![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | !!!!!Toshiba M40!!!!!/ | 2022-03-28 16:39 | - | |
| !! Warning !! CPU Upgrade of A105-101X/ | 2022-03-28 16:39 | - | |
| $35 warranty credit voucher/ | 2022-03-28 16:39 | - | |
| $1099 for 15.4 Toshiba Centrino Notebook/ | 2022-03-28 16:39 | - | |
| $1450 P100-ST1072 quality/ | 2022-03-28 16:39 | - | |
| 's for R200 owners/ | 2022-03-28 16:39 | - | |
| (Old School) Satellite 5105-S701/ | 2022-03-28 16:39 | - | |
| (Satellite A205-S4629) Chicony Camera Issue!/ | 2022-03-28 16:39 | - | |
| (r500 Owners only!) On a scale of 1 to 10/ | 2022-03-28 16:39 | - | |
| (r600 Owners only!) On a scale of 1 to 10/ | 2022-03-28 16:39 | - | |
| (unofficial) A135-s2276 Windows XP Re-Review/ | 2022-03-28 16:39 | - | |
| -- TOSHIBA Qosmio X305-Q706 OR Alienware M17/ | 2022-03-28 16:39 | - | |
| 1 3 of my P35-S609 display is black/ | 2022-03-28 16:39 | - | |
| 2nd HDD bay for Qosmio X505-Q894/ | 2022-03-28 16:39 | - | |
| 2nd M40 - grainy screen and pitching sound, hm/ | 2022-03-28 16:39 | - | |
| 2nd hard drive on Satellite A200-ST2043/ | 2022-03-28 16:39 | - | |
| 2nd hdd bay/ | 2022-03-28 16:39 | - | |
| 2 questions for other G45 Owners/ | 2022-03-28 16:39 | - | |
| 2 touchpad questions/ | 2022-03-28 16:39 | - | |
| 2 year old toshiba X500-Q892 - Stops booting/ | 2022-03-28 16:39 | - | |
| 3.5 hours on this Toshiba netbook/ | 2022-03-28 16:39 | - | |
| 3DMark Vantage Request for Quismo i7 460m/ | 2022-03-28 16:39 | - | |
| 3DV12 - Real/ | 2022-03-28 16:39 | - | |
| 3D driver for X500/ | 2022-03-28 16:39 | - | |
| 3G Slot/ | 2022-03-28 16:39 | - | |
| 3d acceleration/ | 2022-03-28 16:39 | - | |
| 3dmark for toshiba pro A100-830/ | 2022-03-28 16:39 | - | |
| 3 hr 45 min battery life on 65Wh battery- Pro L300/ | 2022-03-28 16:39 | - | |
| 3rd Hard Disk/ | 2022-03-28 16:39 | - | |
| 3 toshiba's 2 os's and no firewire 1394 ilink (used to work)/ | 2022-03-28 16:39 | - | |
| 4GB RAM equals Video Crashes/ | 2022-03-28 16:39 | - | |
| 4 New Sandy Bridge Toshiba Laptops/ | 2022-03-28 16:39 | - | |
| 4 motherboards, 1 wireless card, problem still not fixed!/ | 2022-03-28 16:39 | - | |
| 5.1 output in x205/ | 2022-03-28 16:39 | - | |
| 5 FREE HD DVDs with Toshiba notebooks/ | 2022-03-28 16:39 | - | |
| 5 free hd-dvds/ | 2022-03-28 16:39 | - | |
| 5 in 1 Card Reader Problem/ | 2022-03-28 16:39 | - | |
| 5 keys on my laptop dont work/ | 2022-03-28 16:39 | - | |
| 6gb in Toshiba Laptop/ | 2022-03-28 16:39 | - | |
| 7,200rpm HD on a M2 has anyone did it/ | 2022-03-28 16:39 | - | |
| 8gb inna x300 in Canada/ | 2022-03-28 16:39 | - | |
| 8gigs of ram in X305-720/ | 2022-03-28 16:39 | - | |
| 9 cell vs 6 cell for SatelliteA105/ | 2022-03-28 16:39 | - | |
| 12 cell battery available for T115 and T135/ | 2022-03-28 16:39 | - | |
| 12 cell battery for P205/ | 2022-03-28 16:39 | - | |
| 12 cell battery on the m40 or m50 (problem)/ | 2022-03-28 16:39 | - | |
| 12 or 9 cell battery for Satellite A100-635/ | 2022-03-28 16:39 | - | |
| 12v laptop charger/ | 2022-03-28 16:39 | - | |
| 13.3 Toshiba intel based U405 vs AMD based U405d/ | 2022-03-28 16:39 | - | |
| 15.6 Qosimo any good/ | 2022-03-28 16:39 | - | |
| 15.6 Toshiba Satellite L755-S5258, upgrade from i5-2410M CPU to i7-2860QM - 35W TDP vs 45W TDP/ | 2022-03-28 16:39 | - | |
| 15.6 inch LCD or LED screen in a 16 inch Toshiba L505 or A505/ | 2022-03-28 16:39 | - | |
| 15 tosh with best battery life/ | 2022-03-28 16:39 | - | |
| 16-inch screen replacement for Satellite A660 665/ | 2022-03-28 16:39 | - | |
| 17 gaming notebooks (toshiba & dell )/ | 2022-03-28 16:39 | - | |
| 30 XP drivers for A205/ | 2022-03-28 16:39 | - | |
| 34 Downloads (Updates) for X205-S9349 from Toshiba/ | 2022-03-28 16:39 | - | |
| 60 or 120/ | 2022-03-28 16:39 | - | |
| 64-bit Drivers/ | 2022-03-28 16:39 | - | |
| 64-bit vista on a215/ | 2022-03-28 16:39 | - | |
| 64 32 Bit/ | 2022-03-28 16:39 | - | |
| 64 Bit Vista Support/ | 2022-03-28 16:39 | - | |
| 97 Processes Running...Why/ | 2022-03-28 16:39 | - | |
| 106ºC on a geforce 9700M GPU (qosmio F50-108)/ | 2022-03-28 16:39 | - | |
| 163.75 WHQL Certified and NEW 169 Beta Drivers/ | 2022-03-28 16:39 | - | |
| 169.09 Drivers/ | 2022-03-28 16:39 | - | |
| 169.09 Video Driver Questions/ | 2022-03-28 16:39 | - | |
| 169.09 drivers- Is there a big performance jump driver upgrade/ | 2022-03-28 16:39 | - | |
| 169 Nvidia Driver Install- Windows Experience Score Drops/ | 2022-03-28 16:39 | - | |
| 320GB Hard drive support on A100/ | 2022-03-28 16:39 | - | |
| 580m/ | 2022-03-28 16:39 | - | |
| 655-S5078 Laptop Question/ | 2022-03-28 16:39 | - | |
| 780m + 3470 etc/ | 2022-03-28 16:39 | - | |
| 894 freezes up - please help/ | 2022-03-28 16:39 | - | |
| 945GB GM Support of Wi-Fi N/ | 2022-03-28 16:39 | - | |
| 1000$- Tecra A8 or Satellite/ | 2022-03-28 16:39 | - | |
| 1024MB DDR2 2.5V vs. 1.8V/ | 2022-03-28 16:39 | - | |
| 1080p screen upgrade on L755/ | 2022-03-28 16:39 | - | |
| 1115-S103 Recover Disks for M45-S359 Disks/ | 2022-03-28 16:39 | - | |
| 1410-s174 BABY!/ | 2022-03-28 16:39 | - | |
| 1680x945 or 1920x1080 resolution/ | 2022-03-28 16:39 | - | |
| 1800 hard drive upgrade/ | 2022-03-28 16:39 | - | |
| 1805-s207/ | 2022-03-28 16:39 | - | |
| 1805 freezes does not power on/ | 2022-03-28 16:39 | - | |
| 1920x1080 vs. 1680x945 resolution on an 18.4 notebook/ | 2022-03-28 16:39 | - | |
| 2014 Toshiba Portégé Z30-A Haswell with FullHD IPS panel/ | 2022-03-28 16:39 | - | |
| 2015 Toshiba Portégé Z30-B Z30T-B Broadwell/ | 2022-03-28 16:39 | - | |
| 2560x1440 Kirabook ultrabook/ | 2022-03-28 16:39 | - | |
| 2920X 2960X core i7 in toshiba X775/ | 2022-03-28 16:39 | - | |
| 3020CT Re-Install/ | 2022-03-28 16:39 | - | |
| 4010 CDS/ | 2022-03-28 16:39 | - | |
| 5005-A507 Sound issues/ | 2022-03-28 16:39 | - | |
| 5205-s505 Audio stops working/ | 2022-03-28 16:39 | - | |
| 5205-s505 Clean install help/ | 2022-03-28 16:39 | - | |
| 5205-s505 Normal temperatures/ | 2022-03-28 16:39 | - | |
| 6100 problem/ | 2022-03-28 16:39 | - | |
| 6600 TE question/ | 2022-03-28 16:39 | - | |
| 7200 RPM drive in Toshiba M50/ | 2022-03-28 16:39 | - | |
| 7200rpm Hard Drives/ | 2022-03-28 16:39 | - | |
| 8600m GT Driver SLI Help/ | 2022-03-28 16:39 | - | |
| 8600m GT w SLi or 8700GT/ | 2022-03-28 16:39 | - | |
| 8700GT Overclock&3dMark06 Scores/ | 2022-03-28 16:39 | - | |
| 8700M GT with Toshiba 205-S7483/ | 2022-03-28 16:39 | - | |
| 8700m OC'ing drivers/ | 2022-03-28 16:39 | - | |
| 8800m Form Factor/ | 2022-03-28 16:39 | - | |
| 9700 GTS and 9800 GTS/ | 2022-03-28 16:39 | - | |
| 9700M GTS gone/ | 2022-03-28 16:39 | - | |
| 9700M GTS vs 9800M GTS/ | 2022-03-28 16:39 | - | |
| 9700m GTS 105 celsius!/ | 2022-03-28 16:39 | - | |
| A+ for Toshiba warranty service/ | 2022-03-28 16:39 | - | |
| A-100 fan stopped after Bios Upgrade to 6.00/ | 2022-03-28 16:39 | - | |
| A2 boot problem/ | 2022-03-28 16:39 | - | |
| A4-203 Any reviews, comments/ | 2022-03-28 16:39 | - | |
| A5 experiences/ | 2022-03-28 16:39 | - | |
| A6 Screen System Hangs/ | 2022-03-28 16:40 | - | |
| A10-S167 USB PCMCIA no longer works/ | 2022-03-28 16:39 | - | |
| A10 wireless connection/ | 2022-03-28 16:39 | - | |
| A15-S129 Will Not Show Some Graphics/ | 2022-03-28 16:39 | - | |
| A15-S129 replacement fan/ | 2022-03-28 16:39 | - | |
| A15 BIOS Problem (Yes, I have read the other threads.)/ | 2022-03-28 16:39 | - | |
| A30 -104 Disassembly Instructions/ | 2022-03-28 16:39 | - | |
| A40-sp-151/ | 2022-03-28 16:39 | - | |
| A45-S120 IDE #1Error/ | 2022-03-28 16:39 | - | |
| A45-S250 and Wolfenstein ET.. HELP/ | 2022-03-28 16:39 | - | |
| A45-S2102 is this refurbed from Costco ....help/ | 2022-03-28 16:39 | - | |
| A45 S250 quetion/ | 2022-03-28 16:39 | - | |
| A45 dvd-writer problem/ | 2022-03-28 16:39 | - | |
| A55-S326 No sound/ | 2022-03-28 16:40 | - | |
| A55 DC Power Jack (or charger)/ | 2022-03-28 16:40 | - | |
| A65 memory question/ | 2022-03-28 16:40 | - | |
| A65 need to use HD externally..how/ | 2022-03-28 16:40 | - | |
| A65 screen bracket snapped/ | 2022-03-28 16:40 | - | |
| A 70, black screen,no Power on DVD drive/ | 2022-03-28 16:39 | - | |
| A70- Before I jump in and disassemble/ | 2022-03-28 16:40 | - | |
| A70 - Please Help/ | 2022-03-28 16:40 | - | |
| A70 - any link with corrupupt USB drive and iPod/ | 2022-03-28 16:40 | - | |
| A70 Users!/ | 2022-03-28 16:40 | - | |
| A70 XP Pro upgrade = loss in sound quality/ | 2022-03-28 16:40 | - | |
| A70 screen size problem/ | 2022-03-28 16:40 | - | |
| A70 videocard/ | 2022-03-28 16:40 | - | |
| A75-S206 sound echo/ | 2022-03-28 16:40 | - | |
| A75-S231 - upgrade to faster hard drive/ | 2022-03-28 16:40 | - | |
| A75-S231 ... won't acknowledge SD cards/ | 2022-03-28 16:40 | - | |
| A75-When to buy/ | 2022-03-28 16:40 | - | |
| A75 S-206/ | 2022-03-28 16:40 | - | |
| A75 driving me nuts!!/ | 2022-03-28 16:40 | - | |
| A75 driving me nuts!! SOLVED!!/ | 2022-03-28 16:40 | - | |
| A75 will not power on/ | 2022-03-28 16:40 | - | |
| A75 with PC3200/ | 2022-03-28 16:40 | - | |
| A100-01g/ | 2022-03-28 16:39 | - | |
| A100-153, is it coming to the US/ | 2022-03-28 16:39 | - | |
| A100-846, my spec, how long will stand for gaming/ | 2022-03-28 16:39 | - | |
| A100-906 problem with display/ | 2022-03-28 16:39 | - | |
| A100-SK9- methods of burning-in/ | 2022-03-28 16:39 | - | |
| A100-TA7C issues with ACER AL2017BMD LCD monitor/ | 2022-03-28 16:39 | - | |
| A100-TA7C or A100-TA6/ | 2022-03-28 16:39 | - | |
| A100-Vista Upgrade Problems!/ | 2022-03-28 16:39 | - | |
| A100-jh2/ | 2022-03-28 16:39 | - | |
| A100-va9/ | 2022-03-28 16:39 | - | |
| A100 306 - beeps on startup/ | 2022-03-28 16:39 | - | |
| A100 500 Crashing/ | 2022-03-28 16:39 | - | |
| A100 A105 Motherboard Upgrade/ | 2022-03-28 16:39 | - | |
| A100 Battery/ | 2022-03-28 16:39 | - | |
| A100 Dual cores/ | 2022-03-28 16:39 | - | |
| A100 Graphics card options/ | 2022-03-28 16:39 | - | |
| A100 Keyboard/ | 2022-03-28 16:39 | - | |
| A100 SK8 hardware drivers/ | 2022-03-28 16:39 | - | |
| A100 ST9 vs SK9/ | 2022-03-28 16:39 | - | |
| A100 and vid card question/ | 2022-03-28 16:39 | - | |
| A100 hitting 80C+ temperature. What The Hell/ | 2022-03-28 16:39 | - | |
| A100 intermittentlly rebooting/ | 2022-03-28 16:39 | - | |
| A100 wakeup from standby problem/ | 2022-03-28 16:39 | - | |
| A105, Can't Load XP, Normally or in Safe Mode/ | 2022-03-28 16:39 | - | |
| A105-4211 just shuts off!/ | 2022-03-28 16:39 | - | |
| A105-S101 Memory - NEWBIE/ | 2022-03-28 16:39 | - | |
| A105-S101 network cable unplugged error/ | 2022-03-28 16:39 | - | |
| A105-S101 upgrade, where's the CPU/ | 2022-03-28 16:39 | - | |
| A105-S361 vs. M70-SR6/ | 2022-03-28 16:39 | - | |
| A105-S1013 battery problem/ | 2022-03-28 16:39 | - | |
| A105-S2091, will not power up/ | 2022-03-28 16:39 | - | |
| A105-S2091 battery problems/ | 2022-03-28 16:39 | - | |
| A105-S2141 keyboard failed/ | 2022-03-28 16:39 | - | |
| A105-S2231 Need help/ | 2022-03-28 16:39 | - | |
| A105-S4074 HD upgrade/ | 2022-03-28 16:39 | - | |
| A105-S4284 stuck pixel/ | 2022-03-28 16:39 | - | |
| A105-S4364 IE-6 hangs freezes stops all the time/ | 2022-03-28 16:39 | - | |
| A105-S4384 LCD Problem - - It's Blank/ | 2022-03-28 16:39 | - | |
| A105-S4384 Recovery Partition- contents and use/ | 2022-03-28 16:39 | - | |
| A105-s2051 resets when i try to upgrade the ram!/ | 2022-03-28 16:39 | - | |
| A105-s4211 linksys wpc300n conflict/ | 2022-03-28 16:39 | - | |
| A105 Battery Question/ | 2022-03-28 16:39 | - | |
| A105 Battery issues, did this happen to anyone else/ | 2022-03-28 16:39 | - | |
| A105 CD audio problem/ | 2022-03-28 16:39 | - | |
| A105 CPU Replacement/ | 2022-03-28 16:39 | - | |
| A105 S361/ | 2022-03-28 16:39 | - | |
| A105 S361 making this constant fan-like noise/ | 2022-03-28 16:39 | - | |
| A105 Screen Issue, Need to verify/ | 2022-03-28 16:39 | - | |
| A110 - Need to re-install windows XP. Legit product key, but no CD/ | 2022-03-28 16:39 | - | |
| A130-ST1312, adding a Bluetooth module after the fact/ | 2022-03-28 16:39 | - | |
| A130 cusomize where did it go/ | 2022-03-28 16:39 | - | |
| A130 custom-built on the way -- advice/ | 2022-03-28 16:39 | - | |
| A135-4457 MMC multimedia card driver/ | 2022-03-28 16:39 | - | |
| A135-4467 To XP Pro from Vista, need drivers/ | 2022-03-28 16:39 | - | |
| A135-S2246 RTC battery/ | 2022-03-28 16:39 | - | |
| A135-S2246 just died 1 1 2 years old Vista/ | 2022-03-28 16:39 | - | |
| A135-S2246 or A135-S2276/ | 2022-03-28 16:39 | - | |
| A135-S2247 - Anyone Get CD DVD's to Play Without Booting/ | 2022-03-28 16:39 | - | |
| A135-S2247 - Is there a Keyboard shortcut to Increase decrease Volume/ | 2022-03-28 16:39 | - | |
| A135-S2266 BIOS password/ | 2022-03-28 16:39 | - | |
| A135-S2276 Vista Windows Experience Index/ | 2022-03-28 16:39 | - | |
| A135-S2276 loss time issue/ | 2022-03-28 16:39 | - | |
| A135-S2296- T2060... 32b or 64b/ | 2022-03-28 16:39 | - | |
| A135-S2356 Windows XP Drivers/ | 2022-03-28 16:39 | - | |
| A135-S2356 Windoxs Xp Drivers/ | 2022-03-28 16:39 | - | |
| A135-S2386 Disassembly & second SATA HDD/ | 2022-03-28 16:39 | - | |
| A135-S2386 ram problems/ | 2022-03-28 16:39 | - | |
| A135-S4467 Battery Life/ | 2022-03-28 16:39 | - | |
| A135-S4467 Beeps on Boot/ | 2022-03-28 16:39 | - | |
| A135-S4467 Keyboard/ | 2022-03-28 16:39 | - | |
| A135-S4467 does not work properly/ | 2022-03-28 16:39 | - | |
| A135-S4527 HD Problem with XP/ | 2022-03-28 16:39 | - | |
| A135-S4527 XP sound problems/ | 2022-03-28 16:39 | - | |
| A135-S4656 Ethernet Network driver Help/ | 2022-03-28 16:39 | - | |
| A135-S4656 Screen Cracked Question/ | 2022-03-28 16:39 | - | |
| A135-S4667 Mouse Freeze/ | 2022-03-28 16:39 | - | |
| A135- XPRESS 200 IS 667MHz DUO CORE COMPATIBLE!!!!/ | 2022-03-28 16:39 | - | |
| A135- Xpress 200 3D Vid problems/ | 2022-03-28 16:39 | - | |
| A135-s2246 ram problem/ | 2022-03-28 16:39 | - | |
| A135-s2276 not Booting Up/ | 2022-03-28 16:39 | - | |
| A135-s4467/ | 2022-03-28 16:39 | - | |
| A135 Headphone socket loose connection/ | 2022-03-28 16:39 | - | |
| A135 S4427 v. A135 S4447 graphics memory/ | 2022-03-28 16:39 | - | |
| A135 S4527 multimedia control panel/ | 2022-03-28 16:39 | - | |
| A135 not seeing any network with replacement wireless NIC/ | 2022-03-28 16:39 | - | |
| A135 upgrade/ | 2022-03-28 16:39 | - | |
| A136-S4427 - Possibel to add a Second Hard Drive/ | 2022-03-28 16:39 | - | |
| A200-23u/ | 2022-03-28 16:39 | - | |
| A200 - AH6 Recovery Disc Creator/ | 2022-03-28 16:39 | - | |
| A200-ST2043 in Canada/ | 2022-03-28 16:39 | - | |
| A200-TR6 Battery Icon/ | 2022-03-28 16:39 | - | |
| A200-TR6 Webcam trouble/ | 2022-03-28 16:39 | - | |
| A200 A300 series UK prices/ | 2022-03-28 16:39 | - | |
| A200 Australian Laptop Will NOT Boot!!!! Help!/ | 2022-03-28 16:39 | - | |
| A200 Bios No post And Crisis Disk/ | 2022-03-28 16:39 | - | |
| A200 Equium mass storage driver/ | 2022-03-28 16:39 | - | |
| A200 Noise/ | 2022-03-28 16:39 | - | |
| A200 PSAE6 (24E) upgrade to Penryn/ | 2022-03-28 16:39 | - | |
| A200 cooling mod/ | 2022-03-28 16:39 | - | |
| A200 customize/ | 2022-03-28 16:39 | - | |
| A200 partitioning problems with Vista/ | 2022-03-28 16:39 | - | |
| A200 satellite warranty and dead pixels/ | 2022-03-28 16:39 | - | |
| A200 says its running AC even on battery any idea why/ | 2022-03-28 16:39 | - | |
| A200 series - HDMI And how is the reliablity quality/ | 2022-03-28 16:39 | - | |
| A200 without installation disc/ | 2022-03-28 16:39 | - | |
| A205 - Battery Discharge Time Seems Short/ | 2022-03-28 16:39 | - | |
| A205-S4587 BSOD and explorer.exe problems -(/ | 2022-03-28 16:39 | - | |
| A205-S4587 XP Drivers PLEASE HELP!/ | 2022-03-28 16:39 | - | |
| A205-S4587 crashes when using bootable cd's/ | 2022-03-28 16:39 | - | |
| A205-S4607, Low Buzzing Noise When Idle/ | 2022-03-28 16:39 | - | |
| A205-S4607 Screen Flicks/ | 2022-03-28 16:39 | - | |
| A205-S4777 Hard Drive RPM/ | 2022-03-28 16:39 | - | |
| A205-S5000 Help me make it faster/ | 2022-03-28 16:39 | - | |
| A205-S5800 XP SATA drivers/ | 2022-03-28 16:39 | - | |
| A205-S5804 Drivers for Xp/ | 2022-03-28 16:39 | - | |
| A205-S5804 Memory Upgrade, 1x2GB or 2x1GB/ | 2022-03-28 16:39 | - | |
| A205-S5812 (Accessory)/ | 2022-03-28 16:39 | - | |
| A205-S5814 Downgrade to XP - Need LAN driver/ | 2022-03-28 16:39 | - | |
| A205-S5825/ | 2022-03-28 16:39 | - | |
| A205-S5855 Integrated Webcam Problems/ | 2022-03-28 16:39 | - | |
| A205-S5859- What are safe hard drive temperatures/ | 2022-03-28 16:39 | - | |
| A205-S5859 chassis hot, CPU normal, burning my legs!/ | 2022-03-28 16:39 | - | |
| A205-S7464 Vista to XP - PLEEEASE help!/ | 2022-03-28 16:39 | - | |
| A205 DVD Drive Replacement/ | 2022-03-28 16:39 | - | |
| A205 and installing windows xp/ | 2022-03-28 16:39 | - | |
| A205 won't read all CD DVD/ | 2022-03-28 16:39 | - | |
| A210-A215 Defective bios update safgv200/ | 2022-03-28 16:39 | - | |
| A210-MS4 Screen Clips Broken/ | 2022-03-28 16:39 | - | |
| A210 - No recording from audio out/ | 2022-03-28 16:39 | - | |
| A215, not resolved, read this/ | 2022-03-28 16:39 | - | |
| A215-7422 - Restoring to Factory Defaults/ | 2022-03-28 16:39 | - | |
| A215-S4697 Audio Help!/ | 2022-03-28 16:39 | - | |
| A215-S4757 touchpad doesn't work (I'm on Vista 32)/ | 2022-03-28 16:39 | - | |
| A215-S5817 Problem With Vista Business and Drivers/ | 2022-03-28 16:39 | - | |
| A215-S5824 Won't Start Up/ | 2022-03-28 16:39 | - | |
| A215-S7413 Driver Issue/ | 2022-03-28 16:39 | - | |
| A215-s5837/ | 2022-03-28 16:39 | - | |
| A215 S4767 wifi driver problems/ | 2022-03-28 16:39 | - | |
| A215 battery and screen issues/ | 2022-03-28 16:39 | - | |
| A300-27q bricked after repasting/ | 2022-03-28 16:39 | - | |
| A300 305 HDMI Audio Out problem (w ATI 3650 graphics card)/ | 2022-03-28 16:39 | - | |
| A300 500 - 64bit not installed/ | 2022-03-28 16:39 | - | |
| A300 Battery Life/ | 2022-03-28 16:39 | - | |
| A300D GPU overheating/ | 2022-03-28 16:39 | - | |
| A300 Hard Drive Upgrade/ | 2022-03-28 16:39 | - | |
| A 300 satellite NIC problem/ | 2022-03-28 16:39 | - | |
| A300 stuffed after firmware update!/ | 2022-03-28 16:39 | - | |
| A300 vs L300/ | 2022-03-28 16:39 | - | |
| A300 with ATI HD3650/ | 2022-03-28 16:39 | - | |
| A305-68XX finish (Fuzion w horizon)/ | 2022-03-28 16:39 | - | |
| A305-S6829 drivers/ | 2022-03-28 16:39 | - | |
| A305-S6834 Screen doesn't turn on/ | 2022-03-28 16:39 | - | |
| A305-S6858 Gaming laptop BB/ | 2022-03-28 16:39 | - | |
| A305-S6898- Overheating/ | 2022-03-28 16:39 | - | |
| A305-S6916 DVD Burner Replacement/ | 2022-03-28 16:39 | - | |
| A305D Wireless Driver Question/ | 2022-03-28 16:39 | - | |
| A305 Hardware Question-/ | 2022-03-28 16:39 | - | |
| A305 S6919-Satellite, Limited Edition/ | 2022-03-28 16:39 | - | |
| A305 crash/ | 2022-03-28 16:39 | - | |
| A305d/ | 2022-03-28 16:39 | - | |
| A305 replace labelflash drive with lightscribe/ | 2022-03-28 16:39 | - | |
| A355-6998E Random Forced Sleep Issue - Windows 8/ | 2022-03-28 16:39 | - | |
| A355 replaces 305/ | 2022-03-28 16:39 | - | |
| A500-01x boot issues/ | 2022-03-28 16:39 | - | |
| A500-ST6647 Core I7- Is a 65W adapter enough/ | 2022-03-28 16:39 | - | |
| A500 Randomly Shuts Off/ | 2022-03-28 16:39 | - | |
| A500 cpu Upgade x9100 @3.06ghz/ | 2022-03-28 16:39 | - | |
| A500 or L500 What's the difference/ | 2022-03-28 16:39 | - | |
| A500 with fullHD display/ | 2022-03-28 16:39 | - | |
| A505-S6965, Processes !/ | 2022-03-28 16:39 | - | |
| A505-S6965 ATI Catalyst 9.8/ | 2022-03-28 16:39 | - | |
| A505-S6965 Lit Keyboard/ | 2022-03-28 16:39 | - | |
| A505-S6965 My Experirence/ | 2022-03-28 16:39 | - | |
| A505-S6965 Question, Please Help/ | 2022-03-28 16:39 | - | |
| A505-S6969 Thoughts/ | 2022-03-28 16:39 | - | |
| A505-S6992 Motherboard problem/ | 2022-03-28 16:39 | - | |
| A505 S6965 Win7 Drivers/ | 2022-03-28 16:39 | - | |
| A505 and External usb drive/ | 2022-03-28 16:39 | - | |
| A505 reassign media hotkey/ | 2022-03-28 16:39 | - | |
| A600 with Wireless keyboard mouse/ | 2022-03-28 16:40 | - | |
| A605 vs. R600/ | 2022-03-28 16:40 | - | |
| A660 1080p - 720p switching/ | 2022-03-28 16:40 | - | |
| A665-3DV - Battery life and Heat/ | 2022-03-28 16:40 | - | |
| A665-3DV - Scrambled LCD/ | 2022-03-28 16:40 | - | |
| A665-3DV unboxing/ | 2022-03-28 16:40 | - | |
| A665 DC Jack replacement/ | 2022-03-28 16:40 | - | |
| A665 RAM Upgrade/ | 2022-03-28 16:40 | - | |
| A665 Thermal Repaste/ | 2022-03-28 16:40 | - | |
| AC Adapter HELP!!/ | 2022-03-28 16:40 | - | |
| AC Adapter PA-1900-06/ | 2022-03-28 16:40 | - | |
| AC Adapter for A60/ | 2022-03-28 16:40 | - | |
| AC Adapter not working/ | 2022-03-28 16:40 | - | |
| AC Power Source/ | 2022-03-28 16:40 | - | |
| AC port problem/ | 2022-03-28 16:40 | - | |
| A DVD speed problem and a question about fan control (A215-S4697)/ | 2022-03-28 16:39 | - | |
| AKE USB 3.0 ExpressCard Review/ | 2022-03-28 16:40 | - | |
| ALL NEW Toshiba Models up this weekend/ | 2022-03-28 16:40 | - | |
| ALT key not working on my Q850/ | 2022-03-28 16:40 | - | |
| AMD M780V & ATI Radeon 3100 IGP- Satellite P305D, et al/ | 2022-03-28 16:40 | - | |
| AMD T235 Review/ | 2022-03-28 16:40 | - | |
| AMD Turion 64 X2 mobile technology gold edition TL-64 any good/ | 2022-03-28 16:40 | - | |
| AMD Turion 64 X2 Dual-Core Mobile Technology Gold Edition TL-64/ | 2022-03-28 16:40 | - | |
| AMD powered toshiba 215's/ | 2022-03-28 16:40 | - | |
| AMD turion64 x2 cpu upgrade/ | 2022-03-28 16:40 | - | |
| ANOTHER webcam thread/ | 2022-03-28 16:40 | - | |
| ANyone else got an L100/ | 2022-03-28 16:40 | - | |
| ATI radeon HD 3470/ | 2022-03-28 16:40 | - | |
| ATI says to contact Toshiba for drivers/ | 2022-03-28 16:40 | - | |
| ATTN SLi1 owners- Try the 174.74 Drivers/ | 2022-03-28 16:40 | - | |
| ATi CCC for Toshiba Satellite A500-134/ | 2022-03-28 16:40 | - | |
| A Very Strange Problem/ | 2022-03-28 16:39 | - | |
| About M40's squealing noise/ | 2022-03-28 16:40 | - | |
| About Toshiba A130-ST1312 LCD quality/ | 2022-03-28 16:40 | - | |
| About Toshiba recovery CD/ | 2022-03-28 16:40 | - | |
| About the Qosmio X305/ | 2022-03-28 16:40 | - | |
| About to Purchase A505 (S6005)/ | 2022-03-28 16:40 | - | |
| About to order M200 (Tablet). Which HD/ | 2022-03-28 16:40 | - | |
| About to pull the plug on A300-05U/ | 2022-03-28 16:40 | - | |
| About to pull the trigger on a A135 A130 custom, thoughts/ | 2022-03-28 16:40 | - | |
| A camera to go with P55T's 4k screen/ | 2022-03-28 16:39 | - | |
| Access USB2 ports in laptop/ | 2022-03-28 16:40 | - | |
| Accessing 2nd memory slot in M100 M105/ | 2022-03-28 16:40 | - | |
| Accessing BIOS on old Satellite/ | 2022-03-28 16:40 | - | |
| A cooler to go with the P55T/ | 2022-03-28 16:39 | - | |
| Add Remove programs in M40/ | 2022-03-28 16:40 | - | |
| Adding 2nd hard drive to toshiba satellite p770/ | 2022-03-28 16:40 | - | |
| Adding RAM Qosmio X505-Q894/ | 2022-03-28 16:40 | - | |
| Adding RAM to M45-S265/ | 2022-03-28 16:40 | - | |
| Adding WiFi to older Toshiba/ | 2022-03-28 16:40 | - | |
| Adding a Modem/ | 2022-03-28 16:40 | - | |
| Adding built-in Bluetooth to M55-S3262/ | 2022-03-28 16:40 | - | |
| Additional USB ports/ | 2022-03-28 16:40 | - | |
| Adjusting Pen Pressure/ | 2022-03-28 16:40 | - | |
| Adjusting Screen Brightness on A100 A105/ | 2022-03-28 16:40 | - | |
| Adjusting Volume on Satellite A105-S4334/ | 2022-03-28 16:40 | - | |
| Adjusting volume causes explorer to die in a horrible crash/ | 2022-03-28 16:40 | - | |
| Administrator Rights to Computer/ | 2022-03-28 16:40 | - | |
| Administrator password/ | 2022-03-28 16:40 | - | |
| Advice- Is this laptop any good/ | 2022-03-28 16:40 | - | |
| Advice for replacement screen for X775/ | 2022-03-28 16:40 | - | |
| Advice on Toshiba A205-S4577/ | 2022-03-28 16:40 | - | |
| Advice on my first toshiba notebook/ | 2022-03-28 16:40 | - | |
| Advice please- L305D-S5869 vs. A205-S5866/ | 2022-03-28 16:40 | - | |
| Affordable Used Upgradable Notebook!/ | 2022-03-28 16:40 | - | |
| A find- 99 cent toshiba a100/ | 2022-03-28 16:39 | - | |
| Aftermarked power supply/ | 2022-03-28 16:40 | - | |
| After your experience with Toshiba, would you recommend one to a friend/ | 2022-03-28 16:40 | - | |
| A good choice/ | 2022-03-28 16:39 | - | |
| A green bar across the screen/ | 2022-03-28 16:39 | - | |
| A high performance Toshiba 15.4/ | 2022-03-28 16:39 | - | |
| Air gaps in the plastic chasis/ | 2022-03-28 16:40 | - | |
| A little Toshiba love/ | 2022-03-28 16:39 | - | |
| All I know is its a Toshiba Satellite/ | 2022-03-28 16:40 | - | |
| All USB ports dead/ | 2022-03-28 16:40 | - | |
| All X205-SLI Owners- Help Please/ | 2022-03-28 16:40 | - | |
| All x205 owners, i just notice something/ | 2022-03-28 16:40 | - | |
| All x300 x305 users with 2 hard drives read this!/ | 2022-03-28 16:40 | - | |
| Almost ready to buy A205, i value anybodies input/ | 2022-03-28 16:40 | - | |
| Alright new question/ | 2022-03-28 16:40 | - | |
| Alternate Bluetooth stack for libretto W105/ | 2022-03-28 16:40 | - | |
| Alternative Power Button/ | 2022-03-28 16:40 | - | |
| Alternative for Recovery CD- m55-s325/ | 2022-03-28 16:40 | - | |
| Am I stuck with Windows 8/ | 2022-03-28 16:40 | - | |
| American battery for an European Toshiba/ | 2022-03-28 16:40 | - | |
| An Open Letter to Toshiba (and a warning to others!)/ | 2022-03-28 16:40 | - | |
| Ancient Satellite S1800-100 - Dead RTC battery/ | 2022-03-28 16:40 | - | |
| Ancient Toshiba problem. Portege 4010/ | 2022-03-28 16:40 | - | |
| Angry...Have to replace my U405D-S2852 AGAIN/ | 2022-03-28 16:40 | - | |
| Annnnd I'm back in the Toshiba club with the X775/ | 2022-03-28 16:40 | - | |
| Annoying Squeaking Sound/ | 2022-03-28 16:40 | - | |
| Anolog issues/ | 2022-03-28 16:40 | - | |
| Another Guide- Install SSD and replace ODD with HDD in a Portege R835-P56x/ | 2022-03-28 16:40 | - | |
| Another HD DVD error/ | 2022-03-28 16:40 | - | |
| Another X205 Dual Boot Question/ | 2022-03-28 16:40 | - | |
| Any A350 355D owners/ | 2022-03-28 16:40 | - | |
| Any G45-AV680 Owners Out There/ | 2022-03-28 16:40 | - | |
| Any Idea abour Customize your Qosmio F40 F45/ | 2022-03-28 16:40 | - | |
| Any Information On the Next Gen Qosmio/ | 2022-03-28 16:40 | - | |
| Any L300 L305 or L350 L355 owners here Opinions/ | 2022-03-28 16:40 | - | |
| Any M50 M55 users here/ | 2022-03-28 16:40 | - | |
| Any M500-ST6444 onwers/ | 2022-03-28 16:40 | - | |
| Any Models to Beware of/ | 2022-03-28 16:40 | - | |
| Any P200-RT7 reviews/ | 2022-03-28 16:40 | - | |
| Any P755 S5269 Users/ | 2022-03-28 16:40 | - | |
| Any Pro-Reviews yet for the new Qosmios/ | 2022-03-28 16:40 | - | |
| Any Qosmio G40 owners out there Deciding between that and the Satellite X200/ | 2022-03-28 16:40 | - | |
| Any Reviews of Satellite P770-BT4G22/ | 2022-03-28 16:40 | - | |
| Any Satellite p30 Owners/ | 2022-03-28 16:40 | - | |
| Any Suggestions on this A205 Laptop/ | 2022-03-28 16:40 | - | |
| Any Toshiba M70-159 Reviews/ | 2022-03-28 16:40 | - | |
| Any Toshiba M100 m105 Owners/ | 2022-03-28 16:40 | - | |
| Any Toshiba owners get vista/ | 2022-03-28 16:40 | - | |
| Any Toshibas with dual lamps/ | 2022-03-28 16:40 | - | |
| Any advice on Toshiba A300 A305 Fan Noise/ | 2022-03-28 16:40 | - | |
| Anybody else have massive problems with the screen and general stability/ | 2022-03-28 16:40 | - | |
| Anybody experience battery hardware problems/ | 2022-03-28 16:40 | - | |
| Anybody facing any problems with A105-s4134/ | 2022-03-28 16:40 | - | |
| Anybody give the M200 (or 205) a try/ | 2022-03-28 16:40 | - | |
| Anybody got real pix of A205 and P205 yet/ | 2022-03-28 16:40 | - | |
| Anybody have the P750/ | 2022-03-28 16:40 | - | |
| Anybody here know what is the administrator password for Toshiba Notebook/ | 2022-03-28 16:40 | - | |
| Anybody know the output resolution on A85-S107/ | 2022-03-28 16:40 | - | |
| Anybody know what chip the X205 series uses for setFSB purposes/ | 2022-03-28 16:40 | - | |
| Anybody own Satellite A215 Series Blank Screen/ | 2022-03-28 16:40 | - | |
| Anybody tried the Computrace on the new M40/ | 2022-03-28 16:40 | - | |
| Anybody upgrade the CPU in a Satellite A135-S2276/ | 2022-03-28 16:40 | - | |
| Anybody with a satellite A100/ | 2022-03-28 16:40 | - | |
| Any difference between these two satellites/ | 2022-03-28 16:40 | - | |
| Any experiences on the new Toshiba models (M300 A300 P300 etc.)/ | 2022-03-28 16:40 | - | |
| Any experts with Toshiba Vista to Toshiba XP/ | 2022-03-28 16:40 | - | |
| Any feedback about Toshiba Satellite P775D-S7230/ | 2022-03-28 16:40 | - | |
| Any feedback on Toshiba Satellite A660-042/ | 2022-03-28 16:40 | - | |
| Any happy Satellite X205 owners out there/ | 2022-03-28 16:40 | - | |
| Any idea as to battery life on the new Toshiba M640 645/ | 2022-03-28 16:40 | - | |
| Any idea what that Qosmio refresh will look like coming april/ | 2022-03-28 16:40 | - | |
| Any info about the Satellite Pro X200 Series/ | 2022-03-28 16:40 | - | |
| Any info on Toshiba U500 release in US/ | 2022-03-28 16:40 | - | |
| Any information on R500 Update Refresh/ | 2022-03-28 16:40 | - | |
| Any interest in a T115 T135 Owner's thread/ | 2022-03-28 16:40 | - | |
| Any known issues with the A305 D/ | 2022-03-28 16:40 | - | |
| Any matte screens left/ | 2022-03-28 16:40 | - | |
| Any more new Satellite M100 owners/ | 2022-03-28 16:40 | - | |
| Any news on the Satellite 5005 lawsuit/ | 2022-03-28 16:40 | - | |
| Any news on the Toshiba Qosmio F20/ | 2022-03-28 16:40 | - | |
| Anyone Purchase the Tecra R840 Yet/ | 2022-03-28 16:40 | - | |
| Anyone bought the new Qosmio F60/ | 2022-03-28 16:40 | - | |
| Any one else have problems with Toshiba Systemgaurd/ | 2022-03-28 16:40 | - | |
| Anyone else have the Satellite M645-S4114/ | 2022-03-28 16:40 | - | |
| Anyone else use the 25% Back to School Promo at Toshibadirect.com/ | 2022-03-28 16:40 | - | |
| Anyone familair with the new Tecra A9/ | 2022-03-28 16:40 | - | |
| Anyone get FN keys working after XP/ | 2022-03-28 16:40 | - | |
| Anyone getting have purchased the M645 640/ | 2022-03-28 16:40 | - | |
| Anyone got Toshiba Satellite Intel Celeron M 370 1.5GHz Laptop (M50-MX2)/ | 2022-03-28 16:40 | - | |
| Anyone have Toshiba Qosmio F20/ | 2022-03-28 16:40 | - | |
| Anyone have a Satellite P750-04X/ | 2022-03-28 16:40 | - | |
| Anyone have a Satellite a200 th7/ | 2022-03-28 16:40 | - | |
| Anyone have a Tecra R10, esp with WXGA+ (1440x900) screen/ | 2022-03-28 16:40 | - | |
| Anyone have a Toshiba Qosmio G25-AV513/ | 2022-03-28 16:40 | - | |
| Anyone have a X205-SLi6/ | 2022-03-28 16:40 | - | |
| Anyone have an issue downloading the new Nvidia driver for the M645/ | 2022-03-28 16:40 | - | |
| Anyone have anymore p105-s921 pics/ | 2022-03-28 16:40 | - | |
| Anyone have one of the 305 models/ | 2022-03-28 16:40 | - | |
| Anyone have opinions on Satellite A205-S4629/ | 2022-03-28 16:40 | - | |
| Anyone have the Satellite M305D I'd be interested to hear your opinion of it!/ | 2022-03-28 16:40 | - | |
| Anyone have this Toshiba laptop bag/ | 2022-03-28 16:40 | - | |
| Anyone have this laptop/ | 2022-03-28 16:40 | - | |
| Anyone here own a Satellite P305 Anything I should know before I buy/ | 2022-03-28 16:40 | - | |
| Anyone know how to change inputs on the Toshiba USB HDTV Tuner/ | 2022-03-28 16:40 | - | |
| Anyone know of a better than Toshiba replacement battery/ | 2022-03-28 16:40 | - | |
| Anyone knows what this PCB is called/ | 2022-03-28 16:40 | - | |
| Anyone know when the next gen Qosmios will be released/ | 2022-03-28 16:40 | - | |
| Anyone know where I can get a Service Manual for A35/ | 2022-03-28 16:40 | - | |
| Anyone know where I can get a service manual for a Satellite L35/ | 2022-03-28 16:40 | - | |
| Anyone know where to buy a Qosmio G30-140 in uk/ | 2022-03-28 16:40 | - | |
| Anyone own the A665-S6067 (i7-720) model/ | 2022-03-28 16:40 | - | |
| Anyone own the Toshiba R835 yet/ | 2022-03-28 16:40 | - | |
| Anyone running vista 64bit on their toshiba/ | 2022-03-28 16:40 | - | |
| Anyone solved Toshiba P100 Fan on off issues every 15 seconds/ | 2022-03-28 16:40 | - | |
| Anyone updated their GTX 460 driver/ | 2022-03-28 16:40 | - | |
| Anyone upgrade HD in Toshiba X205s/ | 2022-03-28 16:40 | - | |
| Anyone using Satellite P35/ | 2022-03-28 16:40 | - | |
| Anyone using Toshiba Portege model with Core 2 Duo 1.83ghz/ | 2022-03-28 16:40 | - | |
| Anyone want the RAM out of my Toshiba M40/ | 2022-03-28 16:40 | - | |
| Anyone with insight on new Toshiba E205-S1904/ | 2022-03-28 16:40 | - | |
| Any opinions P755D-S5384/ | 2022-03-28 16:40 | - | |
| Any other G35 av-660 owners out there/ | 2022-03-28 16:40 | - | |
| Any owners of the Satellite E205/ | 2022-03-28 16:40 | - | |
| Any possible upgrades to A215-S4747 to make it more gaming friendly/ | 2022-03-28 16:40 | - | |
| Any quick advice Toshiba L650-15G/ | 2022-03-28 16:40 | - | |
| Any reset button on a105/ | 2022-03-28 16:40 | - | |
| Any review of C855 series in this forum/ | 2022-03-28 16:40 | - | |
| Anything to protect the paintwork/ | 2022-03-28 16:40 | - | |
| Anything wrong with the battery in my M645/ | 2022-03-28 16:40 | - | |
| Any third-party power adapter for X200 X205/ | 2022-03-28 16:40 | - | |
| Any thoughts on this Seems like a good deal/ | 2022-03-28 16:40 | - | |
| Any version of the Satellite line to avoid/ | 2022-03-28 16:40 | - | |
| Anyway for Toshiba p15 laptop to boot from flash/ | 2022-03-28 16:40 | - | |
| Any word on TOSHIBA SATELLITE x205/ | 2022-03-28 16:40 | - | |
| Appraisal for A135-4467/ | 2022-03-28 16:40 | - | |
| A problem with Satellite A65-S1362/ | 2022-03-28 16:39 | - | |
| A question regarding Intel 915 GM Graphics/ | 2022-03-28 16:39 | - | |
| Are Comet trying to rip me off (buying Satellite A210)/ | 2022-03-28 16:40 | - | |
| Are There Any R930 Owners/ | 2022-03-28 16:40 | - | |
| Are Toshiba Satellite's good laptops/ | 2022-03-28 16:40 | - | |
| Are Toshiba Satellite Laptops worth Buying or are they Defective/ | 2022-03-28 16:40 | - | |
| Are Toshiba laptop chargers cross-compatible/ | 2022-03-28 16:40 | - | |
| Are Toshibas/ | 2022-03-28 16:40 | - | |
| A real E200 205 Toshiba Satellite Maintenance Manual from the Aussies/ | 2022-03-28 16:39 | - | |
| Are all laptops true dual screen/ | 2022-03-28 16:40 | - | |
| Are the Aussies getting better laptops than EU US/ | 2022-03-28 16:40 | - | |
| Are there any Satellite models with heating/ | 2022-03-28 16:40 | - | |
| Are there any guide to how to open up toshiba x775-3dv78 yet/ | 2022-03-28 16:40 | - | |
| Are there any new gaming laptops on the horizon/ | 2022-03-28 16:40 | - | |
| Are these all the drivers to put XP on the SLi1/ | 2022-03-28 16:40 | - | |
| A review for Qosmio G35 AV650 coming/ | 2022-03-28 16:39 | - | |
| Are your AC adapters hot/ | 2022-03-28 16:40 | - | |
| Artic silver/ | 2022-03-28 16:40 | - | |
| A silly question to all the satellite x205 owners running XP/ | 2022-03-28 16:39 | - | |
| Asking about Toshiba's shipping condition/ | 2022-03-28 16:40 | - | |
| Assistance Advice for Portege R100/ | 2022-03-28 16:40 | - | |
| Atheros 9281 Network Wireless Adapter - Toshiba A305-S6864/ | 2022-03-28 16:40 | - | |
| Atheros AR9251 Adapter won't connect/ | 2022-03-28 16:40 | - | |
| Atheros WLAN vs INTELs/ | 2022-03-28 16:40 | - | |
| Atheros mini pci wireless card/ | 2022-03-28 16:40 | - | |
| Ati & Toshiba/ | 2022-03-28 16:40 | - | |
| Ati Radeon HD 3100/ | 2022-03-28 16:40 | - | |
| Attaching MiniPCI socket to M40X board/ | 2022-03-28 16:40 | - | |
| Attn- S607 owners/ | 2022-03-28 16:40 | - | |
| Audio-Video problem on Satellite A-30/ | 2022-03-28 16:40 | - | |
| Audio Device Driver on Satellite P200/ | 2022-03-28 16:40 | - | |
| Audio Driver conflicts on A75-S209 Laptop Sound not working/ | 2022-03-28 16:40 | - | |
| Audio Interference Satelite A70/ | 2022-03-28 16:40 | - | |
| Audio Outs/ | 2022-03-28 16:40 | - | |
| Audio problems with A105-S4004/ | 2022-03-28 16:40 | - | |
| Automatic Resume on Lid Open Questions/ | 2022-03-28 16:40 | - | |
| Automatic Upgrade/ | 2022-03-28 16:40 | - | |
| Automatic resume from Standby hibernate/ | 2022-03-28 16:40 | - | |
| BB A105-S101 arrived as A105-S171!!/ | 2022-03-28 16:40 | - | |
| BB now sells X305-Q705/ | 2022-03-28 16:40 | - | |
| BIOS (INSYDE H20) Recovery Satellite L505D-5965/ | 2022-03-28 16:40 | - | |
| BIOS - Dynamic CPU Frequency Mode Intel Dynamic Acceleration/ | 2022-03-28 16:40 | - | |
| BIOS - Fullscreen Panel Fit/ | 2022-03-28 16:40 | - | |
| BIOS Confusion/ | 2022-03-28 16:40 | - | |
| BIOS Crisis Recovery on Toshiba Satellite P100 - factory disabled/ | 2022-03-28 16:40 | - | |
| BIOS Damaged Error/ | 2022-03-28 16:40 | - | |
| BIOS Update Recommendation (Qosmio)/ | 2022-03-28 16:40 | - | |
| BIOS flash Satellite L755-S5214/ | 2022-03-28 16:40 | - | |
| BIOS for Saterllite A100/ | 2022-03-28 16:40 | - | |
| BIOS problems... PLEASE HELP!!/ | 2022-03-28 16:40 | - | |
| BIOS recovery for C655d-s5300/ | 2022-03-28 16:40 | - | |
| BIOS upgrade - 64-bit or 32-bit/ | 2022-03-28 16:40 | - | |
| BIOS upgrade failure/ | 2022-03-28 16:40 | - | |
| BRAND NEW--Toshiba P205-S7804 TROUBLE WITH IT/ | 2022-03-28 16:40 | - | |
| BSOD After BIOS Update/ | 2022-03-28 16:40 | - | |
| BSOD Hell. Bios Mem/ | 2022-03-28 16:40 | - | |
| BSOD after upgrading to Win 7/ | 2022-03-28 16:40 | - | |
| BSOD on 205-S7402/ | 2022-03-28 16:40 | - | |
| Back-lit Keyboard upgrade mod exchange/ | 2022-03-28 16:40 | - | |
| Background programs/ | 2022-03-28 16:40 | - | |
| Backlight flickering at low setting/ | 2022-03-28 16:40 | - | |
| Backlight keyboard on a P505/ | 2022-03-28 16:40 | - | |
| Back to Factory Default/ | 2022-03-28 16:40 | - | |
| Back to Toshiba/ | 2022-03-28 16:40 | - | |
| Bad Service/ | 2022-03-28 16:40 | - | |
| Bad Toshiba Customer Service/ | 2022-03-28 16:40 | - | |
| Bad video driver/ | 2022-03-28 16:40 | - | |
| Bandwith problems/ | 2022-03-28 16:40 | - | |
| Battery Alarm Even on Mains/ | 2022-03-28 16:40 | - | |
| Battery Charging when fully charged and power plugged/ | 2022-03-28 16:40 | - | |
| Battery Compartment/ | 2022-03-28 16:40 | - | |
| Battery Dead/ | 2022-03-28 16:40 | - | |
| Battery Issue/ | 2022-03-28 16:40 | - | |
| Battery Life in M50/ | 2022-03-28 16:40 | - | |
| Battery Life on A205/ | 2022-03-28 16:40 | - | |
| Battery Meter/ | 2022-03-28 16:40 | - | |
| Battery Not Charging/ | 2022-03-28 16:40 | - | |
| Battery Power/ | 2022-03-28 16:40 | - | |
| Battery Sensor Troubles/ | 2022-03-28 16:40 | - | |
| Battery availability in 2 years/ | 2022-03-28 16:40 | - | |
| Battery capacity decreased after OS re-installation/ | 2022-03-28 16:40 | - | |
| Battery charge level/ | 2022-03-28 16:40 | - | |
| Battery charge problem with M100-SP1011/ | 2022-03-28 16:40 | - | |
| Battery charging issues on 3 month old Toshiba/ | 2022-03-28 16:40 | - | |
| Battery error message/ | 2022-03-28 16:40 | - | |
| Battery for A105-S4384/ | 2022-03-28 16:40 | - | |
| Battery icon not working/ | 2022-03-28 16:40 | - | |
| Battery life for M645-S4070 - HELP/ | 2022-03-28 16:40 | - | |
| Battery life on M40/ | 2022-03-28 16:40 | - | |
| Battery life on Satellite M300- What's your experience/ | 2022-03-28 16:40 | - | |
| Battery much improved R705/ | 2022-03-28 16:40 | - | |
| Battery not charging on Toshiba L305/ | 2022-03-28 16:40 | - | |
| Battery not detected (Toshiba A300)/ | 2022-03-28 16:40 | - | |
| Battery plugged in not charging/ | 2022-03-28 16:40 | - | |
| Battery problem/ | 2022-03-28 16:40 | - | |
| Battery query/ | 2022-03-28 16:40 | - | |
| Battery upgrade/ | 2022-03-28 16:40 | - | |
| Beep... Beep!... Beep!... Beep!/ | 2022-03-28 16:40 | - | |
| Beep Codes for a Satellite A70/ | 2022-03-28 16:40 | - | |
| Beep at login/ | 2022-03-28 16:40 | - | |
| Beeping Noise Toshiba Satellite A305/ | 2022-03-28 16:40 | - | |
| Beginner questions- brightness buttons touchpad/ | 2022-03-28 16:40 | - | |
| Be joining you guys for a bit/ | 2022-03-28 16:40 | - | |
| Benefits of Adding 512MB to M45-S351/ | 2022-03-28 16:40 | - | |
| Best Buy Toshiba A665-S6050/ | 2022-03-28 16:40 | - | |
| BestBuy deal on Toshiba laptop/ | 2022-03-28 16:40 | - | |
| Best Gaming Toshiba Notebook Now !!/ | 2022-03-28 16:40 | - | |
| Best Graphics Driver for X205/ | 2022-03-28 16:40 | - | |
| Best Toshiba models of the past/ | 2022-03-28 16:40 | - | |
| Best Video Driver for X205-S9359/ | 2022-03-28 16:40 | - | |
| Best bang for your buck gaming Toshiba laptop/ | 2022-03-28 16:40 | - | |
| Best buy and toshiba/ | 2022-03-28 16:40 | - | |
| Best place for Toshiba, USA/ | 2022-03-28 16:40 | - | |
| Best screen quality/ | 2022-03-28 16:40 | - | |
| Best source for Video Drivers Toshiba 5205-s505/ | 2022-03-28 16:40 | - | |
| Better touch pad/ | 2022-03-28 16:40 | - | |
| Between the Tecra A6 and Sat 105/ | 2022-03-28 16:40 | - | |
| Beware Toshiba's New Depot Shipping Policy/ | 2022-03-28 16:40 | - | |
| Beware of lapmonster.com/ | 2022-03-28 16:40 | - | |
| Be wary of buying a Toshiba - you may never see your notebook again!!/ | 2022-03-28 16:40 | - | |
| Big Problem/ | 2022-03-28 16:40 | - | |
| Biggest Slow down of my M40/ | 2022-03-28 16:40 | - | |
| Big issue on Satellite A70/ | 2022-03-28 16:40 | - | |
| Big problem with Toshiba Depot/ | 2022-03-28 16:40 | - | |
| Bios Issues/ | 2022-03-28 16:40 | - | |
| Bios Upgraded - Satellite 1100 in coma !!/ | 2022-03-28 16:40 | - | |
| Bios Version For Toshiba Satelite A100/ | 2022-03-28 16:40 | - | |
| Bioshock v1.1 patch new plasmids gene tonics and bug fixes/ | 2022-03-28 16:40 | - | |
| Bios locked up of Toshiba Satellite/ | 2022-03-28 16:40 | - | |
| Bios manual or explanations of all settings/ | 2022-03-28 16:40 | - | |
| Bios password at laptop start up/ | 2022-03-28 16:40 | - | |
| Bios password reset for X205/ | 2022-03-28 16:40 | - | |
| Bios update 1.80 for Satellite Z830 - anyone running it or have any info on it/ | 2022-03-28 16:40 | - | |
| Bios upgrade issue on qosmio f50 f55 series/ | 2022-03-28 16:40 | - | |
| Bit the bullet and bought a Satellite P50-BBT2G22/ | 2022-03-28 16:40 | - | |
| Black Friday - Purchase A500 from HP dv5/ | 2022-03-28 16:40 | - | |
| Black LCD Screen/ | 2022-03-28 16:40 | - | |
| Black screen and unresponsive while still running/ | 2022-03-28 16:40 | - | |
| Black screen due to messing with utility program/ | 2022-03-28 16:40 | - | |
| Black screen of Satellite p15/ | 2022-03-28 16:40 | - | |
| Blank Screen, on MOST boots/ | 2022-03-28 16:40 | - | |
| Blank screen after POST on Satellite M50/ | 2022-03-28 16:40 | - | |
| Blank screen boot fail Toshiba Satellite M55-S329/ | 2022-03-28 16:40 | - | |
| Blank screen on boot. Laptop doesn't start/ | 2022-03-28 16:40 | - | |
| Blank white screen after cleaning and assembly/ | 2022-03-28 16:40 | - | |
| Blinking battery in satellite A100/ | 2022-03-28 16:40 | - | |
| Bloatware Guide for the X505 Series Qosmio/ | 2022-03-28 16:40 | - | |
| Bloatware and Recovery CDs/ | 2022-03-28 16:40 | - | |
| Blue-ray in x205 models/ | 2022-03-28 16:40 | - | |
| Blue Screen/ | 2022-03-28 16:40 | - | |
| Blue Screen after Sleep Mode- Need help quickly!/ | 2022-03-28 16:40 | - | |
| Blue Tooth and the M40/ | 2022-03-28 16:40 | - | |
| Blue screen.... and restart, over and over/ | 2022-03-28 16:40 | - | |
| Bluescreen crash - Satellite A200 TR6/ | 2022-03-28 16:40 | - | |
| Blue screen error everytime i turn on my com/ | 2022-03-28 16:40 | - | |
| Bluetooth audio gateway in SLI1/ | 2022-03-28 16:40 | - | |
| Bluetooth fiasco/ | 2022-03-28 16:40 | - | |
| Bluetooth on A135-s4427/ | 2022-03-28 16:40 | - | |
| Bluetooth on satellite A200/ | 2022-03-28 16:40 | - | |
| Boot dsk/ | 2022-03-28 16:40 | - | |
| Booting from a CF card/ | 2022-03-28 16:40 | - | |
| Bought Toshiba P105-S9722= Amazon surprise!/ | 2022-03-28 16:40 | - | |
| Bought a Netbook NB250 - am I missing Bluetooth/ | 2022-03-28 16:40 | - | |
| Bought a Toshiba A100 VA3 for the gf/ | 2022-03-28 16:40 | - | |
| Bought new M50 at CSC,any opinions/ | 2022-03-28 16:40 | - | |
| Brackets for A130 A135 2nd HDD Bay/ | 2022-03-28 16:40 | - | |
| Brand new A305 doesn't charge battery/ | 2022-03-28 16:40 | - | |
| Brand new Satellite M100...FREEZES all the time/ | 2022-03-28 16:40 | - | |
| Brand new Satellite S50 blank screen after 1 day use/ | 2022-03-28 16:40 | - | |
| Brand new U500 has a loud fan/ | 2022-03-28 16:40 | - | |
| Brand new laptop starts in 'recovery wizard'/ | 2022-03-28 16:40 | - | |
| Brightness Problem/ | 2022-03-28 16:40 | - | |
| Bring Back the Volume Dial!/ | 2022-03-28 16:40 | - | |
| Bringing Toshiba A30 hard-drive back to life/ | 2022-03-28 16:40 | - | |
| Broke My screen/ | 2022-03-28 16:40 | - | |
| Broken Port/ | 2022-03-28 16:40 | - | |
| Broken Tecra A4- Worth Selling/ | 2022-03-28 16:40 | - | |
| Broken USB on my m40/ | 2022-03-28 16:40 | - | |
| Broken USB ports (all 4) on my Toshiba Satellite A105-S1014/ | 2022-03-28 16:40 | - | |
| Broken computer/ | 2022-03-28 16:40 | - | |
| Broken connector on P205-S6237/ | 2022-03-28 16:40 | - | |
| Broken motherboard connector/ | 2022-03-28 16:40 | - | |
| Brown Black spots on LCD screen/ | 2022-03-28 16:40 | - | |
| Budget A205, Heat/ | 2022-03-28 16:40 | - | |
| Build Quality of P100-222/ | 2022-03-28 16:40 | - | |
| Built-In Camera won't pick up audio! (computer details inside)/ | 2022-03-28 16:40 | - | |
| Built in Mic/ | 2022-03-28 16:40 | - | |
| Burnt plastic smell/ | 2022-03-28 16:40 | - | |
| Busted 5 (or so) month old Toshiba Satellite/ | 2022-03-28 16:40 | - | |
| Buying Online/ | 2022-03-28 16:40 | - | |
| Buying Toshiba Laptop/ | 2022-03-28 16:40 | - | |
| Buying Toshiba online USA-- Greece/ | 2022-03-28 16:40 | - | |
| Buying a Toshiba A215 on ebay/ | 2022-03-28 16:40 | - | |
| Buying a replacement LCD 17 i'm confused! please help/ | 2022-03-28 16:40 | - | |
| Buying guide on protection/ | 2022-03-28 16:40 | - | |
| Buy new Keyboard and install myself/ | 2022-03-28 16:40 | - | |
| Buy this Toshiba or pass on it/ | 2022-03-28 16:40 | - | |
| C55t-A5287 Touch Screen Questions/ | 2022-03-28 16:40 | - | |
| C75D wowes/ | 2022-03-28 16:40 | - | |
| C655 Won't boot/ | 2022-03-28 16:40 | - | |
| C660 Satelitte Wi-Fi Card/ | 2022-03-28 16:40 | - | |
| CAN anyone help me with x205 sound output/ | 2022-03-28 16:40 | - | |
| CD-DVD Drivers Corrupted or Missing!!!!/ | 2022-03-28 16:40 | - | |
| CD-R DVD Rom Drive replacement/ | 2022-03-28 16:40 | - | |
| CD-ROM error on boot after replacing DVD Drive/ | 2022-03-28 16:40 | - | |
| CD DVD rom of Toshiba A205-S585 not working/ | 2022-03-28 16:40 | - | |
| CD Drive Problems/ | 2022-03-28 16:40 | - | |
| CD ROM Drive needed, Satellite 1800/ | 2022-03-28 16:40 | - | |
| CD drive failure/ | 2022-03-28 16:40 | - | |
| CD driver/ | 2022-03-28 16:40 | - | |
| CHC and Toshiba/ | 2022-03-28 16:40 | - | |
| CLEANiNG x300/ | 2022-03-28 16:40 | - | |
| CMOS battery location Toshiba satellite L350 psld8u-0GH016/ | 2022-03-28 16:40 | - | |
| CMOS battery on 1905-301/ | 2022-03-28 16:40 | - | |
| CNN.com review of the r400/ | 2022-03-28 16:40 | - | |
| CPU FAN Control Issues/ | 2022-03-28 16:40 | - | |
| CPU Fan Not Working/ | 2022-03-28 16:40 | - | |
| CPU RAM HDD Upgrade on a Satellite P100/ | 2022-03-28 16:40 | - | |
| CPU Slow Stuck/ | 2022-03-28 16:40 | - | |
| CPU Upgrade Satellite L775D-S7108/ | 2022-03-28 16:40 | - | |
| CPU Upgrade for a Toshiba Satellite A105-S2001/ | 2022-03-28 16:40 | - | |
| CPU being throttled at 38°C, help please!/ | 2022-03-28 16:40 | - | |
| CPU micro code not recognized by BIOS/ | 2022-03-28 16:40 | - | |
| CPU upgrade Gateway NV570P11u/ | 2022-03-28 16:40 | - | |
| CPU upgrade fun!/ | 2022-03-28 16:40 | - | |
| CPU z shot/ | 2022-03-28 16:40 | - | |
| CRYSIS Multiplayer Beta 3 on Toshiba X205/ | 2022-03-28 16:40 | - | |
| CS- Boot bios password on A135-2276/ | 2022-03-28 16:40 | - | |
| CS- Source on Toshiba A135 with GMA950 experience/ | 2022-03-28 16:40 | - | |
| Calling All Qosmio G35AV600 owners!!!!!/ | 2022-03-28 16:40 | - | |
| Calling Toshiba M60 and M70 owners - how do you like it so far/ | 2022-03-28 16:40 | - | |
| Calling all A70 owners! and others!/ | 2022-03-28 16:40 | - | |
| Calling x770-x775 3D owners/ | 2022-03-28 16:40 | - | |
| Camera assitant software needs to be turned on/ | 2022-03-28 16:40 | - | |
| Can't Find My Serial Number, Series, and Model/ | 2022-03-28 16:40 | - | |
| Can't Remove Toshiba Battery/ | 2022-03-28 16:40 | - | |
| Can't access my BIOS with Qosmio X505-Q830/ | 2022-03-28 16:40 | - | |
| Can't decide/ | 2022-03-28 16:40 | - | |
| Can't find any reviews on this new model, good machine/ | 2022-03-28 16:40 | - | |
| Can't find drivers Sattellite A215/ | 2022-03-28 16:40 | - | |
| Can't find model number/ | 2022-03-28 16:40 | - | |
| Can't game unplugged/ | 2022-03-28 16:40 | - | |
| Can't get Toshiba Satellite A75-206 to acquire IP address/ | 2022-03-28 16:40 | - | |
| Can't get hard drive out of Qosmio x775/ | 2022-03-28 16:40 | - | |
| Can't get in irisvista.com/ | 2022-03-28 16:40 | - | |
| Can't get nvflash to work with mine x200-15k laptop (8700m GT)/ | 2022-03-28 16:40 | - | |
| Can't get the sound to work/ | 2022-03-28 16:40 | - | |
| Can't identify beep code/ | 2022-03-28 16:40 | - | |
| Can't install 2 one gig memory chips/ | 2022-03-28 16:40 | - | |
| Can't install common module software/ | 2022-03-28 16:40 | - | |
| Can't load Operating system/ | 2022-03-28 16:40 | - | |
| Can't watch DVD Movies (P200, downgraded to XP)/ | 2022-03-28 16:40 | - | |
| Can I Switch between Integrated & Discrete in Satellite U500/ | 2022-03-28 16:40 | - | |
| Can I add more RAM/ | 2022-03-28 16:40 | - | |
| Can I custom order a Toshiba/ | 2022-03-28 16:40 | - | |
