | |
| Factroy Setup 2200 Series/ | 2022-03-28 16:06 | - | |
| Failed VGA flash on OCZ Whitebook/ | 2022-03-28 16:06 | - | |
| Fairly small problem with the HEL80...anyone else have this/ | 2022-03-28 16:06 | - | |
| Falcon Northreach TLX/ | 2022-03-28 16:06 | - | |
| Falcon Northwest/ | 2022-03-28 16:06 | - | |
| Falcon Northwest support outside US/ | 2022-03-28 16:06 | - | |
| Familiar with Compal DL70 (Chembook 2070)/ | 2022-03-28 16:06 | - | |
| Fan 6324/ | 2022-03-28 16:06 | - | |
| Fan Error and not working!/ | 2022-03-28 16:06 | - | |
| Fan Keeps Going on and Off/ | 2022-03-28 16:06 | - | |
| Fan for the 6224w 6324w (would a fan from some compal match read its a rebranded compal)/ | 2022-03-28 16:06 | - | |
| Fangbook/ | 2022-03-28 16:06 | - | |
| Fangbook 4/ | 2022-03-28 16:06 | - | |
| Fangbook IV... Is it Good/ | 2022-03-28 16:06 | - | |
| Fangbook X7-100/ | 2022-03-28 16:06 | - | |
| Fan on 6324W won't stop before reboot/ | 2022-03-28 16:06 | - | |
| Fan problem/ | 2022-03-28 16:06 | - | |
| Fan problem with my HGL30/ | 2022-03-28 16:06 | - | |
| Fan replacement for CT14/ | 2022-03-28 16:06 | - | |
| Fan speed in sager 2092(jfl92)/ | 2022-03-28 16:06 | - | |
| Fan speed problems at Znote 6024W/ | 2022-03-28 16:06 | - | |
| Fan speeds/ | 2022-03-28 16:06 | - | |
| Fan spinning, newest bios!/ | 2022-03-28 16:06 | - | |
| Fan spinning on HEL80, any tips/ | 2022-03-28 16:06 | - | |
| Fan toggle for ifl90/ | 2022-03-28 16:06 | - | |
| Far cry 2 on zepto nox mythos nexus/ | 2022-03-28 16:06 | - | |
| Fast Slow - fix please/ | 2022-03-28 16:06 | - | |
| Faulty Physical Network Jack (RJ-45) on 6130/ | 2022-03-28 16:06 | - | |
| Faulty RAM/ | 2022-03-28 16:06 | - | |
| Fav Portable One Laptop Poll/ | 2022-03-28 16:06 | - | |
| Few Questions on HGL-30/ | 2022-03-28 16:06 | - | |
| Few questions about Zepto 6224W/ | 2022-03-28 16:06 | - | |
| Few questions about new Compals/ | 2022-03-28 16:06 | - | |
| Few questions about the HEL80/ | 2022-03-28 16:06 | - | |
| Figured out P1 and P2/ | 2022-03-28 16:06 | - | |
| Finally Got My 6314W - Pics Inside!/ | 2022-03-28 16:06 | - | |
| Finally Upgraded My IC Laptop/ | 2022-03-28 16:06 | - | |
| Finally got my Comapl IFL90/ | 2022-03-28 16:06 | - | |
| Finally made the jump to Clevo Sager Eurocom/ | 2022-03-28 16:06 | - | |
| Finally my 6224W arrived!/ | 2022-03-28 16:06 | - | |
| FingerPrint Reader/ | 2022-03-28 16:06 | - | |
| Fingerprint Reader HEL80/ | 2022-03-28 16:06 | - | |
| Fingerprint Reader Software (Omnipass) for Vista/ | 2022-03-28 16:06 | - | |
| Fingerprint Reader on Windows Vista Problem/ | 2022-03-28 16:06 | - | |
| Finger print reader on H80/ | 2022-03-28 16:06 | - | |
| Fingerprint scanner/ | 2022-03-28 16:06 | - | |
| Fingerprint scanner and omnipass/ | 2022-03-28 16:06 | - | |
| Fingerprint software for IFL90/ | 2022-03-28 16:06 | - | |
| First Steps with a New Laptop/ | 2022-03-28 16:06 | - | |
| First impressions/ | 2022-03-28 16:06 | - | |
| First reports from 6224W user/ | 2022-03-28 16:06 | - | |
| Fit These Specs/ | 2022-03-28 16:06 | - | |
| Fittersman's random questions/ | 2022-03-28 16:06 | - | |
| Fixes for CPU thermal problems with Znote 6x24/ | 2022-03-28 16:06 | - | |
| Fl90 VideoCard Trouble/ | 2022-03-28 16:06 | - | |
| Fl90 only works with adapter/ | 2022-03-28 16:06 | - | |
| Fl92 + T8100/ | 2022-03-28 16:06 | - | |
| Fl Bios Rom/ | 2022-03-28 16:06 | - | |
| Flash 3200 with other BIOS/ | 2022-03-28 16:06 | - | |
| Flash hdds to Zepto/ | 2022-03-28 16:06 | - | |
| Flashing BIOS backup questions (EVOO LP7)/ | 2022-03-28 16:06 | - | |
| Flash player in vista- chrashes/ | 2022-03-28 16:06 | - | |
| Flash video stuttering KHLB2/ | 2022-03-28 16:06 | - | |
| Flextronics Arima 840 & 4870s/ | 2022-03-28 16:06 | - | |
| Flush fit with non-compal optical drive/ | 2022-03-28 16:06 | - | |
| Fn+F1 on HGL30/ | 2022-03-28 16:06 | - | |
| Fn+Numpad/ | 2022-03-28 16:06 | - | |
| Fn-F3/ | 2022-03-28 16:06 | - | |
| Fooled Me!/ | 2022-03-28 16:06 | - | |
| Forcebook IG - JFL92/ | 2022-03-28 16:06 | - | |
| Formating the h-drive 2425W/ | 2022-03-28 16:06 | - | |
| For those looking for the WSXGA+ MATTE screen on the Compal IFL90...Rejoice!/ | 2022-03-28 16:06 | - | |
| For those of you torn between the HEL80 and Z96J/ | 2022-03-28 16:06 | - | |
| For those who are seeking new OCZ 17 Whitebooks/ | 2022-03-28 16:06 | - | |
| Forum description/ | 2022-03-28 16:06 | - | |
| Found a bios update for the mech-15, maybe, sort of/ | 2022-03-28 16:06 | - | |
| Framework Laptop/ | 2022-03-28 16:06 | - | |
| Franken-Comp/ | 2022-03-28 16:06 | - | |
| Free Compal Badge name plate/ | 2022-03-28 16:06 | - | |
| Free Inspice Trace & Recovery for 3 Years/ | 2022-03-28 16:06 | - | |
| Free Software Laptop/ | 2022-03-28 16:06 | - | |
| Freeze on a Compal FL90/ | 2022-03-28 16:06 | - | |
| Freezing problems/ | 2022-03-28 16:06 | - | |
| Freshly Reformatted HGL30 sometimes Hangs at Phoenix screen/ | 2022-03-28 16:06 | - | |
| From 100GB 7200rpm to 200GB 7200rpm in my Zepto Znote 6224W/ | 2022-03-28 16:06 | - | |
| From the ifl90 to an external moniter/ | 2022-03-28 16:06 | - | |
| Frozen Touchpad& Cursor/ | 2022-03-28 16:06 | - | |
| Frustrated- Linux, IFL90 and 8600m GT/ | 2022-03-28 16:06 | - | |
| Fry's GQ Brand Notebooks/ | 2022-03-28 16:06 | - | |
| Full MX Review/ | 2022-03-28 16:06 | - | |
| Full performance on Battery when AC unplugged/ | 2022-03-28 16:06 | - | |
| Furmark on a Whitebook. What are your temps/ | 2022-03-28 16:06 | - | |
| Fusion-Compal IFL 90/ | 2022-03-28 16:06 | - | |
| Future models/ | 2022-03-28 16:06 | - | |
| G14B Upgrades/ | 2022-03-28 16:06 | - | |
| G14b reviews/ | 2022-03-28 16:06 | - | |
| G71G from P1/ | 2022-03-28 16:06 | - | |
| GEN-X-PCs/ | 2022-03-28 16:06 | - | |
| GETAC B300 TUTORIAL for gps stock install/ | 2022-03-28 16:06 | - | |
| GETAC a320t info/ | 2022-03-28 16:06 | - | |
| GF 7600, the best drivers for Vista 32bit/ | 2022-03-28 16:06 | - | |
| GL30 - 14.1 Wxga Tft 1440 900/ | 2022-03-28 16:06 | - | |
| GOT my FL90!!/ | 2022-03-28 16:06 | - | |
| GPD Pocket - 7 Laptop/ | 2022-03-28 16:06 | - | |
| GPD WIN Max/ | 2022-03-28 16:06 | - | |
| GPS module for IFL90/ | 2022-03-28 16:06 | - | |
| GPU0 spick between 0 and 100 after clean installtion of windows 10 into GK5CP6Z TONGFANG/ | 2022-03-28 16:06 | - | |
| GPU Clocks/ | 2022-03-28 16:06 | - | |
| GPU Gone/ | 2022-03-28 16:06 | - | |
| GPU Idle temperatures & Hardware monitoring software/ | 2022-03-28 16:06 | - | |
| GPU Temps/ | 2022-03-28 16:06 | - | |
| GPU Upgrade/ | 2022-03-28 16:06 | - | |
| GPU fan is always at 100% and poor performance!/ | 2022-03-28 16:06 | - | |
| GPU for a Zepto 6615wd/ | 2022-03-28 16:06 | - | |
| GPU monitor for 6615WD/ | 2022-03-28 16:06 | - | |
| GPU temp/ | 2022-03-28 16:06 | - | |
| GPU temperatures zepto 6625WD/ | 2022-03-28 16:06 | - | |
| GamePC GPN-A64B/ | 2022-03-28 16:06 | - | |
| Gamer Xtreme M1/ | 2022-03-28 16:06 | - | |
| Games I'm looking forward to play on 6224W/ | 2022-03-28 16:06 | - | |
| Gaming CPU Temps vista/ | 2022-03-28 16:06 | - | |
| Gaming Laptop Randomly Turning Off and Going to Sleep/ | 2022-03-28 16:06 | - | |
| Gaming Operating System/ | 2022-03-28 16:06 | - | |
| Gaming Zepto/ | 2022-03-28 16:06 | - | |
| Gaming on 14inch (hgl30)/ | 2022-03-28 16:06 | - | |
| Gaming on the HGL-30/ | 2022-03-28 16:06 | - | |
| Gateway Creators Series 15.6 RTX 2060 i5-10300H/ | 2022-03-28 16:06 | - | |
| Gateway FX P-7811 Screen Issue/ | 2022-03-28 16:06 | - | |
| Gateway GWTN116-1BL/ | 2022-03-28 16:06 | - | |
| Gateway GWTN141-10XX i5-1135G7 Owners thread/ | 2022-03-28 16:06 | - | |
| Gateway Solo 2200 booting problem/ | 2022-03-28 16:06 | - | |
| GeForce Go 7600 GT and Bluetooth v2.0 + EDR in HEL80's future/ | 2022-03-28 16:06 | - | |
| Geforce 8600, Vista and Turbocache/ | 2022-03-28 16:06 | - | |
| Geforce 8600M GS - Force underclock (Medion 96380)/ | 2022-03-28 16:06 | - | |
| Geforce 8600M GT Windows XP 64-bit driver (Compal IFL-90+)/ | 2022-03-28 16:06 | - | |
| General Dynamics Any One Go Book/ | 2022-03-28 16:06 | - | |
| General performance decrease when reading a disk/ | 2022-03-28 16:06 | - | |
| Generic manufacturer/ | 2022-03-28 16:06 | - | |
| Gentech/ | 2022-03-28 16:06 | - | |
| Getac/ | 2022-03-28 16:06 | - | |
| Getac A320/ | 2022-03-28 16:06 | - | |
| Getac B300 G5 Phoenix Bios problem/ | 2022-03-28 16:06 | - | |
| Getac S400 Parts Components ---- FOR SALE or TRADE/ | 2022-03-28 16:06 | - | |
| Getting ZAPPED by fingerprint reader!/ | 2022-03-28 16:06 | - | |
| Getting a 6314W/ | 2022-03-28 16:06 | - | |
| Getting a laptop/ | 2022-03-28 16:06 | - | |
| Getting new hdd, how bout windows/ | 2022-03-28 16:06 | - | |
| Getting out of sleep modus/ | 2022-03-28 16:06 | - | |
| Getting rid of the TPM icon in the system tray/ | 2022-03-28 16:06 | - | |
| Getting started with the 6615WD/ | 2022-03-28 16:06 | - | |
| GigaByte Notebooks - Where to buy in the USA/ | 2022-03-28 16:06 | - | |
| Gigabyte's 15.6 Laptop/ | 2022-03-28 16:06 | - | |
| Gigabyte M912 oops/ | 2022-03-28 16:06 | - | |
| Gigabyte W566N - Webcam issue/ | 2022-03-28 16:06 | - | |
| Gigabyte W576V/ | 2022-03-28 16:06 | - | |
| Gigabyte notebooks/ | 2022-03-28 16:06 | - | |
| Gigabyte w551n laptop screen/ | 2022-03-28 16:06 | - | |
| Giving serious consideration to MX/ | 2022-03-28 16:06 | - | |
| Global Warranty in Australia/ | 2022-03-28 16:06 | - | |
| Glossy Screen - Cleaning/ | 2022-03-28 16:06 | - | |
| Glossy into Matte/ | 2022-03-28 16:06 | - | |
| GoBOXX 2300/ | 2022-03-28 16:06 | - | |
| God Jul! Merry Christmas everyone!/ | 2022-03-28 16:06 | - | |
| Going to buy 6024W/ | 2022-03-28 16:06 | - | |
| Good Experiences With Averatec/ | 2022-03-28 16:06 | - | |
| Good Gaming Laptop/ | 2022-03-28 16:06 | - | |
| Goodbye Averatec/ | 2022-03-28 16:06 | - | |
| Goodbye but not Farewell to my CL56/ | 2022-03-28 16:06 | - | |
| Good deal or not!/ | 2022-03-28 16:06 | - | |
| Google Chrome OS CR-48 Notebook/ | 2022-03-28 16:06 | - | |
| Google Chrome OS CR-48 Notebook User Review/ | 2022-03-28 16:06 | - | |
| Go on then Zepto lets be having an 8800/ | 2022-03-28 16:06 | - | |
| Got My MX/ | 2022-03-28 16:06 | - | |
| Got my 6024W/ | 2022-03-28 16:06 | - | |
| Got my 6625wd today/ | 2022-03-28 16:06 | - | |
| Got my Compal IFL90!!!/ | 2022-03-28 16:06 | - | |
| Got my New 6625WD today/ | 2022-03-28 16:06 | - | |
| Got my OCZ barebones/ | 2022-03-28 16:06 | - | |
| Got my UX/ | 2022-03-28 16:06 | - | |
| Got my Znote 2425W - Compal Hel80 - Some Questions/ | 2022-03-28 16:06 | - | |
| Got the Compal JFL92 (BTO 15W26+)/ | 2022-03-28 16:06 | - | |
| Graphic card dead/ | 2022-03-28 16:06 | - | |
| Graphic driver Hel 81 Current version 6.14.10.8390/ | 2022-03-28 16:06 | - | |
| Graphic driver for 6224w/ | 2022-03-28 16:06 | - | |
| Graphics Driver for Znote 6625WD/ | 2022-03-28 16:06 | - | |
| Graphics Error/ | 2022-03-28 16:06 | - | |
| Graphics performance on 6130/ | 2022-03-28 16:06 | - | |
| Great Prices @ MilestonePC for Compal/ | 2022-03-28 16:06 | - | |
| Great review (IFL90)...In Polish -(...Help me find a good translation!/ | 2022-03-28 16:06 | - | |
| Green Charger II on FL90/ | 2022-03-28 16:06 | - | |
| H-E-L-P My IFL90 won't start/ | 2022-03-28 16:06 | - | |
| HANNSPREE HARDDRIVE TRUBLESHOOTING (or how to convert a FAT32 partion to NTFS without having Wndows installed)/ | 2022-03-28 16:06 | - | |
| HANNspree SN12E built-in webcam not detected/ | 2022-03-28 16:06 | - | |
| HD3650 in ifl91/ | 2022-03-28 16:06 | - | |
| HD 3870 Crossfire vs 9800 GTS SLI/ | 2022-03-28 16:06 | - | |
| HD 4650 in (I)FL90 91/ | 2022-03-28 16:06 | - | |
| HD Blu Ray Playback/ | 2022-03-28 16:06 | - | |
| HDD Speeds - Does SetFSB harm your HDD/ | 2022-03-28 16:06 | - | |
| HD DVD now available for 6625WD,6025WD,3215W,3415W/ | 2022-03-28 16:06 | - | |
| HD used in 6130hs/ | 2022-03-28 16:06 | - | |
| HEL-80,81 Memory Question/ | 2022-03-28 16:06 | - | |
| HEL-80 Optical drive issue/ | 2022-03-28 16:06 | - | |
| HEL-80 Realtek LAN gone issues/ | 2022-03-28 16:06 | - | |
| HEL-80 Touchpad Sensitivity/ | 2022-03-28 16:06 | - | |
| HEL-80 buyer question/ | 2022-03-28 16:06 | - | |
| HEL-80 does not restore after lid close Stand By/ | 2022-03-28 16:06 | - | |
| HEL-80 runs too hot/ | 2022-03-28 16:06 | - | |
| HEL-80 vs. HGL-30...HEL80 bulky/ | 2022-03-28 16:06 | - | |
| HEL-80 weird beep sound/ | 2022-03-28 16:06 | - | |
| HEL30 Bios upgrade 025A/ | 2022-03-28 16:06 | - | |
| HEL30 Purchase/ | 2022-03-28 16:06 | - | |
| HEL30 driver update/ | 2022-03-28 16:06 | - | |
| HEL80 & Heat- A Game Too Far/ | 2022-03-28 16:06 | - | |
| HEL80 & Vista problem (Wireless)/ | 2022-03-28 16:06 | - | |
| HEL80 'Blinking' Power Problem/ | 2022-03-28 16:06 | - | |
| HEL80's bluetooth/ | 2022-03-28 16:06 | - | |
| HEL80(Nvidia 7600 Go) drivers to vista(rc1) from where/ | 2022-03-28 16:06 | - | |
| HEL80 (PowerNotebooks PowerPro L 8-15) + Intel WiFi 5300 802.11abgn mPCIe/ | 2022-03-28 16:06 | - | |
| HEL80 + SP2 + Hotfix + SP3 + Overclock/ | 2022-03-28 16:06 | - | |
| HEL80, MiniPCI/ | 2022-03-28 16:06 | - | |
| HEL80- Alternative to stock software/ | 2022-03-28 16:06 | - | |
| HEL80- Battery AC Power/ | 2022-03-28 16:06 | - | |
| HEL80 - Blue Screen of Death/ | 2022-03-28 16:06 | - | |
| HEL80 - Bluetooth connectivity problem/ | 2022-03-28 16:06 | - | |
| HEL80-Can't set external monitor as primary/ | 2022-03-28 16:06 | - | |
| HEL80 - Considering a Purchase, a couple of questions!/ | 2022-03-28 16:06 | - | |
| HEL80 - Do I need a new video board/ | 2022-03-28 16:06 | - | |
| HEL80 - Intermittent system freeze/ | 2022-03-28 16:06 | - | |
| HEL80- Inturruption between power battery/ | 2022-03-28 16:06 | - | |
| HEL80 - Issue with Standby hibernation/ | 2022-03-28 16:06 | - | |
| HEL80- Lid closure of death/ | 2022-03-28 16:06 | - | |
| HEL80 - Network Card Not Detected/ | 2022-03-28 16:06 | - | |
| HEL80 - Questios Before Purchase/ | 2022-03-28 16:06 | - | |
| HEL80 - Strange noise through when using internal soundcard/ | 2022-03-28 16:06 | - | |
| HEL 80 - Technical Data/ | 2022-03-28 16:06 | - | |
| HEL80 - annoying noise under Linux/ | 2022-03-28 16:06 | - | |
| HEL80 - power management under linux/ | 2022-03-28 16:06 | - | |
| HEL80. Why fan starts and stops every 10 seconds. Any help/ | 2022-03-28 16:06 | - | |
| HEL80 4GB memory upgrade/ | 2022-03-28 16:06 | - | |
| HEL80; New to barebones, lots of questions, install OS yourself/ | 2022-03-28 16:06 | - | |
| HEL80 BIOS 114B- battery remaining time indicator added!/ | 2022-03-28 16:06 | - | |
| HEL80 BIOS Problem on frozen laptop/ | 2022-03-28 16:06 | - | |
| HEL80 BackPack/ | 2022-03-28 16:06 | - | |
| HEL80 Battery, Again!/ | 2022-03-28 16:06 | - | |
| HEL80 Battery Problems/ | 2022-03-28 16:06 | - | |
| HEL80 Battery Time Left Notification/ | 2022-03-28 16:06 | - | |
| HEL80 Bios/ | 2022-03-28 16:06 | - | |
| HEL80 Bios Password Lock/ | 2022-03-28 16:06 | - | |
| HEL80 BlueTooth Pointers/ | 2022-03-28 16:06 | - | |
| H EL80 Blutetooth module vs I FL90 Bluetooth module/ | 2022-03-28 16:06 | - | |
| HEL 80 Built-in Camera/ | 2022-03-28 16:06 | - | |
| HEL 80 CPU Upgrade/ | 2022-03-28 16:06 | - | |
| HEL80 CPU Usage/ | 2022-03-28 16:06 | - | |
| HEL80 Color Saturation/ | 2022-03-28 16:06 | - | |
| HEL80 Dim Screen on First Boot/ | 2022-03-28 16:06 | - | |
| HEL80 Display help/ | 2022-03-28 16:06 | - | |
| HEL 80 Drivers for Windows 7/ | 2022-03-28 16:06 | - | |
| HEL80 Embedded Controller Error/ | 2022-03-28 16:06 | - | |
| HEL80 External Monitor + AC Plugged In = Flicker/ | 2022-03-28 16:06 | - | |
| HEL80 Gigabyte wireless disconnection upon upload/ | 2022-03-28 16:06 | - | |
| HEL80 Hardrive!/ | 2022-03-28 16:06 | - | |
| HEL80 Heat/ | 2022-03-28 16:06 | - | |
| HEL 80 Keyboard Replacement/ | 2022-03-28 16:06 | - | |
| HEL80 LAN problem/ | 2022-03-28 16:06 | - | |
| HEL80 Monitor Question/ | 2022-03-28 16:06 | - | |
| HEL80 Overheating Fan Issue/ | 2022-03-28 16:06 | - | |
| HEL80 Overheating question/ | 2022-03-28 16:06 | - | |
| HEL80 Power Adapter/ | 2022-03-28 16:06 | - | |
| HEL80 Power Issues (plugged in, discharging)/ | 2022-03-28 16:06 | - | |
| HEL80 Problem/ | 2022-03-28 16:06 | - | |
| HEL80 Remote Control/ | 2022-03-28 16:06 | - | |
| HEL80 Screen problems/ | 2022-03-28 16:06 | - | |
| HEL80 Screen resolution.. max resolution/ | 2022-03-28 16:06 | - | |
| HEL80 Shutting Down Unexpectedly/ | 2022-03-28 16:06 | - | |
| HEL80 Standby at Windows XP Logon/ | 2022-03-28 16:06 | - | |
| HEL80 Supports SATA3g HDs/ | 2022-03-28 16:06 | - | |
| HEL80 TV-Tuner, where to buy/ | 2022-03-28 16:06 | - | |
| HEL80 TV Connections/ | 2022-03-28 16:06 | - | |
| HEL80 TV Out/ | 2022-03-28 16:06 | - | |
| HEL 80 TV Tuner/ | 2022-03-28 16:06 | - | |
| HEL80 TV tuner driver app/ | 2022-03-28 16:06 | - | |
| HEL80 Temperature/ | 2022-03-28 16:06 | - | |
| HEL80 Time issue/ | 2022-03-28 16:06 | - | |
| HEL80 Touchpad Scrolling Problems/ | 2022-03-28 16:06 | - | |
| HEL80 Tweaks/ | 2022-03-28 16:06 | - | |
| HEL80 Universal AC Adapter/ | 2022-03-28 16:06 | - | |
| HEL80 Upgrading Bios/ | 2022-03-28 16:06 | - | |
| HEL80 User define easy buttons/ | 2022-03-28 16:06 | - | |
| HEL80 VGA out max res/ | 2022-03-28 16:06 | - | |
| HEL80 WSXGA+ uses the new Prism LCD technology!/ | 2022-03-28 16:06 | - | |
| HEL80 WXGA in stock yet/ | 2022-03-28 16:06 | - | |
| HEL80 Wi Fi Switch/ | 2022-03-28 16:06 | - | |
| HEL80 Wont charge or run on outlet power/ | 2022-03-28 16:06 | - | |
| HEL80 XP-Vista Drivers/ | 2022-03-28 16:06 | - | |
| HEL80 Zepto 2425W Windows 7 WSS FIX WITH FILES!/ | 2022-03-28 16:06 | - | |
| HEL80 and HGL30/ | 2022-03-28 16:06 | - | |
| HEL80 and TV Tuner/ | 2022-03-28 16:06 | - | |
| HEL80 and X-Fi for notebooks problem/ | 2022-03-28 16:06 | - | |
| HEL80 and core 2 duo/ | 2022-03-28 16:06 | - | |
| HEL80 and invalid card reader PCI IDs/ | 2022-03-28 16:06 | - | |
| HEL80 and problems with nvidia drivers. Any help/ | 2022-03-28 16:06 | - | |
| HEL80 antenna question/ | 2022-03-28 16:06 | - | |
| HEL 80 audio problems/ | 2022-03-28 16:06 | - | |
| HEL80 battery/ | 2022-03-28 16:06 | - | |
| HEL80 battery question/ | 2022-03-28 16:06 | - | |
| HEL80 bbset, 2 problems/ | 2022-03-28 16:06 | - | |
| HEL80 buyer questions/ | 2022-03-28 16:06 | - | |
| HEL80 clock speeds stuck extremely low/ | 2022-03-28 16:06 | - | |
| HEL80 cpu temp/ | 2022-03-28 16:06 | - | |
| HEL80 display turning greenish/ | 2022-03-28 16:06 | - | |
| HEL80 drivers/ | 2022-03-28 16:06 | - | |
| HEL80 dvd burning issue/ | 2022-03-28 16:06 | - | |
| HEL80 from Powernotebooks or Z96J from gentech (warranty and more)/ | 2022-03-28 16:06 | - | |
| HEL 80 heat/ | 2022-03-28 16:06 | - | |
| HEL80 owner...or not/ | 2022-03-28 16:06 | - | |
| HEL80 problem, and compal problem/ | 2022-03-28 16:06 | - | |
| HEL80 question about CPU speed/ | 2022-03-28 16:06 | - | |
| HEL80 random freezing solution/ | 2022-03-28 16:06 | - | |
| HEL80 slot in drive loads suddently all the time/ | 2022-03-28 16:06 | - | |
| HEL80 touchpad ultimate thread/ | 2022-03-28 16:06 | - | |
| HEL80 video card dead/ | 2022-03-28 16:06 | - | |
| HEL80 video card upgrade help requested/ | 2022-03-28 16:06 | - | |
| HEL80 vs EL80/ | 2022-03-28 16:06 | - | |
| HEL 80 with Mac Osx/ | 2022-03-28 16:06 | - | |
| HEL80 with Ubuntu LAN doesn't work/ | 2022-03-28 16:06 | - | |
| HEL80 with t7200/ | 2022-03-28 16:06 | - | |
| HEL81- replaced inverter, now won't power up/ | 2022-03-28 16:06 | - | |
| HEL81 Optic Drive/ | 2022-03-28 16:06 | - | |
| HEL81 lost LAN/ | 2022-03-28 16:06 | - | |
| HELP!!! BIOS GPU Evesham C720DC Clevo M575U/ | 2022-03-28 16:06 | - | |
| HELP!!! Hypersonic Aviator EX7 Buyer Beware!/ | 2022-03-28 16:06 | - | |
| HELP!!! Installing Windows 7 on a Huawei Matebook X Pro/ | 2022-03-28 16:06 | - | |
| HELP!!! s6210 hdd upgrade/ | 2022-03-28 16:06 | - | |
| HELP!! I need 3200 LCD screen and Keypad/ | 2022-03-28 16:06 | - | |
| HELP!! Zepto 6224W Disable System+Video Shadowing/ | 2022-03-28 16:06 | - | |
| HELP! How to add RAM to Winbook X4 laptop/ | 2022-03-28 16:06 | - | |
| HELP! No picture odd not functioning/ | 2022-03-28 16:06 | - | |
| HELP- Orange flashing light on EL80 (Possibly, it's an EL81)/ | 2022-03-28 16:06 | - | |
| HELP - Zepto not booting other than in safe mode/ | 2022-03-28 16:06 | - | |
| HELP HOW DO I RESET MY BIOS on 6615wd/ | 2022-03-28 16:06 | - | |
| HELP ME !!!! clearing cmos/ | 2022-03-28 16:06 | - | |
| HELP lost xp cd/ | 2022-03-28 16:06 | - | |
| HGL-30, Webcam, and Hibernate/ | 2022-03-28 16:06 | - | |
| HGL-30 Bios Update Thread/ | 2022-03-28 16:06 | - | |
| HGL-30 CPU spikes with lag/ | 2022-03-28 16:06 | - | |
| HGL-30 DVD Playback Question/ | 2022-03-28 16:06 | - | |
| HGL-30 HD Temp/ | 2022-03-28 16:06 | - | |
| HGL-30 Hibernation/ | 2022-03-28 16:06 | - | |
| HGL-30 Windows Vista Qs & New Bios 025/ | 2022-03-28 16:06 | - | |
| HGL-30 bare bone questions/ | 2022-03-28 16:06 | - | |
| HGL-30 hibernation and loose memory/ | 2022-03-28 16:06 | - | |
| HGL-30 integrated camera/ | 2022-03-28 16:06 | - | |
| HGL-30 suddenly became very slow!/ | 2022-03-28 16:06 | - | |
| HGL30 - Build or Order/ | 2022-03-28 16:06 | - | |
| HGL 30 - with high end games/ | 2022-03-28 16:06 | - | |
| HGL 30 AC adapter/ | 2022-03-28 16:06 | - | |
| HGL30 Bios Update 114 & Wireless Update/ | 2022-03-28 16:06 | - | |
| HGL30 Build/ | 2022-03-28 16:06 | - | |
| HGL30 Fault/ | 2022-03-28 16:06 | - | |
| HGL30 Flickering Screen - Drivers not loading Vista/ | 2022-03-28 16:06 | - | |
| HGL 30 Integrated camera cable broke/ | 2022-03-28 16:06 | - | |
| HGL30 Motherboard/ | 2022-03-28 16:06 | - | |
| HGL30 Overclocking CPU PLL Manufacturer/ | 2022-03-28 16:06 | - | |
| HGL30 Questions/ | 2022-03-28 16:06 | - | |
| HGL30 Review posted/ | 2022-03-28 16:06 | - | |
| HGL30 SD reader for readyboost/ | 2022-03-28 16:06 | - | |
| HGL30 Screen Question/ | 2022-03-28 16:06 | - | |
| HGL 30 Touchpad Problem/ | 2022-03-28 16:06 | - | |
| HGL30 Touchpad problem in Ubuntu/ | 2022-03-28 16:06 | - | |
| HGL30 VGA LCD problem/ | 2022-03-28 16:06 | - | |
| HGL30 Webcam samples/ | 2022-03-28 16:06 | - | |
| HGL 30 Won't Power On/ | 2022-03-28 16:06 | - | |
| HGL30 able to do 1080p/ | 2022-03-28 16:06 | - | |
| HGL30 and Antec Notebook Cooler/ | 2022-03-28 16:06 | - | |
| HGL 30 and bluetooth/ | 2022-03-28 16:06 | - | |
| HGL30 assembly question/ | 2022-03-28 16:06 | - | |
| HGL30 at risk for discolouration/ | 2022-03-28 16:06 | - | |
| HGL30 bluetooth and wireless problems/ | 2022-03-28 16:06 | - | |
| HGL30 bluetooth not working after hibernation/ | 2022-03-28 16:06 | - | |
| HGL30 camera and Vista/ | 2022-03-28 16:06 | - | |
| HGL30 fan switch mod/ | 2022-03-28 16:06 | - | |
| HGL30 hardware mods/ | 2022-03-28 16:06 | - | |
| HGL30 in UK Is it possible/ | 2022-03-28 16:06 | - | |
| HGL30 mini-review and some pet peeves/ | 2022-03-28 16:06 | - | |
| HGL30 overheating with SSD/ | 2022-03-28 16:06 | - | |
| HGL30 pictures anyone/ | 2022-03-28 16:06 | - | |
| HGL30 too Expensive at KillerNotebooks.com/ | 2022-03-28 16:06 | - | |
| HGL30 with 1440X900 +1394 Avail @ ABS Mayhem/ | 2022-03-28 16:06 | - | |
| HGL31 I laptop upgrade/ | 2022-03-28 16:06 | - | |
| HGL31 and heat/ | 2022-03-28 16:06 | - | |
| HGST 7K100 Series Best Mobile Drive (again)/ | 2022-03-28 16:06 | - | |
| HL80 and SATA/ | 2022-03-28 16:06 | - | |
| HL90 1.17 Bios/ | 2022-03-28 16:06 | - | |
| HL90 mobo, where to get/ | 2022-03-28 16:06 | - | |
| HL91 Black screen problems/ | 2022-03-28 16:06 | - | |
| HOT info about the new 1000 and 4000/ | 2022-03-28 16:06 | - | |
| HOly S I got my IFL90, I expected it on monday!!!!/ | 2022-03-28 16:06 | - | |
| HP DV2500 - No display/ | 2022-03-28 16:06 | - | |
| HP DV6500t based on IFL90/ | 2022-03-28 16:06 | - | |
| HTC Shift localization of VISTA to CZ lang/ | 2022-03-28 16:06 | - | |
| HUAWEI MateBook X (Installing Windows 7 on UEFI)/ | 2022-03-28 16:06 | - | |
| HYPERSONIC AX7....I finally bought it!/ | 2022-03-28 16:06 | - | |
| Hair underneath HEL-80 screen/ | 2022-03-28 16:06 | - | |
| Halp, can't find NP2030 HGL30 bios download/ | 2022-03-28 16:06 | - | |
| Hannspree - SN12E2/ | 2022-03-28 16:06 | - | |
| Hannspree SN12E23B Hard Drive/ | 2022-03-28 16:06 | - | |
| Hannspree sn10e2 keyboard and wifi/ | 2022-03-28 16:06 | - | |
| Happy Holidays!/ | 2022-03-28 16:06 | - | |
| Happy Holidays/ | 2022-03-28 16:06 | - | |
| Happy New Year/ | 2022-03-28 16:06 | - | |
| Happy holidays, via Znote webcams!/ | 2022-03-28 16:06 | - | |
| Hard Drive Error... HELP!!!!!/ | 2022-03-28 16:06 | - | |
| Hard disk failure on 6625/ | 2022-03-28 16:06 | - | |
| Hard disk selection 6625 page leads to error/ | 2022-03-28 16:06 | - | |
| Hard drive/ | 2022-03-28 16:06 | - | |
| Hard drive for compal ifl90/ | 2022-03-28 16:06 | - | |
| Hard drive removal help please/ | 2022-03-28 16:06 | - | |
| Hard drive update/ | 2022-03-28 16:06 | - | |
| Hard drive upgrade/ | 2022-03-28 16:06 | - | |
| Hard drive upgrade anyone/ | 2022-03-28 16:06 | - | |
| Hard reboot during Windows Installation/ | 2022-03-28 16:06 | - | |
| Hardware Virtualization/ | 2022-03-28 16:06 | - | |
| Hardware Virtualization on HEL80 81/ | 2022-03-28 16:06 | - | |
| Has anyone got Vista 64bit installed on a 6224W/ | 2022-03-28 16:06 | - | |
| Has anyone had any success overclocking the JHL90/ | 2022-03-28 16:06 | - | |
| Has anyone had the opportunity to test the new Huawei Matebook X/ | 2022-03-28 16:06 | - | |
| Has anyone here applied thermal paste to the HGL-30/ | 2022-03-28 16:06 | - | |
| Has anyone purchased the whitebook with a single gpu/ | 2022-03-28 16:06 | - | |
| Has anyone shipped a Zepto (or other laptop) into the U.S/ | 2022-03-28 16:06 | - | |
| Hasee/ | 2022-03-28 16:06 | - | |
| Hasee FA451/ | 2022-03-28 16:06 | - | |
| Hasee HEC41/ | 2022-03-28 16:06 | - | |
| Has the Zepto Znote 6224W GDDR3 memory/ | 2022-03-28 16:06 | - | |
| Haswell Upgrade on thin and light ultrabooks/ | 2022-03-28 16:06 | - | |
| Have IFL90 from zzf working!/ | 2022-03-28 16:06 | - | |
| Have any of you tried the latest release on 185.85 for the 8series-M/ | 2022-03-28 16:06 | - | |
| Have a serious problem with my 6224W/ | 2022-03-28 16:06 | - | |
| Have not received order confirmation for laptop order/ | 2022-03-28 16:06 | - | |
| Have question about Falcon Northwest Fragbook TL/ | 2022-03-28 16:06 | - | |
| Have you ever heard NEC metalware/ | 2022-03-28 16:06 | - | |
| Having fun with the remote/ | 2022-03-28 16:06 | - | |
| Hdtv/ | 2022-03-28 16:06 | - | |
| Headphone interference problem on hel80/ | 2022-03-28 16:06 | - | |
| Heat/ | 2022-03-28 16:06 | - | |
| Heat Problem - TV Tuner IFL90/ | 2022-03-28 16:06 | - | |
| Heat issues compal h80/ | 2022-03-28 16:06 | - | |
| Heat issues on my 6224, any tips and tricks are welcome!/ | 2022-03-28 16:06 | - | |
| Heat with Wireless card - 3150/ | 2022-03-28 16:06 | - | |
| Hel-80 Bios......died/ | 2022-03-28 16:06 | - | |
| Hel-80 Ethernet not working/ | 2022-03-28 16:06 | - | |
| Hel-80 GPU Temp/ | 2022-03-28 16:06 | - | |
| Hel-80 Mic Mic input Issues/ | 2022-03-28 16:06 | - | |
| Hel-80 acting wierd/ | 2022-03-28 16:06 | - | |
| Hel-80 ethernet card problem/ | 2022-03-28 16:06 | - | |
| Hel30 vs Hel80 battery life/ | 2022-03-28 16:06 | - | |
| Hel80 - Has Flashing broken my bios/ | 2022-03-28 16:06 | - | |
| Hel 80/ | 2022-03-28 16:06 | - | |
| Hel80 110v - 220v/ | 2022-03-28 16:06 | - | |
| Hel80 116b bios bootable image (vista ready)/ | 2022-03-28 16:06 | - | |
| Hel80 119b Bios has limited options strange/ | 2022-03-28 16:06 | - | |
| Hel 80 Backpack Sleeve and 9cell battery sizes/ | 2022-03-28 16:06 | - | |
| Hel80 Badgeing/ | 2022-03-28 16:06 | - | |
| Hel80 Battery Woes/ | 2022-03-28 16:06 | - | |
| Hel80 Bios Update/ | 2022-03-28 16:06 | - | |
| Hel80 Bluetooth/ | 2022-03-28 16:06 | - | |
| Hel 80 Cmos battery/ | 2022-03-28 16:06 | - | |
| Hel80 Core 2 Duo Freespire Linspire Problem/ | 2022-03-28 16:06 | - | |
| Hel80 External display fault/ | 2022-03-28 16:06 | - | |
| Hel80 Futureproof for new games/ | 2022-03-28 16:06 | - | |
| Hel80 MXM/ | 2022-03-28 16:06 | - | |
| Hel80 Memory Upgrading/ | 2022-03-28 16:06 | - | |
| Hel 80 No DVI/ | 2022-03-28 16:06 | - | |
| Hel 80 Owners Lounge/ | 2022-03-28 16:06 | - | |
| Hel80 Pci Flash Memory/ | 2022-03-28 16:06 | - | |
| Hel80 Screen Died in 1 year/ | 2022-03-28 16:06 | - | |
| Hel80 Trouble/ | 2022-03-28 16:06 | - | |
| Hel80 Tv-Tuner S-video input output issue/ | 2022-03-28 16:06 | - | |
| Hel80 VS Hgl30/ | 2022-03-28 16:06 | - | |
| Hel80 Vs Xps 1530/ | 2022-03-28 16:06 | - | |
| Hel80 Wsxga -(/ | 2022-03-28 16:06 | - | |
| Hel80 and Samsung DDR2 Memory/ | 2022-03-28 16:06 | - | |
| Hel 80 and bios dude/ | 2022-03-28 16:06 | - | |
| Hel 80 and linux/ | 2022-03-28 16:06 | - | |
| Hel80 doesn't fully support audigy 2 ZS notebook/ | 2022-03-28 16:06 | - | |
| Hel80 doesn't startup/ | 2022-03-28 16:06 | - | |
| Hel80 external speaker question/ | 2022-03-28 16:06 | - | |
| Hel80 get's black screen after Graphics driver uppdate/ | 2022-03-28 16:06 | - | |
| Hel80 guess what i found/ | 2022-03-28 16:06 | - | |
| Hel80 notebook sleeve/ | 2022-03-28 16:06 | - | |
| Hel80 or Asus S96j/ | 2022-03-28 16:06 | - | |
| Hel80 or Z96j/ | 2022-03-28 16:06 | - | |
| Hel80 or hgl30 in canada/ | 2022-03-28 16:06 | - | |
| Hel 80 overheat/ | 2022-03-28 16:06 | - | |
| Hel80 screens - Is yours like mine/ | 2022-03-28 16:06 | - | |
| Hel80 sound problem/ | 2022-03-28 16:06 | - | |
| Hel80 upgradeee/ | 2022-03-28 16:06 | - | |
| Hello! -)/ | 2022-03-28 16:06 | - | |
| Hello, new here - need help with BIOS/ | 2022-03-28 16:06 | - | |
| Hells Yeah!/ | 2022-03-28 16:06 | - | |
| Help!! Monitor start to flow/ | 2022-03-28 16:06 | - | |
| Help! - Need DVD Housing/ | 2022-03-28 16:06 | - | |
| Help! AV2260-EY1 BIOS dump needed/ | 2022-03-28 16:06 | - | |
| Help! How reliable is an UnitedMicro notebook/ | 2022-03-28 16:06 | - | |
| Help! New Zepto 6625WD Not Booting/ | 2022-03-28 16:06 | - | |
| Help! cant get my screen to resume after power down/ | 2022-03-28 16:06 | - | |
| Help, Laptop won't power on!/ | 2022-03-28 16:06 | - | |
| Help - FL90 Bios Corrupt!/ | 2022-03-28 16:06 | - | |
| Help - acessed to wireless but no internet connection/ | 2022-03-28 16:06 | - | |
| Help - another buying decision/ | 2022-03-28 16:06 | - | |
| Help HEL81 assembly/ | 2022-03-28 16:06 | - | |
| Help INS Key not working - IFL90 - Vista 32/ | 2022-03-28 16:06 | - | |
| Help Me Choose/ | 2022-03-28 16:06 | - | |
| Help Pc-m4000/ | 2022-03-28 16:06 | - | |
| Help Please/ | 2022-03-28 16:06 | - | |
| Help Quick Please, Errors With Nvidia Drivers/ | 2022-03-28 16:06 | - | |
| Help finding notebook name brand/ | 2022-03-28 16:06 | - | |
| Help finding review on HEL80/ | 2022-03-28 16:06 | - | |
| Help find notebook/ | 2022-03-28 16:06 | - | |
| Help in deciding between Hypersonic or Sager/ | 2022-03-28 16:06 | - | |
| Help me decide/ | 2022-03-28 16:06 | - | |
| Help me find/ | 2022-03-28 16:06 | - | |
| Help me identify this laptop/ | 2022-03-28 16:06 | - | |
| Help me open a Sharp Actius Al27/ | 2022-03-28 16:06 | - | |
| Help me to recognize this/ | 2022-03-28 16:06 | - | |
| Help me with a Korean Notebook !/ | 2022-03-28 16:06 | - | |
| Help needed identifying a possible IFL90/ | 2022-03-28 16:06 | - | |
| Help needed with broken key latch hgl30/ | 2022-03-28 16:06 | - | |
| Help please!!!!/ | 2022-03-28 16:06 | - | |
| Help please.......Brother Laptop!!/ | 2022-03-28 16:06 | - | |
| Help regarding purchase of 6625w/ | 2022-03-28 16:06 | - | |
| Help reseting the bios in a philips freevents x71/ | 2022-03-28 16:06 | - | |
| Help taking an Averatec C3500 apart to replace the fan/ | 2022-03-28 16:06 | - | |
| Help to change the CPU in 6324/ | 2022-03-28 16:06 | - | |
| Help us find shim-spacer-copper for the modification/ | 2022-03-28 16:06 | - | |
| Help w P1 Restore Disk/ | 2022-03-28 16:06 | - | |
| Help with OC'ing in Vista/ | 2022-03-28 16:06 | - | |
| Help with a few things/ | 2022-03-28 16:06 | - | |
| Help with fixing Everex XT5000T Laptop!/ | 2022-03-28 16:06 | - | |
| Help with keyboard on 3200 series/ | 2022-03-28 16:06 | - | |
| Help wtih PLUG/ | 2022-03-28 16:06 | - | |
| Here's some nice pics of the 1000/ | 2022-03-28 16:06 | - | |
| Hey Zepto, where's my laptop/ | 2022-03-28 16:06 | - | |
| Hgl-30 Bios/ | 2022-03-28 16:06 | - | |
| Hgl-30 Lcd/ | 2022-03-28 16:06 | - | |
| Hgl30 + 116a/ | 2022-03-28 16:06 | - | |
| Hgl30/ | 2022-03-28 16:06 | - | |
| Hi-Grade Model-VA250D/ | 2022-03-28 16:06 | - | |
| Hi-Grade R5400/ | 2022-03-28 16:06 | - | |
| Hibernate or Sleep My IFL90 goes chomatose/ | 2022-03-28 16:06 | - | |
| Hibernating the Zeptos/ | 2022-03-28 16:06 | - | |
| Hidden Partition on 1020-ED1, how to recover OS from DOS Bios/ | 2022-03-28 16:06 | - | |
| Hidden Screens in BIOS/ | 2022-03-28 16:06 | - | |
| Hidden connector question/ | 2022-03-28 16:06 | - | |
| High OCZ temps Need someone with same rig to confirm/ | 2022-03-28 16:06 | - | |
| High end laptop/ | 2022-03-28 16:06 | - | |
| High pitched screech/ | 2022-03-28 16:06 | - | |
| Hight temperatures on standby [PCS Recoil2 (TongFang GK5CN6Z)]/ | 2022-03-28 16:06 | - | |
| Hinge Repair/ | 2022-03-28 16:06 | - | |
| Hitachi 7200 60 gig HDD installed/ | 2022-03-28 16:06 | - | |
| Hitachi or Seagate for HEL80/ | 2022-03-28 16:06 | - | |
| Hmm Unknown fl90 on newegg/ | 2022-03-28 16:06 | - | |
| Hollywood64 Laptop/ | 2022-03-28 16:06 | - | |
| Horizental Scrolling JFL92/ | 2022-03-28 16:06 | - | |
| Horizontal band across screen-2150/ | 2022-03-28 16:06 | - | |
| Horrible Quality Control and RMA Process/ | 2022-03-28 16:06 | - | |