| Can I get a heads up on/ | 2022-03-28 16:40 | - | |
| Can I go with a single 1G RAM chip in a Satellite/ | 2022-03-28 16:40 | - | |
| Can I recovery Vista without the Toshiba Junk/ | 2022-03-28 16:40 | - | |
| Can I replace A505-S6969 keyboard/ | 2022-03-28 16:40 | - | |
| Can I replace my a200 motherboard with another model/ | 2022-03-28 16:40 | - | |
| Can I salvage a X200 X205 with a burned GPU [SLI]/ | 2022-03-28 16:40 | - | |
| Can I set the shared vdeo ram to 128mb (from 64)/ | 2022-03-28 16:40 | - | |
| Can I upgrade RAM on the Toshiba E55-a5114 (if so how much)/ | 2022-03-28 16:40 | - | |
| Can I upgrade my video card/ | 2022-03-28 16:40 | - | |
| Can I upgrade my video card How/ | 2022-03-28 16:40 | - | |
| Can I upgrade the HDs in a Qosmio 660 to a faster Drive/ | 2022-03-28 16:40 | - | |
| Can I upgrade to ATI graphics card from Intel/ | 2022-03-28 16:40 | - | |
| Can I use 4GB of DDR2-800 on a Toshiba Satellite A300-ST4004/ | 2022-03-28 16:40 | - | |
| Can I use an external monitor if my laptop monitor is black/ | 2022-03-28 16:40 | - | |
| Can I use the recovery disc on a different HDD/ | 2022-03-28 16:40 | - | |
| Can PC5300 be detuned to PC4200/ | 2022-03-28 16:40 | - | |
| Can Should I add ram to my L505D/ | 2022-03-28 16:40 | - | |
| Can Someone Please Advise Me On This A15 Issue/ | 2022-03-28 16:40 | - | |
| Can Toshiba battery cause a black screen/ | 2022-03-28 16:40 | - | |
| Can You watch a full DVD movie on battery power/ | 2022-03-28 16:40 | - | |
| Can a Portege R200 series be upgraded to Dual-core/ | 2022-03-28 16:40 | - | |
| Can a Toshiba Satellite A665D run Photoshop CS4/ | 2022-03-28 16:40 | - | |
| Can anybody post pics from their Qosmio X505 with 1920x1080 resolution/ | 2022-03-28 16:40 | - | |
| Can anyone mod my insyde h2o bios/ | 2022-03-28 16:40 | - | |
| Can both Bluetooth monitor and BT Stack for Win by Toshiba coexist/ | 2022-03-28 16:40 | - | |
| Can i buy Toshiba Tecra R840-11W/ | 2022-03-28 16:40 | - | |
| Can i buy individual keyboard keys on a Satellite A300 laptop/ | 2022-03-28 16:40 | - | |
| Can i upgrade my l300 celeron m585 2.2ghz with a t2300 core duo/ | 2022-03-28 16:40 | - | |
| Can i wipe the C drive and install Vista64 and use Restore/ | 2022-03-28 16:40 | - | |
| Can my Satellite run an external 19 wide LCD/ | 2022-03-28 16:40 | - | |
| Cannot find drivers for SATELLITE M70-343/ | 2022-03-28 16:40 | - | |
| Cannot find keyboard software for Satellite A215/ | 2022-03-28 16:40 | - | |
| Cannot increase brightness in Toshiba P100/ | 2022-03-28 16:40 | - | |
| Cannot restore OS/ | 2022-03-28 16:40 | - | |
| Cannot wake up from sleep in SLI mode/ | 2022-03-28 16:40 | - | |
| Can r830 r835 cpu be upgraded Easy to swap or soldered/ | 2022-03-28 16:40 | - | |
| Can someone please help me/ | 2022-03-28 16:40 | - | |
| Can someone take me through the X300s 9400m 9800 sli switchy thing/ | 2022-03-28 16:40 | - | |
| Cant Install Windows Xp Pro- Help/ | 2022-03-28 16:40 | - | |
| Cant add memory/ | 2022-03-28 16:40 | - | |
| Cant boot Satellite A100/ | 2022-03-28 16:40 | - | |
| Cant get Full Screen/ | 2022-03-28 16:40 | - | |
| Can the AMD E-240 processor be updated in a C655D/ | 2022-03-28 16:40 | - | |
| Can the Satellite E105-S1402 handle 8gb or ram 64bit OS/ | 2022-03-28 16:40 | - | |
| Can the Toshiba satallite c55-a5104 run civilization V/ | 2022-03-28 16:40 | - | |
| Can the x305 run it/ | 2022-03-28 16:40 | - | |
| Can this happens with SLI1/ | 2022-03-28 16:40 | - | |
| Cant use recovery discs, help !!/ | 2022-03-28 16:40 | - | |
| Can wireless card be replaced/ | 2022-03-28 16:40 | - | |
| Can you put a 2nd HDD in A105-S4074/ | 2022-03-28 16:40 | - | |
| Can you really play any games on the x205 SLI/ | 2022-03-28 16:40 | - | |
| Can you upgrade a Toshiba laptop video card/ | 2022-03-28 16:40 | - | |
| CardMan 2020 Drivers/ | 2022-03-28 16:40 | - | |
| Cardbus controller for Toshiba Qosmio G-15/ | 2022-03-28 16:40 | - | |
| Case for Tecra M2/ | 2022-03-28 16:40 | - | |
| Celeron to Pentium replacement problem/ | 2022-03-28 16:40 | - | |
| Cell proc still being used in Qosmios/ | 2022-03-28 16:40 | - | |
| Change Memory mapping on Toshiba A105/ | 2022-03-28 16:40 | - | |
| Change Remove DVD-ROM CD-RW Drive on M105-S3031/ | 2022-03-28 16:40 | - | |
| Change widescreen display to 4-3 display/ | 2022-03-28 16:40 | - | |
| Changing 128 shared mem to 256 in BIOS/ | 2022-03-28 16:40 | - | |
| Changing CPU on L500/ | 2022-03-28 16:40 | - | |
| Changing Graphics Card In L300D-028/ | 2022-03-28 16:40 | - | |
| Changing Harddisk of Toshiba/ | 2022-03-28 16:40 | - | |
| Changing Hard drives/ | 2022-03-28 16:40 | - | |
| Changing RAM Tinings Ocercloking P8700 w Intel PM45/ | 2022-03-28 16:40 | - | |
| Changing Shared System Graphics/ | 2022-03-28 16:40 | - | |
| Changing Touch Pad Button Perperties-/ | 2022-03-28 16:40 | - | |
| Changing X505 keyboard to X775 version/ | 2022-03-28 16:40 | - | |
| Changing cpu in Toshiba a110/ | 2022-03-28 16:40 | - | |
| Changing the Hybrid Hard Drive settingson the satellite/ | 2022-03-28 16:40 | - | |
| Changing the light on the laptop/ | 2022-03-28 16:40 | - | |
| Changing the setting on keyboard/ | 2022-03-28 16:40 | - | |
| Charger Help!!/ | 2022-03-28 16:40 | - | |
| Charger replacement/ | 2022-03-28 16:40 | - | |
| Charging issue with A135/ | 2022-03-28 16:40 | - | |
| Check cable connection no bootable device/ | 2022-03-28 16:40 | - | |
| Chicony USB 2.0 Doesn't work on toshiba p205-s6267/ | 2022-03-28 16:40 | - | |
| Chicony USB 2.0 Webcamera Troubleshooting/ | 2022-03-28 16:40 | - | |
| Chinese review of new R830 with Sandy Bridge/ | 2022-03-28 16:40 | - | |
| Clarification on the Toshiba L745D (amd a6-3400/ | 2022-03-28 16:40 | - | |
| Clean Install. Toshiba Product Recovery Disc/ | 2022-03-28 16:40 | - | |
| Clean Install Procedure for Satellite P100/ | 2022-03-28 16:40 | - | |
| Clean Vista Install/ | 2022-03-28 16:40 | - | |
| Clean Vista Install on a x205/ | 2022-03-28 16:40 | - | |
| Cleaning an X205/ | 2022-03-28 16:40 | - | |
| Cleaning the fans [Satellite A70]/ | 2022-03-28 16:40 | - | |
| Cleaning under leyboard keys. Satellite L305-S5918/ | 2022-03-28 16:40 | - | |
| Clean install/ | 2022-03-28 16:40 | - | |
| Clean install of window 7 on Toshiba satellite laptop/ | 2022-03-28 16:40 | - | |
| Clean install on A215-S7433/ | 2022-03-28 16:40 | - | |
| Clean install on Tecra r700/ | 2022-03-28 16:40 | - | |
| Clean reinstall on M100 M105/ | 2022-03-28 16:40 | - | |
| Clean vista install on X205 SLI3/ | 2022-03-28 16:40 | - | |
| Click Click Clicking/ | 2022-03-28 16:40 | - | |
| Cloning an SSD, advise please/ | 2022-03-28 16:40 | - | |
| Cloning and USB Booting on Toshiba - What's feasible/ | 2022-03-28 16:40 | - | |
| Closing my Satellite a 110-225- internet connection/ | 2022-03-28 16:40 | - | |
| Clusters of Dead Pixels/ | 2022-03-28 16:40 | - | |
| Combo Drive VERY noise on my M40/ | 2022-03-28 16:40 | - | |
| Comment for M45-S331 please!/ | 2022-03-28 16:40 | - | |
| Comments & Questions about A500-02U (Blu Ray)/ | 2022-03-28 16:40 | - | |
| Comments on selection of laptop/ | 2022-03-28 16:40 | - | |
| Company of heroes x205/ | 2022-03-28 16:40 | - | |
| Compaq setup partition/ | 2022-03-28 16:40 | - | |
| Comparable Technologies/ | 2022-03-28 16:40 | - | |
| Compare Tecra M3 and Portege S100/ | 2022-03-28 16:40 | - | |
| Comparing Toshiba as a brand to Sager/ | 2022-03-28 16:40 | - | |
| Compatible CDRW-DVD combo drives/ | 2022-03-28 16:40 | - | |
| Compatible DVD/ | 2022-03-28 16:40 | - | |
| Complete System Install for Toshiba Portege 4000 w o CD-ROM drive/ | 2022-03-28 16:40 | - | |
| Complete gpu removal satellite L670/ | 2022-03-28 16:40 | - | |
| Compusmart extended warranty/ | 2022-03-28 16:40 | - | |
| Computer screen freeze's/ | 2022-03-28 16:40 | - | |
| Computer turns itself on while in sleep mode/ | 2022-03-28 16:40 | - | |
| ConfigFree IntelProset Zero Config/ | 2022-03-28 16:40 | - | |
| ConfigFree utility any good for wireless/ | 2022-03-28 16:40 | - | |
| Configurable Satellite models are missing on ToshibaDirect.com- updating to Montevina Centrino 2 finally/ | 2022-03-28 16:40 | - | |
| Configure Media Keys Toshiba Satellite M40X on Winamp/ | 2022-03-28 16:40 | - | |
| Configuring RAID on X205 SLi5/ | 2022-03-28 16:40 | - | |
| Configuring buttons on the left side/ | 2022-03-28 16:40 | - | |
| Configuring my media keys again/ | 2022-03-28 16:40 | - | |
| Confused about Dolby Digital/ | 2022-03-28 16:40 | - | |
| Connect L45-S7423 HD to desktop controller/ | 2022-03-28 16:40 | - | |
| Connect N95 to x300 via blotooth/ | 2022-03-28 16:40 | - | |
| Connecting 5.1 speakers to X205/ | 2022-03-28 16:40 | - | |
| Connecting Qosmio x305 to television Display/ | 2022-03-28 16:40 | - | |
| Considering Tecra M4/ | 2022-03-28 16:40 | - | |
| Considering Toshiba Satellite Pro A200/ | 2022-03-28 16:40 | - | |
| Considering a Custom A130/ | 2022-03-28 16:40 | - | |
| Considering a new Toshiba/ | 2022-03-28 16:40 | - | |
| Constant bugging system crash - Screen related - A100-662 satellite/ | 2022-03-28 16:40 | - | |
| Consumer Infrared Port/ | 2022-03-28 16:40 | - | |
| Control fan speed on Satellite L775/ | 2022-03-28 16:40 | - | |
| Controlling HD and GPU Fans/ | 2022-03-28 16:40 | - | |
| Convince me to buy Toshiba Portege R835/ | 2022-03-28 16:40 | - | |
| Cooling Element/ | 2022-03-28 16:40 | - | |
| Cooling an overheating Toshiba Satellite A205-S4777/ | 2022-03-28 16:40 | - | |
| Cooling problem with Tecra M4/ | 2022-03-28 16:40 | - | |
| Cooling system popup on p-series/ | 2022-03-28 16:40 | - | |
| Cooling system problems on my Toshiba Portege 4000/ | 2022-03-28 16:40 | - | |
| Core 2 Dual Mobile T7300 -X7900/ | 2022-03-28 16:40 | - | |
| Core 2 Duo difference/ | 2022-03-28 16:40 | - | |
| Core Duo 1.6ghz VS Core Solo 1.86ghz/ | 2022-03-28 16:40 | - | |
| Costco out of M40/ | 2022-03-28 16:40 | - | |
| Could not enumerate/ | 2022-03-28 16:40 | - | |
| Counter Strike- Source on M105 GMA950/ | 2022-03-28 16:40 | - | |
| Counter Strike/ | 2022-03-28 16:40 | - | |
| Couple of Dumb Newbie Questions/ | 2022-03-28 16:40 | - | |
| Couple of questions/ | 2022-03-28 16:40 | - | |
| Couple questions to x205 owners/ | 2022-03-28 16:40 | - | |
| Cousor jumps while typing/ | 2022-03-28 16:40 | - | |
| Cracked A15-S157/ | 2022-03-28 16:40 | - | |
| Cracked Display On My Tecra N3/ | 2022-03-28 16:40 | - | |
| Cracked display issues/ | 2022-03-28 16:40 | - | |
| Crashes using SKYPE/ | 2022-03-28 16:40 | - | |
| Create New Partition with shrink method or related other methods/ | 2022-03-28 16:40 | - | |
| Create a Driver Backup Disc on A205-S5804/ | 2022-03-28 16:40 | - | |
| Creating recovery disc - problem/ | 2022-03-28 16:40 | - | |
| Creative Labs Sound Blaster X-Fi 7.1 Notebook Card in an x305/ | 2022-03-28 16:40 | - | |
| Crud, is my touchpad messing up/ | 2022-03-28 16:40 | - | |
| Crysis Microsoft hotfix Vista 32-bit/ | 2022-03-28 16:40 | - | |
| Crysis problems on x205/ | 2022-03-28 16:40 | - | |
| Curious, Overclocking Fix/ | 2022-03-28 16:40 | - | |
| Curious - has anyone actually used the Reliability Refund Guarantee/ | 2022-03-28 16:40 | - | |
| Current Toshiba notebook reliability (especially Qosmio)/ | 2022-03-28 16:40 | - | |
| Custom Building Toshiba Notebooks/ | 2022-03-28 16:40 | - | |
| Custom Toshiba w NVIDIA 7600/ | 2022-03-28 16:40 | - | |
| Custom War for me.. Satellite VS Vostro 1500/ | 2022-03-28 16:40 | - | |
| Custom built Toshiba Laptop. What was your build time/ | 2022-03-28 16:40 | - | |
| Customize Toshibas in Canada Also- M50-MX2/ | 2022-03-28 16:40 | - | |
| Customized M30 or M35-S456/ | 2022-03-28 16:40 | - | |
| DC Port busted, advice/ | 2022-03-28 16:40 | - | |
| DC Power allways plugged in/ | 2022-03-28 16:40 | - | |
| DDR2 Ram in a Tosh M-45/ | 2022-03-28 16:40 | - | |
| DO NOT BUY TOSHIBA LAPTOP!!! Story included!/ | 2022-03-28 16:40 | - | |
| DVD ( burners ) drives .. any problems/ | 2022-03-28 16:40 | - | |
| DVD-RAM Utility/ | 2022-03-28 16:40 | - | |
| DVD-ROM Replacement on Sat 1115-S103/ | 2022-03-28 16:40 | - | |
| DVD-ROM problems/ | 2022-03-28 16:40 | - | |
| DVD-RW R6372 Problems in A45-S250/ | 2022-03-28 16:40 | - | |
| DVD-RW burning problem/ | 2022-03-28 16:40 | - | |
| DVD-R burning speed/ | 2022-03-28 16:40 | - | |
| DVD Drive Problems X205_SL1/ | 2022-03-28 16:40 | - | |
| DVD Drive opens by itself/ | 2022-03-28 16:40 | - | |
| DVD REcovery Disks Question/ | 2022-03-28 16:40 | - | |
| DVDRW is working only at 1X/ | 2022-03-28 16:40 | - | |
| DVD drive keeps on clicking w out media/ | 2022-03-28 16:40 | - | |
| DVD drive not working/ | 2022-03-28 16:40 | - | |
| DVD drives Satallite A100/ | 2022-03-28 16:40 | - | |
| DVD recovery Disk/ | 2022-03-28 16:40 | - | |
| DVI connection options/ | 2022-03-28 16:40 | - | |
| Dain-bramaged Satellite M45/ | 2022-03-28 16:40 | - | |
| Dark Pictures, Fuzzy and dark type faces/ | 2022-03-28 16:40 | - | |
| Dark pictures/ | 2022-03-28 16:40 | - | |
| Data Ports/ | 2022-03-28 16:40 | - | |
| Daylight savings time question/ | 2022-03-28 16:40 | - | |
| Dead LCD Screen - Know where I can buy some/ | 2022-03-28 16:40 | - | |
| Dead M115-S3094/ | 2022-03-28 16:40 | - | |
| Dead Pixel or Cracked Screen/ | 2022-03-28 16:40 | - | |
| Dead Pixels!!/ | 2022-03-28 16:40 | - | |
| Dead Qosmio X305-Q715/ | 2022-03-28 16:40 | - | |
| Dead Sound/ | 2022-03-28 16:40 | - | |
| Dead Toshiba P100/ | 2022-03-28 16:40 | - | |
| Dead Toshiba after replacing power jack/ | 2022-03-28 16:40 | - | |
| Dead or Stuck Pixel/ | 2022-03-28 16:40 | - | |
| Dead pixels -(/ | 2022-03-28 16:40 | - | |
| Dead pixels on my X300 Screen !!!!/ | 2022-03-28 16:40 | - | |
| Dear M35X users- need help on caturing/ | 2022-03-28 16:40 | - | |
| Dedicated forums for Satellites/ | 2022-03-28 16:40 | - | |
| Default 8700m clock speed on x200/ | 2022-03-28 16:40 | - | |
| Deleted Drivers ..... by mistake/ | 2022-03-28 16:40 | - | |
| Deleted Sonic Record Now/ | 2022-03-28 16:40 | - | |
| Dell Exclusivity for ATI9800 to end in 2 days/ | 2022-03-28 16:40 | - | |
| Desperate help on Toshiba Before I Buy/ | 2022-03-28 16:40 | - | |
| Detailed Toshiba NB205 Netbook/ | 2022-03-28 16:40 | - | |
| Device manager - Yellow mark/ | 2022-03-28 16:40 | - | |
| Did Toshiba overclock my laptop/ | 2022-03-28 16:40 | - | |
| Did anyone order their 505-Q885 from Costco/ | 2022-03-28 16:40 | - | |
| Did anyone own a F55-Q502 yet/ | 2022-03-28 16:40 | - | |
| Did anyone receive M100/ | 2022-03-28 16:40 | - | |
| Did you buy a M100/ | 2022-03-28 16:40 | - | |
| Difference Between A500 and A505 Models/ | 2022-03-28 16:40 | - | |
| Difference Between Toshiba Libretto U100 and U105/ | 2022-03-28 16:40 | - | |
| Difference between 1.6 ghz & 1.73 ghz/ | 2022-03-28 16:40 | - | |
| Difference between 2.26 and 2.53/ | 2022-03-28 16:40 | - | |
| Difference between M30 SE and M30X/ | 2022-03-28 16:40 | - | |
| Difference between M640 and M645/ | 2022-03-28 16:40 | - | |
| Difference between Portege A605 and A600/ | 2022-03-28 16:40 | - | |
| Difference between Satellite R830 and Portege R835/ | 2022-03-28 16:40 | - | |
| Different screens used by Toshiba/ | 2022-03-28 16:40 | - | |
| Differing batteries' mAh on a Toshiba A300 series/ | 2022-03-28 16:40 | - | |
| Dilemma (Qosmio G55)/ | 2022-03-28 16:40 | - | |
| Dim Screen - HELP!!/ | 2022-03-28 16:40 | - | |
| Dimensions and or Laptops with this screen Toshiba US- LTD121KA0S/ | 2022-03-28 16:40 | - | |
| Disable Qosmio X70 Soft Keys/ | 2022-03-28 16:40 | - | |
| Disable Toshiba laptop power button/ | 2022-03-28 16:40 | - | |
| Disable password in BIOS on Toshiba portege 2010/ | 2022-03-28 16:40 | - | |
| Disabling Toshiba WebCam (from start-up)/ | 2022-03-28 16:40 | - | |
| Disabling fingerprint scanner/ | 2022-03-28 16:40 | - | |
| Disabling internal mic/ | 2022-03-28 16:40 | - | |
| Disassemble Toshiba M35X -- Now I'm stuck!/ | 2022-03-28 16:40 | - | |
| Disassemble and locate Cmos battery (a135-s2276)/ | 2022-03-28 16:40 | - | |
| Disassemble instructions for Toshiba A205-S5804/ | 2022-03-28 16:40 | - | |
| Disassembling an A70/ | 2022-03-28 16:40 | - | |
| Disassembling the Satellite 1100/ | 2022-03-28 16:40 | - | |
| Discrete graphic card doesnt appear on my Toshiba!/ | 2022-03-28 16:40 | - | |
| Discussions of NB205 Netbooks/ | 2022-03-28 16:40 | - | |
| Disk space used/ | 2022-03-28 16:40 | - | |
| Display Change for a Toshiba Satellite L300-12P/ | 2022-03-28 16:40 | - | |
| Display Problem/ | 2022-03-28 16:40 | - | |
| Display Problem pls help/ | 2022-03-28 16:40 | - | |
| Display Switching/ | 2022-03-28 16:40 | - | |
| Display driver/ | 2022-03-28 16:40 | - | |
| Display driver problem-need help/ | 2022-03-28 16:40 | - | |
| Display faded to black [X205-S9349]/ | 2022-03-28 16:40 | - | |
| Display not readable garbled on Satellite A200-AH1/ | 2022-03-28 16:40 | - | |
| Display problem with Windows/ | 2022-03-28 16:40 | - | |
| Disturbingly loud system beeps/ | 2022-03-28 16:40 | - | |
| Dithering. Am I the only one/ | 2022-03-28 16:40 | - | |
| Dithering on Satellite A200-AH5/ | 2022-03-28 16:40 | - | |
| Do I have a tecra or protege/ | 2022-03-28 16:40 | - | |
| Do NOT buy Toshiba R25 at Amazon/ | 2022-03-28 16:40 | - | |
| Do Not Buy Toshiba!/ | 2022-03-28 16:40 | - | |
| Do Toshiba`s work with a third party PSU/ | 2022-03-28 16:40 | - | |
| Do Toshibas really suck as bad as they say/ | 2022-03-28 16:40 | - | |
| Do all Qosmio X300 X305 have GeForce 9400M GPU/ | 2022-03-28 16:40 | - | |
| Dodgy Matsh!ta DVD drives/ | 2022-03-28 16:40 | - | |
| Does ANYONE have the part # of this SSD cable/ | 2022-03-28 16:40 | - | |
| Does DDR2 Memory work in the m40/ | 2022-03-28 16:40 | - | |
| Does M30-YSJ uses the Dothan CPU/ | 2022-03-28 16:40 | - | |
| Does My Ultrabook Have Enough Processing Power For My Applications/ | 2022-03-28 16:40 | - | |
| Does Portege R835-P81 have dual band wireless/ | 2022-03-28 16:40 | - | |
| Does Qosmio Q850 SSD have TRIM/ | 2022-03-28 16:40 | - | |
| Does Standard Warranty Cover This/ | 2022-03-28 16:40 | - | |
| Does Toshiba A200-ST2041 (customized option) have dual harddrive ability like A205-S4638 1.73ghz one 533fsb abilities/ | 2022-03-28 16:40 | - | |
| Does Toshiba PC Health Monitor slow down computer Also, other preinstalled software questions/ | 2022-03-28 16:40 | - | |
| Does Toshiba Qosmio X505-Q885 play Blu Ray/ | 2022-03-28 16:40 | - | |
| Does Toshiba Satellite A660 have GeForce 300M series problem/ | 2022-03-28 16:40 | - | |
| Does Toshiba X205 SLI work with X7800/ | 2022-03-28 16:40 | - | |
| Does Toshiba do Black Friday Cyber Monday deals/ | 2022-03-28 16:40 | - | |
| Does Toshiba not make Satellite laptops anymore/ | 2022-03-28 16:40 | - | |
| Does Toshiba offer this laptop config/ | 2022-03-28 16:40 | - | |
| Does a Toshiba Satellite-1405-S151 have WiFi/ | 2022-03-28 16:40 | - | |
| Does anybody know P200 still has this option on customized notebooks/ | 2022-03-28 16:40 | - | |
| Does anyone else's/ | 2022-03-28 16:40 | - | |
| Does anyone else experience a Keyboard problem on the X205/ | 2022-03-28 16:40 | - | |
| Does anyone have a disassembly guide or service manual for a P305-S8844/ | 2022-03-28 16:40 | - | |
| Does anyone have a review of the new X305-Q706 system Thank You/ | 2022-03-28 16:40 | - | |
| Does anyone have experience with Toshiba Satellite AW6/ | 2022-03-28 16:40 | - | |
| Does any one have this laptop A355-S6935/ | 2022-03-28 16:40 | - | |
| Does anyone here own the E105 from Bestbuy Do you like it/ | 2022-03-28 16:40 | - | |
| Does anyone know when Sandy Bridge 15.6 Toshibas will be back on the market/ | 2022-03-28 16:40 | - | |
| Does anyone know when the Toshiba's Portégé R700 will be in Canada or if I can get it online now/ | 2022-03-28 16:40 | - | |
| Does anyone own a X300-11S yet/ | 2022-03-28 16:40 | - | |
| Does anyone own a customized P200/ | 2022-03-28 16:40 | - | |
| Does anyone own the Satellite P300 notebook/ | 2022-03-28 16:40 | - | |
| Does anyone own the Toshiba M645-S4080, specifically/ | 2022-03-28 16:40 | - | |
| Does installing Windows 7 RC on my A300 void the warranty/ | 2022-03-28 16:40 | - | |
| Doesn't start with powercable/ | 2022-03-28 16:40 | - | |
| Does running with power cord plugged in reduces the battery life/ | 2022-03-28 16:40 | - | |
| Does some one know how to control the GPU fan in X205/ | 2022-03-28 16:40 | - | |
| Does the 7200mAh battery stick out/ | 2022-03-28 16:40 | - | |
| Does the A215-S7462 support Bluetooth/ | 2022-03-28 16:40 | - | |
| Does the A505-S6965 at BB have a backlit keyboard/ | 2022-03-28 16:40 | - | |
| Does the M45-S359 have bluetooth/ | 2022-03-28 16:40 | - | |
| Does the Qosmio x775-Q7272 come with a Win7 recovery disk/ | 2022-03-28 16:40 | - | |
| Does the SLI1 [& others] have the faulty GPUs/ | 2022-03-28 16:40 | - | |
| Does the Satellite A200-14D mainboard support dual channel memory/ | 2022-03-28 16:40 | - | |
| Does the Toshiba P100-222 have 7900gtx or 7900gs/ | 2022-03-28 16:40 | - | |
| Does the new Toshiba R835 have the same exact keyboard as the R700/ | 2022-03-28 16:40 | - | |
| Does the non-SLI X200 card fit in a X200 with SLI/ | 2022-03-28 16:40 | - | |
| Does this notebook really have an underclocked GPU/ | 2022-03-28 16:40 | - | |
| Does toshiba P300D-151 support RAID/ | 2022-03-28 16:40 | - | |
| Does toshiba direct do special deals via phone/ | 2022-03-28 16:40 | - | |
| Does toshiba have a student discount/ | 2022-03-28 16:40 | - | |
| Don't Ever Repair Your Computer At The Depot!!!/ | 2022-03-28 16:40 | - | |
| Don't buy Toshiba/ | 2022-03-28 16:40 | - | |
| Don't work together - Satellite L450-02T & Agere USB Soft Modem/ | 2022-03-28 16:40 | - | |
| Do not purchase U200 Toshiba laptop/ | 2022-03-28 16:40 | - | |
| Door #1 or door #2/ | 2022-03-28 16:40 | - | |
| Dose your screen ever flicker/ | 2022-03-28 16:40 | - | |
| Dothan CPU/ | 2022-03-28 16:40 | - | |
| Dothan in M30 series/ | 2022-03-28 16:40 | - | |
| Do we need an official XP help thread/ | 2022-03-28 16:40 | - | |
| Downgraded to XP Audio Driver Problem (already searched forum)/ | 2022-03-28 16:40 | - | |
| Downgrading P200 -JS5 to Windows XP X64/ | 2022-03-28 16:40 | - | |
| Downgrading Toshiba Qosmio X300 series from Vista to XP/ | 2022-03-28 16:40 | - | |
| Downgrading from Vista to XP for Toshiba Satellite P105-S6227 Help please!/ | 2022-03-28 16:40 | - | |
| Downgrading from Vista to XP on a Toshiba/ | 2022-03-28 16:40 | - | |
| Downloading Preloaded Software/ | 2022-03-28 16:40 | - | |
| Do you like your Toshiba/ | 2022-03-28 16:40 | - | |
| Do you really think the x205 can run crysis/ | 2022-03-28 16:40 | - | |
| Draft N on X205-Sli notebooks/ | 2022-03-28 16:40 | - | |
| DreamScene Error in A205-S4617/ | 2022-03-28 16:40 | - | |
| Drive D - Inaccessible Incorrect Function/ | 2022-03-28 16:40 | - | |
| Driver Issues/ | 2022-03-28 16:40 | - | |
| Driver Problems/ | 2022-03-28 16:40 | - | |
| Driver Required/ | 2022-03-28 16:40 | - | |
| Driver XP Toshiba A105-SP4081/ | 2022-03-28 16:40 | - | |
| Driver help please!/ | 2022-03-28 16:40 | - | |
| Drivers/ | 2022-03-28 16:40 | - | |
| Drivers Won't Install after Upgrade to XP Pro/ | 2022-03-28 16:40 | - | |
| Drivers for A100/ | 2022-03-28 16:40 | - | |
| Drivers for Satellite A100 R00/ | 2022-03-28 16:40 | - | |
| Drivers for Vista on A135-S4666,which is I need/ | 2022-03-28 16:40 | - | |
| Drivers for XP Install On a X205-SLI1/ | 2022-03-28 16:40 | - | |
| Drivers for the Qosmio X770-107/ | 2022-03-28 16:40 | - | |
| Drivers for toshiba PA3534U-BRS/ | 2022-03-28 16:40 | - | |
| Drivers help... -(/ | 2022-03-28 16:40 | - | |
| Drivers needed for Toshiba Dyabook T6 518CME/ | 2022-03-28 16:40 | - | |
| Drives compatible with the R100/ | 2022-03-28 16:40 | - | |
| Drop in Toshiba BANG/ | 2022-03-28 16:40 | - | |
| Dropped Toshiba Satellite A135-S4467 Won't Boot/ | 2022-03-28 16:40 | - | |
| Dropped a screw into computer/ | 2022-03-28 16:40 | - | |
| Dropping the Hammer!!!/ | 2022-03-28 16:40 | - | |
| Dual Boot With Linux/ | 2022-03-28 16:40 | - | |
| Dual Boot on the X205 - s9349/ | 2022-03-28 16:40 | - | |
| Dual Channel/ | 2022-03-28 16:40 | - | |
| Dual Channel Support/ | 2022-03-28 16:40 | - | |
| Dual NVIDIA GeForce 8600M GT/ | 2022-03-28 16:40 | - | |
| Dual boot Vista 64 bits and XP pro with Qosmio X300 with 2 HD,s/ | 2022-03-28 16:40 | - | |
| Dual booting XP and Vista - HELP PLEASE/ | 2022-03-28 16:40 | - | |
| Dual external monitors on Portege R835/ | 2022-03-28 16:40 | - | |
| Dual lamps on Toshiba Satellite P100 105/ | 2022-03-28 16:40 | - | |
| Dual memory interleave/ | 2022-03-28 16:40 | - | |
| Dual mode pad stopped working!/ | 2022-03-28 16:40 | - | |
| Dual mode touch pad/ | 2022-03-28 16:40 | - | |
| Dumb question about my Qosmio/ | 2022-03-28 16:40 | - | |
| Dvd's sound distorted/ | 2022-03-28 16:40 | - | |
| Dvd drive is gone/ | 2022-03-28 16:40 | - | |
| Dvd sounds funny/ | 2022-03-28 16:40 | - | |
| DynaBook Satellite 1850 sa1200c 4/ | 2022-03-28 16:40 | - | |
| Dynabook Qosimo F50 problem!/ | 2022-03-28 16:40 | - | |
| Dynabook motherboard/ | 2022-03-28 16:40 | - | |
| E105-S1402 Help/ | 2022-03-28 16:40 | - | |
| EA60-173 anybody know it/ | 2022-03-28 16:40 | - | |
| E Electronics Shipping/ | 2022-03-28 16:40 | - | |
| EISA Config Partition/ | 2022-03-28 16:40 | - | |
| ETA on Toshiba Puma Notebooks/ | 2022-03-28 16:40 | - | |
| Eats up Battery/ | 2022-03-28 16:40 | - | |
| Echo effect in A75-S206 speakers/ | 2022-03-28 16:40 | - | |
| Editing Insyde H2O BIOS for L650D-12P to enable Linux/ | 2022-03-28 16:40 | - | |
| Education Discount/ | 2022-03-28 16:40 | - | |
| Eject button on slot load Toshiba U500 series/ | 2022-03-28 16:40 | - | |
| Electrical Problem with a Toshiba Satellite/ | 2022-03-28 16:40 | - | |
| Elegant solution to speaker output in front/ | 2022-03-28 16:40 | - | |
| Empty Compartment/ | 2022-03-28 16:40 | - | |
| Enable ENE CIR for Remote control/ | 2022-03-28 16:40 | - | |
| Enabling AHCI on A305-S6916/ | 2022-03-28 16:40 | - | |
| Entering BIOS on A505-S6965/ | 2022-03-28 16:40 | - | |
| Entry level Toshiba laptop to replace a damaged Dell/ | 2022-03-28 16:40 | - | |
| Equium A60-155 MINI-PCI-WIFI/ | 2022-03-28 16:40 | - | |
| Equium A110 replacement keyboard instructions Anyone/ | 2022-03-28 16:40 | - | |
| Equium A200 constanly losing internet/ | 2022-03-28 16:40 | - | |
| Equium A300D Bios/ | 2022-03-28 16:40 | - | |
| Equium A300 disassembly/ | 2022-03-28 16:40 | - | |
| Equium P200-139/ | 2022-03-28 16:40 | - | |
| Equium hard drive replacement/ | 2022-03-28 16:40 | - | |
| Erorr when installed xp on toshiba a200-p532, with default OS vista home premium/ | 2022-03-28 16:40 | - | |
| Error Message meaning/ | 2022-03-28 16:40 | - | |
| Error Msg iNova_Tabs.ocx/ | 2022-03-28 16:40 | - | |
| Ethernet no longer detected/ | 2022-03-28 16:40 | - | |
| European power adapter question/ | 2022-03-28 16:40 | - | |
| Exchanging laptop display/ | 2022-03-28 16:40 | - | |
| Experiences with the Toshiba M30/ | 2022-03-28 16:40 | - | |
| Experience with r940 r840/ | 2022-03-28 16:40 | - | |
| Experiencing 'Touch Current' while laptop is plugged in/ | 2022-03-28 16:40 | - | |
| ExpressCard Slot/ | 2022-03-28 16:40 | - | |
| ExpressCard Stuck on X200/ | 2022-03-28 16:40 | - | |
| Express Card slot same as Type II PC card/ | 2022-03-28 16:40 | - | |
| ExpressCard to USB3.0 adapter/ | 2022-03-28 16:40 | - | |
| Express Media, and Recovery/ | 2022-03-28 16:40 | - | |
| Express Media Player control keys/ | 2022-03-28 16:40 | - | |
| Express Media Player needed for M45 Laptop/ | 2022-03-28 16:40 | - | |
| Express Media Player recovery problem/ | 2022-03-28 16:40 | - | |
| Extended Battery for Toshiba A135-S4527/ | 2022-03-28 16:40 | - | |
| Extended warranty---change in terms and EXPENSIVE/ | 2022-03-28 16:40 | - | |
| Extended warranty---what is the difference/ | 2022-03-28 16:40 | - | |
| External CD Drive/ | 2022-03-28 16:40 | - | |
| External Display Issues with Satellite 1415-S173/ | 2022-03-28 16:40 | - | |
| External HDD Question/ | 2022-03-28 16:40 | - | |
| External Speakers/ | 2022-03-28 16:40 | - | |
| External Speakers for Qozmio X305-Q701/ | 2022-03-28 16:40 | - | |
| External monitor only shows desktop, please help/ | 2022-03-28 16:40 | - | |
| External monitor viewable during recovery/ | 2022-03-28 16:40 | - | |
| External speakers advice/ | 2022-03-28 16:40 | - | |
| Extra Battery Decision/ | 2022-03-28 16:40 | - | |
| F45-AV425 - HD DVD Playack Issues/ | 2022-03-28 16:40 | - | |
| F50 Question/ | 2022-03-28 16:40 | - | |
| F55-Q502 Thread/ | 2022-03-28 16:40 | - | |
| F55-Q502 coming in Canada/ | 2022-03-28 16:40 | - | |
| F55 vs X305/ | 2022-03-28 16:40 | - | |
| FIX for Toshiba WRONG MACHINE error/ | 2022-03-28 16:40 | - | |
| FM Receiver XP Driver for U405-S2918/ | 2022-03-28 16:40 | - | |
| FN F9 keys/ | 2022-03-28 16:40 | - | |
| FN Keys service/ | 2022-03-28 16:40 | - | |
| FN keys don't work after downgrade to XP Pro SP2/ | 2022-03-28 16:40 | - | |
| FN keys not responding/ | 2022-03-28 16:40 | - | |
| FN works on Vista, only half works on Xp/ | 2022-03-28 16:40 | - | |
| FPS spiking problem/ | 2022-03-28 16:40 | - | |
| FSB 1066 and GFX card upgrade in my laptop/ | 2022-03-28 16:40 | - | |
| Face Recognition/ | 2022-03-28 16:40 | - | |
| Face Recognition question/ | 2022-03-28 16:40 | - | |
| Factory sticker wear/ | 2022-03-28 16:40 | - | |
| Faded fuzzy fonts/ | 2022-03-28 16:40 | - | |
| Failed ConnectionToshiba Satellite Pro L100 to Overhead Projector/ | 2022-03-28 16:40 | - | |
| Failed to ghost my A105-s201!/ | 2022-03-28 16:40 | - | |
| Fan/ | 2022-03-28 16:40 | - | |
| Fan Always Running/ | 2022-03-28 16:40 | - | |
| Fan Control Problems/ | 2022-03-28 16:40 | - | |
| Fan Problem/ | 2022-03-28 16:40 | - | |
| Fan Running Constantly!!/ | 2022-03-28 16:40 | - | |
| Fan Runs Constantly/ | 2022-03-28 16:40 | - | |
| Fan Tweaks for an x305/ | 2022-03-28 16:40 | - | |
| Fan in Satellite M50/ | 2022-03-28 16:40 | - | |
| Fan issue/ | 2022-03-28 16:40 | - | |
| Fan issue with my Toshiba U305/ | 2022-03-28 16:40 | - | |
| Fan problem on M5/ | 2022-03-28 16:40 | - | |
| Fan stuck on High Speed/ | 2022-03-28 16:40 | - | |
| Fastest CPU for Satellite A305-S6905/ | 2022-03-28 16:40 | - | |
| Faulty Graphics card/ | 2022-03-28 16:40 | - | |
| Faulty Processor/ | 2022-03-28 16:40 | - | |
| Faulty screen on Toshiba L20 - screen or ribbon cable/ | 2022-03-28 16:40 | - | |
| Feasable upgrades for the SLI1/ | 2022-03-28 16:40 | - | |
| Feedback on A305 S6845/ | 2022-03-28 16:40 | - | |
| Fellow X205 members...I need a screenshot/ | 2022-03-28 16:40 | - | |
| Ferret Issue/ | 2022-03-28 16:40 | - | |
| Few Questions before reformat P105/ | 2022-03-28 16:40 | - | |
| Few questions about the Satellite M70/ | 2022-03-28 16:40 | - | |
| Few questions about this model C660D-1D3/ | 2022-03-28 16:40 | - | |
| Finally Got it!!! x205-Sli1/ | 2022-03-28 16:40 | - | |
| Finally got the 2gigs into my U200/ | 2022-03-28 16:40 | - | |
| Finding a Toshiba i Australia/ | 2022-03-28 16:40 | - | |
| Finding older Drivers for Protege A100/ | 2022-03-28 16:40 | - | |
| Fingerprint Reader/ | 2022-03-28 16:40 | - | |
| Fingerprint scanner on Qosmio/ | 2022-03-28 16:40 | - | |
| First Impressions - Toshiba NB305 Netbook/ | 2022-03-28 16:40 | - | |
| First Impressions - Toshiba Qosmio X305-Q708/ | 2022-03-28 16:40 | - | |
| First Review of the new Toshiba Qosimo G55/ | 2022-03-28 16:40 | - | |
| Fixed my A105 for 24hrs, then it died again.. related or unrelated/ | 2022-03-28 16:40 | - | |
| Fixing toshibas horrible keyboard layout/ | 2022-03-28 16:40 | - | |
| Fix to R835-Pnn BIOS to support SATA III/ | 2022-03-28 16:40 | - | |
| FlashCards!/ | 2022-03-28 16:40 | - | |
| Flashed bios on M115 now it will not boot/ | 2022-03-28 16:40 | - | |
| Flickering band on monitor of satellite P35-S609/ | 2022-03-28 16:40 | - | |
| Fn Esse Tecra 8200 - LCD Brightness/ | 2022-03-28 16:40 | - | |
| Fn button satellite A205/ | 2022-03-28 16:40 | - | |
| Fn key!/ | 2022-03-28 16:40 | - | |
| Fn keys need reinstallation - Sat Pro M15 - XP Pro SP3/ | 2022-03-28 16:40 | - | |
| For All toshiba p105-s9722 owners! help mee/ | 2022-03-28 16:40 | - | |
| For Qosmio X300 X305 Owners/ | 2022-03-28 16:40 | - | |
| For Toshiba Tecra M3 owners/ | 2022-03-28 16:40 | - | |
| For all M100-JG2 or plain M100 owners/ | 2022-03-28 16:40 | - | |
| For anyone changing from Vista to XP- READ THIS!!/ | 2022-03-28 16:40 | - | |
| ForceWare X 163.67/ | 2022-03-28 16:40 | - | |
| Forcing 64-bit Windows 7 installation/ | 2022-03-28 16:40 | - | |
| Format/ | 2022-03-28 16:40 | - | |
| Format Help/ | 2022-03-28 16:40 | - | |
| Formated HDD problems - Sat. A665-S6094/ | 2022-03-28 16:40 | - | |
| Formatting a X205-S9800/ | 2022-03-28 16:40 | - | |
| For my needs (might be a new question!)/ | 2022-03-28 16:40 | - | |
| Found!! XP Drivers for my A205/ | 2022-03-28 16:40 | - | |
| Found X500 disassemble manual/ | 2022-03-28 16:40 | - | |
| Four year old L15 S104 display deador dying/ | 2022-03-28 16:40 | - | |
| Freakin Stupid Best Buy/ | 2022-03-28 16:40 | - | |
| Free HDDVD's deal in the UK/ | 2022-03-28 16:40 | - | |
| Free Toshiba Notebook Computer !/ | 2022-03-28 16:40 | - | |
| Fresh Install Vista Need Some Drivers Now/ | 2022-03-28 16:40 | - | |
| Fresh Install of XP MCE/ | 2022-03-28 16:40 | - | |
| Fresh OS Install/ | 2022-03-28 16:40 | - | |
| Fresh install on Qosmio, now DVD-BR drive doesn't work/ | 2022-03-28 16:40 | - | |
| Frustrated, if you can help PLEASE DO/ | 2022-03-28 16:40 | - | |
| Frustrated M40 owner/ | 2022-03-28 16:40 | - | |
| Full Fan Speed After Resume From S3 (Stand By)/ | 2022-03-28 16:40 | - | |
| Function Key Question/ | 2022-03-28 16:40 | - | |
| Function Keys not working - Vista/ | 2022-03-28 16:40 | - | |
| Funny spelling error on Toshiba ad/ | 2022-03-28 16:40 | - | |
| Future Shop's return policy on notebooks/ | 2022-03-28 16:40 | - | |
| Fuzzy Green dots on x205/ | 2022-03-28 16:40 | - | |
| G-15 screen problem/ | 2022-03-28 16:40 | - | |
| G-25 issues/ | 2022-03-28 16:40 | - | |
| G25- av513 Power Questions/ | 2022-03-28 16:40 | - | |
| G55 - Availability mid August or Sooner/ | 2022-03-28 16:40 | - | |
| G55-Q802 processor question/ | 2022-03-28 16:40 | - | |
| GAMERS- It's official, VISTA sucks!/ | 2022-03-28 16:40 | - | |
| GPU Overclocking Sli3/ | 2022-03-28 16:40 | - | |
| GPU fan monitor software for Toshiba X205/ | 2022-03-28 16:40 | - | |
| GPU physics on SLi models/ | 2022-03-28 16:40 | - | |
| GPU temp- 103 degrees C- Toshiba p100-ST9012/ | 2022-03-28 16:40 | - | |
| GT330M Bug Report (Like Tosh A500)/ | 2022-03-28 16:40 | - | |
| GTA 4 problem/ | 2022-03-28 16:40 | - | |
| GTX460M need question answered please/ | 2022-03-28 16:40 | - | |
| GTX 560M Throttling/ | 2022-03-28 16:40 | - | |
| GUIDE- Replacing optical drive bay on Portege R835-P56X with HDD Caddy/ | 2022-03-28 16:40 | - | |
| Games Studder/ | 2022-03-28 16:40 | - | |
| Games tested on the R100/ | 2022-03-28 16:40 | - | |
| Games with black bars in windows 7 ati hd2400/ | 2022-03-28 16:40 | - | |
| Gaming , Multimedia Laptop/ | 2022-03-28 16:40 | - | |
| Gaming/ | 2022-03-28 16:40 | - | |
| Gaming Laptopn ( P105 Series) and Gaming CD's promotion/ | 2022-03-28 16:40 | - | |
| Gaming on Satellite Pro L500-1VT/ | 2022-03-28 16:40 | - | |
| GeForce Go 6600 driver = SOS HELP -'(/ | 2022-03-28 16:40 | - | |
| Gears of War on X205-s9359/ | 2022-03-28 16:40 | - | |
| General Maintenance of Screen n Cover/ | 2022-03-28 16:40 | - | |
| Getting 2nd HDD connections in Toshiba/ | 2022-03-28 16:40 | - | |
| Getting HDMI output from A300 A305/ | 2022-03-28 16:40 | - | |
| Getting ready to buy a M100-ST5111/ | 2022-03-28 16:40 | - | |
| Getting rid of that high pitch noise/ | 2022-03-28 16:40 | - | |
| Getting the new Toshiba Qosmio X505-Q850/ | 2022-03-28 16:40 | - | |
| Getting this (Toshiba) delivered to Canada/ | 2022-03-28 16:40 | - | |
| Ghost Image/ | 2022-03-28 16:40 | - | |
| Gift for my Boy frined bf/ | 2022-03-28 16:40 | - | |
| Girlfriend broke it, I have to fix it/ | 2022-03-28 16:40 | - | |
| Glare issues on the M35M30 with Trubrite/ | 2022-03-28 16:40 | - | |
| Going To buy a Toshiba SK9/ | 2022-03-28 16:40 | - | |
| Going to play battlefield 3 Alpha on Qosmio/ | 2022-03-28 16:40 | - | |
| Going with tablet/ | 2022-03-28 16:40 | - | |
| Good Briefcase for the 18.4 inch Qosmios/ | 2022-03-28 16:40 | - | |
| Good Deal for Tecra M2 (Double topic sorry)/ | 2022-03-28 16:40 | - | |
| Good Deals on M30 M35 Batteries/ | 2022-03-28 16:40 | - | |
| Good Stable overclocks GTX 460m X505/ | 2022-03-28 16:40 | - | |
| Good Toshiba Experiences/ | 2022-03-28 16:40 | - | |
| Good buy/ | 2022-03-28 16:40 | - | |
| Good deal on X505/ | 2022-03-28 16:40 | - | |
| Good deals on Dual GeForce 8600M GT/ | 2022-03-28 16:40 | - | |
| Good place to buy Toshiba replacement parts/ | 2022-03-28 16:40 | - | |
| Good to plug battery in and out/ | 2022-03-28 16:40 | - | |
| Got Tweak Happy , screwed up DVD Drive/ | 2022-03-28 16:40 | - | |
| Got a Satellite P305/ | 2022-03-28 16:40 | - | |
| Got my P100, some pics/ | 2022-03-28 16:40 | - | |
| Got some questions about a SSD/ | 2022-03-28 16:40 | - | |
| Go with M40 or M45/ | 2022-03-28 16:40 | - | |
| Graphic Card Quality of Toshiba/ | 2022-03-28 16:40 | - | |
| Graphic check/ | 2022-03-28 16:40 | - | |
| Graphics Card Upgrade/ | 2022-03-28 16:40 | - | |
| Graphics Card for Laptop/ | 2022-03-28 16:40 | - | |
| Graphics Problems. Black dots & Green Streaks/ | 2022-03-28 16:40 | - | |
| Graphics card impossible/ | 2022-03-28 16:40 | - | |
| Graphics cards/ | 2022-03-28 16:40 | - | |
| Graphics on P205/ | 2022-03-28 16:40 | - | |
| Graphics question about the Protege R835-P56X/ | 2022-03-28 16:40 | - | |
| Graphics stuttering in XP on p105-s9312/ | 2022-03-28 16:40 | - | |
| Great computer configuration/ | 2022-03-28 16:40 | - | |
| Great experience with hitachi 7200rpm upgrade/ | 2022-03-28 16:40 | - | |
| Guarantee/ | 2022-03-28 16:40 | - | |
| HD-DVD dead, I want BLURAY on my x205-sli1/ | 2022-03-28 16:40 | - | |
| HD-DVD to dark on tv/ | 2022-03-28 16:40 | - | |
| HD Caddy recommendation for Toshiba M645/ | 2022-03-28 16:40 | - | |
| HDD Password Support/ | 2022-03-28 16:40 | - | |
| HDDVD Drive x205-S9349/ | 2022-03-28 16:40 | - | |
| HD DVD Player and SLI ERROR/ | 2022-03-28 16:40 | - | |
| HD DVD software help/ | 2022-03-28 16:40 | - | |
| HDD compartment screw is shot/ | 2022-03-28 16:40 | - | |
| HDD protection issue/ | 2022-03-28 16:40 | - | |
| HDD recovery/ | 2022-03-28 16:40 | - | |
| HDD upgrade compatibility/ | 2022-03-28 16:40 | - | |
| HDMI Problems/ | 2022-03-28 16:40 | - | |
| HDMI help please!/ | 2022-03-28 16:40 | - | |
| HDMI out not working in R835-P56x/ | 2022-03-28 16:40 | - | |
| HDMI use on an A305/ | 2022-03-28 16:40 | - | |
| HD crashed Pl help/ | 2022-03-28 16:40 | - | |
| HEADS UP ON hitachi 7K200/ | 2022-03-28 16:40 | - | |
| HEAT ISSUES on M645-S4050/ | 2022-03-28 16:40 | - | |
| HEAT in satellite P105-s9722 laptop/ | 2022-03-28 16:40 | - | |
| HELP!!! Disassembled laptop now screen doesn't work!!!/ | 2022-03-28 16:40 | - | |
| HELP!/ | 2022-03-28 16:40 | - | |
| HELP! New problem with Satellite M45-S169/ | 2022-03-28 16:40 | - | |
| HELP! Restore for a Satellite A215-S6820 Key/ | 2022-03-28 16:40 | - | |
| HELP! T115D-S1120 needs a new AC adapter/ | 2022-03-28 16:40 | - | |
| HELP! Toshiba T235-S1350 Bloatware Removal/ | 2022-03-28 16:40 | - | |
| HELP! Weird false-hanging computer ! !/ | 2022-03-28 16:40 | - | |
| HELP - Hardware Problem/ | 2022-03-28 16:40 | - | |
| HELP-How can I separate c driver Thx!/ | 2022-03-28 16:40 | - | |
| HELP - Is this an A300D/ | 2022-03-28 16:40 | - | |
| HELP- Toshiba Portege R100 Screen quality/ | 2022-03-28 16:40 | - | |
| HELP. Toshiba Portege R835-P50x cooling fan issue/ | 2022-03-28 16:40 | - | |
| HELP Blue Screen of Death/ | 2022-03-28 16:40 | - | |
| HELP ME PLEASE A25-S3072 Green pixels/ | 2022-03-28 16:40 | - | |
| HELP ME Toshiba Satellite M115-S3094/ | 2022-03-28 16:40 | - | |
| HELP PLS - which otherToshiba Model uses same HDD as Portege R700 14M/ | 2022-03-28 16:40 | - | |
| HELP Problem with my X205-S9359/ | 2022-03-28 16:40 | - | |
| HELP Toshiba A105 S4094/ | 2022-03-28 16:40 | - | |
| HELP locked x205-sli1/ | 2022-03-28 16:40 | - | |
| HELP me !! i have a laptop i was given .but they forgot the bios password/ | 2022-03-28 16:40 | - | |
| HELP qosmio g35 AV600/ | 2022-03-28 16:40 | - | |
| HELP to remove keyboard of Satellite P15-S420/ | 2022-03-28 16:40 | - | |
| HM65 and recalls/ | 2022-03-28 16:40 | - | |
| HORRIBLE Warranty Repair service from Toshiba/ | 2022-03-28 16:40 | - | |
| HP ZT3000/ | 2022-03-28 16:40 | - | |
| H W Help with Toshiba Satellite P35/ | 2022-03-28 16:40 | - | |
| Had a Qosmio F10.. Replacement with P100-MA6/ | 2022-03-28 16:40 | - | |
| Hands on Qosmio Demo In NYC/ | 2022-03-28 16:40 | - | |
| Hard-Drive Help/ | 2022-03-28 16:40 | - | |
| Hard Disk Drive Recovery/ | 2022-03-28 16:40 | - | |
| Hard Drive Capacity/ | 2022-03-28 16:40 | - | |
| Hard Drive Disk Capacity/ | 2022-03-28 16:40 | - | |
| Hard Drive Replacement Question/ | 2022-03-28 16:40 | - | |
| Hard Drive detector/ | 2022-03-28 16:40 | - | |
| Hard drive upgrade/ | 2022-03-28 16:40 | - | |
| Hard drive upgrade for A215-S7462/ | 2022-03-28 16:40 | - | |
| Hard shutdown after resuming from Sleep/ | 2022-03-28 16:40 | - | |
| Hard to install a second hard drive/ | 2022-03-28 16:40 | - | |
| Hardware question. Toshiba Satellite - M35x series/ | 2022-03-28 16:40 | - | |
| Harman Kardon Speakers on M and A Satellite Series/ | 2022-03-28 16:40 | - | |
| Has ANYONE had dead pixels on LCD/ | 2022-03-28 16:40 | - | |
| Has anybody replaced a Toshiba hinge (speaking about the models with 1 single hinge)/ | 2022-03-28 16:40 | - | |
| Has anybody tried to upgrade the CPU on Toshiba Satellite A500-17X/ | 2022-03-28 16:40 | - | |
| Has anyone dealt with the website pcdirectnet.com/ | 2022-03-28 16:40 | - | |
| Has anyone dropped a Meron core (64bit Core 2 Duo) CPU into their Qosmio G35 AV600/ | 2022-03-28 16:40 | - | |
| Has anyone installed new Intel X3100 driver/ | 2022-03-28 16:40 | - | |
| Has anyone installed or tried to Install Windows 7 on recent Toshiba machines that came with Win 8 or 8.1/ | 2022-03-28 16:40 | - | |
| Has anyone replace the SD card slot on an L850/ | 2022-03-28 16:40 | - | |
| Has anyone reviewed the Tecra S3 yet/ | 2022-03-28 16:40 | - | |
| Has anyone run into this problem/ | 2022-03-28 16:40 | - | |
| Has anyone tried any games on the A105-S101/ | 2022-03-28 16:40 | - | |
| Has anyone tried installing a 2nd HDD in a Satellite A205 or P205/ | 2022-03-28 16:40 | - | |
| Has anyone undervolted A210-11P Good results/ | 2022-03-28 16:40 | - | |
| Has the M30-742 Wireless ON led indicator/ | 2022-03-28 16:40 | - | |
| Hate Vista, Cant find XP drivers Satellite A305D-S6848/ | 2022-03-28 16:40 | - | |
| Have a Toshiba with Video Problems in Vista Post here!/ | 2022-03-28 16:40 | - | |
| Have an old Tecra, quick question/ | 2022-03-28 16:40 | - | |
| Have i chosen the right Laptop (Toshiba Satellite A305-S6861)/ | 2022-03-28 16:40 | - | |
| Have the new A70's been fixed ML1 KM2/ | 2022-03-28 16:40 | - | |
| Have to choose between P100-MA6 and A100-VA9/ | 2022-03-28 16:40 | - | |
| Have to restart to have notebook recognize 2nd monitor/ | 2022-03-28 16:40 | - | |
| Having Problems with my Toshiba Satellite/ | 2022-03-28 16:40 | - | |
| Headphone Jack Buzzing - help!/ | 2022-03-28 16:40 | - | |
| Heads up - Dust your Qosmio X775(and any performer laptop)/ | 2022-03-28 16:40 | - | |
| Heat at Toshiba M30 35 series/ | 2022-03-28 16:40 | - | |
| Heating Problem/ | 2022-03-28 16:40 | - | |
| Heatsink compatibility on Toshiba Satellite A660-042/ | 2022-03-28 16:40 | - | |
| Hello M100 owners. (time remaining problem)/ | 2022-03-28 16:40 | - | |
| Hello from Argentina, Ushuaia/ | 2022-03-28 16:40 | - | |
| Help!!!!!!!!!!!/ | 2022-03-28 16:40 | - | |
| Help!!!!!! Help!!!!!/ | 2022-03-28 16:40 | - | |
| Help!!!A135 S4666/ | 2022-03-28 16:40 | - | |
| Help!! A215 Webcam Problems!!!/ | 2022-03-28 16:40 | - | |
| Help!! I have retarded questions!/ | 2022-03-28 16:40 | - | |
| Help!! Satelite freezes on start up/ | 2022-03-28 16:40 | - | |
| Help!! Toshiba nb205 wont boot, Black screen/ | 2022-03-28 16:40 | - | |
| Help!! Video Controller (VGA) Drivers (X205).. Blue screen of death.. etc/ | 2022-03-28 16:40 | - | |
| Help!...M30X or Qosimo/ | 2022-03-28 16:40 | - | |
| Help! I'm stuck/ | 2022-03-28 16:40 | - | |
| Help! Installing Vertex 3 on my Portege R835/ | 2022-03-28 16:40 | - | |
| Help! Installing an SSD on a R835-P56x/ | 2022-03-28 16:40 | - | |
| Help! Laptop Screen Turn off at Random/ | 2022-03-28 16:40 | - | |
| Help! Lost recovery disk INSIDE Qosmio!/ | 2022-03-28 16:40 | - | |
| Help! M70 won't go in standby!/ | 2022-03-28 16:40 | - | |
| Help! My Sattelite L40D's gpu is crashing/ | 2022-03-28 16:40 | - | |
| Help! My Toshiba locked me out!/ | 2022-03-28 16:40 | - | |
| Help! My fan won't shutup!!!!/ | 2022-03-28 16:40 | - | |
| Help! Satellite M100 battery not charging !/ | 2022-03-28 16:40 | - | |
| Help! Toshiba M30 LCD Screen blanked-out/ | 2022-03-28 16:40 | - | |
| Help! Toshiba Satellite A205 XP downgrade/ | 2022-03-28 16:40 | - | |
| Help! Upgrading the video driver on Toshiba Qosmio G35-AV650 makes only part of desktop appear!/ | 2022-03-28 16:40 | - | |
| Help! WinXP Drivers for A350-04T/ | 2022-03-28 16:40 | - | |
| Help! Z repeats/ | 2022-03-28 16:40 | - | |
| Help, DVD write error/ | 2022-03-28 16:40 | - | |
| Help, I broke my Satellite LCD!/ | 2022-03-28 16:40 | - | |
| Help, Unmountable Boot Volume Win XP/ | 2022-03-28 16:40 | - | |
| Help, black screen....ugh!/ | 2022-03-28 16:40 | - | |
| Help, buying laptop, don't know what to get/ | 2022-03-28 16:40 | - | |
| Help, i need texas instruments flasmedia driver/ | 2022-03-28 16:40 | - | |
| Help , toshiba P30 order/ | 2022-03-28 16:40 | - | |
| Help, toshiba satellite 1800-700/ | 2022-03-28 16:40 | - | |
| Help - Browsers Won't Work!/ | 2022-03-28 16:40 | - | |
| Help- Color Brightness Lowers After Start/ | 2022-03-28 16:40 | - | |
| Help- Debating Upgrade - Dell T2400 & Toshiba T5200/ | 2022-03-28 16:40 | - | |
| Help - L355D totally dead after short storage/ | 2022-03-28 16:40 | - | |
| Help-Line in mic will not work/ | 2022-03-28 16:40 | - | |
| Help-My new X205-SLi4 gets blue screen error/ | 2022-03-28 16:40 | - | |
| Help- Newbie,Is it a good notebook/ | 2022-03-28 16:40 | - | |
| Help - Toshiba Satellite L650/ | 2022-03-28 16:40 | - | |
| Help- Toshiba Satellite P55T 4K Ultra HD Touchscreen- P55T-B5235- Device Driver Support for Windows 7 vs Windows 8 and 8.1/ | 2022-03-28 16:40 | - | |
| Help- Windows 7 video controller driver for old Satellite/ | 2022-03-28 16:40 | - | |
| Help- laptop won't power-up/ | 2022-03-28 16:40 | - | |
| Help. Where do I begin Just bought a Satellite and have no clue what to do next/ | 2022-03-28 16:40 | - | |
| Help/ | 2022-03-28 16:40 | - | |
| Help Deciding - need opinions on the e205 keyboard/ | 2022-03-28 16:40 | - | |
| Help For A A205-7466 SATA Driver/ | 2022-03-28 16:40 | - | |
| Help Format/ | 2022-03-28 16:40 | - | |
| Help Identifying an Old Toshiba Laptop/ | 2022-03-28 16:40 | - | |
| Help Me Upgrade my X205-Sli1/ | 2022-03-28 16:40 | - | |
| Help Me_Toshiba for $600-$800 in the AsiaPacific region. Please suggest one for me/ | 2022-03-28 16:40 | - | |
| Help Me find Driver for VGA for Satellite m200 A432/ | 2022-03-28 16:40 | - | |
| Help Me with my monitor Please/ | 2022-03-28 16:40 | - | |
| Help Please/ | 2022-03-28 16:40 | - | |
| Help Please/ | 2022-03-28 16:40 | - | |
| Help Please Toshiba M105-S3004/ | 2022-03-28 16:40 | - | |
| Help Reformatting a Satellite M305D-S4830/ | 2022-03-28 16:40 | - | |
| Help With BSOD satellite A70/ | 2022-03-28 16:40 | - | |
| Help With My X205!!!!!!/ | 2022-03-28 16:40 | - | |
| Help With My X205!!!/ | 2022-03-28 16:40 | - | |
| Help With Satellite 2455-S305/ | 2022-03-28 16:40 | - | |
| Help [lots of it] to install a HDD then XP in SLi1/ | 2022-03-28 16:40 | - | |
| Help a newbie to tweak his x200 x205!/ | 2022-03-28 16:40 | - | |
| Help choosing battery for toshiba a105 s1712/ | 2022-03-28 16:40 | - | |
| Help find alternative!/ | 2022-03-28 16:40 | - | |
| Help finding a 14-14.1 toshiba notebook/ | 2022-03-28 16:40 | - | |
| Help finding a removed program/ | 2022-03-28 16:40 | - | |
| Help going wireless/ | 2022-03-28 16:40 | - | |
| Help help...find driver CX 47EE Toshiba for WinXP/ | 2022-03-28 16:40 | - | |
| Help identifying toshiba model number P100-801/ | 2022-03-28 16:40 | - | |
| Help installing FW169.01 on X200 8700GT!/ | 2022-03-28 16:40 | - | |
| Help installing new hard drive & BIOS/ | 2022-03-28 16:40 | - | |
| Help lcd of my toshiba r100 broke!-(/ | 2022-03-28 16:40 | - | |
| Help me! Toshiba satellite L310 bios recovery (Phoenix)/ | 2022-03-28 16:40 | - | |
| Help me! urgent, Bios problem/ | 2022-03-28 16:40 | - | |
| Help me choose between 2 or 3 laptops (r500 or r600)/ | 2022-03-28 16:40 | - | |
| Help me identify this Toshiba/ | 2022-03-28 16:40 | - | |
| Help me out/ | 2022-03-28 16:40 | - | |
| Help me please !!!/ | 2022-03-28 16:40 | - | |
| Help my Toshiba stopped working/ | 2022-03-28 16:40 | - | |
| Help needed on A200 BIOS/ | 2022-03-28 16:40 | - | |
| Help needed on TRAP C0000005 Exception/ | 2022-03-28 16:40 | - | |
| Help please! Can't reinstall Vista on satellite a200/ | 2022-03-28 16:40 | - | |
| Help please! Can't write to CD on A105-S4334/ | 2022-03-28 16:40 | - | |
| Help please- How to install BIOS updates/ | 2022-03-28 16:40 | - | |