| Hot-Running HEL80/ | 2022-03-28 16:06 | - | |
| How Bright is Screen Compared to Other Laptops/ | 2022-03-28 16:06 | - | |
| How Can I Make A Recovery DVD CD for 4265/ | 2022-03-28 16:06 | - | |
| How Can I Open the 3200 Case/ | 2022-03-28 16:06 | - | |
| How Future proof is the hel80/ | 2022-03-28 16:06 | - | |
| How I can cool Down my HEL80/ | 2022-03-28 16:06 | - | |
| How I created a recovery DVD for averatec 3270/ | 2022-03-28 16:06 | - | |
| How Is Falcon Northwest/ | 2022-03-28 16:06 | - | |
| How Much better is the 3870 CF to the 9800 GTX solo/ | 2022-03-28 16:06 | - | |
| HowTo - Installing a second hard drive in a Compal NBLB2/ | 2022-03-28 16:06 | - | |
| How To Recell An Averatec 1000 Series Battery/ | 2022-03-28 16:06 | - | |
| How Will/ | 2022-03-28 16:06 | - | |
| How about a PowerPro J 10-15 (Compal IFL90) with WXGA+ (1440x900) Resolution...Vote for your favorite resolution on a 15.4 laptop/ | 2022-03-28 16:06 | - | |
| How are PortableOne Computers/ | 2022-03-28 16:06 | - | |
| How can I enable Intel-VT when the BIOS has no option for it/ | 2022-03-28 16:06 | - | |
| How can I see more options in the BIOS/ | 2022-03-28 16:06 | - | |
| Howcome nobody made a review of 6615/ | 2022-03-28 16:06 | - | |
| How convincing would you be/ | 2022-03-28 16:06 | - | |
| How do I disassemble the graphic card (Going for the oven trick!)/ | 2022-03-28 16:06 | - | |
| How do I get a Zepto if I live in the US/ | 2022-03-28 16:06 | - | |
| How do I start readyboost in vista with Hybrid HD/ | 2022-03-28 16:06 | - | |
| How does Whitebook compare with Macbook Pro 17/ | 2022-03-28 16:06 | - | |
| How does the 4-in-1 card reader work/ | 2022-03-28 16:06 | - | |
| How does the 6120 keyboard touchpad hold out/ | 2022-03-28 16:06 | - | |
| How does the cooling system in the OCZ compare to Sager/ | 2022-03-28 16:06 | - | |
| How do i update my bios/ | 2022-03-28 16:06 | - | |
| How do you change the voltage of the Rebranded M17/ | 2022-03-28 16:06 | - | |
| How do you clean keep your screen clean/ | 2022-03-28 16:06 | - | |
| How do you plan to configure your ram/ | 2022-03-28 16:06 | - | |
| How do you remove the cd-dvd drive/ | 2022-03-28 16:06 | - | |
| How easy it to replace the lcd in the FL90/ | 2022-03-28 16:06 | - | |
| How essential is OCing to game with this thing/ | 2022-03-28 16:06 | - | |
| How good is Averatec/ | 2022-03-28 16:06 | - | |
| How good is the chembook (COMPAL)/ | 2022-03-28 16:06 | - | |
| How hot do you get/ | 2022-03-28 16:06 | - | |
| How is CyberPower and anyone have the Zeusbook Edge x6/ | 2022-03-28 16:06 | - | |
| How is iBuyPower/ | 2022-03-28 16:06 | - | |
| How is the whitebook in actual gaming intensive programs/ | 2022-03-28 16:06 | - | |
| How is this hel-80/ | 2022-03-28 16:06 | - | |
| How long does Averatec take to repair/ | 2022-03-28 16:06 | - | |
| How long for 6324W/ | 2022-03-28 16:06 | - | |
| How long is the RMA process/ | 2022-03-28 16:06 | - | |
| How long should I wait/ | 2022-03-28 16:06 | - | |
| How many 2370s still in use/ | 2022-03-28 16:06 | - | |
| How many of you run Linux on your Compal/ | 2022-03-28 16:06 | - | |
| How much noise will the JHL90 make/ | 2022-03-28 16:06 | - | |
| How much ram-memory can you put in 6625WD/ | 2022-03-28 16:06 | - | |
| How much would you pay used HGL-30/ | 2022-03-28 16:06 | - | |
| How noisy is the HEL80/ | 2022-03-28 16:06 | - | |
| How often does Zepto revise its systems/ | 2022-03-28 16:06 | - | |
| How restore 3700 if can't boot/ | 2022-03-28 16:06 | - | |
| How should I remove a hard drive from an Archos 10 Laptop Model- R10-USR/ | 2022-03-28 16:06 | - | |
| How slow is the BIOS really/ | 2022-03-28 16:06 | - | |
| How thick should the silver be/ | 2022-03-28 16:06 | - | |
| Howto- Mac OS X on a Compal HEL-80/ | 2022-03-28 16:06 | - | |
| How to- Replace your broken (8600M GT) graphics card (in the [I]FL90)/ | 2022-03-28 16:06 | - | |
| How to OverClock past 8.10 driver/ | 2022-03-28 16:06 | - | |
| How to apply arctic silver on the averatec 2370/ | 2022-03-28 16:06 | - | |
| How to build a sub $1K HEL80/ | 2022-03-28 16:06 | - | |
| How to change CMOS battery on a 5428/ | 2022-03-28 16:06 | - | |
| How to change fan AV3260 with Sempron proc/ | 2022-03-28 16:06 | - | |
| How to contact Compal (Laptop is missing!)/ | 2022-03-28 16:06 | - | |
| How to control my Znote 15G fan speed/ | 2022-03-28 16:06 | - | |
| How to disable Hel80 touchpad/ | 2022-03-28 16:06 | - | |
| How to disassemble Zepto 6324W/ | 2022-03-28 16:06 | - | |
| How to flash bios on IFL90/ | 2022-03-28 16:06 | - | |
| How to flash your graphics card (Mobility 3870s)/ | 2022-03-28 16:06 | - | |
| How to increase frame rate from webcam/ | 2022-03-28 16:06 | - | |
| How to install OS from a clean laptop/ | 2022-03-28 16:06 | - | |
| How to install a hard drive/ | 2022-03-28 16:06 | - | |
| How to install new ATI Drivers/ | 2022-03-28 16:06 | - | |
| How to keep Vista retore points when dual booting Vista and XP/ | 2022-03-28 16:06 | - | |
| How to open close 6130/ | 2022-03-28 16:06 | - | |
| How to remove battery/ | 2022-03-28 16:06 | - | |
| How to remove case to upgrade ram/ | 2022-03-28 16:06 | - | |
| How to remove keyboard flex on HGL3X/ | 2022-03-28 16:06 | - | |
| How to remove motherboard/ | 2022-03-28 16:06 | - | |
| How to remove the White symbol on the OCZ Whitebook/ | 2022-03-28 16:06 | - | |
| How to replace memory on averatec 2100/ | 2022-03-28 16:06 | - | |
| How to save your broken GPU (Znote 6224w, but works for all brands and modells)/ | 2022-03-28 16:06 | - | |
| How to start from cd/ | 2022-03-28 16:06 | - | |
| How to start in safe mode/ | 2022-03-28 16:06 | - | |
| How to switch out your DVD drive for a Blu-Ray/ | 2022-03-28 16:06 | - | |
| How to take out the cd dvd burner in averatec model 5428/ | 2022-03-28 16:06 | - | |
| How to update bios for compal JFL92/ | 2022-03-28 16:06 | - | |
| How to update the BIOS of Fl90/ | 2022-03-28 16:06 | - | |
| How to update the harddrive on SHARP MC24/ | 2022-03-28 16:06 | - | |
| How to use the 2.0megapixel Video Camera and Function(Fn) List/ | 2022-03-28 16:06 | - | |
| How to use the DVD and Audio DJ Buttons on the HEL80/ | 2022-03-28 16:06 | - | |
| How useable is the Notus/ | 2022-03-28 16:06 | - | |
| How would the Basic Znote G14b perform/ | 2022-03-28 16:06 | - | |
| Huawei/ | 2022-03-28 16:06 | - | |
| Huawei Honor MagicBook Pro 16.1/ | 2022-03-28 16:06 | - | |
| Huawei MateBook 13/ | 2022-03-28 16:06 | - | |
| Huawei Matebook D 2020 (AMD) Owners Lounge/ | 2022-03-28 16:06 | - | |
| Huawei Matebook D fingerprint sensor/ | 2022-03-28 16:06 | - | |
| Huawei Matebook X/ | 2022-03-28 16:06 | - | |
| Huh HGL30 Battery screwed already/ | 2022-03-28 16:06 | - | |
| Hupersonic vs Sager/ | 2022-03-28 16:06 | - | |
| Hybrid 5200rpm vs 7200rpm review !/ | 2022-03-28 16:06 | - | |
| Hybrid or not/ | 2022-03-28 16:06 | - | |
| HyperData Laptop 900X/ | 2022-03-28 16:06 | - | |
| Hypersonic AX2/ | 2022-03-28 16:06 | - | |
| Hypersonic AX7/ | 2022-03-28 16:06 | - | |
| Hypersonic Aviator EX7 Nightmare/ | 2022-03-28 16:06 | - | |
| Hypersonic Aviator GX7/ | 2022-03-28 16:06 | - | |
| Hypersonic Aviator Laptop/ | 2022-03-28 16:06 | - | |
| Hypersonic CX7 vs. MV7/ | 2022-03-28 16:06 | - | |
| Hypersonic Followup (If yer lookin at Hypersonic, read this)/ | 2022-03-28 16:06 | - | |
| Hypersonic Notebooks/ | 2022-03-28 16:06 | - | |
| Hypersonic Sr-7 R2 WTF/ | 2022-03-28 16:06 | - | |
| Hypersonic Sr5 same as Compal IFL 90/ | 2022-03-28 16:06 | - | |
| Hypersonic w GeForce 6800 Go Ultra/ | 2022-03-28 16:06 | - | |
| I'm looking for a Zepto-thread/ | 2022-03-28 16:07 | - | |
| I'm still having heat problems on my 6214W/ | 2022-03-28 16:07 | - | |
| I'm very close of buying a HEL80, just couple more question/ | 2022-03-28 16:07 | - | |
| I've given up/ | 2022-03-28 16:07 | - | |
| I've got my compal/ | 2022-03-28 16:07 | - | |
| IBP Battalion 101 CLX good or bad/ | 2022-03-28 16:07 | - | |
| IBP CZ-17 Motherboard In Need Of Replacement/ | 2022-03-28 16:07 | - | |
| I BUY POWER, has anyone heard of it/ | 2022-03-28 16:06 | - | |
| IBuyPower Battalion 101 SL/ | 2022-03-28 16:07 | - | |
| I Buy Power notebook question/ | 2022-03-28 16:06 | - | |
| IC Power and Warranty/ | 2022-03-28 16:07 | - | |
| I Did It!/ | 2022-03-28 16:06 | - | |
| IFL-90 & digital audio out/ | 2022-03-28 16:07 | - | |
| IFL-90, BIOS no longer detects DVD drive/ | 2022-03-28 16:07 | - | |
| IFL-90 - Which Drivers ... 030 Intel/ | 2022-03-28 16:07 | - | |
| IFL-90 Assembly-issue/ | 2022-03-28 16:07 | - | |
| IFL-90 Ram problem/ | 2022-03-28 16:07 | - | |
| IFL-90S from zipzoomfly pics/ | 2022-03-28 16:07 | - | |
| IFL-90 USB device in and out/ | 2022-03-28 16:07 | - | |
| IFL90's sound codec + Skype = BSoD/ | 2022-03-28 16:07 | - | |
| IFL90 (semi)mini-review/ | 2022-03-28 16:07 | - | |
| IFL90 (winxp) - black screen after a while/ | 2022-03-28 16:07 | - | |
| IFL90+ Radeon 4650 upgrade problem/ | 2022-03-28 16:07 | - | |
| IFL90+ Touchsensitive buttons don't work/ | 2022-03-28 16:07 | - | |
| IFL 90 + Windows 7 = Smart battery not working/ | 2022-03-28 16:07 | - | |
| IFL90, good or bad/ | 2022-03-28 16:07 | - | |
| IFL90, where to buy from/ | 2022-03-28 16:07 | - | |
| IFL90 - 90W not enough/ | 2022-03-28 16:07 | - | |
| IFL90- Blue Screen Of death/ | 2022-03-28 16:07 | - | |
| IFL90 - Buy a keyboard/ | 2022-03-28 16:07 | - | |
| IFL90 - Disabling eHome CIR transciever/ | 2022-03-28 16:07 | - | |
| IFL90 - Headphone jack not working/ | 2022-03-28 16:07 | - | |
| IFL90- Issue with Wow Video Audio buttons/ | 2022-03-28 16:07 | - | |
| IFL90 - Lack of LCD latches/ | 2022-03-28 16:07 | - | |
| IFL90 - Not reading as Dual Core/ | 2022-03-28 16:07 | - | |
| IFL90 - Standy issue/ | 2022-03-28 16:07 | - | |
| IFL90 - Vista Ultimate 32 - Device Unknow E0100 Error/ | 2022-03-28 16:07 | - | |
| IFL90 - WXGA vs. WSXGA+/ | 2022-03-28 16:07 | - | |
| IFL 90- What tools you use for checking temperatures/ | 2022-03-28 16:07 | - | |
| IFL90- Which video mem 256 or 512mb to buy/ | 2022-03-28 16:07 | - | |
| IFL90 - freezing problem/ | 2022-03-28 16:07 | - | |
| IFL90- i have mine/ | 2022-03-28 16:07 | - | |
| IFL90 - strange problem - won't shut down/ | 2022-03-28 16:07 | - | |
| IFL90 - which screen resolution do I want/ | 2022-03-28 16:07 | - | |
| IFL90. GeForce 8600M died. How do I update with a Radeon HD 3650/ | 2022-03-28 16:07 | - | |
| IFL90 3DMark Scores/ | 2022-03-28 16:07 | - | |
| IFL90 9cell vs 6cell batteries/ | 2022-03-28 16:07 | - | |
| IFL90 112 Bios/ | 2022-03-28 16:07 | - | |
| IFL90 1440x900 Glossy Screen Problem/ | 2022-03-28 16:07 | - | |
| IFL90 8600m GT temperature when running BioShock/ | 2022-03-28 16:07 | - | |
| IFL90 Availability/ | 2022-03-28 16:07 | - | |
| IFL90 BIOS Driver/ | 2022-03-28 16:07 | - | |
| IFL90 BIOS problem/ | 2022-03-28 16:07 | - | |
| IFL90 Battery Questions/ | 2022-03-28 16:07 | - | |
| IFL90 Biometric Fingerprint Scanner/ | 2022-03-28 16:07 | - | |
| IFL90 Bios 1.13 is out/ | 2022-03-28 16:07 | - | |
| IFL90 Bios 1.16/ | 2022-03-28 16:07 | - | |
| IFL 90 Black (blank) screen. Gpu or BIOS/ | 2022-03-28 16:07 | - | |
| IFL90 Bluetooth after the fact/ | 2022-03-28 16:07 | - | |
| IFL90 Bluetooth problem/ | 2022-03-28 16:07 | - | |
| IFL90 Built-in Webcam Help/ | 2022-03-28 16:07 | - | |
| IFL90 CPU Temperature issues/ | 2022-03-28 16:07 | - | |
| IFL90 Card Reader/ | 2022-03-28 16:07 | - | |
| IFL90 Chipset drivers/ | 2022-03-28 16:07 | - | |
| IFL90 DDR2 vs. DDR3 benches/ | 2022-03-28 16:07 | - | |
| IFL90 DVD Driver Fireware/ | 2022-03-28 16:07 | - | |
| IFL90 Disable Touchpad/ | 2022-03-28 16:07 | - | |
| IFL90 Downgrade Vista to Xp!/ | 2022-03-28 16:07 | - | |
| IFL90 Driver/ | 2022-03-28 16:07 | - | |
| IFL90 First Run Problem/ | 2022-03-28 16:07 | - | |
| IFL90 Flash to 1.18 problem/ | 2022-03-28 16:07 | - | |
| IFL90 Graphics Card Resource Problem/ | 2022-03-28 16:07 | - | |
| IFL90 Greens Screen/ | 2022-03-28 16:07 | - | |
| IFL90 How to protection against spills/ | 2022-03-28 16:07 | - | |
| IFL90 Keyboard not working/ | 2022-03-28 16:07 | - | |
| IFL90 Lid/ | 2022-03-28 16:07 | - | |
| IFL90 Low Vista Performance Scores/ | 2022-03-28 16:07 | - | |
| IFL90 Microphone Help/ | 2022-03-28 16:07 | - | |
| IFL90 Model/ | 2022-03-28 16:07 | - | |
| IFL90 NP2090 screen won't turn on/ | 2022-03-28 16:07 | - | |
| IFL90 No DVI Out/ | 2022-03-28 16:07 | - | |
| IFL90 Noise/ | 2022-03-28 16:07 | - | |
| IFL90 Not Nforce2 or later/ | 2022-03-28 16:07 | - | |
| IFL90 Overheating/ | 2022-03-28 16:07 | - | |
| IFL90 Power Issue/ | 2022-03-28 16:07 | - | |
| IFL 90 Problem/ | 2022-03-28 16:07 | - | |
| IFL90 Replacement Battery/ | 2022-03-28 16:07 | - | |
| IFL 90 Replacement System Fan/ | 2022-03-28 16:07 | - | |
| IFL90 Sager 2090 graphics problem- software or hardware/ | 2022-03-28 16:07 | - | |
| IFL90 Scored!/ | 2022-03-28 16:07 | - | |
| IFL90 Screen/ | 2022-03-28 16:07 | - | |
| IFL90 Screen Problem/ | 2022-03-28 16:07 | - | |
| IFL90 Screen Resolution Question - Vendors/ | 2022-03-28 16:07 | - | |
| IFL90 Small Shipment Just Arrived/ | 2022-03-28 16:07 | - | |
| IFL90 Smart Charge Drivers/ | 2022-03-28 16:07 | - | |
| IFL90 Still stronger than competition/ | 2022-03-28 16:07 | - | |
| IFL90 TV card cables and connectors/ | 2022-03-28 16:07 | - | |
| IFL90 TV tuner/ | 2022-03-28 16:07 | - | |
| IFL90 Temps and Processes/ | 2022-03-28 16:07 | - | |
| IFL90 Through powernotebooks/ | 2022-03-28 16:07 | - | |
| IFL90 Turbo Memory/ | 2022-03-28 16:07 | - | |
| IFL90 USB Power Q-Charging Buttons/ | 2022-03-28 16:07 | - | |
| IFL 90 USB Problems/ | 2022-03-28 16:07 | - | |
| IFL90 VBios flash/ | 2022-03-28 16:07 | - | |
| IFL90 Video App/ | 2022-03-28 16:07 | - | |
| IFL90 WSXGA+ matte screen replacement/ | 2022-03-28 16:07 | - | |
| IFL90 Will NOT Boot with 2 x 2Gb Sticks of RAM/ | 2022-03-28 16:07 | - | |
| IFL90 WinXP problem/ | 2022-03-28 16:07 | - | |
| IFL90 XP Card reader working fine with SDHC/ | 2022-03-28 16:07 | - | |
| IFL90 adapter question, need quick response/ | 2022-03-28 16:07 | - | |
| IFL 90 alternatives/ | 2022-03-28 16:07 | - | |
| IFL90 and IFT00 in Canada/ | 2022-03-28 16:07 | - | |
| IFL90 and SATA2/ | 2022-03-28 16:07 | - | |
| IFL 90 and linux/ | 2022-03-28 16:07 | - | |
| IFL90 audio and Windows XP/ | 2022-03-28 16:07 | - | |
| IFL90 audio dropouts crackles when dj-ing/ | 2022-03-28 16:07 | - | |
| IFL90 battery life/ | 2022-03-28 16:07 | - | |
| IFL90 bios 1.11 or older/ | 2022-03-28 16:07 | - | |
| IFL90 booting problem/ | 2022-03-28 16:07 | - | |
| IFL90 button rebinding question/ | 2022-03-28 16:07 | - | |
| IFL90 cannot pass MemTest86+ and Prime95 test/ | 2022-03-28 16:07 | - | |
| IFL90 cant overclock GPU/ | 2022-03-28 16:07 | - | |
| IFL90 charging problems/ | 2022-03-28 16:07 | - | |
| IFL 90 drivers/ | 2022-03-28 16:07 | - | |
| IFL90 drivers location/ | 2022-03-28 16:07 | - | |
| IFL90 fn keys not working right/ | 2022-03-28 16:07 | - | |
| IFL90 graphics card problem/ | 2022-03-28 16:07 | - | |
| IFL90 hard drive speed. 5400 vs. 7200/ | 2022-03-28 16:07 | - | |
| IFL90 hi-res images/ | 2022-03-28 16:07 | - | |
| IFL90 idle temperatures/ | 2022-03-28 16:07 | - | |
| IFL90 impresions (Forcebook Dynamic)/ | 2022-03-28 16:07 | - | |
| IFL90 in Canada/ | 2022-03-28 16:07 | - | |
| IFL90 in the UK/ | 2022-03-28 16:07 | - | |
| IFL90 keyboard/ | 2022-03-28 16:07 | - | |
| IFL90 line out high pitched sound/ | 2022-03-28 16:07 | - | |
| IFL90 nic failure problem solved!/ | 2022-03-28 16:07 | - | |
| IFL90 not charging and battery not working/ | 2022-03-28 16:07 | - | |
| IFL90 now spontaneously shuts down. How to troubleshoot/ | 2022-03-28 16:07 | - | |
| IFL90 only powers on for about 60 seconds/ | 2022-03-28 16:07 | - | |
| IFL90 or JFL92/ | 2022-03-28 16:07 | - | |
| IFL90 or SAGER 2090 ...dvi or hdmi/ | 2022-03-28 16:07 | - | |
| IFL90 part numbers (8600M GT)/ | 2022-03-28 16:07 | - | |
| IFL90 quality/ | 2022-03-28 16:07 | - | |
| IFL90 resolution- 1280x800 vs. 1600x1200/ | 2022-03-28 16:07 | - | |
| IFL 90 screen problems/ | 2022-03-28 16:07 | - | |
| IFL90 screen sometimes lag shutter when viewing AVI/ | 2022-03-28 16:07 | - | |
| IFL90 shipped!/ | 2022-03-28 16:07 | - | |
| IFL90 slow to resume/ | 2022-03-28 16:07 | - | |
| IFL90 smart battery issue/ | 2022-03-28 16:07 | - | |
| IFL90 spillproof and tv connect/ | 2022-03-28 16:07 | - | |
| IFL90 too hot/ | 2022-03-28 16:07 | - | |
| IFL90 top buttons and S-VIDEO USB buttons/ | 2022-03-28 16:07 | - | |
| IFL90 turns on and only shows a white screen/ | 2022-03-28 16:07 | - | |
| IFL90 videocard driver for vista/ | 2022-03-28 16:07 | - | |
| IFL90 vs. G1s/ | 2022-03-28 16:07 | - | |
| IFL90 vs HEL80 Keyboard/ | 2022-03-28 16:07 | - | |
| IFL90 vs HEL80 vs S96J- What is best for me/ | 2022-03-28 16:07 | - | |
| IFL90 webcam or fingerprint reader pinout/ | 2022-03-28 16:07 | - | |
| IFL 90 with 2GB Intel Turbo memory/ | 2022-03-28 16:07 | - | |
| IFL90 working as a GPS/ | 2022-03-28 16:07 | - | |
| IFL90 works with Core 2 Extreme/ | 2022-03-28 16:07 | - | |
| IFL91 Bios Recovery(i have bad flash)/ | 2022-03-28 16:07 | - | |
| IFL91 C-States C3 C4/ | 2022-03-28 16:07 | - | |
| IFL92 Touchpad Driver Question/ | 2022-03-28 16:07 | - | |
| IFL 8600M GT Issue (or not)/ | 2022-03-28 16:07 | - | |
| IFL IFTx panel quality/ | 2022-03-28 16:07 | - | |
| IFL No Power Issue/ | 2022-03-28 16:07 | - | |
| IFT0x and wxga+/ | 2022-03-28 16:07 | - | |
| IFT00 - preorder in the Netherlands/ | 2022-03-28 16:07 | - | |
| IFT00 bios 1.18 - replace 8600gt/ | 2022-03-28 16:07 | - | |
| IFT00 has 8400m GS w 256mb/ | 2022-03-28 16:07 | - | |
| IFT00 info/ | 2022-03-28 16:07 | - | |
| IFT00 opinions/ | 2022-03-28 16:07 | - | |
| IFl90 drivers for Vista Ultimate 64bit/ | 2022-03-28 16:07 | - | |
| ILF90 and BIOS upgrading/ | 2022-03-28 16:07 | - | |
| IPS vs.FHD... Which Should I Get/ | 2022-03-28 16:07 | - | |
| ISTNC Clevo M570A/ | 2022-03-28 16:07 | - | |
| ITC Millenia 6450 ITBOX E355/ | 2022-03-28 16:07 | - | |
| ITC Millenium/ | 2022-03-28 16:07 | - | |
| ITRONIX GoBook 2 II IX260/ | 2022-03-28 16:07 | - | |
| I also have an overheating problem on a compal FL92/ | 2022-03-28 16:06 | - | |
| I am a moron!/ | 2022-03-28 16:06 | - | |
| I am looking for Zepto Zenote 6224W spare parts/ | 2022-03-28 16:06 | - | |
| Ibuypower.com/ | 2022-03-28 16:07 | - | |
| Ibuypower.com Hel80 (Battalion)/ | 2022-03-28 16:07 | - | |
| Ibuypower/ | 2022-03-28 16:07 | - | |
| Ibuypower notebooks/ | 2022-03-28 16:07 | - | |
| I can't find a solution anywhere, modem won't let go, 6100 series/ | 2022-03-28 16:06 | - | |
| Identify Zepto model/ | 2022-03-28 16:07 | - | |
| I desperately need a battery for my 6214w - is this site legit/ | 2022-03-28 16:06 | - | |
| I did it bought a MX A8JS/ | 2022-03-28 16:06 | - | |
| I didn't buy an Alienware, but/ | 2022-03-28 16:06 | - | |
| Idle temperatures on HEL80/ | 2022-03-28 16:07 | - | |
| I don't get it (6615WD and Vista)/ | 2022-03-28 16:06 | - | |
| If for some reason you want your computer closed, but still running/ | 2022-03-28 16:07 | - | |
| I finally picked a laptop/ | 2022-03-28 16:06 | - | |
| Ifl-90 keyboard question/ | 2022-03-28 16:07 | - | |
| Ifl90 & Nhc/ | 2022-03-28 16:07 | - | |
| Ifl90 & Nvidia Game Issue/ | 2022-03-28 16:07 | - | |
| Ifl90 + 8800gt Gtx/ | 2022-03-28 16:07 | - | |
| Ifl90/ | 2022-03-28 16:07 | - | |
| Ifl90 Ir/ | 2022-03-28 16:07 | - | |
| Ifl90 Pcmcia/ | 2022-03-28 16:07 | - | |
| Ifl90 Review/ | 2022-03-28 16:07 | - | |
| Ifl90 replacement touchpad buttons (sager 2090)/ | 2022-03-28 16:07 | - | |
| Ifl91/ | 2022-03-28 16:07 | - | |
| Ifl91 problems with my WiFi Link 4965AGN/ | 2022-03-28 16:07 | - | |
| Ifl9025!!!/ | 2022-03-28 16:07 | - | |
| Ift00 Gpu/ | 2022-03-28 16:07 | - | |
| If you absolutely, positively need an IEEE 1394 Port on the HGL30...Here you go!/ | 2022-03-28 16:07 | - | |
| If you could get the PowerPro J 10-15 (Compal IFL90) WSXGA+ with either Matte or Glossy screen, which would you prefer/ | 2022-03-28 16:07 | - | |
| If you want an AW, read here/ | 2022-03-28 16:07 | - | |
| If you want the m17 go here, better price/ | 2022-03-28 16:07 | - | |
| I have a few questions regarding the Averatec 5400/ | 2022-03-28 16:06 | - | |
| I have a problem with the Hypersonic laptop's LCD/ | 2022-03-28 16:07 | - | |
| Illegear Laguna/ | 2022-03-28 16:07 | - | |
| Illegear Q5 EVO/ | 2022-03-28 16:07 | - | |
| Im Getting Strange Lines On MY 6130HS/ | 2022-03-28 16:07 | - | |
| Im a member of the club now -)/ | 2022-03-28 16:07 | - | |
| Important Zepto annoucement regarding CPU in 14 notebooks/ | 2022-03-28 16:07 | - | |
| Importing the Zepto 6324W/ | 2022-03-28 16:07 | - | |
| Import tax in Canada-/ | 2022-03-28 16:07 | - | |
| Impressions - Compal IFL90 (Sager 2090)/ | 2022-03-28 16:07 | - | |
| Impressions/ | 2022-03-28 16:07 | - | |
| Improve 237x GPU cooling/ | 2022-03-28 16:07 | - | |
| Improvement suggestion to Zepto/ | 2022-03-28 16:07 | - | |
| Impudent Danish Scoundrals!!!!!!!!!!!!!!!!/ | 2022-03-28 16:07 | - | |
| In Need of Help! HGL-30/ | 2022-03-28 16:07 | - | |
| In case i dont sell my 4850/ | 2022-03-28 16:07 | - | |
| Inconsistant pricing - what january sale/ | 2022-03-28 16:07 | - | |
| Incorrect time after shutdown/ | 2022-03-28 16:07 | - | |
| Increasing battery life through underclocking/ | 2022-03-28 16:07 | - | |
| Indoor vs. Outdoor Screens on P1 Models/ | 2022-03-28 16:07 | - | |
| I need a copy of BenQ erecovery, i do not care about the model/ | 2022-03-28 16:07 | - | |
| I need a dissambly guide for 2300 series/ | 2022-03-28 16:07 | - | |
| I need a new battery (6224W)/ | 2022-03-28 16:07 | - | |
| I need a restore disk for a 2370/ | 2022-03-28 16:07 | - | |
| I need help/ | 2022-03-28 16:07 | - | |
| I need help with my old Zepto FW91(Titan A15)/ | 2022-03-28 16:07 | - | |
| I need linux driver for KN1 notebook/ | 2022-03-28 16:07 | - | |
| I need the Everex R109 Bios/ | 2022-03-28 16:07 | - | |
| I need the working video card driver/ | 2022-03-28 16:07 | - | |
| I need this notebook, now/ | 2022-03-28 16:07 | - | |
| I need to source 12V from my Compal HEL80/ | 2022-03-28 16:07 | - | |
| Infinity F20/ | 2022-03-28 16:07 | - | |
| Infinity Gaming Notebook/ | 2022-03-28 16:07 | - | |
| Infinity Laptops/ | 2022-03-28 16:07 | - | |
| Info bout Zepto/ | 2022-03-28 16:07 | - | |
| Info on Compal-Related Website/ | 2022-03-28 16:07 | - | |
| Information on the TrioLCD Transflective display/ | 2022-03-28 16:07 | - | |
| Information regarding 6625WD and 6224W Barebones delivery/ | 2022-03-28 16:07 | - | |
| Infra-red remote control for Zepto notebooks/ | 2022-03-28 16:07 | - | |
| Infra Red at 2092/ | 2022-03-28 16:07 | - | |
| Infrared on 6625wd/ | 2022-03-28 16:07 | - | |
| Inhon Blade 13 Carbon/ | 2022-03-28 16:07 | - | |
| Inside a 6130/ | 2022-03-28 16:07 | - | |
| Inspice Trace & Recovery w Data Protection/ | 2022-03-28 16:07 | - | |
| Installin WLAN/ | 2022-03-28 16:07 | - | |
| Installing Intel 5300 in OCZ DIY 17/ | 2022-03-28 16:07 | - | |
| Installing Ubuntu on my Zepto Znote/ | 2022-03-28 16:07 | - | |
| Installing Vista on HEL80 Bios and Drivers/ | 2022-03-28 16:07 | - | |
| Installing XP on Zepto Nox A15/ | 2022-03-28 16:07 | - | |
| Integrated Microphone/ | 2022-03-28 16:07 | - | |
| Integrated Webcam for EL81/ | 2022-03-28 16:07 | - | |
| Integrated webcam/ | 2022-03-28 16:07 | - | |
| Intel-TongFang QC7 (Element Fusion 15 MAG-15 Vapor 15 Pro)/ | 2022-03-28 16:07 | - | |
| Intel 54Mbit or Zepto 300Mbit/ | 2022-03-28 16:07 | - | |
| Intel 4965agn BSOD/ | 2022-03-28 16:07 | - | |
| Intel Core Extreme processor on IFL90/ | 2022-03-28 16:07 | - | |
| Intel Core Processor/ | 2022-03-28 16:07 | - | |
| IntelGMA folder on 6625/ | 2022-03-28 16:07 | - | |
| Intel GMA on 6625WD/ | 2022-03-28 16:07 | - | |
| Intel Merom Core 2 Duo will hit Distributors shelves on August 28th/ | 2022-03-28 16:07 | - | |
| Intel Next Generation Wireless N update/ | 2022-03-28 16:07 | - | |
| Intel Notebook Modding Competition/ | 2022-03-28 16:07 | - | |
| Intel PM45 SATA drivers needed (Mythos Nox A15)/ | 2022-03-28 16:07 | - | |
| Intel PRO Wireless 2915 removable/ | 2022-03-28 16:07 | - | |
| Intel PRO Wireless 4965 dropping signal/ | 2022-03-28 16:07 | - | |
| Intel Thermal Analysis Tool/ | 2022-03-28 16:07 | - | |
| Intel Turbo Memory (Robson)/ | 2022-03-28 16:07 | - | |
| Intel Turbo Memory/ | 2022-03-28 16:07 | - | |
| Intel Turbo Memory and Photoshop/ | 2022-03-28 16:07 | - | |
| Intel Turbo Memory and Samsung Hybrid at the same time/ | 2022-03-28 16:07 | - | |
| Intel Turbo Memory driver update advantage/ | 2022-03-28 16:07 | - | |
| Intel Turbomemory/ | 2022-03-28 16:07 | - | |
| Intel WiFi Link 5300 on IFL-90 (device cannot start error 10)/ | 2022-03-28 16:07 | - | |
| Intel WiFi Link 5300 on IFL-90/ | 2022-03-28 16:07 | - | |
| Interested in the IFL90/ | 2022-03-28 16:07 | - | |
| Interested in the IFL90 and have a few questions/ | 2022-03-28 16:07 | - | |
| Interesting Marks!/ | 2022-03-28 16:07 | - | |
| Interesting info for Quanta (MW1A B) owners/ | 2022-03-28 16:07 | - | |
| Interesting news on Compal/ | 2022-03-28 16:07 | - | |
| Internal 3G module - Notus A12/ | 2022-03-28 16:07 | - | |
| International Clevo Sager resellers/ | 2022-03-28 16:07 | - | |
| International Support/ | 2022-03-28 16:07 | - | |
| Internet Security Software on HEL80/ | 2022-03-28 16:07 | - | |
| Internet iShop/ | 2022-03-28 16:07 | - | |
| Internet issue/ | 2022-03-28 16:07 | - | |
| Interrupt key for zepto znote 6615wd notebook/ | 2022-03-28 16:07 | - | |
| Inventec and inventec W15. Question/ | 2022-03-28 16:07 | - | |
| I really like my new Hel80/ | 2022-03-28 16:07 | - | |
| Is Averatec notebook reliable/ | 2022-03-28 16:07 | - | |
| Is Compal IFL90 still a good buy/ | 2022-03-28 16:07 | - | |
| Is Compal IFT00 MXM Compatible/ | 2022-03-28 16:07 | - | |
| Is Compal going to update something, sometime/ | 2022-03-28 16:07 | - | |
| Is Dospara Prime Note buyable outside Japan/ | 2022-03-28 16:07 | - | |
| Is Hel-80 power jack on motherboard or separate part/ | 2022-03-28 16:07 | - | |
| Is IFL 90 with glossy 1400x1050 coming/ | 2022-03-28 16:07 | - | |
| Is INTERNETISHOP any good/ | 2022-03-28 16:07 | - | |
| Is OCZ Whitebook HDMI the 1.3 version/ | 2022-03-28 16:07 | - | |
| Is Robson included in 6625 or 6224/ | 2022-03-28 16:07 | - | |
| Is a hybrid harddrive worth it/ | 2022-03-28 16:07 | - | |
| Is anyone familliar with a MaxPac portable workstation/ | 2022-03-28 16:07 | - | |
| Is averatec stable here/ | 2022-03-28 16:07 | - | |
| Is it better to have 2, 3, or 4GB on Vista 32-bit/ | 2022-03-28 16:07 | - | |
| Is it good bye/ | 2022-03-28 16:07 | - | |
| Is it me or what/ | 2022-03-28 16:07 | - | |
| Is it possible to change Intel 5100 to an Atheros in JHL90/ | 2022-03-28 16:07 | - | |
| Is it possible to overclock the cpu and gpu of my fl90/ | 2022-03-28 16:07 | - | |
| Is it possible to record a second monitor/ | 2022-03-28 16:07 | - | |
| Is it possible to upgrade my GPU/ | 2022-03-28 16:07 | - | |
| Is it possible to upgrade the CPU on a FL90 on your own/ | 2022-03-28 16:07 | - | |
| Is it possible to use a FL90's screen for a PS2/ | 2022-03-28 16:07 | - | |
| Is it safe to disable ACPI in the Bios/ | 2022-03-28 16:07 | - | |
| Is mech-15 g2 worth it/ | 2022-03-28 16:07 | - | |
| Is my GPU history/ | 2022-03-28 16:07 | - | |
| Is my Zepto is working fine/ | 2022-03-28 16:07 | - | |
| Is new nvidia Dynamic Boost same as Eluktroboost/ | 2022-03-28 16:07 | - | |
| Issues connecting to the internet/ | 2022-03-28 16:07 | - | |
| Issue with 6128H1-01, SP2 and modem/ | 2022-03-28 16:07 | - | |
| Issue with Nvidia780M on GT70/ | 2022-03-28 16:07 | - | |
| Issue with Zepto DVD Drive/ | 2022-03-28 16:07 | - | |
| Issue with fingerprint reader/ | 2022-03-28 16:07 | - | |
| Is the 3270 a 754-pin socket/ | 2022-03-28 16:07 | - | |
| Is the Dell 1701 a Compal/ | 2022-03-28 16:07 | - | |
| Is the IFL90 bios used for JFL92/ | 2022-03-28 16:07 | - | |
| Is the Intel 4965AGN wireless card compatible with the HEL80/ | 2022-03-28 16:07 | - | |
| Is the Origin EON17 or 18 any good/ | 2022-03-28 16:07 | - | |
| Is the Whitebook painted or resin coated/ | 2022-03-28 16:07 | - | |
| Is the Znote 3415W noisy/ | 2022-03-28 16:07 | - | |
| Is the max memory in the UX 4GB/ | 2022-03-28 16:07 | - | |
| Is the novacustom seller trustworthy/ | 2022-03-28 16:07 | - | |
| Is there ANY way to drive 2560x1600 resolution/ | 2022-03-28 16:07 | - | |
| Is there a better driver for IFL-90's Toucpad/ | 2022-03-28 16:07 | - | |
| Is there a built in Tv Card/ | 2022-03-28 16:07 | - | |
| Is there a laptop brand called Hasee/ | 2022-03-28 16:07 | - | |
| Is there an ODM PDF build manual for the HGL30/ | 2022-03-28 16:07 | - | |
| Is there an updated list of what cpu's work in the W840/ | 2022-03-28 16:07 | - | |
| Is there any compal notebooks that I can purchase with a 512mb video card/ | 2022-03-28 16:07 | - | |
| Is there any explanation as to why Zepto uses a bluetooth device using the BlueSoleil software/ | 2022-03-28 16:07 | - | |
| Is there any way to update the RAID bios/ | 2022-03-28 16:07 | - | |
| Is the world ready for 64-bit technology/ | 2022-03-28 16:07 | - | |
| Is this 4650 gonna work on my compal FL90/ | 2022-03-28 16:07 | - | |
| Is this a Clevo/ | 2022-03-28 16:07 | - | |
| Is this a Compal Picture inside/ | 2022-03-28 16:07 | - | |
| Is this a good deal/ | 2022-03-28 16:07 | - | |
| Is this a problem or a review error Xiaomi mi 13/ | 2022-03-28 16:07 | - | |
| Is this right (concerning info. about delivery)/ | 2022-03-28 16:07 | - | |
| Is this the new flextronic whitebook distributer/ | 2022-03-28 16:07 | - | |
| Is zepto avoiding support/ | 2022-03-28 16:07 | - | |
| It's so affordable! What's the catch/ | 2022-03-28 16:07 | - | |
| I think I've decided on the Nagamaki from K N/ | 2022-03-28 16:07 | - | |
| I too have my Compal/ | 2022-03-28 16:07 | - | |
| I took apart my HGL30/ | 2022-03-28 16:07 | - | |
| Itronix/ | 2022-03-28 16:07 | - | |
| Itronix General Dynamix VR-1 CPU/ | 2022-03-28 16:07 | - | |
| Itronix GoBook II/ | 2022-03-28 16:07 | - | |
| Itronix GoBook III (IX260+) 190 bios driver help for dowmload/ | 2022-03-28 16:07 | - | |
| Itronix Gobook 2 IX260/ | 2022-03-28 16:07 | - | |
| Itronix XR-1 IX270 rugged laptop bluetooth adapter/ | 2022-03-28 16:07 | - | |
| Itronix ix350 battery/ | 2022-03-28 16:07 | - | |
| Its Still Going Back/ | 2022-03-28 16:07 | - | |
| Ivang, I need help!/ | 2022-03-28 16:07 | - | |
| I want to buy hgl30 but I live in Canada -(/ | 2022-03-28 16:07 | - | |
| I wish had never bought a Zepto/ | 2022-03-28 16:07 | - | |
| I would like to order from Portable One but/ | 2022-03-28 16:07 | - | |
| JASQ about cooling pads and thermal grease - FL90/ | 2022-03-28 16:07 | - | |
| JFL92 , Is it able to run T7500 7700 or older chipset 965/ | 2022-03-28 16:07 | - | |
| JFL92 - Really Weird Annoying Audio/ | 2022-03-28 16:07 | - | |
| JFL92- can't activate wireless/ | 2022-03-28 16:07 | - | |
| JFL92 BIOS Help/ | 2022-03-28 16:07 | - | |
| JFL92 Driver site/ | 2022-03-28 16:07 | - | |
| JFL92 Questions/ | 2022-03-28 16:07 | - | |
| JFL92 Sager NP2092 Build Quality/ | 2022-03-28 16:07 | - | |
| JFL92 and Ubuntu 8.04, huge problem out of the box/ | 2022-03-28 16:07 | - | |
| JFL92 black screen Any ideas for a fix/ | 2022-03-28 16:07 | - | |
| JFL92 for audio production/ | 2022-03-28 16:07 | - | |
| JFL92 in Canada/ | 2022-03-28 16:07 | - | |
| JFL92 problems need advice/ | 2022-03-28 16:07 | - | |
| JFL92 temp issue/ | 2022-03-28 16:07 | - | |
| JFL92 thermal IC/ | 2022-03-28 16:07 | - | |
| JFL92 wireless connectivity issues/ | 2022-03-28 16:07 | - | |
| JFT00 BIOS recovery tool/ | 2022-03-28 16:07 | - | |
| JFT00 Bios Upgrade to use the Xp Mode/ | 2022-03-28 16:07 | - | |
| JFT00 charging trouble/ | 2022-03-28 16:07 | - | |
| JFT00 how to make a crisis floppy/ | 2022-03-28 16:07 | - | |
| JFT02 vs JFL92/ | 2022-03-28 16:07 | - | |
| JFT can't support MM 4 GB/ | 2022-03-28 16:07 | - | |
| JHL90 (Sager NP2096) Not Charging/ | 2022-03-28 16:07 | - | |
| JHL90, Touchpad scrolling Spdif Out/ | 2022-03-28 16:07 | - | |
| JHL90 - Bios boot screen/ | 2022-03-28 16:07 | - | |
| JHL90 - Cooling Pad/ | 2022-03-28 16:07 | - | |
| JHL90 - Disable AHCI/ | 2022-03-28 16:07 | - | |
| JHL90 Alps touchpad driver now available from Compal/ | 2022-03-28 16:07 | - | |
| JHL90 BIOS- during Flash Invalid OPCODE/ | 2022-03-28 16:07 | - | |
| JHL90 Bios Flash- HELP!/ | 2022-03-28 16:07 | - | |
| JHL 90 Boot Device Priority/ | 2022-03-28 16:07 | - | |
| JHL90 DVD DS-8A3S firmware update for W7/ | 2022-03-28 16:07 | - | |
| JHL90 Keyboard Compatibly/ | 2022-03-28 16:07 | - | |
| JHL90 Motherboard/ | 2022-03-28 16:07 | - | |
| JHL 90 NP 2096 sound issues help!/ | 2022-03-28 16:07 | - | |
| JHL90 New 1.13 BIOS/ | 2022-03-28 16:07 | - | |
| JHL90 Sager NP2096 BIOS/ | 2022-03-28 16:07 | - | |
| JHL90 Sager NP2096 Bluetooth question/ | 2022-03-28 16:07 | - | |
| JHL90 Sager NP2096 modem problem/ | 2022-03-28 16:07 | - | |
| JHL90 Sound chipset/ | 2022-03-28 16:07 | - | |
| JHL90 Temp Issue/ | 2022-03-28 16:07 | - | |
| JHL90 Touchpad sketchy when on A C power/ | 2022-03-28 16:07 | - | |
| JHL90 Vista x64 Bluetooth problem/ | 2022-03-28 16:07 | - | |
| JHL90 XP Drivers IMPOSSIBLE to find/ | 2022-03-28 16:07 | - | |
| JHL90 XP Have a Couple of Problems/ | 2022-03-28 16:07 | - | |
| JHL90 and HD3870/ | 2022-03-28 16:07 | - | |
| JHL90 and battery charging problems, but only with new batteries!/ | 2022-03-28 16:07 | - | |
| JHL90 and problems using power button to sleep/ | 2022-03-28 16:07 | - | |
| JHL90 barebone/ | 2022-03-28 16:07 | - | |
| JHL90 driver troubles/ | 2022-03-28 16:07 | - | |
| JHL90 new battery - LED Orange & blinking/ | 2022-03-28 16:07 | - | |
| JHL90 on Windows 7/ | 2022-03-28 16:07 | - | |
| JHL90 overclock-results/ | 2022-03-28 16:07 | - | |
| JHL90 overheats since CPU change/ | 2022-03-28 16:07 | - | |
| JHL90 performance/ | 2022-03-28 16:07 | - | |
| JHL90 problem/ | 2022-03-28 16:07 | - | |
| JHL90 reliable/ | 2022-03-28 16:07 | - | |
| JHL90 whitescreen DOA/ | 2022-03-28 16:07 | - | |
| JHL90 wireless performance, switch/ | 2022-03-28 16:07 | - | |
| JTF00 with T5550/ | 2022-03-28 16:07 | - | |
| JUST ORDERED- Xplorer-X5 5850/ | 2022-03-28 16:07 | - | |
| JVC MP-XV941/ | 2022-03-28 16:07 | - | |
| Jacobs parts/ | 2022-03-28 16:07 | - | |
| Jfw91/ | 2022-03-28 16:07 | - | |
| Jhl90 (t8300-9600m Gt-200gb-2000mb-wxga)=1300$/ | 2022-03-28 16:07 | - | |
| Jhl90 bios awol/ | 2022-03-28 16:07 | - | |
| Jht00/ | 2022-03-28 16:07 | - | |
| Johnny T's Guides Portal/ | 2022-03-28 16:07 | - | |
| Just BANISHED my xps 730 desktop and now ordering the NAGAMAKI!/ | 2022-03-28 16:07 | - | |
| Just Bought Compal HEL80/ | 2022-03-28 16:07 | - | |
| Just HOW Mobile is your 6100 Series/ | 2022-03-28 16:07 | - | |
| Just Ordered My First Gaming Laptop/ | 2022-03-28 16:07 | - | |
| Just Ordered OCZ FORCE EXTREME 840 from Xotic/ | 2022-03-28 16:07 | - | |
| Just Ordered The RKC-1756 Extreme!! OCZ Notebook/ | 2022-03-28 16:07 | - | |
| Just Ordered a SN12E238UP212/ | 2022-03-28 16:07 | - | |
| Just Ordered the Kohjinsha SR8 w built in DVDRW!/ | 2022-03-28 16:07 | - | |
| Just Received My RKC-1756 Extreme-OCZ Whitebook!/ | 2022-03-28 16:07 | - | |
| Just Recieved The NAGAMAKI (aka OCZ Whitebook)/ | 2022-03-28 16:07 | - | |
| Just To Clear Up Some Problems - Zio Systems/ | 2022-03-28 16:07 | - | |
| Just a few issues/ | 2022-03-28 16:07 | - | |
| Just bought a Compaq V4000t/ | 2022-03-28 16:07 | - | |
| Just bought a Jetbook Metabox ITC Systemax/ | 2022-03-28 16:07 | - | |
| Just bought the RD10 for $199, few questions/ | 2022-03-28 16:07 | - | |
| Just got my K N QX9300 Nagamaki/ | 2022-03-28 16:07 | - | |
| Just got my system!!!!/ | 2022-03-28 16:07 | - | |
| Just got the C3500 Tablet Questions/ | 2022-03-28 16:07 | - | |
| Just noticed this/ | 2022-03-28 16:07 | - | |
| Just ordered HGL-30/ | 2022-03-28 16:07 | - | |
| Just ordered IFL92/ | 2022-03-28 16:07 | - | |
| Just ordered MPC T3200/ | 2022-03-28 16:07 | - | |
| Just ordered Quanta MW1!!!/ | 2022-03-28 16:07 | - | |
| Just ordered a 6130HS-20/ | 2022-03-28 16:07 | - | |
| Just ordered a HEL80/ | 2022-03-28 16:07 | - | |
| Just ordered an ABS Mayhem Z2 R30!/ | 2022-03-28 16:07 | - | |
| Just ordered an AW Area 51m, and we'll see/ | 2022-03-28 16:07 | - | |
| Just ordered mine, have some questions/ | 2022-03-28 16:07 | - | |
| Just ordered my HEL80/ | 2022-03-28 16:07 | - | |
| Just ordered my RKC-1756 Extreme/ | 2022-03-28 16:07 | - | |
| Just placed my order for my new P1 MX!/ | 2022-03-28 16:07 | - | |
| Just received quanta kn1-pm/ | 2022-03-28 16:07 | - | |
| Just recieved my replacement DVD Writer/ | 2022-03-28 16:07 | - | |
| Just some more images video of the OCZ Whitebook (Arima W840 DI)/ | 2022-03-28 16:07 | - | |
| K42 with i5-520M/ | 2022-03-28 16:07 | - | |
| KHBL2 Sager 2098 top button help/ | 2022-03-28 16:07 | - | |
| KHLB2 (but other Compal barebones as well) screen/ | 2022-03-28 16:07 | - | |
| KHLB2 - Bluetooth and Wifi issues/ | 2022-03-28 16:07 | - | |
| KHLB2 Wireless Switch in Windows 7/ | 2022-03-28 16:07 | - | |
| KHLB2 new battery/ | 2022-03-28 16:07 | - | |
| KIller Notebooks/ | 2022-03-28 16:07 | - | |
| K N lie everyone/ | 2022-03-28 16:07 | - | |
| KOHJINSHA SX3KP06MA - Any reviews/ | 2022-03-28 16:07 | - | |
| Kensington Contour Backpack - Does it fit/ | 2022-03-28 16:07 | - | |
| Key (Volume, Mute etc.) & factory reset/ | 2022-03-28 16:07 | - | |
| Keyboard/ | 2022-03-28 16:07 | - | |
| Keyboard Driver for 6130HS/ | 2022-03-28 16:07 | - | |
| Keyboard Replacement AV2260/ | 2022-03-28 16:07 | - | |
| Keyboard Screwed In (hel80)/ | 2022-03-28 16:07 | - | |
| Keyboard and touchpad quality, 6314w/ | 2022-03-28 16:07 | - | |
| Keyboard bounce/ | 2022-03-28 16:07 | - | |
| Keyboard flex/ | 2022-03-28 16:07 | - | |
| Keyboard for FL90/ | 2022-03-28 16:07 | - | |
| Keyboard for SHARP PCAL27/ | 2022-03-28 16:07 | - | |
| Keyboard for zepto 6214w/ | 2022-03-28 16:07 | - | |
| Keyboard parts needed. Nox A15/ | 2022-03-28 16:07 | - | |
| Keyboard problem with Hgl30/ | 2022-03-28 16:07 | - | |
| Keyboard problem with the Comapl Fl90/ | 2022-03-28 16:07 | - | |
| Keyboards/ | 2022-03-28 16:07 | - | |
| Keyboard shortagte causing long delivery times (holland)/ | 2022-03-28 16:07 | - | |
| Key sequence to restore factory defaults/ | 2022-03-28 16:07 | - | |
| Key stopped working/ | 2022-03-28 16:07 | - | |
| Khlb2 hd 4650/ | 2022-03-28 16:07 | - | |
| Kick the fans in sooner/ | 2022-03-28 16:07 | - | |
| Killer Notebooks..are they too expensive/ | 2022-03-28 16:07 | - | |
| KillerNotebooks Nagamaki Whitebook Review/ | 2022-03-28 16:07 | - | |
| Killer Notebooks Nagamaki first to break 17,000 3D06/ | 2022-03-28 16:07 | - | |
| Killer Notebooks shows the ATI & Nvidia cards/ | 2022-03-28 16:07 | - | |
| Kingmax memory modules + HEL80, need advice/ | 2022-03-28 16:07 | - | |
| Kingmax sodimm 1gb/ | 2022-03-28 16:07 | - | |
| Kobalt computers Mojave/ | 2022-03-28 16:07 | - | |
| L2 Cache - Compal Hel80 T2500/ | 2022-03-28 16:07 | - | |
| L80x Ultra Integrated Camera problem! -[/ | 2022-03-28 16:07 | - | |
| LCD Brightness Control/ | 2022-03-28 16:07 | - | |
| LCD Help Needed/ | 2022-03-28 16:07 | - | |
| LCD Response times on HEL 80/ | 2022-03-28 16:07 | - | |
| LCD Screen Dark (NEC E6000)/ | 2022-03-28 16:07 | - | |
| LCD panel replacement - can I use LED instead of CCFL/ | 2022-03-28 16:07 | - | |
| LCD removal replacement guide for Tongfang laptop 15.6/ | 2022-03-28 16:07 | - | |
| LCD replacement website/ | 2022-03-28 16:07 | - | |
| LCD screen compatibility/ | 2022-03-28 16:07 | - | |
| LCD went dark on C3500/ | 2022-03-28 16:07 | - | |
| LED Screens/ | 2022-03-28 16:07 | - | |
| Laptop/ | 2022-03-28 16:07 | - | |
| Laptop Audio for HEL80 has gone flat/ | 2022-03-28 16:07 | - | |
| Laptop Bag/ | 2022-03-28 16:07 | - | |
| Laptop Is Blue Screening at Startup/ | 2022-03-28 16:07 | - | |
| Laptop Request/ | 2022-03-28 16:07 | - | |
| Laptop Screen/ | 2022-03-28 16:07 | - | |
| Laptop Shootout/ | 2022-03-28 16:07 | - | |
| Laptop Shutdown/ | 2022-03-28 16:07 | - | |
| Laptop Student Hardcore Gamer/ | 2022-03-28 16:07 | - | |
| Laptop Temperature/ | 2022-03-28 16:07 | - | |
| Laptop Tweaking/ | 2022-03-28 16:07 | - | |
| Laptop Uniwil N241S1 temperature/ | 2022-03-28 16:07 | - | |
| Laptop Water coolers- Advanced Liquid Cooling Technology/ | 2022-03-28 16:07 | - | |
| Laptop Woes 6214W/ | 2022-03-28 16:07 | - | |
| Laptop Won't Turn On With Battery/ | 2022-03-28 16:07 | - | |
| Laptop died on me when cleaning it No POST or boot, turns on... Help/ | 2022-03-28 16:07 | - | |
| Laptop doesn't boot, no BIOS screen/ | 2022-03-28 16:07 | - | |
| Laptop keeps heating up and shuts down/ | 2022-03-28 16:07 | - | |
| Laptop pad/ | 2022-03-28 16:07 | - | |
| Laptop shuts down really fast randomly poof/ | 2022-03-28 16:07 | - | |
| Laptops manufactured by Compal/ | 2022-03-28 16:07 | - | |
| Laptops manufactured by Quanta/ | 2022-03-28 16:07 | - | |
| Laptop to external monitor out of range msg at boot/ | 2022-03-28 16:07 | - | |
| Laptop won't boot/ | 2022-03-28 16:07 | - | |
| Laptop wont let me use it/ | 2022-03-28 16:07 | - | |
| Large areas of dead dying pixels in HEL-80/ | 2022-03-28 16:07 | - | |
| Large delays ordering 6214W/ | 2022-03-28 16:07 | - | |
| Last minute recommendations/ | 2022-03-28 16:07 | - | |
| Last steps before buying Zepto g14b/ | 2022-03-28 16:07 | - | |
| Latency energy saving/ | 2022-03-28 16:07 | - | |
| Latest 7600 GO drivers (guide)/ | 2022-03-28 16:07 | - | |
| Latest 8600 GT Drivers for vista 32bit/ | 2022-03-28 16:07 | - | |
| Latest BIOS drivers/ | 2022-03-28 16:07 | - | |
| Latest Nvidia driver + old gui for hel80 7600go/ | 2022-03-28 16:07 | - | |
| Latest Zeptos + SATA II/ | 2022-03-28 16:07 | - | |
| Latest drivers for HEL80/ | 2022-03-28 16:07 | - | |
| Lavie Z HZ/ | 2022-03-28 16:07 | - | |
| Leadtime/ | 2022-03-28 16:07 | - | |
| Lead time for 6224W/ | 2022-03-28 16:07 | - | |
| Led options/ | 2022-03-28 16:07 | - | |
| Left scrollpad button/ | 2022-03-28 16:07 | - | |
| Lid swtich question/ | 2022-03-28 16:07 | - | |
| Liebermann computers/ | 2022-03-28 16:07 | - | |
| Lifeview MVP unstable/ | 2022-03-28 16:07 | - | |
| Lil Processing lagging/ | 2022-03-28 16:07 | - | |
| Limited BIOS/ | 2022-03-28 16:07 | - | |
| Line out on 6130/ | 2022-03-28 16:07 | - | |
| Linux Experiences w 3200/ | 2022-03-28 16:07 | - | |
| Linux and a zepto/ | 2022-03-28 16:07 | - | |
| Linux on Averatec/ | 2022-03-28 16:07 | - | |
| Linux on QAL51/ | 2022-03-28 16:07 | - | |
| Linux on Zepto Nox A15/ | 2022-03-28 16:07 | - | |
| Linux on the new Compal machines and buggy BIOSes/ | 2022-03-28 16:07 | - | |
| Linux support and Battery differences/ | 2022-03-28 16:07 | - | |
| Linx 14 notebook/ | 2022-03-28 16:07 | - | |
| List of Drivers etc. for Compal IFL90/ | 2022-03-28 16:07 | - | |
| List of OCZ Whitebook Flextronics (Arima) W840-DI Vendors/ | 2022-03-28 16:07 | - | |
| Little Help Needed/ | 2022-03-28 16:07 | - | |
| Locked harddrive. What to do jft00/ | 2022-03-28 16:07 | - | |
| Lock for mah Hel80!!!!!!!!!!!!!!!!!!!/ | 2022-03-28 16:07 | - | |
| Lockups in BIOS Anyone/ | 2022-03-28 16:07 | - | |
| Logitech SetPoint and SideWalker/ | 2022-03-28 16:07 | - | |
| Long term 1050 reviews/ | 2022-03-28 16:07 | - | |
| Look.ES CPU..IFL90!/ | 2022-03-28 16:07 | - | |
| Looking For Sharp M4000 Parts/ | 2022-03-28 16:07 | - | |
| Looking at getting the Compal IFL90/ | 2022-03-28 16:07 | - | |
| Looking for CyberPower motherboard/ | 2022-03-28 16:07 | - | |
| Looking for HEL80 IFL90 keyboard module/ | 2022-03-28 16:07 | - | |
| Looking for Twinhead F11Y/ | 2022-03-28 16:07 | - | |
| Looking for a 2100 series 4 cell battery/ | 2022-03-28 16:07 | - | |
| Looking for a HEL80 Graphic card/ | 2022-03-28 16:07 | - | |
| Looking for a JFT00 BIOS download/ | 2022-03-28 16:07 | - | |
| Looking for a Nice Hard Case for the HEL80/ | 2022-03-28 16:07 | - | |
| Looking for a modded Eluktronics P650HP6-G BIOS - will pay/ | 2022-03-28 16:07 | - | |
| Looking for an alternate site for the compal FL 90 drivers/ | 2022-03-28 16:07 | - | |
| Looking for help on IFL90 JFL92/ | 2022-03-28 16:07 | - | |
| Looking for info about old laptop (Equus Nobilis NS020)/ | 2022-03-28 16:07 | - | |
| Looking for the notebook manufacturer/ | 2022-03-28 16:07 | - | |
| Looking for the serial number on my IFL90/ | 2022-03-28 16:07 | - | |
| Looking into Averatec/ | 2022-03-28 16:07 | - | |
| Looking to buy a notebook which store to get from/ | 2022-03-28 16:07 | - | |
| Looking to upgrade CPU inside notebook/ | 2022-03-28 16:07 | - | |
| Looks like Compal Makes a Voodoo PC/ | 2022-03-28 16:07 | - | |
| Loose Power Connector - Power Problems - Hot Power Connector - Battery won't charge/ | 2022-03-28 16:07 | - | |
| Loose hinge (HEL 80)/ | 2022-03-28 16:07 | - | |
| Loose hinge cover/ | 2022-03-28 16:07 | - | |
| Loose keyboard on 3225/ | 2022-03-28 16:07 | - | |
| Lost Video Compal PBL21/ | 2022-03-28 16:07 | - | |
| Lost my CD-Rom/ | 2022-03-28 16:07 | - | |
| Lost recovery after vista installed/ | 2022-03-28 16:07 | - | |
| Lost the Finger, unable to pass fingerprint check/ | 2022-03-28 16:07 | - | |
| Low Battery Noise/ | 2022-03-28 16:07 | - | |
| Low price for GL30 barbone/ | 2022-03-28 16:07 | - | |
| M-Tech D900T/ | 2022-03-28 16:07 | - | |
| M-Tech Laptops/ | 2022-03-28 16:07 | - | |
| M-tech Laptops!!!!/ | 2022-03-28 16:07 | - | |
| M-tech clevo M400/ | 2022-03-28 16:07 | - | |
| M4000 - DVD-RW in Japanese version/ | 2022-03-28 16:07 | - | |
| MDG Notebooks/ | 2022-03-28 16:07 | - | |
| MECH 15 G2Rx RTX 2060 and 2070MQ/ | 2022-03-28 16:07 | - | |
| MEDION® ERAZER® X6813 15.6 Laptop (MD97833)/ | 2022-03-28 16:07 | - | |
| MEROM Available on uk site now!/ | 2022-03-28 16:07 | - | |
| MICRO EXPRESS JFL9226 and JHL9025 LAPTOPS/ | 2022-03-28 16:07 | - | |
| MM20 - Stereo or Mono Audio/ | 2022-03-28 16:07 | - | |
| MM20 Update/ | 2022-03-28 16:07 | - | |
| MM20 available again/ | 2022-03-28 16:07 | - | |
| MM20 replacement in the works/ | 2022-03-28 16:07 | - | |
| MPC - They Won't Send Me My Laptop Back/ | 2022-03-28 16:07 | - | |
| MPC Transport T3200/ | 2022-03-28 16:07 | - | |
| MPS on HEL80 fast but hot!/ | 2022-03-28 16:07 | - | |
| MSI L610 - is a dream in notebook/ | 2022-03-28 16:07 | - | |
| MSI Mega Book...drool/ | 2022-03-28 16:07 | - | |
| MSI vs Asus - Battle it out!!!/ | 2022-03-28 16:07 | - | |
| MW1 15.0 and a ZS or Xfi card/ | 2022-03-28 16:07 | - | |
| MWave Notebooks/ | 2022-03-28 16:07 | - | |
| MX-A8JS with BT/ | 2022-03-28 16:07 | - | |
| MX HD IDE or SATA/ | 2022-03-28 16:07 | - | |
| MX Keyboard Quality/ | 2022-03-28 16:07 | - | |
| MXM graphics module in 6625/ | 2022-03-28 16:07 | - | |
| MX Quick Review/ | 2022-03-28 16:07 | - | |
| MX Review/ | 2022-03-28 16:07 | - | |
| MX Screen Issue/ | 2022-03-28 16:07 | - | |
| MX hotkeys and Crystal Reports XI/ | 2022-03-28 16:07 | - | |
| MX or UX- any thoughts/ | 2022-03-28 16:07 | - | |
| MX question/ | 2022-03-28 16:07 | - | |
| MX questions on size/ | 2022-03-28 16:07 | - | |
| MX series not available on Portable One site/ | 2022-03-28 16:07 | - | |
| MX video card upgrades/ | 2022-03-28 16:07 | - | |
| MX with Transflective Screen/ | 2022-03-28 16:07 | - | |
| Mac OSX Leopard on my 6224W/ | 2022-03-28 16:07 | - | |
| Mac OS X on HEL80/ | 2022-03-28 16:07 | - | |
| Mac on an IFL90/ | 2022-03-28 16:07 | - | |
| MainGear Clutch 13/ | 2022-03-28 16:07 | - | |
| MainGear Clutch series/ | 2022-03-28 16:07 | - | |
| MainGear Vector 2/ | 2022-03-28 16:07 | - | |
| Maingear/ | 2022-03-28 16:07 | - | |
| Maingear Element 2-EL2- Which Tongfang chassis does it use/ | 2022-03-28 16:07 | - | |
| Maingear Pulse 17/ | 2022-03-28 16:07 | - | |
| Maintenance of Whitebook (appearance)/ | 2022-03-28 16:07 | - | |
| Major audio problem/ | 2022-03-28 16:07 | - | |
| Making the switch from Dell to Compal/ | 2022-03-28 16:07 | - | |
| Malibal and WidowPC/ | 2022-03-28 16:07 | - | |
| Managing HD3650 temperatures in FL90/ | 2022-03-28 16:07 | - | |
| Managing The processor speed/ | 2022-03-28 16:07 | - | |
| Manufacturers Warranty/ | 2022-03-28 16:07 | - | |
| Many many reasons not to buy a 3200/ | 2022-03-28 16:07 | - | |
| Matte LCD HEL80 Users/ | 2022-03-28 16:07 | - | |
| Matte Screen/ | 2022-03-28 16:07 | - | |
| Max DVD burn speed of 6130/ | 2022-03-28 16:07 | - | |
| MaxPC mag compares Intel CPU's on Hel80/ | 2022-03-28 16:07 | - | |
| Maxbook HardDrive/ | 2022-03-28 16:07 | - | |
| Maximum 3200 RAM, replacement batteries/ | 2022-03-28 16:07 | - | |
| Maximum HEL80 Hard Drive Specs/ | 2022-03-28 16:07 | - | |
| Maximum resolution of 1024 768 after clean Windows install/ | 2022-03-28 16:07 | - | |
| Max memory averatec 6130/ | 2022-03-28 16:07 | - | |
| Max memory in the HEL80/ | 2022-03-28 16:07 | - | |
| Max vision computers What about these/ | 2022-03-28 16:07 | - | |
| Maybe it's a sign/ | 2022-03-28 16:07 | - | |
| Mayhem G5/ | 2022-03-28 16:07 | - | |
| Mdg/ | 2022-03-28 16:07 | - | |
| Mech-15 disassembly and modding questions/ | 2022-03-28 16:07 | - | |
| Mech 15 G3 Recoil IV RTX 2070 Super vbios flashing/ | 2022-03-28 16:07 | - | |
| Mechrevo z2 or x8ti/ | 2022-03-28 16:07 | - | |
| Media Keys/ | 2022-03-28 16:07 | - | |
| Medion (microstar) MD 40901 memory upgrade, HELP!/ | 2022-03-28 16:07 | - | |
| Medion - 17 inch notebook/ | 2022-03-28 16:07 | - | |
| Medion Akoya Centrino $949 @bestbuy/ | 2022-03-28 16:07 | - | |
| Medion Akoya EX- alternate colors to white/ | 2022-03-28 16:07 | - | |
| Medion Akoya LS Batteries, OEM Accessories Here!/ | 2022-03-28 16:07 | - | |
| Medion Akoya LS First Look/ | 2022-03-28 16:07 | - | |
| Medion Akoya LS Memory Upgrade/ | 2022-03-28 16:07 | - | |
| Medion Erazer X6817 HDMI problem/ | 2022-03-28 16:07 | - | |
| Medion Erazer x6811 or x6813 Advice (Cpu throttling)/ | 2022-03-28 16:07 | - | |
| Medion Laptop Centrino M, 1.73GB, 100GB 1024MB/ | 2022-03-28 16:07 | - | |
| Medion Laptop oem/ | 2022-03-28 16:07 | - | |
| Medion MD-40954 PC Notebook/ | 2022-03-28 16:07 | - | |
| Medion MD6032 Service Manual/ | 2022-03-28 16:07 | - | |
| Medion MD6488/ | 2022-03-28 16:07 | - | |
| Medion MD95319 (2030 ) Laptop Problem/ | 2022-03-28 16:07 | - | |
| Medion MIM 2310 & 2210 Whats the difference/ | 2022-03-28 16:07 | - | |
| Medion Notebook Disassembly/ | 2022-03-28 16:07 | - | |
| Medion Notebook fails POST... help/ | 2022-03-28 16:07 | - | |
| Medion SIM2000/ | 2022-03-28 16:07 | - | |
| Medion SIM2000 Wireless Question/ | 2022-03-28 16:07 | - | |
| Medion Support Forum/ | 2022-03-28 16:07 | - | |
| Medion WIM 2200 CPU upgrade/ | 2022-03-28 16:07 | - | |
| Medion Wireless Connection/ | 2022-03-28 16:07 | - | |
| Medion erazer x7817/ | 2022-03-28 16:07 | - | |
| Medion notebook $699 with combo drive/ | 2022-03-28 16:07 | - | |
| Medion notebooks/ | 2022-03-28 16:07 | - | |
| Medison Celebrity/ | 2022-03-28 16:07 | - | |
| Me experience with Zeptop- Worst ever!/ | 2022-03-28 16:07 | - | |
| Melted Input Power Jack/ | 2022-03-28 16:07 | - | |
| Memory/ | 2022-03-28 16:07 | - | |
| Memory IFL90/ | 2022-03-28 16:07 | - | |
| Memory modules in Zepto 6625/ | 2022-03-28 16:07 | - | |
| Memory not functioning on 6625WD/ | 2022-03-28 16:07 | - | |
| Memory performance/ | 2022-03-28 16:07 | - | |
| Memory tweaking on IFL90 (and other Santa Rosa laptops)/ | 2022-03-28 16:07 | - | |
| Memory upgrade on Averatec AV1050 difficult/ | 2022-03-28 16:07 | - | |
| Memory upgrade problem and perhaps BIOS bug on Znote 6615WD/ | 2022-03-28 16:07 | - | |
| Memory upgrade to 1gb 200 pin pc2700 sodimm WORKS!/ | 2022-03-28 16:07 | - | |
| Menory for my IFL90 4 gb/ | 2022-03-28 16:07 | - | |
| Merom Chips in Asus S96J COMPAL HEL 80/ | 2022-03-28 16:07 | - | |
| Merry Christmas/ | 2022-03-28 16:07 | - | |
| Messed Keyboard [+Picture]/ | 2022-03-28 16:07 | - | |
| Metabox 730/ | 2022-03-28 16:07 | - | |
| MiTAC ODM Notebooks - Any experience anyone/ | 2022-03-28 16:07 | - | |
| MicroExpress! Yay or Nay/ | 2022-03-28 16:07 | - | |
| Micro Express NP3716A/ | 2022-03-28 16:07 | - | |
| Micron Transport PC (2100 2200)/ | 2022-03-28 16:07 | - | |
| Microtel/ | 2022-03-28 16:07 | - | |
| Mic volume on HEL80/ | 2022-03-28 16:07 | - | |
| Milestonepc.com sales/ | 2022-03-28 16:07 | - | |
| Mini PCI-E SSD in FL90/ | 2022-03-28 16:07 | - | |
| Mini PCI-E TV Tuner/ | 2022-03-28 16:07 | - | |
| MiniPCIe SSD in JHL90/ | 2022-03-28 16:07 | - | |
| MiniPCI ports/ | 2022-03-28 16:07 | - | |
| Minor CD drive issue with 6625WD/ | 2022-03-28 16:07 | - | |
| Mirrors Edge on Whitebook/ | 2022-03-28 16:07 | - | |
| Misplaced part (or something like that)/ | 2022-03-28 16:07 | - | |
| Missed my IFL90's birthday!/ | 2022-03-28 16:07 | - | |
| Mitac 8227D 17 8600GS barebone laptop/ | 2022-03-28 16:07 | - | |
| Mitac 8227D Laptop/ | 2022-03-28 16:07 | - | |
| Mitac 8252d Bios Link/ | 2022-03-28 16:07 | - | |
| Mitac laptops/ | 2022-03-28 16:07 | - | |
| Mitac notebooks... What kind of manufacturer is Mitac/ | 2022-03-28 16:07 | - | |
| Mobility HD3870 Crossfire - No compatible ATI drivers yet available/ | 2022-03-28 16:07 | - | |
| Mobility drivers/ | 2022-03-28 16:07 | - | |
| Modding the IFL90/ | 2022-03-28 16:07 | - | |
| Model- 259ei1 - need assistance/ | 2022-03-28 16:07 | - | |
| Moniter output resolution/ | 2022-03-28 16:07 | - | |
| Monitor Back Lights Go Off/ | 2022-03-28 16:07 | - | |
| Monitor Closing problem/ | 2022-03-28 16:07 | - | |
| Monitoring Temp, Voltage and SpeedFan - DEAD/ | 2022-03-28 16:07 | - | |
| Montevina on a P1 computer/ | 2022-03-28 16:07 | - | |
| More MS Store impressions/ | 2022-03-28 16:07 | - | |
| More color options on backlit keyboard/ | 2022-03-28 16:07 | - | |
| Mororola ML 850/ | 2022-03-28 16:07 | - | |
| Mothers Day gift hamper with delightful love/ | 2022-03-28 16:07 | - | |
| Motherboard 5400 Averatec/ | 2022-03-28 16:07 | - | |
| Motherboard for a Medion MIM 2210/ | 2022-03-28 16:07 | - | |
| Motion Computing LE1600 padfolio bump case, Win 7 installation, Ink Flash cards, Mathjournal 2.1/ | 2022-03-28 16:07 | - | |
| Motion Computing LE1700 Screen Orientation/ | 2022-03-28 16:07 | - | |
| Motion Le1600/ | 2022-03-28 16:07 | - | |
| Mouse Computer Labtops, anyone/ | 2022-03-28 16:07 | - | |
| Mtech anyone/ | 2022-03-28 16:07 | - | |
| Multicom P17SM GTX 780M svl7 VBIOS/ | 2022-03-28 16:07 | - | |
| Must Boot Twice To Start/ | 2022-03-28 16:07 | - | |
| Mwave or Uniwell N233ii/ | 2022-03-28 16:07 | - | |
| My (superfical) Averatec 5110P review/ | 2022-03-28 16:07 | - | |
| My 1st Sharp Actius AL27 - need pro help/ | 2022-03-28 16:07 | - | |
| My 4100 lappy/ | 2022-03-28 16:07 | - | |
| My 6214W - Problem (DVD drive) & 1 Question(Touchpad)/ | 2022-03-28 16:07 | - | |
| My 6214w makes a strange noise/ | 2022-03-28 16:07 | - | |
| My 6224 will not start/ | 2022-03-28 16:07 | - | |
| My 6625WD has arrived and the keyboard is faulty/ | 2022-03-28 16:07 | - | |
| My 6625WD is here today! -)/ | 2022-03-28 16:07 | - | |
| My Black Screen problem/ | 2022-03-28 16:07 | - | |
| My Blogg/ | 2022-03-28 16:07 | - | |
| My CN15-A1 Tutorials/ | 2022-03-28 16:07 | - | |
| My Custom Cover Zepto 6214w has arrived!/ | 2022-03-28 16:07 | - | |
| My Experience with Zepto (as it happens)/ | 2022-03-28 16:07 | - | |
| My HEL80 - The Good and Bad/ | 2022-03-28 16:07 | - | |
| My IFL90!! -(/ | 2022-03-28 16:07 | - | |
| My IFL90's 1st 24 hours/ | 2022-03-28 16:07 | - | |
| My List of Official OCZ Whitebook Review/ | 2022-03-28 16:07 | - | |
| My PCMark Vantage Score!!!!/ | 2022-03-28 16:07 | - | |
| My Potential Hel80 System/ | 2022-03-28 16:07 | - | |
| My RK Computers RKC-1756 With QX9300 Just Arrived!/ | 2022-03-28 16:07 | - | |
| My Viliv X70/ | 2022-03-28 16:07 | - | |
| My Zepto.. (6615WD)/ | 2022-03-28 16:07 | - | |
| My Zepto 6214W got lost in the mail/ | 2022-03-28 16:07 | - | |
| My Zepto Mythos personal review/ | 2022-03-28 16:07 | - | |
| My Zepto Znote 6224W personal review/ | 2022-03-28 16:07 | - | |
| My Zepto Znote 6324W pictures/ | 2022-03-28 16:07 | - | |
| My Zepto Znote 6625WD pictures/ | 2022-03-28 16:07 | - | |
| My Zepto doesn't read DVDs -(/ | 2022-03-28 16:07 | - | |
| My averatec 4155 fallinng apart/ | 2022-03-28 16:07 | - | |
| My bad laptop with MDG - could someone help!!!!/ | 2022-03-28 16:07 | - | |
| My comp. is dying. 2100/ | 2022-03-28 16:07 | - | |
| My experience (As it happens ) 2/ | 2022-03-28 16:07 | - | |
| My experience so far with Zepto 6625/ | 2022-03-28 16:07 | - | |
| My experience with Zepto/ | 2022-03-28 16:07 | - | |
| My experience with ZeptoUSA/ | 2022-03-28 16:07 | - | |
| My experience with this site and Portable One/ | 2022-03-28 16:07 | - | |
| My first/ | 2022-03-28 16:07 | - | |
| My games hangs up, and I have to force shut down!/ | 2022-03-28 16:07 | - | |
| My graphics driver keeps crashing/ | 2022-03-28 16:07 | - | |
| My hgl30 doesnt detect my cd rom anymore -S/ | 2022-03-28 16:07 | - | |
| My new panel as arrived/ | 2022-03-28 16:07 | - | |
| My observation/ | 2022-03-28 16:07 | - | |
| My personal RMA with Zepto/ | 2022-03-28 16:07 | - | |
| My sad tale of the 4265/ | 2022-03-28 16:07 | - | |
| Mystery laptop on Officedepot.com/ | 2022-03-28 16:07 | - | |
| Mythlogic Help Needed/ | 2022-03-28 16:07 | - | |
| Mythos A15 - trailer advert/ | 2022-03-28 16:07 | - | |
| Mythos A15 with geffo 9650gt/ | 2022-03-28 16:07 | - | |
| My zepto expirience for potential buyers 3415w/ | 2022-03-28 16:07 | - | |
| N2700 Disassembly and keyboard issues/ | 2022-03-28 16:07 | - | |
| NAGAMAKI - Please help me decide!!!/ | 2022-03-28 16:07 | - | |
| NBLB2 HDD issue/ | 2022-03-28 16:07 | - | |
| NBLB2 Memory recommendation (2x 4GB)/ | 2022-03-28 16:07 | - | |
| NBLB2 wifi-antenna/ | 2022-03-28 16:07 | - | |
| NBLB5 Black screen/ | 2022-03-28 16:07 | - | |
| NBLB5 other Keyboard/ | 2022-03-28 16:07 | - | |
| NC8000 Screen Vertical lines/ | 2022-03-28 16:07 | - | |
| NEC Bersa E6211/ | 2022-03-28 16:07 | - | |
| NEC Hello Kitty Notebook/ | 2022-03-28 16:07 | - | |
| NEC LaVie Z LZ750 NSB (antiglare IGZO 1440p 13.3 , 795g, i7-4500U 4GB 256, ac, 1,5mm)/ | 2022-03-28 16:07 | - | |
| NEC Laptop problem/ | 2022-03-28 16:07 | - | |
| NEC Transport ZX Notebook/ | 2022-03-28 16:07 | - | |
| NEC VERSA M520/ | 2022-03-28 16:07 | - | |
| NEC Versa L1100/ | 2022-03-28 16:07 | - | |
| NEC Versa L2200 - Video display problems/ | 2022-03-28 16:07 | - | |
| NEC Versa M300 Keyboard problems/ | 2022-03-28 16:07 | - | |
| NEC Versa M400 Sound Problem/ | 2022-03-28 16:07 | - | |
| NEC Versa M440, need advice please/ | 2022-03-28 16:07 | - | |
| NEC Versa P570 P8310 BIOS needed - HELP/ | 2022-03-28 16:07 | - | |
| NEC disassembly/ | 2022-03-28 16:07 | - | |
| NEC notebooks/ | 2022-03-28 16:07 | - | |
| NEW - Zmore TV tuner driver application with support for Znote 3415W/ | 2022-03-28 16:07 | - | |
| NEW BIOS for EL80/ | 2022-03-28 16:07 | - | |
| NEW BTO 15W27 (Compal JFL9X)/ | 2022-03-28 16:07 | - | |
| NEW Compal HEL80 Review/ | 2022-03-28 16:07 | - | |
| NEW FL90 - Battery won`t charge/ | 2022-03-28 16:07 | - | |
| NEWS- 4000 Series = Official word from Averatec/ | 2022-03-28 16:07 | - | |
| NEW test on HEL80 -)/ | 2022-03-28 16:07 | - | |
| NHC question/ | 2022-03-28 16:07 | - | |
| NIC Fried EL80/ | 2022-03-28 16:07 | - | |
| NO WARRANTY - Thanks VIZIO/ | 2022-03-28 16:07 | - | |
| NOX15 How do I get to the screen ribbon cable/ | 2022-03-28 16:07 | - | |
| NOX A14 Dimensions/ | 2022-03-28 16:07 | - | |
| NOX A14 Disassembly/ | 2022-03-28 16:07 | - | |
| NOX A14 questions/ | 2022-03-28 16:07 | - | |
| NOX A14 with 9650m GT/ | 2022-03-28 16:07 | - | |
| NOX A15 BIOS-upgrade problems, optical problems and Windows 7 install problems/ | 2022-03-28 16:07 | - | |
| NOX Bios problem/ | 2022-03-28 16:07 | - | |
| NP2090 (Compal IFL90) Owner - Test your Built-in Microphone/ | 2022-03-28 16:07 | - | |
| NP2092 Set Up/ | 2022-03-28 16:07 | - | |
| NP2096 Overheating Help/ | 2022-03-28 16:07 | - | |
| NVIDIA Geforce 8600M GT overclock issue/ | 2022-03-28 16:07 | - | |
| NVMe RAID 0 in a laptop ! - PCSpecialist [RECOIL II]/ | 2022-03-28 16:07 | - | |
| NVidia GeForce FX Go 1400 vs GeForce Go 6800 Ultra/ | 2022-03-28 16:07 | - | |
| Nagamaki - New drivers/ | 2022-03-28 16:07 | - | |
| Nagamaki Benchmark Thread and pictures/ | 2022-03-28 16:07 | - | |
| Nagamaki Whitebook CPU temps with Prime 95/ | 2022-03-28 16:07 | - | |
| Nagamaki is Here!!! (Arima W840 OCZ Whitebook)/ | 2022-03-28 16:07 | - | |
| Nagamaki temps/ | 2022-03-28 16:07 | - | |
| Name that mystery custom clone/ | 2022-03-28 16:07 | - | |
| Nand Turbo Memory on FL90/ | 2022-03-28 16:07 | - | |
| Neat cooling lid from Compal/ | 2022-03-28 16:07 | - | |
| Need Battery/ | 2022-03-28 16:07 | - | |
| Need DVD Drive for JHL90/ | 2022-03-28 16:07 | - | |
| Need Help- UM32W Battery/ | 2022-03-28 16:07 | - | |
| Need Help - Which Video card Processor should I get/ | 2022-03-28 16:07 | - | |
| Need Help Deciding!!!/ | 2022-03-28 16:07 | - | |
| Need Help Locating Part/ | 2022-03-28 16:07 | - | |
| Need Help On Sharp Actius/ | 2022-03-28 16:07 | - | |
| Need Help with OCZ Whitebook from newegg/ | 2022-03-28 16:07 | - | |
| Need Sharp Actius MP30 or Mebius PC-MP70G restore discs, please/ | 2022-03-28 16:07 | - | |
| Need Urgent Help!/ | 2022-03-28 16:07 | - | |
| Need Xplorer x5-5500 parts/ | 2022-03-28 16:07 | - | |
| Need a compact backpack for the HEL80/ | 2022-03-28 16:07 | - | |
| Need a copy of Recovery DVD/ | 2022-03-28 16:07 | - | |
| Need advice on recovering data from dead CL56/ | 2022-03-28 16:07 | - | |
| Need an Averatec 3200 Power Board!/ | 2022-03-28 16:07 | - | |
| Need an HGL-30 cooling fan/ | 2022-03-28 16:07 | - | |
| Need convincing/ | 2022-03-28 16:07 | - | |
| Need desperate help with Gamebridge!/ | 2022-03-28 16:07 | - | |
| Need help, about boot up setting/ | 2022-03-28 16:07 | - | |
| Need help/ | 2022-03-28 16:07 | - | |
| Need help finding a notebook/ | 2022-03-28 16:07 | - | |
| Need help for the Averatec 3220H1/ | 2022-03-28 16:07 | - | |
| Need help identifying a potential HEL-80/ | 2022-03-28 16:07 | - | |
| Need help regarding compal pbl21/ | 2022-03-28 16:07 | - | |
| Need help remembering the name of a mid-2000s boutique PC builder/ | 2022-03-28 16:07 | - | |
| Need help to know what I have (FL92)/ | 2022-03-28 16:07 | - | |
| Need help with Compal JAX10/ | 2022-03-28 16:07 | - | |
| Need help with a 7170/ | 2022-03-28 16:07 | - | |
| Need help with putting back together 3200 series/ | 2022-03-28 16:07 | - | |
| Need info on Sager NP4750 w AMD64 3200+/ | 2022-03-28 16:07 | - | |
| Need new adapter for IFL90/ | 2022-03-28 16:07 | - | |
| Need new keyboard for 6625WD/ | 2022-03-28 16:07 | - | |
| Need no frills i7 Z with premium carbon fiber/ | 2022-03-28 16:07 | - | |
| Need optical drive bracket/ | 2022-03-28 16:07 | - | |
| Need recovery disk!/ | 2022-03-28 16:07 | - | |
| Need some assistance with the older CQ12 series/ | 2022-03-28 16:07 | - | |
| Need to cool my Mythos G15/ | 2022-03-28 16:07 | - | |
| Need to know IFL90 Motherboard/ | 2022-03-28 16:07 | - | |
| Neone Have the PDF For How To Clean a 6100/ | 2022-03-28 16:07 | - | |
| Netlux/ | 2022-03-28 16:07 | - | |
| Never heard of Compal in the states!/ | 2022-03-28 16:07 | - | |
| Never mind/ | 2022-03-28 16:07 | - | |
| New- 13.1 Uniwill M30EI0/ | 2022-03-28 16:07 | - | |
| New 14 inch/ | 2022-03-28 16:07 | - | |
| New 119B bios/ | 2022-03-28 16:07 | - | |
| New 2371 anyone/ | 2022-03-28 16:07 | - | |
| New 4100 series, Turion 64 Ultra Portable 13.3/ | 2022-03-28 16:07 | - | |
| New 6200s with AMD 64 bit chipset/ | 2022-03-28 16:07 | - | |
| New 6214w battery, not Zepto/ | 2022-03-28 16:07 | - | |
| New 6224 owner needs opinions/ | 2022-03-28 16:07 | - | |
| New 6625/ | 2022-03-28 16:07 | - | |
| New 6625WD Bios.....forgotten/ | 2022-03-28 16:07 | - | |
| New AMD Turion 64 notebook - Systemax Neotach 3300/ | 2022-03-28 16:07 | - | |
| New Averatec 6100 Series/ | 2022-03-28 16:07 | - | |
| New Averatec 6240 has AMD 64 Processor/ | 2022-03-28 16:07 | - | |
| New Averatec Models!/ | 2022-03-28 16:07 | - | |
| New Averatec TriGem 2700 Series/ | 2022-03-28 16:07 | - | |
| New Averatec model/ | 2022-03-28 16:07 | - | |
| New Averatec models/ | 2022-03-28 16:07 | - | |
| New BIOS (1.23B) for EL80 EL81 Available!/ | 2022-03-28 16:07 | - | |
| New BIOS Version 112 available now!/ | 2022-03-28 16:07 | - | |
| New BIOS for Nagamaki/ | 2022-03-28 16:07 | - | |
| New BIOS z1.13 for 6014W 6214W released/ | 2022-03-28 16:07 | - | |
| New BIOS z1.14 for 6014W 6214W released/ | 2022-03-28 16:07 | - | |
| New BIOS z1.15 for 6014W 6214W 6314W released/ | 2022-03-28 16:07 | - | |
| New BIOS z1.17 out for 6214W/ | 2022-03-28 16:07 | - | |
| New Battery After one year/ | 2022-03-28 16:07 | - | |
| New Bios 1.21B/ | 2022-03-28 16:07 | - | |
| New CPU for the 6130/ | 2022-03-28 16:07 | - | |
| New Chembooh 4080 (HEL80)/ | 2022-03-28 16:07 | - | |
| New Clevo Model D450T/ | 2022-03-28 16:07 | - | |
| New Compal HGL30 BIOS 112A/ | 2022-03-28 16:07 | - | |
| New Compal Hel 80 - Audio Problems/ | 2022-03-28 16:07 | - | |
| New Compal Machines/ | 2022-03-28 16:07 | - | |
| New Compal Notebook Soon/ | 2022-03-28 16:07 | - | |
| New Compal Won't Boot/ | 2022-03-28 16:07 | - | |
| New Compals KHLB2 Reviews/ | 2022-03-28 16:07 | - | |
| NewEgg.com selling Compals now, for good price/ | 2022-03-28 16:07 | - | |
| New Eluktronics Mech 15 or Max 15 Wich will you choose/ | 2022-03-28 16:07 | - | |
| New FX Series/ | 2022-03-28 16:07 | - | |
| New GPUs/ | 2022-03-28 16:07 | - | |
| New Go 8800 cards available for Zepto notebooks/ | 2022-03-28 16:07 | - | |
| New HD3650 in FL90 - external sound and external monitor not working/ | 2022-03-28 16:07 | - | |
| New HD in 6100, what effect/ | 2022-03-28 16:07 | - | |
| New HEL80 Owner...Need a BT Mouse/ | 2022-03-28 16:07 | - | |
| New Hard Drive/ | 2022-03-28 16:07 | - | |
| New JFL92 Temps/ | 2022-03-28 16:07 | - | |
| New KB2 Laptop/ | 2022-03-28 16:07 | - | |
| New MX-A8J's/ | 2022-03-28 16:07 | - | |
| New MX/ | 2022-03-28 16:07 | - | |
| New MXW3 Keyboard Skin Protectors/ | 2022-03-28 16:07 | - | |
| New MX received on Saturday - thoughts/ | 2022-03-28 16:07 | - | |
| New New MX series (2006 one)/ | 2022-03-28 16:07 | - | |
| New Notebook by End of Summer- Any Suggestions/ | 2022-03-28 16:07 | - | |
| New Nvidia Vista 32 64bit drivers for 6224W 6324W 6625WD (Forceware 167.59)/ | 2022-03-28 16:07 | - | |
| New Nvidia Vista 32 64bit drivers for 6224W 6324W 6625WD (Forceware 175.80)/ | 2022-03-28 16:07 | - | |
| New Nvidia Vista drivers for 6224W 6324W 6625WD/ | 2022-03-28 16:07 | - | |
| New Nvidia XP 32bit drivers for 6224W 6324W 6625WD (Forceware 156.65)/ | 2022-03-28 16:07 | - | |
| New Nvidia XP 32bit drivers for 6224W 6324W 6625WD (Forceware 167.59)/ | 2022-03-28 16:07 | - | |
| New OCZ 17 Barebones Announced/ | 2022-03-28 16:07 | - | |
| New OEM laptop/ | 2022-03-28 16:07 | - | |
| New P1 Laptop- SX/ | 2022-03-28 16:07 | - | |
| New P1 models soon/ | 2022-03-28 16:07 | - | |
| New Pics of HGL30 - Shows the Teal color much better/ | 2022-03-28 16:07 | - | |
| New RaLink Drivers v3.0.1.0/ | 2022-03-28 16:07 | - | |