| Help please- Toshiba L35-S2151 not working with 1.5GB RAM/ | 2022-03-28 16:40 | - | |
| Help please - Toshiba fingerprint scanner & password/ | 2022-03-28 16:40 | - | |
| Help plz... how to upgrade memory on M55/ | 2022-03-28 16:40 | - | |
| Help plz with Toshiba Satellite A10/ | 2022-03-28 16:40 | - | |
| Helppppppp plz/ | 2022-03-28 16:40 | - | |
| Help problems downloading/ | 2022-03-28 16:40 | - | |
| Help remove DVD drive on P105/ | 2022-03-28 16:40 | - | |
| Help removing Satellite R-15 S829 plastic center panel/ | 2022-03-28 16:40 | - | |
| Help spill on A500 now wont turn on/ | 2022-03-28 16:40 | - | |
| Help w A25 S207/ | 2022-03-28 16:40 | - | |
| Help with Bluetooth functionality!/ | 2022-03-28 16:40 | - | |
| Help with Internet Help/ | 2022-03-28 16:40 | - | |
| Help with Satellite A135-S4677 - WinXP/ | 2022-03-28 16:40 | - | |
| Help with Satellite Pro A10/ | 2022-03-28 16:40 | - | |
| Help with Toshiba DVD RAM -(/ | 2022-03-28 16:40 | - | |
| Help with Toshiba L300-EZ1004X power jack/ | 2022-03-28 16:40 | - | |
| Help with Toshiba Portege R835-P56X/ | 2022-03-28 16:40 | - | |
| Help with Toshiba Qosmio/ | 2022-03-28 16:40 | - | |
| Help with Toshiba Qosmio F20 - TV recording/ | 2022-03-28 16:40 | - | |
| Help with Toshiba Satelite A135-S4527/ | 2022-03-28 16:40 | - | |
| Help with Toshiba Satellite 2435-S255/ | 2022-03-28 16:40 | - | |
| Help with Toshiba Satellite T235-S1350/ | 2022-03-28 16:40 | - | |
| Help with Toshiba Satellite T235D-S1350/ | 2022-03-28 16:40 | - | |
| Help with Toshiba T4600C Laptop/ | 2022-03-28 16:40 | - | |
| Help with Toshiba X205 SLi1/ | 2022-03-28 16:40 | - | |
| Help with U205-S5002 Boot up/ | 2022-03-28 16:40 | - | |
| Help with X205 crashes and bios beeps/ | 2022-03-28 16:40 | - | |
| Help with a Satellite L20/ | 2022-03-28 16:40 | - | |
| Help with a decision, please...(long)/ | 2022-03-28 16:40 | - | |
| Help with a mem upgrade on a satellite/ | 2022-03-28 16:40 | - | |
| Help with internal harddrive/ | 2022-03-28 16:40 | - | |
| Help with laptop/ | 2022-03-28 16:40 | - | |
| Help with locating M45 Wallpaper/ | 2022-03-28 16:40 | - | |
| Help with my P20- Screen blank!!/ | 2022-03-28 16:40 | - | |
| Help with my Satellite/ | 2022-03-28 16:40 | - | |
| Help with ram on toshiba satellite L300/ | 2022-03-28 16:40 | - | |
| Help with satellite pro m70. Not booting/ | 2022-03-28 16:40 | - | |
| Here is my laptop, quick question/ | 2022-03-28 16:40 | - | |
| Hey - I know this is a Toshiba - but just letting you guys know if you didn't see it --/ | 2022-03-28 16:40 | - | |
| Hibernate immediately restarts the computer/ | 2022-03-28 16:40 | - | |
| High Brightness VS Normal/ | 2022-03-28 16:40 | - | |
| Highest GPU overclocks/ | 2022-03-28 16:40 | - | |
| High pitched noise, cant get rid of it/ | 2022-03-28 16:40 | - | |
| Hinge screw loose on NB505/ | 2022-03-28 16:40 | - | |
| Hitachi 60GB 7200 RPM HD in M35/ | 2022-03-28 16:40 | - | |
| H key pops/ | 2022-03-28 16:40 | - | |
| Hooking up to TV via HDMI/ | 2022-03-28 16:40 | - | |
| Horizontal line running across the bottom of the screen/ | 2022-03-28 16:40 | - | |
| Horrible service - What should I do/ | 2022-03-28 16:40 | - | |
| Hot Key - Fn-Esse/ | 2022-03-28 16:40 | - | |
| Hot Key for Touchpad not working after XP install/ | 2022-03-28 16:40 | - | |
| How's your P100-ST9012/ | 2022-03-28 16:40 | - | |
| How2 Order Recovery Disk/ | 2022-03-28 16:40 | - | |
| How Are You Guys Liking The Toshiba Satellite L300-04N/ | 2022-03-28 16:40 | - | |
| How Disarming Toshiba G50 12H/ | 2022-03-28 16:40 | - | |
| How Do You Do A Fresh Install For The Toshiba Satellites/ | 2022-03-28 16:40 | - | |
| How Do You Monitor Control Fanspeed Check Temps/ | 2022-03-28 16:40 | - | |
| How Many of ya have Toshiba Satellite Laptop/ | 2022-03-28 16:40 | - | |
| How To Backup Software a100-496/ | 2022-03-28 16:40 | - | |
| How To Open JPGENX files on a Toshiba/ | 2022-03-28 16:40 | - | |
| How about Toshiba/ | 2022-03-28 16:40 | - | |
| How about this model P305-S8909/ | 2022-03-28 16:40 | - | |
| How can I create partitions/ | 2022-03-28 16:40 | - | |
| How can I improve Battery Life in a P100-SD3 or A100-SK8...anything bad with these 2/ | 2022-03-28 16:40 | - | |
| How can I improve the sound of my Toshiba Qosmio F25/ | 2022-03-28 16:40 | - | |
| How can I know the Model No. of the Toshiba motherboard of my latop/ | 2022-03-28 16:40 | - | |
| How can I remove bloatware from new a605/ | 2022-03-28 16:40 | - | |
| How can I set RAM to 533MHz/ | 2022-03-28 16:40 | - | |
| How can Toshibadirect.com charge tax/ | 2022-03-28 16:40 | - | |
| How can i remove the hdd from x200/ | 2022-03-28 16:40 | - | |
| How can keyboards be so different/ | 2022-03-28 16:40 | - | |
| How can you guys use Toshiba Satellite A100 VA9 or TA9 i cant!!/ | 2022-03-28 16:40 | - | |
| How can you test each GPU separately/ | 2022-03-28 16:40 | - | |
| How do I adjust brightness when a function key doesn't work/ | 2022-03-28 16:40 | - | |
| How do I change from single to dual channel/ | 2022-03-28 16:40 | - | |
| How do I clone drive of a215/ | 2022-03-28 16:40 | - | |
| How do I disable boot password/ | 2022-03-28 16:40 | - | |
| How do I disable fast boot, x775-3dv78/ | 2022-03-28 16:40 | - | |
| How do I disassemble the U200/ | 2022-03-28 16:40 | - | |
| How do I get Toshiba to hibernate/ | 2022-03-28 16:40 | - | |
| How do I get the 2-day free shipping/ | 2022-03-28 16:40 | - | |
| How do I improve my x205 s7483/ | 2022-03-28 16:40 | - | |
| How do I install windows 7 Complicated partition/ | 2022-03-28 16:40 | - | |
| How do I overclock a Toshiba a210-11p/ | 2022-03-28 16:40 | - | |
| How do I reformat Satellite M45-S165 without a recovery CD/ | 2022-03-28 16:40 | - | |
| How do I save my files before my laptop dies completely/ | 2022-03-28 16:40 | - | |
| How do I start the Power Saver program/ | 2022-03-28 16:40 | - | |
| How do I tune my harman speaker like this (Bass & Beauty)/ | 2022-03-28 16:40 | - | |
| How does FarCry2 run on the SLi1/ | 2022-03-28 16:40 | - | |
| How does accupoint (trackpoint) in toshiba laptop feel/ | 2022-03-28 16:40 | - | |
| How does this model compare to an m11x/ | 2022-03-28 16:40 | - | |
| How do i open my A-75/ | 2022-03-28 16:40 | - | |
| How do you Reformat Qosmio X505 Series/ | 2022-03-28 16:40 | - | |
| How do you feel about the Satellite L500D-ST2531/ | 2022-03-28 16:40 | - | |
| How do you install the Toshiba Satelite 1550 floppy drive in Toshiba Tecra/ | 2022-03-28 16:40 | - | |
| How do you open x775-3dv78's back plate/ | 2022-03-28 16:40 | - | |
| How do you pronounce the word Qosmio/ | 2022-03-28 16:40 | - | |
| How do you update the Drivers on the Qosmio/ | 2022-03-28 16:40 | - | |
| How easy is it to put in a new HD/ | 2022-03-28 16:40 | - | |
| How fast is/ | 2022-03-28 16:40 | - | |
| How good are the Toshiba R480 speakers/ | 2022-03-28 16:40 | - | |
| How good is toshiba m500/ | 2022-03-28 16:40 | - | |
| How is Toshiba's return policy/ | 2022-03-28 16:40 | - | |
| How is Toshiba Satellite L50- X5315/ | 2022-03-28 16:40 | - | |
| How is Toshiba notebooks compared to Sony's/ | 2022-03-28 16:40 | - | |
| How is this Toshiba deal on Tecra A4/ | 2022-03-28 16:40 | - | |
| How much can I sell this Toshiba for/ | 2022-03-28 16:40 | - | |
| How much could I sell a Portege 3440CT for/ | 2022-03-28 16:40 | - | |
| How often do Toshibas get back to warranty fix/ | 2022-03-28 16:40 | - | |
| How quick is Toshiba with offering new video cards/ | 2022-03-28 16:40 | - | |
| How reliable are toshiba HDs/ | 2022-03-28 16:40 | - | |
| Hows this Qosmio/ | 2022-03-28 16:40 | - | |
| How to- Update your Toshiba's Video drivers/ | 2022-03-28 16:40 | - | |
| How to Convert HD Video Between HD Video and General Video/ | 2022-03-28 16:40 | - | |
| How to Install XP in C partition via recovery CD- Toshiba Satellite M70/ | 2022-03-28 16:40 | - | |
| How to Satellite L750 BIOS update/ | 2022-03-28 16:40 | - | |
| How to access Tecra S3 bios/ | 2022-03-28 16:40 | - | |
| How to activate bloototh on X200 sli 3(x205 sli)/ | 2022-03-28 16:40 | - | |
| How to add more memory to M115-S3094/ | 2022-03-28 16:40 | - | |
| How to boot from a Ghost boot floppy disk/ | 2022-03-28 16:40 | - | |
| How to burn recovery disks/ | 2022-03-28 16:40 | - | |
| How to calibrate screen X500(x505)/ | 2022-03-28 16:40 | - | |
| How to change P15 series HD/ | 2022-03-28 16:40 | - | |
| How to change language in BIOS/ | 2022-03-28 16:40 | - | |
| How to change windows language on Satellite a100/ | 2022-03-28 16:40 | - | |
| How to clean an A300 fan (disassemble)/ | 2022-03-28 16:40 | - | |
| How to connect Toshiba Tecra A6 to TV/ | 2022-03-28 16:40 | - | |
| How to contact Corporate and get help/ | 2022-03-28 16:40 | - | |
| How to contact Toshiba by email/ | 2022-03-28 16:40 | - | |
| How to disable card reader in toshiba notebook/ | 2022-03-28 16:40 | - | |
| How to disable touch pad/ | 2022-03-28 16:40 | - | |
| How to disassemble T5200/ | 2022-03-28 16:40 | - | |
| How to disassemble Toshiba Laptops/ | 2022-03-28 16:40 | - | |
| How to disassemble the R600 (R500 data doesn't help)/ | 2022-03-28 16:40 | - | |
| How to do a clean reformat/ | 2022-03-28 16:40 | - | |
| How to do with my old Satellite 3000/ | 2022-03-28 16:40 | - | |
| How to downgarde vista to XP Toshiba u205-s5057/ | 2022-03-28 16:40 | - | |
| How to downgrade UEFI on P50t-B/ | 2022-03-28 16:40 | - | |
| How to enable 7.1 surround sound through HDMI with my Toshibia X200 SLI3/ | 2022-03-28 16:40 | - | |
| How to enable constant fan on SP M-30/ | 2022-03-28 16:40 | - | |
| How to enter BIOS on A205/ | 2022-03-28 16:40 | - | |
| How to enter the bios setting of M45/ | 2022-03-28 16:40 | - | |
| How to figure out motherboard part number on Toshiba Satellite P100/ | 2022-03-28 16:40 | - | |
| How to fix a TX 66H keys/ | 2022-03-28 16:40 | - | |
| How to get DVI signal from Dock on Toshiba Portage M200/ | 2022-03-28 16:40 | - | |
| How to get Q850 Keyboard always light up/ | 2022-03-28 16:40 | - | |
| How to get Rescue disk/ | 2022-03-28 16:40 | - | |
| How to get Toshiba Webcam to Run Continuously even when laptop is locked/ | 2022-03-28 16:40 | - | |
| How to get my windows 7 free upgrade serial/ | 2022-03-28 16:40 | - | |
| How to get newer drivers to WHQL for x205/ | 2022-03-28 16:40 | - | |
| How to install Windows XP on a X205-S7483 FULL GUIDE(Without Floppy)/ | 2022-03-28 16:40 | - | |
| How to install XP on Portege 3500 without CD-ROM/ | 2022-03-28 16:40 | - | |
| How to install windows xp on my satellite m200 toshiba notebook with preinstalled windows vista home premium edition/ | 2022-03-28 16:40 | - | |
| How to make Portege M200 tablet display working under Windows 7/ | 2022-03-28 16:40 | - | |
| How to make a Vista x64 clean install on Toshiba Satellite A300-1CO/ | 2022-03-28 16:40 | - | |
| How to monitor the CPU temp/ | 2022-03-28 16:40 | - | |
| How to reinstall Portege R205-S2062/ | 2022-03-28 16:40 | - | |
| How to remove HDD cover on M115/ | 2022-03-28 16:40 | - | |
| How to remove Toshiba-added shortcut in Start Menu/ | 2022-03-28 16:40 | - | |
| How to replace lid on Toshiba P50-T/ | 2022-03-28 16:40 | - | |
| How to reset BIOS in Toshiba M70/ | 2022-03-28 16:40 | - | |
| How to reset BIOS password for X205/ | 2022-03-28 16:40 | - | |
| How to setup booting from network for toshibq tecra m200 tablet pc/ | 2022-03-28 16:40 | - | |
| How to turn POST off on A200/ | 2022-03-28 16:40 | - | |
| How to turn off or disable Toshiba CD DVD Acoustic Silencer/ | 2022-03-28 16:40 | - | |
| How to uninstall win XP Pro/ | 2022-03-28 16:40 | - | |
| How to update refresh the M40 Bios/ | 2022-03-28 16:40 | - | |
| How to update the Bios on my toshiba X200 sli/ | 2022-03-28 16:40 | - | |
| How to update the harddrive of Toshiba M30/ | 2022-03-28 16:40 | - | |
| How to upgrade CPU in P4-Notebook (S2430)/ | 2022-03-28 16:40 | - | |
| How to upgrade Satellite M70-CL1/ | 2022-03-28 16:40 | - | |
| How to upgrade m50 memory/ | 2022-03-28 16:40 | - | |
| How would I find out the battery life for this toshiba laptop/ | 2022-03-28 16:40 | - | |
| Huge slowdown of system after cleaning & repaste/ | 2022-03-28 16:40 | - | |
| Hunting Toshiba!/ | 2022-03-28 16:40 | - | |
| Hybrid SSD/ | 2022-03-28 16:40 | - | |
| Hypersensitivity of U205-S5034 Keyboard/ | 2022-03-28 16:40 | - | |
| I'm confuse/ | 2022-03-28 16:40 | - | |
| I'm going to buy A200 today (some question)/ | 2022-03-28 16:40 | - | |
| I'm going to purchase a Toshiba A105-S2081 laptop soon/ | 2022-03-28 16:40 | - | |
| I'm in!(kinda off topic but..)/ | 2022-03-28 16:40 | - | |
| I'm legitimately surprised about my Qosmio/ | 2022-03-28 16:40 | - | |
| I'm looking to upgrade my processor/ | 2022-03-28 16:40 | - | |
| I'm really confused with the video card/ | 2022-03-28 16:40 | - | |
| I'm sick of Toshiba and Vista/ | 2022-03-28 16:40 | - | |
| I'm sure this has been asked before(toshiba controls)/ | 2022-03-28 16:40 | - | |
| I'm thinking of buying a Tecra A10/ | 2022-03-28 16:40 | - | |
| I've got some RAMN questions!/ | 2022-03-28 16:40 | - | |
| I've just discovered something fantastic!/ | 2022-03-28 16:40 | - | |
| IBM T42 or Tecra M2/ | 2022-03-28 16:40 | - | |
| IBM Thinkpad T42p Start-up problem/ | 2022-03-28 16:40 | - | |
| I F.E.A.R. a problem/ | 2022-03-28 16:40 | - | |
| I Just Put In My Order For The Qosmio x505 8100x/ | 2022-03-28 16:40 | - | |
| I Need An English X200 Recovery DVD/ | 2022-03-28 16:40 | - | |
| I Need Instruction Manual For Toshiba Satellite A215-s7444 Pc Notebook/ | 2022-03-28 16:40 | - | |
| I Need Some Help/ | 2022-03-28 16:40 | - | |
| IPS screen on Z830 or r830/ | 2022-03-28 16:41 | - | |
| ISATAP Adapter #16 Error/ | 2022-03-28 16:41 | - | |
| ITT- Teach a newb how to update drivers on a SLI1/ | 2022-03-28 16:41 | - | |
| ITT we discuss x205-SLi video card upgrade possibilities/ | 2022-03-28 16:41 | - | |
| I am buying X505-Q894 or Q896, I need help/ | 2022-03-28 16:40 | - | |
| I am on the way back to Toshiba now... Shouldn't have left/ | 2022-03-28 16:40 | - | |
| I am thinking about buying this A75-S209/ | 2022-03-28 16:40 | - | |
| I bid thee all farewell! (My thanks to you all...)/ | 2022-03-28 16:40 | - | |
| I bought a Portege R100 but i hate the screen,help/ | 2022-03-28 16:40 | - | |
| I bought a Toshiba!/ | 2022-03-28 16:40 | - | |
| I bought a Toshiba 17 inch C675 and have some problems/ | 2022-03-28 16:40 | - | |
| I broke my qosmio/ | 2022-03-28 16:40 | - | |
| I can't do the Toshiba recovery .. why/ | 2022-03-28 16:40 | - | |
| I can't get the bluetooth keyboard to work/ | 2022-03-28 16:40 | - | |
| I can't log in to windows vista/ | 2022-03-28 16:40 | - | |
| I cleaned my keyboard and now keys don't work/ | 2022-03-28 16:40 | - | |
| Identifying Toshiba's majors (years 2012-14), gaming multi with metalic designs/ | 2022-03-28 16:40 | - | |
| If I buy a Tecra A4/ | 2022-03-28 16:40 | - | |
| If my the battery dies, can i still have power from the ac power/ | 2022-03-28 16:40 | - | |
| If you have a Toshiba laptop with Core Duo or Core 2 Duo, READ THIS!/ | 2022-03-28 16:41 | - | |
| If you own the L305D-S5895 laptop PLEASE read, urgent to me help/ | 2022-03-28 16:41 | - | |
| I got it 9300 in 3dmark06 x205-sli1/ | 2022-03-28 16:40 | - | |
| I hate Toshiba's Verification/ | 2022-03-28 16:40 | - | |
| I have a Toshiba labtop m70 and i can't install the drivers/ | 2022-03-28 16:40 | - | |
| I have a few questions/ | 2022-03-28 16:40 | - | |
| I have a few questions regarding the Satellite C650 C650D/ | 2022-03-28 16:40 | - | |
| I have a question/ | 2022-03-28 16:40 | - | |
| I have a toshiba satellite l455d-s5976/ | 2022-03-28 16:40 | - | |
| I just bough U945 when it was on sale for $539. Excellent for the price/ | 2022-03-28 16:40 | - | |
| I just bought a new A300 laptop/ | 2022-03-28 16:40 | - | |
| I just ordered a T135, not much discussion here yet/ | 2022-03-28 16:40 | - | |
| I just purchased an A200S CTO through Office Depot/ | 2022-03-28 16:40 | - | |
| I know this is in the wrong place/ | 2022-03-28 16:40 | - | |
| Image Restoration/ | 2022-03-28 16:41 | - | |
| Image quality/ | 2022-03-28 16:41 | - | |
| Im going to get my new SatelliteA205 and I have some questions/ | 2022-03-28 16:41 | - | |
| Important about charging battery Need answer/ | 2022-03-28 16:41 | - | |
| Impressed... X505 Qosimo GTS 250m 3DMark06!!/ | 2022-03-28 16:41 | - | |
| Improve Toshiba x205-s9439 Perfomance !/ | 2022-03-28 16:41 | - | |
| In Store or Online/ | 2022-03-28 16:41 | - | |
| In built microphone issue/ | 2022-03-28 16:41 | - | |
| Incompatible Bios Translation detected/ | 2022-03-28 16:41 | - | |
| Incorrect Chip Temperature on Toshiba Notebooks/ | 2022-03-28 16:41 | - | |
| Incorrect settings on M400 & M5/ | 2022-03-28 16:41 | - | |
| I need a 2nd battery/ | 2022-03-28 16:40 | - | |
| I need a Sound card for the Toshiba R500/ | 2022-03-28 16:40 | - | |
| I need help! Please/ | 2022-03-28 16:40 | - | |
| I need help disassembling Toshiba Satellite L305-S5875 laptop/ | 2022-03-28 16:40 | - | |
| I need help on a Graphics card driver-related problem/ | 2022-03-28 16:40 | - | |
| I need help please/ | 2022-03-28 16:40 | - | |
| I need help with the Toshiba Satellite x205-SLi1/ | 2022-03-28 16:40 | - | |
| I need opinnion/ | 2022-03-28 16:40 | - | |
| I need some convincing/ | 2022-03-28 16:40 | - | |
| I need to find bios update for a Toshiba satellite M40-331/ | 2022-03-28 16:40 | - | |
| I need to get the spec of Satellita m50 LCD screen/ | 2022-03-28 16:40 | - | |
| I need your advise- Toshiba Tecra 8000/ | 2022-03-28 16:40 | - | |
| Infamous CPU Whine now affecting AMD based Toshiba's. EXTREMELY annoying for my M305D-S4828 with Turion X2 Ultra/ | 2022-03-28 16:41 | - | |
| Info about X305 i have that is no longer available/ | 2022-03-28 16:41 | - | |
| Informations about Tecra M3/ | 2022-03-28 16:41 | - | |
| Initial questions regarding Satellite Z930-10X/ | 2022-03-28 16:41 | - | |
| In need of PCMCIA drivers for A55-S106!/ | 2022-03-28 16:41 | - | |
| I normally love my Toshiba/ | 2022-03-28 16:40 | - | |
| Inquiry about Toshiba Tempro/ | 2022-03-28 16:41 | - | |
| Install Windows Xp on Toshiba Te2000 Help! Going Insane/ | 2022-03-28 16:41 | - | |
| Installed 1GB memory stick but old 512 stick isnt showing/ | 2022-03-28 16:41 | - | |
| Installing 8600m Sli into X205 S9349/ | 2022-03-28 16:41 | - | |
| Installing Express Media Player and Vista/ | 2022-03-28 16:41 | - | |
| Installing Internal Bluetooth Module/ | 2022-03-28 16:41 | - | |
| Installing Memory in u300-PSU30C-AY108C/ | 2022-03-28 16:41 | - | |
| Installing Norton Ghost 14.0 on 64bit System-/ | 2022-03-28 16:41 | - | |
| Installing RAM in M105-S322/ | 2022-03-28 16:41 | - | |
| Installing Vista on p105-S921/ | 2022-03-28 16:41 | - | |
| Installing Windows 7 on x305-q708/ | 2022-03-28 16:41 | - | |
| Installing X-P on a Satellite, L500/ | 2022-03-28 16:41 | - | |
| Installing XP Pro from Command Prompt/ | 2022-03-28 16:41 | - | |
| Installing XP Pro over Vista- No hard drive found/ | 2022-03-28 16:41 | - | |
| Installing XPSP2 over XPSP1/ | 2022-03-28 16:41 | - | |
| Installing XP in C partition via recovery CD/ | 2022-03-28 16:41 | - | |
| Installing XP into VISTA/ | 2022-03-28 16:41 | - | |
| Installing XP on M400/ | 2022-03-28 16:41 | - | |
| Installing XP on Preinstalled Vista/ | 2022-03-28 16:41 | - | |
| Installing XP on Satellite A200/ | 2022-03-28 16:41 | - | |
| Installing XP on Toshiba X205/ | 2022-03-28 16:41 | - | |
| Installing XP over vista on Toshiba A200/ | 2022-03-28 16:41 | - | |
| Installing Xp on satellite x205-s9349/ | 2022-03-28 16:41 | - | |
| Installing a mini-pci wireless adaptor/ | 2022-03-28 16:41 | - | |
| Installing memory problem with my Tecra/ | 2022-03-28 16:41 | - | |
| Insufficient Resources/ | 2022-03-28 16:41 | - | |
| InsydeH20 BIOS Modding ZONE/ | 2022-03-28 16:41 | - | |
| Integrated 1.3M webcam/ | 2022-03-28 16:41 | - | |
| Intel(R) 82801DBM LPC Interface Controller - 24CC/ | 2022-03-28 16:41 | - | |
| Intel 950 GMA/ | 2022-03-28 16:41 | - | |
| Intel 5100 ANG Not Powering Up On Toshiba Qosmio X305/ | 2022-03-28 16:41 | - | |
| Intel 6230 - replacement to Broadcom/ | 2022-03-28 16:41 | - | |
| Intel 6230 Doesn't work! - Toshiba A665/ | 2022-03-28 16:41 | - | |
| Intel Core Duo and Windows, question/ | 2022-03-28 16:41 | - | |
| Intel HD Graphics Indescrepancies 32-64 bit/ | 2022-03-28 16:41 | - | |
| Intel PRO 100 VE drivers for A105 Series/ | 2022-03-28 16:41 | - | |
| Intel Wi-Fi 4965AGN N/ | 2022-03-28 16:41 | - | |
| Intel Wi-Fi 4965AGN N On 945GB GM Chipset/ | 2022-03-28 16:41 | - | |
| Interchangeable motherboard and processor/ | 2022-03-28 16:41 | - | |
| Interested in buying Toshiba/ | 2022-03-28 16:41 | - | |
| Intermittent Freezing Problem With Qosmio X550-Q893/ | 2022-03-28 16:41 | - | |
| Internal ram removable replaceable/ | 2022-03-28 16:41 | - | |
| International Online Retailers for Toshiba/ | 2022-03-28 16:41 | - | |
| International Warranty/ | 2022-03-28 16:41 | - | |
| Internationa warranty/ | 2022-03-28 16:41 | - | |
| Internet activity causes audio cracking/ | 2022-03-28 16:41 | - | |
| Internet connection problems/ | 2022-03-28 16:41 | - | |
| Inverted LCD brightness problem/ | 2022-03-28 16:41 | - | |
| Inverter for Toshiba Sattelite M300/ | 2022-03-28 16:41 | - | |
| I ordered my Satellite M40-JM3/ | 2022-03-28 16:40 | - | |
| I press keys and junk comes up/ | 2022-03-28 16:40 | - | |
| I really screwed up this time/ | 2022-03-28 16:40 | - | |
| I recently got a x775-Q7272, but it says I'm running on integrated graphics/ | 2022-03-28 16:40 | - | |
| I returned my P105-S921 today/ | 2022-03-28 16:40 | - | |
| Is Diablo 3 playable on a Portege Z835-P330/ | 2022-03-28 16:41 | - | |
| Is EIDE and ATA100 the same/ | 2022-03-28 16:41 | - | |
| Is Tecra R840-10Z available with 1600x900/ | 2022-03-28 16:41 | - | |
| Is Toshiba's regular warranty international/ | 2022-03-28 16:41 | - | |
| Is Toshiba L450-16T really exist !/ | 2022-03-28 16:41 | - | |
| Is Toshiba Portege R830 a sane choice/ | 2022-03-28 16:41 | - | |
| Is Toshiba technical service realy that bad/ | 2022-03-28 16:41 | - | |
| Is anyone else stuck trying to decide between the Qosmio and the G73/ | 2022-03-28 16:41 | - | |
| Is anyone has Toshiba Satellite P50-A-05H disassembly instructions/ | 2022-03-28 16:41 | - | |
| Is anyone using xp and reading hd dvd's/ | 2022-03-28 16:41 | - | |
| Is a router with speed booster better/ | 2022-03-28 16:41 | - | |
| I saw a 14 at Circuit City and/ | 2022-03-28 16:40 | - | |
| I screwed up my Toshiba L355-S7905 by opening it- no more display on lcd/ | 2022-03-28 16:40 | - | |
| Is it OK to run my laptop @ HIGH PERFORMANCE mode 24 7/ | 2022-03-28 16:41 | - | |
| Is it a problem/ | 2022-03-28 16:41 | - | |
| Is it ok to leave my Toshiba Satellite plugged in AC even if the battery is fully charged/ | 2022-03-28 16:41 | - | |
| Is it ok to use faster RAM/ | 2022-03-28 16:41 | - | |
| Is it possible to install Windows XP on Satellite X205 series/ | 2022-03-28 16:41 | - | |
| Is it safe to rollback the A300 with the XP disc it came with/ | 2022-03-28 16:41 | - | |
| Is it worth extending my toshiba warranty/ | 2022-03-28 16:41 | - | |
| Is it worth fixing/ | 2022-03-28 16:41 | - | |
| Is it worth it, 4g DDR2 667 (PC2 5300) to 4g DDR2 800 (PC2 6400) upgrade/ | 2022-03-28 16:41 | - | |
| Is it worth it, DDR2 667 (PC2 5300) to 4g DDR2 800 (PC2 6400) upgrade/ | 2022-03-28 16:41 | - | |
| Is my LCD shot Picture within/ | 2022-03-28 16:41 | - | |
| Is my Toshiba Satellite A200 overheating/ | 2022-03-28 16:41 | - | |
| Is my Toshiba safe/ | 2022-03-28 16:41 | - | |
| Is my comp fried/ | 2022-03-28 16:41 | - | |
| Is my ethernet dead/ | 2022-03-28 16:41 | - | |
| Is my q870 running directx 11/ | 2022-03-28 16:41 | - | |
| Issues getting ahold of repair depot/ | 2022-03-28 16:41 | - | |
| Issues with Intel HD graphics/ | 2022-03-28 16:41 | - | |
| Issues with Tecra A7/ | 2022-03-28 16:41 | - | |
| Issues with Toshiba M35X-S329/ | 2022-03-28 16:41 | - | |
| Issues with Vista Service Pack 2/ | 2022-03-28 16:41 | - | |
| Issue with drivers/ | 2022-03-28 16:41 | - | |
| Is the CPU on the Qosmio X305-Q706 user upgradable/ | 2022-03-28 16:41 | - | |
| Is the F50 a good laptop/ | 2022-03-28 16:41 | - | |
| Is the GPU in the X305-Q706 user upgradable/ | 2022-03-28 16:41 | - | |
| Is the HDDVD drive on X200 X205 region coded/ | 2022-03-28 16:41 | - | |
| Is the Intel GMA 950 in my U305-S107 capable of running all of Vista's features/ | 2022-03-28 16:41 | - | |
| Is the Qosmio X300-13O available in the USA too/ | 2022-03-28 16:41 | - | |
| Is the Qosmio X505-Q880 good/ | 2022-03-28 16:41 | - | |
| Is the SLi1's wireless G or N/ | 2022-03-28 16:41 | - | |
| Is the Satellite A660-BT2G22 NVIDIA 3D Vision compatible/ | 2022-03-28 16:41 | - | |
| Is the T235 any good/ | 2022-03-28 16:41 | - | |
| Is the Toshiba A300 M00 any good/ | 2022-03-28 16:41 | - | |
| Is the Toshiba Portege R930 worth buying/ | 2022-03-28 16:41 | - | |
| Is the Toshiba Satellite L675 the lightest 17 inch notebook/ | 2022-03-28 16:41 | - | |
| Is the Toshiba Satellite P-105 good/ | 2022-03-28 16:41 | - | |
| Is the Toshiba Tecra W50-ABT1500 Mobile Workstation worth purchasing/ | 2022-03-28 16:41 | - | |
| Is the X305 9700m faulty/ | 2022-03-28 16:41 | - | |
| Is there Dual channel on the A105-S101/ | 2022-03-28 16:41 | - | |
| Is there a Turbo Boost with Q850/ | 2022-03-28 16:41 | - | |
| Is there a Windows 7 Clean Intall Guide/ | 2022-03-28 16:41 | - | |
| Is there a high spec Harmon Kardon laptop 2.5kg/ | 2022-03-28 16:41 | - | |
| Is there a less chunky Satellite/ | 2022-03-28 16:41 | - | |
| Is there a model for the A200 series that have a PCMCIA slot/ | 2022-03-28 16:41 | - | |
| Is there any model with integrated webcam/ | 2022-03-28 16:41 | - | |
| Is there any word on when the new SB Satellites will be available/ | 2022-03-28 16:41 | - | |
| Is there a program to control the fan/ | 2022-03-28 16:41 | - | |
| Is there a review of this somewhere/ | 2022-03-28 16:41 | - | |
| Is there a utility to automatically download the drivers for my laptop/ | 2022-03-28 16:41 | - | |
| Is there a way to clean the x305's speakers/ | 2022-03-28 16:41 | - | |
| Is there website where I can download/ | 2022-03-28 16:41 | - | |
| Is the u305 good for casual games/ | 2022-03-28 16:41 | - | |
| Is this RAM Compatible/ | 2022-03-28 16:41 | - | |
| Is this Toshiba good for my purposes/ | 2022-03-28 16:41 | - | |
| Is this Toshiba laptop work getting/ | 2022-03-28 16:41 | - | |
| Is this a fair deal/ | 2022-03-28 16:41 | - | |
| Is this a good deal/ | 2022-03-28 16:41 | - | |
| Is this a good deal for a college student/ | 2022-03-28 16:41 | - | |
| Is this a good deal from best buy/ | 2022-03-28 16:41 | - | |
| Is this a good deal on Satellite P740-BT4N22 Laptop/ | 2022-03-28 16:41 | - | |
| Is this charging time typical/ | 2022-03-28 16:41 | - | |
| Is this common with laptop speakers/ | 2022-03-28 16:41 | - | |
| Is toshiba laptop reliable (URGENT HELP)/ | 2022-03-28 16:41 | - | |
| I suggest staying away from Toshiba/ | 2022-03-28 16:40 | - | |
| I suspect that new X305-Q706 would sure as hell give the M17 the run for its money ... what do you think/ | 2022-03-28 16:40 | - | |
| Is video card attached to motherboard P35-S6292/ | 2022-03-28 16:41 | - | |
| Is wireless physically installed (Satellite 5205-S503)/ | 2022-03-28 16:41 | - | |
| Is x200 x205 mxm upgradeable/ | 2022-03-28 16:41 | - | |
| It's arrived!!!/ | 2022-03-28 16:41 | - | |
| It's finally HERE! Anyone know of good performance tweeks software/ | 2022-03-28 16:41 | - | |
| It Is Shocking!/ | 2022-03-28 16:41 | - | |
| I think my bios is a little bit corrupt/ | 2022-03-28 16:40 | - | |
| It won't run reliably unless it's on the lowest cpu setting imaginable/ | 2022-03-28 16:41 | - | |
| I want buy but don`t know/ | 2022-03-28 16:40 | - | |
| I want the drivers of Satellite M60-134/ | 2022-03-28 16:40 | - | |
| I want to get the Toshiba Protege M800... in pink/ | 2022-03-28 16:40 | - | |
| I want to re-install windows in another language/ | 2022-03-28 16:40 | - | |
| I want to use ACHI, Satellite L310 Series/ | 2022-03-28 16:40 | - | |
| I whant the Toshiba A70 DVD BACKUP/ | 2022-03-28 16:40 | - | |
| I will never Buy tosiba again/ | 2022-03-28 16:40 | - | |
| Just Got To Try Out Toshiba P105-S9722/ | 2022-03-28 16:41 | - | |
| Just Ordered the Qosmio X70-AST2GX1 Laptop!/ | 2022-03-28 16:41 | - | |
| Just bought P100-MA6 ... how do i turn the speaker lights/ | 2022-03-28 16:41 | - | |
| Just bought Toshiba u305 - Some Qs/ | 2022-03-28 16:41 | - | |
| Just bought a Toshiba A665 (problems)/ | 2022-03-28 16:41 | - | |
| Just bought a Toshiba P100 Laptop off of ebay/ | 2022-03-28 16:41 | - | |
| Just bought a X205 Sli1 tonight/ | 2022-03-28 16:41 | - | |
| Just bought my first toshiba!!!/ | 2022-03-28 16:41 | - | |
| Just bought new Sattelite A500, query about startup programs/ | 2022-03-28 16:41 | - | |
| Just completed reformat - a few missing driver issues/ | 2022-03-28 16:41 | - | |
| Just got a A135-S2386/ | 2022-03-28 16:41 | - | |
| Just got my first ever Toshiba/ | 2022-03-28 16:41 | - | |
| Just got my new Q855/ | 2022-03-28 16:41 | - | |
| Just got the new R835-P50X/ | 2022-03-28 16:41 | - | |
| Just joined the Toshiba club, couple of questions/ | 2022-03-28 16:41 | - | |
| Just order an A500/ | 2022-03-28 16:41 | - | |
| Just ordered my M60 and will post a review as soon as I can/ | 2022-03-28 16:41 | - | |
| Just ordered the a Toshiba Protege A605-200/ | 2022-03-28 16:41 | - | |
| Just picked up a R835-P50X/ | 2022-03-28 16:41 | - | |
| Just powered up my A505-S6065!/ | 2022-03-28 16:41 | - | |
| Just purchased M55-S3512/ | 2022-03-28 16:41 | - | |
| Just purchased Toshiba P755/ | 2022-03-28 16:41 | - | |
| Just received my X205-SLI1...should I get the SystemGuard along with an Extended Service Plan/ | 2022-03-28 16:41 | - | |
| Just wondering- any Satellite owners using speakers/ | 2022-03-28 16:41 | - | |
| Just wondering why vista take so much more room than xp/ | 2022-03-28 16:41 | - | |
| Keeping keyboard backlight on/ | 2022-03-28 16:41 | - | |
| Keyboard & Mouse - Wake up from Sleep/ | 2022-03-28 16:41 | - | |
| Keyboard/ | 2022-03-28 16:41 | - | |
| Keyboard Configuration seems to have changed/ | 2022-03-28 16:41 | - | |
| Keyboard Problem/ | 2022-03-28 16:41 | - | |
| Keyboard Removal - Toshiba Satellite U200/ | 2022-03-28 16:41 | - | |
| Keyboard and Laptop Recommendation/ | 2022-03-28 16:41 | - | |
| Keyboard and Mouse attached/ | 2022-03-28 16:41 | - | |
| Keyboard backlighting/ | 2022-03-28 16:41 | - | |
| Keyboard disarm and clean on a M305-S4820/ | 2022-03-28 16:41 | - | |
| Keyboard for A215/ | 2022-03-28 16:41 | - | |
| Keyboard stuck a bios/ | 2022-03-28 16:41 | - | |
| Key issue in Tecra A3X/ | 2022-03-28 16:41 | - | |
| Kudos to Toshiba/ | 2022-03-28 16:41 | - | |
| L20-101 Ram query/ | 2022-03-28 16:41 | - | |
| L25-S1216 LCD Problem/ | 2022-03-28 16:41 | - | |
| L25-S1993 overclocking/ | 2022-03-28 16:41 | - | |
| L25 Recovery & Partitions/ | 2022-03-28 16:41 | - | |
| L25 antenna wire routing/ | 2022-03-28 16:41 | - | |
| L25 review/ | 2022-03-28 16:41 | - | |
| L30-134/ | 2022-03-28 16:41 | - | |
| L35-S2151 possible upgrades/ | 2022-03-28 16:41 | - | |
| L35-S2366 not working with 2G RAM/ | 2022-03-28 16:41 | - | |
| L40 17S with 3GB/ | 2022-03-28 16:41 | - | |
| L40 XP installation - anything I need to know before I start/ | 2022-03-28 16:41 | - | |
| L45-S7409 XP Drivers/ | 2022-03-28 16:41 | - | |
| L45-S7423 acpi atk0100/ | 2022-03-28 16:41 | - | |
| L100 no POST/ | 2022-03-28 16:41 | - | |
| L300-1BV, can you put gpedit.msc on vista home premium/ | 2022-03-28 16:41 | - | |
| L300D-03K = no picture/ | 2022-03-28 16:41 | - | |
| L300D Fail/ | 2022-03-28 16:41 | - | |
| L300D overheating/ | 2022-03-28 16:41 | - | |
| L300d-242/ | 2022-03-28 16:41 | - | |
| L305-s5918 CPU UPGRADE/ | 2022-03-28 16:41 | - | |
| L305D-S5893 help!/ | 2022-03-28 16:41 | - | |
| L305 cpu upgrade/ | 2022-03-28 16:41 | - | |
| L305d-s5934/ | 2022-03-28 16:41 | - | |
| L355D-S7815 - Boot, BIOS displays, then endless beeps/ | 2022-03-28 16:41 | - | |
| L355 From Walmart/ | 2022-03-28 16:41 | - | |
| L355 No Video on Screen- Black Display- Backlight On/ | 2022-03-28 16:41 | - | |
| L355d-s7901/ | 2022-03-28 16:41 | - | |
| L500-1EK graphics drivers/ | 2022-03-28 16:41 | - | |
| L500-128 vs L500-126/ | 2022-03-28 16:41 | - | |
| L500 does not boot automatically to Win 7/ | 2022-03-28 16:41 | - | |
| L500 driving me bonkers/ | 2022-03-28 16:41 | - | |
| L505-K10 with quad core/ | 2022-03-28 16:41 | - | |
| L505-S5993 Code 52 on Display Adapter/ | 2022-03-28 16:41 | - | |
| L505 webcam/ | 2022-03-28 16:41 | - | |
| L550-1cc/ | 2022-03-28 16:41 | - | |
| L550 LCD Issues/ | 2022-03-28 16:41 | - | |
| L645-S4104 USB2.0 write speed/ | 2022-03-28 16:41 | - | |
| L645D-S40 Battery Issue/ | 2022-03-28 16:41 | - | |
| L645D-S4037 No Boot/ | 2022-03-28 16:41 | - | |
| L645D Startup problems/ | 2022-03-28 16:41 | - | |
| L650-PSK1JE undervolted BIOS/ | 2022-03-28 16:41 | - | |
| L650 Bios/ | 2022-03-28 16:41 | - | |
| L655-133 Pink laptop/ | 2022-03-28 16:41 | - | |
| L655-175 hard drive sound/ | 2022-03-28 16:41 | - | |
| L655-S5075 LCD Replacement Guide/ | 2022-03-28 16:41 | - | |
| L655-S5110 Crashing/ | 2022-03-28 16:41 | - | |
| L655 blue screen problem----need help/ | 2022-03-28 16:41 | - | |
| L755D-S5160 User Manual/ | 2022-03-28 16:41 | - | |
| L755D-S5204 Recovery disk #2/ | 2022-03-28 16:41 | - | |
| L855-149 LCD Resolution Upgrade/ | 2022-03-28 16:41 | - | |
| L855-S5372 How do I get into bios to change settings/ | 2022-03-28 16:41 | - | |
| L855 wifi issue/ | 2022-03-28 16:41 | - | |
| L875-12p clicking noise HELP!/ | 2022-03-28 16:41 | - | |
| LCD Backlight Flickering dimming/ | 2022-03-28 16:41 | - | |
| LCD Compatibility/ | 2022-03-28 16:41 | - | |
| LCD Problem/ | 2022-03-28 16:41 | - | |
| LCD brightness on Tecras ENOUGH/ | 2022-03-28 16:41 | - | |
| LCD from 5105-S501 fits 5105-S701/ | 2022-03-28 16:41 | - | |
| LCD issues with my Portege 7020CT/ | 2022-03-28 16:41 | - | |
| LCD quality in relation to their size/ | 2022-03-28 16:41 | - | |
| LCD screen problems need help/ | 2022-03-28 16:41 | - | |
| LCD to LED/ | 2022-03-28 16:41 | - | |
| LED Screen and FN Key/ | 2022-03-28 16:41 | - | |
| L P series 740 755 reviews/ | 2022-03-28 16:41 | - | |
| LSS w Toshiba - need recovery disk, they want $/ | 2022-03-28 16:41 | - | |
| Lappy turning off while playing High-end Games Wtf/ | 2022-03-28 16:41 | - | |
| Laptop & Projector difficulties/ | 2022-03-28 16:41 | - | |
| Laptop - Toshiba Satellite M70-160/ | 2022-03-28 16:41 | - | |
| Laptop-projector connection problem/ | 2022-03-28 16:41 | - | |
| Laptop Audio/ | 2022-03-28 16:41 | - | |
| Laptop Battery/ | 2022-03-28 16:41 | - | |
| Laptop Battery losing battery life when not in use for a few days/ | 2022-03-28 16:41 | - | |
| Laptop CD drive problems! cant boot from it/ | 2022-03-28 16:41 | - | |
| Laptop Cooler for Toshiba Satellite P300/ | 2022-03-28 16:41 | - | |
| Laptop Cord Problems/ | 2022-03-28 16:41 | - | |
| Laptop Crashes/ | 2022-03-28 16:41 | - | |
| Laptop Delivery/ | 2022-03-28 16:41 | - | |
| Laptop Heat/ | 2022-03-28 16:41 | - | |
| Laptop Magazine Tecra R840 Review/ | 2022-03-28 16:41 | - | |
| Laptop Media Buttons (Play Pause) Don't Work After Vista SP1/ | 2022-03-28 16:41 | - | |
| Laptop Satelite P75-A7200 recovery SSD (changed from HDD) doesn't work/ | 2022-03-28 16:41 | - | |
| Laptop Screen Cracked - HELP!/ | 2022-03-28 16:41 | - | |
| Laptop a bit noisy/ | 2022-03-28 16:41 | - | |
| Laptop and external monitor/ | 2022-03-28 16:41 | - | |
| Laptop auto-wake up from Sleep/ | 2022-03-28 16:41 | - | |
| Laptop beeps and doesn't boot/ | 2022-03-28 16:41 | - | |
| Laptop beeps randomly/ | 2022-03-28 16:41 | - | |
| Laptop crash (everyday)/ | 2022-03-28 16:41 | - | |
| Laptop fails to start (works sometimes though)/ | 2022-03-28 16:41 | - | |
| Laptop freezing/ | 2022-03-28 16:41 | - | |
| Laptop has no power/ | 2022-03-28 16:41 | - | |
| Laptop microphone does not work when the power cable is unplugged/ | 2022-03-28 16:41 | - | |
| Laptop no response, Satellite/ | 2022-03-28 16:41 | - | |
| Laptop overheating like crazy/ | 2022-03-28 16:41 | - | |
| Laptop powers on for 5 seconds and dies repeatatively/ | 2022-03-28 16:41 | - | |
| Laptop repairs in Los Angeles/ | 2022-03-28 16:41 | - | |
| Laptop running slowly after motherboard change/ | 2022-03-28 16:41 | - | |
| Laptop shutdown when ac adaptor is plugged in/ | 2022-03-28 16:41 | - | |
| Laptop temp onitoring/ | 2022-03-28 16:41 | - | |
| Laptop warranty/ | 2022-03-28 16:41 | - | |
| Laptop was rolled over by a car! Help, please!/ | 2022-03-28 16:41 | - | |
| Laptop will not boot with 4GB of RAM/ | 2022-03-28 16:41 | - | |
| Laptop won't turn on sometimes/ | 2022-03-28 16:41 | - | |
| Latest NVIDIA Drivers (v267.24) can be installed onto Toshiba Qosmio's with 460M/ | 2022-03-28 16:41 | - | |
| Latest X205 3D-Mark 06 bench/ | 2022-03-28 16:41 | - | |
| Launch recovery process on a L25/ | 2022-03-28 16:41 | - | |
| Led screen/ | 2022-03-28 16:41 | - | |
| Left and right channel of A135-S2386/ | 2022-03-28 16:41 | - | |
| Lets see your Qosmio setups/ | 2022-03-28 16:41 | - | |
| Lets talk A205-S5812/ | 2022-03-28 16:41 | - | |
| Letters and numbers, what do they mean!!/ | 2022-03-28 16:41 | - | |
| Libretto L5 - CD ROM Drive/ | 2022-03-28 16:41 | - | |
| Libretto Ram/ | 2022-03-28 16:41 | - | |
| Libretto W105 Review/ | 2022-03-28 16:41 | - | |
| Life of a Charger for Toshiba/ | 2022-03-28 16:41 | - | |
| Light Leakage on new toshiba satellite x200/ | 2022-03-28 16:41 | - | |
| Light in the back of the screen. Is this normal/ | 2022-03-28 16:41 | - | |
| Light leak/ | 2022-03-28 16:41 | - | |
| Like Toshibas...but/ | 2022-03-28 16:41 | - | |
| Line Out/ | 2022-03-28 16:41 | - | |
| Linux Ubuntu Satellite U300 heat problem/ | 2022-03-28 16:41 | - | |
| Linux on G25-AV513/ | 2022-03-28 16:41 | - | |
| Linux on Satellite A130/ | 2022-03-28 16:41 | - | |
| List of drivers for Toshiba Qosmio® X505/ | 2022-03-28 16:41 | - | |
| Little help with a internet connection problem/ | 2022-03-28 16:41 | - | |
| Little problem with my new A100-SK9/ | 2022-03-28 16:41 | - | |
| Live Recording with satellite p100-429/ | 2022-03-28 16:41 | - | |
| Load Error/ | 2022-03-28 16:41 | - | |
| Loading XP onto X205-S9359 Problems -- Help/ | 2022-03-28 16:41 | - | |
| Local Area Network driver missing/ | 2022-03-28 16:41 | - | |
| Location of bios battery/ | 2022-03-28 16:41 | - | |
| Locked BIOS by default Satellite A300-17n/ | 2022-03-28 16:41 | - | |
| Locked out of Phoenix BIOS - A215-S4807/ | 2022-03-28 16:41 | - | |
| LogiTech Microphone Headset Issues/ | 2022-03-28 16:41 | - | |
| Logiech Mic SKype Toshiba Satellite Pro Issue/ | 2022-03-28 16:41 | - | |
| Logitech X-540 Speakers with Qosmio X305/ | 2022-03-28 16:41 | - | |
| Long shot- Qosmio x505 x500 video card compatability with P505 P500/ | 2022-03-28 16:41 | - | |
| Longtime Lenovo owner, looking at inexpensive Toshibas/ | 2022-03-28 16:41 | - | |
| Look for Toshiba Satellite service manual/ | 2022-03-28 16:41 | - | |
| Looking For- Toshiba Satellite P35 Carrying Case/ | 2022-03-28 16:41 | - | |
| Looking at A100-TA4C deal - your thoughts/ | 2022-03-28 16:41 | - | |
| Looking at picking this laptop up next week. Should I do it/ | 2022-03-28 16:41 | - | |
| Looking for A135-s4467 Service Manual/ | 2022-03-28 16:41 | - | |
| Looking for Good video drivers for Sli3/ | 2022-03-28 16:41 | - | |
| Looking for MK4055GSX Hard drive/ | 2022-03-28 16:41 | - | |
| Looking for XP driver for A205-S7464 , I want Audio and Modems drive specialy/ | 2022-03-28 16:41 | - | |
| Looking for XP driver for A205-S7464/ | 2022-03-28 16:41 | - | |
| Looking for XP video driver for A205-S5800/ | 2022-03-28 16:41 | - | |
| Looking for a Toshiba/ | 2022-03-28 16:41 | - | |
| Looking for a Toshiba Refurbished Dealer/ | 2022-03-28 16:41 | - | |
| Looking for a good backpack for X205-SLi1/ | 2022-03-28 16:41 | - | |
| Looking for a laptop that will last/ | 2022-03-28 16:41 | - | |
| Looking for another notebook I can rely on/ | 2022-03-28 16:41 | - | |
| Looking for a x205 sli5 or 6/ | 2022-03-28 16:41 | - | |
| Looking for informaion reviews on Satellite Pro L550/ | 2022-03-28 16:41 | - | |
| Looking for input on getting Qosmio Gaming laptop/ | 2022-03-28 16:41 | - | |
| Looking for the Perfect Toshiba/ | 2022-03-28 16:41 | - | |
| Looking to buy/ | 2022-03-28 16:41 | - | |
| Looking to buy Satellite P200-ST2061/ | 2022-03-28 16:41 | - | |
| Looking to buy X205-SLi4...Questions/ | 2022-03-28 16:41 | - | |
| Looking to buy a P100-SD8/ | 2022-03-28 16:41 | - | |
| Looking to buy a Q892. Have some questions/ | 2022-03-28 16:41 | - | |
| Looking to buy a Toshiba/ | 2022-03-28 16:41 | - | |
| Looking to buy a Toshiba A200 - MR4 parts laptop/ | 2022-03-28 16:41 | - | |
| Looking to buy upgrades for Qosmio G25/ | 2022-03-28 16:41 | - | |
| Looking to upgrade my X205-S9349/ | 2022-03-28 16:41 | - | |
| Looks like Amazon just lowered the price on the Qosmios!/ | 2022-03-28 16:41 | - | |
| Loose AC Power Connection to back of M40/ | 2022-03-28 16:41 | - | |
| Loose Hinges/ | 2022-03-28 16:41 | - | |
| Loose battery/ | 2022-03-28 16:41 | - | |
| Loose plug receptacles on Toshiba P205/ | 2022-03-28 16:41 | - | |
| Losing it/ | 2022-03-28 16:41 | - | |
| Loss of FN buttons on R835-P56X/ | 2022-03-28 16:41 | - | |
| Lost Recovery DVD/ | 2022-03-28 16:41 | - | |
| Lost Vista CD and key/ | 2022-03-28 16:41 | - | |
| Lost hibernate button on shut down after XP Pro/ | 2022-03-28 16:41 | - | |
| Lost my NVIDIA GeForce on my X775-Q7270 Qosmio/ | 2022-03-28 16:41 | - | |
| Lost the internal mic, or did I/ | 2022-03-28 16:41 | - | |
| Lost the screen image on my A105/ | 2022-03-28 16:41 | - | |
| Lost time, p105 -s9312/ | 2022-03-28 16:41 | - | |
| Lost video controller/ | 2022-03-28 16:41 | - | |
| Loud noise emitted from Notebook - Satellite M70-CL1/ | 2022-03-28 16:41 | - | |
| Lower cpu speed on Toshiba a110/ | 2022-03-28 16:41 | - | |
| Low resolution and refresh rate/ | 2022-03-28 16:41 | - | |
| Low sound on laptop/ | 2022-03-28 16:41 | - | |
| Low volume from speakrs portege z930/ | 2022-03-28 16:41 | - | |
| M-45 Fn keys not working/ | 2022-03-28 16:41 | - | |
| M-50 black screen/ | 2022-03-28 16:41 | - | |
| M-60 and bluetooth/ | 2022-03-28 16:41 | - | |
| M2 came, sadly, it won't stay/ | 2022-03-28 16:41 | - | |
| M2 with Dothan...when/ | 2022-03-28 16:41 | - | |
| M3 - Performance/ | 2022-03-28 16:41 | - | |
| M3 owners, please speak up/ | 2022-03-28 16:41 | - | |
| M15-s405/ | 2022-03-28 16:41 | - | |
| M30-603/ | 2022-03-28 16:41 | - | |
| M30-710 Screen/ | 2022-03-28 16:41 | - | |
| M30-YSJ Myster of the FIR Port !/ | 2022-03-28 16:41 | - | |
| M30-YSJ screen trim broken/ | 2022-03-28 16:41 | - | |
| M30 EXTERNAL KEYS/ | 2022-03-28 16:41 | - | |
| M30 M35 Express Media Player Volume/ | 2022-03-28 16:41 | - | |
| M30 Special Edition discontinued/ | 2022-03-28 16:41 | - | |
| M30X-118 Strange, probably bios problem/ | 2022-03-28 16:41 | - | |
| M30X CD buttons problems/ | 2022-03-28 16:41 | - | |
| M30 cpu speed/ | 2022-03-28 16:41 | - | |
| M30 dvd recorder/ | 2022-03-28 16:41 | - | |
| M30 is dead/ | 2022-03-28 16:41 | - | |
| M30 question/ | 2022-03-28 16:41 | - | |
| M30 underclocked GPU/ | 2022-03-28 16:41 | - | |
| M35-S320 Power Connection/ | 2022-03-28 16:41 | - | |
| M35-S359 fan, chip/ | 2022-03-28 16:41 | - | |
| M35-S359 opinions ... Found fair deal/ | 2022-03-28 16:41 | - | |
| M35-S456 - USB not working/ | 2022-03-28 16:41 | - | |
| M35-S456 First Impressions/ | 2022-03-28 16:41 | - | |
| M35-S456 Memory Upgrade and Windows 7 Freezes/ | 2022-03-28 16:41 | - | |
| M35-S456 and a question/ | 2022-03-28 16:41 | - | |
| M35-XS149 Weight/ | 2022-03-28 16:41 | - | |
| M35 Thoughts/ | 2022-03-28 16:41 | - | |
| M35 Upgrade to Windows XP Pro/ | 2022-03-28 16:41 | - | |
| M35X-S109 upgrade potential/ | 2022-03-28 16:41 | - | |
| M35X-S111 - Need help on screen, please/ | 2022-03-28 16:41 | - | |
| M35X-S111 Windows 7 Upgrade/ | 2022-03-28 16:41 | - | |
| M35X-S111 failed to work with camcorder/ | 2022-03-28 16:41 | - | |
| M35X-S149 motherboad in M35X-S111/ | 2022-03-28 16:41 | - | |
| M35X-S161 won't complete statup/ | 2022-03-28 16:41 | - | |
| M35X-S309 stuck on screen/ | 2022-03-28 16:41 | - | |
| M35X-S309 vs. Gateway M320X/ | 2022-03-28 16:41 | - | |
| M35X - reattach data cable properly/ | 2022-03-28 16:41 | - | |
| M35X Motherbord Problem/ | 2022-03-28 16:41 | - | |
| M35X hangs upon returning from hibernation/ | 2022-03-28 16:41 | - | |
| M35X strange Keypad issue/ | 2022-03-28 16:41 | - | |
| M35 sound card question/ | 2022-03-28 16:41 | - | |
| M35 won't boot up/ | 2022-03-28 16:41 | - | |
| M35x-s149 question about memory/ | 2022-03-28 16:41 | - | |
| M35x Graphics Chip Overheats because of heatsink/ | 2022-03-28 16:41 | - | |
| M35x M30 CPU Upgrade/ | 2022-03-28 16:41 | - | |
| M40 & the orange bunny (express card)/ | 2022-03-28 16:41 | - | |
| M40' got Enough or Not!/ | 2022-03-28 16:41 | - | |
| M40, but new Toshiba Laptops announced today/ | 2022-03-28 16:41 | - | |
| M40 - Anyone had any luck running a game/ | 2022-03-28 16:41 | - | |
| M40 - Cardbus feature/ | 2022-03-28 16:41 | - | |
| M40 - Display aspect ratio settings/ | 2022-03-28 16:41 | - | |
| M40-JM3 drivers and Utilites/ | 2022-03-28 16:41 | - | |
| M40-JM3 problem with some dvd and video/ | 2022-03-28 16:41 | - | |
| M40- Red Ghosting - What causes it/ | 2022-03-28 16:41 | - | |
| M40-S4111TD- BIOS & DRIVERS Where/ | 2022-03-28 16:41 | - | |
| M40-S4111TD- Red Ghost on LCD/ | 2022-03-28 16:41 | - | |
| M40-SF3 ending now/ | 2022-03-28 16:41 | - | |
| M40-SF3 wireless stop working after starting/ | 2022-03-28 16:41 | - | |
| M40 - Weird temporary lock-ups/ | 2022-03-28 16:41 | - | |
| M40-jm8 help please!!/ | 2022-03-28 16:41 | - | |
| M40 - nv4_disp.dll errors blue screen of death/ | 2022-03-28 16:41 | - | |
| M40 4-Speaker out/ | 2022-03-28 16:41 | - | |
| M40 45 Sony FS Blue Led Light this that madness/ | 2022-03-28 16:41 | - | |
| M40 BIOS update/ | 2022-03-28 16:41 | - | |
| M40 BIOS update probs...have a look/ | 2022-03-28 16:41 | - | |
| M40 Bios/ | 2022-03-28 16:41 | - | |
| M40 Bios Operation/ | 2022-03-28 16:41 | - | |
| M40C-YP300E DVD pic quality, req feedback/ | 2022-03-28 16:41 | - | |
| M40 Drivers question/ | 2022-03-28 16:41 | - | |
| M40 Dual Channel Does it exist/ | 2022-03-28 16:41 | - | |
| M40 Gpu/ | 2022-03-28 16:41 | - | |
| M40 M45 design layout/ | 2022-03-28 16:41 | - | |
| M40 Scrolling problem!!!/ | 2022-03-28 16:41 | - | |
| M40 USB boot/ | 2022-03-28 16:41 | - | |
| M40 Windows media 10 quick buttons/ | 2022-03-28 16:41 | - | |
| M40X (M40X-RH4E) - CPU Fan noise issue/ | 2022-03-28 16:41 | - | |
| M40X - Is there a Long Life Battery available/ | 2022-03-28 16:41 | - | |
| M40X-RS1/ | 2022-03-28 16:41 | - | |
| M40 XP pro Installation problems/ | 2022-03-28 16:41 | - | |
| M40X harddrive issue no operating system found/ | 2022-03-28 16:41 | - | |
| M40 battery life/ | 2022-03-28 16:41 | - | |
| M40 gettin crapper/ | 2022-03-28 16:41 | - | |
| M40 in the states/ | 2022-03-28 16:41 | - | |
| M40 media keys not working anymore/ | 2022-03-28 16:41 | - | |
| M40 prolems, pleas have a look/ | 2022-03-28 16:41 | - | |
| M40 wireless not working - help !!!/ | 2022-03-28 16:41 | - | |
| M40x-119 adjusting graphics memory share/ | 2022-03-28 16:41 | - | |
| M45's Wireless strength greatly dropped/ | 2022-03-28 16:41 | - | |
| M45-169 Opinions/ | 2022-03-28 16:41 | - | |
| M45-265 laptop/ | 2022-03-28 16:41 | - | |
| M45-351 high pitch noise, PLEASE HELP/ | 2022-03-28 16:41 | - | |
| M45- Fujitsu 100gb hd issues/ | 2022-03-28 16:41 | - | |
| M45-S165 Wont boot past splash screen/ | 2022-03-28 16:41 | - | |
| M45-S265 wireless problem/ | 2022-03-28 16:41 | - | |
| M45-S331 or M45-S351/ | 2022-03-28 16:41 | - | |
| M45-S351/ | 2022-03-28 16:41 | - | |
| M45-S351 No DVD Drive/ | 2022-03-28 16:41 | - | |
| M45-S351 Problems after Bios Upgrade/ | 2022-03-28 16:41 | - | |
| M45-S351 terrible sound and vga output issues/ | 2022-03-28 16:41 | - | |
| M45-S355 PhotoGallery/ | 2022-03-28 16:41 | - | |
| M45-S359 No Recovery Disks- My Options Are/ | 2022-03-28 16:41 | - | |
| M45-S359 Satellite- Just Purchased/ | 2022-03-28 16:41 | - | |
| M45-S359 locks at Toshiba Splash Screen/ | 2022-03-28 16:41 | - | |
| M45-S2692 019006 max hard drive size/ | 2022-03-28 16:41 | - | |
| M45-s269/ | 2022-03-28 16:41 | - | |
| M45-s351 screen needs to be replaced/ | 2022-03-28 16:41 | - | |
| M45 Screen Question/ | 2022-03-28 16:41 | - | |
| M45 Upgrade Problem/ | 2022-03-28 16:41 | - | |
| M45 constant rebooting/ | 2022-03-28 16:41 | - | |
| M45 equivalent in domestic market (Japan)/ | 2022-03-28 16:41 | - | |
| M45 media buttons/ | 2022-03-28 16:41 | - | |
| M45 question/ | 2022-03-28 16:41 | - | |
| M45 recovery issue/ | 2022-03-28 16:41 | - | |
| M45 series laptop problem with screen/ | 2022-03-28 16:41 | - | |
| M50 Help Please (urgent!)/ | 2022-03-28 16:41 | - | |
| M50 M55 - question about High Brightness (non TrueBrite) display option/ | 2022-03-28 16:41 | - | |
| M50 M55 opinions reviews/ | 2022-03-28 16:41 | - | |
| M55-S325-how to replace RAM under the keyboard/ | 2022-03-28 16:41 | - | |
| M55-s325 wont power up from power button/ | 2022-03-28 16:41 | - | |
| M55-s329/ | 2022-03-28 16:41 | - | |
| M55-s3293/ | 2022-03-28 16:41 | - | |
| M55 series ATI Video driver gone bad/ | 2022-03-28 16:41 | - | |