| New Realtek Audio Driver/ | 2022-03-28 16:07 | - | |
| New Rock Notebooks/ | 2022-03-28 16:07 | - | |
| New Sager NP2092 (Compal JFL92) Released/ | 2022-03-28 16:07 | - | |
| New Sandy Bridge models have surfaced, being auctioned/ | 2022-03-28 16:07 | - | |
| New Series 1000 & 4200, widescreens 10.6 & 13.3/ | 2022-03-28 16:07 | - | |
| New Sharp - Japan/ | 2022-03-28 16:07 | - | |
| New Sonoma Samsungs/ | 2022-03-28 16:07 | - | |
| New Sony models/ | 2022-03-28 16:07 | - | |
| New TZ 2xx/ | 2022-03-28 16:07 | - | |
| New To Compal Need Advice/ | 2022-03-28 16:07 | - | |
| New TongFang GM7TG8P , I7 11800h and Rtx 3080/ | 2022-03-28 16:07 | - | |
| New UK phone number for Zepto 0845 6020985 sales enquiries/ | 2022-03-28 16:07 | - | |
| New Video Drivers ATI HD3870/ | 2022-03-28 16:07 | - | |
| New Vizio Lineup Announced/ | 2022-03-28 16:07 | - | |
| New Zepto Bios - Z1.18/ | 2022-03-28 16:07 | - | |
| New Zepto Znote 3414W, released to order on Zepto websites!/ | 2022-03-28 16:07 | - | |
| New at Powernotebooks/ | 2022-03-28 16:07 | - | |
| New averatec media center/ | 2022-03-28 16:07 | - | |
| New battery woes/ | 2022-03-28 16:07 | - | |
| New computer, Zepto Vista CD/ | 2022-03-28 16:07 | - | |
| New delivery problems/ | 2022-03-28 16:07 | - | |
| New desktop replacement & gaming rigs now shipping/ | 2022-03-28 16:07 | - | |
| New event from ZeptoDE/ | 2022-03-28 16:07 | - | |
| New gaming edge- Best Laptop/ | 2022-03-28 16:07 | - | |
| New gfx-cards/ | 2022-03-28 16:07 | - | |
| New keyboard for Hel80/ | 2022-03-28 16:07 | - | |
| New models/ | 2022-03-28 16:07 | - | |
| New models soon to come!/ | 2022-03-28 16:07 | - | |
| New power laptop/ | 2022-03-28 16:07 | - | |
| New power supply Zepto 6324W/ | 2022-03-28 16:07 | - | |
| New ralink drivers 3.0.2.0/ | 2022-03-28 16:07 | - | |
| New rugged laptop/ | 2022-03-28 16:07 | - | |
| News related item Flextronics Arima- Layoffs in Notebook Group/ | 2022-03-28 16:07 | - | |
| New vista drivers/ | 2022-03-28 16:07 | - | |
| New zepto, delivery and Bios update/ | 2022-03-28 16:07 | - | |
| Next ([i]FL [i]FT90- ) generation compals - what would you like to see in them/ | 2022-03-28 16:07 | - | |
| Next Generation NBLB2/ | 2022-03-28 16:07 | - | |
| Next Generation of P4 Notebooks/ | 2022-03-28 16:07 | - | |
| Next Years 6214/ | 2022-03-28 16:07 | - | |
| NextrendPC 470V review/ | 2022-03-28 16:07 | - | |
| Next year I definitely get A C/ | 2022-03-28 16:07 | - | |
| Nexus - Temp monitoring idle/ | 2022-03-28 16:07 | - | |
| Nexus A15 manual/ | 2022-03-28 16:07 | - | |
| Nexus A15 plugged with a Panasonic LCD-TV/ | 2022-03-28 16:07 | - | |
| Nexus Webcam not working/ | 2022-03-28 16:07 | - | |
| Nexus vs Nox/ | 2022-03-28 16:07 | - | |
| Nice looking BenQ/ | 2022-03-28 16:07 | - | |
| No Bios Screen Boot (IFL90)/ | 2022-03-28 16:07 | - | |
| No Centrinos/ | 2022-03-28 16:07 | - | |
| No Express Card on 6615/ | 2022-03-28 16:07 | - | |
| No GPU temp !/ | 2022-03-28 16:07 | - | |
| No HDD on USB boot - Windows XP/ | 2022-03-28 16:07 | - | |
| No More Averatec 4265/ | 2022-03-28 16:07 | - | |
| No No No!!! Please dont say i have to use nusystems/ | 2022-03-28 16:07 | - | |
| No Power C762NR No nothing/ | 2022-03-28 16:07 | - | |
| No Standby/ | 2022-03-28 16:07 | - | |
| No Way To Log In/ | 2022-03-28 16:07 | - | |
| No credit card!/ | 2022-03-28 16:07 | - | |
| Noisy fan with AV1050. Known issue or not/ | 2022-03-28 16:07 | - | |
| Noisy keyboard on 6625wd/ | 2022-03-28 16:07 | - | |
| Nokia Booklet with 3G... Options/ | 2022-03-28 16:07 | - | |
| No more shopping; HEL80 ordered today/ | 2022-03-28 16:07 | - | |
| Non-VBI Compal notebooks in Canada/ | 2022-03-28 16:07 | - | |
| Non Glare Folie/ | 2022-03-28 16:07 | - | |
| Noob with HEL80i questions/ | 2022-03-28 16:07 | - | |
| No problem... Right/ | 2022-03-28 16:07 | - | |
| Normal GPU temperatures/ | 2022-03-28 16:07 | - | |
| North America Availability/ | 2022-03-28 16:07 | - | |
| Northgate notebooks/ | 2022-03-28 16:07 | - | |
| Not a Benq Joybook S42 Review/ | 2022-03-28 16:07 | - | |
| No talk about the UX/ | 2022-03-28 16:07 | - | |
| Not charging/ | 2022-03-28 16:07 | - | |
| NoteMagix B50 Ultra/ | 2022-03-28 16:07 | - | |
| Notebok won't Power on/ | 2022-03-28 16:07 | - | |
| Notebook Cleaning/ | 2022-03-28 16:07 | - | |
| Notebook Graphics Trends/ | 2022-03-28 16:07 | - | |
| Notebook HDD 320GB Round up - WD 320GB Black 7200RPM Wins!/ | 2022-03-28 16:07 | - | |
| Notebook Hardware Monitor/ | 2022-03-28 16:07 | - | |
| Notebook Screen Protectors/ | 2022-03-28 16:07 | - | |
| Notebook Torture Test Winner - Toughbook CF-29/ | 2022-03-28 16:07 | - | |
| Notebook barebones and parts web site; Uniwill/ | 2022-03-28 16:07 | - | |
| Notebook boots to blank screen/ | 2022-03-28 16:07 | - | |
| Notebook for college/ | 2022-03-28 16:07 | - | |
| Noticeable difference between C2D 1.66ghz and 2.0ghz/ | 2022-03-28 16:07 | - | |
| Novatech Nomad Extreme Dual Core 13/ | 2022-03-28 16:07 | - | |
| Novatech X15 GT/ | 2022-03-28 16:07 | - | |
| Novatech X50/ | 2022-03-28 16:07 | - | |
| Novatech X50 MV Pro User Review/ | 2022-03-28 16:07 | - | |
| Novatech x50 vs pcspecialist similar spec/ | 2022-03-28 16:07 | - | |
| Novatech x70/ | 2022-03-28 16:07 | - | |
| Now, wich Zepto do I buy/ | 2022-03-28 16:07 | - | |
| Now I'm getty antsy/ | 2022-03-28 16:07 | - | |
| Now T7300 disappears from 14 Znotes/ | 2022-03-28 16:07 | - | |
| No wireless on Zepto 3415w/ | 2022-03-28 16:07 | - | |
| Nox 14 poor UK spec/ | 2022-03-28 16:07 | - | |
| Nox A14 - first review -)/ | 2022-03-28 16:07 | - | |
| Nox A14 Windows 7 Zepto Utilities Problem/ | 2022-03-28 16:07 | - | |
| Nox A14 screen quality - what's it like/ | 2022-03-28 16:07 | - | |
| Nox A15 CMOS-Battery/ | 2022-03-28 16:07 | - | |
| Nox A15 GeForce 9650M GT - driver update/ | 2022-03-28 16:07 | - | |
| Nox A15 Gpu Replacement. Hard Drive questions/ | 2022-03-28 16:07 | - | |
| Nox A15 new BIOS 4638 (26 05-2009)/ | 2022-03-28 16:07 | - | |
| Nox A15 stuck at BIOS SCREEN/ | 2022-03-28 16:07 | - | |
| Nox A15 too heavy to carry around daily/ | 2022-03-28 16:07 | - | |
| Nox a14 unknown device, wlan/ | 2022-03-28 16:07 | - | |
| Nox fan cover bent/ | 2022-03-28 16:07 | - | |
| Nox screen hinge broke/ | 2022-03-28 16:07 | - | |
| Number Pad on the compal ILF90/ | 2022-03-28 16:07 | - | |
| Numlock problems help/ | 2022-03-28 16:07 | - | |
| Nvidia 260m 280m GTX/ | 2022-03-28 16:07 | - | |
| Nvidia Died and Ati doesn't light up. Now what/ | 2022-03-28 16:07 | - | |
| Nvidia Driver in Linux = black screen/ | 2022-03-28 16:07 | - | |
| Nvidia chip problem/ | 2022-03-28 16:07 | - | |
| Nvidia report heating issue/ | 2022-03-28 16:07 | - | |
| Nvidia settlement for defective GPUs ---- I'm left out/ | 2022-03-28 16:07 | - | |
| OC'n s41 8600GS/ | 2022-03-28 16:07 | - | |
| OC GPU is ok but CPU/ | 2022-03-28 16:07 | - | |
| OCZ's support/ | 2022-03-28 16:07 | - | |
| OCZ + Nvidia 260/ | 2022-03-28 16:07 | - | |
| OCZ- What graphic settings do you have for Crysis- Warhead/ | 2022-03-28 16:07 | - | |
| OCZ 17 whitebook qx9300 with RAID 0 120gb SSD ocz/ | 2022-03-28 16:07 | - | |
| OCZ 840 AW M17 Upgradeability/ | 2022-03-28 16:07 | - | |
| OCZ 840 with XP -- pros & cons/ | 2022-03-28 16:07 | - | |
| OCZ 3870 Standard MXMIII/ | 2022-03-28 16:07 | - | |
| OCZ ATI drivers/ | 2022-03-28 16:07 | - | |
| OCZ Arima w840 Measurement/ | 2022-03-28 16:07 | - | |
| OCZDIY17A2-BM88XT SLI Upgrade/ | 2022-03-28 16:07 | - | |
| OCZDIY17A2-BM88XTX2 Wake on LAN Support/ | 2022-03-28 16:07 | - | |
| OCZDIY17A2-DM88XTX2 Intel VT support/ | 2022-03-28 16:07 | - | |
| OCZDIY17B1-Us and video/ | 2022-03-28 16:07 | - | |
| OCZDIY17B1 sound and mouse 'freezing'/ | 2022-03-28 16:07 | - | |
| OCZ DIY 17 Gaming Notebook - Intel - ATI CrossFire Edition--WebPage Up with Specs & XP Vista Drivers/ | 2022-03-28 16:07 | - | |
| OCZ DIY Kits MXM/ | 2022-03-28 16:07 | - | |
| OCZ Drivers/ | 2022-03-28 16:07 | - | |
| OCZ Force Extreme 840 from XoticPC/ | 2022-03-28 16:07 | - | |
| OCZ Hello Let's resurrect this forum, or something/ | 2022-03-28 16:07 | - | |
| OCZNBIM17A1 Good deal/ | 2022-03-28 16:07 | - | |
| OCZ Official 8.12 Drivers/ | 2022-03-28 16:07 | - | |
| OCZ Rebrands M17 Overclocking Guide - CPU & GPU/ | 2022-03-28 16:07 | - | |
| OCZ SODIMM For Mobile Intel Core 2 Extreme/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook - Build Quality Ruggedness/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook - Stock 3DMARK06 Score/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook Benchmarks - Post 'em if ya got 'em! All rebrands may participate/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook Heat Mod/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook Media Test Failure/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook Power Consumption/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook Vista install w Drivers/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook Xotic or K N/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook barebone DYI Question/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook support Hdd 10000-15000Rpm/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook unboxing/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook vs. M17/ | 2022-03-28 16:07 | - | |
| OCZ Whitebook will not turn on/ | 2022-03-28 16:07 | - | |
| OCZ and Physx/ | 2022-03-28 16:07 | - | |
| OCZ mods invading my space/ | 2022-03-28 16:07 | - | |
| OCZ to support the HD4k Series M98XT/ | 2022-03-28 16:07 | - | |
| OCZ whitebook Overclocking etc/ | 2022-03-28 16:07 | - | |
| OCZ whitebook and Zalman nc200/ | 2022-03-28 16:07 | - | |
| OCZ with twin 4870s/ | 2022-03-28 16:07 | - | |
| OC go7600, NHC & Nvidia PowerMizer yes no/ | 2022-03-28 16:07 | - | |
| ODD Bracket for HGL-30/ | 2022-03-28 16:07 | - | |
| ODM of laptops on alibaba/ | 2022-03-28 16:07 | - | |
| OEMBIOS Files/ | 2022-03-28 16:07 | - | |
| OEM Vista VS Vista/ | 2022-03-28 16:07 | - | |
| OEM for the new Sandy Bridge NB/ | 2022-03-28 16:07 | - | |
| OEM notebook won't power up/ | 2022-03-28 16:07 | - | |
| OFFICIAL Gateway Creator Series Model- GWTN156-3 i5-10300H W RTX 2060/ | 2022-03-28 16:07 | - | |
| OH MAN! Destroyed my Keyboard!/ | 2022-03-28 16:07 | - | |
| OK, so OCZ Whitebook it is. Best vendor price/ | 2022-03-28 16:07 | - | |
| OLPC XO Review/ | 2022-03-28 16:07 | - | |
| ORCA 90Fx2 - MOST POWERFUL LAPTOP ON EARTH!/ | 2022-03-28 16:07 | - | |
| OSD in Windows Vista/ | 2022-03-28 16:07 | - | |
| Oblivion on HEL80/ | 2022-03-28 16:07 | - | |
| Ocz 15 Diy/ | 2022-03-28 16:07 | - | |
| Ocz 17 is it good bad or ugly/ | 2022-03-28 16:07 | - | |
| Ocz Force Extreme 840 & Raid/ | 2022-03-28 16:07 | - | |
| Ocz WhiteBook Performance/ | 2022-03-28 16:07 | - | |
| Oczdiy17b1/ | 2022-03-28 16:07 | - | |
| Ocz whitebook drivers, raid setup and SO performance/ | 2022-03-28 16:07 | - | |
| Ocz whitebook quick questions/ | 2022-03-28 16:07 | - | |
| Odd Problems/ | 2022-03-28 16:07 | - | |
| Official TongfangGM7MG0R Drivers Bios/ | 2022-03-28 16:07 | - | |
| Official notes for Mythos G15/ | 2022-03-28 16:07 | - | |
| Ogio Metroid. Will the HEL80 fit/ | 2022-03-28 16:07 | - | |
| Oh no, insane discount/ | 2022-03-28 16:07 | - | |
| Ok, I guess I'm in/ | 2022-03-28 16:07 | - | |
| Old - Intel-TongFang QC7 (Element Fusion 15 MAG-15 Vapor 15 Pro)/ | 2022-03-28 16:07 | - | |
| Old Nexus BIOS/ | 2022-03-28 16:07 | - | |
| Old nec notebook i`m searching/ | 2022-03-28 16:07 | - | |
| Olidata Conte/ | 2022-03-28 16:07 | - | |
| Omg Plz Help!!!!/ | 2022-03-28 16:07 | - | |
| Omnipass + Firefox 2.0 == 40% CPU !/ | 2022-03-28 16:07 | - | |
| Omnipass Alternative/ | 2022-03-28 16:07 | - | |
| Omnipass not working/ | 2022-03-28 16:07 | - | |
| Omnipass problems on HEL80... -(/ | 2022-03-28 16:07 | - | |
| On Screen Display/ | 2022-03-28 16:07 | - | |
| Onboard NIC died !/ | 2022-03-28 16:07 | - | |
| Once again, these guys are just amazing!/ | 2022-03-28 16:07 | - | |
| One USB port not responding on Znote6324/ | 2022-03-28 16:07 | - | |
| One extremely satisfied portable one customer/ | 2022-03-28 16:07 | - | |
| Online PDF Manual for Flextronics W840-DI First Edition/ | 2022-03-28 16:07 | - | |
| Online store which has HGL30 and ships internationaly/ | 2022-03-28 16:07 | - | |
| Open and destroy case for reach graphic card -IFL90/ | 2022-03-28 16:07 | - | |
| Opentec australian-made notebook computers/ | 2022-03-28 16:07 | - | |
| Operating Systems and Zepto/ | 2022-03-28 16:07 | - | |
| Opininons on Medion Erazer Defender P15 NH77EPY in UK/ | 2022-03-28 16:07 | - | |
| Opinions on MDG Horizon Laptops/ | 2022-03-28 16:07 | - | |
| Opinions on QUANTA Notebooks/ | 2022-03-28 16:07 | - | |
| Opinions wanted on Zepto 2425W Vs 6615WD/ | 2022-03-28 16:07 | - | |
| Optimal in game settings for the major games/ | 2022-03-28 16:07 | - | |
| Optimed P1 Image/ | 2022-03-28 16:07 | - | |
| Ordered PowerPro J 10-15 today, my wallet hurts but im excited!/ | 2022-03-28 16:07 | - | |
| Ordered my IFL90 from Zipzoomfly/ | 2022-03-28 16:07 | - | |
| Ordered my ifl90/ | 2022-03-28 16:07 | - | |
| Ordered new ram/ | 2022-03-28 16:07 | - | |
| Ordering Woes/ | 2022-03-28 16:07 | - | |
| Ordering a 6625WD/ | 2022-03-28 16:07 | - | |
| Ordering a Compal !FL90/ | 2022-03-28 16:07 | - | |
| Ordering a Zepto from France...is that really possible/ | 2022-03-28 16:07 | - | |
| Ordering a cooling fan/ | 2022-03-28 16:07 | - | |
| Order me a Nox/ | 2022-03-28 16:07 | - | |
| Origin Evo15-S AND Eon15-S - New 2017 Versions Announced at E3/ | 2022-03-28 16:07 | - | |
| Origin Laptops EON15-s and EVON15-s How is the sound on these Laptops/ | 2022-03-28 16:07 | - | |
| Origin PC/ | 2022-03-28 16:07 | - | |
| OriginPC EVO15-S and EVO15-S pro/ | 2022-03-28 16:07 | - | |
| Origin PC Evo17-S/ | 2022-03-28 16:07 | - | |
| Origin PCs/ | 2022-03-28 16:07 | - | |
| Orion A14 gone/ | 2022-03-28 16:07 | - | |
| Ouch, what the heck happened here/ | 2022-03-28 16:07 | - | |
| Over 2-1 2 Years With Sotec 3120x/ | 2022-03-28 16:07 | - | |
| OverClocking my Zepto Znote 6224W's Videocard/ | 2022-03-28 16:07 | - | |
| Over Powered 15-LP2 (TONGFANG GK5CN6Z) benchmarks + temps/ | 2022-03-28 16:07 | - | |
| Over Powered Laptop is not bad/ | 2022-03-28 16:07 | - | |
| Over Priced/ | 2022-03-28 16:07 | - | |
| Overam Computers/ | 2022-03-28 16:07 | - | |
| Overclock/ | 2022-03-28 16:07 | - | |
| Overclocking CPU PLL Manufacturer/ | 2022-03-28 16:07 | - | |
| Overclocking Compel Hel80 CPU and Ram/ | 2022-03-28 16:07 | - | |
| Overclocking HGL30 7600/ | 2022-03-28 16:07 | - | |
| Overclocking OCZDIY17B1 Question/ | 2022-03-28 16:07 | - | |
| Overclocking a 3415W/ | 2022-03-28 16:07 | - | |
| Overclocking and warranties/ | 2022-03-28 16:07 | - | |
| Overclocking potential in Znotes/ | 2022-03-28 16:07 | - | |
| Overclocking the Geforce 7600/ | 2022-03-28 16:07 | - | |
| Overclocking undervolting the IFL90/ | 2022-03-28 16:07 | - | |
| Overheating +bios in jft00/ | 2022-03-28 16:07 | - | |
| Overheating 6130/ | 2022-03-28 16:07 | - | |
| Overheating HGL-30/ | 2022-03-28 16:07 | - | |
| Overheating Issues, PLEASE RESPOND!!!/ | 2022-03-28 16:07 | - | |
| Overheating issue/ | 2022-03-28 16:07 | - | |
| Overheating notebook (HEL-80)/ | 2022-03-28 16:07 | - | |
| Overpowered OP-LP3 17inch version/ | 2022-03-28 16:07 | - | |
| Overpriced IFL90/ | 2022-03-28 16:07 | - | |
| P1's optimized disk/ | 2022-03-28 16:07 | - | |
| P1 Faq/ | 2022-03-28 16:07 | - | |
| P1 MX (and others) show up on cnet.com/ | 2022-03-28 16:07 | - | |
| P1 Mx A8js/ | 2022-03-28 16:07 | - | |
| P1 New Line of Laptops in 08 Wishlist -)/ | 2022-03-28 16:07 | - | |
| P1 SZ600 Series Recovery Set Questions/ | 2022-03-28 16:07 | - | |
| P1 Sony Vaio SZ7 - hard drive questions/ | 2022-03-28 16:07 | - | |
| P1 UXM520, BIOS and Virtualization/ | 2022-03-28 16:07 | - | |
| P1 transflective compared to NEC Versa Daylite/ | 2022-03-28 16:07 | - | |
| P6xxSE Prema Mod v2/ | 2022-03-28 16:07 | - | |
| P150EM upgrade to 980m or 970m/ | 2022-03-28 16:07 | - | |
| PBL21 - looking for latest BIOS/ | 2022-03-28 16:07 | - | |
| PBL21 and NVIDIA Optimus/ | 2022-03-28 16:07 | - | |
| PC-MM10 internal wireless card malfunctioning/ | 2022-03-28 16:07 | - | |
| PC-MP30 deleted partitions. help!/ | 2022-03-28 16:07 | - | |
| PC 5300 memory now avaible!/ | 2022-03-28 16:07 | - | |
| PCI Express SSD Trouble/ | 2022-03-28 16:07 | - | |
| PCI Express for averatec Notebooks/ | 2022-03-28 16:07 | - | |
| PCMCIA card jammed - help!/ | 2022-03-28 16:07 | - | |
| PCMCIA soundcard for HEL80 worth it/ | 2022-03-28 16:07 | - | |
| PC Microworks Fusion/ | 2022-03-28 16:07 | - | |
| PC Microworks repair advice/ | 2022-03-28 16:07 | - | |
| PC Specialist/ | 2022-03-28 16:07 | - | |
| PC Specialist gaming laptops - thoughts/ | 2022-03-28 16:07 | - | |
| PC card wont fit in laptop- very odd or I'm stupid/ | 2022-03-28 16:07 | - | |
| PICTURES! Inside a brand new 6130 back cover/ | 2022-03-28 16:07 | - | |
| PLEASE HELP! Medion Akoya Laptop. good or bust/ | 2022-03-28 16:07 | - | |
| PLEASE HELP SHARP AV18P BIOS Issue/ | 2022-03-28 16:07 | - | |
| PLEASE HELP me make alive my EL80 laptop/ | 2022-03-28 16:07 | - | |
| POLL- Do you use the TPM and why/ | 2022-03-28 16:07 | - | |
| POLL- How long does your battery last/ | 2022-03-28 16:07 | - | |
| PYTHON D470K option for DVD burner 2x or 4x/ | 2022-03-28 16:08 | - | |
| Packard Bell EasyNote MB88-P-003 - Problems with screen and loading Windows/ | 2022-03-28 16:07 | - | |
| Packard bell Easynote not booting up/ | 2022-03-28 16:07 | - | |
| Panasonic R3 Video Review/ | 2022-03-28 16:07 | - | |
| Panasonic Y2 and T2 Video Reviews/ | 2022-03-28 16:07 | - | |
| Parts compatibility between FL90 and JHL90/ | 2022-03-28 16:07 | - | |
| Parts for Compal/ | 2022-03-28 16:07 | - | |
| Patriot 6001 Laptop/ | 2022-03-28 16:07 | - | |
| Paying to pay/ | 2022-03-28 16:07 | - | |
| Payment options!/ | 2022-03-28 16:07 | - | |
| Pc6400 + Pc5300/ | 2022-03-28 16:07 | - | |
| Pci express remote/ | 2022-03-28 16:07 | - | |
| Pc specialist octane no display/ | 2022-03-28 16:07 | - | |
| Pegasus 670/ | 2022-03-28 16:07 | - | |
| Penryn X9000 in FL92 FL90SRR/ | 2022-03-28 16:07 | - | |
| Penryn for all Santa Rosa/ | 2022-03-28 16:07 | - | |
| Penryn in IFL90!/ | 2022-03-28 16:07 | - | |
| Penryn is coming/ | 2022-03-28 16:07 | - | |
| Penryn roadmap/ | 2022-03-28 16:07 | - | |
| Pentium-m compatible/ | 2022-03-28 16:07 | - | |
| People with Penryn share your experience here, thanks/ | 2022-03-28 16:07 | - | |
| Performance boost with ram upgrade/ | 2022-03-28 16:07 | - | |
| Persistant IRQL Not Less Than or Equal to BSODs at start up/ | 2022-03-28 16:07 | - | |
| Personalised Covers, hmmm/ | 2022-03-28 16:07 | - | |
| Petition for a swap of Fn and Ctrl/ | 2022-03-28 16:07 | - | |
| Philips Freevents X56 owners - I need your help!/ | 2022-03-28 16:07 | - | |
| Philips X53/ | 2022-03-28 16:07 | - | |
| Philips freevents 55 disaster/ | 2022-03-28 16:07 | - | |
| Philips freevents x54 black screen/ | 2022-03-28 16:07 | - | |
| Phillips X53 Hard Drive upgrade/ | 2022-03-28 16:07 | - | |
| Phoenix hyperspace compal hel80/ | 2022-03-28 16:07 | - | |
| Photos of TV CARD/ | 2022-03-28 16:07 | - | |
| PiDrive 314GB Offers Power-Efficient Storage For Raspberry Pi/ | 2022-03-28 16:07 | - | |
| Picked up New 1050 for $1050/ | 2022-03-28 16:07 | - | |
| Picking up ram/ | 2022-03-28 16:07 | - | |
| Pictures From Zeptos Open house day/ | 2022-03-28 16:07 | - | |
| Pictures of disassembling 6x14/ | 2022-03-28 16:07 | - | |
| Pictures of mixed colour combinations - 6324W w. black keyboard and the other way around/ | 2022-03-28 16:07 | - | |
| Pioneer 19 SLI/ | 2022-03-28 16:07 | - | |
| Pioneer Dual Layer DVD burner/ | 2022-03-28 16:07 | - | |
| Pioneer M57/ | 2022-03-28 16:07 | - | |
| Pioneer Notebooks/ | 2022-03-28 16:07 | - | |
| Pixel/ | 2022-03-28 16:07 | - | |
| Placed my HEL 80 order today!/ | 2022-03-28 16:07 | - | |
| Placed my HGL30 Order today/ | 2022-03-28 16:07 | - | |
| Placing Laptop in Fridge for it to work/ | 2022-03-28 16:07 | - | |
| Plagued with BSODs/ | 2022-03-28 16:07 | - | |
| Planning on buying a 3225hs/ | 2022-03-28 16:07 | - | |
| Plannning on getting an IFL90/ | 2022-03-28 16:07 | - | |
| Plastic film blocking vent/ | 2022-03-28 16:07 | - | |
| Players do not work!/ | 2022-03-28 16:07 | - | |
| Playing GRID/ | 2022-03-28 16:07 | - | |
| Please,Please please please help!!!! --( please/ | 2022-03-28 16:07 | - | |
| Please Help!!!! Trouble with compal fl90!!!/ | 2022-03-28 16:07 | - | |
| Please Help- Parity Errors (6214W)/ | 2022-03-28 16:07 | - | |
| Please help, something is wrong/ | 2022-03-28 16:07 | - | |
| Please help- error caused by device driver/ | 2022-03-28 16:07 | - | |
| Please help/ | 2022-03-28 16:07 | - | |
| Please help identify - Notebook - cheetah/ | 2022-03-28 16:07 | - | |
| Please help me choose between these two Averatecs!/ | 2022-03-28 16:07 | - | |
| Please help me determine the cheapest solution for fixing my IFL90/ | 2022-03-28 16:07 | - | |
| Please help me on thi config/ | 2022-03-28 16:07 | - | |
| Polish Zepto branch/ | 2022-03-28 16:07 | - | |
| Poll- Zepto Notebooks Startup and Shutdown Problems/ | 2022-03-28 16:07 | - | |
| Polywell Model 3015AW - Can somone comment/ | 2022-03-28 16:07 | - | |
| Poor German support/ | 2022-03-28 16:07 | - | |
| Poor Keyboards/ | 2022-03-28 16:07 | - | |
| Poor build quality/ | 2022-03-28 16:07 | - | |
| Poor customer service/ | 2022-03-28 16:07 | - | |
| Poor performance Kingston v100 SSD in SN12E2/ | 2022-03-28 16:07 | - | |
| Portable 1 MX - convince me please/ | 2022-03-28 16:07 | - | |
| Portable One (Pls Reply)/ | 2022-03-28 16:07 | - | |
| Portable One...WX ! !/ | 2022-03-28 16:07 | - | |
| Portable One= The BEST in Customer Service/ | 2022-03-28 16:07 | - | |
| Portable One MX!/ | 2022-03-28 16:07 | - | |
| PortableOne Notebook Question/ | 2022-03-28 16:07 | - | |
| PortableOne SX -vs- Thinkpad T60/ | 2022-03-28 16:07 | - | |
| Portable One SX Question/ | 2022-03-28 16:07 | - | |
| Portable One UX vs. SX model/ | 2022-03-28 16:07 | - | |
| Portable One WX Series/ | 2022-03-28 16:07 | - | |
| Portable One new release/ | 2022-03-28 16:07 | - | |
| PortableOne where are your UX/ | 2022-03-28 16:07 | - | |
| Portableone MX...the perfect notebook for a student/ | 2022-03-28 16:07 | - | |
| Portableone UX- first impressions/ | 2022-03-28 16:07 | - | |
| Portables4Gamers Comparison- HD3870 x2 vs 8800M GTX SLi/ | 2022-03-28 16:07 | - | |
| Positive experience working with M-Tech/ | 2022-03-28 16:07 | - | |
| Possible 6124W/ | 2022-03-28 16:07 | - | |
| Possible CPU Upgrade for IFL90/ | 2022-03-28 16:07 | - | |
| Possible Power Jack Short 2370/ | 2022-03-28 16:07 | - | |
| Possible issues with the HM250JI HDD/ | 2022-03-28 16:07 | - | |
| Possible problems that cause startup failure in 3200/ | 2022-03-28 16:07 | - | |
| Possible replacement 6 cell batteries for Znote 6xx4 6xx5 series/ | 2022-03-28 16:07 | - | |
| Possible to Enable Virtualization/ | 2022-03-28 16:07 | - | |
| Possible to create restore media (and other noob questions)/ | 2022-03-28 16:07 | - | |
| Possible to get IFL 90 w o processor/ | 2022-03-28 16:07 | - | |
| Possible upgrade for HEL80/ | 2022-03-28 16:07 | - | |
| Possibly looking to sell 6214W/ | 2022-03-28 16:07 | - | |
| Possibly selling/ | 2022-03-28 16:07 | - | |
| Post here with your Averatec 'Repair Dept' horror stories/ | 2022-03-28 16:07 | - | |
| Post you idle temps/ | 2022-03-28 16:07 | - | |
| Power Issues/ | 2022-03-28 16:07 | - | |
| Power Plug Jack Connector Vizio/ | 2022-03-28 16:07 | - | |
| PowerPro 10-15 with 4965AGN question/ | 2022-03-28 16:07 | - | |
| PowerPro 15-2 falling apart after a year; is this normal/ | 2022-03-28 16:07 | - | |
| PowerPro J 10-14 (Compal FT00) are now in Country and will begin shipping next week!/ | 2022-03-28 16:07 | - | |
| PowerPro J 10-15 (Compal IFL90) w WSXGA+ screens will resume shipping by August 16th/ | 2022-03-28 16:07 | - | |
| Power Pro J 10-15 (IFL90)/ | 2022-03-28 16:07 | - | |
| PowerPro L 8-15 SUPRA and Crown P 15-2 SUPRA/ | 2022-03-28 16:07 | - | |
| PowerPro P 11-12/ | 2022-03-28 16:07 | - | |
| PowerPro and Sager... What's the difference/ | 2022-03-28 16:07 | - | |
| PowerPro and or Mwave/ | 2022-03-28 16:07 | - | |
| PowerProducer No Rcgnz DVD as burner on AV6130HS/ | 2022-03-28 16:07 | - | |
| Power Pro lpatops/ | 2022-03-28 16:07 | - | |
| PowerPro vs. Sager/ | 2022-03-28 16:07 | - | |
| Power Receptacle Problem- 1050 EB1/ | 2022-03-28 16:07 | - | |
| Power Settings, turn off screen option/ | 2022-03-28 16:07 | - | |
| Power Supplies/ | 2022-03-28 16:07 | - | |
| Power Supply/ | 2022-03-28 16:07 | - | |
| Power Supply 6130/ | 2022-03-28 16:07 | - | |
| Power Supply in Znote 6314W/ | 2022-03-28 16:07 | - | |
| Powermizer/ | 2022-03-28 16:07 | - | |
| Powernotebook Phone Price/ | 2022-03-28 16:07 | - | |
| Power releted(for lack of better subject )/ | 2022-03-28 16:07 | - | |
| Pre-Order Zepto/ | 2022-03-28 16:07 | - | |
| Preliminary Info on NEW Compal IFL90 IFL91 IFT01 IFT00/ | 2022-03-28 16:07 | - | |
| Preliminary Review of the Averatec 6130HS-20/ | 2022-03-28 16:07 | - | |
| Press Release- The PowerPro J 10-15 (Compal IFL90) w WXGA screens are IN THE WAREHOU/ | 2022-03-28 16:08 | - | |
| Pricing errors on UK site/ | 2022-03-28 16:08 | - | |
| Privacy filter/ | 2022-03-28 16:08 | - | |
| ProStar... What/ | 2022-03-28 16:08 | - | |
| ProStar 9191/ | 2022-03-28 16:08 | - | |
| ProStar Laptop/ | 2022-03-28 16:08 | - | |
| Pro Tools Problem/ | 2022-03-28 16:08 | - | |
| Problem after installing driver for tvtuner/ | 2022-03-28 16:08 | - | |
| Problem free OCZ Whitebook/ | 2022-03-28 16:08 | - | |
| Problem installing 2x2gb ram on HEL80/ | 2022-03-28 16:08 | - | |
| Problem powering up my 6130-HS/ | 2022-03-28 16:08 | - | |
| Problem reconnecting touchpad to motherboard/ | 2022-03-28 16:08 | - | |
| Problems Installing VISTA w IFL-90/ | 2022-03-28 16:08 | - | |
| Problems docking the 6625wd to it's dockingstation/ | 2022-03-28 16:08 | - | |
| Problems with 6024W after 10 months/ | 2022-03-28 16:08 | - | |
| Problems with 6214W (want to remove dust)/ | 2022-03-28 16:08 | - | |
| Problems with 6214w/ | 2022-03-28 16:08 | - | |
| Problems with 6615, where is Zepto Finland/ | 2022-03-28 16:08 | - | |
| Problems with Averatec 2370 keyboard/ | 2022-03-28 16:08 | - | |
| Problems with Averatec 6130HS/ | 2022-03-28 16:08 | - | |
| Problems with CDR RW/ | 2022-03-28 16:08 | - | |
| Problems with FL90/ | 2022-03-28 16:08 | - | |
| Problems with Nox A15 (and horrible customer care)/ | 2022-03-28 16:08 | - | |
| Problems with Samsung DVD-Rom/ | 2022-03-28 16:08 | - | |
| Problems with Zepto 6625WD/ | 2022-03-28 16:08 | - | |
| Problems with a new HEL80/ | 2022-03-28 16:08 | - | |
| Problems with connecting headset/ | 2022-03-28 16:08 | - | |
| Problems with extra monitor for Znote 6324/ | 2022-03-28 16:08 | - | |
| Problems with games freezing/ | 2022-03-28 16:08 | - | |
| Problems with my screen, Hel80/ | 2022-03-28 16:08 | - | |
| Problems with setting up Raid-0 with Whitebook/ | 2022-03-28 16:08 | - | |
| Problems with the card reader on 6224W/ | 2022-03-28 16:08 | - | |
| Problems with wireless card zepto 3215W/ | 2022-03-28 16:08 | - | |
| Problem to buy/ | 2022-03-28 16:08 | - | |
| Problem with 6124W hard drive/ | 2022-03-28 16:08 | - | |
| Problem with 6615WD/ | 2022-03-28 16:08 | - | |
| Problem with 8600m stuttering slowdown found/ | 2022-03-28 16:08 | - | |
| Problem with Atheros Wireless Driver on Hannspree SN12E2/ | 2022-03-28 16:08 | - | |
| Problem with Firewire/ | 2022-03-28 16:08 | - | |
| Problem with HEL80 dvd burner/ | 2022-03-28 16:08 | - | |
| Problem with HGL30 dvd rw drive/ | 2022-03-28 16:08 | - | |
| Problem with IFL90 Screen on Reset/ | 2022-03-28 16:08 | - | |
| Problem with Keyboard...Dead Key/ | 2022-03-28 16:08 | - | |
| Problem with Medion Akoya EX with PC Projectors/ | 2022-03-28 16:08 | - | |
| Problem with RAM upgrade on HEL81/ | 2022-03-28 16:08 | - | |
| Problem with Vista, FlyTV Express and LifeView MVP/ | 2022-03-28 16:08 | - | |
| Problem with a screw/ | 2022-03-28 16:08 | - | |
| Problem with gf 8600m gt/ | 2022-03-28 16:08 | - | |
| Problem with resuming/ | 2022-03-28 16:08 | - | |
| Problem with wifi switch on HEL-80/ | 2022-03-28 16:08 | - | |
| Problem with wireless/ | 2022-03-28 16:08 | - | |
| Problem with wireless card on ifl90 np2090/ | 2022-03-28 16:08 | - | |
| Programable buttons 1 and 2/ | 2022-03-28 16:08 | - | |
| Pros Cons of switching to the Asus G1S/ | 2022-03-28 16:08 | - | |
| Prostar 5722 Thinking of buying/ | 2022-03-28 16:08 | - | |
| Protector Suite QL (Sager NP2090, but maybe relevant to others)/ | 2022-03-28 16:08 | - | |
| Protector Suite and Firefox 2.0/ | 2022-03-28 16:08 | - | |
| Psystar offers OSX with Blu-Ray, will offer OSX Notebook/ | 2022-03-28 16:08 | - | |
| Purchased HGL30 Few Quick Questions/ | 2022-03-28 16:08 | - | |
| Purchased Nagamaki (Arima W840 DI) -- Check out the hard drives!/ | 2022-03-28 16:08 | - | |
| Pushed in wrong card/ | 2022-03-28 16:08 | - | |
| Put a second HDD (or SSD) in stead of DVD drive/ | 2022-03-28 16:08 | - | |
| Putting my order in for a HEL80 from powernotebooks.com tomorrow/ | 2022-03-28 16:08 | - | |
| Q-Charging Button (IFL90)/ | 2022-03-28 16:08 | - | |
| Q9000 FSB overclocking in Whitebook/ | 2022-03-28 16:08 | - | |
| QAL30 Questions !/ | 2022-03-28 16:08 | - | |
| QAL50 Replacement Adapter [Help Finding one]/ | 2022-03-28 16:08 | - | |
| QLButton problem (6214W)/ | 2022-03-28 16:08 | - | |
| QUANTA NL5A - Help with the Touchpad/ | 2022-03-28 16:08 | - | |
| QUANTA NL5A - feedback needed/ | 2022-03-28 16:08 | - | |
| Qal-15/ | 2022-03-28 16:08 | - | |
| Qal51/ | 2022-03-28 16:08 | - | |
| Qal51 bios password reset/ | 2022-03-28 16:08 | - | |
| Quad-core in 15 DIY/ | 2022-03-28 16:08 | - | |
| Quality of Compal IFL90/ | 2022-03-28 16:08 | - | |
| Quality of ECS Notebooks (ECS 600)/ | 2022-03-28 16:08 | - | |
| Quanta- any new opinions/ | 2022-03-28 16:08 | - | |
| Quanta KN1-PM, alternative to Asus Z71V/ | 2022-03-28 16:08 | - | |
| Quanta KN1 vs MW1/ | 2022-03-28 16:08 | - | |
| Quanta KN Series Logo/ | 2022-03-28 16:08 | - | |
| Quanta MW1 bios v. q3b81/ | 2022-03-28 16:08 | - | |
| Quanta NL5E/ | 2022-03-28 16:08 | - | |
| Quanta NL8K/ | 2022-03-28 16:08 | - | |
| Quanta NLCA chassis for RTX 2070/ | 2022-03-28 16:08 | - | |
| Quanta Quanta HW1A B quality/ | 2022-03-28 16:08 | - | |
| Quanta SW1 out. 14 widescreen/ | 2022-03-28 16:08 | - | |
| Quanta TW3M/ | 2022-03-28 16:08 | - | |
| Quanta nl9k/ | 2022-03-28 16:08 | - | |
| Quanta random shutdown/ | 2022-03-28 16:08 | - | |
| Questians about 6615WD-/ | 2022-03-28 16:08 | - | |
| Question Regarding Overheat Shutdown Temp on IFL90/ | 2022-03-28 16:08 | - | |
| Question about 3650M GDDR3 Vbios file/ | 2022-03-28 16:08 | - | |
| Question about CPU-fan and DTS calibration !/ | 2022-03-28 16:08 | - | |
| Question about CPUmarks/ | 2022-03-28 16:08 | - | |
| Question about Smart battery/ | 2022-03-28 16:08 | - | |
| Question about VGNSZ730EC/ | 2022-03-28 16:08 | - | |
| Question about WSXGA+/ | 2022-03-28 16:08 | - | |
| Question about Xoticpc and the 840/ | 2022-03-28 16:08 | - | |
| Question about battery/ | 2022-03-28 16:08 | - | |
| Question about compal internal tv tuner card/ | 2022-03-28 16:08 | - | |
| Question about finger print software/ | 2022-03-28 16:08 | - | |
| Question about laptop sleeves and backpacks/ | 2022-03-28 16:08 | - | |
| Question about old Compal model (Compal CR10)/ | 2022-03-28 16:08 | - | |
| Question about resolution of Compal IFL90 Webcam/ | 2022-03-28 16:08 | - | |
| Question about the i7 CN15/ | 2022-03-28 16:08 | - | |
| Question about the whitebook lid/ | 2022-03-28 16:08 | - | |
| Question for HGL 30 Owners/ | 2022-03-28 16:08 | - | |
| Question for PowerNotebooks/ | 2022-03-28 16:08 | - | |
| Question on Compal HEL80/ | 2022-03-28 16:08 | - | |
| Question on the 9600 in the a15/ | 2022-03-28 16:08 | - | |
| Question regarding m4000 keyboard, Silver White/ | 2022-03-28 16:08 | - | |
| Question regarding the Compal HEL 80 notebook/ | 2022-03-28 16:08 | - | |
| Questions About The P35Wv2-CF5 Gaming Laptop from Newegg.com (802.11 AC & Laptop Color)/ | 2022-03-28 16:08 | - | |
| Questions about 3415W 6224W 6625W/ | 2022-03-28 16:08 | - | |
| Questions about Compal HEL80/ | 2022-03-28 16:08 | - | |
| Questions about Compal IFL-90.. touchpad scrolling, and DVD-drive noisy/ | 2022-03-28 16:08 | - | |
| Questions about HEL 80/ | 2022-03-28 16:08 | - | |
| Questions about bluetooth accessories for HEL80 Bluetooth capable notebook/ | 2022-03-28 16:08 | - | |
| Questions about drivers and OS/ | 2022-03-28 16:08 | - | |
| Questions about my Averatec 3270 purchase/ | 2022-03-28 16:08 | - | |
| Questions about the Compal/ | 2022-03-28 16:08 | - | |
| Questions about the HGL30/ | 2022-03-28 16:08 | - | |
| Questions about the PCMW Impulse alias 6224w/ | 2022-03-28 16:08 | - | |
| Questions about the new Compal JFL92/ | 2022-03-28 16:08 | - | |
| Questions on getting an IFL90 from ZZF/ | 2022-03-28 16:08 | - | |
| Questions on the 6224w!/ | 2022-03-28 16:08 | - | |
| Questions regarding future UX or MX purchase/ | 2022-03-28 16:08 | - | |
| Questions regarding the 4100 4200/ | 2022-03-28 16:08 | - | |
| Questions regarding the Sager 2090 Compal IFL90/ | 2022-03-28 16:08 | - | |
| Quick Launch Buttons FL90/ | 2022-03-28 16:08 | - | |
| Quick Notebook Review for Newcomers. (If you own it Pls grade Rate it)/ | 2022-03-28 16:08 | - | |
| Quick Q/ | 2022-03-28 16:08 | - | |
| Quick Summary/ | 2022-03-28 16:08 | - | |
| Quick question about Drivers/ | 2022-03-28 16:08 | - | |
| Quick question regarding the 3415W battery/ | 2022-03-28 16:08 | - | |
| Quick questions regarding Merom + gfx on 2425/ | 2022-03-28 16:08 | - | |
| Qx 9300 Cpu/ | 2022-03-28 16:08 | - | |
| R6-Vegas on HGL-30/ | 2022-03-28 16:08 | - | |
| RAM for overclocking/ | 2022-03-28 16:08 | - | |
| RAM on the IFL90/ | 2022-03-28 16:08 | - | |
| RAM performance, Corsair vs. other brands/ | 2022-03-28 16:08 | - | |
| RAM upgrade/ | 2022-03-28 16:08 | - | |
| RD10 how to boot into a cd/ | 2022-03-28 16:08 | - | |
| RECOIL II v EON15-S - 62Wh battery upgrade question/ | 2022-03-28 16:08 | - | |
| RJ Tech/ | 2022-03-28 16:08 | - | |
| RMA'd your Averatec with good results, please post/ | 2022-03-28 16:08 | - | |
| RMA Case - Update/ | 2022-03-28 16:08 | - | |
| RMClock causes IFL90 + Vista32bit to thrash HD/ | 2022-03-28 16:08 | - | |
| RMclock and the IFL90- question about IDA/ | 2022-03-28 16:08 | - | |
| ROCK Laptops, opinions/ | 2022-03-28 16:08 | - | |
| RTX 2060 VBIOS 2x MiniDP/ | 2022-03-28 16:08 | - | |
| RaLink Wireless Card and scrambled screen issues/ | 2022-03-28 16:08 | - | |
| Ralink problem/ | 2022-03-28 16:08 | - | |
| Ram/ | 2022-03-28 16:08 | - | |
| Ram Upgrade question/ | 2022-03-28 16:08 | - | |
| Ram gets pretty warm/ | 2022-03-28 16:08 | - | |
| Ram or CPU Check my order before buy/ | 2022-03-28 16:08 | - | |
| Ram problem/ | 2022-03-28 16:08 | - | |
| Ram software/ | 2022-03-28 16:08 | - | |
| Random Crashes while booting with Compal HLB2 (MySN HLB2 MG6)/ | 2022-03-28 16:08 | - | |
| Random Ie firefox windows opening/ | 2022-03-28 16:08 | - | |
| Random Restart Issue - 2425w/ | 2022-03-28 16:08 | - | |
| Random Shutdowns/ | 2022-03-28 16:08 | - | |
| Random beep noise/ | 2022-03-28 16:08 | - | |
| Random reboots/ | 2022-03-28 16:08 | - | |
| Raspberry Pi/ | 2022-03-28 16:08 | - | |
| Raspberry Pi 2 unveiled with faster quad processor and more memory/ | 2022-03-28 16:08 | - | |
| Raspberry Pi 3 Offers Big Performance Leap, Same $35 Price built in Wifi -Bluetooth/ | 2022-03-28 16:08 | - | |
| Raspberry Pi Model B+ arrives with four USB ports, microSD slot $35/ | 2022-03-28 16:08 | - | |
| Raspberry Pi finally offers an official starter kit after passing 10M sales/ | 2022-03-28 16:08 | - | |
| Raven X6 New Laptop/ | 2022-03-28 16:08 | - | |
| RawBook 2550! drooool/ | 2022-03-28 16:08 | - | |
| Raw Power Notebook Systems/ | 2022-03-28 16:08 | - | |
| Raw Power pc. Question/ | 2022-03-28 16:08 | - | |
| Razer Blade 2014 Help/ | 2022-03-28 16:08 | - | |
| Razorbook 400 CE - what do you think/ | 2022-03-28 16:08 | - | |
| Re- Portable One TZ100 Image/ | 2022-03-28 16:08 | - | |
| Read my Review/ | 2022-03-28 16:08 | - | |
| ReadyDrive ReadyBoost problems/ | 2022-03-28 16:08 | - | |
| Readyboost and it's usefulness/ | 2022-03-28 16:08 | - | |
| Real IFL90 weight/ | 2022-03-28 16:08 | - | |
| Real extent of 6224 problems/ | 2022-03-28 16:08 | - | |
| Real in game benchmarks from the major games/ | 2022-03-28 16:08 | - | |
| Reallife pictures of the Zepto Nox and the Zepto Mythos/ | 2022-03-28 16:08 | - | |
| Really Loud Multi Drive on HEL80/ | 2022-03-28 16:08 | - | |
| Realtek HD audio - spdif no light/ | 2022-03-28 16:08 | - | |
| Realtek SPDIF Optical Out Problem/ | 2022-03-28 16:08 | - | |
| Realtek sound drivers/ | 2022-03-28 16:08 | - | |
| Reappearing screen scuff on 3220HS/ | 2022-03-28 16:08 | - | |
| Rebooting my CompalIFL90 Sager2090 ... + cds they gave us + linux questions/ | 2022-03-28 16:08 | - | |
| Received my 6324W yesterday/ | 2022-03-28 16:08 | - | |
| Received my 6625WD!/ | 2022-03-28 16:08 | - | |
| Recoil 3 TongFang GK7CP7S reviews/ | 2022-03-28 16:08 | - | |
| Recommendation - Mini PCI WLAN Card replacement for 2100 series/ | 2022-03-28 16:08 | - | |
| Recommended Universal AC Adapter for HEL80 Sager NP2080/ | 2022-03-28 16:08 | - | |
| Reconsider buying from dennedusa.com/ | 2022-03-28 16:08 | - | |
| Record from a Bios Flash/ | 2022-03-28 16:08 | - | |
| Recording from mixer/ | 2022-03-28 16:08 | - | |
| Recording sound with a 6324W in vista a nogo/ | 2022-03-28 16:08 | - | |
| Recovering many Averatec's supplied with no recovery CDs/ | 2022-03-28 16:08 | - | |
| Recovery CD Revisited/ | 2022-03-28 16:08 | - | |
| Recovery Partition/ | 2022-03-28 16:08 | - | |
| Recurring GPU driver crash with HD 8970M in a P170SM/ | 2022-03-28 16:08 | - | |
| Redoing the OS/ | 2022-03-28 16:08 | - | |
| Reformated IFL90/ | 2022-03-28 16:08 | - | |
| Reformatting HGL-30/ | 2022-03-28 16:08 | - | |
| Refurbished/ | 2022-03-28 16:08 | - | |
| Refurbished FL90 92/ | 2022-03-28 16:08 | - | |
| Reinstalling Win XP on Averatec 3200/ | 2022-03-28 16:08 | - | |
| Reinstall with AHCI or without AHCI & Vista 32 64 Bits/ | 2022-03-28 16:08 | - | |
| Release Date For White 6214w/ | 2022-03-28 16:08 | - | |
| Reliable, worth the cost gaming graphic rigs/ | 2022-03-28 16:08 | - | |
| Remapping Mail and internet hotkeys/ | 2022-03-28 16:08 | - | |
| Remote/ | 2022-03-28 16:08 | - | |
| Remote control for 6625WD/ | 2022-03-28 16:08 | - | |
| Removing 6130HS-20 monitor/ | 2022-03-28 16:08 | - | |
| Removing optical drive (Arima W840)/ | 2022-03-28 16:08 | - | |
| Removing the hinge cover on JFL92/ | 2022-03-28 16:08 | - | |
| Removing the keyboard on a cn15/ | 2022-03-28 16:08 | - | |
| Repairs - RMA case/ | 2022-03-28 16:08 | - | |
| Replace Compal HEL-80 screen/ | 2022-03-28 16:08 | - | |
| Replace hinge on Zepto 6214W/ | 2022-03-28 16:08 | - | |
| Replacement 3415W power adapter/ | 2022-03-28 16:08 | - | |
| Replacement Motherboard Help/ | 2022-03-28 16:08 | - | |
| Replacement Touch Pad/ | 2022-03-28 16:08 | - | |
| Replacement keyboard/ | 2022-03-28 16:08 | - | |
| Replacement lid and lcd/ | 2022-03-28 16:08 | - | |
| Replacement screen for 6615WD/ | 2022-03-28 16:08 | - | |
| Replacing 46wh battery on RP-15 chassis computer/ | 2022-03-28 16:08 | - | |
| Replacing 2370 keyboard/ | 2022-03-28 16:08 | - | |
| Replacing Core 2 Duo with a Quad/ | 2022-03-28 16:08 | - | |
| Replacing FL 90 screen/ | 2022-03-28 16:08 | - | |
| Replacing Memory in 6130HS/ | 2022-03-28 16:08 | - | |
| Replacing ODD/ | 2022-03-28 16:08 | - | |
| Replacing a failed JFL92 DVD drive/ | 2022-03-28 16:08 | - | |
| Replacing processor/ | 2022-03-28 16:08 | - | |
| Repositioning the DVD Drive/ | 2022-03-28 16:08 | - | |
| Request - Disassembly Instructions for 2100 series/ | 2022-03-28 16:08 | - | |
| Request- HowTo integrate Bluetooth in AV1050/ | 2022-03-28 16:08 | - | |
| Request for info- IFL90 2090 Outer Sticker Slot Dimensions/ | 2022-03-28 16:08 | - | |
| Requesting Notebook Help/ | 2022-03-28 16:08 | - | |
| Require MV12W driver disc/ | 2022-03-28 16:08 | - | |
| Restore Disks/ | 2022-03-28 16:08 | - | |
| Restoring 2370/ | 2022-03-28 16:08 | - | |
| Returned Averatec 6110-EH1/ | 2022-03-28 16:08 | - | |
| Returns to Zepto/ | 2022-03-28 16:08 | - | |
| Review of 6324W by notebookjournal.de/ | 2022-03-28 16:08 | - | |
| Review of CyberPowerPC Xplorer x6-9100/ | 2022-03-28 16:08 | - | |
| Review of my problematic 6615WD/ | 2022-03-28 16:08 | - | |
| Review of the Novatek X50MV Pro (NNB-655)/ | 2022-03-28 16:08 | - | |
| Review of the Vizio 15.6 Thin & Light (The Verge)/ | 2022-03-28 16:08 | - | |
| Reviving your dead Compal IFL90 FL90 by reflowing the GPU/ | 2022-03-28 16:08 | - | |
| Ricoh R5C833 Cardreader( Compal FT02) and Windows 7 x64/ | 2022-03-28 16:08 | - | |
| Ripoff Warning - AVA Direct strikes again/ | 2022-03-28 16:08 | - | |
| Rizeon Fl90e/ | 2022-03-28 16:08 | - | |
| Rizeon IFL90 or Dell vostro/ | 2022-03-28 16:08 | - | |
| Rizeon JHL90/ | 2022-03-28 16:08 | - | |
| Rizeon JHL90 Notebook/ | 2022-03-28 16:08 | - | |
| Rizeon JHL90 XP Drivers - help D-/ | 2022-03-28 16:08 | - | |
| Rizeon M571 Notebook/ | 2022-03-28 16:08 | - | |
| Rizeon S37S/ | 2022-03-28 16:08 | - | |
| Rizeon S37S Motherboard/ | 2022-03-28 16:08 | - | |
| Rizeon S96S or Rizeon FL90 Is the extra £60 necessary/ | 2022-03-28 16:08 | - | |
| Rizeon S97V-GT/ | 2022-03-28 16:08 | - | |
| Rizeon Stock Shipping Update/ | 2022-03-28 16:08 | - | |
| Rizeon Z37s battery/ | 2022-03-28 16:08 | - | |
| Rizeon help/ | 2022-03-28 16:08 | - | |
| Rizeon in UK/ | 2022-03-28 16:08 | - | |
| Rjtech.com/ | 2022-03-28 16:08 | - | |
| Robson Turbo memory/ | 2022-03-28 16:08 | - | |
| Rock Direct - UK Clevo seller/ | 2022-03-28 16:08 | - | |
| Rock Direct - any info/ | 2022-03-28 16:08 | - | |
| Rock Direct/ | 2022-03-28 16:08 | - | |
| Rock Pegasus 650... any good/ | 2022-03-28 16:08 | - | |
| Rock Xtreme 850/ | 2022-03-28 16:08 | - | |
| Roverbook Voyager V553 - how to find out it's platform/ | 2022-03-28 16:08 | - | |
| Royal Ball Gown Floor-length Sweetheart Pink Organza Dress/ | 2022-03-28 16:08 | - | |
| Running PCMCIA and ExpressCard simultaneously on Compal/ | 2022-03-28 16:08 | - | |
| Running below native res/ | 2022-03-28 16:08 | - | |
| Running the notebook closed/ | 2022-03-28 16:08 | - | |
| S-Video in IFL90 problem/ | 2022-03-28 16:08 | - | |
| S-Video on 2425W/ | 2022-03-28 16:08 | - | |
| S-Video out on 6100 series/ | 2022-03-28 16:08 | - | |
| S-video on HEL80/ | 2022-03-28 16:08 | - | |
| S-video out on a HEL-80/ | 2022-03-28 16:08 | - | |
| S.T.A.L.K.E.R Clear Sky/ | 2022-03-28 16:08 | - | |
| S57 power up problem/ | 2022-03-28 16:08 | - | |
| S96J Won't Boot XP/ | 2022-03-28 16:08 | - | |
| S96J vs. HEL80/ | 2022-03-28 16:08 | - | |
| S96j Hel80/ | 2022-03-28 16:08 | - | |
| SA Stock/ | 2022-03-28 16:08 | - | |
| SATA Odd how can this be/ | 2022-03-28 16:08 | - | |
| SD-MW1-PM 15.0 Quanta/ | 2022-03-28 16:08 | - | |
| SDHC drivers for 4155-EH1 or other equivalent/ | 2022-03-28 16:08 | - | |
| SDHC support in Zeptos for readyboost/ | 2022-03-28 16:08 | - | |
| SHARP CV-50 Video Review/ | 2022-03-28 16:08 | - | |
| SHARP M4000 Problem/ | 2022-03-28 16:08 | - | |
| SHARP MANUALS/ | 2022-03-28 16:08 | - | |
| SHARP notebook/ | 2022-03-28 16:08 | - | |
| SHARP notebook PC-A200/ | 2022-03-28 16:08 | - | |
| SL3150HD/ | 2022-03-28 16:08 | - | |
| SN10E2 - Turn on 3G/ | 2022-03-28 16:08 | - | |
| SN10E2 10.1 Netbook Thread/ | 2022-03-28 16:08 | - | |
| SN10E2 Power off issue/ | 2022-03-28 16:08 | - | |
| SR 2/ | 2022-03-28 16:08 | - | |
| SR2 Docking Station/ | 2022-03-28 16:08 | - | |
| SSD drive for SN12E2 compatible/ | 2022-03-28 16:08 | - | |
| SWAP- Restore DVD for ROM BIOS file/ | 2022-03-28 16:08 | - | |
| SXGA Now an Option on the D470K/ | 2022-03-28 16:08 | - | |
| SX Questions & Review Request/ | 2022-03-28 16:08 | - | |
| SXS37 9 Cell Batteries/ | 2022-03-28 16:08 | - | |
| SXS37 Finally Shipping/ | 2022-03-28 16:08 | - | |
| SXS37 fingerprint reader/ | 2022-03-28 16:08 | - | |
| SXS37 vs M1330/ | 2022-03-28 16:08 | - | |
| SXS37 vs Sony SZ 640 battery life/ | 2022-03-28 16:08 | - | |
| SXS37 with integrated graphics/ | 2022-03-28 16:08 | - | |
| SX UX MX A8Js Models Questions/ | 2022-03-28 16:08 | - | |
| SX is what asus model/ | 2022-03-28 16:08 | - | |
| SX or MX Review/ | 2022-03-28 16:08 | - | |
| SX release date/ | 2022-03-28 16:08 | - | |
| SZ Meroms/ | 2022-03-28 16:08 | - | |
| Sager 2092 question/ | 2022-03-28 16:08 | - | |
| Sager 2098 (Compal KHLB2) WLAN switch not working correctly...help!/ | 2022-03-28 16:08 | - | |
| Sager 3790-V/ | 2022-03-28 16:08 | - | |
| Sager 4780/ | 2022-03-28 16:08 | - | |
| Sager 9880 (supporting GeForce Go 6800 Ultra)/ | 2022-03-28 16:08 | - | |
| Sager NP2090 COMPAL IFL90 FAQ!/ | 2022-03-28 16:08 | - | |
| Sager NP2090 COMPAL IFL90 Fan control/ | 2022-03-28 16:08 | - | |
| Sager NP2092 Compal IFL92 Battery Issue/ | 2022-03-28 16:08 | - | |
| Sager NP2098 (Built on the Compal KHLB2) - Convince Me/ | 2022-03-28 16:08 | - | |
| Sager NP3790 vs. Compal CL56 comparison/ | 2022-03-28 16:08 | - | |
| SagerNP5680 Pentium4- Extreme edition question/ | 2022-03-28 16:08 | - | |
| Sager NP5720 v vs ProStar 5722-3A/ | 2022-03-28 16:08 | - | |
| Sager Notebooks/ | 2022-03-28 16:08 | - | |
| Sager Screens/ | 2022-03-28 16:08 | - | |
| Sager computers/ | 2022-03-28 16:08 | - | |
| Sager selling Compals/ | 2022-03-28 16:08 | - | |
| Sager shipping Go 6800 Ultra and Pentium M 780/ | 2022-03-28 16:08 | - | |
| Sager uk/ | 2022-03-28 16:08 | - | |
| Sam's Club Deal On 3270 EH1/ | 2022-03-28 16:08 | - | |
| Samsung 250GB 5400rpm Vs 200GB 7200rpm Harddisks/ | 2022-03-28 16:08 | - | |
| Samsung Laptops in USA/ | 2022-03-28 16:08 | - | |
| Samsung Sonoma Alvisio-based Notebooks/ | 2022-03-28 16:08 | - | |
| Samsung V25 Help/ | 2022-03-28 16:08 | - | |
| Samsung ports Tizen to Raspberry Pi to improve the OS’ adoption/ | 2022-03-28 16:08 | - | |
| Samsung slot-in dvd burner/ | 2022-03-28 16:08 | - | |
| Samsung x360/ | 2022-03-28 16:08 | - | |
| Sata-150 300/ | 2022-03-28 16:08 | - | |
| Save up to £414 on 3145W power!/ | 2022-03-28 16:08 | - | |
| Savrow Katana WX Review/ | 2022-03-28 16:08 | - | |
| Say bye to the Drama - XOTIC OCZ 840 time/ | 2022-03-28 16:08 | - | |
| Scaling down resolution on HEL80/ | 2022-03-28 16:08 | - | |
| Schenker XMG Neo 15 - New Slim-Bezel gamin laptop with mechanical keyboard/ | 2022-03-28 16:08 | - | |
| Scratched caused by the computer itself -S !/ | 2022-03-28 16:08 | - | |
| Scratchy and slow audio/ | 2022-03-28 16:08 | - | |
| Screen, Brightness and Resolution/ | 2022-03-28 16:08 | - | |
| Screen Blank - Very Strange Circumstances/ | 2022-03-28 16:08 | - | |
| Screen Installation and Repair/ | 2022-03-28 16:08 | - | |
| Screen Issues - Clevo N150RF/ | 2022-03-28 16:08 | - | |
| Screen Trouble/ | 2022-03-28 16:08 | - | |
| Screen dimension on the UX and the MX/ | 2022-03-28 16:08 | - | |
| Screen resolution on external monitor/ | 2022-03-28 16:08 | - | |
| Screen ripples- HELP !/ | 2022-03-28 16:08 | - | |
| Screenshots/ | 2022-03-28 16:08 | - | |
| Screen went blank when gaming/ | 2022-03-28 16:08 | - | |
| Scroller on touch pad not working/ | 2022-03-28 16:08 | - | |
| Scroll lock and Caps Lock blinking on HGL30/ | 2022-03-28 16:08 | - | |
| Second Life for My 5110H/ | 2022-03-28 16:08 | - | |
| Second monitor with lid closed/ | 2022-03-28 16:08 | - | |
| Section description/ | 2022-03-28 16:08 | - | |
| Seems like we're not the only ones with Dual ATi Mobility Radeon 3870s/ | 2022-03-28 16:08 | - | |
| Self-Waking 6130HS/ | 2022-03-28 16:08 | - | |
| Self install bluetooth/ | 2022-03-28 16:08 | - | |
| Selling some parts from znote 6324/ | 2022-03-28 16:08 | - | |
| Send Your Averatec Power Switch to the North Pole/ | 2022-03-28 16:08 | - | |
| Service manual for the 6214W/ | 2022-03-28 16:08 | - | |
| Service of 6625wd keyboard & docking station/ | 2022-03-28 16:08 | - | |
| Setting BIOS to Default. How HGL30/ | 2022-03-28 16:08 | - | |
| Setting Up A Raid/ | 2022-03-28 16:08 | - | |
| Setting compal fan speed/ | 2022-03-28 16:08 | - | |
| Setting default brightness on HEL80/ | 2022-03-28 16:08 | - | |
| Setting up a Compal HEL80/ | 2022-03-28 16:08 | - | |
| Severe Overheating EVOO-LP5(Tonfang GK5CP6X)/ | 2022-03-28 16:08 | - | |
| Sexy or Stupid/ | 2022-03-28 16:08 | - | |
| Sharp Actius AL27/ | 2022-03-28 16:08 | - | |
| Sharp Actius AV18 Optical Drive Problem/ | 2022-03-28 16:08 | - | |
| Sharp Actius MC24 Reviews/ | 2022-03-28 16:08 | - | |
| Sharp Actius MM20(P) HD swap/ | 2022-03-28 16:08 | - | |
| Sharp Actius MM20/ | 2022-03-28 16:08 | - | |
| Sharp Actius MV 12 hard drive replacement/ | 2022-03-28 16:08 | - | |
| Sharp Laptop PC-A200 for Sale!/ | 2022-03-28 16:08 | - | |
| Sharp Mv1214 Switch on/ | 2022-03-28 16:08 | - | |
| Sharp PC-6200 6220/ | 2022-03-28 16:08 | - | |
| Sharp PC-AL27 Memory Upgrade Problem/ | 2022-03-28 16:08 | - | |
| Sharp PC-MV1214 HELP drivers/ | 2022-03-28 16:08 | - | |
| Sharp PC-MV1214 Laptop- Really Need drivers restore discs please/ | 2022-03-28 16:08 | - | |
| Shinelon ( )/ | 2022-03-28 16:08 | - | |
| Shinelon Destroyer/ | 2022-03-28 16:08 | - | |
| Shinza Sleeve w 6130HS/ | 2022-03-28 16:08 | - | |
| Shipping date of the PowerPro J 10-15 (Compal IFL90) delayed until late June...but the WSXGA+ IS the 8600 GT/ | 2022-03-28 16:08 | - | |
| Shipping for IFL90 Sager 2090/ | 2022-03-28 16:08 | - | |
| Shipping to Canada/ | 2022-03-28 16:08 | - | |
| Shops/ | 2022-03-28 16:08 | - | |
| Short battery life/ | 2022-03-28 16:08 | - | |
| Short review on Compal NBLB2/ | 2022-03-28 16:08 | - | |
| Should I Get The AL27/ | 2022-03-28 16:08 | - | |
| Should I be worried/ | 2022-03-28 16:08 | - | |
| Should I be worried that Xotic PC hasn't shipped my HEL80/ | 2022-03-28 16:08 | - | |
| Should I buy an Everex Stepnote NC1500 Laptop HELP!/ | 2022-03-28 16:08 | - | |
| Should I buy an Xbox 360 elite Falcon I'm gonna be in the us 26july to august 3rd/ | 2022-03-28 16:08 | - | |
| Should I buy a whitebook in 2010/ | 2022-03-28 16:08 | - | |
| Should I choose an Averatec 6130H/ | 2022-03-28 16:08 | - | |
| Should I purchase 3250 now or wait/ | 2022-03-28 16:08 | - | |
| Should I put on XP Pro 32 bit or 64 bit on my HEL80/ | 2022-03-28 16:08 | - | |
| Should I stay away/ | 2022-03-28 16:08 | - | |
| Should I strip an s96j and put it into a compal which one/ | 2022-03-28 16:08 | - | |
| Should I upgrade my FL90's BIOS/ | 2022-03-28 16:08 | - | |
| Should I upgrade to IFL90/ | 2022-03-28 16:08 | - | |
| Should I w8/ | 2022-03-28 16:08 | - | |
| Should i buy a Zepto/ | 2022-03-28 16:08 | - | |
| Should i pick up a Clevo Notebook/ | 2022-03-28 16:08 | - | |
| Should one buy an Averatec from Futureshop BestBuy/ | 2022-03-28 16:08 | - | |
| Shutdown Hibernation behaviour & USB - just a BIOS issue or hardware related/ | 2022-03-28 16:08 | - | |
| Shutting down after Thermal compound replacement/ | 2022-03-28 16:08 | - | |
| SiSPower.dll/ | 2022-03-28 16:08 | - | |
| Sidewalker/ | 2022-03-28 16:08 | - | |
| Signed driver problem/ | 2022-03-28 16:08 | - | |
| Silver Painting/ | 2022-03-28 16:08 | - | |
| Simple JHL90 disassembly guide/ | 2022-03-28 16:08 | - | |
| Since this is going to be my first laptop/ | 2022-03-28 16:08 | - | |
| Skin for HGL30/ | 2022-03-28 16:08 | - | |
| Skin for my ifl90/ | 2022-03-28 16:08 | - | |
| Sleep Issues/ | 2022-03-28 16:08 | - | |
| Sleeves bags for the HEL-80/ | 2022-03-28 16:08 | - | |
| Slimdrive Replacement for 6100/ | 2022-03-28 16:08 | - | |
| Sli notebook from WidowPC/ | 2022-03-28 16:08 | - | |
| Slow Boot time due to omnipass/ | 2022-03-28 16:08 | - | |
| Slow harddrive/ | 2022-03-28 16:08 | - | |
| Slowness when using batteries (6130)/ | 2022-03-28 16:08 | - | |
| Smooth Creations/ | 2022-03-28 16:08 | - | |
| Smooth Creations now sells laptops desktops/ | 2022-03-28 16:08 | - | |
| So, I just ordered a Znote 6224W/ | 2022-03-28 16:08 | - | |
| So, how's your VGA out at 1920x1200/ | 2022-03-28 16:08 | - | |
| So Averatec is definitely a bad idea/ | 2022-03-28 16:08 | - | |
| So I decided to edit my bootscreen/ | 2022-03-28 16:08 | - | |
| So I have been reading a bit.. correct me if I'm wrong/ | 2022-03-28 16:08 | - | |
| Socket A XP-M CPU's in Averatec 3200, inter changable/ | 2022-03-28 16:08 | - | |
| So confused with all the P4 processors right now/ | 2022-03-28 16:08 | - | |
| Software for FL90 infrared!/ | 2022-03-28 16:08 | - | |
| Software to disable LCD/ | 2022-03-28 16:08 | - | |
| Solution to thomasck.dk's GPU trouble/ | 2022-03-28 16:08 | - | |
| Solved! 2300 series wakes self from sleep/ | 2022-03-28 16:08 | - | |
| Solved wireless selection switch on Windows 7/ | 2022-03-28 16:08 | - | |
| Solving the Averatec 3200 series overheat/ | 2022-03-28 16:08 | - | |
| So maybe the Portable MX is what I want/ | 2022-03-28 16:08 | - | |
| Some 6240 Questions!/ | 2022-03-28 16:08 | - | |
| Some 6625WD Pictures for the intrested/ | 2022-03-28 16:08 | - | |
| Some 6625WD problems/ | 2022-03-28 16:08 | - | |
| Some Advice needed for a IFL90/ | 2022-03-28 16:08 | - | |
| Some Pre-Purchase Ponderings/ | 2022-03-28 16:08 | - | |
| Some comments questions about the HEL80/ | 2022-03-28 16:08 | - | |
| Some hope for matte screen lovers/ | 2022-03-28 16:08 | - | |
| Some issues with my A8JM/ | 2022-03-28 16:08 | - | |
| Someone from Zepto can help me with the order/ | 2022-03-28 16:08 | - | |
| Someone has (totaly) opened his 6615/ | 2022-03-28 16:08 | - | |
| Some questions about Zepto 6625 WD/ | 2022-03-28 16:08 | - | |
| Some questions about the NOX A14/ | 2022-03-28 16:08 | - | |
| Some questions about the Whitebook/ | 2022-03-28 16:08 | - | |
| Some questions before ordering 6224w/ | 2022-03-28 16:08 | - | |
| Somethings gone wrong! Help!/ | 2022-03-28 16:08 | - | |
| Sony's slot-in and tray drives- Media code list/ | 2022-03-28 16:08 | - | |
| Sony VAIO BZ560P34/ | 2022-03-28 16:08 | - | |
| Sony Vaio Z/ | 2022-03-28 16:08 | - | |
| Sony VaioZ XP downgrade problems/ | 2022-03-28 16:08 | - | |
| Sony Viao Warranty out side US/ | 2022-03-28 16:08 | - | |
| Sony slot-in drive and AnyDVD/ | 2022-03-28 16:08 | - | |
| Sony slot DVD writer drive - rubbish!/ | 2022-03-28 16:08 | - | |
| Soo, where do one get ahold of a FL90(3415W) battery charger/ | 2022-03-28 16:08 | - | |
| Sooooo Where else can I get JHL90 barebone/ | 2022-03-28 16:08 | - | |
| Sorry Folks, I jumped off the Compal building/ | 2022-03-28 16:08 | - | |
| Sotec 3120X Fan needed/ | 2022-03-28 16:08 | - | |
| Sotec 3120x Memory and CPU upgrades/ | 2022-03-28 16:08 | - | |
| Sotec fan needed/ | 2022-03-28 16:08 | - | |
| Sound Card Drivers Again/ | 2022-03-28 16:08 | - | |
| Sound Problems (Headphone Jack)/ | 2022-03-28 16:08 | - | |
| Sound card drivers/ | 2022-03-28 16:08 | - | |
| Soundcard for IFL90/ | 2022-03-28 16:08 | - | |
| Sound enhancement program.. work with hgl30 hel80/ | 2022-03-28 16:08 | - | |
| Sound issue in games/ | 2022-03-28 16:08 | - | |
| Sound stuttering when changing resolution/ | 2022-03-28 16:08 | - | |
| Spare battery for 6214W/ | 2022-03-28 16:08 | - | |
| Spare part for 6224w 6234w/ | 2022-03-28 16:08 | - | |
| Speaking of loaded...Take a look at this/ | 2022-03-28 16:08 | - | |
| Specified Module Could not be Found/ | 2022-03-28 16:08 | - | |
| Speedstep and Vista/ | 2022-03-28 16:08 | - | |
| Speedstep not functioning correctly in Windows Vista 64bit/ | 2022-03-28 16:08 | - | |
| Spilled water on HEL80/ | 2022-03-28 16:08 | - | |
| Spontaneous Shutdowns ! ! !/ | 2022-03-28 16:08 | - | |
| Stamp notebook performance/ | 2022-03-28 16:08 | - | |
| Stand BY/ | 2022-03-28 16:08 | - | |
| Stand by Hibernation Issue/ | 2022-03-28 16:08 | - | |
| Starter Kit/ | 2022-03-28 16:08 | - | |
| Static & Heat/ | 2022-03-28 16:08 | - | |
| Still top notch/ | 2022-03-28 16:08 | - | |
| Stop Making The OCZ/ | 2022-03-28 16:08 | - | |
| Store in Miami area/ | 2022-03-28 16:08 | - | |
| Strange Compal HLB0 Battery issue/ | 2022-03-28 16:08 | - | |
| Strange Glitch with Keyboard - HEL80/ | 2022-03-28 16:08 | - | |
| Strange Optical Drive Problem/ | 2022-03-28 16:08 | - | |
| Strange Problem with IFL90/ | 2022-03-28 16:08 | - | |
| Strange boot issue, dvd drive at fault/ | 2022-03-28 16:08 | - | |
| Strange fan behaviour/ | 2022-03-28 16:08 | - | |
| Strange results with CounterStrike/ | 2022-03-28 16:08 | - | |
| Strictures for Zepto Part 1/ | 2022-03-28 16:08 | - | |
| Student light gamer - Cyberpower laptop/ | 2022-03-28 16:08 | - | |
| Stuttering = refund/ | 2022-03-28 16:08 | - | |
| Sugestions/ | 2022-03-28 16:08 | - | |
| Supercomputing gets more affordable with a little help from Raspberry Pi/ | 2022-03-28 16:08 | - | |
| Superlow Windows experience index score/ | 2022-03-28 16:08 | - | |
| Surprsingly low vatnage score/ | 2022-03-28 16:08 | - | |
| Surround sound from hel80/ | 2022-03-28 16:08 | - | |
| Suspend Resume Problem on my Znote 6224W/ | 2022-03-28 16:08 | - | |
| Suzuki/ | 2022-03-28 16:08 | - | |
| Swapped the CPU of the 6130 with a mobile 3.06G/ | 2022-03-28 16:08 | - | |
| Swapping Drives in 6130HS/ | 2022-03-28 16:08 | - | |
| Sxs37/ | 2022-03-28 16:08 | - | |
| Symbol scanner PDT8100-Z1AB2T00/ | 2022-03-28 16:08 | - | |
| System76- Anybody know about them/ | 2022-03-28 16:08 | - | |
| Systemax 4220/ | 2022-03-28 16:08 | - | |
| Systemax Pursuit 4000 Series Notebook/ | 2022-03-28 16:08 | - | |
| System fan JHL90/ | 2022-03-28 16:08 | - | |
| T7500 & T7700 No Longer Available On Zepto 14 Notebooks!/ | 2022-03-28 16:08 | - | |
| T7500 on Znote 6224W (UK)/ | 2022-03-28 16:08 | - | |
| T7700 wont clock at higher speeds/ | 2022-03-28 16:08 | - | |
| TANDY- That was my first notebook in 1985. Anyone else have one/ | 2022-03-28 16:08 | - | |
| TG Dreambook AR Series/ | 2022-03-28 16:08 | - | |
| TG Dreambook D7 Series/ | 2022-03-28 16:08 | - | |
| TG Dreambook N7 problem/ | 2022-03-28 16:08 | - | |
| THE 6214W over heating thread/ | 2022-03-28 16:08 | - | |
| THe Killernotebooks.com Difference/ | 2022-03-28 16:08 | - | |
| TONGFANG GK5CN5Z GK5CN6Z GK5CQ7Z GK5CP0Z/ | 2022-03-28 16:08 | - | |
| TONGFANG GK5CN6Z MECH G2 OP LP-2 not turning on at all/ | 2022-03-28 16:08 | - | |
| TONGFANG GK5CN61/ | 2022-03-28 16:08 | - | |
| TONGFANG GK7CN6S GK7CP0S GK7CP7S/ | 2022-03-28 16:08 | - | |
| TPM Activation/ | 2022-03-28 16:08 | - | |
| TV-out not working/ | 2022-03-28 16:08 | - | |
| TV Out! How HEL 80/ | 2022-03-28 16:08 | - | |
| TV Tuner Question/ | 2022-03-28 16:08 | - | |
| TV Tuner not TV Tuning/ | 2022-03-28 16:08 | - | |
| TV Tuner not Working/ | 2022-03-28 16:08 | - | |
| TV Tuner stereo reception/ | 2022-03-28 16:08 | - | |
| TV on 6625wd/ | 2022-03-28 16:08 | - | |
| TV tuner doesn't work with Vista Business!/ | 2022-03-28 16:08 | - | |
| TV tuner performance/ | 2022-03-28 16:08 | - | |
| Take apart mpc TransPort T1000/ | 2022-03-28 16:08 | - | |
| Targa Traveller Notebook 1720 MT34/ | 2022-03-28 16:08 | - | |
| Targus Tip for Hel-80/ | 2022-03-28 16:08 | - | |
| Tatung Laptop. anyone/ | 2022-03-28 16:08 | - | |
| Tech support is moving to Mexico/ | 2022-03-28 16:08 | - | |
| Temperature monitoring/ | 2022-03-28 16:08 | - | |
| Temps high whilst gaming/ | 2022-03-28 16:08 | - | |
| Terrible hum on Zepto 6615WD/ | 2022-03-28 16:08 | - | |
| Test of 6625WD and 6024/ | 2022-03-28 16:08 | - | |
| Thanking XoticPC/ | 2022-03-28 16:08 | - | |
| Thanks ZEPTO!!/ | 2022-03-28 16:08 | - | |
| The 6625wd's keyboard is better with a docking station/ | 2022-03-28 16:08 | - | |
| The Arima W840 DI Thread/ | 2022-03-28 16:08 | - | |
| The Australian Ordering Site is a Shambles/ | 2022-03-28 16:08 | - | |
| The Averatec 1000 for only $999.99!/ | 2022-03-28 16:08 | - | |
| The Battery Test/ | 2022-03-28 16:08 | - | |
| The Benq P-41 Trouble/ | 2022-03-28 16:08 | - | |
| The Compal IFL90 (PowerPro J 10-15) is now available for PRE-ORDER with SHIPPING BEGINNING MID-JUNE/ | 2022-03-28 16:08 | - | |
| The Compal Notebook FAQ [read this first]/ | 2022-03-28 16:08 | - | |
| The GPU question/ | 2022-03-28 16:08 | - | |
| The God ed FAN/ | 2022-03-28 16:08 | - | |
| The H EL80 and non-intel MINI-PCIe wireless cards/ | 2022-03-28 16:08 | - | |
| The Hannspree HannsBook SN12E2 Thread!/ | 2022-03-28 16:08 | - | |
| The How do I clean my white Zepto Mythos Thread/ | 2022-03-28 16:08 | - | |
| The IFT00/ | 2022-03-28 16:08 | - | |
| The New Averatec Notebook PC (AV3250HX80)/ | 2022-03-28 16:08 | - | |
| The Notebook!/ | 2022-03-28 16:08 | - | |
| The OCZ Whitebook is now available/ | 2022-03-28 16:08 | - | |
| The Official IFL90 Shipping Waiting Thread/ | 2022-03-28 16:08 | - | |
| The Overpricing of high-end individual laptop GPU card kits/ | 2022-03-28 16:08 | - | |
| The Penryn is here!!!/ | 2022-03-28 16:08 | - | |
| The PowerPro P 12-15 (Compal JHL90) will begin shipping Thursday July 31st!/ | 2022-03-28 16:08 | - | |
| The Problem with the power plug is giving me terrible headaces... pls help/ | 2022-03-28 16:08 | - | |
| The Rizeon IFL90/ | 2022-03-28 16:08 | - | |
| The SLOT-IN DVD burner/ | 2022-03-28 16:08 | - | |
| The Sharp Actius AL 27 is a must buy!/ | 2022-03-28 16:08 | - | |
| The Ultimate Simplified Guide to Flash HGL30 BIOS/ | 2022-03-28 16:08 | - | |
| The WORST keyboard ever...very frustrating (send it back )/ | 2022-03-28 16:08 | - | |
| The Zepto Hydra A17/ | 2022-03-28 16:08 | - | |
| The Zepto Nox A14/ | 2022-03-28 16:08 | - | |
| The Zepto Nox A15/ | 2022-03-28 16:08 | - | |
| The beast is here!/ | 2022-03-28 16:08 | - | |
| The best christmas ever!/ | 2022-03-28 16:08 | - | |
| The best grafik driver for FT02 Nvidia 8400m GS/ | 2022-03-28 16:08 | - | |
| The continued saga of the fubar 3415W/ | 2022-03-28 16:08 | - | |
| The heat problem is back!/ | 2022-03-28 16:08 | - | |
| The memory could not be read/ | 2022-03-28 16:08 | - | |
| The new 6214W screen (1280 800)/ | 2022-03-28 16:08 | - | |
| The new Znote 3215W/ | 2022-03-28 16:08 | - | |
| The old Compal IFT00/ | 2022-03-28 16:08 | - | |
| The perfect partner for your 6214/ | 2022-03-28 16:08 | - | |
| There should be enough help and support options/ | 2022-03-28 16:08 | - | |
| The right way to flash Bios IFL90/ | 2022-03-28 16:08 | - | |
| Thermal Paste On GPU/ | 2022-03-28 16:08 | - | |
| Thermal compound on 6100 series/ | 2022-03-28 16:08 | - | |
| These Zepto's look amazing! Whats the consensus/ | 2022-03-28 16:08 | - | |
| The wait/ | 2022-03-28 16:08 | - | |
| The white 6224W is now ready to order at danish site (6324W)/ | 2022-03-28 16:08 | - | |
| The world's 2nd largest laptop maker, Compal has designed and .......who's the first/ | 2022-03-28 16:08 | - | |
| They should rename the 6214 to Flamer not Gamer/ | 2022-03-28 16:08 | - | |
| Thin, light, high resolution model/ | 2022-03-28 16:08 | - | |
| Things to know before sending laptop 4 RMA/ | 2022-03-28 16:08 | - | |
| Thinkin About IFL90/ | 2022-03-28 16:08 | - | |
| Thinking About Getting A Zepto - Some Questions/ | 2022-03-28 16:08 | - | |
| Thinking about an MX, Need Some Help/ | 2022-03-28 16:08 | - | |
| Thinking about purchasing an ocz force extreme 840/ | 2022-03-28 16:08 | - | |
| Thinking about selling the ifl90/ | 2022-03-28 16:08 | - | |
| Thinking about upgrading to 9.2 driver/ | 2022-03-28 16:08 | - | |
| Thinking of buying 6412W - Gamer some Q's/ | 2022-03-28 16:08 | - | |
| Thinking of buying a 6024W/ | 2022-03-28 16:08 | - | |
| Thinking of buying a 6625WD in Australia. Looking for some opinions on Zepto laptops/ | 2022-03-28 16:08 | - | |
| Third party reviews for HEL80/ | 2022-03-28 16:08 | - | |
| This is a rebranded Compal Hel80/ | 2022-03-28 16:08 | - | |
| This is doing my head in/ | 2022-03-28 16:08 | - | |
| This is how to enable Lightscribe on Slot-in drive (Samsung)/ | 2022-03-28 16:08 | - | |
| This is the Nokia Booklet 3G thread/ | 2022-03-28 16:08 | - | |
| This may solve IRQL not less or equal error for some/ | 2022-03-28 16:08 | - | |
| Those anyone knows anything about xVx Computers/ | 2022-03-28 16:08 | - | |
| Those with IFL90s- how portable does it seem to you/ | 2022-03-28 16:08 | - | |
| Thoughts about a Uniwill 259EN3/ | 2022-03-28 16:08 | - | |
| Thoughts on Sagers/ | 2022-03-28 16:08 | - | |
| Thoughts on the 4870's/ | 2022-03-28 16:08 | - | |
| Thoughts on the Averatec 3250H1/ | 2022-03-28 16:08 | - | |
| Thoughts on this one/ | 2022-03-28 16:08 | - | |
| Thread deleted/ | 2022-03-28 16:08 | - | |
| Three leds in front/ | 2022-03-28 16:08 | - | |
| Three unasked questions/ | 2022-03-28 16:08 | - | |
| Tilde key/ | 2022-03-28 16:08 | - | |
| Time Issues on HEL80/ | 2022-03-28 16:08 | - | |
| Time Uk/ | 2022-03-28 16:08 | - | |
| Time and Date reset/ | 2022-03-28 16:08 | - | |
| Tiny ECS G900 overheating/ | 2022-03-28 16:08 | - | |
| Titan A15/ | 2022-03-28 16:08 | - | |
| Titan A15 resolution problems/ | 2022-03-28 16:08 | - | |
| To...Rob RKComputer about OCZ whitebook/ | 2022-03-28 16:08 | - | |
| To All Owners of the Sharp AV-18 and AV-18P/ | 2022-03-28 16:08 | - | |
| To Compal Owners, how's your laptop holding up/ | 2022-03-28 16:08 | - | |
| To Nox Nexus owners/ | 2022-03-28 16:08 | - | |
| To Zepto or not to Zepto/ | 2022-03-28 16:08 | - | |
| To Zepto staff who visit the board - any news on a new faster GPU model laptop/ | 2022-03-28 16:08 | - | |
| To buy the 4100...or not/ | 2022-03-28 16:08 | - | |
| Tomshardware review ASI's IQ17-D2 aka ocz whitebook/ | 2022-03-28 16:08 | - | |
| TongFang GI5CN5E/ | 2022-03-28 16:08 | - | |
| TongFang GJ5CN6E/ | 2022-03-28 16:08 | - | |
| TongFang GK5CN6Z keyboard/ | 2022-03-28 16:08 | - | |
| TongFang GK5CN67/ | 2022-03-28 16:08 | - | |
| TongFang GK5CP7Y (Vyper II Onyx Pro ....)/ | 2022-03-28 16:08 | - | |
| TongFang PF4WN2F PF4MN2F/ | 2022-03-28 16:08 | - | |
| TongFang PF5MN2G PF5WN2G PF5CP5G/ | 2022-03-28 16:08 | - | |
| Tongfang GH5KN51/ | 2022-03-28 16:08 | - | |
| Tongfang GI5KN5A/ | 2022-03-28 16:08 | - | |
| Tongfang GJ5CN6E Fan Cleaning/ | 2022-03-28 16:08 | - | |
| Tongfang GK5C6X - Evoo gaming 15 EG-LP5-BK - Overpowered V 2.0/ | 2022-03-28 16:08 | - | |
| Tongfang GK5NR-O, GK7NP-R (Ryzen 4000 mobile)/ | 2022-03-28 16:08 | - | |
| Tongfang GK7CP0S - Evoo gaming 17 EG-LP6-BK - Overpowered V 2.0/ | 2022-03-28 16:08 | - | |
| Tongfang GM5MP0Y P7Y PHY Q8Y P0W P7W PHW Q8W/ | 2022-03-28 16:08 | - | |
| Tongfang GM7MP0P P7P PHP Q8P P5R RFR R0R/ | 2022-03-28 16:08 | - | |
| Tongfang GM7TG7P (i7-11800H and RTX3070)/ | 2022-03-28 16:08 | - | |
| Tongfang Models 2021/ | 2022-03-28 16:08 | - | |
| Tongfang Ryzen 4800h/ | 2022-03-28 16:08 | - | |
| Tongfang gk5cp0z RTX 2060 bios flash/ | 2022-03-28 16:08 | - | |
| Too Hot to Handle/ | 2022-03-28 16:08 | - | |
| Torn between the MX and UX...help needed/ | 2022-03-28 16:08 | - | |
| Toshiba 335cds bios/ | 2022-03-28 16:08 | - | |
| Totally Baffled!!!!!!/ | 2022-03-28 16:08 | - | |
| Touchpad Improvers/ | 2022-03-28 16:08 | - | |
| Touchpad and keyboard question to 6625WD owners/ | 2022-03-28 16:08 | - | |