| M55 trouble with external VGA and Projector/ | 2022-03-28 16:41 | - | |
| M55 video card/ | 2022-03-28 16:41 | - | |
| M60-159 Screen Problem/ | 2022-03-28 16:41 | - | |
| M60 S-Video/ | 2022-03-28 16:41 | - | |
| M60 Screen died, help/ | 2022-03-28 16:41 | - | |
| M65 - How to clean the LCD/ | 2022-03-28 16:41 | - | |
| M70, need help!!!/ | 2022-03-28 16:41 | - | |
| M70-144 OpenGL Vista Problems!/ | 2022-03-28 16:41 | - | |
| M70-DL3 Setting Video Memory/ | 2022-03-28 16:41 | - | |
| M70-FE5 DVD burning Errors !/ | 2022-03-28 16:41 | - | |
| M70-SR6 vs M70-FE5/ | 2022-03-28 16:41 | - | |
| M70-fe5/ | 2022-03-28 16:41 | - | |
| M70- heat, noise, other cons and pros/ | 2022-03-28 16:41 | - | |
| M70-sr6/ | 2022-03-28 16:41 | - | |
| M70 FE5 x700 256mb BEST DRIVER/ | 2022-03-28 16:41 | - | |
| M70 Keyboard dead/ | 2022-03-28 16:41 | - | |
| M70 SR6 video driver question/ | 2022-03-28 16:41 | - | |
| M70 battery/ | 2022-03-28 16:41 | - | |
| M71C-SR600E or Qosmio F20C-GS102E/ | 2022-03-28 16:41 | - | |
| M80 in Orients What abt in Western/ | 2022-03-28 16:41 | - | |
| M100 Colors/ | 2022-03-28 16:41 | - | |
| M100 Express Media Application/ | 2022-03-28 16:41 | - | |
| M100 M105 Questions/ | 2022-03-28 16:41 | - | |
| M100 Review anywhere/ | 2022-03-28 16:41 | - | |
| M100_express media player when booting window s/ | 2022-03-28 16:41 | - | |
| M100 and Adobe Premiere/ | 2022-03-28 16:41 | - | |
| M100 harman kardon speaker/ | 2022-03-28 16:41 | - | |
| M100 vs M105/ | 2022-03-28 16:41 | - | |
| M105-S322 Boot Problem/ | 2022-03-28 16:41 | - | |
| M105-S3004 ethernet problem/ | 2022-03-28 16:41 | - | |
| M105-S3041 ethernet A network cable is unplugged/ | 2022-03-28 16:41 | - | |
| M105-s3084/ | 2022-03-28 16:41 | - | |
| M105 Build Quality/ | 2022-03-28 16:41 | - | |
| M105 Help/ | 2022-03-28 16:41 | - | |
| M115-S3094 video card memory/ | 2022-03-28 16:41 | - | |
| M115 DVD drive swap/ | 2022-03-28 16:41 | - | |
| M115 Keyboard/ | 2022-03-28 16:41 | - | |
| M115 totally locks up/ | 2022-03-28 16:41 | - | |
| M200- Maximum size of SD-card/ | 2022-03-28 16:41 | - | |
| M200 205, got one/ | 2022-03-28 16:41 | - | |
| M200 Downgrade to XP issue/ | 2022-03-28 16:41 | - | |
| M205 help - corrupt video , options/ | 2022-03-28 16:41 | - | |
| M305-S4822 Battery Life/ | 2022-03-28 16:41 | - | |
| M305D-S4830 Bloatware/ | 2022-03-28 16:41 | - | |
| M305D-S4830 reboot issue/ | 2022-03-28 16:41 | - | |
| M305d reboot issues/ | 2022-03-28 16:41 | - | |
| M305 sound coloring/ | 2022-03-28 16:41 | - | |
| M350 KEYBAORD PROBLEM/ | 2022-03-28 16:41 | - | |
| M400 Junk/ | 2022-03-28 16:41 | - | |
| M405-S8003 motherboard question. IMPORTANT AND QUICKLY PLEASE/ | 2022-03-28 16:41 | - | |
| M405 - When booting from USB, can't see internal HDD/ | 2022-03-28 16:41 | - | |
| M645, anyone notice what was on the reviews/ | 2022-03-28 16:41 | - | |
| M645-S4055 with 4gb of ram, how to upgrade to 6gb of ram/ | 2022-03-28 16:41 | - | |
| M645-S4070 Updated Bios, fan running harder/ | 2022-03-28 16:41 | - | |
| M645 flicker on dark colors/ | 2022-03-28 16:41 | - | |
| M645 non Sandybridge owners that came stock with 6gb of ram. please reply/ | 2022-03-28 16:41 | - | |
| M645 with Intel Centrino 6250 owners please read/ | 2022-03-28 16:41 | - | |
| M645 worth updating Bios if everything is fine/ | 2022-03-28 16:41 | - | |
| M700/ | 2022-03-28 16:41 | - | |
| M800 intermittently won't shutdown/ | 2022-03-28 16:41 | - | |
| MY Tecra Review/ | 2022-03-28 16:41 | - | |
| Mac OS X on Toshiba P200/ | 2022-03-28 16:41 | - | |
| Macbook Pro 13 vs Thinkpad T410 vs Toshiba R705/ | 2022-03-28 16:41 | - | |
| Made Decision & Got Memory Now New Question/ | 2022-03-28 16:41 | - | |
| Magnets v s Satellite = Toasted Screen !/ | 2022-03-28 16:41 | - | |
| Major Help Needed... PLZ/ | 2022-03-28 16:41 | - | |
| Major Issue With Toshiba Satellite/ | 2022-03-28 16:41 | - | |
| Major computer issues-Please Help!/ | 2022-03-28 16:41 | - | |
| Making recovery disks/ | 2022-03-28 16:41 | - | |
| Many issues, Toshiba G25/ | 2022-03-28 16:41 | - | |
| Marks on the palm rest/ | 2022-03-28 16:41 | - | |
| Mass storage Controller Driver disapeared/ | 2022-03-28 16:41 | - | |
| Master Inverted C-SEL Pioneer DVR-K05 for older Toshibas/ | 2022-03-28 16:41 | - | |
| Mat a UJ-850s A100-VA9/ | 2022-03-28 16:41 | - | |
| Matsushita vs Pioneer DVD-RW drives/ | 2022-03-28 16:41 | - | |
| Max CPU upgrade for Toshiba Satellite 1115-s103/ | 2022-03-28 16:41 | - | |
| Maxing out RAM/ | 2022-03-28 16:41 | - | |
| Max resolution of DVI on Slim port replicator II (R500)/ | 2022-03-28 16:41 | - | |
| May DVDRW Mashita of Tos. is not good/ | 2022-03-28 16:41 | - | |
| Maybe 3D really is here to stay/ | 2022-03-28 16:41 | - | |
| May be time to wipe my Satellite and start new..help/ | 2022-03-28 16:41 | - | |
| Media Buttons/ | 2022-03-28 16:41 | - | |
| Media Buttons and Winamp (M40)/ | 2022-03-28 16:41 | - | |
| Media Card Stuck in A205-S5855/ | 2022-03-28 16:41 | - | |
| Media Center Edition/ | 2022-03-28 16:41 | - | |
| Media Player and Voice issue on toshiba/ | 2022-03-28 16:41 | - | |
| Media buttons not working/ | 2022-03-28 16:41 | - | |
| Memory/ | 2022-03-28 16:41 | - | |
| Memory Bandwidth in L25-S119 is awful/ | 2022-03-28 16:41 | - | |
| Memory Problems/ | 2022-03-28 16:41 | - | |
| Memory Q for Satellite SA30-203/ | 2022-03-28 16:41 | - | |
| Memory Size Reads Incorrectly/ | 2022-03-28 16:41 | - | |
| Memory Upgrade/ | 2022-03-28 16:41 | - | |
| Memory card stuck in Satellite Pro A200/ | 2022-03-28 16:41 | - | |
| Memory for Satellite M65/ | 2022-03-28 16:41 | - | |
| Memory modules for Toshiba/ | 2022-03-28 16:41 | - | |
| Memory question/ | 2022-03-28 16:41 | - | |
| Memory upgrade for TE2100/ | 2022-03-28 16:41 | - | |
| Memory upgrade questions/ | 2022-03-28 16:41 | - | |
| Mempry Upgrade for Toshiba M35X-S149/ | 2022-03-28 16:41 | - | |
| Merom Swap in an M115-S3094/ | 2022-03-28 16:41 | - | |
| Message reads PXE-E01- PCI Vendor and Device do not match/ | 2022-03-28 16:41 | - | |
| Messed up LCD/ | 2022-03-28 16:41 | - | |
| Middle east- Qosmio F55 F50/ | 2022-03-28 16:41 | - | |
| Mini Review of Toshiba M40 SF3/ | 2022-03-28 16:41 | - | |
| Mini wireless card/ | 2022-03-28 16:41 | - | |
| Mirror's Edge on x205-SliX/ | 2022-03-28 16:41 | - | |
| Missing 2 drivers with my A200 XP Install, help/ | 2022-03-28 16:41 | - | |
| Missing Battery Time Display/ | 2022-03-28 16:41 | - | |
| Missing Files on Recovery partion/ | 2022-03-28 16:41 | - | |
| Missing Toshiba Driver/ | 2022-03-28 16:41 | - | |
| Mobile GL960 Express with Core2Duo/ | 2022-03-28 16:41 | - | |
| Modded 15x.xx driver for X200 X205/ | 2022-03-28 16:41 | - | |
| Modded Vbios for Toshiba l745 -psk12l/ | 2022-03-28 16:41 | - | |
| Model 305D-S6848 Saw today, but question/ | 2022-03-28 16:41 | - | |
| Model L305D-S5934 - Questions issues/ | 2022-03-28 16:41 | - | |
| Model No equivalent of Sat A80-P4321/ | 2022-03-28 16:41 | - | |
| Model name number reason/ | 2022-03-28 16:41 | - | |
| Model part number and serial number not compatile!!/ | 2022-03-28 16:41 | - | |
| Modem can't connect/ | 2022-03-28 16:41 | - | |
| Modem problem/ | 2022-03-28 16:41 | - | |
| Mod for Insyde h2o 1.5 bios/ | 2022-03-28 16:41 | - | |
| Monitor Calibration/ | 2022-03-28 16:41 | - | |
| Monitor flikering and resetting !/ | 2022-03-28 16:41 | - | |
| Monitoring apps showing different CPU temps/ | 2022-03-28 16:41 | - | |
| Monitor is not working/ | 2022-03-28 16:41 | - | |
| More M40 Questions/ | 2022-03-28 16:41 | - | |
| More Performance X205 sli1/ | 2022-03-28 16:41 | - | |
| Most recent 14 16-10 laptops/ | 2022-03-28 16:41 | - | |
| Most similar to Satellite P775-S7215/ | 2022-03-28 16:41 | - | |
| Motherboard help/ | 2022-03-28 16:41 | - | |
| Mouse Touchpad Problem/ | 2022-03-28 16:41 | - | |
| Mouse pad ribbon cable clip/ | 2022-03-28 16:41 | - | |
| Mouse problem/ | 2022-03-28 16:41 | - | |
| Multimedia Keys on Toshiba X205/ | 2022-03-28 16:41 | - | |
| Multimedia NOT working on Toshiba A100, VISTA/ | 2022-03-28 16:41 | - | |
| Multitouch with Toshiba Portégé R500 (Alps Touchpad)/ | 2022-03-28 16:41 | - | |
| Music Youtube skipping whenever I move the computer/ | 2022-03-28 16:41 | - | |
| Must pull battery after using Express Media. Label issue/ | 2022-03-28 16:41 | - | |
| My 5105-S5101 does not boot/ | 2022-03-28 16:41 | - | |
| My Camera Assistant For Toshiba/ | 2022-03-28 16:41 | - | |
| My First Notebook, Toshiba M100/ | 2022-03-28 16:41 | - | |
| My Great G35-A650 is going to the shop/ | 2022-03-28 16:41 | - | |
| My Keyboard Errorr/ | 2022-03-28 16:41 | - | |
| My Led Screen is so dark.(The lights not working)/ | 2022-03-28 16:41 | - | |
| My M50 is making strange noises/ | 2022-03-28 16:41 | - | |
| My M55-S325 does not accept my recovery disk!/ | 2022-03-28 16:41 | - | |
| My M55-S3294 has arrived!/ | 2022-03-28 16:41 | - | |
| My M115-S3094 is very slow in Boot up and Shut down/ | 2022-03-28 16:41 | - | |
| My New Toshiba T115D-S1120 (pics)/ | 2022-03-28 16:41 | - | |
| My P105-S921 is warping already -(/ | 2022-03-28 16:41 | - | |
| My Personal Review of TOSHIBA Netbook NB555D-02Y/ | 2022-03-28 16:41 | - | |
| My Qosmio Q7272's Backlit keyboard's backlight won't light up/ | 2022-03-28 16:41 | - | |
| My R600-ST4203 Shipped Today/ | 2022-03-28 16:41 | - | |
| My Review of Toshiba Satellite A40/ | 2022-03-28 16:41 | - | |
| My Review of the X775-Q7380/ | 2022-03-28 16:41 | - | |
| MySafe...GONE/ | 2022-03-28 16:41 | - | |
| My Satellite 1800 S254 is toast/ | 2022-03-28 16:41 | - | |
| My Satellite has been muted/ | 2022-03-28 16:41 | - | |
| My Satellite p105-s9722 won't turn on/ | 2022-03-28 16:41 | - | |
| My Screen Wont Come On!!!/ | 2022-03-28 16:41 | - | |
| My Toshiba A210-11P should be arriving tomorrow!/ | 2022-03-28 16:41 | - | |
| My Toshiba Laptop!/ | 2022-03-28 16:41 | - | |
| My Toshiba Laptop's Power and Battery Problem/ | 2022-03-28 16:41 | - | |
| My Toshiba Portege's fan is always on!!/ | 2022-03-28 16:41 | - | |
| My Toshiba Portege M200 won't start, overheated/ | 2022-03-28 16:41 | - | |
| My Toshiba Satellite A500-ST6621 shipping/ | 2022-03-28 16:41 | - | |
| My Toshiba Tecra A5/ | 2022-03-28 16:41 | - | |
| My Toshiba a135-s2276/ | 2022-03-28 16:41 | - | |
| My Toshiba keeps restarting after showing a blue Screen!/ | 2022-03-28 16:41 | - | |
| My X205's Touchpad has gone crazy!/ | 2022-03-28 16:41 | - | |
| My X205-SLi3 arrives today/ | 2022-03-28 16:41 | - | |
| My Z key broke off [Tecra A4] -'(/ | 2022-03-28 16:41 | - | |
| My battery won't charge on my Toshiba/ | 2022-03-28 16:41 | - | |
| My experience with customized A130-ST1312/ | 2022-03-28 16:41 | - | |
| My fan is loud and goes off often/ | 2022-03-28 16:41 | - | |
| My laptop's shocking me/ | 2022-03-28 16:41 | - | |
| My laptop's sound is gone/ | 2022-03-28 16:41 | - | |
| My laptop TOSHIBA M30X gone for repair/ | 2022-03-28 16:41 | - | |
| My laptop is smoking!!!/ | 2022-03-28 16:41 | - | |
| My laptop won't turn on!/ | 2022-03-28 16:41 | - | |
| My new Toshiba Satellite M305 has problems i don't know how to fix/ | 2022-03-28 16:41 | - | |
| My next laptop- Toshiba Qosmio G20/ | 2022-03-28 16:41 | - | |
| My press play keys, stop, next, etc. are not working, help!/ | 2022-03-28 16:41 | - | |
| My r100 Won't surf on Batteries/ | 2022-03-28 16:41 | - | |
| My screen keeps blacking out on my/ | 2022-03-28 16:41 | - | |
| My sli1's GPU clocks get floored with sli disabled/ | 2022-03-28 16:41 | - | |
| My toshiba satellite M115-S3094 was bought defective.. please read/ | 2022-03-28 16:41 | - | |
| My x205-s9349!/ | 2022-03-28 16:41 | - | |
| N200 Netbook/ | 2022-03-28 16:41 | - | |
| NB100 - are you happy with it/ | 2022-03-28 16:41 | - | |
| NB200 wwan not working... help/ | 2022-03-28 16:41 | - | |
| NB205-N310 Cigarette Lighter Adapter/ | 2022-03-28 16:41 | - | |
| NB205-N312 BL + 802.11n/ | 2022-03-28 16:41 | - | |
![[DIR]](/icons/binary.gif) | NB205 bootpriorty.exe/ | 2022-03-28 16:41 | - | |
| NB205 netbook available to order/ | 2022-03-28 16:41 | - | |
| NB205 overzealous shock protection/ | 2022-03-28 16:41 | - | |
| NB205 owners/ | 2022-03-28 16:41 | - | |
| NB305-410 and 2gb of RAM, worth it/ | 2022-03-28 16:41 | - | |
| NB305 - Bad keyboard/ | 2022-03-28 16:41 | - | |
| NB305-N310 vs T115 same keyboard/ | 2022-03-28 16:41 | - | |
| NB520 more memory/ | 2022-03-28 16:41 | - | |
| NBR Toshiba Interview - Give Us your Questions/ | 2022-03-28 16:41 | - | |
| N E 1 compared the 8700GT vs SLI/ | 2022-03-28 16:41 | - | |
| NEEED Help Plezz/ | 2022-03-28 16:41 | - | |
| NEW 215-S7444 at circuit city/ | 2022-03-28 16:41 | - | |
| NEW BIOS 1.60 for P205 P200 X205s/ | 2022-03-28 16:41 | - | |
| NEW LAPTOP -Application Cleanup/ | 2022-03-28 16:41 | - | |
| NEW Toshiba p100 p105 bios out!/ | 2022-03-28 16:41 | - | |
| NHC and CPU temp/ | 2022-03-28 16:41 | - | |
| NHC and acpi files/ | 2022-03-28 16:41 | - | |
| NIC for Satellite A105 S4384/ | 2022-03-28 16:41 | - | |
| N Router for my x205/ | 2022-03-28 16:41 | - | |
| NVIDIA 7600 256 MB dedicated memory/ | 2022-03-28 16:41 | - | |
| NVIDIA video and chipset driver release for the Q706 Q708/ | 2022-03-28 16:41 | - | |
| NYT- 'Toshiba Lays Claim to World s Lightest Laptop'/ | 2022-03-28 16:41 | - | |
| Need ACPI Common Module A105-S2051/ | 2022-03-28 16:41 | - | |
| Need A New Lap Top/ | 2022-03-28 16:41 | - | |
| Need A Review for Toshiba Satellite L35-S2171/ | 2022-03-28 16:41 | - | |
| Need BIOS for Qosmio laptop F20-111/ | 2022-03-28 16:41 | - | |
| Need DMI update utility for P100 p105 series/ | 2022-03-28 16:41 | - | |
| Need Help!!!!/ | 2022-03-28 16:41 | - | |
| Need Help!! (Satellite A200)/ | 2022-03-28 16:41 | - | |
| Need Help!/ | 2022-03-28 16:41 | - | |
| Need Help/ | 2022-03-28 16:41 | - | |
| Need Help; Qosmio X300-13o/ | 2022-03-28 16:41 | - | |
| Need Help Finding a Important Driver File/ | 2022-03-28 16:41 | - | |
| Need Help Toshiba A130 Wireless Problem/ | 2022-03-28 16:41 | - | |
| Need Help With L25-1192, RAM Upgrade Problem/ | 2022-03-28 16:41 | - | |
| Need Help With Toshiba Portege P2010/ | 2022-03-28 16:41 | - | |
| Need Help X205/ | 2022-03-28 16:41 | - | |
| Need Help replacing the FAN on the M35-S456/ | 2022-03-28 16:41 | - | |
| Need Help with Toshiba M40/ | 2022-03-28 16:41 | - | |
| Need Help with Toshiba Satellite EZ Button/ | 2022-03-28 16:41 | - | |
| Need Help with Weird Wireless Problem on my M50/ | 2022-03-28 16:41 | - | |
| Need Info On Toshiba and Batteries/ | 2022-03-28 16:41 | - | |
| Need Information about Toshiba laptop P770/ | 2022-03-28 16:41 | - | |
| Need LCD TV Computer Hook Up Help Please/ | 2022-03-28 16:41 | - | |
| Need P35-S609 hard drive replacement instructions/ | 2022-03-28 16:41 | - | |
| Need Recovery Disk 2 for Toshiba A135-S2246/ | 2022-03-28 16:41 | - | |
| Need Sum help/ | 2022-03-28 16:41 | - | |
| Need To Wipe My Hardrive Clean/ | 2022-03-28 16:41 | - | |
| Need Toshiba A70 Help - very easy/ | 2022-03-28 16:41 | - | |
| Need Toshiba Notebook with 128 Mb of Video Memory/ | 2022-03-28 16:41 | - | |
| Need Windows Vista Disc/ | 2022-03-28 16:41 | - | |
| Need XP Drivers A215-S4697 Toshiba/ | 2022-03-28 16:41 | - | |
| Need a Fresh Start- Q s re how to/ | 2022-03-28 16:41 | - | |
| Need a User manual for Tecra/ | 2022-03-28 16:41 | - | |
| Need a cooling pad for qosmio x300-13w/ | 2022-03-28 16:41 | - | |
| Need advice on removing a Toshiba P50T hi-res screen glass/ | 2022-03-28 16:41 | - | |
| Need a new Notebook ... decisions decisions -S/ | 2022-03-28 16:41 | - | |
| Need a suggestion/ | 2022-03-28 16:41 | - | |
| Need computer help- laptop is plugged in but running from bat power and not charging/ | 2022-03-28 16:41 | - | |
| Need computer under $CA 900/ | 2022-03-28 16:41 | - | |
| Need driver for HL-DT-ST DVDRAM GSA-U10N/ | 2022-03-28 16:41 | - | |
| Needed Express Media Player for Toshiba Satellite/ | 2022-03-28 16:41 | - | |
| Need express media player recovery backup cd iso image/ | 2022-03-28 16:41 | - | |
| Need help - No sound/ | 2022-03-28 16:41 | - | |
| Need help Bluetooth has not started/ | 2022-03-28 16:41 | - | |
| Need help Choosin a Toshiba model/ | 2022-03-28 16:41 | - | |
| Need help Modding unlocking hidden options c655d s5120 Bios/ | 2022-03-28 16:41 | - | |
| Need help P205 downgrade WINXP/ | 2022-03-28 16:41 | - | |
| Need help about Toshiba M50 Keyboard/ | 2022-03-28 16:41 | - | |
| Need help deciding on the Qosmio F45 series PLEASE!/ | 2022-03-28 16:41 | - | |
| Need help finding right driver for Toshiba Satellite A205-S5814/ | 2022-03-28 16:41 | - | |
| Need help fixing a friends Satellite P105/ | 2022-03-28 16:41 | - | |
| Need help for dumping VGA bios/ | 2022-03-28 16:41 | - | |
| Need help identifying bloatware on new Toshiba E205/ | 2022-03-28 16:41 | - | |
| Need help on A305-S6916 Please/ | 2022-03-28 16:41 | - | |
| Need help on P100 DVD drive problem/ | 2022-03-28 16:41 | - | |
| Need help on problem with shift key hosing the keyboard on M45/ | 2022-03-28 16:41 | - | |
| Need help overclocking an A8 Llano with Toshiba's watered down AMD Control Center/ | 2022-03-28 16:41 | - | |
| Need help running Battlefield 2/ | 2022-03-28 16:41 | - | |
| Need help taking apart Toshiba Portege S100/ | 2022-03-28 16:41 | - | |
| Need help to download wireless netword driver toshiba satellite a500d-10e/ | 2022-03-28 16:41 | - | |
| Need help with A105 Modem driver/ | 2022-03-28 16:41 | - | |
| Need help with Keyboard drivers/ | 2022-03-28 16:41 | - | |
| Need help with S-video X205/ | 2022-03-28 16:41 | - | |
| Need help with Sat. 5205-s703/ | 2022-03-28 16:41 | - | |
| Need help with Satellite P15-S479/ | 2022-03-28 16:41 | - | |
| Need help with Toshiba Satellite L305-S5875 laptop fan installation/ | 2022-03-28 16:41 | - | |
| Need help with Toshiba satellite l755/ | 2022-03-28 16:41 | - | |
| Need help with aToshiba P15-S479/ | 2022-03-28 16:41 | - | |
| Need help with an X205/ | 2022-03-28 16:41 | - | |
| Need help with my Qosmio G45/ | 2022-03-28 16:41 | - | |
| Need help with my Satellite M45-S355/ | 2022-03-28 16:41 | - | |
| Need help with my X205/ | 2022-03-28 16:41 | - | |
| Need help with my laptop/ | 2022-03-28 16:41 | - | |
| Need help with older toshiba laptop/ | 2022-03-28 16:41 | - | |
| Need help with overclocking/ | 2022-03-28 16:41 | - | |
| Needing Drivers/ | 2022-03-28 16:41 | - | |
| Needing a new batt/ | 2022-03-28 16:41 | - | |
| Needing help/ | 2022-03-28 16:41 | - | |
| Need monitor specs on A215/ | 2022-03-28 16:41 | - | |
| Need older bios for Satellite M40 JM3/ | 2022-03-28 16:41 | - | |
| Need opinions on Satellite L655-13V/ | 2022-03-28 16:41 | - | |
| Need recovery CD for Satellite A205/ | 2022-03-28 16:41 | - | |
| Need recovery disks for X205-S9359/ | 2022-03-28 16:41 | - | |
| Need restore disk or drivers for A25/ | 2022-03-28 16:41 | - | |
| Need screen for C855D-S5307 curious if anyone can confirm part number or supplier/ | 2022-03-28 16:41 | - | |
| Need some Toshiba drivers help!!!/ | 2022-03-28 16:41 | - | |
| Need some help - Toshiba m40-yp3 - I think GPU is fried...Geforce GO 6600/ | 2022-03-28 16:41 | - | |
| Need some help on a p100-sd4/ | 2022-03-28 16:41 | - | |
| Need some help with RAM upgrade in m55-s331/ | 2022-03-28 16:41 | - | |
| Need some help with a Toshiba Sat A205/ | 2022-03-28 16:41 | - | |
| Need some new Drivers/ | 2022-03-28 16:41 | - | |
| Need supervisor password for Satellite A30/ | 2022-03-28 16:41 | - | |
| Need to buy notebook, price not issue/ | 2022-03-28 16:41 | - | |
| Need to find compatible CPU FAN for my X205/ | 2022-03-28 16:41 | - | |
| Need to replace 2200bg mini in Toshiba/ | 2022-03-28 16:41 | - | |
| Need to replace a motherboard in a Toshiba Laptop/ | 2022-03-28 16:41 | - | |
| Need to setup XP on my U405-S2856/ | 2022-03-28 16:41 | - | |
| Need video drivers for X205/ | 2022-03-28 16:41 | - | |
| Need your help/ | 2022-03-28 16:41 | - | |
| Need your help before buy Toshiba Satellite Radius 15/ | 2022-03-28 16:41 | - | |
| Need your help for my Toshiba Laptop/ | 2022-03-28 16:41 | - | |
| Need your help to decide/ | 2022-03-28 16:41 | - | |
| Negative reviews of Qosmio X505-Q880 890/ | 2022-03-28 16:41 | - | |
| Netbook NB100/ | 2022-03-28 16:41 | - | |
| Network boot a Satellite Pro A300-00J/ | 2022-03-28 16:41 | - | |
| Network problem on p305/ | 2022-03-28 16:41 | - | |
| Never Again - Bye Bye Toshiba/ | 2022-03-28 16:41 | - | |
| New (refurb) M60 - DVD ram problem/ | 2022-03-28 16:41 | - | |
| New A105 - 2 small issues/ | 2022-03-28 16:41 | - | |
| New A200GE-26p Strange Anomly/ | 2022-03-28 16:41 | - | |
| New A660 1DZ blu-ray playback problem/ | 2022-03-28 16:41 | - | |
| New A665-S6095 questions/ | 2022-03-28 16:41 | - | |
| New AC adapter messing up my mousepad!!1/ | 2022-03-28 16:41 | - | |
| New BIOS 1.7/ | 2022-03-28 16:41 | - | |
| New BIOS update for the Satelite T11x T13x out there/ | 2022-03-28 16:41 | - | |
| New Battery won't charge (portege 4010)/ | 2022-03-28 16:41 | - | |
| New Core i3 Toshiba Satellite L510-S4318/ | 2022-03-28 16:41 | - | |
| New Drivers X305/ | 2022-03-28 16:41 | - | |
| New F55-Q504/ | 2022-03-28 16:41 | - | |
| New HD/ | 2022-03-28 16:41 | - | |
| New HD problems/ | 2022-03-28 16:41 | - | |
| New Hard drive. 5400Rpm or 7200Rpm/ | 2022-03-28 16:41 | - | |
| New Here and could use some help!!!/ | 2022-03-28 16:41 | - | |
| New Hitachi 200GB 7200RPM Drive/ | 2022-03-28 16:41 | - | |
| New HrdDsk for A75; Use Recovery/ | 2022-03-28 16:41 | - | |
| New Intel Graphics Driver for Vista!/ | 2022-03-28 16:41 | - | |
| New LCD screen/ | 2022-03-28 16:41 | - | |
| New Laptop - All Those Darn Stickers!!/ | 2022-03-28 16:41 | - | |
| New Laptop. another Vista Plz/ | 2022-03-28 16:41 | - | |
| New Line of Laptops/ | 2022-03-28 16:41 | - | |
| New M2 Overheating - Please Help!!/ | 2022-03-28 16:41 | - | |
| New M45-S351 Extended Warranty/ | 2022-03-28 16:41 | - | |
| New Monitor won't display at native resolution, help please/ | 2022-03-28 16:41 | - | |
| New Motherboard or New Laptop/ | 2022-03-28 16:41 | - | |
| New Nvidia Drivers v.270.28/ | 2022-03-28 16:41 | - | |
| New Nvidia Qosmios on Amazon/ | 2022-03-28 16:41 | - | |
| New Nvidia beta Drivers 270.51/ | 2022-03-28 16:41 | - | |
| New Offers/ | 2022-03-28 16:41 | - | |
| New Owner of Satellite Z830 10T UltraBook Seeking General Advice Etc/ | 2022-03-28 16:41 | - | |
| New Owner of a A105-4211. Need help!/ | 2022-03-28 16:41 | - | |
| New Portege Z830/ | 2022-03-28 16:41 | - | |
| New Qosmio - Plugged in, not charging Why/ | 2022-03-28 16:41 | - | |
| New Qosmio F55- Where to possibly get/ | 2022-03-28 16:41 | - | |
| New Qosmio G35AV600 Owner!A few questions/ | 2022-03-28 16:41 | - | |
| New Qosmio G45 AV690 report/ | 2022-03-28 16:41 | - | |
| New Qosmio X505s/ | 2022-03-28 16:41 | - | |
| New Qosmio gaming notebook out - X305-Q725/ | 2022-03-28 16:41 | - | |
| New R500 models/ | 2022-03-28 16:41 | - | |
| New R835-P56x owner with screen issues/ | 2022-03-28 16:41 | - | |
| New S520 Thoughts/ | 2022-03-28 16:41 | - | |
| New SSD Question and Toshiba Installed Bloatware/ | 2022-03-28 16:41 | - | |
| New SSD in Qosmio x775-q7272/ | 2022-03-28 16:41 | - | |
| New Sat S111 acting up with DLink Wireless Card/ | 2022-03-28 16:41 | - | |
| New Satellite® - A300 - A305-S6864 with C2D P8400...FSB1066!/ | 2022-03-28 16:41 | - | |
| New Satellite A350 - dirt inside LCD/ | 2022-03-28 16:41 | - | |
| New Satellite A500 deal/ | 2022-03-28 16:41 | - | |
| New Satellite A665-S5199X owner/ | 2022-03-28 16:41 | - | |
| New Satellite M40 (PSM40C-YP300E) released/ | 2022-03-28 16:41 | - | |
| New Satellite M645 fan seems pretty loud and annoying/ | 2022-03-28 16:41 | - | |
| New Satellite Processors/ | 2022-03-28 16:41 | - | |
| New Satellite U200 - couple of minor problems/ | 2022-03-28 16:41 | - | |
| New TOSHIBA QOSMIO X7 70 107 at pc world, UK/ | 2022-03-28 16:41 | - | |
| New TOSHIBA R830 R480 and R850 packing Sandy Bridge/ | 2022-03-28 16:41 | - | |
| New Tecra A2/ | 2022-03-28 16:41 | - | |
| New Tecra A8 T5600 high CPU temperature!!!/ | 2022-03-28 16:41 | - | |
| New Tecra M8 laptop owner/ | 2022-03-28 16:41 | - | |
| New Toshi Laptop owner with 's/ | 2022-03-28 16:41 | - | |
| New Toshiba's discounts!!!/ | 2022-03-28 16:41 | - | |
| New Toshiba - IE7 freeze problem/ | 2022-03-28 16:41 | - | |
| New Toshiba/ | 2022-03-28 16:41 | - | |
| New Toshiba A305-6898/ | 2022-03-28 16:41 | - | |
| New Toshiba A505 - Seems slower than old A105/ | 2022-03-28 16:41 | - | |
| New Toshiba Display Driver on 8 08 08/ | 2022-03-28 16:41 | - | |
| New Toshiba Ivy Bridge Series - Portege R930 etc/ | 2022-03-28 16:41 | - | |
| New Toshiba M400 Tablet PC Fan always run in fast speed/ | 2022-03-28 16:41 | - | |
| New Toshiba SLI2 and SLI4/ | 2022-03-28 16:41 | - | |
| New Toshiba Satellite A300-14R Frozes alot!/ | 2022-03-28 16:41 | - | |
| New Toshiba Satellite M60 17 Notebook/ | 2022-03-28 16:41 | - | |
| New Toshiba Satellite X200 for Canada/ | 2022-03-28 16:41 | - | |
| New Toshiba Satellites Are Coming Soon!/ | 2022-03-28 16:41 | - | |
| New Toshiba Slow/ | 2022-03-28 16:41 | - | |
| New Toshiba T135 Available/ | 2022-03-28 16:41 | - | |
| New Toshiba laptop buyer, very concerned about battery life/ | 2022-03-28 16:41 | - | |
| New Toshiba laptops with 7900GTX available (--/ | 2022-03-28 16:41 | - | |
| New Toshiba lineup/ | 2022-03-28 16:41 | - | |
| New Toshiba models exclusive to Canada/ | 2022-03-28 16:41 | - | |
| New Toshiba need drivers for XP/ | 2022-03-28 16:41 | - | |
| New Toshiba problem - Nvidia driver has stopped working and have recovered/ | 2022-03-28 16:41 | - | |
| New Toshiba satellite Core2 spec/ | 2022-03-28 16:41 | - | |
| New X205-S9349/ | 2022-03-28 16:41 | - | |
| New X305-Q725 model on Newegg/ | 2022-03-28 16:41 | - | |
| New X305 Reviews Worldwide availability/ | 2022-03-28 16:41 | - | |
| New X305 configuration at Best Buy/ | 2022-03-28 16:41 | - | |
| New X505-893 and big problem/ | 2022-03-28 16:41 | - | |
| New and much improved P105-9312/ | 2022-03-28 16:41 | - | |
| Newb- X205-SLI1 - Drive Upgrade/ | 2022-03-28 16:41 | - | |
| Newbie advice on new X300 Qosimo/ | 2022-03-28 16:41 | - | |
| Newbie having problem with extended speakers for Toshiba x200! Please help!/ | 2022-03-28 16:41 | - | |
| Newbie here-info needed on Toshiba/ | 2022-03-28 16:41 | - | |
| Newbie seeks clean install guide for Toshiba U305-S5097.Please HELP/ | 2022-03-28 16:41 | - | |
| Newbie to this forum with a few questions about my new laptop!/ | 2022-03-28 16:41 | - | |
| New culv machines/ | 2022-03-28 16:41 | - | |
| New display driver form nvidia 179.48/ | 2022-03-28 16:41 | - | |
| New drivers for Toshiba Tecra A2 to install IPod Touch/ | 2022-03-28 16:41 | - | |
| New driver v167.26/ | 2022-03-28 16:41 | - | |
| Newer A305 - USB ports failing!/ | 2022-03-28 16:41 | - | |
| Newer Intel CPU's/ | 2022-03-28 16:41 | - | |
| New here/ | 2022-03-28 16:41 | - | |
| New internal wifi card/ | 2022-03-28 16:41 | - | |
| Newly bought M40-SF3 with annoying clicking sound/ | 2022-03-28 16:41 | - | |
| New notebook owner with 's/ | 2022-03-28 16:41 | - | |
| New owner of a Qosmio X505 Q894!/ | 2022-03-28 16:41 | - | |
| New purchase/ | 2022-03-28 16:41 | - | |
| New tecra A6 and Sat 200 arrived -D/ | 2022-03-28 16:41 | - | |
| New to Intel Toshiba, dual channel RAM question/ | 2022-03-28 16:41 | - | |
| New to me Toshiba Satellite A105-S4064, looking to upgrade/ | 2022-03-28 16:41 | - | |
| New toshiba's announced may14th/ | 2022-03-28 16:41 | - | |
| New toshiba won't recognize externals/ | 2022-03-28 16:41 | - | |
| New to the forums !/ | 2022-03-28 16:41 | - | |
| New to this/ | 2022-03-28 16:41 | - | |
| New x205s/ | 2022-03-28 16:41 | - | |
| Next-Gen Qosmio X500's/ | 2022-03-28 16:41 | - | |
| Next Generation Of Qosmios/ | 2022-03-28 16:41 | - | |
| Nid Help Badly..-(( with my toshiba satellite 2455-S305/ | 2022-03-28 16:41 | - | |
| No A100-V3 on Toshibadirect.ca/ | 2022-03-28 16:41 | - | |
| No Audio - Toshiba Satellite M35X-S163 - XP Pro/ | 2022-03-28 16:41 | - | |
| No Bluetooth/ | 2022-03-28 16:41 | - | |
| No Bootable Device/ | 2022-03-28 16:41 | - | |
| No CD RW function on 5105 S607/ | 2022-03-28 16:41 | - | |
| No D drive/ | 2022-03-28 16:41 | - | |
| No Drivers For Satellite A500-ST6647/ | 2022-03-28 16:41 | - | |
| No Fax-Modem on the Qosmio/ | 2022-03-28 16:41 | - | |
| No HDD recovery area/ | 2022-03-28 16:41 | - | |
| No Hibernate, Standby, or screen savers/ | 2022-03-28 16:41 | - | |
| No Led Backlight After Replacement Of Cracked Screen!/ | 2022-03-28 16:41 | - | |
| No Sound For Satellie M50 !/ | 2022-03-28 16:41 | - | |
| No Sound from Left Speakers - Toshiba A305-S6864/ | 2022-03-28 16:41 | - | |
| No W7 SP1 upgrade notification in my Toshiba yet/ | 2022-03-28 16:41 | - | |
| No WiFi access with battery poqer on Balanced power plan/ | 2022-03-28 16:41 | - | |
| No audio Through HDMI output/ | 2022-03-28 16:41 | - | |
| No audio through HDMI cable with Toshiba Satellite/ | 2022-03-28 16:41 | - | |
| No backlight on P105/ | 2022-03-28 16:41 | - | |
| No boot on A305/ | 2022-03-28 16:41 | - | |
| No graphics when turning on the computer/ | 2022-03-28 16:41 | - | |
| Noise & Satellite A135-S4527 WinXP downgrade/ | 2022-03-28 16:41 | - | |
| Noisy Fan on Satellite P15-S420/ | 2022-03-28 16:41 | - | |
| No life on screen Equium M50-192/ | 2022-03-28 16:41 | - | |
| No more S2 !/ | 2022-03-28 16:41 | - | |
| Non-glossy keyboard for U405/ | 2022-03-28 16:41 | - | |
| No network detected and problem in device manager/ | 2022-03-28 16:41 | - | |
| No restart out of standby mode/ | 2022-03-28 16:41 | - | |
| No sound, please help/ | 2022-03-28 16:41 | - | |
| No sound in XP/ | 2022-03-28 16:41 | - | |
| No sound on X205-sli1/ | 2022-03-28 16:41 | - | |
| No sound on my Toshiba p100 with XP/ | 2022-03-28 16:41 | - | |
| Notebook Brand Comparison/ | 2022-03-28 16:41 | - | |
| Notebook cooler's that work well for toshibas/ | 2022-03-28 16:41 | - | |
| Notebook dead after BIOS flash/ | 2022-03-28 16:41 | - | |
| Notebook usage!!!/ | 2022-03-28 16:41 | - | |
| Notebook will not turn on/ | 2022-03-28 16:41 | - | |
| Noticable volume issue/ | 2022-03-28 16:41 | - | |
| Not sure what kind of help I need!/ | 2022-03-28 16:41 | - | |
| No video with Protege S100/ | 2022-03-28 16:41 | - | |
| No wireless networks were found in range. [Virus Related] [Satellite m45-s351]/ | 2022-03-28 16:41 | - | |
| Now that you've owned the M40 for a while/ | 2022-03-28 16:41 | - | |
| Number of dead pixels needed for replacement/ | 2022-03-28 16:41 | - | |
| Nvidia GeForce Go 7900 GS Video Driver/ | 2022-03-28 16:41 | - | |
| Nvidia Verde 257.21/ | 2022-03-28 16:41 | - | |
| Nvidia driver advice/ | 2022-03-28 16:41 | - | |
| OC Satellite A500 with SetFSB/ | 2022-03-28 16:41 | - | |
| OCing CPU in x505 Qosmio with Set FSB/ | 2022-03-28 16:41 | - | |
| OK, I have a SLI problem/ | 2022-03-28 16:41 | - | |
| OK, how bad is it/ | 2022-03-28 16:41 | - | |
| OS help with an old Toshiba 2655XDVD/ | 2022-03-28 16:41 | - | |
| OUCH cooling fan died BIOS help/ | 2022-03-28 16:41 | - | |
| Oc'ing 9700 gts/ | 2022-03-28 16:41 | - | |
| Odd M45 Question/ | 2022-03-28 16:41 | - | |
| Odd Toshiba Question/ | 2022-03-28 16:41 | - | |
| Odd Video Issues with Toshiba A100/ | 2022-03-28 16:41 | - | |
| Odd processors/ | 2022-03-28 16:41 | - | |
| Off center keyboards/ | 2022-03-28 16:41 | - | |
| Offical supporting TOshiba website backs to work/ | 2022-03-28 16:41 | - | |
| Official P300 P305 UPDATES AND PROBLEMS/ | 2022-03-28 16:41 | - | |
| Official Satellite P Series Laptops/ | 2022-03-28 16:41 | - | |
| Official Toshiba Nvidia 265.89 drivers for x505/ | 2022-03-28 16:41 | - | |
| Official X500 Owner's Lounge!/ | 2022-03-28 16:41 | - | |
| Official x300 x305 Owner's Lounge/ | 2022-03-28 16:41 | - | |
| Oh no! Did I just kill my x205/ | 2022-03-28 16:41 | - | |
| Oh where oh where is a M5 review/ | 2022-03-28 16:41 | - | |
| Ok, I ordered an A4/ | 2022-03-28 16:41 | - | |
| Ok so i have formatted my ST9012/ | 2022-03-28 16:41 | - | |
| Ok to change partition sizes when restoring to factory setting/ | 2022-03-28 16:41 | - | |
| Old P25 HD question/ | 2022-03-28 16:41 | - | |
| Old Qosmio Laptop in 2020/ | 2022-03-28 16:41 | - | |
| Old Tosh convert IDE to SSD/ | 2022-03-28 16:41 | - | |
| Old Toshiba, Satellite Pro 6100, How to enter BIOS/ | 2022-03-28 16:41 | - | |
| Old Toshiba Satellite/ | 2022-03-28 16:41 | - | |
| Old Tosh wont boot Please Help!/ | 2022-03-28 16:41 | - | |
| Older Satellite reinstall- 32-bit or 64-bit/ | 2022-03-28 16:41 | - | |
| Older Toshiba Sat M30 BIOS Upgrade Difficulties/ | 2022-03-28 16:41 | - | |
| Older Toshiba Upgrade help/ | 2022-03-28 16:41 | - | |
| Oldie/ | 2022-03-28 16:41 | - | |
| Old laptop with a problem!/ | 2022-03-28 16:41 | - | |
| Old portege 3410ct docking station/ | 2022-03-28 16:41 | - | |
| Old satellite 2100cds battery problem/ | 2022-03-28 16:41 | - | |
| Old satellite A60/ | 2022-03-28 16:41 | - | |
| On Q706, using sli 9800m GTS and the 9400m GT for physx/ | 2022-03-28 16:41 | - | |
| On Screen Green Overlay Volume Bars/ | 2022-03-28 16:41 | - | |
| One Note/ | 2022-03-28 16:41 | - | |
| One of my laptop keys has stopped working/ | 2022-03-28 16:41 | - | |
| One of the four pillars that lifts my Toshiba up from the flat surface fell out/ | 2022-03-28 16:41 | - | |
| One of those on my list- X305 X500/ | 2022-03-28 16:41 | - | |
| One way Access is denied/ | 2022-03-28 16:41 | - | |
| One year with the Portege R705/ | 2022-03-28 16:41 | - | |
| Online retailers selling X305-Q706/ | 2022-03-28 16:41 | - | |
| Oops... Regarding Previous Post/ | 2022-03-28 16:41 | - | |
| Oops I tipped a glass of water on my laptop/ | 2022-03-28 16:41 | - | |
| OpenGL 2.0 for Intel Integrated Graphics/ | 2022-03-28 16:41 | - | |
| Opening a Toshiba to clean the case!/ | 2022-03-28 16:41 | - | |
| Operation Successful-new I7-940xm - Qosmio x505/ | 2022-03-28 16:41 | - | |
| Opinion 9700m vs 9600m/ | 2022-03-28 16:41 | - | |
| Opinion on Toshiba Qosmio G25-Av513/ | 2022-03-28 16:41 | - | |
| Opinions needed on Toshiba Satellite M55 (new)/ | 2022-03-28 16:41 | - | |
| Opinions of Tecra a6/ | 2022-03-28 16:41 | - | |
| Opinions on Satellite M500 Series/ | 2022-03-28 16:41 | - | |
| Opinions on Toshiba A70-RX1/ | 2022-03-28 16:41 | - | |
| Opinions on the Toshiba Qosmio G30-201 notebook/ | 2022-03-28 16:41 | - | |
| Opinions on the new Tecra A7/ | 2022-03-28 16:41 | - | |
| Optical Drive and Network Adapter/ | 2022-03-28 16:41 | - | |
| Optical drive no longer works [X205-SLi4]/ | 2022-03-28 16:41 | - | |
| Optical out (P105)/ | 2022-03-28 16:41 | - | |
| Options for now useless HD DVD drive in X205/ | 2022-03-28 16:41 | - | |
| Ordered a M2, any tips/ | 2022-03-28 16:41 | - | |
| Ordered a M100/ | 2022-03-28 16:41 | - | |
| Ordered a custom A205 - on sale from Toshiba/ | 2022-03-28 16:41 | - | |
| Ordered my Toshiba today/ | 2022-03-28 16:41 | - | |
| Oscar Wild/ | 2022-03-28 16:41 | - | |
| Out of no where, will not connect wirelessly/ | 2022-03-28 16:41 | - | |
| Outrage - Portege r200 and Windows 7 incompatibility/ | 2022-03-28 16:41 | - | |
| Overclock Toshiba pentium 4 3.06GHz/ | 2022-03-28 16:41 | - | |
| Overclock X205-SLi1/ | 2022-03-28 16:41 | - | |
| Overclock help for x205/ | 2022-03-28 16:41 | - | |
| Overclocking (old) Satellite 2715/ | 2022-03-28 16:41 | - | |
| Overclocking Satellite A60-S135/ | 2022-03-28 16:41 | - | |
| Overclocking a X205-S7483/ | 2022-03-28 16:41 | - | |
| Overclocking the 8700mGT/ | 2022-03-28 16:41 | - | |
| Overheating/ | 2022-03-28 16:41 | - | |
| Overheating GPU X205 Sli3/ | 2022-03-28 16:41 | - | |
| Over heating problem, need help under clocking or undervolting/ | 2022-03-28 16:41 | - | |
| Owners of Toshiba M645 with 12 cell or extended 6 cell battery, please read/ | 2022-03-28 16:41 | - | |
| P10-610/ | 2022-03-28 16:41 | - | |
| P10-EE1 - with ATI 9700 !!!/ | 2022-03-28 16:41 | - | |
| P15-479 widescreen change to regular screen/ | 2022-03-28 16:41 | - | |
| P15 Help Please/ | 2022-03-28 16:41 | - | |
| P15 and SD Card/ | 2022-03-28 16:41 | - | |
| P15 s420 - rebate status/ | 2022-03-28 16:41 | - | |
| P25-607 touchpad/ | 2022-03-28 16:41 | - | |
| P25-S670 Dead/ | 2022-03-28 16:41 | - | |
| P25-S676 Overheating issue/ | 2022-03-28 16:41 | - | |
| P25 Carrying Case/ | 2022-03-28 16:41 | - | |
| P25 S509/ | 2022-03-28 16:41 | - | |
| P25 display problem strange/ | 2022-03-28 16:41 | - | |
| P25 port replicator/ | 2022-03-28 16:41 | - | |
| P30-110 acc damage/ | 2022-03-28 16:41 | - | |
| P30 and P35 Motherboard Interchangability/ | 2022-03-28 16:41 | - | |
| P30 battery life/ | 2022-03-28 16:41 | - | |
| P30 is there a TIM between the CPU and the HEATSINK/ | 2022-03-28 16:41 | - | |
| P30 overheating shuting off/ | 2022-03-28 16:41 | - | |
| P35-s629 discrete graphics/ | 2022-03-28 16:41 | - | |
| P35 Problems/ | 2022-03-28 16:41 | - | |
| P50-B-10V no power on and spark/ | 2022-03-28 16:41 | - | |
| P50-B UHD 3840x2160 Screen Panel Model Number/ | 2022-03-28 16:41 | - | |
| P50 Battery Life with Integrated Graphics vs. NVIDIA® GeForce® GT 740M/ | 2022-03-28 16:41 | - | |
| P50 Review/ | 2022-03-28 16:41 | - | |
| P55T-B5262 VS P55T-B5156/ | 2022-03-28 16:41 | - | |
| P55T 4K - Confusion/ | 2022-03-28 16:41 | - | |
| P75-A7200 Support/ | 2022-03-28 16:41 | - | |
| P100-112 113/ | 2022-03-28 16:41 | - | |
| P100-160 CPU Upgrade/ | 2022-03-28 16:41 | - | |
| P100-374/ | 2022-03-28 16:41 | - | |
| P100-9012 Battery Problem/ | 2022-03-28 16:41 | - | |
| P100-sd8/ | 2022-03-28 16:41 | - | |
| P100 Audio Driver for XP/ | 2022-03-28 16:41 | - | |
| P100 Bluetooth mouse problem/ | 2022-03-28 16:41 | - | |
| P100 Customized or P105 S9312/ | 2022-03-28 16:41 | - | |
| P100 Lid Cracks/ | 2022-03-28 16:41 | - | |
| P100 P105 HD User Upgradeable/ | 2022-03-28 16:41 | - | |
| P100 ST9012 WONT connect to the network/ | 2022-03-28 16:41 | - | |
| P100 ST9012 now TOO DIM/ | 2022-03-28 16:41 | - | |
| P100 connecting to LCD tv - not wrkng/ | 2022-03-28 16:41 | - | |
| P100 formatting-- drivers where!/ | 2022-03-28 16:41 | - | |
| P100 questions... what do you think Thanks for the help!/ | 2022-03-28 16:41 | - | |
| P100 vs. P105/ | 2022-03-28 16:41 | - | |
| P105-9722 Vista Upgrade Problem/ | 2022-03-28 16:41 | - | |
| P105-S921 Here's some pics for ya/ | 2022-03-28 16:41 | - | |
| P105-S921 Infrared Port- No connection to Cell Phone/ | 2022-03-28 16:41 | - | |
| P105-S921 What sound chip/ | 2022-03-28 16:41 | - | |
| P105-S921 good deal or not/ | 2022-03-28 16:41 | - | |
| P105-S9312- slow, then fast... then slow/ | 2022-03-28 16:41 | - | |
| P105-S9312 cracks around hinge area/ | 2022-03-28 16:41 | - | |
| P105-S9339. Noisy fan, BIOS does not save silent mode setting/ | 2022-03-28 16:41 | - | |
| P105-S9339 go7900GS - fried/ | 2022-03-28 16:41 | - | |
| P105-S9722 Hard Drive Upgrade/ | 2022-03-28 16:41 | - | |
| P105-S9722 Will not display/ | 2022-03-28 16:41 | - | |
| P105-S9722 vs. Gateway NX860XL/ | 2022-03-28 16:41 | - | |
| P105-s921/ | 2022-03-28 16:41 | - | |
| P105-s6014 Help/ | 2022-03-28 16:41 | - | |
| P105-s6147/ | 2022-03-28 16:41 | - | |
| P105-s9312 upgradeable or not/ | 2022-03-28 16:41 | - | |
| P105/ | 2022-03-28 16:41 | - | |
| P105 Dmi Utility/ | 2022-03-28 16:41 | - | |
| P105 S9312 Satellite - Fan On Off/ | 2022-03-28 16:41 | - | |
| P105 S9312 and Sadness/ | 2022-03-28 16:41 | - | |
| P200, P205, X200, X205 will support Peryn processors/ | 2022-03-28 16:41 | - | |
| P200-1EE Won't boot from CD DVD/ | 2022-03-28 16:41 | - | |
| P200-1k8/ | 2022-03-28 16:41 | - | |
| P200 line input noisy/ | 2022-03-28 16:41 | - | |
| P200 or X205/ | 2022-03-28 16:41 | - | |
| P205-S6237 Driving me Crazy... Please help me/ | 2022-03-28 16:41 | - | |
| P205-S6267 computer/ | 2022-03-28 16:41 | - | |
| P205-S6267 satellite... XP (all drivers)/ | 2022-03-28 16:41 | - | |
| P205-S6267 satellite... XP Heres where im at/ | 2022-03-28 16:41 | - | |
| P205-S7402 for $799/ | 2022-03-28 16:41 | - | |
| P205-S8811 Opinons Anything to beware of/ | 2022-03-28 16:41 | - | |
| P205D 64 bit drivers ( )/ | 2022-03-28 16:41 | - | |
| P205 Hotkeys/ | 2022-03-28 16:41 | - | |
| P300 -20H - Can I add a GPU/ | 2022-03-28 16:41 | - | |
| P300 - problems with external monitor/ | 2022-03-28 16:41 | - | |
| P300/ | 2022-03-28 16:41 | - | |
| P305 Hotkey Issue/ | 2022-03-28 16:41 | - | |
| P500 Optical Drive Upgrade/ | 2022-03-28 16:41 | - | |
| P505 dust in the display/ | 2022-03-28 16:41 | - | |
| P745-S4217 Screen replacement/ | 2022-03-28 16:41 | - | |
| P745 Owners Report Here Please/ | 2022-03-28 16:41 | - | |
| P750 , clean install need drivers software are they on the hdd somewhere/ | 2022-03-28 16:41 | - | |
| P875-S7102 Wifi Connected but No Internet/ | 2022-03-28 16:41 | - | |
| PC2-6400 800Mhz vs PC-5400 667Mhz RAM/ | 2022-03-28 16:41 | - | |
| PC5300 vs PC5400/ | 2022-03-28 16:41 | - | |
| PCMCIA on x205/ | 2022-03-28 16:41 | - | |
| PLEASE HELP!!! BRAND NEW p500/ | 2022-03-28 16:41 | - | |
| PLEASE HELP! Toshiba laptop problem!/ | 2022-03-28 16:41 | - | |
| PLEASE HELP MY TOSHIBA going to bluescreen n restart computer/ | 2022-03-28 16:41 | - | |
| PLZ help...no full screen mode/ | 2022-03-28 16:41 | - | |
| PM965 or GM965 in Your X205 X200 - Possible onboard graphics conflict/ | 2022-03-28 16:41 | - | |
| PSA To All Qosmio X500 x505 Users Make your Recovery Discs!/ | 2022-03-28 16:42 | - | |
| PSM30C-7101U CMOS Battery/ | 2022-03-28 16:42 | - | |
| Paint wears off!/ | 2022-03-28 16:41 | - | |
| Partition Modiifcation/ | 2022-03-28 16:41 | - | |
| Partitioning so 'quickplay' still works/ | 2022-03-28 16:41 | - | |
| Password in Toshiba Satellite A65-126/ | 2022-03-28 16:41 | - | |
| Password issues on X205/ | 2022-03-28 16:41 | - | |
| Pelican Case for Qosmio x505/ | 2022-03-28 16:41 | - | |
| Perfect Photoshop laptop - recommendations/ | 2022-03-28 16:41 | - | |
| Peripherals dead after wake on M115-S3094/ | 2022-03-28 16:41 | - | |
| Petition Toshiba to enable SATA-III for R835 laptops/ | 2022-03-28 16:41 | - | |
| Phoenix Trustedcore Bios Beep codes/ | 2022-03-28 16:41 | - | |
| PhysX on the SLIx [pt 2] Performance, heat, etc/ | 2022-03-28 16:41 | - | |
| Picked up a Toshiba R835-P50 today from bestbuy/ | 2022-03-28 16:41 | - | |
| Picture of Toshiba R200 with 2nd battery attached/ | 2022-03-28 16:41 | - | |
| Pinger.exe/ | 2022-03-28 16:41 | - | |
| Pioneer DVR-K05 or K06 compatible with m115-s3094/ | 2022-03-28 16:41 | - | |
| Play pause and stop button not working/ | 2022-03-28 16:41 | - | |
| Play pause stop buttons in background/ | 2022-03-28 16:41 | - | |
| Please! Need help with Satellite A215-S7425/ | 2022-03-28 16:41 | - | |
| Please Help!!!/ | 2022-03-28 16:41 | - | |
| Please Help!/ | 2022-03-28 16:41 | - | |
| Please Help! M40 issues/ | 2022-03-28 16:41 | - | |
| Please Help! Where can a Canadian acquire a Satellite X200 205/ | 2022-03-28 16:41 | - | |
| Please Help- Toshiba Dynabook CX 2213CMSW/ | 2022-03-28 16:41 | - | |
| Please Help- Toshiba Satellite A135-S4666/ | 2022-03-28 16:41 | - | |
| Please Help Where to Buy Toshiba M40/ | 2022-03-28 16:41 | - | |
| Please Help wireless not working!/ | 2022-03-28 16:41 | - | |
| Please Help with Express Media Player/ | 2022-03-28 16:41 | - | |
| Please advise- which model easy upgrade XP/ | 2022-03-28 16:41 | - | |
| Please help -( Satellite X205-S9349 Win7 Flickering Screen/ | 2022-03-28 16:41 | - | |
| Please help- Is my laptop overheating/ | 2022-03-28 16:41 | - | |
| Please help- M45-DVD burning problem/ | 2022-03-28 16:41 | - | |
| Please help - Slow Performance of Toshiba 2400/ | 2022-03-28 16:41 | - | |
| Please help- Which Toshiba Model/ | 2022-03-28 16:41 | - | |
| Please help/ | 2022-03-28 16:41 | - | |
| Please help a nooby using X205-Sli1/ | 2022-03-28 16:41 | - | |
| Please help me ! I lost my disk recovery for Satelilte A100 PSSAA/ | 2022-03-28 16:41 | - | |
| Please help me/ | 2022-03-28 16:41 | - | |
| Please help me find drivers, Thank You/ | 2022-03-28 16:41 | - | |
| Please help retrieve my info/ | 2022-03-28 16:41 | - | |
| Pls Help- Do you recomend PORTEGE A600/ | 2022-03-28 16:41 | - | |
| Pls help, newbie computer illiterate x205 sli1/ | 2022-03-28 16:41 | - | |
| Plz Help me with driver of Toshiba Satellite A105-S4324/ | 2022-03-28 16:41 | - | |
| Pm965 & Gm965/ | 2022-03-28 16:41 | - | |
| Poor Toshiba Quality/ | 2022-03-28 16:41 | - | |
| Poor toshiba laptop/ | 2022-03-28 16:41 | - | |
| Poor video playback, display quality/ | 2022-03-28 16:41 | - | |
| Portégé 4000 WiFi problems/ | 2022-03-28 16:41 | - | |
| Portégé R500 with Intel X25-M 160GB SSD/ | 2022-03-28 16:41 | - | |
| Portégé R835 Questions/ | 2022-03-28 16:41 | - | |
| Portal, TF2 not working on X205-SLi1/ | 2022-03-28 16:41 | - | |
| Portege 2000 boot/ | 2022-03-28 16:41 | - | |
| Portege 2010 HDD woes/ | 2022-03-28 16:41 | - | |
| Portege 2010 Help Please/ | 2022-03-28 16:41 | - | |
| Portege 3110CT worth/ | 2022-03-28 16:41 | - | |
| Portege 3490- reformatting, and reinstalling OS/ | 2022-03-28 16:41 | - | |
| Portege 3500 - Beeps/ | 2022-03-28 16:41 | - | |
| Portege 3505 LCD issue/ | 2022-03-28 16:41 | - | |
| Portege 5100 and USB/ | 2022-03-28 16:41 | - | |
| Portege 7220 Recovery/ | 2022-03-28 16:41 | - | |
| Portege M200, how to rebuild/ | 2022-03-28 16:41 | - | |
| Portege M300 Bios password reset/ | 2022-03-28 16:41 | - | |
| Portege M500 HD 10GB missing( )/ | 2022-03-28 16:41 | - | |
| Portege M500 RAM upgrade/ | 2022-03-28 16:41 | - | |
| Portege M500 sound problem/ | 2022-03-28 16:41 | - | |
| Portege M600 - opinions/ | 2022-03-28 16:41 | - | |
| Portege M700 mousepad/ | 2022-03-28 16:41 | - | |
| Portege M900-D364 Performance/ | 2022-03-28 16:41 | - | |
| Portege R30-A-1CQ CPU upgrade/ | 2022-03-28 16:41 | - | |
| Portege R200/ | 2022-03-28 16:41 | - | |
| Portege R200 Bluetooth and Logitech MX5000/ | 2022-03-28 16:41 | - | |
| Portege R200 vs. Portege R205. What are the differences/ | 2022-03-28 16:41 | - | |
| Portege R400's Fan too Noisy/ | 2022-03-28 16:41 | - | |
| Portege R500/ | 2022-03-28 16:41 | - | |
| Portege R600 - black or dead pixels/ | 2022-03-28 16:41 | - | |
| Portege R700, don't want go to full speed/ | 2022-03-28 16:41 | - | |
| Portege R700 - BIOS Access Issues/ | 2022-03-28 16:41 | - | |
| Portege R700 - BIOS EC/ | 2022-03-28 16:41 | - | |
| Portege R700 - On Screen Display for Fn key actions/ | 2022-03-28 16:41 | - | |
| Portege R700 - the thin and light 13.3/ | 2022-03-28 16:41 | - | |
| Portege R700 Freezing- Full speed fan, no keyboard/ | 2022-03-28 16:41 | - | |
| Portege R700 Price too high/ | 2022-03-28 16:41 | - | |
| Portege R705-P35/ | 2022-03-28 16:41 | - | |
| Portege R705-P41 $799 at bestcustompc.com/ | 2022-03-28 16:41 | - | |
| Portege R705-P42 Possible to upgrade screen to IPS/ | 2022-03-28 16:41 | - | |
| Portege R705 - can't see sd cards mounted in card reader/ | 2022-03-28 16:41 | - | |
| Portege R830 - Horror Story!!!/ | 2022-03-28 16:41 | - | |
| Portege R830- What SSD to replace the original HDD/ | 2022-03-28 16:41 | - | |
| Portege R830 - i3 or i5/ | 2022-03-28 16:41 | - | |
| Portege R830-x3310 cougar point issue/ | 2022-03-28 16:41 | - | |
| Portege R830 memory upgrade up to 2x8GB/ | 2022-03-28 16:41 | - | |
| Portege R835 -- 50X vs. 56X/ | 2022-03-28 16:41 | - | |
| Portege R835-P92 issues/ | 2022-03-28 16:41 | - | |
| Portege R835/ | 2022-03-28 16:41 | - | |
| Portege R835 screen contrast( ) changing from time to time/ | 2022-03-28 16:41 | - | |
| Portege S100 - new Sonoma ultralight w optical/ | 2022-03-28 16:41 | - | |
| Portege Z830 - Windows 8 Bluetooth/ | 2022-03-28 16:41 | - | |
| Portege Z830 - Windows 8 and Flashcards/ | 2022-03-28 16:41 | - | |
| Portege Z830/ | 2022-03-28 16:41 | - | |
| Portege Z830 Win USB install Problem/ | 2022-03-28 16:41 | - | |
| Portege Z835-p330 backlight issue/ | 2022-03-28 16:41 | - | |
| Portege fan always on overheating. Why/ | 2022-03-28 16:41 | - | |
| Portege or Vaio TX/ | 2022-03-28 16:41 | - | |
| Portege r200 and VISTA - Please comment on performace/ | 2022-03-28 16:41 | - | |
| Portege r705-P41 fan at full speed (90%) all the time/ | 2022-03-28 16:41 | - | |
| Portege r835 Screen Upgrade FAILURE/ | 2022-03-28 16:41 | - | |
| Portege z930 keys hard to press/ | 2022-03-28 16:41 | - | |
| Portege z930 z935/ | 2022-03-28 16:41 | - | |
| Possble video card failing on my Qosmio X305-Q705 laptop/ | 2022-03-28 16:41 | - | |
| Possible 169.01 nvidia driver problem on X205/ | 2022-03-28 16:41 | - | |
| Possible Graphic Card upgrade/ | 2022-03-28 16:41 | - | |
| Possible Toshiba Notebook Purchase - Suggestions/ | 2022-03-28 16:41 | - | |
| Possible USB 3.0 solution for Qosmio/ | 2022-03-28 16:41 | - | |
| Possible new card/ | 2022-03-28 16:41 | - | |
| Possible to add bluetooth internally to Satellite U305/ | 2022-03-28 16:41 | - | |
| Possible to control Toshiba laptop fan speed with RW everythin/ | 2022-03-28 16:41 | - | |
| Possibly DUMB question about Qosmio 3D output/ | 2022-03-28 16:41 | - | |
| Post Your Qosmio gameshots here/ | 2022-03-28 16:41 | - | |
| Power Adapter Sparks/ | 2022-03-28 16:41 | - | |
| Power Adapter for Satellite 5205-S505/ | 2022-03-28 16:41 | - | |
| Power Adapter not charging my X205-S9349 laptop/ | 2022-03-28 16:41 | - | |
| Power Cable Beeping....HELP ME !!/ | 2022-03-28 16:41 | - | |
| Power Cord doesn't work/ | 2022-03-28 16:41 | - | |
| PowerDVD and X205... HELP!!!!/ | 2022-03-28 16:41 | - | |
| Power On Password for Satellite A135-S2246/ | 2022-03-28 16:41 | - | |
| Power Options unavailable after CMOS update/ | 2022-03-28 16:41 | - | |
| Power Problem - A135-s2386 pdc T2080 512 80 15/ | 2022-03-28 16:41 | - | |