| Touchpad not responding/ | 2022-03-28 16:08 | - | |
| Touchpad on Averatec 1020 is WAY to sensitive and scroll doesn't work/ | 2022-03-28 16:08 | - | |
| Touchpad on Zeptos - strange movement/ | 2022-03-28 16:08 | - | |
| Travelling to Europe/ | 2022-03-28 16:08 | - | |
| Tried to remove dust from my 6615wd, broke the keyboard and the wifi/ | 2022-03-28 16:08 | - | |
| Trioview Polarization question/ | 2022-03-28 16:08 | - | |
| Trouble Downloading Vista Drivers for HEL80/ | 2022-03-28 16:08 | - | |
| Trouble installing drivers/ | 2022-03-28 16:08 | - | |
| Troubles Installing new 8600gt in FL90/ | 2022-03-28 16:08 | - | |
| Trouble with AOpen 2000 notebook/ | 2022-03-28 16:08 | - | |
| Trusted Reviews Zepto 6214W Review/ | 2022-03-28 16:08 | - | |
| Trying to figure out which computer to get/ | 2022-03-28 16:08 | - | |
| Trying to install Intel 3945abg wireless card in 2370 - Not recognized/ | 2022-03-28 16:08 | - | |
| Turbo Memory or not Turbo Memory that is the question!/ | 2022-03-28 16:08 | - | |
| Turn off blue lights on 6214W/ | 2022-03-28 16:08 | - | |
| Tutorial on how to clean the 6100/ | 2022-03-28 16:08 | - | |
| Tuxedo Bios on Eluktronics (Tongfang GK5NR0O)/ | 2022-03-28 16:08 | - | |
| Tuxedo laptop review requested/ | 2022-03-28 16:08 | - | |
| Tv on Nox/ | 2022-03-28 16:08 | - | |
| Tv tuner antenna inout/ | 2022-03-28 16:08 | - | |
| TwinHead Durabook n15RI/ | 2022-03-28 16:08 | - | |
| Twinhead 10D - a budget 10 ultraportable/ | 2022-03-28 16:08 | - | |
| Twinhead F11Y in U.S.A/ | 2022-03-28 16:08 | - | |
| Twinhead H12Y I have a minor problem with the media player quick key/ | 2022-03-28 16:08 | - | |
| Twinhead notebooks opinions/ | 2022-03-28 16:08 | - | |
| Two versions of IFL90 at Xotic = huge price difference... Why/ | 2022-03-28 16:08 | - | |
| Type of RAM/ | 2022-03-28 16:08 | - | |
| Type of RAM for compal IFL90 FL90/ | 2022-03-28 16:08 | - | |
| Type of ram for Averatec 2100/ | 2022-03-28 16:08 | - | |
| Typical Battery Life/ | 2022-03-28 16:08 | - | |
| Typing on Zepto Nox A14 and A15/ | 2022-03-28 16:08 | - | |
| UGing memory on 3360/ | 2022-03-28 16:08 | - | |
| UK customer support/ | 2022-03-28 16:08 | - | |
| UM10M no audio/ | 2022-03-28 16:08 | - | |
| UNKNOWN LAPTOP/ | 2022-03-28 16:08 | - | |
| UNMOUNTABLE_DRIVE_VOLUME blue screen/ | 2022-03-28 16:08 | - | |
| URGENT XP Problem/ | 2022-03-28 16:08 | - | |
| USB 2.0 Issue on my Nox A14/ | 2022-03-28 16:08 | - | |
| USB Ports - JFL92/ | 2022-03-28 16:08 | - | |
| USB mice not working on NEC VersaPro UltraLite VS/ | 2022-03-28 16:08 | - | |
| USB mouse not working after sleep mode/ | 2022-03-28 16:08 | - | |
| USB power issues/ | 2022-03-28 16:08 | - | |
| USB problem/ | 2022-03-28 16:08 | - | |
| USB problems/ | 2022-03-28 16:08 | - | |
| USB transfer speed & Vista/ | 2022-03-28 16:08 | - | |
| UXM520 BIOS Update/ | 2022-03-28 16:08 | - | |
| UXM520 Vista BIOS Update/ | 2022-03-28 16:08 | - | |
| UX color option Poll/ | 2022-03-28 16:08 | - | |
| UX question- low voltage/ | 2022-03-28 16:08 | - | |
| UX question/ | 2022-03-28 16:08 | - | |
| Ubuntu 8.10 Intrepid Ibex on Avertec 1020/ | 2022-03-28 16:08 | - | |
| Ubuntu Feisty Fawn 7.04 on Compal HEL80/ | 2022-03-28 16:08 | - | |
| Ubuntu on 6224W - GRUB problems/ | 2022-03-28 16:08 | - | |
| Ubuntu on Zepto 6224W/ | 2022-03-28 16:08 | - | |
| Ubuntu on whitebook/ | 2022-03-28 16:08 | - | |
| Ultimate Dummy Guide to flashing Compal JFT00/ | 2022-03-28 16:08 | - | |
| Ultimate dummy guide to flash Compal HEL80/ | 2022-03-28 16:08 | - | |
| Um, is Sharp still in the laptop business/ | 2022-03-28 16:08 | - | |
| Umpc/ | 2022-03-28 16:08 | - | |
| Unable To Read CPU Temps/ | 2022-03-28 16:08 | - | |
| Unable to Boot via USB ports in AVERATEC 4100 Series/ | 2022-03-28 16:08 | - | |
| Underclocking/ | 2022-03-28 16:08 | - | |
| Undervolting/ | 2022-03-28 16:08 | - | |
| Undervolting HGL30/ | 2022-03-28 16:08 | - | |
| Undervolting Underclocking the KHLB2 HD 4650/ | 2022-03-28 16:08 | - | |
| Undervolting graphic card on 6224w/ | 2022-03-28 16:08 | - | |
| Undervolting the HEL80/ | 2022-03-28 16:08 | - | |
| Undervolting using bios. Is it possible/ | 2022-03-28 16:08 | - | |
| Unexpected power down/ | 2022-03-28 16:08 | - | |
| Unfortunately the new Win8 visio models don't thrill/ | 2022-03-28 16:08 | - | |
| Uninstall omnipass. I need help/ | 2022-03-28 16:08 | - | |
| Universal Charger for Medion MD97600/ | 2022-03-28 16:08 | - | |
| Universal control remote for TV tuner/ | 2022-03-28 16:08 | - | |
| Universal power supply adaptor for G15 A15/ | 2022-03-28 16:08 | - | |
| Uniwill 258ka0/ | 2022-03-28 16:08 | - | |
| Uniwill 259EN3 and other/ | 2022-03-28 16:08 | - | |
| Uniwill 259IA3 fsb adjustments/ | 2022-03-28 16:08 | - | |
| Uniwill 259IA WXGA LCD impressions please -)/ | 2022-03-28 16:08 | - | |
| Uniwill 259en3 replace lcd question/ | 2022-03-28 16:08 | - | |
| Uniwill 295IA - Dothan Based System with 256mb VRA/ | 2022-03-28 16:08 | - | |
| Uniwill Quality/ | 2022-03-28 16:08 | - | |
| Uniwill laptop/ | 2022-03-28 16:08 | - | |
| Uniwill laptops/ | 2022-03-28 16:08 | - | |
| Unlock AES-NI in Compal PBL21 with Intel i5-2410M and other CPU/ | 2022-03-28 16:08 | - | |
| Unofficial Averatec Forums - gone or whatever/ | 2022-03-28 16:08 | - | |
| Unresponsive Touchpad keyboard/ | 2022-03-28 16:08 | - | |
| Unstable keyboard fl90/ | 2022-03-28 16:08 | - | |
| Update 7K200 Series Feature Tool/ | 2022-03-28 16:08 | - | |
| Update CPU on 6214W/ | 2022-03-28 16:08 | - | |
| Updated New UX/ | 2022-03-28 16:08 | - | |
| Updated from 119B to 122B PROBLEM/ | 2022-03-28 16:08 | - | |
| Update driver for WPA/ | 2022-03-28 16:08 | - | |
| Update on AMD64 notebook/ | 2022-03-28 16:08 | - | |
| Updating NBLB5 bios/ | 2022-03-28 16:08 | - | |
| Updating Video Card for Averatec 3715 ED1/ | 2022-03-28 16:08 | - | |
| Updating audio drivers/ | 2022-03-28 16:08 | - | |
| Upgrade 5400 Ram/ | 2022-03-28 16:08 | - | |
| Upgrade CPU and TV tuner on Compal HEL80/ | 2022-03-28 16:08 | - | |
| Upgrade Graphics Card/ | 2022-03-28 16:08 | - | |
| Upgrade Memory on 6130HS/ | 2022-03-28 16:08 | - | |
| Upgrade Processor for 4100/ | 2022-03-28 16:08 | - | |
| Upgrade from EL80/ | 2022-03-28 16:08 | - | |
| Upgrades for xmas/ | 2022-03-28 16:08 | - | |
| Upgrade to 8600 DDR3/ | 2022-03-28 16:08 | - | |
| Upgrade to XP Pro/ | 2022-03-28 16:08 | - | |
| Upgrading 6625WD/ | 2022-03-28 16:08 | - | |
| Upgrading Averatec 6200H/ | 2022-03-28 16:08 | - | |
| Upgrading GFX on a FT00 possible/ | 2022-03-28 16:08 | - | |
| Upgrading Updating Ur Hel80laptop/ | 2022-03-28 16:08 | - | |
| Upgrading a Zepto yourself - Voiding Warranty/ | 2022-03-28 16:08 | - | |
| Upgrading memory on 6615/ | 2022-03-28 16:08 | - | |
| Upgrading my CPU for JHL90 from T5800/ | 2022-03-28 16:08 | - | |
| Upgrading my FL90/ | 2022-03-28 16:08 | - | |
| Upgrading ram/ | 2022-03-28 16:08 | - | |
| Upgrading the Averatec 2370 memory/ | 2022-03-28 16:08 | - | |
| Upgrading wireless drivers for IFL90/ | 2022-03-28 16:08 | - | |
| Urgent! Recovering on the 2200/ | 2022-03-28 16:08 | - | |
| Urgent HELP NEEDED!!!/ | 2022-03-28 16:08 | - | |
| Urgent problem- Hel-80 sudden shut down upon XP installation/ | 2022-03-28 16:08 | - | |
| Usb/ | 2022-03-28 16:08 | - | |
| Used Cyberpower laptop worth it/ | 2022-03-28 16:08 | - | |
| Use of Intel Turbo Memory for FL90 and deactivating it/ | 2022-03-28 16:08 | - | |
| User Review- Hannspree Hannsbook - 12.1 Netbook/ | 2022-03-28 16:08 | - | |
| Using 3270 in Europe- adapter or converter/ | 2022-03-28 16:08 | - | |
| Using Compal as a DVD player/ | 2022-03-28 16:08 | - | |
| Using Fingerprint and Welcome Logon screen Hiding/ | 2022-03-28 16:08 | - | |
| Using Power Trio suite/ | 2022-03-28 16:08 | - | |
| Using RMClock/ | 2022-03-28 16:08 | - | |
| Utopia Computers (UK Europe)/ | 2022-03-28 16:08 | - | |
| VAIO FW with XBRITE-HiColor/ | 2022-03-28 16:08 | - | |
| VBI HEL 80 out!/ | 2022-03-28 16:08 | - | |
| VBI Not powering up/ | 2022-03-28 16:08 | - | |
| VGA BIOS version/ | 2022-03-28 16:08 | - | |
| VGA Sound Wireless Drivers/ | 2022-03-28 16:08 | - | |
| VGA bios for 6615WD and 6214W/ | 2022-03-28 16:08 | - | |
| VGA output supported resolutions/ | 2022-03-28 16:08 | - | |
| VIZIO Screwing all it's customers again. PRICE DROP/ | 2022-03-28 16:08 | - | |
| Vaio SZ vs. Premium SZ/ | 2022-03-28 16:08 | - | |
| Various questions about Zepto/ | 2022-03-28 16:08 | - | |
| Vcom System Suite 7 is out- worth it/ | 2022-03-28 16:08 | - | |
| Velocity Micro B50 Campus Edition!/ | 2022-03-28 16:08 | - | |
| Velocity Micro NoteMagix x20 (Asus C90)/ | 2022-03-28 16:08 | - | |
| Venom BlackBook/ | 2022-03-28 16:08 | - | |
| Vertical Colored Lines with Radeon/ | 2022-03-28 16:08 | - | |
| Vertical blue line in ilf90/ | 2022-03-28 16:08 | - | |
| Vertical color lines on my IFL 90 monitor.HELP!!!/ | 2022-03-28 16:08 | - | |
| Very close to buying the 6214W/ | 2022-03-28 16:08 | - | |
| Very little P1 representation here/ | 2022-03-28 16:08 | - | |
| Very loud noise from 6625 DVD drive/ | 2022-03-28 16:08 | - | |
| Very serious screen flickering in 6625WD/ | 2022-03-28 16:08 | - | |
| Very tempted on this Averatec!/ | 2022-03-28 16:08 | - | |
| Very weird HEL80 Ethernet related error/ | 2022-03-28 16:08 | - | |
| Vicious PC Shogun vs Ninja/ | 2022-03-28 16:08 | - | |
| Victor MP-XV831 worlds smallest DVD-RW subnote/ | 2022-03-28 16:08 | - | |
| Video- Hel80i Assembly/ | 2022-03-28 16:08 | - | |
| Video/ | 2022-03-28 16:08 | - | |
| Video drivers/ | 2022-03-28 16:08 | - | |
| Video overlay on Zepto 6224 wth nvidia 8600M GT/ | 2022-03-28 16:08 | - | |
| Video overlay zoomed to much in/ | 2022-03-28 16:08 | - | |
| Video playback problems/ | 2022-03-28 16:08 | - | |
| View angles on EX and MX/ | 2022-03-28 16:08 | - | |
| Viewing DVDs on the 6200 -no full image/ | 2022-03-28 16:08 | - | |
| Vigorgaming Artorius - headache inside/ | 2022-03-28 16:08 | - | |
| Vinyl Deck 97 troubles -- advice/ | 2022-03-28 16:08 | - | |
| Virtualization (Round 2)/ | 2022-03-28 16:08 | - | |
| Virtual scroll on Samsung P28 touchpad/ | 2022-03-28 16:08 | - | |
| Virtual surround problem/ | 2022-03-28 16:08 | - | |
| Vista32 + power plan..help/ | 2022-03-28 16:08 | - | |
| Vista 32 Unknown Device/ | 2022-03-28 16:08 | - | |
| Vista 32 or 64/ | 2022-03-28 16:08 | - | |
| Vista 64bit (6615WD but not exclusive)/ | 2022-03-28 16:08 | - | |
| Vista 64 bit on Znote 6224W/ | 2022-03-28 16:08 | - | |
| Vista 64 bits drivers for HEL80/ | 2022-03-28 16:08 | - | |
| Vista Bug can TRASH your system/ | 2022-03-28 16:08 | - | |
| Vista Installation Problem with 6214w/ | 2022-03-28 16:08 | - | |
| Vista SP1 HGL30 & Fingerprint Drivers/ | 2022-03-28 16:08 | - | |
| Vista Upgrade/ | 2022-03-28 16:08 | - | |
| Vista Video driver installation/ | 2022-03-28 16:08 | - | |
| Vista business sp1 DISPLAYS my 4GB of RAM/ | 2022-03-28 16:08 | - | |
| Vista on 5400/ | 2022-03-28 16:08 | - | |
| Vista on HGL30/ | 2022-03-28 16:08 | - | |
| Vista only $120 on a compal and arctic silver/ | 2022-03-28 16:08 | - | |
| Vista sleep = lock up! help/ | 2022-03-28 16:08 | - | |
| Vista upgrade programme/ | 2022-03-28 16:08 | - | |
| Vista x64 & SP1 fingerprint issue/ | 2022-03-28 16:08 | - | |
| Visual guide to Vista language change/ | 2022-03-28 16:08 | - | |
| Vizio's making computers now/ | 2022-03-28 16:08 | - | |
| Vizio CN15-A1 short review/ | 2022-03-28 16:08 | - | |
| Vizio CN15 A5 32gb SSD question/ | 2022-03-28 16:08 | - | |
| Vizio CT14-A0 Review/ | 2022-03-28 16:08 | - | |
| Vizio CT15-A1 Fan Issue/ | 2022-03-28 16:08 | - | |
| Vizio CT15-A1 Review - Almost there -(/ | 2022-03-28 16:08 | - | |
| Vizio CT15-A2 Owners Lounge/ | 2022-03-28 16:08 | - | |
| Vizio CT15-A5 randomly goes to sleep during use Help/ | 2022-03-28 16:08 | - | |
| Vizio CT15-A5 soaked in tea/ | 2022-03-28 16:08 | - | |
| Vizio CT15 Charger - anyone know where to get one/ | 2022-03-28 16:08 | - | |
| Vizio CT15 Teardown/ | 2022-03-28 16:08 | - | |
| Vizio Cn15 A5/ | 2022-03-28 16:08 | - | |
| Vizio IPS screen model numbers/ | 2022-03-28 16:08 | - | |
| Vizio Laptop Finally available at costco/ | 2022-03-28 16:08 | - | |
| Vizio Laptop YouTube Reviews/ | 2022-03-28 16:08 | - | |
| Vizio Notebook/ | 2022-03-28 16:08 | - | |
| Vizio Thin and Light Touch Release Date/ | 2022-03-28 16:08 | - | |
| Vizio ct14-a4 Smooth (er) Touch Pad Tutorial Windows 8/ | 2022-03-28 16:08 | - | |
| Vizio impressions at MS Store/ | 2022-03-28 16:08 | - | |
| Vizio laptop and desktop now at local Sam's Club/ | 2022-03-28 16:08 | - | |
| Vizio thin&light laptop strange partition/ | 2022-03-28 16:08 | - | |
| Vizio thin + light Hackintosh/ | 2022-03-28 16:08 | - | |
| Vizio windows 8 easter egg, pseudo touch interface/ | 2022-03-28 16:08 | - | |
| Vodafone Datacard/ | 2022-03-28 16:08 | - | |
| Voice recording problem/ | 2022-03-28 16:08 | - | |
| Volume Help Please!!!!/ | 2022-03-28 16:08 | - | |
| Volume Increases on its own - 6130-HS20/ | 2022-03-28 16:08 | - | |
| Volume Meter when adjusting volume via FN+F4 F5/ | 2022-03-28 16:08 | - | |
| Volume sucks/ | 2022-03-28 16:08 | - | |
| Voodoo's new laptop/ | 2022-03-28 16:08 | - | |
| W230st/ | 2022-03-28 16:08 | - | |
| W840 DI and Windows 7 x64 Build 7077/ | 2022-03-28 16:08 | - | |
| WARNING- To any one thinking of buying Vizio Laptops/ | 2022-03-28 16:08 | - | |
| WARNING...the Compal (I)FL90 91, (I)FT00 01 and JFT00 DO NOT SUPPORT PENRYN no matter what BIOS they have...try it and fry it!/ | 2022-03-28 16:08 | - | |
| WHERE can I buy G1S en france or paris now/ | 2022-03-28 16:08 | - | |
| WIMPIEST WI-FI WEST OF THE ATLANTIC/ | 2022-03-28 16:08 | - | |
| WLAN speed tanking!!/ | 2022-03-28 16:08 | - | |
| WSS, Bluetooth Help (HEL80)/ | 2022-03-28 16:08 | - | |
| WSXGA aspect ratio and lower resolutions/ | 2022-03-28 16:08 | - | |
| WTB FL92 fingerprint reader/ | 2022-03-28 16:08 | - | |
| Walmart Overpowered Laptops/ | 2022-03-28 16:08 | - | |
| Walmart Tatung 12.1 4.1lb notebook/ | 2022-03-28 16:08 | - | |
| Want an OCZ...what to do/ | 2022-03-28 16:08 | - | |
| Want benq S41 in US/ | 2022-03-28 16:08 | - | |
| Wanted Pictures P1 transreflective screen/ | 2022-03-28 16:08 | - | |
| Wanted pics posted of Trioview LCD/ | 2022-03-28 16:08 | - | |
| Want graphics improvement on 6130HS/ | 2022-03-28 16:08 | - | |
| Want to get rid of averatec logo/ | 2022-03-28 16:08 | - | |
| Want to make your IFL90 media buttons work here's how!/ | 2022-03-28 16:08 | - | |
| Want to upgrade memory to my averatec 3220, help!/ | 2022-03-28 16:08 | - | |
| Warcraft 3 lags like hell even i have the right specs/ | 2022-03-28 16:08 | - | |
| Warranty/ | 2022-03-28 16:08 | - | |
| Warranty Advice Needed/ | 2022-03-28 16:08 | - | |
| Warranty Issues/ | 2022-03-28 16:08 | - | |
| Warranty Question - if order from Toronto Canada/ | 2022-03-28 16:08 | - | |
| Warranty on GL30 - MilestonePC gone/ | 2022-03-28 16:08 | - | |
| Warranty work on a OCZ DIY 17/ | 2022-03-28 16:08 | - | |
| Washed-out IFL90 screen/ | 2022-03-28 16:08 | - | |
| Was what I bought worth it/ | 2022-03-28 16:08 | - | |
| Watercooled XMG Neo 15 Eluktronics Mech-15 G3/ | 2022-03-28 16:08 | - | |
| Wbcam program for ifl 90/ | 2022-03-28 16:08 | - | |
| Webcam Drivers/ | 2022-03-28 16:08 | - | |
| Webcam Issue/ | 2022-03-28 16:08 | - | |
| Webcam Software for JHL90/ | 2022-03-28 16:08 | - | |
| Webcam and Cardreader drivers to Vista 64/ | 2022-03-28 16:08 | - | |
| Web cam for IFL90/ | 2022-03-28 16:08 | - | |
| Webcam in 6625WD does not work in Windows XP -(/ | 2022-03-28 16:08 | - | |
| Webcam on HEL80 with Kubuntu or other Linux/ | 2022-03-28 16:08 | - | |
| Webcam software/ | 2022-03-28 16:08 | - | |
| Weird/ | 2022-03-28 16:08 | - | |
| Weird Keyboard Issue/ | 2022-03-28 16:08 | - | |
| Weird Problem with Virtual Box and VT/ | 2022-03-28 16:08 | - | |
| Weird Sounds from my 6130/ | 2022-03-28 16:08 | - | |
| Weird beep/ | 2022-03-28 16:08 | - | |
| Weird fan on SD-MW1/ | 2022-03-28 16:08 | - | |
| Weird keyboard and context menu problem/ | 2022-03-28 16:08 | - | |
| Weird keyboard problem (Averatec 2200)/ | 2022-03-28 16:08 | - | |
| Well my 2155 finally died/ | 2022-03-28 16:08 | - | |
| Well the IFL90 showed up, but doesn't fit! What cases ya'll using/ | 2022-03-28 16:08 | - | |
| What's it with the Finnish Zepto dealer/ | 2022-03-28 16:08 | - | |
| What's the avg. battery life for a 6 Cell Compal FL90/ | 2022-03-28 16:08 | - | |
| What's the difference in Compals part #'s for IFL90/ | 2022-03-28 16:08 | - | |
| What's the latest stable forceware for HEL80/ | 2022-03-28 16:08 | - | |
| What's the perfect Whitebook Cooler/ | 2022-03-28 16:08 | - | |
| What's up with Boxx workstation laptops Why so expensive/ | 2022-03-28 16:08 | - | |
| What's up with the spanish Zepto website/ | 2022-03-28 16:08 | - | |
| What 3dmark will 4870 give us/ | 2022-03-28 16:08 | - | |
| What Are the Differences Between 6224w and 6324w/ | 2022-03-28 16:08 | - | |
| What Bluetooth Cable for the SN12/ | 2022-03-28 16:08 | - | |
| What CPU'd for the IFL-90/ | 2022-03-28 16:08 | - | |
| What Gives/ | 2022-03-28 16:08 | - | |
| What Happen to the Averatec 6130HS/ | 2022-03-28 16:08 | - | |
| What OS will you use with your new HEL80/ | 2022-03-28 16:08 | - | |
| What Ram to upgrade to/ | 2022-03-28 16:08 | - | |
| What Thermal Compound Does Zepto Use/ | 2022-03-28 16:08 | - | |
| What about NEV@DA MODELS/ | 2022-03-28 16:08 | - | |
| What about the Averatec 6130H1/ | 2022-03-28 16:08 | - | |
| What about the box/ | 2022-03-28 16:08 | - | |
| What are the best performance testing tools for Compal/ | 2022-03-28 16:08 | - | |
| What are the built in webcams on Zeptos like/ | 2022-03-28 16:08 | - | |
| What are your thoughts on CyberPower laptops/ | 2022-03-28 16:08 | - | |
| What brand of HD does the 6130-HS have/ | 2022-03-28 16:08 | - | |
| What can i do about my touchpad The lack of physical left right click buttons is a horrible design/ | 2022-03-28 16:08 | - | |
| What changes would u like to see on new 13in Port 1 coming out soon/ | 2022-03-28 16:08 | - | |
| What colors is the Sharp Mebius MW70J avaliable in/ | 2022-03-28 16:08 | - | |
| What do I give up to choose UX over MX/ | 2022-03-28 16:08 | - | |
| What do i need to know before installing vista ultimate 64bit on my hgl30/ | 2022-03-28 16:08 | - | |
| What do these buttons do/ | 2022-03-28 16:08 | - | |
| What do you think/ | 2022-03-28 16:08 | - | |
| What do you think about TwinHead Notebooks/ | 2022-03-28 16:08 | - | |
| What do you want to see before you order/ | 2022-03-28 16:08 | - | |
| What drivers do i need/ | 2022-03-28 16:08 | - | |
| What happened to the ETA 42 Days -O/ | 2022-03-28 16:08 | - | |
| What is a used hel80 worth/ | 2022-03-28 16:08 | - | |
| What is highest video card for x8100/ | 2022-03-28 16:08 | - | |
| What is the catch/ | 2022-03-28 16:08 | - | |
| What is the characterisics of a Short Circut/ | 2022-03-28 16:08 | - | |
| What is the cheapest 1070 1060 ti or non ti overclockable laptop available/ | 2022-03-28 16:08 | - | |
| What is the difference between Vizio's Signature Windows 7 and DigitalRiver's Windows 7/ | 2022-03-28 16:08 | - | |
| What is the difference between the FL90 and the IFL90/ | 2022-03-28 16:08 | - | |
| What is the largest capacity hard drive an Hel 80 can handle/ | 2022-03-28 16:08 | - | |
| What is the motherboard of the Ifl90 so I can overclock the cpu/ | 2022-03-28 16:08 | - | |
| What is the name of the motherboard on HEL80/ | 2022-03-28 16:08 | - | |
| What is this/ | 2022-03-28 16:08 | - | |
| What is this Illegear Raven (another Quanta Compal)/ | 2022-03-28 16:08 | - | |
| What is your 7600's driver/ | 2022-03-28 16:08 | - | |
| What is your battery wear level at/ | 2022-03-28 16:08 | - | |
| What kind of RAM on the IFL90/ | 2022-03-28 16:08 | - | |
| What kind of chipset motherboard does OCZ Whitebook have/ | 2022-03-28 16:08 | - | |
| What kind of mainboard is in the 6214w (linux bios)/ | 2022-03-28 16:08 | - | |
| What laptop is this/ | 2022-03-28 16:08 | - | |
| What port is this on 6324W(&6224W)/ | 2022-03-28 16:08 | - | |
| Whats do you all think of the New Falcon Northwest I O/ | 2022-03-28 16:08 | - | |
| What should I uninstall I want to clear room/ | 2022-03-28 16:08 | - | |
| Whats normal temp for go7600 gpu/ | 2022-03-28 16:08 | - | |
| Whats the difference/ | 2022-03-28 16:08 | - | |
| Whats the speed of the 2155's HDD/ | 2022-03-28 16:08 | - | |
| Whats video card for 6240/ | 2022-03-28 16:08 | - | |
| Whats wrong with my screen-/ | 2022-03-28 16:08 | - | |
| Whats wrong with the keyboard/ | 2022-03-28 16:08 | - | |
| Whats your opinon/ | 2022-03-28 16:08 | - | |
| What temp do you have for your 3870x2/ | 2022-03-28 16:08 | - | |
| What to Sacrifice in my PowerPro J 10-15 Configuration/ | 2022-03-28 16:08 | - | |
| What to do with a dead Zepto 6214w/ | 2022-03-28 16:08 | - | |
| Whatt would you guys do/ | 2022-03-28 16:08 | - | |
| What type of Corsair comes with the compal/ | 2022-03-28 16:08 | - | |
| What type of hard drive do they put in the SZ/ | 2022-03-28 16:08 | - | |
| What would make the microphone too quiet/ | 2022-03-28 16:08 | - | |
| When are painted covers coming back/ | 2022-03-28 16:08 | - | |
| When are your getting a zepto nox with 9650m gt/ | 2022-03-28 16:08 | - | |
| When buying a Zepto/ | 2022-03-28 16:08 | - | |
| When will IFL90 be in my hands/ | 2022-03-28 16:08 | - | |
| Where's the cheapest place to get the IFL-90/ | 2022-03-28 16:08 | - | |
| Where are the 6224w reviews/ | 2022-03-28 16:08 | - | |
| Where are the Winbook Owners/ | 2022-03-28 16:08 | - | |
| Where are you buying your Compal IFL90/ | 2022-03-28 16:08 | - | |
| Where can I buy a Comapl HGL30/ | 2022-03-28 16:08 | - | |
| Where can I buy a Sharp MM20/ | 2022-03-28 16:08 | - | |
| Where can I buy hel80's graphics card/ | 2022-03-28 16:08 | - | |
| Where can I find averarec parts/ | 2022-03-28 16:08 | - | |
| Where can I find technical info about the screen/ | 2022-03-28 16:08 | - | |
| Where can I find the JFL92 on ebay/ | 2022-03-28 16:08 | - | |
| Where can I find the Sharp M4000 WideNote Sharp Mebius MW70J/ | 2022-03-28 16:08 | - | |
| Where can I find the backlight fuse/ | 2022-03-28 16:08 | - | |
| Where can I get a FL90 battery charger (Sweden)/ | 2022-03-28 16:08 | - | |
| Where can I get a new motherboard for my FL90/ | 2022-03-28 16:08 | - | |
| Where can I see this new M4000 WideNote in person/ | 2022-03-28 16:08 | - | |
| Where can i find Quanta barebones/ | 2022-03-28 16:08 | - | |
| Where can you buy Compal laptops in Canada/ | 2022-03-28 16:08 | - | |
| Where could i get a A14 in the USA/ | 2022-03-28 16:08 | - | |
| Where did all the 14 Compals go/ | 2022-03-28 16:08 | - | |
| Where did the 1050 go/ | 2022-03-28 16:08 | - | |
| Where did you buy your compal/ | 2022-03-28 16:08 | - | |
| Where did you order your IFL90 2090/ | 2022-03-28 16:08 | - | |
| Where do computers come from/ | 2022-03-28 16:08 | - | |
| Where does the TV tuner aerial fit/ | 2022-03-28 16:08 | - | |
| Where is the 4100 series/ | 2022-03-28 16:08 | - | |
| Where is the cheapest to get Averatec 3220H/ | 2022-03-28 16:08 | - | |
| Where is this Everex R1.09 Bios everyone talks about here and how to flash into my 2300 series/ | 2022-03-28 16:08 | - | |
| Where to Buy for HEL80 owners/ | 2022-03-28 16:08 | - | |
| Where to buy OEM AV1050-EU1 Battery/ | 2022-03-28 16:08 | - | |
| Where to buy arima based laptops/ | 2022-03-28 16:08 | - | |
| Where to buy barebones whitebook Clevo M560A/ | 2022-03-28 16:08 | - | |
| Where to buy clevo m560a/ | 2022-03-28 16:08 | - | |
| Where to buy clevo notebooks in the US/ | 2022-03-28 16:08 | - | |
| Where to buy the cheapest Compal HEL80 EL80 backbone(WSXGA+)/ | 2022-03-28 16:08 | - | |
| Where to check service tag of compal computer/ | 2022-03-28 16:08 | - | |
| Where to download the latest Nvidia drivers/ | 2022-03-28 16:08 | - | |
| Where to find current Compal Whitebooks/ | 2022-03-28 16:08 | - | |
| Where to get Drivers Update Bios for Compal IFL90/ | 2022-03-28 16:08 | - | |
| Where to get New Packaging for Used Notebooks/ | 2022-03-28 16:08 | - | |
| Where to order the Asus A8JM from/ | 2022-03-28 16:08 | - | |
| Where to upgrade latest drivers/ | 2022-03-28 16:08 | - | |
| Which Averatec Notebook/ | 2022-03-28 16:08 | - | |
| Which Bios is best for the 6625WD please/ | 2022-03-28 16:08 | - | |
| Which Celeron for the IFL90/ | 2022-03-28 16:08 | - | |
| Which DVD+ -RW drive to get for hgl30/ | 2022-03-28 16:08 | - | |
| Which Hard Disk to get/ | 2022-03-28 16:08 | - | |
| Which Zepto notebook do I buy & pricing/ | 2022-03-28 16:08 | - | |
| Which laptop sleeve and cooler did you buy/ | 2022-03-28 16:08 | - | |
| Which memory for 6224/ | 2022-03-28 16:08 | - | |
| Which memory is better for the HEL80/ | 2022-03-28 16:08 | - | |
| Which of these laptops is better for gaming/ | 2022-03-28 16:08 | - | |
| Which power supply for 6625WD (Germany)/ | 2022-03-28 16:08 | - | |
| Which seller to purchase the OCZ from/ | 2022-03-28 16:08 | - | |
| Which video cards work in an IFL90/ | 2022-03-28 16:08 | - | |
| Which wireless card for Hel80/ | 2022-03-28 16:08 | - | |
| Which would you chose- 6625 (15.4 ) or 6224 (14.1 )/ | 2022-03-28 16:08 | - | |
| Whireless card for Zepto/ | 2022-03-28 16:08 | - | |
| Whitebook - ati 3870/ | 2022-03-28 16:08 | - | |
| Whitebook 4850 4870 Upgrades/ | 2022-03-28 16:08 | - | |
| Whitebook Blu-Ray Drive Not Loading Blu Ray Discs! -(/ | 2022-03-28 16:08 | - | |
| Whitebook Notebook Computers/ | 2022-03-28 16:08 | - | |
| Whitebook Processors/ | 2022-03-28 16:08 | - | |
| Whitebook Sager 8660/ | 2022-03-28 16:08 | - | |
| Whitebook and Windows 7 pre-release ATI supplied drivers/ | 2022-03-28 16:08 | - | |
| Whitebook at xotic/ | 2022-03-28 16:08 | - | |
| Whitebook quality/ | 2022-03-28 16:08 | - | |
| Whitebook speakers/ | 2022-03-28 16:08 | - | |
| Whitebook stuttering sleep issue fix/ | 2022-03-28 16:08 | - | |
| White book with SSD HD vs traditional HD/ | 2022-03-28 16:08 | - | |
| Whitebox Provider/ | 2022-03-28 16:08 | - | |
| Who's personally installing Win XP on their IFL90/ | 2022-03-28 16:08 | - | |
| Who Is Responsible for Compal VBI Hel-80 Warranty/ | 2022-03-28 16:08 | - | |
| Who are Savrow/ | 2022-03-28 16:08 | - | |
| Who bought HGL-30 from RJtech/ | 2022-03-28 16:08 | - | |
| Who builds custom laptops in Canada/ | 2022-03-28 16:08 | - | |
| Who covers Sony warranty buying from P1/ | 2022-03-28 16:08 | - | |
| Who has bought a Philips X59 laptop/ | 2022-03-28 16:08 | - | |
| Who is Jetbook/ | 2022-03-28 16:08 | - | |
| Who is ZT/ | 2022-03-28 16:08 | - | |
| Who is building his own Compal Laptop/ | 2022-03-28 16:08 | - | |
| Who is manufacturing Zepto 12 cell battery for 6xx6 series/ | 2022-03-28 16:08 | - | |
| Who is the best boutique/ | 2022-03-28 16:08 | - | |
| Who knows this one internetishop UN25KD32A/ | 2022-03-28 16:08 | - | |
| Whole System Or Barebones/ | 2022-03-28 16:08 | - | |
| Who makes l notebooks/ | 2022-03-28 16:08 | - | |
| Why Does the IFL90 have no media controls/ | 2022-03-28 16:08 | - | |
| Why Eluktroboost with Mech-G3 2070 Super AS/ | 2022-03-28 16:08 | - | |
| Why I'm doing business with XoticPC/ | 2022-03-28 16:08 | - | |
| Why I Love Compal and Sager-/ | 2022-03-28 16:08 | - | |
| Why are Compal and Sager not included/ | 2022-03-28 16:08 | - | |
| Why buy boutique brands/ | 2022-03-28 16:08 | - | |
| Why c net score low for HL 80/ | 2022-03-28 16:08 | - | |
| Why do Zepto repairs take so long/ | 2022-03-28 16:08 | - | |
| Why does the HEL30 suck/ | 2022-03-28 16:08 | - | |
| Why drivers from Zepto/ | 2022-03-28 16:08 | - | |
| Why the big mark-up on Arctic Silver 5/ | 2022-03-28 16:08 | - | |
| WiFi doesn't work on wake/ | 2022-03-28 16:08 | - | |
| WiFi switch/ | 2022-03-28 16:08 | - | |
| WiFi won't working now/ | 2022-03-28 16:08 | - | |
| Wich memory does Znote 3415W use/ | 2022-03-28 16:08 | - | |
| Widnows 2000 Pro/ | 2022-03-28 16:08 | - | |
| WidowPC Canada/ | 2022-03-28 16:08 | - | |
| Widow Pc Sting 917 Fyi/ | 2022-03-28 16:08 | - | |
| Wierdest FL90 problem I've ever seen/ | 2022-03-28 16:08 | - | |
| Wifi comparision/ | 2022-03-28 16:08 | - | |
| Wifi issues with CT14-A1 in Win 8/ | 2022-03-28 16:08 | - | |
| Will A Compal CL56 Take ATA-100 Hardrive/ | 2022-03-28 16:08 | - | |
| Will Compal IFL90 Play BluRay/ | 2022-03-28 16:08 | - | |
| Will I need a screw extractor/ | 2022-03-28 16:08 | - | |
| Will The HEL80 take more than 2GB/ | 2022-03-28 16:08 | - | |
| Will This Charger Support My Averatec 6130HS/ | 2022-03-28 16:08 | - | |
| Will This Make the IFL90 Scrath Resistant/ | 2022-03-28 16:08 | - | |
| Will Zepto be upgrading Vista to Win 7 free/ | 2022-03-28 16:08 | - | |
| Will this hotfix work for the whitebooks/ | 2022-03-28 16:08 | - | |
| Will this memory upgrade work/ | 2022-03-28 16:08 | - | |
| Will this ram work in HEL80/ | 2022-03-28 16:08 | - | |
| Win2k on the 3415w/ | 2022-03-28 16:08 | - | |
| Win7 64 on Averatec 2370 Problems/ | 2022-03-28 16:08 | - | |
| Win7 Beta & Whitebook Performance/ | 2022-03-28 16:08 | - | |
| Win 8 CT14-A4/ | 2022-03-28 16:08 | - | |
| WinBook Notebooks/ | 2022-03-28 16:08 | - | |
| Win Media Center Edition 2005 and Vista Media Center and FlyTV DVB-T/ | 2022-03-28 16:08 | - | |
| Winbook Owners....Please help/ | 2022-03-28 16:08 | - | |
| Winbook W160 review at Hardware Central/ | 2022-03-28 16:08 | - | |
| Winbook W340 or other new W Series/ | 2022-03-28 16:08 | - | |
| Winbooks by Micro Center/ | 2022-03-28 16:08 | - | |
| Windows 7/ | 2022-03-28 16:08 | - | |
| Windows 7 Drivers for HGL-30/ | 2022-03-28 16:08 | - | |
| Windows 7 and the battery/ | 2022-03-28 16:08 | - | |
| Windows 7 installation issues/ | 2022-03-28 16:08 | - | |
| Windows 7 on HEL80/ | 2022-03-28 16:08 | - | |
| Windows 8.1 on Original Hardware/ | 2022-03-28 16:08 | - | |
| Windows Boot manager error for 4th time on Sager notebook (Compal JHL90)/ | 2022-03-28 16:08 | - | |
| Windows Hotstart/ | 2022-03-28 16:08 | - | |
| Windows Idle/ | 2022-03-28 16:08 | - | |
| Windows Loading Problem on HEL80/ | 2022-03-28 16:08 | - | |
| Windows Media 32bit 64bit Question/ | 2022-03-28 16:08 | - | |
| Windows Seven drivers for the Compal JHL90/ | 2022-03-28 16:08 | - | |
| Windows Vista Home Premium x64/ | 2022-03-28 16:08 | - | |
| Windows Vista Upgrade program/ | 2022-03-28 16:08 | - | |
| Windows Vista and Compal Hel80/ | 2022-03-28 16:08 | - | |
| Windows Vista in Znotes/ | 2022-03-28 16:08 | - | |
| Windows Vista on Compal HEL80/ | 2022-03-28 16:08 | - | |
| Windows XP PRO SP3 or Vista for games/ | 2022-03-28 16:08 | - | |
| Windows XP Pro 64 Bit edition/ | 2022-03-28 16:08 | - | |
| Windows XP on Gamer Xtreme M1/ | 2022-03-28 16:08 | - | |
| Windows XP on JFL92/ | 2022-03-28 16:08 | - | |
| Windows XP problems installing on FL90/ | 2022-03-28 16:08 | - | |
| Windows XP x64 - Finger print Camera - HEL80/ | 2022-03-28 16:08 | - | |
| Windows freeze on HGL30/ | 2022-03-28 16:08 | - | |
| Wireless AES encryption problem on JHL90/ | 2022-03-28 16:08 | - | |
| Wireless Connection Help/ | 2022-03-28 16:08 | - | |
| Wireless Driver shows up in Ext devices/ | 2022-03-28 16:08 | - | |
| Wireless Inet Question--/ | 2022-03-28 16:08 | - | |
| Wireless Internet problem after formatting/ | 2022-03-28 16:08 | - | |
| Wireless N in the HGL30/ | 2022-03-28 16:08 | - | |
| Wireless Select Switch and Windows XP x64/ | 2022-03-28 16:08 | - | |
| Wireless Select Switch doesn't work anymore/ | 2022-03-28 16:08 | - | |
| Wireless card automatically disabling on EL80/ | 2022-03-28 16:08 | - | |
| Wireless card connect issues/ | 2022-03-28 16:08 | - | |
| Wireless connectivity on the FL90/ | 2022-03-28 16:08 | - | |
| Wireless fix under XP Pack 2 for many models/ | 2022-03-28 16:08 | - | |
| Wireless issue on HEL80/ | 2022-03-28 16:08 | - | |
| Wireless kill switch on HGL31/ | 2022-03-28 16:08 | - | |
| Wireless network/ | 2022-03-28 16:08 | - | |
| Wireless turns off when the lid is closed/ | 2022-03-28 16:08 | - | |
| Wlan card/ | 2022-03-28 16:08 | - | |
| WoW problems/ | 2022-03-28 16:08 | - | |
| Wondering if 6625WD is for me!/ | 2022-03-28 16:08 | - | |
| Woo Hoo Ordered my Hel80/ | 2022-03-28 16:08 | - | |
| Woot, the Zepto Hydra A17 is out! (linky)/ | 2022-03-28 16:08 | - | |
| Workaround broken GPU, did you try this/ | 2022-03-28 16:08 | - | |
| Workstation apps on the 5720/ | 2022-03-28 16:08 | - | |
| World's First DIY Notebook Kit- FL90/ | 2022-03-28 16:08 | - | |
| World of Warcraft on 6224W/ | 2022-03-28 16:08 | - | |
| Worth getting repaired/ | 2022-03-28 16:08 | - | |
| Would Paypal be an advantage for Zepto/ | 2022-03-28 16:08 | - | |
| Would this work in my xFL90/ | 2022-03-28 16:08 | - | |
| Would you still go for the Compal if you had a 2nd chance/ | 2022-03-28 16:08 | - | |
| Wow Audio Video Touch buttons Compal IFL90/ | 2022-03-28 16:08 | - | |
| Wow audio video doesn't work/ | 2022-03-28 16:08 | - | |
| Wrath of the zepto customer/ | 2022-03-28 16:08 | - | |
| Wrong memorystick to 6625WD/ | 2022-03-28 16:08 | - | |
| X50 MV Pro/ | 2022-03-28 16:08 | - | |
| X3000/ | 2022-03-28 16:08 | - | |
| X9100 vs Q9200/ | 2022-03-28 16:08 | - | |
| XFG (videocard maker) jumps into the laptop market/ | 2022-03-28 16:08 | - | |
| XG Action 6000/ | 2022-03-28 16:08 | - | |
| XG Action 6000 Notebook/ | 2022-03-28 16:08 | - | |
| XMG Core 17 Tongfang GK7CP6R owners, I have a query please/ | 2022-03-28 16:08 | - | |
| XMG P707 - Strange problem with GPU/ | 2022-03-28 16:08 | - | |
| XP 64-bit/ | 2022-03-28 16:09 | - | |
| XP Battery software/ | 2022-03-28 16:09 | - | |
| XP Driver for Radeon HD 3650/ | 2022-03-28 16:09 | - | |