| Power cord - which end to pull/ | 2022-03-28 16:41 | - | |
| Power cord for A75-S125/ | 2022-03-28 16:41 | - | |
| Power cord problem/ | 2022-03-28 16:41 | - | |
| Power issue with M50/ | 2022-03-28 16:41 | - | |
| Power on problem with Satellite U305/ | 2022-03-28 16:41 | - | |
| Power problems/ | 2022-03-28 16:41 | - | |
| Powers on but nothing else/ | 2022-03-28 16:41 | - | |
| Power supply problems/ | 2022-03-28 16:41 | - | |
| Power supply system board issues with Toshiba Satellite A135/ | 2022-03-28 16:41 | - | |
| Pre-installed Toshiba software/ | 2022-03-28 16:41 | - | |
| Pre-install software/ | 2022-03-28 16:41 | - | |
| Price Drop - Satellite M40/ | 2022-03-28 16:41 | - | |
| Primary clicking problems, Toshiba Satellite/ | 2022-03-28 16:41 | - | |
| Probelms connecting wirelessly/ | 2022-03-28 16:41 | - | |
| Probelms with System Time Date/ | 2022-03-28 16:41 | - | |
| Problem!!! DVD-Ram Matshita UJ-841S (Please Help)/ | 2022-03-28 16:42 | - | |
| Problem Installing WIndows XP On New Laptop/ | 2022-03-28 16:41 | - | |
| Problem Powering on Satellite L305D-S5934/ | 2022-03-28 16:41 | - | |
| Problem Reformatting M55/ | 2022-03-28 16:41 | - | |
| Problem With My Toshiba A105-s4034/ | 2022-03-28 16:41 | - | |
| Problem With Toshiba P105-s9312 Vista Display Driver/ | 2022-03-28 16:42 | - | |
| Problem after installing new RAM/ | 2022-03-28 16:41 | - | |
| Problem after upgrading to XP/ | 2022-03-28 16:41 | - | |
| Problem backing me up from buying Qosmio X505/ | 2022-03-28 16:41 | - | |
| Problem in installing modem & audio XP driver/ | 2022-03-28 16:41 | - | |
| Problem of Toshiba Satellite A60 Upgrade/ | 2022-03-28 16:41 | - | |
| Problem regaring wireless radio/ | 2022-03-28 16:41 | - | |
| Problems/ | 2022-03-28 16:42 | - | |
| Problems after Toshiba Sattelite F755 Disassembly/ | 2022-03-28 16:42 | - | |
| Problems when connecting to Projector/ | 2022-03-28 16:42 | - | |
| Problems with Boot priority/ | 2022-03-28 16:42 | - | |
| Problems with Media Buttons on my Sat. A205- Regarding Itunes, and operation/ | 2022-03-28 16:42 | - | |
| Problems with Qosmio x775 3dv80/ | 2022-03-28 16:42 | - | |
| Problems with Toshiba M30 (buzzing noise)/ | 2022-03-28 16:42 | - | |
| Problems with Toshiba M55-S325/ | 2022-03-28 16:42 | - | |
| Problems with Toshiba Satellite M100 Wireless Card/ | 2022-03-28 16:42 | - | |
| Problems with Video card on A135-s4527/ | 2022-03-28 16:42 | - | |
| Problems with X205-S9359/ | 2022-03-28 16:42 | - | |
| Problems with X205/ | 2022-03-28 16:42 | - | |
| Problems with the A70/ | 2022-03-28 16:42 | - | |
| Problems with the Toshiba A200-st2042/ | 2022-03-28 16:42 | - | |
| Problem w Toshiba x205 s7483 Please Help!!!/ | 2022-03-28 16:41 | - | |
| Problem with A85 screen/ | 2022-03-28 16:41 | - | |
| Problem with CD DVD on Tecra A2/ | 2022-03-28 16:41 | - | |
| Problem with Integreted Web Cam/ | 2022-03-28 16:41 | - | |
| Problem with M45-S269 Drivers/ | 2022-03-28 16:41 | - | |
| Problem with My x205!!!/ | 2022-03-28 16:41 | - | |
| Problem with PCI devices/ | 2022-03-28 16:41 | - | |
| Problem with Satellite A305/ | 2022-03-28 16:41 | - | |
| Problem with Satellite P75-A7200/ | 2022-03-28 16:42 | - | |
| Problem with Toshiba's A100-906 screen/ | 2022-03-28 16:42 | - | |
| Problem with Toshiba. What could this be/ | 2022-03-28 16:42 | - | |
| Problem with Toshiba/ | 2022-03-28 16:42 | - | |
| Problem with Toshiba A300/ | 2022-03-28 16:42 | - | |
| Problem with Toshiba Satellite A505 S6009 LCD screen/ | 2022-03-28 16:42 | - | |
| Problem with Toshiba Satellite M50/ | 2022-03-28 16:42 | - | |
| Problem with Toshiba laptop/ | 2022-03-28 16:42 | - | |
| Problem with Windows Explorer and Tecra A10 volume knob/ | 2022-03-28 16:42 | - | |
| Problem with bios install on X200 sli/ | 2022-03-28 16:41 | - | |
| Problem with display brigthness in toshiba satellite/ | 2022-03-28 16:41 | - | |
| Problem with either DVD burner or Windows DVD Maker/ | 2022-03-28 16:41 | - | |
| Problem with express media player/ | 2022-03-28 16:41 | - | |
| Problem with install OS on Toshiba Portege 2000/ | 2022-03-28 16:41 | - | |
| Problem with installing Intel 4965AGN on Satellite P100-222/ | 2022-03-28 16:41 | - | |
| Problem with microphone in Toshiba a200-1mb/ | 2022-03-28 16:41 | - | |
| Problem with my P206...PLEASE HELP!/ | 2022-03-28 16:41 | - | |
| Problem with my Satellite U305 - touchpad and dvd-rom won't work!!/ | 2022-03-28 16:41 | - | |
| Problem with my hdd protection 3d viewer/ | 2022-03-28 16:41 | - | |
| Problem with ram/ | 2022-03-28 16:41 | - | |
| Problem with recovery dvd/ | 2022-03-28 16:41 | - | |
| Problem with sli on Toshiba X205 sli1 - Please help me/ | 2022-03-28 16:42 | - | |
| Problem with toshiba p100-st9612 LCD screen/ | 2022-03-28 16:42 | - | |
| Problem with toshiba satellite M40-331 when installing Windows XP/ | 2022-03-28 16:42 | - | |
| Problem with usb sound card and A105/ | 2022-03-28 16:42 | - | |
| Problem with wireless card on Toshiba Satellite/ | 2022-03-28 16:42 | - | |
| Problem with wireless on A300/ | 2022-03-28 16:42 | - | |
| Probs with Tecra M2 Hard Drives/ | 2022-03-28 16:42 | - | |
| Prob with Fn keys and Toshiba Flash Cards/ | 2022-03-28 16:41 | - | |
| Processor Check for Toshiba Qosmio X305-Q701/ | 2022-03-28 16:42 | - | |
| Processor Type/ | 2022-03-28 16:42 | - | |
| Processor Upgrade Help/ | 2022-03-28 16:42 | - | |
| Processor info/ | 2022-03-28 16:42 | - | |
| Product Recovery DVD-ROM/ | 2022-03-28 16:42 | - | |
| Program Issues/ | 2022-03-28 16:42 | - | |
| Program for touchpad/ | 2022-03-28 16:42 | - | |
| Program not responding freezing error reports/ | 2022-03-28 16:42 | - | |
| Prospective buyer/ | 2022-03-28 16:42 | - | |
| ProtectorSuiteQL Help please/ | 2022-03-28 16:42 | - | |
| Protege A605-P210 - Just got it and am loving it!/ | 2022-03-28 16:42 | - | |
| Protege M400 biometric lock reset/ | 2022-03-28 16:42 | - | |
| Protege R100 Boot Help Please/ | 2022-03-28 16:42 | - | |
| Protege R100 Questions/ | 2022-03-28 16:42 | - | |
| Protege R600/ | 2022-03-28 16:42 | - | |
| Protege S100/ | 2022-03-28 16:42 | - | |
| Protege r200/ | 2022-03-28 16:42 | - | |
| Psm40c-sf3/ | 2022-03-28 16:42 | - | |
| Purchased Tecra R840/ | 2022-03-28 16:42 | - | |
| Purchasing a Toshiba - Satellite Laptop Model- A505-S6033 SKU- 9705203/ | 2022-03-28 16:42 | - | |
| Purchasing a laptop, I need some imput/ | 2022-03-28 16:42 | - | |
| Putting an 80GB HD in my Toshiba Portege 4000...possible/ | 2022-03-28 16:42 | - | |
| Q- To Those Who Oc 8700 Gt Help/ | 2022-03-28 16:42 | - | |
| Q- Toshiba A105-S4334 with 945 chipset/ | 2022-03-28 16:42 | - | |
| Q- Toshiba M35/ | 2022-03-28 16:42 | - | |
| Q850, Win7 64 does not shutdown when SD Card is present/ | 2022-03-28 16:42 | - | |
| QOSMIO's weight and speaker issue/ | 2022-03-28 16:42 | - | |
| QOSMIO F15 video card/ | 2022-03-28 16:42 | - | |
| Qismio X 300 DVD driver gone/ | 2022-03-28 16:42 | - | |
| Qosimo 505 q898 EGPU/ | 2022-03-28 16:42 | - | |
| Qosimo Screen Problems Help!/ | 2022-03-28 16:42 | - | |
| Qosimo vs Satellite/ | 2022-03-28 16:42 | - | |
| Qosmio & Linux/ | 2022-03-28 16:42 | - | |
| Qosmio -- Loud Noise on Startup (Fan )/ | 2022-03-28 16:42 | - | |
| Qosmio - comments please/ | 2022-03-28 16:42 | - | |
| Qosmio/ | 2022-03-28 16:42 | - | |
| Qosmio 3DV78 benchmarks Any one post them yet/ | 2022-03-28 16:42 | - | |
| Qosmio E15/ | 2022-03-28 16:42 | - | |
| Qosmio E15 HDD Failure and Replacement/ | 2022-03-28 16:42 | - | |
| Qosmio F-25 AV205 Dual Channel RAM question/ | 2022-03-28 16:42 | - | |
| Qosmio F10-101/ | 2022-03-28 16:42 | - | |
| Qosmio F10 Diagnostics Disk/ | 2022-03-28 16:42 | - | |
| Qosmio F15-210 can't read memory stick/ | 2022-03-28 16:42 | - | |
| Qosmio F15-AV201 Notebook/ | 2022-03-28 16:42 | - | |
| Qosmio F15-AV201 sound driver problem/ | 2022-03-28 16:42 | - | |
| Qosmio F15/ | 2022-03-28 16:42 | - | |
| Qosmio F20/ | 2022-03-28 16:42 | - | |
| Qosmio F25/ | 2022-03-28 16:42 | - | |
| Qosmio F25 AV205 issue/ | 2022-03-28 16:42 | - | |
| Qosmio F25 internal michrophone/ | 2022-03-28 16:42 | - | |
| Qosmio F40 F45/ | 2022-03-28 16:42 | - | |
| Qosmio F40 ST4101 - Compatible Video card options/ | 2022-03-28 16:42 | - | |
| Qosmio F45-Av425/ | 2022-03-28 16:42 | - | |
| Qosmio F50-10Z Dismantling/ | 2022-03-28 16:42 | - | |
| Qosmio F50-10Z windows version/ | 2022-03-28 16:42 | - | |
| Qosmio F50/ | 2022-03-28 16:42 | - | |
| Qosmio F50 HDMI Output Quesztionz/ | 2022-03-28 16:42 | - | |
| Qosmio F50 Hard disk Opinion/ | 2022-03-28 16:42 | - | |
| Qosmio F55-Q502/ | 2022-03-28 16:42 | - | |
| Qosmio F55-Q502 vs Q503/ | 2022-03-28 16:42 | - | |
| Qosmio F55-Q503/ | 2022-03-28 16:42 | - | |
| Qosmio F55-Q504 Information/ | 2022-03-28 16:42 | - | |
| Qosmio F55- Your review/ | 2022-03-28 16:42 | - | |
| Qosmio F55 Q502 2 harddrives possible/ | 2022-03-28 16:42 | - | |
| Qosmio F750 - 3D screen w o glasses/ | 2022-03-28 16:42 | - | |
| Qosmio F750- Wifi-Upgrade possible/ | 2022-03-28 16:42 | - | |
| Qosmio F7553D/ | 2022-03-28 16:42 | - | |
| Qosmio G-25 Cooling Fans/ | 2022-03-28 16:42 | - | |
| Qosmio G15 ...sweeeet/ | 2022-03-28 16:42 | - | |
| Qosmio G20 online/ | 2022-03-28 16:42 | - | |
| Qosmio G20 problem- Black vertical sidebar on left of screen covering desktop & icons/ | 2022-03-28 16:42 | - | |
| Qosmio G30 (Australia's Take of the G35 - Updated)/ | 2022-03-28 16:42 | - | |
| Qosmio G30 Video-in cable/ | 2022-03-28 16:42 | - | |
| Qosmio G30 video problems/ | 2022-03-28 16:42 | - | |
| Qosmio G35-AV600 for $1600/ | 2022-03-28 16:42 | - | |
| Qosmio G35-AV600 or Satellite P105-S921/ | 2022-03-28 16:42 | - | |
| Qosmio G35 AV600 Media Center(Vista) and Build in IR receiver/ | 2022-03-28 16:42 | - | |
| Qosmio G35 AV650/ | 2022-03-28 16:42 | - | |
| Qosmio G35 Nvidia Driver/ | 2022-03-28 16:42 | - | |
| Qosmio G35 stuck in Reboot Cycle/ | 2022-03-28 16:42 | - | |
| Qosmio G35 with built in PAL TV tuner/ | 2022-03-28 16:42 | - | |
| Qosmio G40 Screen Luminance/ | 2022-03-28 16:42 | - | |
| Qosmio G40 built-in camera doesn't work in Windows Live Messenger/ | 2022-03-28 16:42 | - | |
| Qosmio G40 is around the corner/ | 2022-03-28 16:42 | - | |
| Qosmio G45-AV680/ | 2022-03-28 16:42 | - | |
| Qosmio G45 DVD rom not working/ | 2022-03-28 16:42 | - | |
| Qosmio G45 HDTV USB tuner/ | 2022-03-28 16:42 | - | |
| Qosmio G50 - Windows XP SATA Driver and BSOD/ | 2022-03-28 16:42 | - | |
| Qosmio G50 disable subwoofer/ | 2022-03-28 16:42 | - | |
| Qosmio G55-Q802 - Will there by any better CPU model/ | 2022-03-28 16:42 | - | |
| Qosmio G55/ | 2022-03-28 16:42 | - | |
| Qosmio Graphics Card Problems/ | 2022-03-28 16:42 | - | |
| Qosmio Keyboard Problem - Spacebar types semicolon/ | 2022-03-28 16:42 | - | |
| Qosmio Nvidia Display Driver - Toshiba Generic/ | 2022-03-28 16:42 | - | |
| Qosmio Overheating/ | 2022-03-28 16:42 | - | |
| Qosmio P8400/ | 2022-03-28 16:42 | - | |
| Qosmio Q850 brightness wont work/ | 2022-03-28 16:42 | - | |
| Qosmio Q885 not working/ | 2022-03-28 16:42 | - | |
| Qosmio Q888 vs Q896/ | 2022-03-28 16:42 | - | |
| Qosmio Refresh for 2014/ | 2022-03-28 16:42 | - | |
| Qosmio Start Up Loop Issue (Help!!)/ | 2022-03-28 16:42 | - | |
| Qosmio TV tuner question/ | 2022-03-28 16:42 | - | |
| Qosmio Touchpad Problem/ | 2022-03-28 16:42 | - | |
| Qosmio X70 75 for $1100/ | 2022-03-28 16:42 | - | |
| Qosmio X70 spotted and announced! (GTX 770M included!)/ | 2022-03-28 16:42 | - | |
| Qosmio X300-11S/ | 2022-03-28 16:42 | - | |
| Qosmio X300-11W/ | 2022-03-28 16:42 | - | |
| Qosmio X300 - broken dc jack pin/ | 2022-03-28 16:42 | - | |
| Qosmio X300/ | 2022-03-28 16:42 | - | |
| Qosmio X300 04S black screen+noise....help please!!!!/ | 2022-03-28 16:42 | - | |
| Qosmio X300 305/ | 2022-03-28 16:42 | - | |
| Qosmio X300 Boots, then powers off. Does it in BIOS too!/ | 2022-03-28 16:42 | - | |
| Qosmio X300 Series owners' thread/ | 2022-03-28 16:42 | - | |
| Qosmio X300 help!/ | 2022-03-28 16:42 | - | |
| Qosmio X300 x305 fan control/ | 2022-03-28 16:42 | - | |
| Qosmio X305-Q705 trouble shooting help/ | 2022-03-28 16:42 | - | |
| Qosmio X305-Q706 in Canada/ | 2022-03-28 16:42 | - | |
| Qosmio X305-Q715/ | 2022-03-28 16:42 | - | |
| Qosmio X305-Q725/ | 2022-03-28 16:42 | - | |
| Qosmio X305-q705 Upgradable/ | 2022-03-28 16:42 | - | |
| Qosmio X305/ | 2022-03-28 16:42 | - | |
| Qosmio X305 Dvd Drive Problem/ | 2022-03-28 16:42 | - | |
| Qosmio X305 crashes when playing games/ | 2022-03-28 16:42 | - | |
| Qosmio X305 laptop run 2 external monitors at once/ | 2022-03-28 16:42 | - | |
| Qosmio X305 media control buttons not working/ | 2022-03-28 16:42 | - | |
| Qosmio X305 with 9800 GTX/ | 2022-03-28 16:42 | - | |
| Qosmio X500 + Intel 6200N = -D/ | 2022-03-28 16:42 | - | |
| Qosmio X500-14h Failed Bios Update/ | 2022-03-28 16:42 | - | |
| Qosmio X500-Q930X Laptop/ | 2022-03-28 16:42 | - | |
| Qosmio X500/ | 2022-03-28 16:42 | - | |
| Qosmio X500 X505/ | 2022-03-28 16:42 | - | |
| Qosmio X500 keybrd sceern scuff and warranty/ | 2022-03-28 16:42 | - | |
| Qosmio X500 pricing revealed/ | 2022-03-28 16:42 | - | |
| Qosmio X500 rocks/ | 2022-03-28 16:42 | - | |
| Qosmio X505-896 dim screen update/ | 2022-03-28 16:42 | - | |
| Qosmio X505 - Annoying fan warning message/ | 2022-03-28 16:42 | - | |
| Qosmio X505- NVIDIA 360 VS. 460/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q830 - what settings can improve performance with the GPU I have now/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q830 Problem !/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q850/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q870 black screen Or unpowered screen/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q880 890/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q887, possibly display malfunction/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q890 recovery disk/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q893 - Possible GPU failure URGENT/ | 2022-03-28 16:42 | - | |
| Qosmio X505-Q896 Best Cooling Fan/ | 2022-03-28 16:42 | - | |
| Qosmio X505- question about post q890 (892,893,896, etc) models/ | 2022-03-28 16:42 | - | |
| Qosmio X505 INS button/ | 2022-03-28 16:42 | - | |
| Qosmio X505 Q860 BSOD DEBUG_CODE_USB/ | 2022-03-28 16:42 | - | |
| Qosmio X505 Ram Question/ | 2022-03-28 16:42 | - | |
| Qosmio X505 Series Sound Quality/ | 2022-03-28 16:42 | - | |
| Qosmio X505 series/ | 2022-03-28 16:42 | - | |
| Qosmio X770-11C LCD screen replacement/ | 2022-03-28 16:42 | - | |
| Qosmio X770 98 degrees Prime 95 I7 2630Qm/ | 2022-03-28 16:42 | - | |
| Qosmio X770 GPU upgrade/ | 2022-03-28 16:42 | - | |
| Qosmio X770 X775 Real World Battery Life/ | 2022-03-28 16:42 | - | |
| Qosmio X775 wifi turning itself off randomly/ | 2022-03-28 16:42 | - | |
| Qosmio X875 - Can it upgrade/ | 2022-03-28 16:42 | - | |
| Qosmio X875 Owners Lounge/ | 2022-03-28 16:42 | - | |
| Qosmio battery power issue/ | 2022-03-28 16:42 | - | |
| Qosmio build quality/ | 2022-03-28 16:42 | - | |
| Qosmio f50 Boot Problem/ | 2022-03-28 16:42 | - | |
| Qosmio for Gaming/ | 2022-03-28 16:42 | - | |
| Qosmio g35 reload help please/ | 2022-03-28 16:42 | - | |
| Qosmio hard drive size/ | 2022-03-28 16:42 | - | |
| Qosmio help/ | 2022-03-28 16:42 | - | |
| Qosmio how much $/ | 2022-03-28 16:42 | - | |
| Qosmio owners, should I go for a 660 instead of a Dell 1705/ | 2022-03-28 16:42 | - | |
| Qosmio problem/ | 2022-03-28 16:42 | - | |
| Qosmio q8102X Review and Initial Impression/ | 2022-03-28 16:42 | - | |
| Qosmio q8102X Temperatures/ | 2022-03-28 16:42 | - | |
| Qosmio question/ | 2022-03-28 16:42 | - | |
| Qosmio release date/ | 2022-03-28 16:42 | - | |
| Qosmio wifi stopped working/ | 2022-03-28 16:42 | - | |
| Qosmio x300 and powermizer help advise/ | 2022-03-28 16:42 | - | |
| Qosmio x300 x305 touch sensitive buttons help!/ | 2022-03-28 16:42 | - | |
| Qosmio x305-701 mic problem help please!/ | 2022-03-28 16:42 | - | |
| Qosmio x305-701 touch bar Question/ | 2022-03-28 16:42 | - | |
| Qosmio x305-q706 Driver Help!/ | 2022-03-28 16:42 | - | |
| Qosmio x305 battery life/ | 2022-03-28 16:42 | - | |
| Qosmio x305 sound/ | 2022-03-28 16:42 | - | |
| Qosmio x500-03l upgrade question/ | 2022-03-28 16:42 | - | |
| Qosmio x505-896 can't find N network/ | 2022-03-28 16:42 | - | |
| Qosmio x505-q870 Constant BSOD, dying/ | 2022-03-28 16:42 | - | |
| Qosmio x505-q894 VS x505-q896/ | 2022-03-28 16:42 | - | |
| Qosmio x505-q894 brief review/ | 2022-03-28 16:42 | - | |
| Qosmio x505 Review/ | 2022-03-28 16:42 | - | |
| Qosmio x505 Stress Tests/ | 2022-03-28 16:42 | - | |
| Qosmio x505 laptop desk for use in bed couch/ | 2022-03-28 16:42 | - | |
| Qosmio x505 reduce SSD speed/ | 2022-03-28 16:42 | - | |
| Qosmio x770 - LCD flex cable burnt, and melted bezel, screen not working, need suggestions/ | 2022-03-28 16:42 | - | |
| Qosmio x770/ | 2022-03-28 16:42 | - | |
| Qosmio x775-Q7270/ | 2022-03-28 16:42 | - | |
| Qosmio x775 - Throttling at low(ish) temps/ | 2022-03-28 16:42 | - | |
| Qosmio x775 Models/ | 2022-03-28 16:42 | - | |
| Quality and reliability of Toshiba notebooks/ | 2022-03-28 16:42 | - | |
| Quality of Toshiba/ | 2022-03-28 16:42 | - | |
| Quality of Toshiba X505 series/ | 2022-03-28 16:42 | - | |
| Quality of the Toshiba P200 P205/ | 2022-03-28 16:42 | - | |
| Quality of toshibas/ | 2022-03-28 16:42 | - | |
| Quasimodo 17 Experience/ | 2022-03-28 16:42 | - | |
| Question(s) about p505-s8980/ | 2022-03-28 16:42 | - | |
| Question...-l/ | 2022-03-28 16:42 | - | |
| Question/ | 2022-03-28 16:42 | - | |
| Question About Laptop movement on Qosmio/ | 2022-03-28 16:42 | - | |
| Question About Toshiba U405-S2826/ | 2022-03-28 16:42 | - | |
| Question Regarding Laptop Ram Upgrade/ | 2022-03-28 16:42 | - | |
| Question Regarding Toshiba M100/ | 2022-03-28 16:42 | - | |
| Question about Best Buy and Toshiba extended warranties/ | 2022-03-28 16:42 | - | |
| Question about DVD drive firmware/ | 2022-03-28 16:42 | - | |
| Question about Drivers/ | 2022-03-28 16:42 | - | |
| Question about Qomiso--from China/ | 2022-03-28 16:42 | - | |
| Question about Qosmio Driver update/ | 2022-03-28 16:42 | - | |
| Question about Satellite A85-S107/ | 2022-03-28 16:42 | - | |
| Question about Tecra S11-114 - numeric keypad or not/ | 2022-03-28 16:42 | - | |
| Question about Toshiba Satellite M65-S9091/ | 2022-03-28 16:42 | - | |
| Question about Toshiba a215 notebook/ | 2022-03-28 16:42 | - | |
| Question about Toshiba recovery CD/ | 2022-03-28 16:42 | - | |
| Question about X205-S9349/ | 2022-03-28 16:42 | - | |
| Question about XP driver for Toshiba X205-9359/ | 2022-03-28 16:42 | - | |
| Question about backing up disk drive/ | 2022-03-28 16:42 | - | |
| Question about battery problem/ | 2022-03-28 16:42 | - | |
| Question about graphics card - please help!/ | 2022-03-28 16:42 | - | |
| Question about hardrives.... for my Toshiba/ | 2022-03-28 16:42 | - | |
| Question about installed windows XP home edtion in A100/ | 2022-03-28 16:42 | - | |
| Question about notebook DVD-RW device/ | 2022-03-28 16:42 | - | |
| Question about oldie Satellite 110CT RTC battery/ | 2022-03-28 16:42 | - | |
| Question about q8102/ | 2022-03-28 16:42 | - | |
| Question about the A305-6845/ | 2022-03-28 16:42 | - | |
| Question about the High Brightness option/ | 2022-03-28 16:42 | - | |
| Question about the R600/ | 2022-03-28 16:42 | - | |
| Question about the Satellite M50 and Tecra A5/ | 2022-03-28 16:42 | - | |
| Question about the TOSHIBA Qosmio X505-Q850/ | 2022-03-28 16:42 | - | |
| Question about the p300 st6711/ | 2022-03-28 16:42 | - | |
| Question about the screen latch on a P105/ | 2022-03-28 16:42 | - | |
| Question about toshiba satellite p205-s6237/ | 2022-03-28 16:42 | - | |
| Question about viewing angles/ | 2022-03-28 16:42 | - | |
| Question about x500 x505 boot speed up with system config/ | 2022-03-28 16:42 | - | |
| Question abt warranty/ | 2022-03-28 16:42 | - | |
| Question concerning bluray compatibility/ | 2022-03-28 16:42 | - | |
| Question for Any X205 SLI owners/ | 2022-03-28 16:42 | - | |
| Question for Friend- Toshiba Satellite/ | 2022-03-28 16:42 | - | |
| Question for M50 toshiba/ | 2022-03-28 16:42 | - | |
| Question for any L35-2161 owner/ | 2022-03-28 16:42 | - | |
| Question for any U200 or u205 owner - build quality/ | 2022-03-28 16:42 | - | |
| Question on Qosmio Display Brightness/ | 2022-03-28 16:42 | - | |
| Question on Satellite M50 M55 and Dual Channel RAM/ | 2022-03-28 16:42 | - | |
| Question on Satellite P100-ST7111/ | 2022-03-28 16:42 | - | |
| Question on Tecra M2/ | 2022-03-28 16:42 | - | |
| Question on Toshiba T115D-S1125 and MS Office/ | 2022-03-28 16:42 | - | |
| Question on Toshiba T115D-S1125 and bloatware/ | 2022-03-28 16:42 | - | |
| Question on X70 configuration/ | 2022-03-28 16:42 | - | |
| Question on X205 - International usability/ | 2022-03-28 16:42 | - | |
| Question on the Satellite A215 series/ | 2022-03-28 16:42 | - | |
| Question on upgrading processor/ | 2022-03-28 16:42 | - | |
| Question re- new laptop/ | 2022-03-28 16:42 | - | |
| Question regarding the transparent foil on GPU, motherboard/ | 2022-03-28 16:42 | - | |
| Question regarding using a High Capacity (8GB) SD Card in 5-in-1 reader/ | 2022-03-28 16:42 | - | |
| Questions about A100-TA9 (thinking of buying)/ | 2022-03-28 16:42 | - | |
| Questions about M35-S456/ | 2022-03-28 16:42 | - | |
| Questions about M40 M45/ | 2022-03-28 16:42 | - | |
| Questions about P100/ | 2022-03-28 16:42 | - | |
| Questions about Portege Tecra/ | 2022-03-28 16:42 | - | |
| Questions about RAM and optical drive (A205-S5804)/ | 2022-03-28 16:42 | - | |
| Questions about Satellite P305-S8825/ | 2022-03-28 16:42 | - | |
| Questions about Toshiba X205 SLI3/ | 2022-03-28 16:42 | - | |
| Questions about a TOSHIBA Satellite Laptop!/ | 2022-03-28 16:42 | - | |
| Questions about new Toshiba A135 notebooks/ | 2022-03-28 16:42 | - | |
| Questions about the X205-S9800/ | 2022-03-28 16:42 | - | |
| Questions for P75-A7200 owners/ | 2022-03-28 16:42 | - | |
| Questions for Qosmio x505 owner/ | 2022-03-28 16:42 | - | |
| Questions for Registration/ | 2022-03-28 16:42 | - | |
| Questions for toshiba a500-025/ | 2022-03-28 16:42 | - | |
| Questions on P100-ST7111/ | 2022-03-28 16:42 | - | |
| Questions on upgrading my A205-s4616/ | 2022-03-28 16:42 | - | |
| Question to owners of 1440x900 Satellite X200 205-SLI/ | 2022-03-28 16:42 | - | |
| Quick L305d key question/ | 2022-03-28 16:42 | - | |
| Quick Question For TOSHIBA A200 users with the Camera Assistant Software!/ | 2022-03-28 16:42 | - | |
| Quick Question for A200 A205 A215 Owners/ | 2022-03-28 16:42 | - | |
| Quick Review for Toshiba Satellite M100-ST511/ | 2022-03-28 16:42 | - | |
| Quick Sync and i5 Sandy Bridge/ | 2022-03-28 16:42 | - | |
| Quick drive question on the Toshiba A105-S4054/ | 2022-03-28 16:42 | - | |
| Quick question regarding Northbridge Thermal Compound!/ | 2022-03-28 16:42 | - | |
| R.I.P Toshiba/ | 2022-03-28 16:42 | - | |
| R100 slimdock/ | 2022-03-28 16:42 | - | |
| R200 R205 Drivers/ | 2022-03-28 16:42 | - | |
| R205 recovery partition help/ | 2022-03-28 16:42 | - | |
| R500/ | 2022-03-28 16:42 | - | |
| R500 Broken Optical Drive Issue/ | 2022-03-28 16:42 | - | |
| R500 Hibernate auto activated/ | 2022-03-28 16:42 | - | |
| R500 and legacy USB keyboard support/ | 2022-03-28 16:42 | - | |
| R500 gets HSDPA/ | 2022-03-28 16:42 | - | |
| R500 vs. A605/ | 2022-03-28 16:42 | - | |
| R600 (and other business Tosh's) incoming/ | 2022-03-28 16:42 | - | |
| R600 memory not running at full speed/ | 2022-03-28 16:42 | - | |
| R600 on order !!/ | 2022-03-28 16:42 | - | |
| R600 round table/ | 2022-03-28 16:42 | - | |
| R600 vs Sony TT/ | 2022-03-28 16:42 | - | |
| R700 Cannot enter bios/ | 2022-03-28 16:42 | - | |
| R700 Memory Upgrade/ | 2022-03-28 16:42 | - | |
| R700 and Intel Chipsets -Differences/ | 2022-03-28 16:42 | - | |
| R700 keyboard help/ | 2022-03-28 16:42 | - | |
| R700 screen question/ | 2022-03-28 16:42 | - | |
| R705-P41 SDHC card trouble/ | 2022-03-28 16:42 | - | |
| R830 835 -- can swap keyboard with Z830 835/ | 2022-03-28 16:42 | - | |
| R830 and wifi/ | 2022-03-28 16:42 | - | |
| R835-P50x questions/ | 2022-03-28 16:42 | - | |
| R835-P56X Device Manager !/ | 2022-03-28 16:42 | - | |
| R835-P56x Ethernet Issue/ | 2022-03-28 16:42 | - | |
| R835-P89 -- keep it or return it +concerns/ | 2022-03-28 16:42 | - | |
| R835 great deals/ | 2022-03-28 16:42 | - | |
| R835 or R845/ | 2022-03-28 16:42 | - | |
| R835 upgrades/ | 2022-03-28 16:42 | - | |
| R840 Upgradeability/ | 2022-03-28 16:42 | - | |
| R6025 -pure virtual function call error -/ | 2022-03-28 16:42 | - | |
| RAM Upgradation/ | 2022-03-28 16:42 | - | |
| RAM for X505-Q894/ | 2022-03-28 16:42 | - | |
| RAM upgrade/ | 2022-03-28 16:42 | - | |
| RAM upgrade for L45-S7423/ | 2022-03-28 16:42 | - | |
| RAM upgrde for my C55t-A5103 - will 16GB (2x8GB) work/ | 2022-03-28 16:42 | - | |
| REMOVING BLOATWARE from Toshiba U305/ | 2022-03-28 16:42 | - | |
| REQUESTING REVIEW/ | 2022-03-28 16:42 | - | |
| REQest-Bios Microcode update Satellite L500-1EN/ | 2022-03-28 16:42 | - | |
| RESOLUTION PROBLEMS ON x205 , HELP/ | 2022-03-28 16:42 | - | |
| Racism in Toshiba laptop (cant change key bindings)/ | 2022-03-28 16:42 | - | |
| Radeon HD 3650/ | 2022-03-28 16:42 | - | |
| Raid X205/ | 2022-03-28 16:42 | - | |
| Raising prices/ | 2022-03-28 16:42 | - | |
| Ram/ | 2022-03-28 16:42 | - | |
| Ram Upgrade Issues/ | 2022-03-28 16:42 | - | |
| Ram upgrade from 512mb to 2gb in Satellite M100/ | 2022-03-28 16:42 | - | |
| Random Laptop shut downs NOT HEAT RELATED/ | 2022-03-28 16:42 | - | |
| Random No Sound!/ | 2022-03-28 16:42 | - | |
| Random touchpad freezes/ | 2022-03-28 16:42 | - | |
| Re- t2050 to t7200/ | 2022-03-28 16:42 | - | |
| Reading SD card bridge media adapter/ | 2022-03-28 16:42 | - | |
| RealTek Audio Issues After Fresh XP SP3 Install/ | 2022-03-28 16:42 | - | |
| Real Time Clock Problem/ | 2022-03-28 16:42 | - | |
| Realtek Audio Driver Won't Install on Toshiba P745/ | 2022-03-28 16:42 | - | |
| Reapplying thermal paste for cpu/ | 2022-03-28 16:42 | - | |
| Reason and sollution for overheating M30/ | 2022-03-28 16:42 | - | |
| Reassembled Portege 4000 - problems/ | 2022-03-28 16:42 | - | |
| Reassign Disable Annoying Qosmio Media Keys/ | 2022-03-28 16:42 | - | |
| Received replacement T135 with flexible keyboard/ | 2022-03-28 16:42 | - | |
| Recently Released Toshiba Tecra M3/ | 2022-03-28 16:42 | - | |
| Recently Released Toshiba Tecra S2/ | 2022-03-28 16:42 | - | |
| Recommed Toshiba/ | 2022-03-28 16:42 | - | |
| Recommended Tecra A8 StartUp Settings (MSCONFIG)/ | 2022-03-28 16:42 | - | |
| Record from TV to DVD wirelessly/ | 2022-03-28 16:42 | - | |
| Recording VHS tapes to computer hard drive/ | 2022-03-28 16:42 | - | |
| Recover Disk for tecra m2/ | 2022-03-28 16:42 | - | |
| Recovering Space on the Qosmio 64GB SSD/ | 2022-03-28 16:42 | - | |
| Recovery/ | 2022-03-28 16:42 | - | |
| Recovery CD DVD/ | 2022-03-28 16:42 | - | |
| Recovery CD Password/ | 2022-03-28 16:42 | - | |
| Recovery Disc Creator Download/ | 2022-03-28 16:42 | - | |
| Recovery Disc Creator error/ | 2022-03-28 16:42 | - | |
| Recovery Disk/ | 2022-03-28 16:42 | - | |
| Recovery Disk Creator program gives error/ | 2022-03-28 16:42 | - | |
| Recovery Error- F3-FFFF-0013/ | 2022-03-28 16:42 | - | |
| Recovery Problem/ | 2022-03-28 16:42 | - | |
| Recovery discs for a C655D/ | 2022-03-28 16:42 | - | |
| Recovery from WINRE Partition/ | 2022-03-28 16:42 | - | |
| Recovery issues on two P205's/ | 2022-03-28 16:42 | - | |
| Recovery problem (Tecra A10 if it matters)/ | 2022-03-28 16:42 | - | |
| Recovery problem- files are there but how to use them/ | 2022-03-28 16:42 | - | |
| Recovery without CD drive/ | 2022-03-28 16:42 | - | |
| Red Screen and Red fringing on Satellite X205/ | 2022-03-28 16:42 | - | |
| Reduce Display Brightness Satellite U305-S7467/ | 2022-03-28 16:42 | - | |
| Reducing fan noise on M55/ | 2022-03-28 16:42 | - | |
| Reformat Help/ | 2022-03-28 16:42 | - | |
| Reformat a Satellite A105/ | 2022-03-28 16:42 | - | |
| Reformating a A100/ | 2022-03-28 16:42 | - | |
| Reformating hard drive/ | 2022-03-28 16:42 | - | |
| Reformat reinstall start from scratch L305D-S5938/ | 2022-03-28 16:42 | - | |
| Reformatting a brand new laptop/ | 2022-03-28 16:42 | - | |
| Reformatting my Toshiba Laptop/ | 2022-03-28 16:42 | - | |
| Refresh Of Qosmio Line/ | 2022-03-28 16:42 | - | |
| Refurbed Toshi' from Radio Shack/ | 2022-03-28 16:42 | - | |
| Refurbished Toshiba Where to buy/ | 2022-03-28 16:42 | - | |
| Reinstall Windows with recovery cd/ | 2022-03-28 16:42 | - | |
| Reinstal windows on A65 with broken DVD drive/ | 2022-03-28 16:42 | - | |
| Reliability of Toshiba laptops/ | 2022-03-28 16:42 | - | |
| Removal of HD for repair/ | 2022-03-28 16:42 | - | |
| Remove Tecra A8 keyboard/ | 2022-03-28 16:42 | - | |
| Remove Vista And Install Windows XP Toshiba Satellite A200 (PSAF6A)/ | 2022-03-28 16:42 | - | |
| Remove Volume On Screen Display Indicator/ | 2022-03-28 16:42 | - | |
| Remove bios update/ | 2022-03-28 16:42 | - | |
| Remove known HDD password on Toshiba Tecra M2/ | 2022-03-28 16:42 | - | |
| Remove known HDD password on Toshiba Tecra M2 again/ | 2022-03-28 16:42 | - | |
| Removing Bloatware from U200/ | 2022-03-28 16:42 | - | |
| Removing Bloatware on a Toshiba Satellite L505D & Operating System Disc Question/ | 2022-03-28 16:42 | - | |
| Removing HDD Cover on M115 Series/ | 2022-03-28 16:42 | - | |
| Removing Password from Bios/ | 2022-03-28 16:42 | - | |
| Removing Vista and installing XP/ | 2022-03-28 16:42 | - | |
| Removing a key cap, cleaning under key/ | 2022-03-28 16:42 | - | |
| Removing bloatware (l650)/ | 2022-03-28 16:42 | - | |
| Removing bloatware/ | 2022-03-28 16:42 | - | |
| Removing keyboard keys from a M70/ | 2022-03-28 16:42 | - | |
| Removing laptop cover- Toshiba Satellite U200-161/ | 2022-03-28 16:42 | - | |
| Removing norton internet security/ | 2022-03-28 16:42 | - | |
| Reoccuring problem!please suggest/ | 2022-03-28 16:42 | - | |
| Repairing a120 audio jack/ | 2022-03-28 16:42 | - | |
| Repair or Recovery/ | 2022-03-28 16:42 | - | |
| Replace HDD on Dynabook CX 2213CMSW/ | 2022-03-28 16:42 | - | |
| Replace HDD with SDD in Portege R500 with WinXP/ | 2022-03-28 16:42 | - | |
| Replace Intel Pro Wireless 3945ABG with Intel Centrino Ultimate-N 6300/ | 2022-03-28 16:42 | - | |
| Replace Portege R830 DVD drive with HDD SSD/ | 2022-03-28 16:42 | - | |
| Replace Toshiba A205 Keyboard/ | 2022-03-28 16:42 | - | |
| Replace a new hard drive for laptop/ | 2022-03-28 16:42 | - | |
| Replace cmos battery on Satellite Pro A200/ | 2022-03-28 16:42 | - | |
| Replaced thermal paste on a215 and it's amazing what a difference it makes!/ | 2022-03-28 16:42 | - | |
| Replace graphic card of Toshiba Satellite P100-187/ | 2022-03-28 16:42 | - | |
| Replacement Battery for old Satellite/ | 2022-03-28 16:42 | - | |
| Replacement Bezel Screws for a P100-160/ | 2022-03-28 16:42 | - | |
| Replacement Master IDE Slimline Optical drive for Toshiba Laptop/ | 2022-03-28 16:42 | - | |
| Replacement WUXGA panel for X305/ | 2022-03-28 16:42 | - | |
| Replacement battery pack won't charge/ | 2022-03-28 16:42 | - | |
| Replacement screen needed, but from where !/ | 2022-03-28 16:42 | - | |
| Replace motherboard satellite pro p100 PSPA4A-005002/ | 2022-03-28 16:42 | - | |
| Replacing Broadcom Wireless A665/ | 2022-03-28 16:42 | - | |
| Replacing CD-ROM, keyboard on Satellite 1625 CDT/ | 2022-03-28 16:42 | - | |
| Replacing HD in A135/ | 2022-03-28 16:42 | - | |
| Replacing Hard Drive/ | 2022-03-28 16:42 | - | |
| Replacing M35X-S161 cover/ | 2022-03-28 16:42 | - | |
| Replacing Toshiba P745 with Portege R935 Your Thoughts/ | 2022-03-28 16:42 | - | |
| Replacing WiFi Card on a L300D/ | 2022-03-28 16:42 | - | |
| Replacing harddrive/ | 2022-03-28 16:42 | - | |
| Replacing keyboard with a different layout/ | 2022-03-28 16:42 | - | |
| Replacing processor on a A135-S7404/ | 2022-03-28 16:42 | - | |
| Replacing the hard drive in a Toshiba Satellite/ | 2022-03-28 16:42 | - | |
| Replacing the hard drive in a x205/ | 2022-03-28 16:42 | - | |
| Replacing the modem with something useful/ | 2022-03-28 16:42 | - | |
| Rerquest for Wallpaper Qosmio x300/ | 2022-03-28 16:42 | - | |
| Reset Toshiba Portege M400 bios password/ | 2022-03-28 16:42 | - | |
| Resolution of the Satellite A660/ | 2022-03-28 16:42 | - | |
| Restore Cd for Satellite 1100-S101 anyone/ | 2022-03-28 16:42 | - | |
| Restore Disk Operation/ | 2022-03-28 16:42 | - | |
| Restore NOT working with C Key/ | 2022-03-28 16:42 | - | |
| Restore ONLY Windows/ | 2022-03-28 16:42 | - | |
| Restore disc or recovery or partition/ | 2022-03-28 16:42 | - | |
| Restore unsing the origiinal settings without CD/ | 2022-03-28 16:42 | - | |
| Restoring to factory drive configuration/ | 2022-03-28 16:42 | - | |
| Resurrecting a died Toshiba's A200-ST2/ | 2022-03-28 16:42 | - | |
| Returned a m30x, but had a wonderful experience/ | 2022-03-28 16:42 | - | |
| Returned my m30x, now I got a spare AC adapter/ | 2022-03-28 16:42 | - | |
| Return to newegg for exchange vs. sending to Toshiba for warranty repair/ | 2022-03-28 16:42 | - | |
| Reverting an activated Windows 8 Toshiba laptop to Windows 7/ | 2022-03-28 16:42 | - | |
| Reverting to older bios version on P105/ | 2022-03-28 16:42 | - | |
| Review Feedback on U500/ | 2022-03-28 16:42 | - | |
| Review for A60/ | 2022-03-28 16:42 | - | |
| Review of My Qosmio X505-Q892/ | 2022-03-28 16:42 | - | |
| Review of Toshiba X775-Q7384/ | 2022-03-28 16:42 | - | |
| Review on Toshiba A100-727/ | 2022-03-28 16:42 | - | |
| Reviews for Satellite A660-ST2N01/ | 2022-03-28 16:42 | - | |
| Reviving a dead Satellite L505-S5966/ | 2022-03-28 16:42 | - | |
| Revving Sounds/ | 2022-03-28 16:42 | - | |
| Riddle me this- How do you turn on a webcam that's stuck on the display/ | 2022-03-28 16:42 | - | |
| Right, im getting me a X205. What should i do with it first/ | 2022-03-28 16:42 | - | |
| Riva Tuner/ | 2022-03-28 16:42 | - | |
| RivaTuner 2.08 not compatible with X205-SLi4/ | 2022-03-28 16:42 | - | |
| Rumored upcoming 13in/ | 2022-03-28 16:42 | - | |
| S-Video Out Issue on Toshiba A100/ | 2022-03-28 16:42 | - | |
| S-video in X205 SLI1 help please !!!/ | 2022-03-28 16:42 | - | |
| S-video output on the Sattelite M65/ | 2022-03-28 16:42 | - | |
| S2 Questions/ | 2022-03-28 16:42 | - | |
| S50D thread/ | 2022-03-28 16:42 | - | |
| S70 OS question/ | 2022-03-28 16:42 | - | |
| S100-S1132; no one has it/ | 2022-03-28 16:42 | - | |
| S100 Heat and Fan Issues/ | 2022-03-28 16:42 | - | |
| S100 port replicator question/ | 2022-03-28 16:42 | - | |
| S235-S1345 vs S1345 S1360 -- Same Model/ | 2022-03-28 16:42 | - | |
| S955 - Display freezes but audio keeps playing/ | 2022-03-28 16:42 | - | |
| S1900-102/ | 2022-03-28 16:42 | - | |
| S2112 Memory Upgrade/ | 2022-03-28 16:42 | - | |
| S6056, S6059, or S6020/ | 2022-03-28 16:42 | - | |
| S7438 Windows XP Drivers Needed Argh!/ | 2022-03-28 16:42 | - | |
| SAFEST BEST OC Clocks for 8700mGT/ | 2022-03-28 16:42 | - | |
| SATA Drivers for Vista 64/ | 2022-03-28 16:42 | - | |
| SATA Throughput for A135-2246/ | 2022-03-28 16:42 | - | |
| SATELLITE L75D-A7288 not turbo boosting -(/ | 2022-03-28 16:42 | - | |
| SATELLITE L305D-S5934 turns on when it wants to/ | 2022-03-28 16:42 | - | |
| SATELLITE POWER CORD LOOSE! 4 prong/ | 2022-03-28 16:42 | - | |
| SATELLITE PRO S300-121 cpu upgrade/ | 2022-03-28 16:42 | - | |
| SATELLITE PRO S300-121 lcd cracked need/ | 2022-03-28 16:42 | - | |
| SDHC SD card not read by Portege R500/ | 2022-03-28 16:42 | - | |
| SDRAM question 5205-S705/ | 2022-03-28 16:42 | - | |
| SD card reader not reading all data/ | 2022-03-28 16:42 | - | |
| SIM card stuck in slot/ | 2022-03-28 16:42 | - | |
| S L355d/ | 2022-03-28 16:42 | - | |
| SLI- a joke/ | 2022-03-28 16:42 | - | |
| SLI1's S-video- Does it work for games/ | 2022-03-28 16:42 | - | |
| SLI1 GPU upgrade to P8600/ | 2022-03-28 16:42 | - | |
| SLI1 tweaking adventures story/ | 2022-03-28 16:42 | - | |
| SLI3 Temps-Graphics in particular/ | 2022-03-28 16:42 | - | |
| SLI3 gigabit network BSOD/ | 2022-03-28 16:42 | - | |
| SLI in a Qosmio - anyone tried it/ | 2022-03-28 16:42 | - | |
| SLOW touch pad/ | 2022-03-28 16:42 | - | |
| SLi-3 Driver Problems. Cant upgrade/ | 2022-03-28 16:42 | - | |
| SLi1 BIOS version/ | 2022-03-28 16:42 | - | |
| SLi1 w XP & 177.41 drivers = 7500 no OC!!/ | 2022-03-28 16:42 | - | |
| SLi2 and SLi4 now available/ | 2022-03-28 16:42 | - | |
| S PDIF I am so lost, and i know computers/ | 2022-03-28 16:42 | - | |
| SPDIF output in Toshiba A300/ | 2022-03-28 16:42 | - | |
| SSD Drive upgrade ptions/ | 2022-03-28 16:42 | - | |
| SSD In a T115D-S1125RD/ | 2022-03-28 16:42 | - | |
| SSD Question/ | 2022-03-28 16:42 | - | |
| SSD Upgrade for A500-ST22 - Can it be done/ | 2022-03-28 16:42 | - | |
| SSD installation into HDD Drive Caddy as 2nd drive/ | 2022-03-28 16:42 | - | |
| SSDs work in Satellite A135-S4527/ | 2022-03-28 16:42 | - | |
| STOP C0000221 Urlmon.dll corrupted/ | 2022-03-28 16:42 | - | |
| SXGA+ (1400x1050) screen quality of Tecra M5/ | 2022-03-28 16:42 | - | |
| Sa40-261 Won't boot No BIOS/ | 2022-03-28 16:42 | - | |
| Safe Mode/ | 2022-03-28 16:42 | - | |
| Safe to peel off sticker on Toshiba Satellite L505/ | 2022-03-28 16:42 | - | |
| Salellite A30 921/ | 2022-03-28 16:42 | - | |
| Same 4 less/ | 2022-03-28 16:42 | - | |
| Samsung A500 Hands-on Looks Good/ | 2022-03-28 16:42 | - | |
| Sandisk help/ | 2022-03-28 16:42 | - | |
| Sandy bridge Toshiba bios modding thread (XMP enabled)/ | 2022-03-28 16:42 | - | |
| Santa Rosa Notebooks/ | 2022-03-28 16:42 | - | |
| Sat. p30 Battery charging problem/ | 2022-03-28 16:42 | - | |
| Sat A110 won't turn on/ | 2022-03-28 16:42 | - | |
| Sat M40- MY FAN DIED/ | 2022-03-28 16:42 | - | |
| Sat P105-s9722 Battery Not Charging/ | 2022-03-28 16:42 | - | |
| Sat Pro A200GE-26Q Heat/ | 2022-03-28 16:42 | - | |
| Satalite p200 pro overheating, can fan be controlled/ | 2022-03-28 16:42 | - | |
| Satallite Pro M300 Quality/ | 2022-03-28 16:42 | - | |
| Satelite A100 VA1 Jiggly Battery Issue/ | 2022-03-28 16:42 | - | |
| Satelite A105- My delete key fell off!/ | 2022-03-28 16:42 | - | |
| Satelite C55-B5300 NO CMOS BATTERY/ | 2022-03-28 16:42 | - | |
| Satelite L45-S7423 -- Work with XP/ | 2022-03-28 16:42 | - | |
| Satelite L45-S7423 and Mouse problems/ | 2022-03-28 16:42 | - | |
| Satelite M500 - Optimus/ | 2022-03-28 16:42 | - | |
| Satelitte A10 shuts down by itself/ | 2022-03-28 16:42 | - | |
| Satelitte L300 Reformat/ | 2022-03-28 16:42 | - | |
| Satelitte a25 recovery disks/ | 2022-03-28 16:42 | - | |
| Satellite/ | 2022-03-28 16:42 | - | |
| Satellite 100 not starting up/ | 2022-03-28 16:42 | - | |
| Satellite 205cds screen size/ | 2022-03-28 16:42 | - | |
| Satellite 755-175 drivers/ | 2022-03-28 16:42 | - | |
| Satellite 1100 Problems/ | 2022-03-28 16:42 | - | |
| Satellite 1100 disassembly/ | 2022-03-28 16:42 | - | |
| Satellite 1105 Recovery/ | 2022-03-28 16:42 | - | |
| Satellite 1110 laptop - screen issue button playing up/ | 2022-03-28 16:42 | - | |
| Satellite 1115-S103 DVD SD-C2612 options/ | 2022-03-28 16:42 | - | |
| Satellite 1135 Crash. How to fix now/ | 2022-03-28 16:42 | - | |
| Satellite 1135 S155 USB Problems/ | 2022-03-28 16:42 | - | |
| Satellite 1400 - Dead CD Drive/ | 2022-03-28 16:42 | - | |
| Satellite 1405 Hinges/ | 2022-03-28 16:42 | - | |
| Satellite 1405 power problem/ | 2022-03-28 16:42 | - | |
| Satellite 1695CDT, accepts 168 pin memory/ | 2022-03-28 16:42 | - | |
| Satellite 1800-maximum RAM amount/ | 2022-03-28 16:42 | - | |
| Satellite 1800 Memory Upgrade/ | 2022-03-28 16:42 | - | |
| Satellite 1905-S301 S-Video/ | 2022-03-28 16:42 | - | |
| Satellite 2415 Charge question/ | 2022-03-28 16:42 | - | |
| Satellite 2435-S255 Upgrade Question Newbie/ | 2022-03-28 16:42 | - | |
| Satellite 3005-S307 rejuvination!!/ | 2022-03-28 16:42 | - | |
| Satellite 3040cdt hard drive upgrade/ | 2022-03-28 16:42 | - | |
| Satellite 5005 BIOS/ | 2022-03-28 16:42 | - | |
| Satellite 5205-S505 Notebook/ | 2022-03-28 16:42 | - | |
| Satellite 6100 and wireless card issue/ | 2022-03-28 16:42 | - | |
| Satellite A10/ | 2022-03-28 16:42 | - | |
| Satellite A15-S127 Notebook/ | 2022-03-28 16:42 | - | |
| Satellite A20- LCD Backlight dead.. how do i replace/ | 2022-03-28 16:42 | - | |
| Satellite A20 Bios Update/ | 2022-03-28 16:42 | - | |
| Satellite A25-S307 -- what's it worth/ | 2022-03-28 16:42 | - | |
| Satellite A25-S2792 Power Problems/ | 2022-03-28 16:42 | - | |
| Satellite A30 - Battery starts discharging while power supply is connected/ | 2022-03-28 16:42 | - | |
| Satellite A30 can't play any DVD after format/ | 2022-03-28 16:42 | - | |
| Satellite A30 screen flickering/ | 2022-03-28 16:42 | - | |
| Satellite A35 Mobo Replacement Advice/ | 2022-03-28 16:42 | - | |
| Satellite A45-S120 CPU compatibility question/ | 2022-03-28 16:42 | - | |
| Satellite A45-S1202/ | 2022-03-28 16:42 | - | |
| Satellite A55-S326 Power Issues/ | 2022-03-28 16:42 | - | |
| Satellite A65-S126 = No Power To The Board/ | 2022-03-28 16:42 | - | |
| Satellite A65-S1362-- Over Heating & Shutting Down/ | 2022-03-28 16:42 | - | |
| Satellite A70-RX1/ | 2022-03-28 16:42 | - | |
| Satellite A70-TSI/ | 2022-03-28 16:42 | - | |
| Satellite A70-processor HD upgrade/ | 2022-03-28 16:42 | - | |
| Satellite A70 Issues Flaws/ | 2022-03-28 16:42 | - | |
| Satellite A70 users/ | 2022-03-28 16:42 | - | |
| Satellite A75-S211 Touchpad/ | 2022-03-28 16:42 | - | |
| Satellite A75 S211 touchpad/ | 2022-03-28 16:42 | - | |
| Satellite A80 - bios update gone wrong/ | 2022-03-28 16:42 | - | |
| Satellite A80 - new/ | 2022-03-28 16:42 | - | |
| Satellite A80 recovery DVD partitioning/ | 2022-03-28 16:42 | - | |
| Satellite A100-192 - X1600 seriously underclocked/ | 2022-03-28 16:42 | - | |
| Satellite A100-220 - which RAM slot is the 1st one/ | 2022-03-28 16:42 | - | |
| Satellite A100-702 anybody/ | 2022-03-28 16:42 | - | |
| Satellite A100-773 - cooling fans are not spinning/ | 2022-03-28 16:42 | - | |
| Satellite A100-2222E/ | 2022-03-28 16:42 | - | |
| Satellite A100 - Need Vista 64Bit Mass Storage Controller & TOS1901 driver/ | 2022-03-28 16:42 | - | |
| Satellite A100-SK9 electrical specs/ | 2022-03-28 16:42 | - | |
| Satellite A100-VA9 Crashing/ | 2022-03-28 16:42 | - | |
| Satellite A100-VA9 Hassles/ | 2022-03-28 16:42 | - | |
| Satellite A100 Battery Indicator issue with Vista/ | 2022-03-28 16:42 | - | |
| Satellite A100 DVD Burn Issue/ | 2022-03-28 16:42 | - | |
| Satellite A100 DVD CD Freeze/ | 2022-03-28 16:42 | - | |
| Satellite A100 LCD screen problems/ | 2022-03-28 16:42 | - | |
| Satellite A100 List Problem/ | 2022-03-28 16:42 | - | |
| Satellite A100 Screen Flash Flicker Popup/ | 2022-03-28 16:42 | - | |
| Satellite A100 VA9 AV Buttons/ | 2022-03-28 16:42 | - | |
| Satellite A100 body construction/ | 2022-03-28 16:42 | - | |
| Satellite A100 brightness problem/ | 2022-03-28 16:42 | - | |
| Satellite A105-S101 Memory upgrade help/ | 2022-03-28 16:42 | - | |
| Satellite A105-S2716...Any Opinion/ | 2022-03-28 16:42 | - | |
| Satellite A105-S4002 Upgrade to Vista - Display Driver Problem/ | 2022-03-28 16:42 | - | |
| Satellite A105-S4054 DVD won't read- Coincidence/ | 2022-03-28 16:42 | - | |
| Satellite A105-S4284 - SDHC memory card in SD card slot/ | 2022-03-28 16:42 | - | |
| Satellite A105-S4364- Q re which OS/ | 2022-03-28 16:42 | - | |
| Satellite A105-S4383 At Circuit City/ | 2022-03-28 16:42 | - | |
| Satellite A105-S4384 Hibernation Problem/ | 2022-03-28 16:42 | - | |
| Satellite A105 - Screen blacks out/ | 2022-03-28 16:42 | - | |
| Satellite A105- changing video ram to 128MB/ | 2022-03-28 16:42 | - | |
| Satellite A105 S4054 - hate it, love it Is the A105 series okay/ | 2022-03-28 16:42 | - | |
| Satellite A110 System fan problem/ | 2022-03-28 16:42 | - | |
| Satellite A130 question/ | 2022-03-28 16:42 | - | |
| Satellite A135-4727 power issues/ | 2022-03-28 16:42 | - | |
| Satellite A135-S2246 BIos Memory or power issue/ | 2022-03-28 16:42 | - | |
| Satellite A135-S2246 problems/ | 2022-03-28 16:42 | - | |
| Satellite A135-S2276 running horribly slow/ | 2022-03-28 16:42 | - | |
| Satellite A135-S2326 Battery problem/ | 2022-03-28 16:42 | - | |
| Satellite A135-S2386 Hard drive upgrade/ | 2022-03-28 16:42 | - | |
| Satellite A135-S3296/ | 2022-03-28 16:42 | - | |
| Satellite A135-S4467 and fan/ | 2022-03-28 16:42 | - | |
| Satellite A135-S4656 XP install instructions/ | 2022-03-28 16:42 | - | |
| Satellite A135-S7404 SUCKS! Help!/ | 2022-03-28 16:42 | - | |
| Satellite A135/ | 2022-03-28 16:42 | - | |
| Satellite A135 2276 Hangs frequently/ | 2022-03-28 16:42 | - | |
| Satellite A135 Question/ | 2022-03-28 16:42 | - | |
| Satellite A135 Wifi mod/ | 2022-03-28 16:42 | - | |
| Satellite A200's HD2600 catalyst 7.10/ | 2022-03-28 16:42 | - | |
| Satellite A200-17O - CPU too slow/ | 2022-03-28 16:42 | - | |
| Satellite A200-236 display resolution/ | 2022-03-28 16:42 | - | |
| Satellite A200-AHI PSAE0C-AHIO6C Drivers/ | 2022-03-28 16:42 | - | |
| Satellite A200-TR6 -- Dead/ | 2022-03-28 16:42 | - | |
| Satellite A200-TR6 USB Problem/ | 2022-03-28 16:42 | - | |
| Satellite A200/ | 2022-03-28 16:42 | - | |
| Satellite A200 Family/ | 2022-03-28 16:42 | - | |
| Satellite A200 Sleep and Hibernate Problems/ | 2022-03-28 16:42 | - | |
| Satellite A200 and Windows Vistas SP1/ | 2022-03-28 16:42 | - | |
| Satellite A200 recovery problem/ | 2022-03-28 16:42 | - | |
| Satellite A200 wont boot. Help please/ | 2022-03-28 16:42 | - | |
| Satellite A205 + Hitachi Travelstar 7K500/ | 2022-03-28 16:42 | - | |
| Satellite A205-S4577 help if you dont mind please/ | 2022-03-28 16:42 | - | |
| Satellite A205-S5800 CPU Upgrade/ | 2022-03-28 16:42 | - | |
| Satellite A205-S5800 XP Drivers/ | 2022-03-28 16:42 | - | |
| Satellite A205-S5804 and WinXP (BSOD on first boot) - Any help appreciated!/ | 2022-03-28 16:42 | - | |
| Satellite A205-S7458- I can't play games/ | 2022-03-28 16:42 | - | |
| Satellite A205-S7468- Device errors/ | 2022-03-28 16:42 | - | |
| Satellite A205/ | 2022-03-28 16:42 | - | |
| Satellite A205 help!! Please!/ | 2022-03-28 16:42 | - | |
| Satellite A205 is hovering around 60 degrees C/ | 2022-03-28 16:42 | - | |
| Satellite A205 problem with VGA output to Maxent 50XM3/ | 2022-03-28 16:42 | - | |
| Satellite A210-16G - CPU and memory frequency problem/ | 2022-03-28 16:42 | - | |
| Satellite A210-16f tv out/ | 2022-03-28 16:42 | - | |
| Satellite A210-133/ | 2022-03-28 16:42 | - | |
| Satellite A210-ms5 - I Need The Working Bios/ | 2022-03-28 16:42 | - | |
| Satellite A214-S7422 will not boot/ | 2022-03-28 16:42 | - | |
| Satellite A215-4747 hard disk inconsistency. what kind i do/ | 2022-03-28 16:42 | - | |
| Satellite A215-S4747 dropping WLAN connection!/ | 2022-03-28 16:42 | - | |
| Satellite A215-S4757 display will not work/ | 2022-03-28 16:42 | - | |
| Satellite A215-S4807 and touchpad scroll/ | 2022-03-28 16:42 | - | |
| Satellite A215-S7414 Bios update crash/ | 2022-03-28 16:42 | - | |
| Satellite A215-S7416 Can't find info, any good/ | 2022-03-28 16:42 | - | |
| Satellite A215-S7422 bios crisis recovery/ | 2022-03-28 16:42 | - | |
| Satellite A215 Keyboard problem/ | 2022-03-28 16:42 | - | |
| Satellite A215 Ques/ | 2022-03-28 16:42 | - | |
| Satellite A215 Series - The middle access panel/ | 2022-03-28 16:42 | - | |
| Satellite A215 Won't Start/ | 2022-03-28 16:42 | - | |
| Satellite A215 set its own password/ | 2022-03-28 16:42 | - | |
| Satellite A300-047/ | 2022-03-28 16:42 | - | |
| Satellite A300-1G3 OR Satellite Pro A300-1Ns/ | 2022-03-28 16:42 | - | |
| Satellite A300-15A manual to download/ | 2022-03-28 16:42 | - | |
| Satellite A300-15B/ | 2022-03-28 16:42 | - | |
| Satellite A300-16I good buy/ | 2022-03-28 16:42 | - | |
| Satellite A300 - weird problem with noise/ | 2022-03-28 16:42 | - | |
| Satellite A300 Keyboard compatibility/ | 2022-03-28 16:42 | - | |
| Satellite A300 lcd inverter/ | 2022-03-28 16:42 | - | |
| Satellite A305-S6905 Problem With BIOS PASSWORD !!!/ | 2022-03-28 16:42 | - | |
| Satellite A305-S6905 left fan exhaust creaking/ | 2022-03-28 16:42 | - | |
| Satellite A 305 LED/ | 2022-03-28 16:42 | - | |
| Satellite A500-027 [Canada]/ | 2022-03-28 16:42 | - | |
| Satellite A500-17x Audio Crackling/ | 2022-03-28 16:42 | - | |
| Satellite A500-18R blank screen/ | 2022-03-28 16:42 | - | |
| Satellite A500-ST6621 - First Impressions/ | 2022-03-28 16:42 | - | |
| Satellite A500 Graphics Upgrade/ | 2022-03-28 16:42 | - | |
| Satellite A505-S6965 Ac Adapter needed/ | 2022-03-28 16:42 | - | |
| Satellite A505-S6965 touch pad freezes/ | 2022-03-28 16:42 | - | |
| Satellite A505-S6969/ | 2022-03-28 16:42 | - | |
| Satellite A660-BT2G22 Laptop/ | 2022-03-28 16:42 | - | |
| Satellite A660D-ST2G02 keyboard FN+Z backlight keyboard/ | 2022-03-28 16:42 | - | |
| Satellite A660 Screen Resolution/ | 2022-03-28 16:42 | - | |
| Satellite A665-S6086- Factory Bluetooth/ | 2022-03-28 16:42 | - | |
| Satellite A665-S6093 Upgrade/ | 2022-03-28 16:42 | - | |
| Satellite A665D-S6051 Black Screen - Corrupted BIOS/ | 2022-03-28 16:42 | - | |
| Satellite AV200-10V/ | 2022-03-28 16:42 | - | |
| Satellite C50-B-1C4 Bios reset/ | 2022-03-28 16:42 | - | |
| Satellite C75D-B7300 - thoughts/ | 2022-03-28 16:42 | - | |
| Satellite C75D-B7300 ram upgradable/ | 2022-03-28 16:42 | - | |
| Satellite C650 display replacement/ | 2022-03-28 16:42 | - | |
| Satellite C650 not booting with DVD/ | 2022-03-28 16:42 | - | |
| Satellite C650 occasionally wont turn on/ | 2022-03-28 16:42 | - | |
| Satellite C655-S5060 cracked LCD repair/ | 2022-03-28 16:42 | - | |
| Satellite C655/ | 2022-03-28 16:42 | - | |
| Satellite C655 Issue/ | 2022-03-28 16:42 | - | |
| Satellite C655 question/ | 2022-03-28 16:42 | - | |
| Satellite C850-19D cpu update/ | 2022-03-28 16:42 | - | |
| Satellite C850-B797 review/ | 2022-03-28 16:42 | - | |
| Satellite C855-226 Weight/ | 2022-03-28 16:42 | - | |
| Satellite C875 - backlit keyboard possible/ | 2022-03-28 16:42 | - | |
| Satellite Closing Lid Query/ | 2022-03-28 16:42 | - | |
| Satellite Display Device Switching/ | 2022-03-28 16:42 | - | |
| Satellite E205 - touchpad bug/ | 2022-03-28 16:42 | - | |
| Satellite HDD Frequent Spindown/ | 2022-03-28 16:42 | - | |
| Satellite L25-S1193 Memory/ | 2022-03-28 16:42 | - | |
| Satellite L25-S1193 problem need help ASAP/ | 2022-03-28 16:42 | - | |
| Satellite L25-S1193 running full throttle all the time/ | 2022-03-28 16:42 | - | |
| Satellite L30-10Y memory upgrade problem/ | 2022-03-28 16:42 | - | |
| Satellite L35-S1054 CPU RAM upgrade 100%/ | 2022-03-28 16:42 | - | |
| Satellite L35-S2151's screen does not run on/ | 2022-03-28 16:42 | - | |
| Satellite L35-S2194/ | 2022-03-28 16:42 | - | |
| Satellite L35 Wi-fi problem/ | 2022-03-28 16:42 | - | |
| Satellite L40-18W driver/ | 2022-03-28 16:42 | - | |
| Satellite L44D-S5976 cpu upgrade/ | 2022-03-28 16:42 | - | |
| Satellite L300-11M/ | 2022-03-28 16:42 | - | |
| Satellite L300-20D CPU upgrade/ | 2022-03-28 16:42 | - | |
| Satellite L300-ST3502/ | 2022-03-28 16:42 | - | |
| Satellite L300 - any negative thoughts/ | 2022-03-28 16:42 | - | |
| Satellite L300 L350 Pro L350 Pro L300 h2o bios unlock hidden advanced settings menu Request/ | 2022-03-28 16:42 | - | |
| Satellite L305-S5920 disconnects frequently/ | 2022-03-28 16:42 | - | |
| Satellite L305-S5933 xp downgrade/ | 2022-03-28 16:42 | - | |
| Satellite L305-S5955 won't lite off/ | 2022-03-28 16:42 | - | |
| Satellite L305-s5865 is 1 HOUR OFF from correct time/ | 2022-03-28 16:42 | - | |
| Satellite L305-s5875 drivers/ | 2022-03-28 16:42 | - | |
| Satellite L305D-S5895/ | 2022-03-28 16:42 | - | |
| Satellite L305D-S5895 NEED HELP/ | 2022-03-28 16:42 | - | |
| Satellite L355 shuts down while playing WoW/ | 2022-03-28 16:42 | - | |
| Satellite L450D-10Z - Install replace the keyboard/ | 2022-03-28 16:42 | - | |
| Satellite L455-S5975 audio app/ | 2022-03-28 16:42 | - | |
| Satellite L455D not starting or responding to recovery CD/ | 2022-03-28 16:42 | - | |
| Satellite L500D/ | 2022-03-28 16:42 | - | |
| Satellite L500D AMD, anything to share/ | 2022-03-28 16:42 | - | |
| Satellite L505D Question-XP video driver/ | 2022-03-28 16:42 | - | |
| Satellite L505 Screen Vibration/ | 2022-03-28 16:42 | - | |
| Satellite L505 Speakers/ | 2022-03-28 16:42 | - | |
| Satellite L505 cannot locate anything wirelessly/ | 2022-03-28 16:42 | - | |
| Satellite L505d Sound, Usb, Wifi, Card reader not working Here's the Solution/ | 2022-03-28 16:42 | - | |
| Satellite L515-S4008/ | 2022-03-28 16:42 | - | |
| Satellite L635-S3040/ | 2022-03-28 16:42 | - | |
| Satellite L740/ | 2022-03-28 16:42 | - | |
| Satellite L755-S5301 and Bluetooth/ | 2022-03-28 16:42 | - | |
| Satellite L775D-S7206 green outlines around objects on LCD/ | 2022-03-28 16:42 | - | |
| Satellite L775D-S7223 Upgrade Question/ | 2022-03-28 16:42 | - | |
| Satellite M30 Help/ | 2022-03-28 16:42 | - | |
| Satellite M30 IDE #0 Fault. Wierd!/ | 2022-03-28 16:42 | - | |
| Satellite M30 Wireless malfunction/ | 2022-03-28 16:42 | - | |
| Satellite M30X-128- LCD panel compatibility list/ | 2022-03-28 16:42 | - | |
| Satellite M30X USB problems/ | 2022-03-28 16:42 | - | |
| Satellite M35X Color Problem !/ | 2022-03-28 16:42 | - | |
| Satellite M35X Screen Issue/ | 2022-03-28 16:42 | - | |
| Satellite M35x-S161 Screen Dimming/ | 2022-03-28 16:42 | - | |
| Satellite M40 - Boot and shutdown problems - ACPI and BIOS/ | 2022-03-28 16:42 | - | |
| Satellite M40 281 spare parts/ | 2022-03-28 16:42 | - | |
| Satellite M40 Display Problem/ | 2022-03-28 16:42 | - | |
| Satellite M40 Screen Dead. Sort of/ | 2022-03-28 16:42 | - | |
| Satellite M40X - any good/ | 2022-03-28 16:42 | - | |
| Satellite M40 media buttons question/ | 2022-03-28 16:42 | - | |
| Satellite M40 series shutdown problem/ | 2022-03-28 16:42 | - | |
| Satellite M45-S165 BIOS password/ | 2022-03-28 16:42 | - | |
| Satellite M45-S355 Graphics/ | 2022-03-28 16:42 | - | |
| Satellite M45-s265 random shut down & wont turn back on/ | 2022-03-28 16:42 | - | |
| Satellite M45/ | 2022-03-28 16:42 | - | |
| Satellite M45 S351 Dying/ | 2022-03-28 16:42 | - | |
| Satellite M45 freezes randomly and consistently/ | 2022-03-28 16:42 | - | |
| Satellite M45 or M55/ | 2022-03-28 16:42 | - | |
| Satellite M50-P345/ | 2022-03-28 16:42 | - | |
| Satellite M50-YK4, any opinions/ | 2022-03-28 16:42 | - | |
| Satellite M50 M55 keyboard wear/ | 2022-03-28 16:42 | - | |
| Satellite M50 M55 screen/ | 2022-03-28 16:42 | - | |
| Satellite M50 M55 vs Tecra A5 - build quality and battery life/ | 2022-03-28 16:42 | - | |
| Satellite M50 Media Button controls/ | 2022-03-28 16:42 | - | |
| Satellite M50 reviews anyone/ | 2022-03-28 16:42 | - | |
| Satellite M55-S135 BSOD in safe mode/ | 2022-03-28 16:42 | - | |
| Satellite M55-S325 will not post anymore/ | 2022-03-28 16:42 | - | |
| Satellite M55-S3512, no boot, 4-1-1 beep code/ | 2022-03-28 16:42 | - | |
| Satellite M60-BK3- Constant CPU Load from DPCs and Interrupts/ | 2022-03-28 16:42 | - | |
| Satellite M60 has no power/ | 2022-03-28 16:42 | - | |
| Satellite M65/ | 2022-03-28 16:42 | - | |
| Satellite M 70-129 supports DVD-RAM/ | 2022-03-28 16:42 | - | |
| Satellite M70 - 160 sound problems/ | 2022-03-28 16:42 | - | |
| Satellite M70-168 - new HD and OEM license/ | 2022-03-28 16:42 | - | |
| Satellite M70 and sound loudness and quality/ | 2022-03-28 16:42 | - | |
| Satellite M100-(PSMA0A)-Remote Control not working, please help!/ | 2022-03-28 16:42 | - | |
| Satellite M100 ...configuring added RAM/ | 2022-03-28 16:42 | - | |
| Satellite M100 Fingerprint reader/ | 2022-03-28 16:42 | - | |
| Satellite M100 Recovery Disk/ | 2022-03-28 16:42 | - | |
| Satellite M100 memory upgrading issue/ | 2022-03-28 16:42 | - | |
| Satellite M105-SP381 info/ | 2022-03-28 16:42 | - | |
| Satellite M105-s3041 Recovery Discs/ | 2022-03-28 16:42 | - | |
| Satellite M115 easy upgrades/ | 2022-03-28 16:42 | - | |
| Satellite M150, I think it's crashed/ | 2022-03-28 16:42 | - | |
| Satellite M205-S4806 - Help with rollback to XP/ | 2022-03-28 16:42 | - | |
| Satellite M500 - First Impressions/ | 2022-03-28 16:42 | - | |
| Satellite M500 009 windows 7 drivers/ | 2022-03-28 16:42 | - | |
| Satellite M645 s4050 HDD clicking/ | 2022-03-28 16:42 | - | |
| Satellite Media Buttons/ | 2022-03-28 16:42 | - | |
| Satellite P15-S409/ | 2022-03-28 16:42 | - | |
| Satellite P15 Internet Quick Access Button/ | 2022-03-28 16:42 | - | |
| Satellite P20 P25 Noise/ | 2022-03-28 16:42 | - | |
| Satellite P20 and pressed the power button to hard and now it is stuck in there/ | 2022-03-28 16:42 | - | |
| Satellite P25-S670/ | 2022-03-28 16:42 | - | |
| Satellite P25 series/ | 2022-03-28 16:42 | - | |
| Satellite P30 RG4/ | 2022-03-28 16:42 | - | |
| Satellite P50-A- Hard disk became much slow after re-installed Windows 8 pro/ | 2022-03-28 16:42 | - | |
| Satellite P50T-A Bricked/ | 2022-03-28 16:42 | - | |
| Satellite P55-A5312/ | 2022-03-28 16:42 | - | |
| Satellite P70 Screen - Subtle Uniform Pinstripe Vertical Lines/ | 2022-03-28 16:42 | - | |
| Satellite P100 (PSPA3A) and Conexant audio vista driver/ | 2022-03-28 16:42 | - | |
| Satellite P100, need help reviewing/ | 2022-03-28 16:42 | - | |
| Satellite P100-106 fan question/ | 2022-03-28 16:42 | - | |
| Satellite P100-160 XP Audio Problems again!/ | 2022-03-28 16:42 | - | |
| Satellite P100-160 dead pixel/ | 2022-03-28 16:42 | - | |
| Satellite P100 105 Questions- Battery & Sale/ | 2022-03-28 16:42 | - | |
| Satellite P100 HD to go question/ | 2022-03-28 16:42 | - | |
| Satellite P100 Lost Power During Bios Upgrade/ | 2022-03-28 16:42 | - | |
| Satellite P100 PSPA6C-SD802E video help plz!/ | 2022-03-28 16:42 | - | |
| Satellite P100 Suctomized First Impressions/ | 2022-03-28 16:42 | - | |
| Satellite P100 and SSD issue/ | 2022-03-28 16:42 | - | |
| Satellite P100 or Tecra A7/ | 2022-03-28 16:42 | - | |
| Satellite P100 question/ | 2022-03-28 16:42 | - | |
| Satellite P105 (with nVidia GeForce 7900) -- DISCONTINUED!/ | 2022-03-28 16:42 | - | |
| Satellite P105-S921 - Does it have WSXGA WUXGA options/ | 2022-03-28 16:42 | - | |
| Satellite P105-S921 available in Canada/ | 2022-03-28 16:42 | - | |
| Satellite P105-S6024 -VS- P105-S6134/ | 2022-03-28 16:42 | - | |
| Satellite P105-S6064 CD drive problems/ | 2022-03-28 16:42 | - | |
| Satellite P105-S6084 No Display/ | 2022-03-28 16:42 | - | |
| Satellite P105-S9312/ | 2022-03-28 16:42 | - | |
| Satellite P105-S9337 Won't Boot!/ | 2022-03-28 16:42 | - | |
| Satellite P105-S9339 Nvidia Go 7900 GS Replacement Needed/ | 2022-03-28 16:42 | - | |
| Satellite P105 6114 Media Buttons/ | 2022-03-28 16:42 | - | |
| Satellite P105 S9722 having trouble with Battery charging/ | 2022-03-28 16:42 | - | |
| Satellite P105 choppy audio/ | 2022-03-28 16:42 | - | |
| Satellite P200(PSPB6A) - Heating Issue/ | 2022-03-28 16:42 | - | |
| Satellite P200-1EE cpu upgrade T6570 (penryn) success !/ | 2022-03-28 16:42 | - | |
| Satellite P200-14H and Windows XP SATA problems/ | 2022-03-28 16:42 | - | |
| Satellite P200-17C BIOS Recovery/ | 2022-03-28 16:42 | - | |
| Satellite P200. Install second hard drive/ | 2022-03-28 16:42 | - | |
| Satellite P200D-11R 2nd HDD/ | 2022-03-28 16:42 | - | |
| Satellite P200 DVD Drive Problem/ | 2022-03-28 16:42 | - | |
| Satellite P205-S6337 - Can I install another second HDD/ | 2022-03-28 16:42 | - | |
| Satellite P205D-S7438 Intervideo WinDVD8/ | 2022-03-28 16:42 | - | |
| Satellite P300-19Q - Processor Upgrade/ | 2022-03-28 16:42 | - | |
| Satellite P300 - How many Mini PCIe Slots/ | 2022-03-28 16:42 | - | |
| Satellite P300- Your recommendation Also, 2 internal hard drives/ | 2022-03-28 16:42 | - | |
| Satellite P300D-10V - Win XP drivers/ | 2022-03-28 16:42 | - | |
| Satellite P305-S8825 Help!/ | 2022-03-28 16:42 | - | |
| Satellite P305-S8915 - Yea or Nay/ | 2022-03-28 16:42 | - | |
| Satellite P305D-S8828 disc problems/ | 2022-03-28 16:42 | - | |
| Satellite P305D-S8828 fan running excessively/ | 2022-03-28 16:42 | - | |
| Satellite P500-BT2N20- Anyone know if the firewire chip is Texas Instruments/ | 2022-03-28 16:42 | - | |
| Satellite P500 - Same Screen As Qosmio/ | 2022-03-28 16:42 | - | |
| Satellite P745 - thoughts on this laptop/ | 2022-03-28 16:42 | - | |
| Satellite P845t-S305 - F2 key press stuck sticky takes into BIOS without any usage of keyboard/ | 2022-03-28 16:42 | - | |
| Satellite P855-S5312 WIFI problem/ | 2022-03-28 16:42 | - | |
| Satellite PCMCIA ExpressCard won't fit!/ | 2022-03-28 16:42 | - | |
| Satellite P L 700 Series/ | 2022-03-28 16:42 | - | |
| Satellite Power Problem/ | 2022-03-28 16:42 | - | |
| Satellite Power not coming in/ | 2022-03-28 16:42 | - | |
| Satellite Pro 6100 H D Failure/ | 2022-03-28 16:42 | - | |
| Satellite Pro 6100 Wireless trouble/ | 2022-03-28 16:42 | - | |
| Satellite Pro 6100 not booting up/ | 2022-03-28 16:42 | - | |
| Satellite Pro A10/ | 2022-03-28 16:42 | - | |
| Satellite Pro A10 DVD Drive/ | 2022-03-28 16:42 | - | |
| Satellite Pro A100 - cpu upgrade/ | 2022-03-28 16:42 | - | |
| Satellite Pro A110 crashes while transferring large amount of data through LAN/ | 2022-03-28 16:42 | - | |
| Satellite Pro A120 modem issue/ | 2022-03-28 16:42 | - | |
| Satellite Pro A200-EZ2204X- decent performer/ | 2022-03-28 16:42 | - | |
| Satellite Pro A200 Service Manual/ | 2022-03-28 16:42 | - | |
| Satellite Pro A210-EZ2203X/ | 2022-03-28 16:42 | - | |
| Satellite Pro A300 (Canada) - anyone have one these/ | 2022-03-28 16:42 | - | |
| Satellite Pro A300-1NS, Entry is necessary/ | 2022-03-28 16:42 | - | |
| Satellite Pro A300 BIOS Recovery/ | 2022-03-28 16:42 | - | |
| Satellite Pro A300 on screen volume bar/ | 2022-03-28 16:42 | - | |
| Satellite Pro C-50A (SSD Problems)/ | 2022-03-28 16:42 | - | |
| Satellite Pro L40 cpu upgrade/ | 2022-03-28 16:42 | - | |
| Satellite Pro L300/ | 2022-03-28 16:42 | - | |
| Satellite Pro L300 Series vs. Satellite Pro A300 Series/ | 2022-03-28 16:42 | - | |
| Satellite Pro L300 screen/ | 2022-03-28 16:42 | - | |
| Satellite Pro L300 upgrades/ | 2022-03-28 16:42 | - | |
| Satellite Pro L510-EZ1410/ | 2022-03-28 16:42 | - | |
| Satellite Pro L650-1CH Motorboating BSOD/ | 2022-03-28 16:42 | - | |
| Satellite Pro M10 Power problem/ | 2022-03-28 16:42 | - | |
| Satellite Pro M30 or Tecra S1/ | 2022-03-28 16:42 | - | |
| Satellite Pro M30 vs. NEW Tecra A4/ | 2022-03-28 16:42 | - | |
| Satellite Pro P100-227 Dual monitor/ | 2022-03-28 16:42 | - | |
| Satellite Pro P300-1EX USB Ports broke/ | 2022-03-28 16:42 | - | |
| Satellite Pro S5100 and wireless networking/ | 2022-03-28 16:42 | - | |
| Satellite Pro U300 Battery Life/ | 2022-03-28 16:42 | - | |
| Satellite Pro U400-13G/ | 2022-03-28 16:42 | - | |
| Satellite Pro U400 warms the touchpad/ | 2022-03-28 16:42 | - | |
| Satellite Pro Vostro1500 vs A200-1F9 - T7300, 250gb, 2048mb, HD2600/ | 2022-03-28 16:42 | - | |
| Satellite Pro laptop and Infocus projector compatability/ | 2022-03-28 16:42 | - | |
| Satellite Pro opinions/ | 2022-03-28 16:42 | - | |
| Satellite P series/ | 2022-03-28 16:42 | - | |
| Satellite R630 - noisy fan/ | 2022-03-28 16:42 | - | |
| Satellite R830 R835 serious flaws (besides phantom Sata3, the fail of USB3. What's next )/ | 2022-03-28 16:42 | - | |
| Satellite Radius™ 15 4K P55W-C5208-4K Laptop- RAM and SSD Upgrades, Thoughts/ | 2022-03-28 16:42 | - | |
| Satellite S50 Mod/ | 2022-03-28 16:42 | - | |
| Satellite S135-S4527 freezing up when in screensaver mode/ | 2022-03-28 16:42 | - | |
| Satellite S4284 Screen turns black problem! HELP!/ | 2022-03-28 16:42 | - | |
| Satellite T115-S1100 Review/ | 2022-03-28 16:42 | - | |
| Satellite U205-S5002/ | 2022-03-28 16:42 | - | |
| Satellite U205-S5002 processor upgrade/ | 2022-03-28 16:42 | - | |
| Satellite U205/ | 2022-03-28 16:42 | - | |
| Satellite U205 with Vista/ | 2022-03-28 16:42 | - | |
| Satellite U300 - Does yours crash reboot Blue Screen after waking from Sleep/ | 2022-03-28 16:42 | - | |
| Satellite U300 U305 Fan Control/ | 2022-03-28 16:42 | - | |
| Satellite U300 and Satellite Pro U300 differences Which one is the better buy/ | 2022-03-28 16:42 | - | |
| Satellite U305-S5127 (WinXP Drivers Here)/ | 2022-03-28 16:42 | - | |
| Satellite U305 CD DVD issues/ | 2022-03-28 16:42 | - | |
| Satellite U400 - 15B/ | 2022-03-28 16:42 | - | |
| Satellite U400-ST3301/ | 2022-03-28 16:42 | - | |
| Satellite U400 405 fan speed/ | 2022-03-28 16:42 | - | |
| Satellite U405D Black Screen/ | 2022-03-28 16:42 | - | |
| Satellite X200 - 8700M - Counter Strike Source Issues/ | 2022-03-28 16:42 | - | |
| Satellite X200- fan intake covered/ | 2022-03-28 16:42 | - | |
| Satellite X200 Overheating PLEASE HELP ME!!!/ | 2022-03-28 16:42 | - | |
| Satellite X200 series Blu Ray upgrade/ | 2022-03-28 16:42 | - | |
| Satellite X205 - No post on start up/ | 2022-03-28 16:42 | - | |
| Satellite X205-S7483 - Hardware Upgrades/ | 2022-03-28 16:42 | - | |
| Satellite X205-S7483 running real slow, cpu keeps switching frequencys/ | 2022-03-28 16:42 | - | |
| Satellite X205-S9349 GPU Temperature Issue/ | 2022-03-28 16:42 | - | |
| Satellite X205-S9349 System Recovery disc problem -((/ | 2022-03-28 16:42 | - | |
| Satellite X205-S9349 Vista 64-bit drivers/ | 2022-03-28 16:42 | - | |
| Satellite X205-S9800/ | 2022-03-28 16:42 | - | |
| Satellite X205-SLi1 purchase/ | 2022-03-28 16:42 | - | |
| Satellite X205-s9359/ | 2022-03-28 16:42 | - | |
| Satellite X205 8700m Gt Tune/ | 2022-03-28 16:42 | - | |
| Satellite X205 Sleep Start Up Problem/ | 2022-03-28 16:42 | - | |
| Satellite X205 numpad problem/ | 2022-03-28 16:42 | - | |
| Satellite XP drivers - U405 -2820 specifically/ | 2022-03-28 16:42 | - | |
| Satellite XP install, soft-key issue/ | 2022-03-28 16:42 | - | |
| Satellite Z930-10X Expected battery usage whilst sleeping/ | 2022-03-28 16:42 | - | |
| Satellite a75-s226 okay for World of Warcraft/ | 2022-03-28 16:42 | - | |
| Satellite a85 dvd rw drive/ | 2022-03-28 16:42 | - | |
| Satellite a105-s4074/ | 2022-03-28 16:42 | - | |
| Satellite a110 keyboard disassembly PLEASE HELP!!!/ | 2022-03-28 16:42 | - | |
| Satellite a135-s4467 -XP drivers- Any resolution/ | 2022-03-28 16:42 | - | |
| Satellite a200-14D random loud beep/ | 2022-03-28 16:42 | - | |
| Satellite a215- Screen goes funky purple, pink and green when tilted/ | 2022-03-28 16:42 | - | |
| Satellite battery dies during hibernate mode/ | 2022-03-28 16:42 | - | |
| Satellite c655-s5082 .fd file to .rom/ | 2022-03-28 16:42 | - | |
| Satellite freeze after booting up/ | 2022-03-28 16:42 | - | |
| Satellite has no sound from HDMI output/ | 2022-03-28 16:42 | - | |
| Satellite l455-s5975 overheating/ | 2022-03-28 16:42 | - | |
| Satellite m50 heat/ | 2022-03-28 16:42 | - | |
| Satellite m 60 ram upgrade/ | 2022-03-28 16:42 | - | |
| Satellite m65-s9062 mini pci wfi card upgrade/ | 2022-03-28 16:42 | - | |
| Satellite m70 help !/ | 2022-03-28 16:42 | - | |
| Satellite new model!!!/ | 2022-03-28 16:42 | - | |
| Satellite p25-s607 problem (LCD)/ | 2022-03-28 16:42 | - | |
| Satellite p25-s676 tv connection/ | 2022-03-28 16:42 | - | |
| Satellite p30-145 needs new battery/ | 2022-03-28 16:42 | - | |
| Satellite p100 105 is being discontinued/ | 2022-03-28 16:42 | - | |
| Satellite p100 MA5 Speakers Quit/ | 2022-03-28 16:42 | - | |
| Satellite p200D click sound/ | 2022-03-28 16:42 | - | |
| Satellite p850 p855 p870 p875 (Ivy Bridge)/ | 2022-03-28 16:42 | - | |
| Satellite ps25 series battery discharges when on ac/ | 2022-03-28 16:42 | - | |
| Satellite refusing to boot/ | 2022-03-28 16:42 | - | |
| Satellite screen shaking! HELP!!/ | 2022-03-28 16:42 | - | |
| Satellites do not come with built-in recovery partitions/ | 2022-03-28 16:42 | - | |
| Satellite shutsdown after ram upgrade/ | 2022-03-28 16:42 | - | |
| Satellite starts when closed/ | 2022-03-28 16:42 | - | |
| Satellite touchpad bad on mains power/ | 2022-03-28 16:42 | - | |
| Satellite vs Tecra/ | 2022-03-28 16:42 | - | |
| Satellite x205-Sli4 on the way, just have a quick question/ | 2022-03-28 16:42 | - | |
| Saterlite A100 - 12 Cell Battery/ | 2022-03-28 16:42 | - | |
| Sat pro 6000 Fixed/ | 2022-03-28 16:42 | - | |
| Sattalite A15-S129 problems/ | 2022-03-28 16:42 | - | |
| Sattelite M100 Owners/ | 2022-03-28 16:42 | - | |
| Sattelite M115 + Windows Vista. Toshiba's basic softwares/ | 2022-03-28 16:42 | - | |
| Sattelite Wont Turn on/ | 2022-03-28 16:42 | - | |
| Sattellite L300 SD Card reader stopped working/ | 2022-03-28 16:42 | - | |
| Saw the BIG one today at BB/ | 2022-03-28 16:42 | - | |
| Scammer Alert/ | 2022-03-28 16:42 | - | |
| Schematic diagram for a tecra m7/ | 2022-03-28 16:42 | - | |
| Scored X205-S7483/ | 2022-03-28 16:42 | - | |
| Scratch Repair/ | 2022-03-28 16:42 | - | |
| Scratches on A205-S4577 cover/ | 2022-03-28 16:42 | - | |
| Screen Brightness for Qosmio X505/ | 2022-03-28 16:42 | - | |
| Screen For A30/ | 2022-03-28 16:42 | - | |
| Screen Gets Dimmer/ | 2022-03-28 16:42 | - | |
| Screen Problem/ | 2022-03-28 16:42 | - | |
| Screen Problems/ | 2022-03-28 16:42 | - | |
| Screen Problem with p35-s609/ | 2022-03-28 16:42 | - | |
| Screen Protector for M200/ | 2022-03-28 16:42 | - | |
| Screen Resolution On Toshiba M400/ | 2022-03-28 16:42 | - | |
| Screen Resolution on LCDs/ | 2022-03-28 16:42 | - | |
| Screen Swap A70/ | 2022-03-28 16:42 | - | |
| Screen Upgrade - Success! Qosmio X775/ | 2022-03-28 16:42 | - | |
| Screen change for Portege r705/ | 2022-03-28 16:42 | - | |
| Screen comes on then dies/ | 2022-03-28 16:42 | - | |
| Screen doesn't come back on after lid close/ | 2022-03-28 16:42 | - | |
| Screen flickering problem/ | 2022-03-28 16:42 | - | |
| Screen flickers while running on battery/ | 2022-03-28 16:42 | - | |
| Screen goes black/ | 2022-03-28 16:42 | - | |
| Screen goes black after installing graphics driver/ | 2022-03-28 16:42 | - | |
| Screen kaput on Tecra M2/ | 2022-03-28 16:42 | - | |
| Screen on Satellite A215 broken/ | 2022-03-28 16:42 | - | |
| Screen problems Satellite A305-SP6906R/ | 2022-03-28 16:42 | - | |
| Screen problem with Satellite Toshiba/ | 2022-03-28 16:42 | - | |
| Screen protector on the Z830/ | 2022-03-28 16:42 | - | |
| Screen too Dark/ | 2022-03-28 16:42 | - | |
| Screen went out, but still can bearly make out the faint screen/ | 2022-03-28 16:42 | - | |
| Screen works, Backlight doesn't --(/ | 2022-03-28 16:42 | - | |
| Screwed myself, can't update Windows [Error 80070003]/ | 2022-03-28 16:42 | - | |
| Scrolling and Function key not working on Toshiba Satellite C660/ | 2022-03-28 16:42 | - | |
| Searching service manual for Satellite Pro U400/ | 2022-03-28 16:42 | - | |
| Secondary Hard drive P205D/ | 2022-03-28 16:42 | - | |
| Secondary hard drive caddy for my Toshiba/ | 2022-03-28 16:42 | - | |
| Secondary hard drive for p100/ | 2022-03-28 16:42 | - | |
| Second hard drive/ | 2022-03-28 16:42 | - | |
| Seeking Nvidia 9800mGTX part no/ | 2022-03-28 16:42 | - | |
| Seeking Webcam driver for A305D-S6A31/ | 2022-03-28 16:42 | - | |
| Seeking low cost Toshiba with best 2D graphics quality - not speed!/ | 2022-03-28 16:42 | - | |
| Seeking users' experience re R600's durability, etc/ | 2022-03-28 16:42 | - | |
| Selling my X205-S7483 how/ | 2022-03-28 16:42 | - | |
| Sending Toshiba Laptop in for Repair/ | 2022-03-28 16:42 | - | |
| Sensitive Hyper Keyboard/ | 2022-03-28 16:42 | - | |
| Sent off my Satellite 5005, what should I get now/ | 2022-03-28 16:42 | - | |
| Serial Port/ | 2022-03-28 16:42 | - | |
| Serial number list for Z830 regarding fan noise/ | 2022-03-28 16:42 | - | |
| Serious BIOS Problem/ | 2022-03-28 16:42 | - | |
| Serious PC help - Toshiba Equium A100 [Video]/ | 2022-03-28 16:42 | - | |
| Serious WiFi Problem,PLZ Help/ | 2022-03-28 16:42 | - | |
| Service Manual Disassembly Toshiba C850/ | 2022-03-28 16:42 | - | |
| Service Manuals for Satellite A300 A305/ | 2022-03-28 16:42 | - | |
| Service Manuals of Portégé A600/ | 2022-03-28 16:42 | - | |
| Service manual TOSHIBA/ | 2022-03-28 16:42 | - | |
| Service station stops working/ | 2022-03-28 16:42 | - | |
| Setting BIOS password on Toshiba Tecra A1/ | 2022-03-28 16:42 | - | |
| Setup cannot find my new Hard Drive (6100)/ | 2022-03-28 16:42 | - | |
| Short Short Short Short Short Long Pause Short Short on a Portege Z30-C, means/ | 2022-03-28 16:42 | - | |
| Shortage of M2's/ | 2022-03-28 16:42 | - | |
| Should I.. Shouldn't I Upgrade To Windows Vista/ | 2022-03-28 16:42 | - | |
| Should I Get a Protege R100/ | 2022-03-28 16:42 | - | |
| Should I Update my RAM Or Buy A New Laptop/ | 2022-03-28 16:42 | - | |
| Should I buy a A100-JH2 right now/ | 2022-03-28 16:42 | - | |
| Should I buy a Toshiba satellite PSAL6C-04S015/ | 2022-03-28 16:42 | - | |
| Should I get the extended warranty/ | 2022-03-28 16:42 | - | |
| Should I replace the screen/ | 2022-03-28 16:42 | - | |
| ShutdownProblem/ | 2022-03-28 16:42 | - | |
| Shutdown problem/ | 2022-03-28 16:42 | - | |
| Shuts down with 80% battery chadrge/ | 2022-03-28 16:42 | - | |
| Sigma Tel sound car in M 35 issue update/ | 2022-03-28 16:42 | - | |
| Sign of things to come (toshiba Canada)/ | 2022-03-28 16:42 | - | |
| Sims 2 & expansions pack and Sims 3 on Toshiba L300-1A6/ | 2022-03-28 16:42 | - | |
| Single noob question about starting with x205/ | 2022-03-28 16:42 | - | |
| Sketchy Screen - Satellite P50-A/ | 2022-03-28 16:42 | - | |
| Skinning A M300/ | 2022-03-28 16:42 | - | |
| Skype sticker on X205. Does it leave any marks when removed/ | 2022-03-28 16:42 | - | |
| Sleep & Charge Feature - How activate/ | 2022-03-28 16:42 | - | |
| Sleep/ | 2022-03-28 16:42 | - | |
| Sleep and hibernate mode/ | 2022-03-28 16:42 | - | |
| Sleep causing reboot on X505/ | 2022-03-28 16:42 | - | |
| Sli 1/ | 2022-03-28 16:42 | - | |
| Sli1 n vista sp1/ | 2022-03-28 16:42 | - | |
| Sli3 AUDIO driver for XP please/ | 2022-03-28 16:42 | - | |
| Sli3 Xp/ | 2022-03-28 16:42 | - | |
| Slight Problem/ | 2022-03-28 16:42 | - | |
| Slot 54/ | 2022-03-28 16:42 | - | |
| Slow HDD performance on A200/ | 2022-03-28 16:42 | - | |
| Slow Startup/ | 2022-03-28 16:42 | - | |
| Slow T5500/ | 2022-03-28 16:42 | - | |
| Slow boot remedy/ | 2022-03-28 16:42 | - | |
| Slowdowns with Toshiba P100/ | 2022-03-28 16:42 | - | |
| Slow log on (I mean Slow) with P300D/ | 2022-03-28 16:42 | - | |
| Slow wireless conection/ | 2022-03-28 16:42 | - | |
| Small problem with Toshiba Satellite laptop! Please help/ | 2022-03-28 16:42 | - | |
| So... For any Qosmio lovers/ | 2022-03-28 16:42 | - | |
| So I got P55T today. Weak Points and Strong Points/ | 2022-03-28 16:42 | - | |
| So That's It Is Toshiba Done With Gaming Laptops/ | 2022-03-28 16:42 | - | |
| Software For Toshiba Laptops/ | 2022-03-28 16:42 | - | |
| Software Update/ | 2022-03-28 16:42 | - | |
| Software will not complete loading/ | 2022-03-28 16:42 | - | |
| So is there something wrong with my laptop 893/ | 2022-03-28 16:42 | - | |
| Soldering the power jack/ | 2022-03-28 16:42 | - | |
| Some L40-18W questions/ | 2022-03-28 16:42 | - | |
| Some Questions About X200 X205/ | 2022-03-28 16:42 | - | |
| Some X505 (Q880) Questions/ | 2022-03-28 16:42 | - | |
| Some after thoughts on the A300-ST4004/ | 2022-03-28 16:42 | - | |
| Some benchmark results for an X205-S9359/ | 2022-03-28 16:42 | - | |
| Someone please benchmark Q X505-8xx !/ | 2022-03-28 16:42 | - | |
| Some questions for Portege z30 owners/ | 2022-03-28 16:42 | - | |
| Some quick R500 questions/ | 2022-03-28 16:42 | - | |
| Some quick questions about the satellite u300 and tecra M8/ | 2022-03-28 16:42 | - | |
| Some serious help needed please/ | 2022-03-28 16:42 | - | |
| Something about warranty/ | 2022-03-28 16:42 | - | |
| Something weird with my a70/ | 2022-03-28 16:42 | - | |
| Something wrong with MyToshiba Sat P10/ | 2022-03-28 16:42 | - | |
| Sonoma Alviso/ | 2022-03-28 16:42 | - | |
| Sound/ | 2022-03-28 16:42 | - | |
| Sound Control - Satellite P105/ | 2022-03-28 16:42 | - | |
| Sound Help!!/ | 2022-03-28 16:42 | - | |
| Sound Issue. D-/ | 2022-03-28 16:42 | - | |
| Sound Problem/ | 2022-03-28 16:42 | - | |
| Sound Problem Please help/ | 2022-03-28 16:42 | - | |
| Sound Problem in Toshiba A205S4577 after installing XP/ | 2022-03-28 16:42 | - | |
| Sound card replacable A105-4344/ | 2022-03-28 16:42 | - | |
| Sound distortion with Pro A200/ | 2022-03-28 16:42 | - | |
| Sound driver installed, but no sound !/ | 2022-03-28 16:42 | - | |
| Sound not working on Satellite A505-S6965/ | 2022-03-28 16:42 | - | |
| Sound output problems on X205 HELP/ | 2022-03-28 16:42 | - | |
| Sound problem and A135-S4527/ | 2022-03-28 16:42 | - | |
| Sound problems with brand new Qosmio X505-Q890/ | 2022-03-28 16:42 | - | |
| Source for 1.8 8.0mm drives/ | 2022-03-28 16:42 | - | |
| Spacebar not working/ | 2022-03-28 16:42 | - | |
| Speaker Problem with A100-SK9/ | 2022-03-28 16:42 | - | |
| Speaker problem/ | 2022-03-28 16:42 | - | |
| Speaker problem with M115-S3094/ | 2022-03-28 16:42 | - | |
| Speakers working intermittently/ | 2022-03-28 16:42 | - | |
| SpeedStep Problem/ | 2022-03-28 16:42 | - | |
| Spilled coke on my Toshiba Satellite P200, under the space bar/ | 2022-03-28 16:42 | - | |
| Spilled liquid on top of keys... now one key dead, what to do/ | 2022-03-28 16:42 | - | |
| Spilled lot of water on laptop... wont turn on... PLEASE PLEASE HELP!!/ | 2022-03-28 16:42 | - | |
| Stack overflow/ | 2022-03-28 16:42 | - | |
| StartUpLite and X775 HD/ | 2022-03-28 16:42 | - | |
| Starting up problem!!! PLEASE HELP!!!/ | 2022-03-28 16:42 | - | |
| Start up issues/ | 2022-03-28 16:42 | - | |
| Startup problems with Satellite A25/ | 2022-03-28 16:42 | - | |
| Static Problem How serious is it/ | 2022-03-28 16:42 | - | |
| Static Problem with Toshiba s/ | 2022-03-28 16:42 | - | |
| Static from speakers; lappy hangs during boot/ | 2022-03-28 16:42 | - | |
| Static noise on my earphones/ | 2022-03-28 16:42 | - | |
| Sticky Keys/ | 2022-03-28 16:42 | - | |
| Still Webcam Driver open Fail !!!!/ | 2022-03-28 16:42 | - | |
| Still looking for complaints Qosmio X505-Q890/ | 2022-03-28 16:42 | - | |
| Stock Ram in Toshiba Tecra/ | 2022-03-28 16:42 | - | |
| Storage Link Icon/ | 2022-03-28 16:42 | - | |
| Strange Display Problem (Satellite A20)/ | 2022-03-28 16:42 | - | |
| Strange GPU temps X205-sli2/ | 2022-03-28 16:42 | - | |
| Strange Numbers in Top Right of some screens/ | 2022-03-28 16:42 | - | |
| Strange Screen Occurence -- Please Help!!!/ | 2022-03-28 16:42 | - | |
| Strange Screw on M115-S3094 Wireless Card Cover/ | 2022-03-28 16:42 | - | |
| Strange issue on R150/ | 2022-03-28 16:42 | - | |
| Strange problem with laptop (I think)/ | 2022-03-28 16:42 | - | |
| Strange video glitch issue - very frustrating!/ | 2022-03-28 16:42 | - | |
| Stuck Sony Pro Duo stick in card reader (Help please!)/ | 2022-03-28 16:42 | - | |
| Stuck pixel on the A505-S6965... Help!/ | 2022-03-28 16:42 | - | |
| Study-Toshiba,Asus make most reliable notebooks/ | 2022-03-28 16:42 | - | |
| Stupid Questions about Toshiba Qosmio F-25/ | 2022-03-28 16:42 | - | |
| Stuttering notebook/ | 2022-03-28 16:42 | - | |
| Stuttering with x205-sli1 in COD4/ | 2022-03-28 16:42 | - | |
| Sub-$1000 Toshiba worth it (A65)/ | 2022-03-28 16:42 | - | |
| Success story and tips for your CPUolasty/ | 2022-03-28 16:42 | - | |
| Success story with TOSHIBA warranty/ | 2022-03-28 16:42 | - | |
| Sudden Power Off !/ | 2022-03-28 16:42 | - | |
| Suggestions for upgraded M45 memory/ | 2022-03-28 16:42 | - | |
| Suggestions on Problem/ | 2022-03-28 16:42 | - | |
| Suggest replacement battery for 4 year old Satellite L300D - PSLC8C-01N019/ | 2022-03-28 16:42 | - | |
| Super bright Washed out screen !/ | 2022-03-28 16:42 | - | |
| Support Engineer/ | 2022-03-28 16:42 | - | |
| Support for Toshiba Satellite Pro M15-S405/ | 2022-03-28 16:42 | - | |
| Surfing problem/ | 2022-03-28 16:42 | - | |
| S video question/ | 2022-03-28 16:42 | - | |
| Swapping LCDs/ | 2022-03-28 16:42 | - | |
| Switching from a Mac/ | 2022-03-28 16:42 | - | |
| Switching to XP from Vista on Toshiba U300/ | 2022-03-28 16:42 | - | |
| Swtichable graphics for toshiba tecra r840-s8450/ | 2022-03-28 16:42 | - | |
| Synaptics Touchpad Nonfunctional/ | 2022-03-28 16:42 | - | |
| Synaptics Touchpad on Satellite Windows 7/ | 2022-03-28 16:42 | - | |
| Synaptics driver crashing (BSOD) P75-A7200 after sleeping/ | 2022-03-28 16:42 | - | |
| Synaptics touchpad + display problems/ | 2022-03-28 16:42 | - | |
| System Crash/ | 2022-03-28 16:42 | - | |
| Systemguard Experiences/ | 2022-03-28 16:42 | - | |
| System won't restore/ | 2022-03-28 16:42 | - | |
| T13x series notebook recall/ | 2022-03-28 16:42 | - | |
| T135- S1312 Wireless Issue/ | 2022-03-28 16:42 | - | |
| T235-S1345 First Impressions/ | 2022-03-28 16:42 | - | |
| T235-S1350 vs T235D-S1345/ | 2022-03-28 16:42 | - | |
| T1350 64-bit/ | 2022-03-28 16:42 | - | |
| T5450, 965 Socket P - 945 Socket M Chipset or Both/ | 2022-03-28 16:42 | - | |
| T5450 temps/ | 2022-03-28 16:42 | - | |
| T6570 on Toshiba Satellite C655-S5082/ | 2022-03-28 16:42 | - | |
| T9300 Compatibility in A505/ | 2022-03-28 16:42 | - | |
| T9300 not working properly in X205/ | 2022-03-28 16:42 | - | |
| T9600 Overclock Friendly/ | 2022-03-28 16:42 | - | |
| TCG Error- TPM Initialization Failed/ | 2022-03-28 16:42 | - | |
| TCP and FTP packets dropped/ | 2022-03-28 16:42 | - | |
| TE2000 problem/ | 2022-03-28 16:42 | - | |
| TE2100 Replacement Display Board/ | 2022-03-28 16:42 | - | |
| TE2100 bad etc battery/ | 2022-03-28 16:42 | - | |
| TEAC DW-224E CDRW DVD-ROM drive - Toshiba Compatible/ | 2022-03-28 16:42 | - | |
| TECRA M5 RECOVERY DISK PROBLEM- help/ | 2022-03-28 16:42 | - | |
| TECRA S1 (PT831C-30QW6)/ | 2022-03-28 16:42 | - | |
| THE TOSHIBA QOSMIO f55-q04!!!/ | 2022-03-28 16:42 | - | |
| THIS IS INSANE!!!!!! (M45)/ | 2022-03-28 16:42 | - | |
| THotKey - Is just with me/ | 2022-03-28 16:42 | - | |
| TI 64-bit drivers/ | 2022-03-28 16:42 | - | |
| TOSHIBA A4-S211 info/ | 2022-03-28 16:43 | - | |
| TOSHIBA Chicony Camera Assistant FAILS!/ | 2022-03-28 16:43 | - | |
| TOSHIBA EQUIUM L40-17M need xp sata drivers for slipstreaming/ | 2022-03-28 16:43 | - | |
| TOSHIBA EQUIUM P200D ( How To Upgrade Bios)/ | 2022-03-28 16:43 | - | |
| TOSHIBA Intel Core 2 DUO Processor T8100 Laptop/ | 2022-03-28 16:43 | - | |
| TOSHIBA L650-1MT PSK1JE undervolted GPU BIOS/ | 2022-03-28 16:43 | - | |
| TOSHIBA L650 PSKxJE unlocked BIOS/ | 2022-03-28 16:43 | - | |
| TOSHIBA M35 FAN/ | 2022-03-28 16:43 | - | |
| TOSHIBA P200-ST2071 Initial Review/ | 2022-03-28 16:43 | - | |
| TOSHIBA Portege R500 64GB ONLINE AT LAST/ | 2022-03-28 16:43 | - | |
| TOSHIBA QUALITY/ | 2022-03-28 16:43 | - | |
| TOSHIBA Qosmio X305-Q715 at newegg/ | 2022-03-28 16:43 | - | |
| TOSHIBA Qosmio X500-067 blu ray RE - Anyone here have one/ | 2022-03-28 16:43 | - | |
| TOSHIBA Qosmio X775-3DV78 vs msi gt780r/ | 2022-03-28 16:43 | - | |
| TOSHIBA REGISTRATION/ | 2022-03-28 16:43 | - | |
| TOSHIBA SATELLITE A300D 14P Problem EVERYONE PLEASE HELP!/ | 2022-03-28 16:43 | - | |
| TOSHIBA SATELLITE LAPTOP M35X-S349 fan issue/ | 2022-03-28 16:43 | - | |
| TOSHIBA Satellite 5100-503 - 2 Problems NEED HELP PLS! (VIDEO)/ | 2022-03-28 16:43 | - | |
| TOSHIBA Satellite A355D-S6922 Question/ | 2022-03-28 16:43 | - | |
| TOSHIBA Satellite M30X-113/ | 2022-03-28 16:43 | - | |
| TOSHIBA Satellite M70 Review/ | 2022-03-28 16:43 | - | |
| TOSHIBA Satellite T215D-S1150/ | 2022-03-28 16:43 | - | |
| TOSHIBA prices japan/ | 2022-03-28 16:43 | - | |
| TOSHIBA recovery media creator - where to download from/ | 2022-03-28 16:43 | - | |
| TOshiba A100 SK9/ | 2022-03-28 16:42 | - | |
| TOshiba M60 Heating/ | 2022-03-28 16:43 | - | |
| TS-L802A firmware/ | 2022-03-28 16:43 | - | |
| TSST TS-L632D versus Pioneer DVR-K17A/ | 2022-03-28 16:43 | - | |
| Tablet PC options/ | 2022-03-28 16:42 | - | |
| Take your Toshiba to the next level. Upgrade RAM!/ | 2022-03-28 16:42 | - | |
| Taking Apart Toshiba A300 - Dedicated GPU Model/ | 2022-03-28 16:42 | - | |
| Taking apart P305-S8825/ | 2022-03-28 16:42 | - | |
| Taking care of Toshiba batteries/ | 2022-03-28 16:42 | - | |
| Tap Zones keep coming back/ | 2022-03-28 16:42 | - | |
| Technician in the House/ | 2022-03-28 16:42 | - | |
| Techra M7- No Standby, No Access to Power Saver etc/ | 2022-03-28 16:42 | - | |
| Tecra (Portege) R700/ | 2022-03-28 16:42 | - | |
| Tecra/ | 2022-03-28 16:42 | - | |
| Tecra 520CDT Cardbus problem/ | 2022-03-28 16:42 | - | |
| Tecra 8000 RAM upgrade/ | 2022-03-28 16:42 | - | |
| Tecra 8000 Weird Problem. Help Please/ | 2022-03-28 16:42 | - | |
| Tecra 8100 - dying - dead/ | 2022-03-28 16:42 | - | |
| Tecra 8100/ | 2022-03-28 16:42 | - | |
| Tecra 8100 Intermittent Freeze Locks Up/ | 2022-03-28 16:42 | - | |
| Tecra 8100 screen problems/ | 2022-03-28 16:42 | - | |
| Tecra 8200/ | 2022-03-28 16:42 | - | |
| Tecra A1 Internal lan help!!!/ | 2022-03-28 16:42 | - | |
| Tecra A2 029 dead/ | 2022-03-28 16:42 | - | |
| Tecra A2 high pitch sound/ | 2022-03-28 16:42 | - | |
| Tecra A2 supports 48-bit LBA/ | 2022-03-28 16:42 | - | |
| Tecra A3-106 MS SD Card Reader Problem/ | 2022-03-28 16:42 | - | |
| Tecra A3/ | 2022-03-28 16:42 | - | |
| Tecra A3 S611/ | 2022-03-28 16:42 | - | |
| Tecra A3 low volume/ | 2022-03-28 16:42 | - | |
| Tecra A4/ | 2022-03-28 16:42 | - | |
| Tecra A4 Freezing/ | 2022-03-28 16:42 | - | |
| Tecra A4 OS recovery (bis)/ | 2022-03-28 16:42 | - | |
| Tecra A4 OS recovery/ | 2022-03-28 16:42 | - | |
| Tecra A4 Recovery Disc Creator/ | 2022-03-28 16:42 | - | |
| Tecra A4 and Vista- I'm sure this has been done before but I couldn't find it/ | 2022-03-28 16:42 | - | |
| Tecra A4 screen LCD issue/ | 2022-03-28 16:42 | - | |
| Tecra A5/ | 2022-03-28 16:42 | - | |
| Tecra A5 owners/ | 2022-03-28 16:42 | - | |
| Tecra A6/ | 2022-03-28 16:42 | - | |
| Tecra A6 2300 Ethernet controller help...PLEASE!!!/ | 2022-03-28 16:42 | - | |
| Tecra A6 = Satellite/ | 2022-03-28 16:42 | - | |
| Tecra A6 and Alcohol 120% standby problems/ | 2022-03-28 16:42 | - | |
| Tecra A6 internal memory slot,where to find/ | 2022-03-28 16:42 | - | |
| Tecra A6 vs. Tecra M5/ | 2022-03-28 16:42 | - | |
| Tecra A6 vs M5 Price Confusion/ | 2022-03-28 16:42 | - | |
| Tecra A7 - Questions/ | 2022-03-28 16:42 | - | |
| Tecra A7-SP4032 DUO better than MacBook Pro/ | 2022-03-28 16:42 | - | |
| Tecra A7- Toshiba or Phoenix BIOS/ | 2022-03-28 16:42 | - | |
| Tecra A7/ | 2022-03-28 16:42 | - | |
| Tecra A7 Hell - Need Assistance/ | 2022-03-28 16:42 | - | |
| Tecra A7 With 4GB DDR2 of RAM/ | 2022-03-28 16:42 | - | |
| Tecra A7 cracked in the corner/ | 2022-03-28 16:42 | - | |
| Tecra A8 - how much does it really weigh/ | 2022-03-28 16:42 | - | |
| Tecra A8 won't boot passed bios/ | 2022-03-28 16:42 | - | |
| Tecra A8 wont boot from CD!!/ | 2022-03-28 16:42 | - | |
| Tecra A9-ST9001 OR Satellite A200-ST2041/ | 2022-03-28 16:42 | - | |
| Tecra A10-ST9010/ | 2022-03-28 16:42 | - | |
| Tecra A10- blu-ray with external drive/ | 2022-03-28 16:42 | - | |
| Tecra A10 CPU upgrade/ | 2022-03-28 16:42 | - | |
| Tecra A11-11H - Possible to put a higher resolution screen on/ | 2022-03-28 16:42 | - | |
| Tecra A11-S3540/ | 2022-03-28 16:42 | - | |
| Tecra M-Series/ | 2022-03-28 16:42 | - | |
| Tecra M1 has anyone installed Vista/ | 2022-03-28 16:42 | - | |
| Tecra M2 'Customization Charge' !!/ | 2022-03-28 16:42 | - | |
| Tecra M2 - Cnet doesn't like the keyboard/ | 2022-03-28 16:42 | - | |
| Tecra M2-S730 Bluetooth does not work/ | 2022-03-28 16:42 | - | |
| Tecra M2-S730 battery life/ | 2022-03-28 16:42 | - | |
| Tecra M2 - please help me choose/ | 2022-03-28 16:42 | - | |
| Tecra M2- seeking advice from owners/ | 2022-03-28 16:42 | - | |
| Tecra M2/ | 2022-03-28 16:42 | - | |
| Tecra M2 Audio Speaker Problem/ | 2022-03-28 16:42 | - | |
| Tecra M2 Bluetooth module/ | 2022-03-28 16:42 | - | |
| Tecra M2 Front Side Bus Speed/ | 2022-03-28 16:42 | - | |
| Tecra M2 Keyboard/ | 2022-03-28 16:42 | - | |
| Tecra M2 Prices Raised!/ | 2022-03-28 16:42 | - | |
| Tecra M2 S-Video Mode/ | 2022-03-28 16:42 | - | |
| Tecra M2V/ | 2022-03-28 16:42 | - | |
| Tecra M2 over 2 doz purch for University/ | 2022-03-28 16:42 | - | |
| Tecra M2 password/ | 2022-03-28 16:42 | - | |
| Tecra M2 reviews/ | 2022-03-28 16:42 | - | |
| Tecra M3/ | 2022-03-28 16:42 | - | |
| Tecra M3 graphics/ | 2022-03-28 16:42 | - | |
| Tecra M3 touchpad/ | 2022-03-28 16:42 | - | |
| Tecra M4, perfect for the student gamer/ | 2022-03-28 16:42 | - | |
| Tecra M4 - pinmod update failure, multiplier only x6/ | 2022-03-28 16:42 | - | |
| Tecra M4 EasyGuard Advanced Instant Security/ | 2022-03-28 16:42 | - | |
| Tecra M4 SATA controller drivers/ | 2022-03-28 16:42 | - | |
| Tecra M5 - problem booting due to fingerprint reader/ | 2022-03-28 16:42 | - | |
| Tecra M5 Audio Issues Windows XP!/ | 2022-03-28 16:42 | - | |
| Tecra M6, Satelite U200 or Satellite U205/ | 2022-03-28 16:42 | - | |
| Tecra M8/ | 2022-03-28 16:42 | - | |
| Tecra M8 Hard Drive Recognition Problems/ | 2022-03-28 16:42 | - | |
| Tecra M9/ | 2022-03-28 16:42 | - | |
| Tecra M11 1600x900 screen quality/ | 2022-03-28 16:42 | - | |
| Tecra R10-S4401/ | 2022-03-28 16:42 | - | |
| Tecra R10/ | 2022-03-28 16:42 | - | |
| Tecra R830, R835, R840 Fan Noise/ | 2022-03-28 16:42 | - | |
| Tecra R840 - Options for Embedded 3G Modem/ | 2022-03-28 16:42 | - | |
| Tecra R840-ST8401 CTO HDMI/ | 2022-03-28 16:42 | - | |
| Tecra R840 - first impressions/ | 2022-03-28 16:42 | - | |
| Tecra R840 vs Portege R830 v R835... all vs Lenovo X1/ | 2022-03-28 16:42 | - | |
| Tecra R850-146, screen quality and other 900p netbooks/ | 2022-03-28 16:42 | - | |
| Tecra R940/ | 2022-03-28 16:42 | - | |
| Tecra R950-11M/ | 2022-03-28 16:42 | - | |
| Tecra S1 waking-from-hibernation problem/ | 2022-03-28 16:42 | - | |
| Tecra S2 (GL101E)/ | 2022-03-28 16:42 | - | |
| Tecra S2/ | 2022-03-28 16:42 | - | |
| Tecra S2 Power Socket Question/ | 2022-03-28 16:42 | - | |
| Tecra S2 fan speed woes/ | 2022-03-28 16:42 | - | |
| Tecra S2 memory option. Only DDR in a DDR2 platfor/ | 2022-03-28 16:42 | - | |
| Tecra S2 opinions wanted/ | 2022-03-28 16:42 | - | |
| Tecra S2 or M3/ | 2022-03-28 16:42 | - | |
| Tecra S3/ | 2022-03-28 16:42 | - | |
| Tecra S11 vs Dell 640m (pics)/ | 2022-03-28 16:42 | - | |
| Tecra W50 4K Display Availability/ | 2022-03-28 16:42 | - | |
| Tecra Z60 Ubuntu compatibility/ | 2022-03-28 16:42 | - | |
| Tecra a2/ | 2022-03-28 16:42 | - | |
| Tecra a6 with x1400 ouput 1680x1050 res/ | 2022-03-28 16:42 | - | |
| Tecra dealer in SF San Jose area/ | 2022-03-28 16:42 | - | |
| Tecra m2 wireless/ | 2022-03-28 16:42 | - | |
| Tecra or Satellite/ | 2022-03-28 16:42 | - | |
| Tecra vs Satellite Matte or Glossy/ | 2022-03-28 16:42 | - | |
| Tecra w Windows XP SP3 is flaky/ | 2022-03-28 16:42 | - | |
| Tecra with Nvidia Quadro - any good for gaming/ | 2022-03-28 16:42 | - | |
| Tectra A7 Hard Drive FDE Upgrade/ | 2022-03-28 16:42 | - | |
| Tell me about your R600 experiences/ | 2022-03-28 16:42 | - | |
| Tell me little about your x305-q706/ | 2022-03-28 16:42 | - | |
| Temperature on CPU/ | 2022-03-28 16:42 | - | |
| Temporary Black Screen/ | 2022-03-28 16:42 | - | |
| Tempted by Qosmio G50 but no blu-ray/ | 2022-03-28 16:42 | - | |
| Thank You For Reading This/ | 2022-03-28 16:42 | - | |
| The 5205 experiment/ | 2022-03-28 16:42 | - | |
| The Funniest Qosmio G15 Question Thread/ | 2022-03-28 16:42 | - | |
| The Mother Of All Fixes for Qosmio ... vBios 1.10 ... here !/ | 2022-03-28 16:42 | - | |
| The Qosmio X305-Q706- Yay or Nay/ | 2022-03-28 16:42 | - | |
| The Satellite A665-S6086 and Windows XP/ | 2022-03-28 16:42 | - | |
| The Toshiba Satellite A205-S7468. A good laptop/ | 2022-03-28 16:42 | - | |
| The U300 is nice!/ | 2022-03-28 16:42 | - | |
| The battery... or the adapter/ | 2022-03-28 16:42 | - | |
| The best $1400-1500 Toshiba for Interior Design (3DMax user)/ | 2022-03-28 16:42 | - | |
| The best Toshiba series/ | 2022-03-28 16:42 | - | |
| The cause of the random beeps some laptops make/ | 2022-03-28 16:42 | - | |
| The difference between Satellite U300 & U305/ | 2022-03-28 16:42 | - | |
| The fan yet again/ | 2022-03-28 16:42 | - | |
| The function key Touchpad enable disable not work/ | 2022-03-28 16:42 | - | |
| Themes and backgrounds/ | 2022-03-28 16:42 | - | |
| The new Tecra M2 is out!!! HOT HOT HOT!/ | 2022-03-28 16:42 | - | |
| The new Toshiba Qosmio F30/ | 2022-03-28 16:42 | - | |
| The paint comes off - anyone else/ | 2022-03-28 16:42 | - | |
| The problem with Toshiba/ | 2022-03-28 16:42 | - | |
| The worst customer service/ | 2022-03-28 16:42 | - | |
| Things about Toshiba Laptops that annoy you/ | 2022-03-28 16:42 | - | |
| Things to disable on startup/ | 2022-03-28 16:42 | - | |
| Thinking about buying Portege R835/ | 2022-03-28 16:42 | - | |
| Thinking about this notebook/ | 2022-03-28 16:42 | - | |
| Thinking of buying a Toshiba A70-ak1/ | 2022-03-28 16:42 | - | |
| Thinking of selling - confused/ | 2022-03-28 16:42 | - | |
| This afternoons project for X205, cooling/ | 2022-03-28 16:42 | - | |
| This forum is looking more and more like Acer's/ | 2022-03-28 16:42 | - | |
| Those with R400 experience, please HELP !/ | 2022-03-28 16:42 | - | |
| Thoshiba P200 Windows XP downgrade/ | 2022-03-28 16:42 | - | |
| Thought I would bring this up with all Qosmio Owners/ | 2022-03-28 16:42 | - | |
| Thoughts (and memories) on older models/ | 2022-03-28 16:42 | - | |
| Thoughts on A105-S4074/ | 2022-03-28 16:42 | - | |
| Thoughts on Intel Pro Wireless 3945ABG wireless/ | 2022-03-28 16:42 | - | |
| Thoughts on Satellite S55/ | 2022-03-28 16:42 | - | |
| Thoughts on the Toshiba Satellite L675-06K/ | 2022-03-28 16:42 | - | |
| Time to refund the a70/ | 2022-03-28 16:42 | - | |
| Tingling shocks/ | 2022-03-28 16:42 | - | |
| Tinkering w Broken USB/ | 2022-03-28 16:42 | - | |
| Tips for traveling with laptop/ | 2022-03-28 16:42 | - | |
| Tips to preserve the battery/ | 2022-03-28 16:42 | - | |
| Tjmax for GTS350M/ | 2022-03-28 16:42 | - | |
| To Tablet or not to Tablet/ | 2022-03-28 16:42 | - | |
| Toashiba Satelite A100 help!/ | 2022-03-28 16:42 | - | |
| Tobisha laptop A135-S4827 won't start up/ | 2022-03-28 16:42 | - | |
| To everyone with recent BIOS update flash failure problem/ | 2022-03-28 16:42 | - | |
| Tohiba and hp dv6000/ | 2022-03-28 16:42 | - | |
| Tohsiba Satellite Pro L300D Bios Update (Has anyone actually found Toshiba's Bios updates)/ | 2022-03-28 16:42 | - | |
| Tons of basic x205 questions/ | 2022-03-28 16:42 | - | |
| Torn between Brands (Toshiba vs. Asus)/ | 2022-03-28 16:42 | - | |
| Torn between two/ | 2022-03-28 16:42 | - | |
| Tosh. Sat. M70-148 - continuous faint high pitch sound/ | 2022-03-28 16:42 | - | |
| Tosh. Satt. M70-148 - color calibration/ | 2022-03-28 16:42 | - | |
| Tosh M30 35 questions for anyone that owns one/ | 2022-03-28 16:42 | - | |
| Tosh M35-S359 fan noise/ | 2022-03-28 16:42 | - | |
| Tosh Qosmio G35 AV650 vs. Sony Vaio AR-190G/ | 2022-03-28 16:42 | - | |
| Tosh Satellite M45 S 165 Battery Life -Upgrade/ | 2022-03-28 16:42 | - | |
| Tosh Tecra - problem with jumping MS travel mouse/ | 2022-03-28 16:42 | - | |
| Toshi Centrino Notebook w printer $1049/ | 2022-03-28 16:42 | - | |
| Toshi Equium ea80 disc drive/ | 2022-03-28 16:42 | - | |
| Toshi P25-S609...opinions/ | 2022-03-28 16:42 | - | |
| Toshi S127 for $699.99/ | 2022-03-28 16:42 | - | |
| Toshia M45-S331 or A75-211/ | 2022-03-28 16:42 | - | |
| Toshiba & ATI RS350 chipset/ | 2022-03-28 16:42 | - | |
| Toshiba & Vista refund/ | 2022-03-28 16:42 | - | |
| Toshiba & XP PRO - How hard to upgrade/ | 2022-03-28 16:42 | - | |
| Toshiba's Customer Service - Yay or Nay/ | 2022-03-28 16:43 | - | |
| Toshiba's Hot New Qosmio X305 Gaming Laptop!/ | 2022-03-28 16:43 | - | |
| Toshiba's Hotkey Utility freezing after install NIS 2007/ | 2022-03-28 16:43 | - | |
| Toshiba's Media Esperience Software/ | 2022-03-28 16:43 | - | |
| Toshiba's New Sandy Bridge Qosmios/ | 2022-03-28 16:43 | - | |
| Toshiba's Radeon HD 3100 vs HD 3200/ | 2022-03-28 16:43 | - | |
| Toshiba's SystemGuard Warranty/ | 2022-03-28 16:43 | - | |
| Toshiba's Windows 7 Upgrade - did you get scammed/ | 2022-03-28 16:43 | - | |
| Toshiba's current web site/ | 2022-03-28 16:43 | - | |
| Toshiba's gotta be on crack/ | 2022-03-28 16:43 | - | |
| Toshiba's lightest 13 inch laptop/ | 2022-03-28 16:43 | - | |
| Toshiba's quality/ | 2022-03-28 16:43 | - | |
| Toshiba's softwares with Satellite model a100-0fh/ | 2022-03-28 16:43 | - | |
| Toshiba (A100 vs. P10)/ | 2022-03-28 16:42 | - | |
| Toshiba (Touchpad problem)/ | 2022-03-28 16:42 | - | |
| Toshiba + Water = Not recommended/ | 2022-03-28 16:42 | - | |
| Toshiba+two LCD's impossible/ | 2022-03-28 16:43 | - | |
| Toshiba-ATI/ | 2022-03-28 16:43 | - | |
| Toshiba - L675-S7108 - Good for games/ | 2022-03-28 16:42 | - | |
| Toshiba - TBSwireless.exe or entire TBS folder/ | 2022-03-28 16:42 | - | |
| Toshiba.com direct to Canada/ | 2022-03-28 16:43 | - | |
| Toshiba 4K laptop vs Razor 2014/ | 2022-03-28 16:42 | - | |
| Toshiba 12 cell Li-Ion Batteries/ | 2022-03-28 16:42 | - | |
| Toshiba 15.4 LCD panels/ | 2022-03-28 16:42 | - | |
| Toshiba 17 Satellite X205-S9800 question/ | 2022-03-28 16:42 | - | |
| Toshiba 30 FUNCTION KEYS/ | 2022-03-28 16:42 | - | |
| Toshiba 205-S5825 random crashes/ | 2022-03-28 16:42 | - | |
| Toshiba 335CDS Video Display Driver Win2000/ | 2022-03-28 16:42 | - | |
| Toshiba 855D CPU upgrade/ | 2022-03-28 16:42 | - | |
| Toshiba 1394a chipset help for DAW/ | 2022-03-28 16:42 | - | |
| Toshiba 1410-S173 CMOS battery problem/ | 2022-03-28 16:42 | - | |
| Toshiba 1415 disc replace/ | 2022-03-28 16:42 | - | |
| Toshiba 1605cds reboot/ | 2022-03-28 16:42 | - | |
| Toshiba 1800 - can't go in BIOS/ | 2022-03-28 16:42 | - | |
| Toshiba 1805-S207 DVD drive Master or Slave/ | 2022-03-28 16:42 | - | |
| Toshiba 2450 Manual/ | 2022-03-28 16:42 | - | |
| Toshiba 2450 cannot use recovert cds/ | 2022-03-28 16:42 | - | |
| Toshiba 2500 parts/ | 2022-03-28 16:42 | - | |
| Toshiba 2800 Problems/ | 2022-03-28 16:42 | - | |
| Toshiba 3110 CT/ | 2022-03-28 16:42 | - | |
| Toshiba 3440CT - Big Problem, Need Help! Thanks!/ | 2022-03-28 16:42 | - | |
| Toshiba 4080xcdt Mouse ribbons/ | 2022-03-28 16:42 | - | |
| Toshiba 5005-S504 laptop/ | 2022-03-28 16:42 | - | |
| Toshiba 5005 recovery discs - wrong machine!!/ | 2022-03-28 16:42 | - | |
| Toshiba 5100-201 BIOS Password/ | 2022-03-28 16:42 | - | |
| Toshiba 5205-S703 Will Not Power Up/ | 2022-03-28 16:42 | - | |
| Toshiba 5205-S705- Neeed Recovery CD/ | 2022-03-28 16:42 | - | |
| Toshiba 5205-S705/ | 2022-03-28 16:42 | - | |
| Toshiba 5205-S705 and similar models/ | 2022-03-28 16:42 | - | |
| Toshiba 6100/ | 2022-03-28 16:42 | - | |
| Toshiba 8100 Composite video output to TV/ | 2022-03-28 16:42 | - | |
| Toshiba A-10 Sattelite/ | 2022-03-28 16:42 | - | |
| Toshiba A6 freezing/ | 2022-03-28 16:43 | - | |
| Toshiba A8 sound not working/ | 2022-03-28 16:43 | - | |
| Toshiba A15-S157 NEED to change parts HELP/ | 2022-03-28 16:42 | - | |
| Toshiba A20 Hard disk Size/ | 2022-03-28 16:42 | - | |
| Toshiba A35-S159 vs. Toshiba 5205-S503/ | 2022-03-28 16:43 | - | |