| XP drivers for 2100 Series AV2150-EH1/ | 2022-03-28 16:09 | - | |
| XP on the JHL90/ | 2022-03-28 16:09 | - | |
| XP sp2 + Wireless = misery on 6100 Try this/ | 2022-03-28 16:09 | - | |
| Xiaomi Mi Air 13 - i5 6200U, 940MX/ | 2022-03-28 16:08 | - | |
| Xiaomi Mi Notebook Air 12.5 and 13.3/ | 2022-03-28 16:08 | - | |
| Xiaomi mi notebook pro/ | 2022-03-28 16:08 | - | |
| Xidax/ | 2022-03-28 16:08 | - | |
| Xmeld (MSI Turion notebooks)/ | 2022-03-28 16:08 | - | |
| Xotic OCZ FORCE EXTREME 840 Questions/ | 2022-03-28 16:08 | - | |
| XoticPC's OCZ Extreme 840 - Are you ready/ | 2022-03-28 16:09 | - | |
| XoticPC.com Let Me Down, But Have Responded Well to Correct Their Error/ | 2022-03-28 16:09 | - | |
| Xotic PC Force NBLB2 (Compal NBLB2)/ | 2022-03-28 16:08 | - | |
| XoticPC and PowerNotebooks Offering IFL90 with WXGA+ and 8600M GT/ | 2022-03-28 16:08 | - | |
| XoticPC selling OCZ Whitebook (Arima W840 DI) - nice!/ | 2022-03-28 16:09 | - | |
| Xoticpc/ | 2022-03-28 16:08 | - | |
| Xoticpc monthly payments/ | 2022-03-28 16:09 | - | |
| Xoticpc shipping/ | 2022-03-28 16:09 | - | |
| Xplorer X5 6800 Notebook/ | 2022-03-28 16:09 | - | |
| Xplorer X7-8100, Geforce 675m or 680m/ | 2022-03-28 16:09 | - | |
| Xplorer notebooks/ | 2022-03-28 16:09 | - | |
| Xtream Gear/ | 2022-03-28 16:09 | - | |
| Xtreme CTX with Core Duo processor/ | 2022-03-28 16:09 | - | |
| Xtreme Edge 745/ | 2022-03-28 16:09 | - | |
| Xtremenotebooks.com or Ibuypower/ | 2022-03-28 16:09 | - | |
| Yet another standby won't wake up HEL80 thread/ | 2022-03-28 16:09 | - | |
| Yet an other what to buy ......3790 vs 9860/ | 2022-03-28 16:09 | - | |
| Yet more overheating (6214)/ | 2022-03-28 16:09 | - | |
| YouTube- Zepto Znote 6224W CLB's configuration/ | 2022-03-28 16:09 | - | |
| Your 6214 Screen/ | 2022-03-28 16:09 | - | |
| Your BF2 Settings/ | 2022-03-28 16:09 | - | |
| Your Computer Setups! Let the reviews begin/ | 2022-03-28 16:09 | - | |
| Your opinion on the Compal IFL90/ | 2022-03-28 16:09 | - | |
| Z790/ | 2022-03-28 16:09 | - | |
| ZEPTO G15 Fan replacement/ | 2022-03-28 16:09 | - | |
| ZEPTO becomes insolvent!!!/ | 2022-03-28 16:09 | - | |
| ZNote 6314W thermal zones/ | 2022-03-28 16:09 | - | |
| ZNote 6625 new chipsetdriver- Intel_Chipset_8.3.1.1009_Vista_32bit/ | 2022-03-28 16:09 | - | |
| ZT Element/ | 2022-03-28 16:09 | - | |
| ZT Element S1007i-73/ | 2022-03-28 16:09 | - | |
| Zen and buying 6625WD/ | 2022-03-28 16:09 | - | |
| Zepto & RMClock other tools/ | 2022-03-28 16:09 | - | |
| Zepto 'Titan' for 299,- euro/ | 2022-03-28 16:09 | - | |
| Zepto's DX9 models - when discontinued/ | 2022-03-28 16:09 | - | |
| Zepto's Festive Discount Release Period/ | 2022-03-28 16:09 | - | |
| Zepto's MXM standing/ | 2022-03-28 16:09 | - | |
| Zepto's On Ebay/ | 2022-03-28 16:09 | - | |
| Zepto's overheating/ | 2022-03-28 16:09 | - | |
| Zepto's support, WTF/ | 2022-03-28 16:09 | - | |
| Zepto, SSD and SATA-II/ | 2022-03-28 16:09 | - | |
| Zepto- Nothing but Problems/ | 2022-03-28 16:09 | - | |
| Zepto - POOR UK Customer Service/ | 2022-03-28 16:09 | - | |
| Zepto- bad customer service support/ | 2022-03-28 16:09 | - | |
| Zepto/ | 2022-03-28 16:09 | - | |
| Zepto 6x24 card reader adaptor suggestions/ | 2022-03-28 16:09 | - | |
| Zepto 13'3/ | 2022-03-28 16:09 | - | |
| Zepto 17inch Laptop Soon/ | 2022-03-28 16:09 | - | |
| Zepto 300mbit Wireless LAN drivers/ | 2022-03-28 16:09 | - | |
| Zepto 2415w without a sound!/ | 2022-03-28 16:09 | - | |
| Zepto 2425W (EL80) color improvement/ | 2022-03-28 16:09 | - | |
| Zepto 2425W processor/ | 2022-03-28 16:09 | - | |
| Zepto 3214W vs. Compal IFT01/ | 2022-03-28 16:09 | - | |
| Zepto 3215 W- Power issues/ | 2022-03-28 16:09 | - | |
| Zepto 3405W - a budget gaming machine/ | 2022-03-28 16:09 | - | |
| Zepto 3415 DVD drive problem !/ | 2022-03-28 16:09 | - | |
| Zepto 3415W (Compal IFL90 w WXGA) Review/ | 2022-03-28 16:09 | - | |
| Zepto 3415W - Audio question/ | 2022-03-28 16:09 | - | |
| Zepto 3415W Fingerprint Scanner for BIOS P W/ | 2022-03-28 16:09 | - | |
| Zepto 3415W Microphones -- Very Quiet!/ | 2022-03-28 16:09 | - | |
| Zepto 3415W Nvidia 8600m GT shutdown problem/ | 2022-03-28 16:09 | - | |
| Zepto 3415W issues/ | 2022-03-28 16:09 | - | |
| Zepto 3415w Desktop Resolution/ | 2022-03-28 16:09 | - | |
| Zepto 6024W + latest Intel graphics driver (15.7)/ | 2022-03-28 16:09 | - | |
| Zepto 6024W - Battery behaviour/ | 2022-03-28 16:09 | - | |
| Zepto 6024W - Unexpected Shutdown/ | 2022-03-28 16:09 | - | |
| Zepto 6214W - OSD and XD card/ | 2022-03-28 16:09 | - | |
| Zepto 6214W -where to buy/ | 2022-03-28 16:09 | - | |
| Zepto 6214W DVD-Drive, Cursed or just Haunted/ | 2022-03-28 16:09 | - | |
| Zepto 6214W Keyboard Replacement/ | 2022-03-28 16:09 | - | |
| Zepto 6214W Screen/ | 2022-03-28 16:09 | - | |
| Zepto 6214w versus Compal HGL30/ | 2022-03-28 16:09 | - | |
| Zepto 6224, Screen wont start!/ | 2022-03-28 16:09 | - | |
| Zepto 6224 - Win 64bit drivers/ | 2022-03-28 16:09 | - | |
| Zepto 6224- quality and warranty/ | 2022-03-28 16:09 | - | |
| Zepto 6224 Express Card IR-remote/ | 2022-03-28 16:09 | - | |
| Zepto 6224W - Warranty/ | 2022-03-28 16:09 | - | |
| Zepto 6224W PC MicroWorks Impulse = Compal/ | 2022-03-28 16:09 | - | |
| Zepto 6224W Pre-Review/ | 2022-03-28 16:09 | - | |
| Zepto 6224W Upgradeable Video Card/ | 2022-03-28 16:09 | - | |
| Zepto 6224W w 2.4Ghz Processor/ | 2022-03-28 16:09 | - | |
| Zepto 6224W with Norwegian Keyboard/ | 2022-03-28 16:09 | - | |
| Zepto 6224 screen UK/ | 2022-03-28 16:09 | - | |
| Zepto 6224w + full-hd on Benq E2400HD/ | 2022-03-28 16:09 | - | |
| Zepto 6224w dvd drive problem/ | 2022-03-28 16:09 | - | |
| Zepto 6224w gone up in price !/ | 2022-03-28 16:09 | - | |
| Zepto 6224w nvidia drivers/ | 2022-03-28 16:09 | - | |
| Zepto 6225WD/ | 2022-03-28 16:09 | - | |
| Zepto 6314W In-Car Charger/ | 2022-03-28 16:09 | - | |
| Zepto 6324 Speakers/ | 2022-03-28 16:09 | - | |
| Zepto 6324 heat problems/ | 2022-03-28 16:09 | - | |
| Zepto 6615 Impressive but touchpad problems/ | 2022-03-28 16:09 | - | |
| Zepto 6615WD/ | 2022-03-28 16:09 | - | |
| Zepto 6615WD weight/ | 2022-03-28 16:09 | - | |
| Zepto 6615 black screen/ | 2022-03-28 16:09 | - | |
| Zepto 6625-A quick review/ | 2022-03-28 16:09 | - | |
| Zepto 6625 Cracked Screen/ | 2022-03-28 16:09 | - | |
| Zepto 6625 DirectX10 Notebook Announced/ | 2022-03-28 16:09 | - | |
| Zepto 6625 Vs Asus G1S/ | 2022-03-28 16:09 | - | |
| Zepto 6625WD BSOD at startup, delivered with faulty memory And what to do/ | 2022-03-28 16:09 | - | |
| Zepto 6625WD Bluescreening!/ | 2022-03-28 16:09 | - | |
| Zepto 6625WD Complete Review/ | 2022-03-28 16:09 | - | |
| Zepto 6625WD Review/ | 2022-03-28 16:09 | - | |
| Zepto 6625WD and logitech V270 bluetooth mouse/ | 2022-03-28 16:09 | - | |
| Zepto 6625WD problem with sound in XP/ | 2022-03-28 16:09 | - | |
| Zepto 6625WD reviewed by Trusted Reviews/ | 2022-03-28 16:09 | - | |
| Zepto 6625WD vs. Acer 5920 gemstone/ | 2022-03-28 16:09 | - | |
| Zepto 6625wd and Analog surround, help please/ | 2022-03-28 16:09 | - | |
| Zepto 6625wd crash my 2,5 cents -)/ | 2022-03-28 16:09 | - | |
| Zepto 8640/ | 2022-03-28 16:09 | - | |
| Zepto Bison Cam/ | 2022-03-28 16:09 | - | |
| Zepto Bluetooth/ | 2022-03-28 16:09 | - | |
| Zepto Build Quality/ | 2022-03-28 16:09 | - | |
| Zepto CPU Availability/ | 2022-03-28 16:09 | - | |
| Zepto Customer Service/ | 2022-03-28 16:09 | - | |
| Zepto Danmark - Waiting on delivery for 2 months.. customer service line dead/ | 2022-03-28 16:09 | - | |
| Zepto Delivery Service/ | 2022-03-28 16:09 | - | |
| Zepto Driver CD 1.0/ | 2022-03-28 16:09 | - | |
| Zepto External Monitors & Photo Editing/ | 2022-03-28 16:09 | - | |
| Zepto FL90 Power problems/ | 2022-03-28 16:09 | - | |
| Zepto G14b upgraded from 1440x900 to 1280x800/ | 2022-03-28 16:09 | - | |
| Zepto G14 sleep problems/ | 2022-03-28 16:09 | - | |
| Zepto In Canada/ | 2022-03-28 16:09 | - | |
| Zepto Januar drivers/ | 2022-03-28 16:09 | - | |
| Zepto Keyboard Just Broke/ | 2022-03-28 16:09 | - | |
| Zepto Laptop - Vista SP1 (Service pack 1) install/ | 2022-03-28 16:09 | - | |
| Zepto Mythos's new casing!!/ | 2022-03-28 16:09 | - | |
| Zepto Mythos 15A Help!/ | 2022-03-28 16:09 | - | |
| Zepto Mythos A15/ | 2022-03-28 16:09 | - | |
| Zepto Nexus A15 - MXM and future upgrade/ | 2022-03-28 16:09 | - | |
| Zepto Nexus A15/ | 2022-03-28 16:09 | - | |
| Zepto Nexus Discontinued/ | 2022-03-28 16:09 | - | |
| Zepto Nexus random freezing/ | 2022-03-28 16:09 | - | |
| Zepto Notebooks/ | 2022-03-28 16:09 | - | |
| Zepto Notus/ | 2022-03-28 16:09 | - | |
| Zepto Notus and Windows XP/ | 2022-03-28 16:09 | - | |
| Zepto Nox - Thermal paste/ | 2022-03-28 16:09 | - | |
| Zepto Nox - Windows 7/ | 2022-03-28 16:09 | - | |
| Zepto Nox A15 disassembly/ | 2022-03-28 16:09 | - | |
| Zepto NoxA15 screen went black/ | 2022-03-28 16:09 | - | |
| Zepto Nox Mythos Nexus max gpu temps/ | 2022-03-28 16:09 | - | |
| Zepto Nox Zepto Mythos pics trailers/ | 2022-03-28 16:09 | - | |
| Zepto Nox and Mythos graphicscard upgrade in the works/ | 2022-03-28 16:09 | - | |
| Zepto Nox webcam on Windows XP 32-bit/ | 2022-03-28 16:09 | - | |
| Zepto Official Driver Download - Now Online/ | 2022-03-28 16:09 | - | |
| Zepto Owners Favorite Apps, Tweaks and Stuff Thread/ | 2022-03-28 16:09 | - | |
| Zepto Pick Up and Return Service Warranty/ | 2022-03-28 16:09 | - | |
| Zepto Pricing/ | 2022-03-28 16:09 | - | |
| Zepto RMA help/ | 2022-03-28 16:09 | - | |
| Zepto Release Znote 3415W for preorder through websites/ | 2022-03-28 16:09 | - | |
| Zepto Satisfaction Poll (standard)/ | 2022-03-28 16:09 | - | |
| Zepto Screen Scratches/ | 2022-03-28 16:09 | - | |
| Zepto Service/ | 2022-03-28 16:09 | - | |
| Zepto Service does not exist/ | 2022-03-28 16:09 | - | |
| Zepto Slot-in Drive Issue/ | 2022-03-28 16:09 | - | |
| Zepto Sony DVD RW Drive Problem - help !/ | 2022-03-28 16:09 | - | |
| Zepto Support in UK/ | 2022-03-28 16:09 | - | |
| Zepto UK Address!/ | 2022-03-28 16:09 | - | |
| Zepto UK Order/ | 2022-03-28 16:09 | - | |
| Zepto UK customer service on the ball!/ | 2022-03-28 16:09 | - | |
| Zepto UK don't you just love them/ | 2022-03-28 16:09 | - | |
| Zepto USA and Canada/ | 2022-03-28 16:09 | - | |
| Zepto US website and possible resellers/ | 2022-03-28 16:09 | - | |
| Zepto Warranty Question/ | 2022-03-28 16:09 | - | |
| Zepto Warranty cost changes/ | 2022-03-28 16:09 | - | |
| Zepto Webcams/ | 2022-03-28 16:09 | - | |
| Zepto Wireless Intel 4965AGN 300Mbps Help/ | 2022-03-28 16:09 | - | |
| Zepto Wpro 300Mbit wireless network card/ | 2022-03-28 16:09 | - | |
| Zepto Z-Note 6625WD DX10 Notebook Offically Announced/ | 2022-03-28 16:09 | - | |
| Zepto Zepto Presto Chango!/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6x24W - BIOS z14005/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6x24W - BIOS z14005e/ | 2022-03-28 16:09 | - | |
| Zepto Znote 2225W or 6014W/ | 2022-03-28 16:09 | - | |
| Zepto Znote 2425W Vista Drivers/ | 2022-03-28 16:09 | - | |
| Zepto Znote 2425W with WSXGA+/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6014 6214 6314W - BIOS z1.24/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6014 6214 6314W - BIOS z1.25/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6014 6214 6314W - BIOS z1.26/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6024W - BIOS z14I006/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6024W Review Now Posted/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6024W available/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6025WD - BIOS z15I011/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6025WD - Office (UK)/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6025 WD/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6214 Graphics Drivers/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6214W is not booting (at all)/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6224 Now available on UK site !!!/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6224W 6324W - BIOS z14N006/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6224W First Impressions/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6224W ugly silver parts/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6224w - Guide/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6314W/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6324W First Impressions/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6615WD - built-in tv-card/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6615WD/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6615WD Screen/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6615WD display screen response time and general questions/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6615WD fan issues/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6615WD thoughts/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD - BIOS z15N011/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD - BIOS z15N012/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD - BIOS z15N015/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD BIOS z15N015/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD Crysis Demo/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD Keyboard/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD Now available on UK site !!!/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD forthcoming review/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD no display/ | 2022-03-28 16:09 | - | |
| Zepto Znote 6625WD wireless internet problems/ | 2022-03-28 16:09 | - | |
| Zepto Znote 7000 and GNU Linux/ | 2022-03-28 16:09 | - | |
| Zepto and 8600m gt/ | 2022-03-28 16:09 | - | |
| Zepto and Firewire (external hd)/ | 2022-03-28 16:09 | - | |
| Zepto and Linux/ | 2022-03-28 16:09 | - | |
| Zepto and warranty/ | 2022-03-28 16:09 | - | |
| Zepto and what laptop magazine offer Znote 6015 amazing price £499 + shipping/ | 2022-03-28 16:09 | - | |
| Zepto backlight switch/ | 2022-03-28 16:09 | - | |
| Zepto bankrupt/ | 2022-03-28 16:09 | - | |
| Zepto build quality and other info!/ | 2022-03-28 16:09 | - | |
| Zepto chassis/ | 2022-03-28 16:09 | - | |
| Zepto customer services...big whinge/ | 2022-03-28 16:09 | - | |
| Zepto delivery in Sweden/ | 2022-03-28 16:09 | - | |
| Zepto delivery times once shipped/ | 2022-03-28 16:09 | - | |
| Zepto don't do dimensions/ | 2022-03-28 16:09 | - | |
| Zepto drivers - ftp folder is empty!/ | 2022-03-28 16:09 | - | |
| Zepto ever to use Vestel/ | 2022-03-28 16:09 | - | |
| Zepto filed for bankruptcy/ | 2022-03-28 16:09 | - | |
| Zepto first to launch worlds largest mobile hard drive (320GB)/ | 2022-03-28 16:09 | - | |
| Zepto for Asia/ | 2022-03-28 16:09 | - | |
| Zepto g14b very noisy!!/ | 2022-03-28 16:09 | - | |
| Zepto in Dubai/ | 2022-03-28 16:09 | - | |
| Zepto in NZ/ | 2022-03-28 16:09 | - | |
| Zepto in problems/ | 2022-03-28 16:09 | - | |
| Zepto is back!/ | 2022-03-28 16:09 | - | |
| Zepto is playing dirty/ | 2022-03-28 16:09 | - | |
| Zepto models with HDMI or DVI/ | 2022-03-28 16:09 | - | |
| Zepto netbook is arriving/ | 2022-03-28 16:09 | - | |
| Zepto notebooks - USB power stays on when computer is off/ | 2022-03-28 16:09 | - | |
| Zepto notebooks cheaper in UK than/ | 2022-03-28 16:09 | - | |
| Zepto not in NBR Manufacturer list & more 6625W Review info/ | 2022-03-28 16:09 | - | |
| Zepto offering 500GB HDD option/ | 2022-03-28 16:09 | - | |
| Zepto opens 2 stores in Copenhagen/ | 2022-03-28 16:09 | - | |
| Zeptop 6625WD/ | 2022-03-28 16:09 | - | |
| Zepto payment options uk/ | 2022-03-28 16:09 | - | |
| Zepto preparing 17 gaming notebook/ | 2022-03-28 16:09 | - | |
| Zepto quality/ | 2022-03-28 16:09 | - | |
| Zepto readies the next generation of wireless networks for notebooks/ | 2022-03-28 16:09 | - | |
| Zepto release 320GB 5400 samsung Hard drive/ | 2022-03-28 16:09 | - | |
| Zepto release Znote 3215W for pre order through websites/ | 2022-03-28 16:09 | - | |
| Zepto repair questions/ | 2022-03-28 16:09 | - | |
| Zepto repair service/ | 2022-03-28 16:09 | - | |
| Zepto support !!/ | 2022-03-28 16:09 | - | |
| Zepto to quit selling laptops in 14 countries/ | 2022-03-28 16:09 | - | |
| Zepto to supply Compal HGL30/ | 2022-03-28 16:09 | - | |
| Zepto vs Dell/ | 2022-03-28 16:09 | - | |
| Zepto with DVI/ | 2022-03-28 16:09 | - | |
| Zepto with preinstalled Windows Vista/ | 2022-03-28 16:09 | - | |
| Zepto won't start. Tpm problem/ | 2022-03-28 16:09 | - | |
| Zepto won't take my money/ | 2022-03-28 16:09 | - | |
| Zepto znote 3415W - AC adapter low effect heat/ | 2022-03-28 16:09 | - | |
| Zepto znote 3415W - Grafik/ | 2022-03-28 16:09 | - | |
| Zepto znote 6214w and BF2/ | 2022-03-28 16:09 | - | |
| Zeptp nox mythos delivery time/ | 2022-03-28 16:09 | - | |
| Zeto 6625WD DVD Drive problems/ | 2022-03-28 16:09 | - | |
| Zeusbook Ultimate/ | 2022-03-28 16:09 | - | |
| ZioSys.com - new Laptop/ | 2022-03-28 16:09 | - | |
| Zmore tv tuner problem/ | 2022-03-28 16:09 | - | |
| Znote - 6224 - fan on always/ | 2022-03-28 16:09 | - | |
| Znote 2415w and windows 7. Sound problems/ | 2022-03-28 16:09 | - | |
| Znote 3415 Disassembly guide/ | 2022-03-28 16:09 | - | |
| Znote 3415W WOW VIDEO and WOW AUDIO (Win7) problem/ | 2022-03-28 16:09 | - | |
| Znote 3415W Zpro2 N driver/ | 2022-03-28 16:09 | - | |
| Znote 3415W and OS'es/ | 2022-03-28 16:09 | - | |
| Znote 6024W - Study/ | 2022-03-28 16:09 | - | |
| Znote 6024W/ | 2022-03-28 16:09 | - | |
| Znote6214W - BIOS z123.iso/ | 2022-03-28 16:09 | - | |
| Znote 6214W Problems/ | 2022-03-28 16:09 | - | |
| Znote 6214W card reader drivers for Vista 64bit/ | 2022-03-28 16:09 | - | |
| Znote 6214W screen backlight/ | 2022-03-28 16:09 | - | |
| Znote 6214w viewing angles/ | 2022-03-28 16:09 | - | |
| Znote 6224W - Fn key problem/ | 2022-03-28 16:09 | - | |
| Znote 6224W/ | 2022-03-28 16:09 | - | |
| Znote 6224W and battery life/ | 2022-03-28 16:09 | - | |
| Znote 6224W keyboard/ | 2022-03-28 16:09 | - | |
| Znote 6224W or Znote 6324W UK Owners/ | 2022-03-28 16:09 | - | |
| Znote 6224W start-up problems/ | 2022-03-28 16:09 | - | |
| Znote 6224 mute button issue/ | 2022-03-28 16:09 | - | |
| Znote 6224 noise/ | 2022-03-28 16:09 | - | |
| Znote 6224w Vista or XP/ | 2022-03-28 16:09 | - | |
| Znote6314W- Ubuntu installation problem/ | 2022-03-28 16:09 | - | |
| Znote6324 CPU throttling and GPU overheating, should I bother sending it to the manufacturer/ | 2022-03-28 16:09 | - | |
| Znote 6324W - Resume from Standby only shows a blank screen/ | 2022-03-28 16:09 | - | |
| Znote 6324W - suddenly not going into sleep/ | 2022-03-28 16:09 | - | |
| Znote 6324W Quality/ | 2022-03-28 16:09 | - | |
| Znote 6324W Zepto DPC Latency Problem solved/ | 2022-03-28 16:09 | - | |
| Znote 6324 throttling - serious CPU themal problems/ | 2022-03-28 16:09 | - | |
| Znote 6324w and forceware drivers/ | 2022-03-28 16:09 | - | |
| Znote 6324w wallpaper/ | 2022-03-28 16:09 | - | |
| Znote 6424w, heat and latency/ | 2022-03-28 16:09 | - | |
| Znote 6615WD Barbones Manufactuer/ | 2022-03-28 16:09 | - | |
| Znote 6615WD screen probs/ | 2022-03-28 16:09 | - | |
| Znote 6625 BIOS 6625_z15n004 HELP!!!!/ | 2022-03-28 16:09 | - | |
| Znote 6625 Not Up To Scratch/ | 2022-03-28 16:09 | - | |
| Znote 6625WD, adding more RAM/ | 2022-03-28 16:09 | - | |
| Znote 6625WD - includes AC Adapter 6x15, 6x14/ | 2022-03-28 16:09 | - | |
| Znote 6625WD/ | 2022-03-28 16:09 | - | |
| Znote 6625WD Graphics Card broken/ | 2022-03-28 16:09 | - | |
| Znote 6625WD or Znote 6324W/ | 2022-03-28 16:09 | - | |
| Znote 6625WD upgrade/ | 2022-03-28 16:09 | - | |
| Znote Counter Strike problem/ | 2022-03-28 16:09 | - | |
| Znote G15 underachieving badly/ | 2022-03-28 16:09 | - | |
| Znotes with Merom- Win XP64 or not/ | 2022-03-28 16:09 | - | |
| [6214]Is the double screen killing the GPU/ | 2022-03-28 16:09 | - | |
| [6615WD] Cleaning out the fan/ | 2022-03-28 16:09 | - | |
| [6615WD] Freezing World of Warcraft/ | 2022-03-28 16:09 | - | |
| [ASK] Product Number of Zepto 12cell battery/ | 2022-03-28 16:09 | - | |
| [BIOS] KHLB2 updating to custom bios/ | 2022-03-28 16:09 | - | |
| [FL 90] Help with blind booting/ | 2022-03-28 16:09 | - | |
| [FL90] Keyboard keys not working/ | 2022-03-28 16:09 | - | |
| [FL92] Buttons to the right of power button/ | 2022-03-28 16:09 | - | |
| [HEL80] Keyboard layout/ | 2022-03-28 16:09 | - | |
| [HEL 80] WLAN kill switch not working/ | 2022-03-28 16:09 | - | |
| [IFL90]Shutdown while playing/ | 2022-03-28 16:09 | - | |
| [IFL 90] Upgrading Memory/ | 2022-03-28 16:09 | - | |
| [Info] Battery lifetime/ | 2022-03-28 16:09 | - | |
| [Medion] Found this ... good notebook, cheap... any opinions/ | 2022-03-28 16:09 | - | |
| [Official] Huawei Matebook X Pro Owners Lounge/ | 2022-03-28 16:09 | - | |
| [Question] ECS E11IS1 bios mods/ | 2022-03-28 16:09 | - | |
| [REQ] New ODM notebook LIST Intel Napa/ | 2022-03-28 16:09 | - | |
| [Req]Procedure for Crisis REcovery diskette [Recovery bios fail]/ | 2022-03-28 16:09 | - | |
| [Request] Increase RAM for Compal HEL80/ | 2022-03-28 16:09 | - | |
| [Resolved!] Disappointing Customer Service with Portable One/ | 2022-03-28 16:09 | - | |
| [To Morten] New BIOS - status/ | 2022-03-28 16:09 | - | |
| [WTA] Please help... Some question for Znote 6615WD/ | 2022-03-28 16:09 | - | |
| [Znote 6224W]microphone working really bad/ | 2022-03-28 16:09 | - | |
| [Znote 6615WD] Hybrid Mini-PCI TV card - a long way/ | 2022-03-28 16:09 | - | |
| [ask] hel80 wireless things/ | 2022-03-28 16:09 | - | |
| about bluetooth on the compal/ | 2022-03-28 16:05 | - | |
| about mythos nox bios/ | 2022-03-28 16:05 | - | |
| about that touchpad/ | 2022-03-28 16:05 | - | |
| ac adapters/ | 2022-03-28 16:05 | - | |
| acer ferrari 3000/ | 2022-03-28 16:05 | - | |
| actius al 27 users!!!/ | 2022-03-28 16:05 | - | |
| actual screen size of 6625WD/ | 2022-03-28 16:05 | - | |
| adding memory to IFL90/ | 2022-03-28 16:05 | - | |
| advent 7072/ | 2022-03-28 16:05 | - | |
| advent S431/ | 2022-03-28 16:05 | - | |
| advice please/ | 2022-03-28 16:05 | - | |
| a few jfl92's... some pics/ | 2022-03-28 16:05 | - | |
| afraid to buy online/ | 2022-03-28 16:05 | - | |
| agearnotebooks.com - how good are they/ | 2022-03-28 16:05 | - | |
| agere modem driver standby problem-xp pro/ | 2022-03-28 16:05 | - | |
| alienware notebooks vs Voodoo PC's new line up in LATE june/ | 2022-03-28 16:05 | - | |
| all in one opening/ | 2022-03-28 16:05 | - | |
| amateur asking for guidance...COMPAL PBL21/ | 2022-03-28 16:05 | - | |
| another 8600m problem/ | 2022-03-28 16:05 | - | |
| another Compal hgl-30 review/ | 2022-03-28 16:05 | - | |
| another which notebook should I get thread/ | 2022-03-28 16:05 | - | |
| anybody have a zeos/ | 2022-03-28 16:05 | - | |
| anybody owns MITAC 8224D/ | 2022-03-28 16:05 | - | |
| any idea who the ODM is for this notebook/ | 2022-03-28 16:05 | - | |
| any loose cables possibly/ | 2022-03-28 16:05 | - | |
| anyone... what LCD panel is in your averatec/ | 2022-03-28 16:05 | - | |
| anyone consider the sharp 3d/ | 2022-03-28 16:05 | - | |
| anyone getting a zepto nox next week/ | 2022-03-28 16:05 | - | |
| anyone heard of mitac or mitec/ | 2022-03-28 16:05 | - | |
| anyone help with a Getac V100 service manual schematic/ | 2022-03-28 16:05 | - | |
| anyone here owned a dell 1730 that now has a whitebook/ | 2022-03-28 16:05 | - | |
| anyone with info on this clevo laptop/ | 2022-03-28 16:05 | - | |
| any pictures/ | 2022-03-28 16:05 | - | |
| any revews of the whitebook with comparison pics/ | 2022-03-28 16:05 | - | |
| are hgl30 and hel80 VBI/ | 2022-03-28 16:05 | - | |
| are whitebooks trustworthy/ | 2022-03-28 16:05 | - | |
| arima M623-DCX quality/ | 2022-03-28 16:05 | - | |
| arrghh - GPU which driver/ | 2022-03-28 16:05 | - | |
| atheros wireless and baterry issues/ | 2022-03-28 16:05 | - | |
| attachments/ | 2022-03-28 16:05 | - | |
| audio problem/ | 2022-03-28 16:05 | - | |
| auto run stopped working/ | 2022-03-28 16:05 | - | |
| av6130h1-10 is freezing/ | 2022-03-28 16:05 | - | |
| avaratec 4200 review/ | 2022-03-28 16:05 | - | |
| averag score with xfrire with x9100 vs qx9300/ | 2022-03-28 16:05 | - | |
| averatec 2200 replacing 12.1 screen/ | 2022-03-28 16:05 | - | |
| averatec 2300 series/ | 2022-03-28 16:05 | - | |
| averatec 2300 turns on but screen stays black/ | 2022-03-28 16:05 | - | |
| averatec 2575 battery same as msi Megabook/ | 2022-03-28 16:05 | - | |
| averatec 3200 dvd cdr w died...help please!/ | 2022-03-28 16:05 | - | |
| averatec 3225hs/ | 2022-03-28 16:05 | - | |
| averatec 3270/ | 2022-03-28 16:05 | - | |
| averatec 3700 series/ | 2022-03-28 16:05 | - | |
| averatec 4100 drivers for xp/ | 2022-03-28 16:05 | - | |
| averatec 5110HR refurb from tigerdirect/ | 2022-03-28 16:05 | - | |
| averatec 5110 series/ | 2022-03-28 16:05 | - | |
| averatec 6235 hardware components/ | 2022-03-28 16:05 | - | |
| averatec AV6130HS remarks/ | 2022-03-28 16:05 | - | |
| averatec av 4265 - upgradibility of graphics processor/ | 2022-03-28 16:05 | - | |
| averatec av6130h1-10 video upgrade/ | 2022-03-28 16:05 | - | |
| averatec c3500 firewire can capture DV properly/ | 2022-03-28 16:05 | - | |
| averatec memory and hard drive upgrades/ | 2022-03-28 16:05 | - | |
| averatec shipitforyou.com useless/ | 2022-03-28 16:05 | - | |
| averatec spares/ | 2022-03-28 16:05 | - | |
| averatec usb issues/ | 2022-03-28 16:05 | - | |
| awaiting the new P1 MX/ | 2022-03-28 16:05 | - | |
| bENQ joybook r55v/ | 2022-03-28 16:05 | - | |
| backlit keyboard color problem/ | 2022-03-28 16:05 | - | |
| bad audio playback on whitebook/ | 2022-03-28 16:05 | - | |
| bad flash bios NP2090/ | 2022-03-28 16:05 | - | |
| bad processor power leak on my UX/ | 2022-03-28 16:05 | - | |
| bag for ifl90 with a 9 cell battery/ | 2022-03-28 16:05 | - | |
| battery change - what model/ | 2022-03-28 16:05 | - | |
| battery life and OS/ | 2022-03-28 16:05 | - | |
| battery life from the whitebook/ | 2022-03-28 16:05 | - | |
| battery problem on hel80/ | 2022-03-28 16:05 | - | |
| battery saving on 6615WD/ | 2022-03-28 16:05 | - | |
| battery training auto calibration/ | 2022-03-28 16:05 | - | |
| battery wear 9% is that normal/ | 2022-03-28 16:05 | - | |
| beeps/ | 2022-03-28 16:05 | - | |
| beep sound on 6130HS/ | 2022-03-28 16:05 | - | |
| benq 7000 joybook/ | 2022-03-28 16:05 | - | |
| benq laptops/ | 2022-03-28 16:05 | - | |
| best keyboard among P1 offerings/ | 2022-03-28 16:05 | - | |
| better 2370 vista video driver/ | 2022-03-28 16:05 | - | |
| better louder speakers in HGL30/ | 2022-03-28 16:05 | - | |
| bios and ec for cz-27/ | 2022-03-28 16:05 | - | |
| bios bomb/ | 2022-03-28 16:05 | - | |
| bios flashing. how/ | 2022-03-28 16:05 | - | |
| bios trouble/ | 2022-03-28 16:05 | - | |
| bizcom drivers for ifl90 - intel or compal/ | 2022-03-28 16:05 | - | |
| black rubber spacer from 3200/ | 2022-03-28 16:05 | - | |
| bluetooth disappeared 6224/ | 2022-03-28 16:05 | - | |
| bluetooth help!/ | 2022-03-28 16:05 | - | |
| bluetooth not working/ | 2022-03-28 16:05 | - | |
| broken casing/ | 2022-03-28 16:05 | - | |
| building a budget HGL-30... using a T2050 and Atheros nic/ | 2022-03-28 16:05 | - | |
| build quality of 6625WD/ | 2022-03-28 16:05 | - | |
| build your own Compal with amazing prices/ | 2022-03-28 16:05 | - | |
| built in camera/ | 2022-03-28 16:05 | - | |
| burning cd in itunes error/ | 2022-03-28 16:05 | - | |
| buy from portable one/ | 2022-03-28 16:05 | - | |
| buying barebones in australia/ | 2022-03-28 16:05 | - | |
| buying the new MB for the penry/ | 2022-03-28 16:05 | - | |
| bye-bye 4255-eh1/ | 2022-03-28 16:05 | - | |
| camcorder to laptop/ | 2022-03-28 16:05 | - | |
| camera question/ | 2022-03-28 16:05 | - | |
| can't play EA games on high resolution/ | 2022-03-28 16:05 | - | |
| can't retain wireless signal/ | 2022-03-28 16:05 | - | |
| can any one send me Audio, video & chipset drivers of AVERATEC 2300 series/ | 2022-03-28 16:05 | - | |
| can anything be done about the fan/ | 2022-03-28 16:05 | - | |
| can someone tell me what the difference is between the jfl92 and/ | 2022-03-28 16:05 | - | |
| can the hel80's dvd drive(liteon 8515s) burn dual layer discs/ | 2022-03-28 16:05 | - | |
| case for 2370/ | 2022-03-28 16:05 | - | |
| catalyst driver for 6130HS ati 9600/ | 2022-03-28 16:05 | - | |
| cd-rom won't read after burn cd-r!/ | 2022-03-28 16:05 | - | |
| celeron beats core 2 duo/ | 2022-03-28 16:05 | - | |
| change controller to sata II 2300 series/ | 2022-03-28 16:05 | - | |
| changing QWERTZ to QWERTY on the IFL90/ | 2022-03-28 16:05 | - | |
| changing batteries/ | 2022-03-28 16:05 | - | |
| choosing the right laptop (new member)/ | 2022-03-28 16:05 | - | |
| cisnet/ | 2022-03-28 16:05 | - | |
| clevo d400p - change dvd drive/ | 2022-03-28 16:06 | - | |
| clevo notebooks/ | 2022-03-28 16:06 | - | |
| clock running too slow on HEL80/ | 2022-03-28 16:06 | - | |
| closed lid and heating/ | 2022-03-28 16:06 | - | |
| cmos battery/ | 2022-03-28 16:06 | - | |
| compal HEL80c overheating even when idle/ | 2022-03-28 16:06 | - | |
| compal IFl90 unknown hardware/ | 2022-03-28 16:06 | - | |
| compal bios, I need your oppinion !/ | 2022-03-28 16:06 | - | |
| compal cl56 vs. uniwill 259ia3 battery/ | 2022-03-28 16:06 | - | |
| compal dock/ | 2022-03-28 16:06 | - | |
| compal el80/ | 2022-03-28 16:06 | - | |
| compal el80 question about dvd burner/ | 2022-03-28 16:06 | - | |
| compal el80 touchpad parts/ | 2022-03-28 16:06 | - | |
| compal fl90 - overheating/ | 2022-03-28 16:06 | - | |
| compal fl90 and ahci how to enable with win xp pro/ | 2022-03-28 16:06 | - | |
| compal fl90 won't boot - black screen/ | 2022-03-28 16:06 | - | |
| compal hasn't come out with any notebooks/ | 2022-03-28 16:06 | - | |
| compal hel80 barebone assembly video/ | 2022-03-28 16:06 | - | |
| compal hel80 just arrived!!/ | 2022-03-28 16:06 | - | |
| compal hgl30...bulky/ | 2022-03-28 16:06 | - | |
| compal hgl30 and milestonepc warranty/ | 2022-03-28 16:06 | - | |
| compal hgl30 mic/ | 2022-03-28 16:06 | - | |
| compal ifl-90s- delay in shipping/ | 2022-03-28 16:06 | - | |
| compal ifl90 camera/ | 2022-03-28 16:06 | - | |
| compal jhl90 processor compatability/ | 2022-03-28 16:06 | - | |
| compal sound problem/ | 2022-03-28 16:06 | - | |
| compal users unite!/ | 2022-03-28 16:06 | - | |
| completing installation... hangs - jhl90 vista home premium oem, please help!/ | 2022-03-28 16:06 | - | |
| computer crashed/ | 2022-03-28 16:06 | - | |
| connect 2370 to 1080p HDTV/ | 2022-03-28 16:06 | - | |
| connect notebook to tv to view vacation pics/ | 2022-03-28 16:06 | - | |
| considering a barebones IFL90/ | 2022-03-28 16:06 | - | |
| cooling fan- averatec 3150/ | 2022-03-28 16:06 | - | |
| cooling fan of 3200 and 3100 seies/ | 2022-03-28 16:06 | - | |
| couple questions about my 3150/ | 2022-03-28 16:06 | - | |
| cpu problem/ | 2022-03-28 16:06 | - | |
| cpu throttling/ | 2022-03-28 16:06 | - | |
| cpu upgrades/ | 2022-03-28 16:06 | - | |
| cricket-like sound coming from 6625WD/ | 2022-03-28 16:06 | - | |
| cs source/ | 2022-03-28 16:06 | - | |
| ct14-a0 impressions & Walmart wierdness/ | 2022-03-28 16:06 | - | |
| ctrl button popped off keyboard/ | 2022-03-28 16:06 | - | |
| cz-27 Valkyrie randomly shut off then wont turn on/ | 2022-03-28 16:06 | - | |
| damaged brand new hgl30/ | 2022-03-28 16:06 | - | |
| dangers of taking ifl90 into a meeting/ | 2022-03-28 16:06 | - | |
| darker in the lower right and left corners/ | 2022-03-28 16:06 | - | |
| decisions decisions/ | 2022-03-28 16:06 | - | |
| default firmware for hel80 dvd drive/ | 2022-03-28 16:06 | - | |
| delivery times/ | 2022-03-28 16:06 | - | |
| difference between glossy and matte hel80 screen/ | 2022-03-28 16:06 | - | |
| difference between ifl90 and sager np2090/ | 2022-03-28 16:06 | - | |
| difference between these/ | 2022-03-28 16:06 | - | |
| difference between these Compal systems/ | 2022-03-28 16:06 | - | |
| difference is between the 5110H, and the 3270/ | 2022-03-28 16:06 | - | |
| differences in HEL80 and HEL80i (vbi)/ | 2022-03-28 16:06 | - | |
| different between the intel drivers and not intel/ | 2022-03-28 16:06 | - | |
| disassemble Zepto 6224W/ | 2022-03-28 16:06 | - | |
| discountlaptops.com questions I need answered - URGENT PLEASE HELP/ | 2022-03-28 16:06 | - | |
| does anyone here own a chembook 2030/ | 2022-03-28 16:06 | - | |
| does any one here owns a IC Laptop/ | 2022-03-28 16:06 | - | |
| does my 2090 from zipzoomfly have bluetooth/ | 2022-03-28 16:06 | - | |
| do you have to put together your compal notebook/ | 2022-03-28 16:06 | - | |
| drivers/ | 2022-03-28 16:06 | - | |
| dvd burner for HEL80/ | 2022-03-28 16:06 | - | |
| dvd doesn't support discs/ | 2022-03-28 16:06 | - | |
| dvd drive for a 3200 series/ | 2022-03-28 16:06 | - | |
| dvd movie backup/ | 2022-03-28 16:06 | - | |
| eCAFE EC-900/ | 2022-03-28 16:06 | - | |
| eSata card for external hard disk/ | 2022-03-28 16:06 | - | |
| eee 901's now in stock!/ | 2022-03-28 16:06 | - | |
| el80 'freezing' from time to time/ | 2022-03-28 16:06 | - | |
| el80, vista and new hardware/ | 2022-03-28 16:06 | - | |
| el80 CIR question/ | 2022-03-28 16:06 | - | |
| el80 DC power jack size/ | 2022-03-28 16:06 | - | |
| el80 touchpad going haywire/ | 2022-03-28 16:06 | - | |
| elantech driver hangs upon wake- uninstalled = problem solved/ | 2022-03-28 16:06 | - | |
| enabling PowerNow! in 4155/ | 2022-03-28 16:06 | - | |
| enp783 from pc club-got one reviews/ | 2022-03-28 16:06 | - | |
| eternal glossy vs matte/ | 2022-03-28 16:06 | - | |
| evo n1020v blank screen wont boot/ | 2022-03-28 16:06 | - | |