| Toshiba A35 and firewire connection/ | 2022-03-28 16:43 | - | |
| Toshiba A40 ACPI support/ | 2022-03-28 16:43 | - | |
| Toshiba A45-250 .. i love it/ | 2022-03-28 16:43 | - | |
| Toshiba A45 S250/ | 2022-03-28 16:43 | - | |
| Toshiba A50-AG1 (in Canada)/ | 2022-03-28 16:43 | - | |
| Toshiba A50 wireless and general questions/ | 2022-03-28 16:43 | - | |
| Toshiba A55-S306 On It's Last Legs/ | 2022-03-28 16:43 | - | |
| Toshiba A60/ | 2022-03-28 16:43 | - | |
| Toshiba A60 USB Ports and Power plug broken!,, HELP!/ | 2022-03-28 16:43 | - | |
| Toshiba A60 opinions/ | 2022-03-28 16:43 | - | |
| Toshiba A65-S126 Any good/ | 2022-03-28 16:43 | - | |
| Toshiba A65 processor replacement/ | 2022-03-28 16:43 | - | |
| Toshiba A65 processor upgradable/ | 2022-03-28 16:43 | - | |
| Toshiba A70 BIOS/ | 2022-03-28 16:43 | - | |
| Toshiba A70 Sound Probleme/ | 2022-03-28 16:43 | - | |
| Toshiba A75-211 memory upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba A75-2112 woes. Please help!/ | 2022-03-28 16:43 | - | |
| Toshiba A75-S206 Crashing problem/ | 2022-03-28 16:43 | - | |
| Toshiba A75-S2112/ | 2022-03-28 16:43 | - | |
| Toshiba A75 S209 CPU upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba A80 problem/ | 2022-03-28 16:43 | - | |
| Toshiba A85 LCD hinges/ | 2022-03-28 16:43 | - | |
| Toshiba A85 laptop....buyers beware!/ | 2022-03-28 16:43 | - | |
| Toshiba A100-306 BIOS Recovery Procedure/ | 2022-03-28 16:42 | - | |
| Toshiba A100-635 unable to burn DVD's/ | 2022-03-28 16:42 | - | |
| Toshiba A100-847 PSAA9E-0R101QAR with 4GB ram but it reads only 3GB on 64bit system/ | 2022-03-28 16:42 | - | |
| Toshiba A100 - CD DVD burner not working/ | 2022-03-28 16:42 | - | |
| Toshiba A100-SK9 Benchmarks/ | 2022-03-28 16:42 | - | |
| Toshiba A100-TA6 (Fan running nonstop)/ | 2022-03-28 16:42 | - | |
| Toshiba A100-TA9 Resolution Help/ | 2022-03-28 16:42 | - | |
| Toshiba A100-VA5/ | 2022-03-28 16:42 | - | |
| Toshiba A100-VA9 questions/ | 2022-03-28 16:42 | - | |
| Toshiba A100/ | 2022-03-28 16:42 | - | |
| Toshiba A100 A105..please advise/ | 2022-03-28 16:42 | - | |
| Toshiba A100 Audio Feedback/ | 2022-03-28 16:42 | - | |
| Toshiba A100 Battery Question/ | 2022-03-28 16:42 | - | |
| Toshiba A100 Input Device missing Wave and Synth/ | 2022-03-28 16:42 | - | |
| Toshiba A100 JH2 Advice Please/ | 2022-03-28 16:42 | - | |
| Toshiba A100 Laptop RGB & Contrast Adjustment/ | 2022-03-28 16:42 | - | |
| Toshiba A100 Problem with Adobe Premiere Pro/ | 2022-03-28 16:42 | - | |
| Toshiba A100 Satellite LCD Screen Broken - Are the screens universal/ | 2022-03-28 16:42 | - | |
| Toshiba A100 Series/ | 2022-03-28 16:42 | - | |
| Toshiba A100 TouchPad/ | 2022-03-28 16:42 | - | |
| Toshiba A100VA1 or A135S2266/ | 2022-03-28 16:42 | - | |
| Toshiba A100 does not light/ | 2022-03-28 16:42 | - | |
| Toshiba A100 express media player Recovery CD ISO image/ | 2022-03-28 16:42 | - | |
| Toshiba A100 not shutting down/ | 2022-03-28 16:42 | - | |
| Toshiba A100 or A105 WiFi question/ | 2022-03-28 16:42 | - | |
| Toshiba A100 sound line out headphones out problem - low bass/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S101/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S101 blank screen/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S2716 Screen Lost/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S4034 Recovery DVD/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S4094/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S4104 and SATA2 HDD/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S4134..any good/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S4211 Ethernet controller Help/ | 2022-03-28 16:42 | - | |
| Toshiba A105-S4284 upgrades/ | 2022-03-28 16:42 | - | |
| Toshiba A105 - Screen Turns White/ | 2022-03-28 16:42 | - | |
| Toshiba A105-s4074/ | 2022-03-28 16:42 | - | |
| Toshiba A105/ | 2022-03-28 16:42 | - | |
| Toshiba A105@best buy/ | 2022-03-28 16:42 | - | |
| Toshiba A105 LCD problem/ | 2022-03-28 16:42 | - | |
| Toshiba A105 No sound since Day 1/ | 2022-03-28 16:42 | - | |
| Toshiba A105 S1013 White Screen/ | 2022-03-28 16:42 | - | |
| Toshiba A105 S4134- How is it/ | 2022-03-28 16:42 | - | |
| Toshiba A105 Series BIOS/ | 2022-03-28 16:42 | - | |
| Toshiba A105 arrow, Fn and z keys not working/ | 2022-03-28 16:42 | - | |
| Toshiba A105 different DC power connectors/ | 2022-03-28 16:42 | - | |
| Toshiba A105 users, Please share!/ | 2022-03-28 16:42 | - | |
| Toshiba A105 will not power on/ | 2022-03-28 16:42 | - | |
| Toshiba A105 wont start up!/ | 2022-03-28 16:42 | - | |
| Toshiba A120 160, 16-9 on external monitor/ | 2022-03-28 16:42 | - | |
| Toshiba A134-S4407, microphone does not work/ | 2022-03-28 16:42 | - | |
| Toshiba A135-2286 issues/ | 2022-03-28 16:42 | - | |
| Toshiba A135-4527 internal mic/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S2246/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S2246 Unkown device drivers/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S2276 XP Upgrade Problems/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S2276 dual Channel/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S2306 Drivers/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S2326 (Please Help)/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4427 -- Why $1299/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4487 Graphics card/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4527/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4527 Problem! pls help/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4527 Touchpad not working HELP/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4527 blank screen/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4656 WinXP Down Grade Drivers/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4666- The Raw Deal on the XP Up Downgrade/ | 2022-03-28 16:42 | - | |
| Toshiba A135-S4666 Atheros AR5006X Wireless Adapter/ | 2022-03-28 16:42 | - | |
| Toshiba A135 S2276 memeory upgrade/ | 2022-03-28 16:42 | - | |
| Toshiba A135 Wireless Shortcut Key/ | 2022-03-28 16:42 | - | |
| Toshiba A200-1ZF need old bios/ | 2022-03-28 16:43 | - | |
| Toshiba A200-13J, slow CPU after upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba A200-244 XP downgrade/ | 2022-03-28 16:43 | - | |
| Toshiba A200 - Camera power/ | 2022-03-28 16:42 | - | |
| Toshiba A200/ | 2022-03-28 16:42 | - | |
| Toshiba A200 AH6/ | 2022-03-28 16:42 | - | |
| Toshiba A200 HDD/ | 2022-03-28 16:43 | - | |
| Toshiba A200 Heat/ | 2022-03-28 16:43 | - | |
| Toshiba A200 Recovery Mystery- DVD just pops out/ | 2022-03-28 16:43 | - | |
| Toshiba A200 wireless internet/ | 2022-03-28 16:43 | - | |
| Toshiba A200 x25 upgrade qx9300/ | 2022-03-28 16:43 | - | |
| Toshiba A205 - HD DVD drive questions/ | 2022-03-28 16:43 | - | |
| Toshiba A205-S4707 - WiFi Stopped Working/ | 2022-03-28 16:43 | - | |
| Toshiba A205-S5804/ | 2022-03-28 16:43 | - | |
| Toshiba A205-S5804 Recovery CD-s/ | 2022-03-28 16:43 | - | |
| Toshiba A205 Now on NewEgg (Lots of Pictures!)/ | 2022-03-28 16:43 | - | |
| Toshiba A205 System Drivers Needed/ | 2022-03-28 16:43 | - | |
| Toshiba A205 bios/ | 2022-03-28 16:43 | - | |
| Toshiba A210-1AO battery exploded in my laptop!!!!... Message contains an attachment/ | 2022-03-28 16:43 | - | |
| Toshiba A210-133/ | 2022-03-28 16:43 | - | |
| Toshiba A215-7427 Bios update failed unexpectedly/ | 2022-03-28 16:43 | - | |
| Toshiba A215-S4767 BIOS password issue/ | 2022-03-28 16:43 | - | |
| Toshiba A215-S5825 Satellite ac adapter/ | 2022-03-28 16:43 | - | |
| Toshiba A215-S7422 does not start, possibly bios update crashed/ | 2022-03-28 16:43 | - | |
| Toshiba A215-S7462 power problem/ | 2022-03-28 16:43 | - | |
| Toshiba A215 No Power/ | 2022-03-28 16:43 | - | |
| Toshiba A215 series -- any to avoid/ | 2022-03-28 16:43 | - | |
| Toshiba A300-034/ | 2022-03-28 16:43 | - | |
| Toshiba A300-07G, how long will this be able to last/ | 2022-03-28 16:43 | - | |
| Toshiba A300-17N video card problem/ | 2022-03-28 16:43 | - | |
| Toshiba A300-193 replacement hard drive/ | 2022-03-28 16:43 | - | |
| Toshiba A300-D Freezing Problem/ | 2022-03-28 16:43 | - | |
| Toshiba A300 - MXM II/ | 2022-03-28 16:43 | - | |
| Toshiba A300D 17D sound problem/ | 2022-03-28 16:43 | - | |
| Toshiba A300 Freezes and LocksUp + (Intel(R) Pro error at startup)/ | 2022-03-28 16:43 | - | |
| Toshiba A300 Harman Kardon best battery/ | 2022-03-28 16:43 | - | |
| Toshiba A300 Won't load Windows/ | 2022-03-28 16:43 | - | |
| Toshiba A300 at bestbuy/ | 2022-03-28 16:43 | - | |
| Toshiba A305-6898, good choice/ | 2022-03-28 16:43 | - | |
| Toshiba A305-S6839/ | 2022-03-28 16:43 | - | |
| Toshiba A305-S6858 LCD Replacement/ | 2022-03-28 16:43 | - | |
| Toshiba A305/ | 2022-03-28 16:43 | - | |
| Toshiba A305 Question/ | 2022-03-28 16:43 | - | |
| Toshiba A305 Touchpad/ | 2022-03-28 16:43 | - | |
| Toshiba A305 power adapter compatibility/ | 2022-03-28 16:43 | - | |
| Toshiba A500, M500, U500, L500 - New Intel iCORE Processors/ | 2022-03-28 16:43 | - | |
| Toshiba A500 - 026 HDMI Cant Connect/ | 2022-03-28 16:43 | - | |
| Toshiba A500 - Programs Not Responding/ | 2022-03-28 16:43 | - | |
| Toshiba A500 error mxmII/ | 2022-03-28 16:43 | - | |
| Toshiba A500 question/ | 2022-03-28 16:43 | - | |
| Toshiba A505-S6033 - Almost Perfect/ | 2022-03-28 16:43 | - | |
| Toshiba A505-S6965, Media Control Buttons/ | 2022-03-28 16:43 | - | |
| Toshiba A505-S6965- What do you think/ | 2022-03-28 16:43 | - | |
| Toshiba A505-S6965 5.1 over HDMI/ | 2022-03-28 16:43 | - | |
| Toshiba A505-S6992 sound problems/ | 2022-03-28 16:43 | - | |
| Toshiba A505D-S6958 Laptop BIOS SUCKS/ | 2022-03-28 16:43 | - | |
| Toshiba A660 A665 lack of fan vent holes/ | 2022-03-28 16:43 | - | |
| Toshiba A660 Owners Read!/ | 2022-03-28 16:43 | - | |
| Toshiba A660 Series/ | 2022-03-28 16:42 | - | |
| Toshiba A665-3DV/ | 2022-03-28 16:43 | - | |
| Toshiba A665-11Z TV Tuner/ | 2022-03-28 16:43 | - | |
| Toshiba A665-6065 Segate Momentus XT Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba A665-S6065/ | 2022-03-28 16:43 | - | |
| Toshiba A665 -i720QM 4GB GT350M - Poor Quality Control/ | 2022-03-28 16:43 | - | |
| Toshiba A665D-S6091 Bios Mod/ | 2022-03-28 16:43 | - | |
| Toshiba AMD vs Intel/ | 2022-03-28 16:43 | - | |
| Toshiba ATI Driver - any differences to normal ATI drivers/ | 2022-03-28 16:43 | - | |
| Toshiba BIOS mod thread, how to get .rom file (for those with .com)/ | 2022-03-28 16:43 | - | |
| Toshiba Battery Issue/ | 2022-03-28 16:43 | - | |
| Toshiba Battery Recognition Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Blank Screen Fixed!/ | 2022-03-28 16:43 | - | |
| Toshiba Bloatware/ | 2022-03-28 16:43 | - | |
| Toshiba Bloatware removal/ | 2022-03-28 16:43 | - | |
| Toshiba Bluetooth nag window Remote screen message/ | 2022-03-28 16:43 | - | |
| Toshiba Brain Fart/ | 2022-03-28 16:43 | - | |
| Toshiba Build Quality/ | 2022-03-28 16:43 | - | |
| Toshiba C55t-A5123 Has no access to UEFI CSM/ | 2022-03-28 16:43 | - | |
| Toshiba C75-B7200 It's a pain but it's ours/ | 2022-03-28 16:43 | - | |
| Toshiba C650 Graphic memory/ | 2022-03-28 16:43 | - | |
| Toshiba C650 Wont Boot/ | 2022-03-28 16:43 | - | |
| Toshiba C660-1J0 without light even after screen replacement/ | 2022-03-28 16:43 | - | |
| Toshiba C850-PSCBWC 05700J CPU upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba C850D-125 BIOS recovery help/ | 2022-03-28 16:43 | - | |
| Toshiba CD/ | 2022-03-28 16:43 | - | |
| Toshiba Canada Sucks ! Satellite M70-CL1/ | 2022-03-28 16:43 | - | |
| Toshiba Canada sells Used as New - Beware/ | 2022-03-28 16:43 | - | |
| Toshiba Charging defect/ | 2022-03-28 16:43 | - | |
| Toshiba Config Free Help/ | 2022-03-28 16:43 | - | |
| Toshiba Contrast ! HELP PLZ!/ | 2022-03-28 16:43 | - | |
| Toshiba Controls (The media buttons on the M70) question/ | 2022-03-28 16:43 | - | |
| Toshiba Coupons/ | 2022-03-28 16:43 | - | |
| Toshiba Custom Configuration-How to Confirm Verify/ | 2022-03-28 16:43 | - | |
| Toshiba Cyber Monday Sale/ | 2022-03-28 16:43 | - | |
| Toshiba DVD Drive problems/ | 2022-03-28 16:43 | - | |
| Toshiba DVD Player on a Qosmio F60/ | 2022-03-28 16:43 | - | |
| Toshiba Direct (The company)/ | 2022-03-28 16:43 | - | |
| Toshiba Direct order/ | 2022-03-28 16:43 | - | |
| Toshiba Direct problems/ | 2022-03-28 16:43 | - | |
| Toshiba Disc Creator For M115/ | 2022-03-28 16:43 | - | |
| Toshiba Done Me Wrong!!!!/ | 2022-03-28 16:43 | - | |
| Toshiba Durablity and Reliablity/ | 2022-03-28 16:43 | - | |
| Toshiba Dynabook R731/ | 2022-03-28 16:43 | - | |
| Toshiba Dynabook SS MX = Tecra M6 = Portege M500/ | 2022-03-28 16:43 | - | |
| Toshiba Dynabook UX 23LWH Screen Black/ | 2022-03-28 16:43 | - | |
| Toshiba Dynabook build quality/ | 2022-03-28 16:43 | - | |
| Toshiba Dynapad/ | 2022-03-28 16:43 | - | |
| Toshiba E55 Help (How to get in the BIOS)/ | 2022-03-28 16:43 | - | |
| Toshiba E105-S1402/ | 2022-03-28 16:43 | - | |
| Toshiba E105-S1402 questions/ | 2022-03-28 16:43 | - | |
| Toshiba E105 at Best Buy/ | 2022-03-28 16:43 | - | |
| Toshiba E105 refurbished experiences/ | 2022-03-28 16:43 | - | |
| Toshiba E205 S1904 and S1980 Best Buy difference/ | 2022-03-28 16:43 | - | |
| Toshiba Equium A60/ | 2022-03-28 16:43 | - | |
| Toshiba Equium A100-02l Rebooting/ | 2022-03-28 16:43 | - | |
| Toshiba Equium A200-196 - BIOS Recovery/ | 2022-03-28 16:43 | - | |
| Toshiba Equium P200D/ | 2022-03-28 16:43 | - | |
| Toshiba Express Media Player with Windows Vista/ | 2022-03-28 16:43 | - | |
| Toshiba F10 format issue/ | 2022-03-28 16:43 | - | |
| Toshiba F50/ | 2022-03-28 16:43 | - | |
| Toshiba F50 F55 discontinued/ | 2022-03-28 16:43 | - | |
| Toshiba F50 Qosmio/ | 2022-03-28 16:43 | - | |
| Toshiba F55, nowhere to get in Europe/ | 2022-03-28 16:43 | - | |
| Toshiba F55-Q5021 OVERHEATING!/ | 2022-03-28 16:43 | - | |
| Toshiba G35 Qosmio, anybody has any experience/ | 2022-03-28 16:43 | - | |
| Toshiba G50 (102) Review Owners/ | 2022-03-28 16:43 | - | |
| Toshiba Gaming Performance (x205)/ | 2022-03-28 16:43 | - | |
| Toshiba HDD Partition Trouble/ | 2022-03-28 16:43 | - | |
| Toshiba HDD Protection/ | 2022-03-28 16:43 | - | |
| Toshiba HD DVD Multi Drive/ | 2022-03-28 16:43 | - | |
| Toshiba HD non-reflective high brightness display/ | 2022-03-28 16:43 | - | |
| Toshiba International Warranty/ | 2022-03-28 16:43 | - | |
| Toshiba Is Clamming Up Its Technologies/ | 2022-03-28 16:43 | - | |
| Toshiba L25 S1194/ | 2022-03-28 16:43 | - | |
| Toshiba L25 Screen Problem/ | 2022-03-28 16:43 | - | |
| Toshiba L35-S2151 not working with 1.5G RAM/ | 2022-03-28 16:43 | - | |
| Toshiba L40 CMOS power low/ | 2022-03-28 16:43 | - | |
| Toshiba L50-C-22L (w FHD IPS screen, i5-5200U 8GB)/ | 2022-03-28 16:43 | - | |
| Toshiba L300-11C upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba L300 Camera Assistant issue/ | 2022-03-28 16:43 | - | |
| Toshiba L300 Touchpad scroll & Boot disc/ | 2022-03-28 16:43 | - | |
| Toshiba L300 fan/ | 2022-03-28 16:43 | - | |
| Toshiba L300 toshiba services.msc/ | 2022-03-28 16:43 | - | |
| Toshiba L305-S5891 Video Problem/ | 2022-03-28 16:43 | - | |
| Toshiba L305 Display/ | 2022-03-28 16:43 | - | |
| Toshiba L350 - 107 runs fine on battery reboots on poweradapter.... problem/ | 2022-03-28 16:43 | - | |
| Toshiba L445D need BIOS chip model number/ | 2022-03-28 16:43 | - | |
| Toshiba L455d-S5976 cpu upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba L500 (or smthng else )/ | 2022-03-28 16:43 | - | |
| Toshiba L500 - high temps, cleaning fans/ | 2022-03-28 16:43 | - | |
| Toshiba L550-0CD display/ | 2022-03-28 16:43 | - | |
| Toshiba L640 display problem/ | 2022-03-28 16:43 | - | |
| Toshiba L640 on 1-2 seconds then off again/ | 2022-03-28 16:43 | - | |
| Toshiba L645-1013 1015 1026/ | 2022-03-28 16:43 | - | |
| Toshiba L645-S4108/ | 2022-03-28 16:43 | - | |
| Toshiba L645 - i3 330 processor/ | 2022-03-28 16:43 | - | |
| Toshiba L645 battery life/ | 2022-03-28 16:43 | - | |
| Toshiba L650-11F I5 430M Overclock [OC]/ | 2022-03-28 16:43 | - | |
| Toshiba L650-I5310 or C640-I4531/ | 2022-03-28 16:43 | - | |
| Toshiba L650 12Q - Comments from owners/ | 2022-03-28 16:43 | - | |
| Toshiba L655D-S5116 Issue/ | 2022-03-28 16:43 | - | |
| Toshiba L675-S7016 hard drive failure/ | 2022-03-28 16:43 | - | |
| Toshiba L750 BIOS/ | 2022-03-28 16:43 | - | |
| Toshiba L775D-S7206 boot password rest/ | 2022-03-28 16:43 | - | |
| Toshiba L850 doesn't boot after BIOS update/ | 2022-03-28 16:43 | - | |
| Toshiba LAN Port Problem/ | 2022-03-28 16:43 | - | |
| Toshiba LS-S1216- Problems Ripping Music/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop 2450/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop Battery for M45-S2653/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop Comparison/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop Help!/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop Keyboard Wont Work 911!!/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop M40/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop Screen Half Dead/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop Screen Problems/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop Turning off by itself!!!/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop Video Driver Not Found/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop function keys/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop just SHUTS OFF randomnly.HELP/ | 2022-03-28 16:43 | - | |
| Toshiba Laptop starts but nothing in the Screen or HDD light/ | 2022-03-28 16:43 | - | |
| Toshiba Lcd replacement/ | 2022-03-28 16:43 | - | |
| Toshiba Libretto 70CT doesnt appear to POST/ | 2022-03-28 16:43 | - | |
| Toshiba Libretto L5 80 - Display and battery driver problem/ | 2022-03-28 16:43 | - | |
| Toshiba Libretto U100/ | 2022-03-28 16:43 | - | |
| Toshiba Libretto W105 - One Year Update/ | 2022-03-28 16:43 | - | |
| Toshiba Life/ | 2022-03-28 16:43 | - | |
| Toshiba M-800 -Pink/ | 2022-03-28 16:43 | - | |
| Toshiba M2 Dothan 14,1 1400x1050 dispaly/ | 2022-03-28 16:43 | - | |
| Toshiba M2 Tecra - How To Remove DVD Drive/ | 2022-03-28 16:43 | - | |
| Toshiba M5 - Do you like it/ | 2022-03-28 16:43 | - | |
| Toshiba M5 review (No Pics)/ | 2022-03-28 16:43 | - | |
| Toshiba M8 vs. Dell M1330/ | 2022-03-28 16:43 | - | |
| Toshiba M9 Series/ | 2022-03-28 16:43 | - | |
| Toshiba M10/ | 2022-03-28 16:43 | - | |
| Toshiba M15 display/ | 2022-03-28 16:43 | - | |
| Toshiba M30-00K or Acer 2012WLMi/ | 2022-03-28 16:43 | - | |
| Toshiba M30-S350-NO LONGER AVAIL THRU TOSHIBA/ | 2022-03-28 16:43 | - | |
| Toshiba M30-UU9/ | 2022-03-28 16:43 | - | |
| Toshiba M30-YSJ or M35-S456/ | 2022-03-28 16:43 | - | |
| Toshiba M 30... help needed!/ | 2022-03-28 16:43 | - | |
| Toshiba M30/ | 2022-03-28 16:43 | - | |
| Toshiba M30 Advertising Issue HELP HELP HELP!!!/ | 2022-03-28 16:43 | - | |
| Toshiba M30X or/ | 2022-03-28 16:43 | - | |
| Toshiba M30 keyboard messed up/ | 2022-03-28 16:43 | - | |
| Toshiba M30 ram/ | 2022-03-28 16:43 | - | |
| Toshiba M30 w 7200rpm/ | 2022-03-28 16:43 | - | |
| Toshiba M30 wont boot/ | 2022-03-28 16:43 | - | |
| Toshiba M30x/ | 2022-03-28 16:43 | - | |
| Toshiba M30x Does the palm rest get hot/ | 2022-03-28 16:43 | - | |
| Toshiba M35-S456 or M30-YSJ/ | 2022-03-28 16:43 | - | |
| Toshiba M35X-311 Processor Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba M35X-S149 Glare White Spot on Screen/ | 2022-03-28 16:43 | - | |
| Toshiba M35X-S161 problems/ | 2022-03-28 16:43 | - | |
| Toshiba M35X-S311 is dead/ | 2022-03-28 16:43 | - | |
| Toshiba M35X - bad mother board/ | 2022-03-28 16:43 | - | |
| Toshiba M35X Motherboard/ | 2022-03-28 16:43 | - | |
| Toshiba M35X dvd question/ | 2022-03-28 16:43 | - | |
| Toshiba M35 and infrared/ | 2022-03-28 16:43 | - | |
| Toshiba M35x-S109 screen problem, i apreciate any comment!/ | 2022-03-28 16:43 | - | |
| Toshiba M35x-S349 issues/ | 2022-03-28 16:43 | - | |
| Toshiba M40 - current owners check your screen/ | 2022-03-28 16:43 | - | |
| Toshiba M40 45 - The Unanswered Questions/ | 2022-03-28 16:43 | - | |
| Toshiba M40 Battery Life still worth it/ | 2022-03-28 16:43 | - | |
| Toshiba M40 Flexing/ | 2022-03-28 16:43 | - | |
| Toshiba M40 SF3 Wireless Switch Problem/ | 2022-03-28 16:43 | - | |
| Toshiba M40 Shutdown Question/ | 2022-03-28 16:43 | - | |
| Toshiba M40 image restore/ | 2022-03-28 16:43 | - | |
| Toshiba M40 lcd DISPLAY/ | 2022-03-28 16:43 | - | |
| Toshiba M40 problem/ | 2022-03-28 16:43 | - | |
| Toshiba M40 screens with dead pixel problems/ | 2022-03-28 16:43 | - | |
| Toshiba M40 video upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba M40x-189/ | 2022-03-28 16:43 | - | |
| Toshiba M45-S165 HELP!/ | 2022-03-28 16:43 | - | |
| Toshiba M45-S331 vs Gateway 7422GX ! !/ | 2022-03-28 16:43 | - | |
| Toshiba M45-S355 BIOS CMOS Battery/ | 2022-03-28 16:43 | - | |
| Toshiba M45-S355 graphics question/ | 2022-03-28 16:43 | - | |
| Toshiba M45 LCD problems/ | 2022-03-28 16:43 | - | |
| Toshiba M45 M40/ | 2022-03-28 16:43 | - | |
| Toshiba M45 Problems... Please Help!!!/ | 2022-03-28 16:43 | - | |
| Toshiba M45 S165/ | 2022-03-28 16:43 | - | |
| Toshiba M45 S269 Recovery Problems/ | 2022-03-28 16:43 | - | |
| Toshiba M45 S331/ | 2022-03-28 16:43 | - | |
| Toshiba M45 S359 shut downs, freezes, heat & cpu issues/ | 2022-03-28 16:43 | - | |
| Toshiba M50-MX2/ | 2022-03-28 16:43 | - | |
| Toshiba M50-MX5 CPU Temp Monitoring isn't active/ | 2022-03-28 16:43 | - | |
| Toshiba M50 Battery Problems/ | 2022-03-28 16:43 | - | |
| Toshiba M50 Bios Secutity/ | 2022-03-28 16:43 | - | |
| Toshiba M50X-MX2 vs Acer AS5002WLMI/ | 2022-03-28 16:43 | - | |
| Toshiba M50 motherboard/ | 2022-03-28 16:43 | - | |
| Toshiba M55 Battery/ | 2022-03-28 16:43 | - | |
| Toshiba M55 PLEASE HELP!/ | 2022-03-28 16:43 | - | |
| Toshiba M55 or Dell 600m/ | 2022-03-28 16:43 | - | |
| Toshiba M60 - No power DC, battery usage is perfect/ | 2022-03-28 16:43 | - | |
| Toshiba M60/ | 2022-03-28 16:43 | - | |
| Toshiba M60 french keybord keys/ | 2022-03-28 16:43 | - | |
| Toshiba M60 vs Quismio G25/ | 2022-03-28 16:43 | - | |
| Toshiba M65 Unknow Project ID!!! BIOS Version BIOS error/ | 2022-03-28 16:43 | - | |
| Toshiba M70-DL3 Screen goes magenta, need help!/ | 2022-03-28 16:43 | - | |
| Toshiba M70-SR3 Problems Anyone/ | 2022-03-28 16:43 | - | |
| Toshiba M70-SR6 video card question/ | 2022-03-28 16:43 | - | |
| Toshiba M70/ | 2022-03-28 16:43 | - | |
| Toshiba M70 Laptop Driver Problems/ | 2022-03-28 16:43 | - | |
| Toshiba M70 Overheating I think/ | 2022-03-28 16:43 | - | |
| Toshiba M70 Speaker Wiring/ | 2022-03-28 16:43 | - | |
| Toshiba M70 power-on password problems/ | 2022-03-28 16:43 | - | |
| Toshiba M100 (Core Solo & 256mb ram) TOO SLOW/ | 2022-03-28 16:43 | - | |
| Toshiba M100-2022E/ | 2022-03-28 16:43 | - | |
| Toshiba M100 Lid close switch help needed!/ | 2022-03-28 16:43 | - | |
| Toshiba M100 screen problem!!/ | 2022-03-28 16:43 | - | |
| Toshiba M105/ | 2022-03-28 16:43 | - | |
| Toshiba M105 Screen/ | 2022-03-28 16:43 | - | |
| Toshiba M105 cd jack/ | 2022-03-28 16:43 | - | |
| Toshiba M105 or M115/ | 2022-03-28 16:43 | - | |
| Toshiba M115-S3094 - Hinges/ | 2022-03-28 16:43 | - | |
| Toshiba M115-series discontinued/ | 2022-03-28 16:43 | - | |
| Toshiba M115 S3094 Bios Password Reset/ | 2022-03-28 16:43 | - | |
| Toshiba M200/ | 2022-03-28 16:43 | - | |
| Toshiba M200 Memory Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba M200 Problems/ | 2022-03-28 16:43 | - | |
| Toshiba M200 keyboard problem- can I fix this/ | 2022-03-28 16:43 | - | |
| Toshiba M300-037 - is this a good buy/ | 2022-03-28 16:43 | - | |
| Toshiba M300/ | 2022-03-28 16:43 | - | |
| Toshiba M300V... it restart by its own after shutting down !!!/ | 2022-03-28 16:43 | - | |
| Toshiba M305-4622 Question/ | 2022-03-28 16:43 | - | |
| Toshiba M500 blue screen/ | 2022-03-28 16:43 | - | |
| Toshiba M500 heating opinions/ | 2022-03-28 16:43 | - | |
| Toshiba M505-S4947/ | 2022-03-28 16:43 | - | |
| Toshiba M640 - few questions/ | 2022-03-28 16:43 | - | |
| Toshiba M 640/ | 2022-03-28 16:43 | - | |
| Toshiba M645 - Dropped my 7 month old laptop --(/ | 2022-03-28 16:43 | - | |
| Toshiba M645 - i love it/ | 2022-03-28 16:43 | - | |
| Toshiba M645. No Blu Ray/ | 2022-03-28 16:43 | - | |
| Toshiba M645/ | 2022-03-28 16:43 | - | |
| Toshiba M645 Bloatware during startup. What to remove/ | 2022-03-28 16:43 | - | |
| Toshiba M645 Blu-ray Issue/ | 2022-03-28 16:43 | - | |
| Toshiba M645 brand new in box 6 cell battery for you 12 cell owners/ | 2022-03-28 16:43 | - | |
| Toshiba M645 problem with SLEEP/ | 2022-03-28 16:43 | - | |
| Toshiba M800 white version asking the white led on keyboard always on after shutdown/ | 2022-03-28 16:43 | - | |
| Toshiba Maximizer Startup/ | 2022-03-28 16:43 | - | |
| Toshiba Meda controls- M50/ | 2022-03-28 16:43 | - | |
| Toshiba Media PowerCinema Button/ | 2022-03-28 16:43 | - | |
| Toshiba Memory/ | 2022-03-28 16:43 | - | |
| Toshiba Mini NB205-N330 Power Adapter; naturally loose/ | 2022-03-28 16:43 | - | |
| Toshiba Mini NB305 Power LED/ | 2022-03-28 16:43 | - | |
| Toshiba Model- A100 105-S4384/ | 2022-03-28 16:43 | - | |
| Toshiba Multilingual Keyboard Replacement/ | 2022-03-28 16:43 | - | |
| Toshiba N505 ram upgrade to 4gb/ | 2022-03-28 16:43 | - | |
| Toshiba NB 100, anyone/ | 2022-03-28 16:43 | - | |
| Toshiba NB100 Wireless/ | 2022-03-28 16:43 | - | |
| Toshiba NB100 and games/ | 2022-03-28 16:43 | - | |
| Toshiba NB205 -- Questions/ | 2022-03-28 16:43 | - | |
| Toshiba NB205-N310BN/ | 2022-03-28 16:43 | - | |
| Toshiba NB205-N310 and Connection Problems/ | 2022-03-28 16:43 | - | |
| Toshiba NB205-N330 ram upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba NB205-n210 mini-pcie upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba NB205 Battery Loose/ | 2022-03-28 16:43 | - | |
| Toshiba NB305-N410WH/ | 2022-03-28 16:43 | - | |
| Toshiba NB 305 Netbook/ | 2022-03-28 16:43 | - | |
| Toshiba NB500 Owner's Lounge/ | 2022-03-28 16:43 | - | |
| Toshiba NB520 or NB550/ | 2022-03-28 16:43 | - | |
| Toshiba NB550D (AMD Fusion)/ | 2022-03-28 16:43 | - | |
| Toshiba Netbook/ | 2022-03-28 16:43 | - | |
| Toshiba Netbook Windows Question/ | 2022-03-28 16:43 | - | |
| Toshiba Notebook CD Rom Hook/ | 2022-03-28 16:43 | - | |
| Toshiba Notebooks (Make of HDD)/ | 2022-03-28 16:43 | - | |
| Toshiba Notebooks/ | 2022-03-28 16:43 | - | |
| Toshiba Notebooks good for Gaming/ | 2022-03-28 16:43 | - | |
| Toshiba Outlet/ | 2022-03-28 16:43 | - | |
| Toshiba OverHeat Problem/ | 2022-03-28 16:43 | - | |
| Toshiba P10-S429 video card replacement/ | 2022-03-28 16:43 | - | |
| Toshiba P20-771 is the best notebook/ | 2022-03-28 16:43 | - | |
| Toshiba P25-S676 Screen Display Issue/ | 2022-03-28 16:43 | - | |
| Toshiba P25-S5263 - good choice/ | 2022-03-28 16:43 | - | |
| Toshiba P25-s609 number of RAM slots present/ | 2022-03-28 16:43 | - | |
| Toshiba P25 S609/ | 2022-03-28 16:43 | - | |
| Toshiba P25 S676 Media Slow and Jerky-help/ | 2022-03-28 16:43 | - | |
| Toshiba P30 prob/ | 2022-03-28 16:43 | - | |
| Toshiba P30 vs M40 (which has better game play)/ | 2022-03-28 16:43 | - | |
| Toshiba P35-S605/ | 2022-03-28 16:43 | - | |
| Toshiba P35-S611- Bose companion 3 Multimedia spea/ | 2022-03-28 16:43 | - | |
| Toshiba P35 inquiries/ | 2022-03-28 16:43 | - | |
| Toshiba P50 - How difficult it is to replace the cd drive with a hdd caddy Also,how are the temps/ | 2022-03-28 16:43 | - | |
| Toshiba P50T-BST2N01 4K laptop UNBOXING/ | 2022-03-28 16:43 | - | |
| Toshiba P50T-BST2N01 4K laptop compatible blu-ray drives/ | 2022-03-28 16:43 | - | |
| Toshiba P50t-B gaming 4K with AMD R9 M265X/ | 2022-03-28 16:43 | - | |
| Toshiba P50t with Haswell/ | 2022-03-28 16:43 | - | |
| Toshiba P100-160 SATA HD compatible/ | 2022-03-28 16:43 | - | |
| Toshiba P100-429 Intel Wifilink 5300 problem/ | 2022-03-28 16:43 | - | |
| Toshiba P100-434 Rebuilt/ | 2022-03-28 16:43 | - | |
| Toshiba P100 - Ext DVI connected monitor can't enter power saving/ | 2022-03-28 16:43 | - | |
| Toshiba P100-ST9012 Battery Problem/ | 2022-03-28 16:43 | - | |
| Toshiba P100-ST9012 Issues!!!/ | 2022-03-28 16:43 | - | |
| Toshiba P100-ST9012 Thoughts/ | 2022-03-28 16:43 | - | |
| Toshiba P100/ | 2022-03-28 16:43 | - | |
| Toshiba P100 CPU Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba P100 not keeping correct time or date/ | 2022-03-28 16:43 | - | |
| Toshiba P105-S921 - Questions/ | 2022-03-28 16:43 | - | |
| Toshiba P105-S921 doubt/ | 2022-03-28 16:43 | - | |
| Toshiba P105-S6024 (NO BOOT!)/ | 2022-03-28 16:43 | - | |
| Toshiba P105-S6084 Weird sound from hardware/ | 2022-03-28 16:43 | - | |
| Toshiba P105-S6177/ | 2022-03-28 16:43 | - | |
| Toshiba P105-S9337 Terrible game perfomance! (on a gaming laptop)/ | 2022-03-28 16:43 | - | |
| Toshiba P105/ | 2022-03-28 16:43 | - | |
| Toshiba P105 7900 nvidia drivers/ | 2022-03-28 16:43 | - | |
| Toshiba P105 Issues/ | 2022-03-28 16:43 | - | |
| Toshiba P105 LCD question/ | 2022-03-28 16:43 | - | |
| Toshiba P105 S6024 Network Adapter/ | 2022-03-28 16:43 | - | |
| Toshiba P105 Some good news with VISTA 32bit Drivers/ | 2022-03-28 16:43 | - | |
| Toshiba P200-1ED/ | 2022-03-28 16:43 | - | |
| Toshiba P200-ST2061 display driver help!!!/ | 2022-03-28 16:43 | - | |
| Toshiba P200 or X205/ | 2022-03-28 16:43 | - | |
| Toshiba P200 st2071 power problem/ | 2022-03-28 16:43 | - | |
| Toshiba P200 with four partitions - which one can I delete/ | 2022-03-28 16:43 | - | |
| Toshiba P205-S6267 - Vista/ | 2022-03-28 16:43 | - | |
| Toshiba P205-S6267 CPU upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba P205-S6347 XP problem/ | 2022-03-28 16:43 | - | |
| Toshiba P205-S7469 - SATI Driver needed to install XP/ | 2022-03-28 16:43 | - | |
| Toshiba P205 every keystroke opens browser/ | 2022-03-28 16:43 | - | |
| Toshiba P300-19P Screen Issue/ | 2022-03-28 16:43 | - | |
| Toshiba P300 05 suitable for web design graphic design functions/ | 2022-03-28 16:43 | - | |
| Toshiba P300D-13J heating issues/ | 2022-03-28 16:43 | - | |
| Toshiba P300 Motherboard/ | 2022-03-28 16:43 | - | |
| Toshiba P305-S8835 Help/ | 2022-03-28 16:43 | - | |
| Toshiba P305D-S8995E/ | 2022-03-28 16:43 | - | |
| Toshiba P505-S8980 Surround sound through spdif/ | 2022-03-28 16:43 | - | |
| Toshiba P505 Series Disassembly Screen Brightness/ | 2022-03-28 16:43 | - | |
| Toshiba P740 - screen upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba P750 AC Adapter/ | 2022-03-28 16:43 | - | |
| Toshiba P775-S7100/ | 2022-03-28 16:43 | - | |
| Toshiba P850 Info New Official Owners page/ | 2022-03-28 16:43 | - | |
| Toshiba PA2487U battery for $90!!!/ | 2022-03-28 16:43 | - | |
| Toshiba Parts (R700 keyboard)/ | 2022-03-28 16:43 | - | |
| Toshiba Portégé R700/ | 2022-03-28 16:43 | - | |
| Toshiba Portege (and UP) owner's lounge/ | 2022-03-28 16:43 | - | |
| Toshiba Portege- the fan's intermittently whirring is driving me nuts!/ | 2022-03-28 16:43 | - | |
| Toshiba Portege 2000 issues/ | 2022-03-28 16:43 | - | |
| Toshiba Portege 2010/ | 2022-03-28 16:43 | - | |
| Toshiba Portege 4000 - how to upgrade its BIOS/ | 2022-03-28 16:43 | - | |
| Toshiba Portege A-100/ | 2022-03-28 16:43 | - | |
| Toshiba Portege A100/ | 2022-03-28 16:43 | - | |
| Toshiba Portege A600/ | 2022-03-28 16:43 | - | |
| Toshiba Portege M400 Driver Issue/ | 2022-03-28 16:43 | - | |
| Toshiba Portege M600/ | 2022-03-28 16:43 | - | |
| Toshiba Portege M800- How to find MAC address using serial number/ | 2022-03-28 16:43 | - | |
| Toshiba Portege M800/ | 2022-03-28 16:43 | - | |
| Toshiba Portege R200-S234 Service Manual/ | 2022-03-28 16:43 | - | |
| Toshiba Portege R500- $700 from Toshiba Direct/ | 2022-03-28 16:43 | - | |
| Toshiba Portege R700 - Mysterious scratches/ | 2022-03-28 16:43 | - | |
| Toshiba Portege R700 Port Replicator Questions/ | 2022-03-28 16:43 | - | |
| Toshiba Portege R830, experiences/ | 2022-03-28 16:43 | - | |
| Toshiba Portege R835-56X - BIOS update/ | 2022-03-28 16:43 | - | |
| Toshiba Portege R835-P56X in Canada/ | 2022-03-28 16:43 | - | |
| Toshiba Portege R835 - SATA III Support/ | 2022-03-28 16:43 | - | |
| Toshiba Portege S100/ | 2022-03-28 16:43 | - | |
| Toshiba Portege S100 Wi-Fi Card Replacement/ | 2022-03-28 16:43 | - | |
| Toshiba Portege Z10t - Detachable Ultrabook/ | 2022-03-28 16:43 | - | |
| Toshiba Portege Z35-AST3N06/ | 2022-03-28 16:43 | - | |
| Toshiba Portege Z835/ | 2022-03-28 16:43 | - | |
| Toshiba Portege Z930 Z935 Owners Thread/ | 2022-03-28 16:43 | - | |
| Toshiba Portege m400 Touchscreen Issues/ | 2022-03-28 16:43 | - | |
| Toshiba Portege r700 clean install/ | 2022-03-28 16:43 | - | |
| Toshiba Power Saver/ | 2022-03-28 16:43 | - | |
| Toshiba Power Saver and NHC/ | 2022-03-28 16:43 | - | |
| Toshiba Power Woes/ | 2022-03-28 16:43 | - | |
| Toshiba Power issue/ | 2022-03-28 16:43 | - | |
| Toshiba Pre-Installed Utilities/ | 2022-03-28 16:43 | - | |
| Toshiba Pro 200 disc creator/ | 2022-03-28 16:43 | - | |
| Toshiba Pro L550-EZ1702/ | 2022-03-28 16:43 | - | |
| Toshiba Processor & Battery/ | 2022-03-28 16:43 | - | |
| Toshiba Protege 650CT/ | 2022-03-28 16:43 | - | |
| Toshiba Protege M780 w i7 Core/ | 2022-03-28 16:43 | - | |
| Toshiba Protege R100/ | 2022-03-28 16:43 | - | |
| Toshiba Q304-Q715/ | 2022-03-28 16:43 | - | |
| Toshiba QOSMIO G50/ | 2022-03-28 16:43 | - | |
| Toshiba QOSMIO x505-g898 questions comments/ | 2022-03-28 16:43 | - | |
| Toshiba Qosimo 15.4/ | 2022-03-28 16:43 | - | |
| Toshiba Qosimo F750 Glasses-Free 3D/ | 2022-03-28 16:43 | - | |
| Toshiba Qosimo X505 - Variants/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio $1000.00 off/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio's Keyboard Flex/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio-X305-Q701 Notebook Ques. 2nd HDD/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio Bios update screwed my computer/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F20-153/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F20 Wrong Recovery Disk - DMI settings/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F25, what u think/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F30/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F40-ST4101 Questions and Recommendations/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F40 - mxm graphic card/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F50 CPU upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F55-Q503- Beating a Dead Horse/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F60 Comming in Europe/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio F60 Released/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G20 in Canada, G25 in USA Serious Problem On Startup/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G20 internal mic not working/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G25-AV513 Laptop with Geforce Go 6600 with 128mm RAM/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G25 Cd drive to Motherboard cable/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G30 Screen Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G30 Z01/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G35-AV600/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G35 AV600 Vista Upgrade Issues/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G35s... any owners here/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio G50 - experiences/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio GPU user upgradeable via MXM/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio NVidia GPU Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio Refresh/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio WXW/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X70-ABT3G22 throttling question/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X70-B-11D fan control via acpi tables (warning-am noob)/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X70 ABT3G22 for 999$ Worth it/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X300, Fan/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X300, X305 Benchmarks/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X300 Gaming rig minor problem/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X300 Repair Help/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X305-Q701 + Warhammer/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X305-Q705 vs -Q701 vs F55-Q504/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X305-Q706/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X305-Q706 and X305-Q708 now available!/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X305-Q720/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X305 Gaming laptop delayed/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X305 and SetFSB/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-1800X First Impressions/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q850 (US) - my take/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q850 Upgrades/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q870 GPU upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q875 - Optimization/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q887/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q890/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q892, second HDD/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q892 - New users Review/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q893 User Review/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q898/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505-Q8102X display upgrade to Q8104X possible/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505 CPU Fan Excessive Noise/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505 Overclockable/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505 Speaker pinout/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X505 Upgraded processor, overheating issues/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X770 3D- EDID override INF drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X775-3DV78/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X775-3DV Models/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X775-Q7170 Core i7 Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X775-Q7270/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X775-Q7270 LCD Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio X870-168 Unlock/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio case cracking/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio help needed/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio light leakage!/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio or Hp pavillion/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmios and SK Gaming Partnership/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio vs Satelite A205/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio vs Satellite - a big difference of quality/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio x70 msata slot/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio x300 x305 GeForce 9800M GTS SLI Graphics adapter/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio x305-q705 GPU Ugrade/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio x305 - q705 problem/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio x505-Q885 turning off randomly/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio x770 Modded BIOS VBIOS/ | 2022-03-28 16:43 | - | |
| Toshiba Qosmio x870 !/ | 2022-03-28 16:43 | - | |
| Toshiba Quailty Is garbage/ | 2022-03-28 16:43 | - | |
| Toshiba Questions- M40/ | 2022-03-28 16:43 | - | |
| Toshiba Quosimo x505-875/ | 2022-03-28 16:43 | - | |
| Toshiba Quosmio/ | 2022-03-28 16:43 | - | |
| Toshiba R150/ | 2022-03-28 16:43 | - | |
| Toshiba R200/ | 2022-03-28 16:43 | - | |
| Toshiba R205 Recover problem!!!/ | 2022-03-28 16:43 | - | |
| Toshiba R500 - HDD user upgradable/ | 2022-03-28 16:43 | - | |
| Toshiba R500 Portege with Vista Bus or XP Pro/ | 2022-03-28 16:43 | - | |
| Toshiba R500 availability/ | 2022-03-28 16:43 | - | |
| Toshiba R500 in shops/ | 2022-03-28 16:43 | - | |
| Toshiba R500 screen is unacceptable/ | 2022-03-28 16:43 | - | |
| Toshiba R700 Buzzing Noise When Turned Off/ | 2022-03-28 16:43 | - | |
| Toshiba R700 R630 Satellite Function keys disabled/ | 2022-03-28 16:43 | - | |
| Toshiba R700 R705 R630 Owners Thread/ | 2022-03-28 16:43 | - | |
| Toshiba R700 Worth it/ | 2022-03-28 16:43 | - | |
| Toshiba R705 wireless driver for XP/ | 2022-03-28 16:43 | - | |
| Toshiba R835-P50X vs P56X/ | 2022-03-28 16:43 | - | |
| Toshiba R835-P56x Dual External Monitors/ | 2022-03-28 16:43 | - | |
| Toshiba R835/ | 2022-03-28 16:43 | - | |
| Toshiba R835 Screen Door effect/ | 2022-03-28 16:43 | - | |
| Toshiba R840 eGPU/ | 2022-03-28 16:43 | - | |
| Toshiba R845 What.... is it/ | 2022-03-28 16:43 | - | |
| Toshiba Radius 14 AMD (E45DW-C4210)/ | 2022-03-28 16:43 | - | |
| Toshiba Recommendations/ | 2022-03-28 16:43 | - | |
| Toshiba Recovery/ | 2022-03-28 16:43 | - | |
| Toshiba Recovery DVD !/ | 2022-03-28 16:43 | - | |
| Toshiba Recovery DVD on similar units/ | 2022-03-28 16:43 | - | |
| Toshiba Recovery Disc Creator Help!/ | 2022-03-28 16:43 | - | |
| Toshiba Recovery Disc For Satellite A665/ | 2022-03-28 16:43 | - | |
| Toshiba Recovery Disks for Satellite M115/ | 2022-03-28 16:43 | - | |
| Toshiba Registration! Great Service!/ | 2022-03-28 16:43 | - | |
| Toshiba S50D-A Laptop dying/ | 2022-03-28 16:43 | - | |
| Toshiba S70T-B005 Upgrading to SSD/ | 2022-03-28 16:43 | - | |
| Toshiba S75D-a7272/ | 2022-03-28 16:43 | - | |
| Toshiba S325 Keyboard Question/ | 2022-03-28 16:43 | - | |
| Toshiba S456 video capture/ | 2022-03-28 16:43 | - | |
| Toshiba S855-S5265/ | 2022-03-28 16:43 | - | |
| Toshiba S1800-814 memory upgrade problem/ | 2022-03-28 16:43 | - | |
| Toshiba S6845 for 799/ | 2022-03-28 16:43 | - | |
| Toshiba SATA controller driver/ | 2022-03-28 16:43 | - | |
| Toshiba SATELLITE R830-182 - Randomly Freezing/ | 2022-03-28 16:43 | - | |
| Toshiba SD firmware upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba SLi-1 and 169.2x drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Saetllite laptop P505d-S8935 no video at bootup!/ | 2022-03-28 16:43 | - | |
| Toshiba Sat. A75-2112- Cd-Rom disappeared from the my computer/ | 2022-03-28 16:43 | - | |
| Toshiba Sat. A110 soundcard problem/ | 2022-03-28 16:43 | - | |
| Toshiba Sat. A300 - Need to replace SATA cables... Where and how/ | 2022-03-28 16:43 | - | |
| Toshiba Sat Pro A100-830 - The verdict/ | 2022-03-28 16:43 | - | |
| Toshiba Sat U205 Tap Pad/ | 2022-03-28 16:43 | - | |
| Toshiba Satalite A200 Question. Please Help/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite 1955-S805 SLOW booting/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite 5105 S607 no power/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite A105's WEIRED screen !!!/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite A105 S4547/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite A105 won't boot past XP splash screen/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite A215-S5839 Wireless Adapter Help/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite A300D-14P - BIOS Dead/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite L500-1gf/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite P75-A7200 sound was much louder before I re-instaled Windows 8/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite Pro 420CDT/ | 2022-03-28 16:43 | - | |
| Toshiba Satelite Probs, Fan/ | 2022-03-28 16:43 | - | |
| ToshibaSateliteT135ProblemsWithKeyboard/ | 2022-03-28 16:43 | - | |
| Toshiba Satelitte C650-Battery problems/ | 2022-03-28 16:43 | - | |
| Toshiba Satelitte P100 434 - Dvd Playback And Gaming Slowdown glitches/ | 2022-03-28 16:43 | - | |