| excel notebook/ | 2022-03-28 16:06 | - | |
| external HD/ | 2022-03-28 16:06 | - | |
| fairwell soon/ | 2022-03-28 16:06 | - | |
| fan control program/ | 2022-03-28 16:06 | - | |
| fan noise in HEL80 vs S96J/ | 2022-03-28 16:06 | - | |
| fan on the hgl30/ | 2022-03-28 16:06 | - | |
| final offer on inexpensive 2370 2371 parts/ | 2022-03-28 16:06 | - | |
| firefox 1.5.0.5 fixes scrolling issue!/ | 2022-03-28 16:06 | - | |
| fl90 bios flash (downgrade from 1.16 to 1.13)/ | 2022-03-28 16:06 | - | |
| fl90 disassambly problem/ | 2022-03-28 16:06 | - | |
| fl90 svideo/ | 2022-03-28 16:06 | - | |
| flash Bios for IFL90/ | 2022-03-28 16:06 | - | |
| flash jhl90 bios with vista 64... any suggestions/ | 2022-03-28 16:06 | - | |
| forcebook/ | 2022-03-28 16:06 | - | |
| forcebook notebooks/ | 2022-03-28 16:06 | - | |
| forcing 1024 768 without stretching/ | 2022-03-28 16:06 | - | |
| forgotten password/ | 2022-03-28 16:06 | - | |
| for those with the extended battery for the 2370/ | 2022-03-28 16:06 | - | |
| fps problems/ | 2022-03-28 16:06 | - | |
| fried EL80/ | 2022-03-28 16:06 | - | |
| front top emblem ,madalion, for the FL90/ | 2022-03-28 16:06 | - | |
| future ASImobile Flextronics Arima 840 17 notebook/ | 2022-03-28 16:06 | - | |
| gen x pc/ | 2022-03-28 16:06 | - | |
| gl-30 heat issue! help/ | 2022-03-28 16:06 | - | |
| glossy or matte screen/ | 2022-03-28 16:06 | - | |
| go7700 x1700/ | 2022-03-28 16:06 | - | |
| goodmans p50 notebook/ | 2022-03-28 16:06 | - | |
| got my P1 MX last week/ | 2022-03-28 16:06 | - | |
| gpu dead (HGL-30)/ | 2022-03-28 16:06 | - | |
| graphic bug with my compal IFL90/ | 2022-03-28 16:06 | - | |
| graphics card temps going crazy/ | 2022-03-28 16:06 | - | |
| gtx 970m 3gb custom bios/ | 2022-03-28 16:06 | - | |
| haggling/ | 2022-03-28 16:06 | - | |
| hard drive Brand/ | 2022-03-28 16:06 | - | |
| hard drive clicking noise on IFL90/ | 2022-03-28 16:06 | - | |
| hard drive performance increase on my IFL90/ | 2022-03-28 16:06 | - | |
| hardware detection problem/ | 2022-03-28 16:06 | - | |
| hardware list drivers for 3270/ | 2022-03-28 16:06 | - | |
| hardware problem/ | 2022-03-28 16:06 | - | |
| hardware techies please help me. need help/ | 2022-03-28 16:06 | - | |
| has any1 else had this kind of problem/ | 2022-03-28 16:06 | - | |
| has anyone noticed/ | 2022-03-28 16:06 | - | |
| have a look n pls comment/ | 2022-03-28 16:06 | - | |
| hdd password compal el80/ | 2022-03-28 16:06 | - | |
| headphone jack not working anymore/ | 2022-03-28 16:06 | - | |
| heating problem 6224w/ | 2022-03-28 16:06 | - | |
| heh found company who has it/ | 2022-03-28 16:06 | - | |
| hel-80 and 1080p, anyone try yet/ | 2022-03-28 16:06 | - | |
| hel-80 dead cmos battery!!!!!/ | 2022-03-28 16:06 | - | |
| hel80 - lower than native resolution/ | 2022-03-28 16:06 | - | |
| hel80 and hgl30 side by side pics/ | 2022-03-28 16:06 | - | |
| hel80 battery charging time/ | 2022-03-28 16:06 | - | |
| hel80 c2d temperatures/ | 2022-03-28 16:06 | - | |
| hel80 questions/ | 2022-03-28 16:06 | - | |
| hel80 vedio card buggo 7600 play 3D game dead/ | 2022-03-28 16:06 | - | |
| hel80 video question/ | 2022-03-28 16:06 | - | |
| hel80 wireless card question! help!/ | 2022-03-28 16:06 | - | |
| hel80 wsxga+ glossy/ | 2022-03-28 16:06 | - | |
| help!!!! i sitting here with a hel80 stumped !/ | 2022-03-28 16:06 | - | |
| help!/ | 2022-03-28 16:06 | - | |
| help! T61 vs IFL90/ | 2022-03-28 16:06 | - | |
| help! hel80 mainboard/ | 2022-03-28 16:06 | - | |
| help. Asus Z71v x Sager NP3880/ | 2022-03-28 16:06 | - | |
| help/ | 2022-03-28 16:06 | - | |
| help identify a laptop/ | 2022-03-28 16:06 | - | |
| help me decide pls/ | 2022-03-28 16:06 | - | |
| help me finding laptop for gaming/ | 2022-03-28 16:06 | - | |
| help no sound on 6100A!!!! -(((/ | 2022-03-28 16:06 | - | |
| help overclocking 7600/ | 2022-03-28 16:06 | - | |
| help please IFL90/ | 2022-03-28 16:06 | - | |
| help pls proplem With bois/ | 2022-03-28 16:06 | - | |
| help w cl56 that POSTs but doesn't boot/ | 2022-03-28 16:06 | - | |
| help with a Clevo/ | 2022-03-28 16:06 | - | |
| help with my BenQ Joybook 2100E PLEASE HELP/ | 2022-03-28 16:06 | - | |
| help with my advent 9112!/ | 2022-03-28 16:06 | - | |
| help with screen res!/ | 2022-03-28 16:06 | - | |
| help with taskbar and other things/ | 2022-03-28 16:06 | - | |
| here's a nerdy one- speakers wired out of phase/ | 2022-03-28 16:06 | - | |
| hgl-30 audio question/ | 2022-03-28 16:06 | - | |
| hgl30's driver (Vista 64 bit)/ | 2022-03-28 16:06 | - | |
| hgl30's upgrade (processor)/ | 2022-03-28 16:06 | - | |
| hgl30 - max hard drive capacity/ | 2022-03-28 16:06 | - | |
| hgl30 ordered/ | 2022-03-28 16:06 | - | |
| hi! noobalert. Any1 ^grade Ram 6100 series/ | 2022-03-28 16:06 | - | |
| hibernating, shutting down/ | 2022-03-28 16:06 | - | |
| hibernation of 6625WD/ | 2022-03-28 16:06 | - | |
| hl90 lid/ | 2022-03-28 16:06 | - | |
| hmm i wonder if the display port would function/ | 2022-03-28 16:06 | - | |
| how are compals so cheap/ | 2022-03-28 16:06 | - | |
| how can i remove the keyboard of my znote 6224/ | 2022-03-28 16:06 | - | |
| how do you clean your screen/ | 2022-03-28 16:06 | - | |
| how do you dual boot xp and vista on ifl90/ | 2022-03-28 16:06 | - | |
| how easy is it to upgrade ram/ | 2022-03-28 16:06 | - | |
| how friendly is the ifl90 with/ | 2022-03-28 16:06 | - | |
| how get the most out of the HGL-30/ | 2022-03-28 16:06 | - | |
| how many models have compal as odm/ | 2022-03-28 16:06 | - | |
| how painful is installing vista-64 on IFL90/ | 2022-03-28 16:06 | - | |
| how to check- Native Resolutionin New Hel-80/ | 2022-03-28 16:06 | - | |
| how to install win 7 on Packard bell Dot M/ | 2022-03-28 16:06 | - | |
| how to remove dvdrw in 2300/ | 2022-03-28 16:06 | - | |
| how to replace screen on averatec 2370/ | 2022-03-28 16:06 | - | |
| how to set full fan speed on ifl90/ | 2022-03-28 16:06 | - | |
| how to update the HD on 3250HX/ | 2022-03-28 16:06 | - | |
| http- www.averatec-forums.com ARISES/ | 2022-03-28 16:06 | - | |
| http- www.averatecforums.com RIP/ | 2022-03-28 16:06 | - | |
| hyd400s hyundai/ | 2022-03-28 16:06 | - | |
| hypersonic/ | 2022-03-28 16:06 | - | |
| hypersonic computers/ | 2022-03-28 16:06 | - | |
| i5 i7 Sony Z's coming to P1/ | 2022-03-28 16:07 | - | |
| i7 7700k Clevo P7xxDM2-G underclocking/ | 2022-03-28 16:07 | - | |
| iBUYPOWER.com and my good experience/ | 2022-03-28 16:07 | - | |
| iBUYPOWER CRZ-93XE with XP/ | 2022-03-28 16:07 | - | |
| iBUYPOWER is here!/ | 2022-03-28 16:07 | - | |
| iBUYPOWER or Velocity Micro/ | 2022-03-28 16:07 | - | |
| iBuyPower...good company/ | 2022-03-28 16:07 | - | |
| iBuyPower VS CyberPowerInc paint jobs/ | 2022-03-28 16:07 | - | |
| iPhone owners with children or kids/ | 2022-03-28 16:07 | - | |
| iPro/ | 2022-03-28 16:07 | - | |
| iQon LM7WM freeze on file transfer/ | 2022-03-28 16:07 | - | |
| i WANT to buy this .. but scared of the quality/ | 2022-03-28 16:07 | - | |
| iastor timeout error IFL-90/ | 2022-03-28 16:07 | - | |
| ibuypower hl90/ | 2022-03-28 16:07 | - | |
| if PORTABLE 1 is kind enough to give me a discount, i will buy a W2 in 3 days!/ | 2022-03-28 16:07 | - | |
| if anyone gets a lot of fine scratches in the gloss/ | 2022-03-28 16:07 | - | |
| if i ordered an ifl90 with a celeron/ | 2022-03-28 16:07 | - | |
| ifl-90 arctic silver question/ | 2022-03-28 16:07 | - | |
| ifl-90 intel proset slow as molasses/ | 2022-03-28 16:07 | - | |
| ifl-90 owners, what video drivers for 64bit vista/ | 2022-03-28 16:07 | - | |
| ifl90 (california acces m160s)/ | 2022-03-28 16:07 | - | |
| ifl90 - unknown device in xp/ | 2022-03-28 16:07 | - | |
| ifl90 and the thermaltake ixoft/ | 2022-03-28 16:07 | - | |
| ifl90 audio sound problem/ | 2022-03-28 16:07 | - | |
| ifl90 battery question/ | 2022-03-28 16:07 | - | |
| ifl90 cleaning/ | 2022-03-28 16:07 | - | |
| ifl90 core temps/ | 2022-03-28 16:07 | - | |
| ifl90 dvd-rw problem/ | 2022-03-28 16:07 | - | |
| ifl90 jfl92 motherboard/ | 2022-03-28 16:07 | - | |
| ifl90 or acer 5920-6582/ | 2022-03-28 16:07 | - | |
| ifl90 questions, smart battery problems/ | 2022-03-28 16:07 | - | |
| ifl90 secondary keys are primary, unusable/ | 2022-03-28 16:07 | - | |
| ifl90 strange overheating problem/ | 2022-03-28 16:07 | - | |
| ifl90 switches its self off! overheating/ | 2022-03-28 16:07 | - | |
| ifl90 wireless problems/ | 2022-03-28 16:07 | - | |
| ifl91 bluetooth module/ | 2022-03-28 16:07 | - | |
| ifl92 jfl92 what 8600 drivers are you using/ | 2022-03-28 16:07 | - | |
| ifl battery life/ | 2022-03-28 16:07 | - | |
| if u have averatec 3700 do me a favor plz/ | 2022-03-28 16:07 | - | |
| i have recieved word from someone today at ocz about ati driver!!/ | 2022-03-28 16:07 | - | |
| ihl90 touchpad problem/ | 2022-03-28 16:07 | - | |
| ill be doing a full writeup with pics on how to build the jfl92/ | 2022-03-28 16:07 | - | |
| impatience strikes/ | 2022-03-28 16:07 | - | |
| improved 2300 series Vista video driver/ | 2022-03-28 16:07 | - | |
| increase wifi performance/ | 2022-03-28 16:07 | - | |
| increasing fsb/ | 2022-03-28 16:07 | - | |
| increasing volume/ | 2022-03-28 16:07 | - | |
| info about the ocz whitebook/ | 2022-03-28 16:07 | - | |
| infrared reciver/ | 2022-03-28 16:07 | - | |
| installed XP Can't see HDD issue/ | 2022-03-28 16:07 | - | |
| installing Bluetooth Module (Hel-80)/ | 2022-03-28 16:07 | - | |
| installing Compal 8600M GT in an Acer (or anything else)/ | 2022-03-28 16:07 | - | |
| installing OS on Zepto 6625/ | 2022-03-28 16:07 | - | |
| integrated camera on hel80/ | 2022-03-28 16:07 | - | |
| interesting pictures(no 56k)/ | 2022-03-28 16:07 | - | |
| is a HEL80 better than a S Z96j/ | 2022-03-28 16:07 | - | |
| is anyone's lid a bit squeaky or creaky/ | 2022-03-28 16:07 | - | |
| is anyone anywhere selling this with the matte finish besides aw/ | 2022-03-28 16:07 | - | |
| is it BYON brand use Compal OEM motherboard/ | 2022-03-28 16:07 | - | |
| is the 6224 and 6324 supposed to differ in price and spec options/ | 2022-03-28 16:07 | - | |
| is the hgl30 vista compatible/ | 2022-03-28 16:07 | - | |
| is there a barebones version of the Sager NP5791/ | 2022-03-28 16:07 | - | |
| is there a build-in bluetooth card for Uniwill259/ | 2022-03-28 16:07 | - | |
| is this a good compal/ | 2022-03-28 16:07 | - | |
| is this a good idea/ | 2022-03-28 16:07 | - | |
| is this a good price for the 6130hs/ | 2022-03-28 16:07 | - | |
| is this vbi hel80/ | 2022-03-28 16:07 | - | |
| its official I canceled my m1730 and getting a ocz whitebook!/ | 2022-03-28 16:07 | - | |
| i want one! 6214W gamer/ | 2022-03-28 16:07 | - | |
| jfl92.. where to get the camera program/ | 2022-03-28 16:07 | - | |
| jfl92 and vista sp1/ | 2022-03-28 16:07 | - | |
| jfl92 unknown item in device manager/ | 2022-03-28 16:07 | - | |
| just got mine...a couple questions probs though/ | 2022-03-28 16:07 | - | |
| just now recieved a email from a freind in china about the arima/ | 2022-03-28 16:07 | - | |
| just recieved my 6224W/ | 2022-03-28 16:07 | - | |
| keyboard backlight colour/ | 2022-03-28 16:07 | - | |
| keyboard cover/ | 2022-03-28 16:07 | - | |
| keyboard keys - cleaning/ | 2022-03-28 16:07 | - | |
| keyboard problem (FL90)/ | 2022-03-28 16:07 | - | |
| keybord/ | 2022-03-28 16:07 | - | |
| keys dont work/ | 2022-03-28 16:07 | - | |
| laptop and speaker connection/ | 2022-03-28 16:07 | - | |
| laptop notebook clones/ | 2022-03-28 16:07 | - | |
| latest Bluetooth version/ | 2022-03-28 16:07 | - | |
| latest driver for Flytv dvb-t/ | 2022-03-28 16:07 | - | |
| lcd dark/ | 2022-03-28 16:07 | - | |
| legal action against Averatec/ | 2022-03-28 16:07 | - | |
| lifeview TV tuner not working correctly/ | 2022-03-28 16:07 | - | |
| line-in microphone too soft/ | 2022-03-28 16:07 | - | |
| linux and ifl90 sound problem/ | 2022-03-28 16:07 | - | |
| linux under 6130hs/ | 2022-03-28 16:07 | - | |
| live chat yet dead/ | 2022-03-28 16:07 | - | |
| lock/ | 2022-03-28 16:07 | - | |
![[TXT]](/icons/text.gif) | log.txt | 2022-01-29 09:01 | 3.2M | |
| logo/ | 2022-03-28 16:07 | - | |
| lol alienware/ | 2022-03-28 16:07 | - | |
| look for new bios for hydra A17/ | 2022-03-28 16:07 | - | |
| looking at 6615wd/ | 2022-03-28 16:07 | - | |
| looking for Old Prema MOD Bios Clevo W370ET/ | 2022-03-28 16:07 | - | |
| love it or hate it/ | 2022-03-28 16:07 | - | |
| lowdown on the compal hgl30/ | 2022-03-28 16:07 | - | |
| low volume on 6130hs/ | 2022-03-28 16:07 | - | |
| m4000 Graphics Memory/ | 2022-03-28 16:07 | - | |
| matte screens/ | 2022-03-28 16:07 | - | |
| max ammount of ram in 6324w/ | 2022-03-28 16:07 | - | |
| maxdata 6100 matrix/ | 2022-03-28 16:07 | - | |
| maxdata pro 6100iw bios/ | 2022-03-28 16:07 | - | |
| measuring cpu temp/ | 2022-03-28 16:07 | - | |
| medion model md6032/ | 2022-03-28 16:07 | - | |
| memory (ddr2 3200) upgrade on av4265/ | 2022-03-28 16:07 | - | |
| memory card reader on 6625wd/ | 2022-03-28 16:07 | - | |
| memory for 6625w/ | 2022-03-28 16:07 | - | |
| memory install/ | 2022-03-28 16:07 | - | |
| memory put in both slots cause OS to freeze/ | 2022-03-28 16:07 | - | |
| memory question averatec 5110h/ | 2022-03-28 16:07 | - | |
| metallic beep voice coming out every minute/ | 2022-03-28 16:07 | - | |
| micron trek II/ | 2022-03-28 16:07 | - | |
| microsoft works/ | 2022-03-28 16:07 | - | |
| middle mouse button in 6214w/ | 2022-03-28 16:07 | - | |
| mm20 case sleeve/ | 2022-03-28 16:07 | - | |
| mm20 extended battery/ | 2022-03-28 16:07 | - | |
| mm20 user group or Forums/ | 2022-03-28 16:07 | - | |
| mod. 1000 mouspad turnoff/ | 2022-03-28 16:07 | - | |
| more zepto question lol/ | 2022-03-28 16:07 | - | |
| mx a8js vista upgrade/ | 2022-03-28 16:07 | - | |
| my 2-3 months experience with a 6625WD!/ | 2022-03-28 16:07 | - | |
| mySN - any1 ever heard of this manufacturer/ | 2022-03-28 16:07 | - | |
| my averatec 6100a crashed/ | 2022-03-28 16:07 | - | |
| n2700 owners/ | 2022-03-28 16:07 | - | |
| nVIDIA ForceWare X 185.20/ | 2022-03-28 16:07 | - | |
| nVidia 8600M GT Znote 6224/ | 2022-03-28 16:07 | - | |
| nVidia drivers cause mouse lag in Vista/ | 2022-03-28 16:07 | - | |
| nVidia nForce network controller error in vista/ | 2022-03-28 16:07 | - | |
| need AV3715-EH1 recovery disc/ | 2022-03-28 16:07 | - | |
| need Help with Keyboard-6130/ | 2022-03-28 16:07 | - | |
| need compal 8515s dvd firmware/ | 2022-03-28 16:07 | - | |
| needing help for compal pbl21 trackpad/ | 2022-03-28 16:07 | - | |
| need review for zepto nox a15/ | 2022-03-28 16:07 | - | |
| need some help with an upgrade/ | 2022-03-28 16:07 | - | |
| need suggestion about averatec 2370 for $599.99/ | 2022-03-28 16:07 | - | |
| need to find out what screens are compatible with my laptop/ | 2022-03-28 16:07 | - | |
| need upc from MV12W/ | 2022-03-28 16:07 | - | |
| neoprene screen/ | 2022-03-28 16:07 | - | |
| new 13.3 with dedicated graphics!/ | 2022-03-28 16:07 | - | |
| new 3250/ | 2022-03-28 16:07 | - | |
| new 6214w with memory issues/ | 2022-03-28 16:07 | - | |
| new 6625WD suddenly will not boot/ | 2022-03-28 16:07 | - | |
| new HEL80 owner here; some initial questions/ | 2022-03-28 16:07 | - | |
| new HGL30 owner/ | 2022-03-28 16:07 | - | |
| new compal ifl90/ | 2022-03-28 16:07 | - | |
| new laptop jus a few questions/ | 2022-03-28 16:07 | - | |
| new laptops from Puget Systems/ | 2022-03-28 16:07 | - | |
| new pc, burn in/ | 2022-03-28 16:07 | - | |
| new prices/ | 2022-03-28 16:07 | - | |
| new vizio laptop soon vizio ct15t-c1/ | 2022-03-28 16:07 | - | |
| new zepto nox new fan problems,help!!!/ | 2022-03-28 16:07 | - | |
| new zepto rumors/ | 2022-03-28 16:07 | - | |
| no NEC notebooks in America/ | 2022-03-28 16:07 | - | |
| noob question about flashing/ | 2022-03-28 16:07 | - | |
| no sound with ILF90/ | 2022-03-28 16:07 | - | |
| no suttetring here ! ( with quad)/ | 2022-03-28 16:07 | - | |
| ntune problem/ | 2022-03-28 16:07 | - | |
| nvidia 179.19 drivers working awesome on compal jfl92/ | 2022-03-28 16:07 | - | |
| nvidia driver problems/ | 2022-03-28 16:07 | - | |
| ocz, lcd screen or motherboard problem or something/ | 2022-03-28 16:07 | - | |
| ocz keyboard/ | 2022-03-28 16:07 | - | |
| ocz speaker headphone problem/ | 2022-03-28 16:07 | - | |
| ocz whitebook cooler/ | 2022-03-28 16:07 | - | |
| ocz whitebook problems/ | 2022-03-28 16:07 | - | |
| off the wall core 2 duo cpu/ | 2022-03-28 16:07 | - | |
| okay so i found a qx9300 but/ | 2022-03-28 16:07 | - | |
| old Sanyo notebook/ | 2022-03-28 16:07 | - | |
| omnipass, why so long delay time/ | 2022-03-28 16:07 | - | |
| omnipass problem/ | 2022-03-28 16:07 | - | |
| on screen volume bar/ | 2022-03-28 16:07 | - | |
| opening case on 2225 averatec laptop/ | 2022-03-28 16:07 | - | |
| opening ifl90/ | 2022-03-28 16:07 | - | |
| open up my 6214w/ | 2022-03-28 16:07 | - | |
| ordered hel-80/ | 2022-03-28 16:07 | - | |
| ordering ProStar 5722 OMG THIS IS TEH PWNAGE/ | 2022-03-28 16:07 | - | |
| ordering a compal IFl90 today/ | 2022-03-28 16:07 | - | |
| ordering mx from p1/ | 2022-03-28 16:07 | - | |
| overclocking C2D/ | 2022-03-28 16:07 | - | |
| overclocking the video drivers/ | 2022-03-28 16:07 | - | |
| packard bell amd E1/ | 2022-03-28 16:07 | - | |
| parting out HEL80 notebook/ | 2022-03-28 16:07 | - | |
| patriot laptops/ | 2022-03-28 16:07 | - | |
| pbl21/ | 2022-03-28 16:07 | - | |
| people having fixed the stuttering issue again by Bios update/ | 2022-03-28 16:07 | - | |
| performance tweaking for integrated camera/ | 2022-03-28 16:07 | - | |
| philips ultra portable 12NB5800/ | 2022-03-28 16:07 | - | |
| philips x54/ | 2022-03-28 16:07 | - | |
| phoenix bios help/ | 2022-03-28 16:07 | - | |
| picture request HEL80/ | 2022-03-28 16:07 | - | |
| pictures of OCZ FORCE EXTREME 840/ | 2022-03-28 16:07 | - | |
| pioneer power 470K/ | 2022-03-28 16:07 | - | |
| please help me recover my averatec 1000 series/ | 2022-03-28 16:07 | - | |
| please help with blue ray and wlan drivers/ | 2022-03-28 16:07 | - | |
| please see if you hear this noise too/ | 2022-03-28 16:07 | - | |
| portability of segar np2090/ | 2022-03-28 16:07 | - | |
| powernotebooks.com compal HEL80/ | 2022-03-28 16:07 | - | |
| powernotebooks/ | 2022-03-28 16:07 | - | |
| power problem/ | 2022-03-28 16:07 | - | |
| predictions on a price drop/ | 2022-03-28 16:07 | - | |
| pre sale advise please on a Zepto 6625WD/ | 2022-03-28 16:07 | - | |
| prestigion visconte 1300/ | 2022-03-28 16:08 | - | |
| problem connecting wirelessly/ | 2022-03-28 16:08 | - | |
| problems with NHC in Vista on HEL80/ | 2022-03-28 16:08 | - | |
| problems with bluetooth/ | 2022-03-28 16:08 | - | |
| problems with my FL90 (maybe graphic card)/ | 2022-03-28 16:08 | - | |
| problem w cdrom on 3150/ | 2022-03-28 16:08 | - | |
| problem wireless/ | 2022-03-28 16:08 | - | |
| problem with Oblivion on hgl30/ | 2022-03-28 16:08 | - | |
| problem with el80 e noise/ | 2022-03-28 16:08 | - | |
| problem with pixels/ | 2022-03-28 16:08 | - | |
| problem with wlan on jhl90/ | 2022-03-28 16:08 | - | |
| processor speed issue/ | 2022-03-28 16:08 | - | |
| question/ | 2022-03-28 16:08 | - | |
| question about 3214w/ | 2022-03-28 16:08 | - | |
| question about P1 P2 buttons/ | 2022-03-28 16:08 | - | |
| question about ct 14/ | 2022-03-28 16:08 | - | |
| question about mobile quad core patch from killernotebook/ | 2022-03-28 16:08 | - | |
| question from an Italian girl!/ | 2022-03-28 16:08 | - | |
| rFactor on JFL92 or Sager NP2090/ | 2022-03-28 16:08 | - | |
| ramdom Freezing on my Zepto Hydra/ | 2022-03-28 16:08 | - | |
| rayservers laptop reseller/ | 2022-03-28 16:08 | - | |
| re-using a Vista-Biz-64 license/ | 2022-03-28 16:08 | - | |
| reading +r media/ | 2022-03-28 16:08 | - | |
| realtek alc268 4 channels/ | 2022-03-28 16:08 | - | |
| realtek r2.15 audio driver links/ | 2022-03-28 16:08 | - | |
| reasign the mail button to open a different program/ | 2022-03-28 16:08 | - | |
| rebate rejected/ | 2022-03-28 16:08 | - | |
| recovery partition vizio cn15 (windows 8)/ | 2022-03-28 16:08 | - | |
| red dot on screen/ | 2022-03-28 16:08 | - | |
| red pixel/ | 2022-03-28 16:08 | - | |
| reformatted/ | 2022-03-28 16:08 | - | |
| refurbished Averatec AV6130HS/ | 2022-03-28 16:08 | - | |
| remaping keys (including the QL buttons)/ | 2022-03-28 16:08 | - | |
| removing zepto keyboard, wont budge/ | 2022-03-28 16:08 | - | |
| repair manual 6200/ | 2022-03-28 16:08 | - | |
| replace DVD in 3200 series/ | 2022-03-28 16:08 | - | |
| replace a hard disk on Avaratec 3270/ | 2022-03-28 16:08 | - | |
| replaced cd dvd combo drive/ | 2022-03-28 16:08 | - | |
| replacement EL80 motherboard/ | 2022-03-28 16:08 | - | |
| revised cooling improvement for 2370/ | 2022-03-28 16:08 | - | |
| rizeon and compal delivery dates/ | 2022-03-28 16:08 | - | |
| rizeon laptops/ | 2022-03-28 16:08 | - | |
| rma diff. status/ | 2022-03-28 16:08 | - | |
| rugged notebook- rough rider junior help!/ | 2022-03-28 16:08 | - | |
| running 6324W on battery/ | 2022-03-28 16:08 | - | |
| s-video out/ | 2022-03-28 16:08 | - | |
| s-video port/ | 2022-03-28 16:08 | - | |
| s96 multi drive on a compal hel80/ | 2022-03-28 16:08 | - | |
| sager 2090 compalifl90 nvidia card sleep hibernate help/ | 2022-03-28 16:08 | - | |
| sager and prostar/ | 2022-03-28 16:08 | - | |
| scan Isotope barebones/ | 2022-03-28 16:08 | - | |
| screen problem- 6625/ | 2022-03-28 16:08 | - | |
| screwed over by officemax/ | 2022-03-28 16:08 | - | |
| scroll bar slider on touch pad/ | 2022-03-28 16:08 | - | |
| scrolling hotspots for HEL80 in vista/ | 2022-03-28 16:08 | - | |
| second monitor on 8600GT/ | 2022-03-28 16:08 | - | |
| sell motherboard/ | 2022-03-28 16:08 | - | |
| sempron mobile heat problems/ | 2022-03-28 16:08 | - | |
| service manual cyberpower/ | 2022-03-28 16:08 | - | |
| shareyour hel80 hot as mine/ | 2022-03-28 16:08 | - | |
| sharp Actius UM32W - laptop won't turn on, help/ | 2022-03-28 16:08 | - | |
| sharp al27 hmmmm...might want to read this one!!!/ | 2022-03-28 16:08 | - | |
| sharp av18 battery/ | 2022-03-28 16:08 | - | |
| sharp intel centrion 1.4ghz pent m/ | 2022-03-28 16:08 | - | |
| sharp m4000/ | 2022-03-28 16:08 | - | |
| sharp m4000 widenote keyboard/ | 2022-03-28 16:08 | - | |
| simple question- how to deactivate speakers while using headphones/ | 2022-03-28 16:08 | - | |
| site inaccessable/ | 2022-03-28 16:08 | - | |
| skin and bones laptop/ | 2022-03-28 16:08 | - | |
| sloppy hinges/ | 2022-03-28 16:08 | - | |
| slow speeds with wifi/ | 2022-03-28 16:08 | - | |
| smaller notebooks/ | 2022-03-28 16:08 | - | |
| so ... any infos about gfx clocks 'n stuff in the IFL90/ | 2022-03-28 16:08 | - | |
| so any idea when they will be refreshing them OCZ extreme 840 with them 4850 cards/ | 2022-03-28 16:08 | - | |
| so can all you Medion Laptop ppl give a verdict-/ | 2022-03-28 16:08 | - | |
| solution for ifl90 or sager 2090 integrated camera issue/ | 2022-03-28 16:08 | - | |
| some vibrations trembles while playing certain sounds/ | 2022-03-28 16:08 | - | |
| somewhat dissapointed with my IFL90/ | 2022-03-28 16:08 | - | |
| so much for the worthless fingerprint scanner/ | 2022-03-28 16:08 | - | |
| so sager is having quality probs/ | 2022-03-28 16:08 | - | |
| sound driver/ | 2022-03-28 16:08 | - | |
| sound issue ifl90/ | 2022-03-28 16:08 | - | |
| spare part/ | 2022-03-28 16:08 | - | |
| speakers/ | 2022-03-28 16:08 | - | |
| spontaneous GPU recovery (6224w)/ | 2022-03-28 16:08 | - | |
| ssm 8515s firmware problem/ | 2022-03-28 16:08 | - | |
| stores that still carry HGL30/ | 2022-03-28 16:08 | - | |
| strange problem after IFL90 upgraded to hd3650/ | 2022-03-28 16:08 | - | |
| stuck in phoenix technologies boot screen!/ | 2022-03-28 16:08 | - | |
| stupid question ( may be repeated many times) IFL 90 support winXP/ | 2022-03-28 16:08 | - | |
| sudden shutdown - 6200 series/ | 2022-03-28 16:08 | - | |
| swapping Fn and Ctrl/ | 2022-03-28 16:08 | - | |
| swapping fn and ctrl keys/ | 2022-03-28 16:08 | - | |
| sweetspoting hel-80 headphone jack/ | 2022-03-28 16:08 | - | |
| systemax lappys/ | 2022-03-28 16:08 | - | |
| systemax pursuit/ | 2022-03-28 16:08 | - | |
| sz7/ | 2022-03-28 16:08 | - | |
| t-out s-video out how do I get it to work/ | 2022-03-28 16:08 | - | |
| tarox/ | 2022-03-28 16:08 | - | |
| tax shipping/ | 2022-03-28 16:08 | - | |
| temperatures 6214w/ | 2022-03-28 16:08 | - | |
| temps...hdd, cpd, gfx ..powermizer/ | 2022-03-28 16:08 | - | |
| the end of the story, zepto.dk/ | 2022-03-28 16:08 | - | |
| the new tpg laptop vs acer Celeron or cetrino/ | 2022-03-28 16:08 | - | |
| thermal paste , price is a crock of , But are they equal in performance/ | 2022-03-28 16:08 | - | |
| thermal pasting the JHL90/ | 2022-03-28 16:08 | - | |
| the walmart ecs lptop/ | 2022-03-28 16:08 | - | |
| thinking about HEL80 or HGL30/ | 2022-03-28 16:08 | - | |
| thinking about OCZ Whitebook over NP5796/ | 2022-03-28 16:08 | - | |
| thinking about getting a hel80 but/ | 2022-03-28 16:08 | - | |
| thinking about ordering a cyberpower, BUT/ | 2022-03-28 16:08 | - | |
| thinkinh about upgrading my Znote 6224W/ | 2022-03-28 16:08 | - | |
| this dvd burner work in hel80/ | 2022-03-28 16:08 | - | |
| this is a very nice machine i am very happy with these/ | 2022-03-28 16:08 | - | |
| thoughts on the q9100 anyone have it and how good is it/ | 2022-03-28 16:08 | - | |
| toshiba M700/ | 2022-03-28 16:08 | - | |
| touchpad/ | 2022-03-28 16:08 | - | |
| troubles with vista/ | 2022-03-28 16:08 | - | |
| turbo memory/ | 2022-03-28 16:08 | - | |
| turning off cooling fan for 3250H1/ | 2022-03-28 16:08 | - | |
| turn off beep averatec 3225/ | 2022-03-28 16:08 | - | |
| tv-out problems/ | 2022-03-28 16:08 | - | |
| tv-tuner/ | 2022-03-28 16:08 | - | |
| tweaking the new baby, 3220 series/ | 2022-03-28 16:08 | - | |
| two different brand, same laptop/ | 2022-03-28 16:08 | - | |
| two questions/ | 2022-03-28 16:08 | - | |
| ubuntu users SOundcard question/ | 2022-03-28 16:08 | - | |
| undervolting cpu for 2370/ | 2022-03-28 16:08 | - | |
| unknown device in XPpro 64bit/ | 2022-03-28 16:08 | - | |
| upgrade cpu/ | 2022-03-28 16:08 | - | |
| upgrade cpu on IFL-90/ | 2022-03-28 16:08 | - | |
| upgrading/ | 2022-03-28 16:08 | - | |
| upgrading Averatech/ | 2022-03-28 16:08 | - | |
| upgrading cpu on a 3250 series/ | 2022-03-28 16:08 | - | |
| upgrading the bios/ | 2022-03-28 16:08 | - | |
| usb plugin mouse issue/ | 2022-03-28 16:08 | - | |
| usb port problem (hel80)/ | 2022-03-28 16:08 | - | |
| using cell phone on my HEL80/ | 2022-03-28 16:08 | - | |
| using zepto computers in the united states/ | 2022-03-28 16:08 | - | |
| ventilation holes 662wd/ | 2022-03-28 16:08 | - | |
| very cheap AV6130H1-01/ | 2022-03-28 16:08 | - | |
| vga drivers problem/ | 2022-03-28 16:08 | - | |
| vga problems/ | 2022-03-28 16:08 | - | |
| video driver, 6625/ | 2022-03-28 16:08 | - | |
| video driver for 6100/ | 2022-03-28 16:08 | - | |
| vigorgaming.com/ | 2022-03-28 16:08 | - | |
| vista + hgl-30 = bad news/ | 2022-03-28 16:08 | - | |
| vista changing resolution when coming out of standby/ | 2022-03-28 16:08 | - | |
| vista drivers 6615WD/ | 2022-03-28 16:08 | - | |
| vista drivers question/ | 2022-03-28 16:08 | - | |
| vista question/ | 2022-03-28 16:08 | - | |
| vizio ct15-a4 ssd/ | 2022-03-28 16:08 | - | |
| void warranty/ | 2022-03-28 16:08 | - | |
| voodoo envy 133/ | 2022-03-28 16:08 | - | |
| vtdisp problem/ | 2022-03-28 16:08 | - | |
| w00tness!/ | 2022-03-28 16:08 | - | |
| w840di XP x86 Drivers for lazy/ | 2022-03-28 16:08 | - | |
| w3415 RAM upgrade problem/ | 2022-03-28 16:08 | - | |
| walmart motile laptops - appear to be tonfang as well/ | 2022-03-28 16:08 | - | |
| warranty and bios update/ | 2022-03-28 16:08 | - | |
| warranty questions/ | 2022-03-28 16:08 | - | |
| warranty repairs- good or bad/ | 2022-03-28 16:08 | - | |
| was there ever a fix for the annoying sound you hear in headphones on the hel80/ | 2022-03-28 16:08 | - | |
| webcam cover/ | 2022-03-28 16:08 | - | |
| webcam not functional/ | 2022-03-28 16:08 | - | |
| weird cpu usage phenomenon on hel80/ | 2022-03-28 16:08 | - | |
| well i ordered 2 BARE bones and i mean bare bones jlf92's.. question/ | 2022-03-28 16:08 | - | |
| we recieved my mom's fl90 from zzf today/ | 2022-03-28 16:08 | - | |
| westinghouse laptop nb 14w-2/ | 2022-03-28 16:08 | - | |
| what's wrong with my screen/ | 2022-03-28 16:08 | - | |
| what OS to get/ | 2022-03-28 16:08 | - | |
| what does this mean/ | 2022-03-28 16:08 | - | |
| what do you guys think about/ | 2022-03-28 16:08 | - | |
| what do you use your p1 p2 buttons for/ | 2022-03-28 16:08 | - | |
| what happens/ | 2022-03-28 16:08 | - | |
| what is the difference between these 2 FL90's/ | 2022-03-28 16:08 | - | |
| what oem burner did your jfl92 come with/ | 2022-03-28 16:08 | - | |
| what sata chipset does the 6625wd have please/ | 2022-03-28 16:08 | - | |
| what screen is in the ocz whitebook/ | 2022-03-28 16:08 | - | |
| what should i do to optimize vista/ | 2022-03-28 16:08 | - | |
| what type of ram does the hel80 take/ | 2022-03-28 16:08 | - | |
| what was broken in my 6324w/ | 2022-03-28 16:08 | - | |
| what wsxga+ glossy did you get with your fl92/ | 2022-03-28 16:08 | - | |
| when hdmi for zepto 6625 6224/ | 2022-03-28 16:08 | - | |
| when i boot ifl-90, asks yes no/ | 2022-03-28 16:08 | - | |
| where can I buy an averatec c3500 in new zealand/ | 2022-03-28 16:08 | - | |
| where is Uniwill/ | 2022-03-28 16:08 | - | |
| where is the best place to buy a uniwill 259ia3/ | 2022-03-28 16:08 | - | |
| where is the cheapest place to get the ifl90/ | 2022-03-28 16:08 | - | |
| where to buy hel80 in NEW YORK/ | 2022-03-28 16:08 | - | |
| where to buy the Averatec 1000 in the Netherlands/ | 2022-03-28 16:08 | - | |
| where to purchase Quanta laptops barebones/ | 2022-03-28 16:08 | - | |
| which 119 bios are you guys using/ | 2022-03-28 16:08 | - | |
| which compal program for the usb button and power plug button/ | 2022-03-28 16:08 | - | |
| which day are u getting your zepto notebook with 9650m gt next week/ | 2022-03-28 16:08 | - | |
| which driver to get/ | 2022-03-28 16:08 | - | |
| which notebook is better/ | 2022-03-28 16:08 | - | |
| which would be better/ | 2022-03-28 16:08 | - | |
| whining screeching noises/ | 2022-03-28 16:08 | - | |
| whitebook doesn't start without AC plugged in/ | 2022-03-28 16:08 | - | |
| whitebook keyboard/ | 2022-03-28 16:08 | - | |
| whitebook m17 bios recovery/ | 2022-03-28 16:08 | - | |
| whitebook motherboard/ | 2022-03-28 16:08 | - | |
| whitebook on your lap/ | 2022-03-28 16:08 | - | |
| who's been using the integrated mic/ | 2022-03-28 16:08 | - | |
| who is having the choppy audio video after sleep issue/ | 2022-03-28 16:08 | - | |
| wierd noise/ | 2022-03-28 16:08 | - | |
| wifi problems/ | 2022-03-28 16:08 | - | |
| will a MD6071 cdrw drive fit in a medion MD9783/ | 2022-03-28 16:08 | - | |
| will agearnotebooks.com or powernotebooks.com have a sale/ | 2022-03-28 16:08 | - | |
| will ata-6 hdd work with my emachine/ | 2022-03-28 16:08 | - | |
| win7 64bit on a 2370/ | 2022-03-28 16:08 | - | |
| winbook/ | 2022-03-28 16:08 | - | |
| winbook j4 - take apart for dust removal/ | 2022-03-28 16:08 | - | |
| windows or my computer/ | 2022-03-28 16:08 | - | |
| winxp and sound drivers/ | 2022-03-28 16:08 | - | |
| wiping hard drive/ | 2022-03-28 16:08 | - | |
| wireless diskdrive/ | 2022-03-28 16:08 | - | |
| wireless for Znote 6224/ | 2022-03-28 16:08 | - | |
| wireless network problem!/ | 2022-03-28 16:08 | - | |
| wireless problems with 3225/ | 2022-03-28 16:08 | - | |
| world of warcraft framerate issues on hel80/ | 2022-03-28 16:08 | - | |
| wow i hope the ati drivers are better for the whitebook/ | 2022-03-28 16:08 | - | |
| wow so far 3 for three wsxga+ chimei jfl92/ | 2022-03-28 16:08 | - | |
| wsxga+ being restocked/ | 2022-03-28 16:08 | - | |
| wtf battery lasts like 1 1 2 hours/ | 2022-03-28 16:08 | - | |
| www.averatec-forums.com/ | 2022-03-28 16:08 | - | |
| xFL9x BIOS 1.18 Released/ | 2022-03-28 16:08 | - | |
| xVx Online/ | 2022-03-28 16:09 | - | |
| xotic price increase on arima !/ | 2022-03-28 16:08 | - | |
| xp penryn/ | 2022-03-28 16:09 | - | |
| xp reset/ | 2022-03-28 16:09 | - | |
| xtremenotebooks.com/ | 2022-03-28 16:09 | - | |
| your compal & bluetooth/ | 2022-03-28 16:09 | - | |
| zenith laptop director model/ | 2022-03-28 16:09 | - | |
| zepto 6214 is inventec w14/ | 2022-03-28 16:09 | - | |
| zepto 6214w + surround/ | 2022-03-28 16:09 | - | |
| zepto 6324w and 8600 performance/ | 2022-03-28 16:09 | - | |
| zepto 6625wd help choosing which drivers to install/ | 2022-03-28 16:09 | - | |
| zepto Zz button/ | 2022-03-28 16:09 | - | |
| zepto australia warranty...united electrical activation/ | 2022-03-28 16:09 | - | |
| zepto drivers (winXP 64 bit)/ | 2022-03-28 16:09 | - | |
| zepto drivers/ | 2022-03-28 16:09 | - | |
| zepto driver support for winXP 64bit/ | 2022-03-28 16:09 | - | |
| zepto hydra A17 hard drive/ | 2022-03-28 16:09 | - | |
| zepto hydra a17 bios/ | 2022-03-28 16:09 | - | |
| zepto keyboard issue buy new/ | 2022-03-28 16:09 | - | |
| zepto nox a15 battery/ | 2022-03-28 16:09 | - | |
| zepto pricingiscrazy/ | 2022-03-28 16:09 | - | |
| zepto wireless/ | 2022-03-28 16:09 | - | |
| zepto worth the money/ | 2022-03-28 16:09 | - | |
| znote 6224w problem/ | 2022-03-28 16:09 | - | |
| znote 6615 -- media keys/ | 2022-03-28 16:09 | - | |
| znote 6625wd bios/ | 2022-03-28 16:09 | - | |
| znote 6625wd fan spinnage...and hdd light/ | 2022-03-28 16:09 | - | |
| znote 7000 or not/ | 2022-03-28 16:09 | - | |
|
|---|