| Toshiba Satelitte P500-0TE screen quality poor. Brightness uniformity poor/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite® R25-S3513 14.1 Tablet PC Come with the Pen/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite® Tablet PC (R15-S829)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite & FarmTown -- How to improve sluggish performance/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 'Configurable' Models (Centrino 2) update/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite (A215) screen brightness problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite (M65-S9063) - Circuit City/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite, Cracked LCD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite, Windows 7/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite -- no good for Multimedia/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite - Hibernate Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite-L30/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite - Loose Screws/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite-M105 s3041/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite - black(blank) screen after bios update/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite - no built in mic/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 21OCT/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 1100-s101 HINGES/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 1110 dust problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 1130 Ps113e Z25 Trackpad Not Working/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 1200 wont charge up!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 1410-604 - wifi/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 1900/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 2400-s201- Where do the black and white wifi cables connect to/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 2410 Wireless card/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 2435-S255 looking for replacement video card/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 2450 DVD RW/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 2800-100 Recovery CD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 3000 - WLAN card not recognized Win2K/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 5005-S504 CD-burner problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 5005/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 5005 Lawsuit/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 5105 - Bad LCD Image/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite 5105-s501/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite; no video and no sound upon booting/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite = Badly made keyboard/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A-100 problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A-100 shuts down by itself/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A-135 S2776 Mouse freezes and I can't use it/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A-200/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A15 S157/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A25-S307 Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A30 On-board Wireless Card not found/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A35-S159 Recovery CD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A40 (model number- PSA40)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A40/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A45-S250/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A50 Fn key problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A60/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A65-S1362 Notebook - HELP!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A65 screen issues/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A70- NO STARTUP, POWER OR BOOT. Flashing Blinking Green Battery LED/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A70 Hard Drive Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A70 Laptop/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A70 Upgrade Posibilities (And Questions)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A75-S211 hibernation issues/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A75-S226 too good to be true !/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A75-s206 Drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A80-S178TD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100 (SK8 and SK9) build quality/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-011/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-168/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-259/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-283 anyone fast!!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-599 or Dell Inspiron 6400/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-906/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-JH2 Front USB ports dead/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-SK8; Motherboard Part # V000068150/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-TA9C/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100-va3/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100 A100-SK9_Opinions/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100 Any Good/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100 JH2- Dark spots on lower corners of LCD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100 Question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100 corrupted BIOS/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A100 series drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105-S2141 overheating/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105-S4014 worth the money/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105-S4045 drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105-S4064 battery/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105-S4064 with Kubuntu/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105-S4134 CD-R burning/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105-S4284 Drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105-S4547 is this real/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105 - Screen Brightness/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105 fan cleaning question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105 question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A105 touchpad not working properly/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A110 - major issues/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A110 series...BIOS update/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A130 Sound Card Questions/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-2276/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-S2246 or S2276/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-S2386 gets stuck at the boot screen/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-S4427/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-S4457 Charging problems/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-S4527 wont turn on/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-S4666 (How to install WinXP)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-S4666 cpu upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135-S4666 v. Vostro 1500/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A135 screen problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A200-085 - don't find it official!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A200-1TW(PSAE6E)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A200 - HELP PLEASE!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A200-TH7/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A200 - gaming Upgrades/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A200 start problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A205-4617 $1199.. Good Deal/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A205-S4577 screen flicker, w pic/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A205-S4607/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A205-S5804 - what is the real max memory/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A205-S5804/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A205-S5804 Vista-XP!!!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A205-S5855/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A205 Bluetooth/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A210-11P/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A210-16G/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A210-19K baterry, graphics - problem Help!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A210 - CPU temperature/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A210 heating problems/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215-S4757 Problem, Please Help/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215-S7416 Display Size/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215-S7437, ATI Radeon X1200 Question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215-S7437 BIOS UPDATE FAILED!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215 - Scrollbar on Mousepad/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215 - dead/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215 Hibernation Problems/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215S4697 Notebook/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A215 x64 Vista Display drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A300-1NN/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A300-16M the same build as other A300s/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A300D-11T/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A300 graphic card compatibility/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A305-S6837/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A305-S6837 CPU Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A305-S6861 Vista- XP/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A305-S6905 mainboard replacment/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A305-S6919 at Best Buy/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A305/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A305D-S6865 Win Xp Drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A305D-S6886 with ATI Hybrid CrossFire X2 technology/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A350D/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A500-17x or Satellite L555-10R/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A505-S6033 Performance and RAM limits/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A505-S6035 Insyde Bios 1.10/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A505 - S6965 -Installing 2nd HDD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A505 - S6965 automatic shutdown/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A505-S6997 at Walmart/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A505 Battery Question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A505 difference/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A660-18N problem!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A660 - How to enable nVidia Optimus/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A660 - Volume indication to display on screen/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A660 - remote control/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A665-S5170 Upgrades/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A665-S5179/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A665-S6067 Fluctuating Low Screen Resolution/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite A665D-S6082 - installing new ram/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Adapter Problems/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Atheros Wi-Fi not always booting/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Audio Skipping/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite BSOD - 4 Days Old/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Bios/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Blank Screen/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Button Trackpad design flaw/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C55-C-13R fan control/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C650-00E No power/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C655 Casing Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C655D-S5120 Question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C655 battery/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C660-11M cpu upgrade problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C660-S268. . . !/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C660 Battery/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite C855/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Dead/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Equium u400 u405 user opinions/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L35-S2151 Recovery (HELP!)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L35-S2171 reformatting help!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L100 crack on the monitor cover/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L100 overheating -s (laptop)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L300-ST2501/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L300 Cover/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L305-S5902 or A305-S6872/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L305 Power Issues/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L310/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L350-107 cpu upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L350 Issue/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L350 Just Turns Off/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L355-S7812 keeps restarting with AC Adapter plugged in/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L450D-10Z CPU upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L500-1tu randomly crashes or hibernates/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L500-157 DISPLAY/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L500 L500D - 15.6 & 16.0/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L505-10x/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L505-GS5035/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L505-GS5037/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L505-S5964 Charging Issue Power Cord Not Connecting/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L505D/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L505 S5983/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L600D Review and Disassembly/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L635-S3050RD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L650-11R/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L655-5115 Web Cam Issues/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L655D-S5152 Webcam issue/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L655 bios to improve/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L670/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L675-S7018- Is it a solid buy/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L675-S7018 Webcam Problem. Need, please/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L675-S7051 Sound Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L745D - False advertisement/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L755-S5258 w i5-2410M CPU has AES-NI Encryption Unlocked and Enabled/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L755d-10j/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L775-S7307/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite L850-13R problem with internal video card/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite LCD Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Laptop, A100-200,/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Laptop A100/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M35-S320 , need help!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M35-S320 - Toshiba Qosmio E15-AV/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M35-S456 vs. T42p/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M35X-S149/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M35X-S349 usb question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M35X Overheating problem (please help)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40 (PSM40C-SF300E) RAM Question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40, BLACK BAR probleM display faulty BIOS/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40-298 - battery/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40-JM3 - I need your opinion/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40-JM3/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40-JM3 mini-review/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40 PSM43A-01000H - Unable to locate display driver/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40XN00/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M40 memory/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M45-S331/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M 45-S2629/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M45-S2962/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M45 hard drives/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M45 won't start up/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M50-S418TD PROBLEM/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M50/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M50 M55 memory type/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M55-S141 Help plz/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M55-S1001 only sees 1gb of ram/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M55/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M55 M50 users/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M55 Review Posted/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M55 does not start/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M60-134 Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M60/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M60 Review Posted/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M60 Screen/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M60 problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M65-S9063/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M70-131 display contrast/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M 70- No USB Boot/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M70 - Rust in chassis/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M70-SR3 Looking for a replacement Lcd/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M70 - Whistling noise with notebook OFF if power supply connected/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M70 audio problems/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M100- question about fan/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M100 questions/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M100 quick question about remote/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M105 LCD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M105 S3031 on it's way to me!!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M115-S3094 LOW VOLUME/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M115-S3094 upgrade to XP PRO/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M115-S3094 wifi problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M115-S3104 adapter/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M200 touchpad/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite M645-S4048 review/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Memory/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Mobile Intel 965 Express Chipset driver please for Visa SP1/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Notebook Display Help Needed!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Notebook PC (L25-S1193)/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P-100/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P10-610/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P10-EE1, shared video memory/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P10 - Keeps turning off instantly/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P15-S470 notebook laptop overheating/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P15 Screen Image Trouble/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P15 severe problems/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P20-QR7/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P25-S609 DVD Burner Issues/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P25-S676 Video IN/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P25 P20 - Cpu Fan Not Running In Windows/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P25 Series Shut down and will not start up/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P30- 141 HELP/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P30-RG1 advice needed/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P 30/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P75-A7200 owners - Static Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P100 HELP!!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P105-9312 Memory Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P105-S921/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P105-S921 Review + TONS OF PICS!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P105-S6147 CD not playing/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P105-S9312 - Black screen with dotted lines/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P105-S9337 with 7200rpm/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P200-1K9/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P200-1ee Cpu Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P200-14H ICC Profile/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P200 CPU Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P205-S6237 Notebook - NEED XP drivers for DVD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P205/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P300 05y/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P300 Temperature Concerns/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P305D - S8829 S-Video not working/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P500-026/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P500 Information/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P505D-S8935 Laptop/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P505D Upgrade options/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P750-755/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P750-BT4G22 battery a bit loose/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P750-ST6GX1/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P750 problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P775-11E touch sensor sound off button turns keyboard back light off instead of the sound!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite P870-31K - Bad processor airflow/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Parts/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Price/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro - New Motherboard/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro 100 - 1.83 GHz/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro450 L/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro 4200 upgrades/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro 4600/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro 6100 Cooling problems/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro A10 - Replacement Screen/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro A10/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro A120-187/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro A120-216 questions/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro A300-1C2... any good/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro C850 (1LZ) i5 Ivy Bridge CPU Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro L100 DXDIAG Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro L300D-20R/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro M70 Rating/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro P300-145/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro P300 16V - system config read write error press F1 to continue/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Pro U200-10D Your opinions/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite QL60/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite R10 r15 Tablet PC/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite R630 Bloatware/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite R830-10C - Anyone got one/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite R830 and processes eating my system/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite R845/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite RAM memory upgrade 2GB or 4GB/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Radeon 4650 mobility/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Radius 12 - Owners Thread/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Radius SSD/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Radius voltage leaking - tingle sensation on AC/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Recovery Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite S50-B series/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite S70-BBT2N23/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite S1620CDS/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Satellite P105-S9312 - Benchmarks! -/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Screen Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Screen Question/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Sound Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Stopped Booting/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite T115D-S1125 Mini review/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite T1910/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U205 series memory install/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U305 w Vista - Irritating Problem with window minimizing when I click/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U405-S2856 PSU44U notebook and windows xp/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U405-ST550W/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U405 Crashed/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U500-1GK price/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U500 hard disk size/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U505-S2980-T/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite U845T Ultrabooks/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Upgrade Q/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Wallpaper/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite Will Not Post/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite With Santa Rosa Hardware/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite X200-AA3 Bios/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite X200- SLI gaming laptop/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite X200 X205 brightness problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite X205-S9349 Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite X205-S9349 Wont Boot/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite X205-SLI1/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite X205 Sli4 - Sli problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite a30 wallpapers/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite a65-s126 CPU change/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite a135 problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite a205-s5859 64 bit drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite a305 Bluetooth upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite a665-s6067 review/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite advice/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite clean install guide like Stallen's Lenovo guide/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite cpu fan/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite help/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite laptop F keys/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite laptop not getting past this error message... please help!/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite m50-YK5/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite m100/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite m105 s3004 - problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite m110 Express Media Recovery/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite not going to desktop/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite pro 6100 14.1 help/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite slow with autocad and sketchup/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite supervisor password recovery/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite u920t - Recovery Media Download/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite vs other versions/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite w WVHP/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite won't shut down/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite won't turn on/ | 2022-03-28 16:43 | - | |
| Toshiba Satellite x205-s9349 Slow/ | 2022-03-28 16:43 | - | |
| Toshiba Satillite system recovery problem/ | 2022-03-28 16:43 | - | |
| Toshiba Satisfaction Poll/ | 2022-03-28 16:43 | - | |
| Toshiba Sattelite--RAM HDD may be jarred loose. Help, please!/ | 2022-03-28 16:43 | - | |
| Toshiba Sattelite C55A -1 RG Bad Performance in Counter-Strike 1.6 and other OpenGL apps/ | 2022-03-28 16:43 | - | |
| Toshiba Sattelite P100/ | 2022-03-28 16:43 | - | |
| Toshiba Sattelite P305 S8832/ | 2022-03-28 16:43 | - | |
| Toshiba Sattelite T1900c/ | 2022-03-28 16:43 | - | |
| Toshiba Sattelite pro c660 camera problem/ | 2022-03-28 16:43 | - | |
| Toshiba Screen Font/ | 2022-03-28 16:43 | - | |
| Toshiba Service Center Rant Thread (and kinda need help thread)/ | 2022-03-28 16:43 | - | |
| Toshiba Service WORST in all Aspects/ | 2022-03-28 16:43 | - | |
| Toshiba Shipping Delays and Problems/ | 2022-03-28 16:43 | - | |
| Toshiba Sleep and Charge/ | 2022-03-28 16:43 | - | |
| Toshiba Sli3 Hangs on reboot/ | 2022-03-28 16:43 | - | |
| Toshiba Software Installer for Windows 7/ | 2022-03-28 16:43 | - | |
| Toshiba Software Upgrades Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Software Upgrades application...ahh, what/ | 2022-03-28 16:43 | - | |
| Toshiba Sonic DVD or NERO on A70/ | 2022-03-28 16:43 | - | |
| Toshiba Spark for my daughter/ | 2022-03-28 16:43 | - | |
| Toshiba Struggling to Recapture Notebook Market/ | 2022-03-28 16:43 | - | |
| Toshiba Sub-Forums/ | 2022-03-28 16:43 | - | |
| Toshiba Support Rant/ | 2022-03-28 16:43 | - | |
| Toshiba System Volume question/ | 2022-03-28 16:43 | - | |
| Toshiba T100 series/ | 2022-03-28 16:43 | - | |
| Toshiba T115D - AMD HD3200 11.6 coming soon (12 17)/ | 2022-03-28 16:43 | - | |
| Toshiba T115D - AMD HD3200 11.6 thread/ | 2022-03-28 16:43 | - | |
| Toshiba T130-15H/ | 2022-03-28 16:43 | - | |
| Toshiba T230 annoying fan!/ | 2022-03-28 16:43 | - | |
| Toshiba T235-1350 user reviews/ | 2022-03-28 16:43 | - | |
| Toshiba T235D and its Battery Life/ | 2022-03-28 16:43 | - | |
| Toshiba T235 Power Drain Issue/ | 2022-03-28 16:43 | - | |
| Toshiba T355 Runs hot or bad fan/ | 2022-03-28 16:43 | - | |
| Toshiba T1200 red flashing light, sometimes flashes red and green/ | 2022-03-28 16:43 | - | |
| Toshiba T5500 shuts down when I plug in wireless net work card (only on battery power)/ | 2022-03-28 16:43 | - | |
| Toshiba TA7 Model Inforamtion!!!/ | 2022-03-28 16:43 | - | |
| Toshiba Te2100 Help/ | 2022-03-28 16:43 | - | |
| Toshiba Teca A8/ | 2022-03-28 16:43 | - | |
| Toshiba Tech Support (...or lack of...)/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra 780CDM Charger/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra 8000 docking station pinout connector/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A1 HELP!!!!!!!!!!!!!!!!/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A2 going veeery slowly/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A4-227 question/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A4 - Pictures & First Impression/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A4- fan noise/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A4/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A5/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A6-SP3052 upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A8 -S8514 - LCD Problem/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A8/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A8 9-cell or 12-cell battery/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A9-14G any reviews/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A9 - user experience/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A11-S3540/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A11 - i3 i5 Core - 15.6/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra A series/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra Flickering Screen/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M2 - worth it/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M2 Died!/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M2 My Travel thoughts/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M2 vs Thunderbox Phantom Radius/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M3... Any good/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M3/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M4/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M5-S4333 Fingerprint reader problems/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M7 (tablet)- resolution issues/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M9 Bios Password/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra M9 user experience requested/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra R940 unable to view on external display/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra S1/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra S1 USB drivers/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra S3 , any reviews yet/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra Te2100/ | 2022-03-28 16:43 | - | |
| Toshiba Tecra not booting properly/ | 2022-03-28 16:43 | - | |
| Toshiba Trade-in Deal/ | 2022-03-28 16:43 | - | |
| Toshiba TruBrite for real/ | 2022-03-28 16:43 | - | |
| Toshiba U205-5057 Screen goes blank while starting applications/ | 2022-03-28 16:43 | - | |
| Toshiba U205 Lock Up Problem/ | 2022-03-28 16:43 | - | |
| Toshiba U205 Questions-/ | 2022-03-28 16:43 | - | |
| Toshiba U205 from RadioShack/ | 2022-03-28 16:43 | - | |
| Toshiba U205 mini review/ | 2022-03-28 16:43 | - | |
| Toshiba U300-153 - replacing Vista home premium by XP professional/ | 2022-03-28 16:43 | - | |
| Toshiba U300-FA3 Drivers please/ | 2022-03-28 16:43 | - | |
| Toshiba U300/ | 2022-03-28 16:43 | - | |
| Toshiba U300 does not power on after trying to install WinXP/ | 2022-03-28 16:43 | - | |
| Toshiba U300 model/ | 2022-03-28 16:43 | - | |
| Toshiba U300 partition after 1st use/ | 2022-03-28 16:43 | - | |
| Toshiba U305 - Lack of Reviews/ | 2022-03-28 16:43 | - | |
| Toshiba U305-S2808 Bios help!/ | 2022-03-28 16:43 | - | |
| Toshiba U305-S7467 CPU Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba U305 DVD RW Drive missing/ | 2022-03-28 16:43 | - | |
| Toshiba U305 HDD Protection/ | 2022-03-28 16:43 | - | |
| Toshiba U400-S1301/ | 2022-03-28 16:43 | - | |
| Toshiba U500 13 Notebook with ATI 4570/ | 2022-03-28 16:43 | - | |
| Toshiba U945 S4390 disassembly/ | 2022-03-28 16:43 | - | |
| Toshiba USA forums/ | 2022-03-28 16:43 | - | |
| Toshiba USB ports HELP!!/ | 2022-03-28 16:43 | - | |
| Toshiba Unveils New Dothan-based laptop/ | 2022-03-28 16:43 | - | |
| Toshiba Warranty/ | 2022-03-28 16:43 | - | |
| Toshiba Warranty Repair - experiences/ | 2022-03-28 16:43 | - | |
| Toshiba Warranty Service Experiences Please/ | 2022-03-28 16:43 | - | |
| Toshiba Warranty Woes - Warning to Would-be Purchasers/ | 2022-03-28 16:43 | - | |
| Toshiba Wireless/ | 2022-03-28 16:43 | - | |
| Toshiba With Dualpointer/ | 2022-03-28 16:43 | - | |
| Toshiba X75/ | 2022-03-28 16:43 | - | |
| Toshiba X200 - World in Conflict (Demo) Benchmarks/ | 2022-03-28 16:43 | - | |
| Toshiba X200/ | 2022-03-28 16:43 | - | |
| Toshiba X200 Driver Problem/ | 2022-03-28 16:43 | - | |
| Toshiba X200 X205 Temperature/ | 2022-03-28 16:43 | - | |
| Toshiba X200 X205 second HDD/ | 2022-03-28 16:43 | - | |
| Toshiba X200 can I use a T9400 CPU/ | 2022-03-28 16:43 | - | |
| Toshiba X200 is it good for me/ | 2022-03-28 16:43 | - | |
| Toshiba X200 not turning on/ | 2022-03-28 16:43 | - | |
| Toshiba X200 strange overheating problems/ | 2022-03-28 16:43 | - | |
| Toshiba X205 & XP Problems/ | 2022-03-28 16:43 | - | |
| Toshiba X205 + X9000/ | 2022-03-28 16:43 | - | |
| Toshiba X205, Bioshock benchmarks/ | 2022-03-28 16:43 | - | |
| Toshiba X205-1440 x 900 resolution on a 17 screen Wtf are they thinking/ | 2022-03-28 16:43 | - | |
| Toshiba X205-9349... need help with upgrades/ | 2022-03-28 16:43 | - | |
| Toshiba X205-9810 Display driver/ | 2022-03-28 16:43 | - | |
| Toshiba X205-S7483 and XP, how to do it/ | 2022-03-28 16:43 | - | |
| Toshiba X205-S9349 Express Card Port/ | 2022-03-28 16:43 | - | |
| Toshiba X205-S9349 and AoC - What Nvidia driver/ | 2022-03-28 16:43 | - | |
| Toshiba X205-S9349 hard drives/ | 2022-03-28 16:43 | - | |
| Toshiba X205-S9349 price/ | 2022-03-28 16:43 | - | |
| Toshiba X205-S9800 ..CPU Upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba X205-SLI1 DVD not burning Properly/ | 2022-03-28 16:43 | - | |
| Toshiba X205-SLI1 XP Install help - sound issues/ | 2022-03-28 16:43 | - | |
| Toshiba X205-SLi3 Video Card upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba X205-SLi4 dead...for the THIRD TIME/ | 2022-03-28 16:43 | - | |
| Toshiba X205-SLi5 and X205-SLi6/ | 2022-03-28 16:43 | - | |
| Toshiba X205 Additional Warranty/ | 2022-03-28 16:43 | - | |
| Toshiba X205 Bad Performance Issues/ | 2022-03-28 16:43 | - | |
| Toshiba X205 CPU overclock !/ | 2022-03-28 16:43 | - | |
| Toshiba X205 HD DVD problem/ | 2022-03-28 16:43 | - | |
| Toshiba X205 HDMI HD Audio output problem, only 2 channel even Playing a HD-DVD/ | 2022-03-28 16:43 | - | |
| Toshiba X205 InfraRed drivers for XP/ | 2022-03-28 16:43 | - | |
| Toshiba X205 Overclocking Itself/ | 2022-03-28 16:43 | - | |
| Toshiba X205 Raid/ | 2022-03-28 16:43 | - | |
| Toshiba X205 SLI2 vs Gateway P-171S FX/ | 2022-03-28 16:43 | - | |
| Toshiba X205 SLI 8600m GT vs Toshiba X205 8700m GT/ | 2022-03-28 16:43 | - | |
| Toshiba X205 SLi1 video driver help/ | 2022-03-28 16:43 | - | |
| Toshiba X205 Screen Failure/ | 2022-03-28 16:43 | - | |
| Toshiba X205 Usability and Power-Brick experiences/ | 2022-03-28 16:43 | - | |
| Toshiba X205 Video Control Panel Problems/ | 2022-03-28 16:43 | - | |
| Toshiba X205 Vista SP1 just appeared in my WU!/ | 2022-03-28 16:43 | - | |
| Toshiba X205 X200 (UK) Motherboard and Chipset/ | 2022-03-28 16:43 | - | |
| Toshiba X205 X200 BIOS/ | 2022-03-28 16:43 | - | |
| Toshiba X205 board and GPU/ | 2022-03-28 16:43 | - | |
| Toshiba X205 fans/ | 2022-03-28 16:43 | - | |
| Toshiba X205 hard drive type... IDE SATA/ | 2022-03-28 16:43 | - | |
| Toshiba X205 is the s9359 worth 500 more than the s9349/ | 2022-03-28 16:43 | - | |
| Toshiba X205 on the WAY!!!/ | 2022-03-28 16:43 | - | |
| Toshiba X205 with 8800M/ | 2022-03-28 16:43 | - | |
| Toshiba X300-(123)/ | 2022-03-28 16:43 | - | |
| Toshiba X300-122 absurd overheating problem/ | 2022-03-28 16:43 | - | |
| Toshiba X300 305 keyboard lights/ | 2022-03-28 16:43 | - | |
| Toshiba X305-706 major directx 10 issues!/ | 2022-03-28 16:43 | - | |
| Toshiba X305-Q701 Disassembly...enjoy/ | 2022-03-28 16:43 | - | |
| Toshiba X305-Q701 media button not starting up program/ | 2022-03-28 16:43 | - | |
| Toshiba X305 Awesome!/ | 2022-03-28 16:43 | - | |
| Toshiba X305 Keyboard and mouse trouble/ | 2022-03-28 16:43 | - | |
| Toshiba X500-S1801 Any good/ | 2022-03-28 16:43 | - | |
| Toshiba X500 - fixing shutdowns overheating/ | 2022-03-28 16:43 | - | |
| Toshiba X505-Q879 & X505-Q880/ | 2022-03-28 16:43 | - | |
| Toshiba Xli1 Problems/ | 2022-03-28 16:43 | - | |
| Toshiba Z30t (touch) thread/ | 2022-03-28 16:43 | - | |
| Toshiba Z930-11Z Issue with turning on/ | 2022-03-28 16:43 | - | |
| Toshiba a2 pta2oe-07701qen/ | 2022-03-28 16:42 | - | |
| Toshiba a 10 high cpu load/ | 2022-03-28 16:42 | - | |
| Toshiba a70-rw1/ | 2022-03-28 16:43 | - | |
| Toshiba a100 - power management problem/ | 2022-03-28 16:42 | - | |
| Toshiba a100 Noise/ | 2022-03-28 16:42 | - | |
| Toshiba a110 replacement/ | 2022-03-28 16:42 | - | |
| Toshiba a135-s4427 cpu upgrade/ | 2022-03-28 16:42 | - | |
| Toshiba a135-s4427 power problem/ | 2022-03-28 16:42 | - | |
| Toshiba a135 2nd try to post/ | 2022-03-28 16:42 | - | |
| Toshiba a135 4447 recovery disk missing/ | 2022-03-28 16:42 | - | |
| Toshiba a135 and system's freeze-up/ | 2022-03-28 16:42 | - | |
| Toshiba a135 drivers/ | 2022-03-28 16:42 | - | |
| Toshiba a200 Bad Bios/ | 2022-03-28 16:43 | - | |
| Toshiba a205-s5800 Upgrades/ | 2022-03-28 16:43 | - | |
| Toshiba a215 Power Issue - DC cable soldered to board/ | 2022-03-28 16:43 | - | |
| Toshiba a215 bios location/ | 2022-03-28 16:43 | - | |
| Toshiba and Projector Problem/ | 2022-03-28 16:43 | - | |
| Toshiba and Windows 7 Beta/ | 2022-03-28 16:43 | - | |
| Toshiba announces core i5 i3 laptops at CES 2010/ | 2022-03-28 16:43 | - | |
| Toshiba anti-virus help!/ | 2022-03-28 16:43 | - | |
| Toshiba assembling quality/ | 2022-03-28 16:43 | - | |
| Toshiba battery/ | 2022-03-28 16:43 | - | |
| Toshiba battery lifetime question/ | 2022-03-28 16:43 | - | |
| Toshiba battery problem/ | 2022-03-28 16:43 | - | |
| Toshiba bilingual laptops How change language/ | 2022-03-28 16:43 | - | |
| Toshiba bios problem/ | 2022-03-28 16:43 | - | |
| Toshiba build quality and other questions/ | 2022-03-28 16:43 | - | |
| Toshiba burning software questions/ | 2022-03-28 16:43 | - | |
| Toshiba c660-11k-/ | 2022-03-28 16:43 | - | |
| Toshiba c660/ | 2022-03-28 16:43 | - | |
| Toshiba cant take care of their own bills/ | 2022-03-28 16:43 | - | |
| Toshiba charging port/ | 2022-03-28 16:43 | - | |
| Toshiba complaints thread/ | 2022-03-28 16:43 | - | |
| Toshiba connection problem -(/ | 2022-03-28 16:43 | - | |
| Toshiba deal on BF, L35-S2151, 512MB memory question/ | 2022-03-28 16:43 | - | |
| Toshiba deletes a month early notebook promotion off it's website before end of promotion Free MS Office 2003/ | 2022-03-28 16:43 | - | |
| Toshibadirect.com, any problems/ | 2022-03-28 16:43 | - | |
| Toshiba display driver/ | 2022-03-28 16:43 | - | |
| Toshiba display garbled/ | 2022-03-28 16:43 | - | |
| Toshiba download section for satellite A200 systems - latest bios update/ | 2022-03-28 16:43 | - | |
| Toshiba driver download support side/ | 2022-03-28 16:42 | - | |
| Toshiba dual drive/ | 2022-03-28 16:43 | - | |
| Toshiba excelent Service/ | 2022-03-28 16:43 | - | |
| Toshiba express media player/ | 2022-03-28 16:43 | - | |
| Toshiba f55-Q504 or the x305-705/ | 2022-03-28 16:43 | - | |
| Toshiba face recognition uninstall/ | 2022-03-28 16:43 | - | |
| Toshiba fan control/ | 2022-03-28 16:43 | - | |
| Toshiba flashcards/ | 2022-03-28 16:43 | - | |
| Toshiba for high performance not share memory/ | 2022-03-28 16:43 | - | |
| Toshiba gaming/ | 2022-03-28 16:43 | - | |
| Toshiba garanty is internationla default/ | 2022-03-28 16:43 | - | |
| Toshiba guidance!/ | 2022-03-28 16:43 | - | |
| Toshiba introduces Dynabook SS SX/ | 2022-03-28 16:43 | - | |
| Toshiba is Weird/ | 2022-03-28 16:43 | - | |
| Toshiba just won my soul/ | 2022-03-28 16:43 | - | |
| Toshiba keyboard backlight not working/ | 2022-03-28 16:43 | - | |
| Toshiba keyboard cover skin/ | 2022-03-28 16:43 | - | |
| Toshiba keyboard dead/ | 2022-03-28 16:43 | - | |
| Toshiba keyboard question a305/ | 2022-03-28 16:43 | - | |
| Toshiba kira - screen/ | 2022-03-28 16:43 | - | |
| Toshiba l25-s1193 - Middle click (using left right key)/ | 2022-03-28 16:43 | - | |
| Toshiba laptop AC Pin breaking/ | 2022-03-28 16:43 | - | |
| Toshiba laptop comparable to G1 IFL90/ | 2022-03-28 16:43 | - | |
| Toshiba laptop display problems/ | 2022-03-28 16:43 | - | |
| Toshiba laptop doesn't sleep hibernate/ | 2022-03-28 16:43 | - | |
| Toshiba laptop hard drive bracket/ | 2022-03-28 16:43 | - | |
| Toshiba laptop help needed/ | 2022-03-28 16:43 | - | |
| Toshiba laptop keeps rebooting/ | 2022-03-28 16:43 | - | |
| Toshiba laptop of satellite P205-S6267- Function Key for TouchPad and Turn Off not working/ | 2022-03-28 16:43 | - | |
| Toshiba laptop problem, any suggestions/ | 2022-03-28 16:43 | - | |
| Toshiba laptop problem - HELP/ | 2022-03-28 16:43 | - | |
| Toshiba laptops and TPM/ | 2022-03-28 16:43 | - | |
| Toshiba laptop suddenly disappeared from Costco website/ | 2022-03-28 16:43 | - | |
| Toshiba laptops with USB 3/ | 2022-03-28 16:43 | - | |
| Toshiba laptops w matte screens/ | 2022-03-28 16:43 | - | |
| Toshiba laptop that will not turn on/ | 2022-03-28 16:43 | - | |
| Toshiba laptop with 2 hard drives/ | 2022-03-28 16:43 | - | |
| Toshiba laptop w xp pro/ | 2022-03-28 16:43 | - | |
| Toshiba launches premium corporate laptop line/ | 2022-03-28 16:43 | - | |
| Toshiba lost their email/ | 2022-03-28 16:43 | - | |
| Toshiba m30-001/ | 2022-03-28 16:43 | - | |
| Toshiba m30-001 review/ | 2022-03-28 16:43 | - | |
| Toshiba m30 - Cant install display drivers/ | 2022-03-28 16:43 | - | |
| Toshiba m40-sf3 pc card/ | 2022-03-28 16:43 | - | |
| Toshiba m55-s3262, does this exist/ | 2022-03-28 16:43 | - | |
| Toshiba m70-147 performance/ | 2022-03-28 16:43 | - | |
| Toshiba m100, 14 with x1600. Does it exist/ | 2022-03-28 16:43 | - | |
| Toshiba m405 Tablet PC/ | 2022-03-28 16:43 | - | |
| Toshiba media center remote/ | 2022-03-28 16:43 | - | |
| Toshiba nightmare/ | 2022-03-28 16:43 | - | |
| Toshiba notebook..BIOS updates/ | 2022-03-28 16:43 | - | |
| Toshiba notebook discounts and coupon codes/ | 2022-03-28 16:43 | - | |
| Toshiba notebooks are great oc'ers/ | 2022-03-28 16:43 | - | |
| Toshiba notebooks with core 2 duo/ | 2022-03-28 16:43 | - | |
| Toshiba not recognizing AC adapter when turned on/ | 2022-03-28 16:43 | - | |
| Toshiba online product information pop up/ | 2022-03-28 16:43 | - | |
| Toshiba on sale, good deal or not/ | 2022-03-28 16:43 | - | |
| Toshiba p1-221 usb trouble/ | 2022-03-28 16:43 | - | |
| Toshiba p30 ac adaptor battery problem/ | 2022-03-28 16:43 | - | |
| Toshiba p100 PROBLEMS/ | 2022-03-28 16:43 | - | |
| Toshiba p200d speakers/ | 2022-03-28 16:43 | - | |
| Toshiba p300 - HD-DVD/ | 2022-03-28 16:43 | - | |
| Toshiba parts/ | 2022-03-28 16:43 | - | |
| Toshiba portege r830 vs Toshiba Satellite r830/ | 2022-03-28 16:43 | - | |
| Toshiba power saver unresolved issue -(/ | 2022-03-28 16:43 | - | |
| Toshiba prices VS pcmall prices/ | 2022-03-28 16:43 | - | |
| Toshiba processor upgrades From duo to merom/ | 2022-03-28 16:43 | - | |
| Toshiba qosmio i5 vs i7 (gaming)/ | 2022-03-28 16:43 | - | |
| Toshiba quosmio f750 LCD screen replacement/ | 2022-03-28 16:43 | - | |
| Toshiba r200 and Solid state drive (SSD) ... and any other upgrades/ | 2022-03-28 16:43 | - | |
| Toshiba r200 and Vista/ | 2022-03-28 16:43 | - | |
| Toshiba r500 portege/ | 2022-03-28 16:43 | - | |
| Toshiba r835-p56x - New Bios 2.80/ | 2022-03-28 16:43 | - | |
| Toshiba rebates/ | 2022-03-28 16:43 | - | |
| Toshiba recalls 340K Dynabook batteries/ | 2022-03-28 16:43 | - | |
| Toshiba recovery disk - What all does it erase/ | 2022-03-28 16:43 | - | |
| Toshiba reliability/ | 2022-03-28 16:43 | - | |
| Toshiba repair customer service fail/ | 2022-03-28 16:43 | - | |
| Toshiba rep states about A215 issues/ | 2022-03-28 16:43 | - | |
| Toshibas are noisy/ | 2022-03-28 16:43 | - | |
| Toshiba satalite M50 S00/ | 2022-03-28 16:43 | - | |
| Toshiba satellite 205cds help!/ | 2022-03-28 16:43 | - | |
| Toshiba satellite 1005-S157 wireless card/ | 2022-03-28 16:43 | - | |
| Toshiba satellite 1405 - no power up/ | 2022-03-28 16:43 | - | |
| Toshiba satellite A60-need to re-image/ | 2022-03-28 16:43 | - | |
| Toshiba satellite A80/ | 2022-03-28 16:43 | - | |
| Toshiba satellite A105-S4074 Fan on Program/ | 2022-03-28 16:43 | - | |
| Toshiba satellite A305-S6916 wifi connection problem/ | 2022-03-28 16:43 | - | |
| Toshiba satellite A350 bios recovery (Phoenix)/ | 2022-03-28 16:43 | - | |
| Toshiba satellite A660-11m/ | 2022-03-28 16:43 | - | |
| Toshiba satellite A660 dvd clicking noise/ | 2022-03-28 16:43 | - | |
| Toshiba satellite L35 - S2194/ | 2022-03-28 16:43 | - | |
| Toshiba satellite M70-168 can't start/ | 2022-03-28 16:43 | - | |
| Toshiba satellite R25-s3503/ | 2022-03-28 16:43 | - | |
| Toshiba satellite S50-b-127 any User Experience !/ | 2022-03-28 16:43 | - | |
| Toshiba satellite U305-S5087/ | 2022-03-28 16:43 | - | |
| Toshiba satellite USB ports not working/ | 2022-03-28 16:43 | - | |
| Toshiba satellite a105-touchpad/ | 2022-03-28 16:43 | - | |
| Toshiba satellite a305 problem/ | 2022-03-28 16:43 | - | |
| Toshiba satellite a665/ | 2022-03-28 16:43 | - | |
| Toshiba satellite c655-s5121 laptop 15.6 250gb hd/ | 2022-03-28 16:43 | - | |
| Toshiba satellite c850 fails to boot & black screen/ | 2022-03-28 16:43 | - | |
| Toshiba satellite disassebly/ | 2022-03-28 16:43 | - | |
| Toshiba satellite froze -/ | 2022-03-28 16:43 | - | |
| Toshiba satellite l500d amd series/ | 2022-03-28 16:43 | - | |
| Toshiba satellite l955-s5370 restart rather than resume in sleep mode/ | 2022-03-28 16:43 | - | |
| Toshiba satellite p200 series internet connection/ | 2022-03-28 16:43 | - | |
| Toshiba satellite pro 415cs 810/ | 2022-03-28 16:43 | - | |
| Toshiba satellite pro A60 problem/ | 2022-03-28 16:43 | - | |
| Toshiba satellite pro a120 fresh xp pro sp2 install !!!NO SOUND!!!!/ | 2022-03-28 16:43 | - | |
| Toshiba satellite touchpad problems/ | 2022-03-28 16:43 | - | |
| Toshiba satellite u 500-1f4/ | 2022-03-28 16:43 | - | |
| Toshiba satellite x205-s9349 processor/ | 2022-03-28 16:43 | - | |
| Toshiba screen black-out or no back light/ | 2022-03-28 16:43 | - | |
| Toshiba screen problem/ | 2022-03-28 16:43 | - | |
| Toshiba screen resolution question!/ | 2022-03-28 16:43 | - | |
| Toshiba sells its PC unit to Sharp in $36 million deal/ | 2022-03-28 16:43 | - | |
| Toshiba shovelware remover, like the Dell De-Crapifier/ | 2022-03-28 16:43 | - | |
| Toshiba software help -)/ | 2022-03-28 16:43 | - | |
| Toshiba sound too low/ | 2022-03-28 16:43 | - | |
| Toshiba staellite A200 chargers/ | 2022-03-28 16:43 | - | |
| Toshiba start up/ | 2022-03-28 16:43 | - | |
| Toshiba support etc/ | 2022-03-28 16:43 | - | |
| Toshibas with backlit keyboards/ | 2022-03-28 16:43 | - | |
| Toshiba systemboard/ | 2022-03-28 16:43 | - | |
| Toshibat Satellite A100 TA9 good for GAMING/ | 2022-03-28 16:43 | - | |
| Toshiba table review concerns/ | 2022-03-28 16:43 | - | |
| Toshiba tech support source/ | 2022-03-28 16:43 | - | |
| Toshiba tecra 8200 lcd help!!/ | 2022-03-28 16:43 | - | |
| Toshiba tecra M1 cpu upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba tecra S1..problem!/ | 2022-03-28 16:43 | - | |
| Toshiba touchpad doesnt work/ | 2022-03-28 16:43 | - | |
| Toshiba u205-s5002 issue or no/ | 2022-03-28 16:43 | - | |
| Toshiba update software/ | 2022-03-28 16:43 | - | |
| Toshiba vista upgrade/ | 2022-03-28 16:43 | - | |
| Toshiba w 128MB Geforce Go 7600/ | 2022-03-28 16:43 | - | |
| Toshiba wallpapers/ | 2022-03-28 16:43 | - | |
| Toshiba warranty question/ | 2022-03-28 16:43 | - | |
| Toshiba warranty questions/ | 2022-03-28 16:43 | - | |
| Toshiba warranty vs FS PSP plan/ | 2022-03-28 16:43 | - | |
| Toshiba was the one for me/ | 2022-03-28 16:43 | - | |
| Toshiba weird green and purple bar glitch!/ | 2022-03-28 16:43 | - | |
| Toshiba white blacklist wifi cards in their BIOS too/ | 2022-03-28 16:43 | - | |
| Toshiba won't boot/ | 2022-03-28 16:43 | - | |
| Toshiba x200-15k PSPB9E Hard Disk Interface/ | 2022-03-28 16:43 | - | |
| Toshiba x200-15k overheat/ | 2022-03-28 16:43 | - | |
| Toshiba x200-25i UK version and Intel Turbo memory/ | 2022-03-28 16:43 | - | |
| Toshiba x200 Function keys/ | 2022-03-28 16:43 | - | |
| Toshiba x200 function keys help/ | 2022-03-28 16:43 | - | |
| Toshiba x205-9359 Optical Drive swap/ | 2022-03-28 16:43 | - | |
| Toshiba x205-9359 with 8700GT Nvidia/ | 2022-03-28 16:43 | - | |
| Toshiba x205-s9349 Won't Boot/ | 2022-03-28 16:43 | - | |
| Toshiba x205-s9810/ | 2022-03-28 16:43 | - | |
| Toshiba x205-sli1 clean install questions/ | 2022-03-28 16:43 | - | |
| Toshiba x205 Backpack/ | 2022-03-28 16:43 | - | |
| Toshiba x205 HDMI/ | 2022-03-28 16:43 | - | |
| Toshiba x205 Question/ | 2022-03-28 16:43 | - | |
| Toshiba x205 Review/ | 2022-03-28 16:43 | - | |
| Toshiba x205 SLi3/ | 2022-03-28 16:43 | - | |
| Toshiba x205 and HDTV (HELP!!)/ | 2022-03-28 16:43 | - | |
| Toshiba x205 s-7483/ | 2022-03-28 16:43 | - | |
| Toshiba x205 with Windows XP/ | 2022-03-28 16:43 | - | |
| Toshiba x300-11s Questions/ | 2022-03-28 16:43 | - | |
| Toshiba x300-11s help/ | 2022-03-28 16:43 | - | |
| Toshiba x300-158 + a New gamer has arrived !/ | 2022-03-28 16:43 | - | |
| Toshiba x305 9800M GTX SLI/ | 2022-03-28 16:43 | - | |
| Toshiba x775 GTX 560 M not detected by games/ | 2022-03-28 16:43 | - | |
| Toshiba xli webcam Problem/ | 2022-03-28 16:43 | - | |
| Toshiba z830 - Power Supply/ | 2022-03-28 16:43 | - | |
| Toshiba z930 Flash issue/ | 2022-03-28 16:43 | - | |
| Toshibe X205-S9800 sound issue...your input would be HELPFULL/ | 2022-03-28 16:43 | - | |
| Toshie L500 02C vs L650 07C vs A660 07P/ | 2022-03-28 16:43 | - | |
| Tosiba Satalite A35 Recovery Disc/ | 2022-03-28 16:43 | - | |
| Tosihba Satellite M40 45/ | 2022-03-28 16:43 | - | |
| Total height - U305/ | 2022-03-28 16:43 | - | |
| To the owners of Toshiba Satellite A300/ | 2022-03-28 16:42 | - | |
| TouchPad Problem/ | 2022-03-28 16:43 | - | |
| Touch pad/ | 2022-03-28 16:43 | - | |
| Touchpad AND USB mouse/ | 2022-03-28 16:43 | - | |
| Touchpad Disappeared!! Driver help needed as well/ | 2022-03-28 16:43 | - | |
| Touchpad corner utility/ | 2022-03-28 16:43 | - | |
| Touchpad inactive!!!/ | 2022-03-28 16:43 | - | |
| Touchpad not working/ | 2022-03-28 16:43 | - | |
| Touchpad not working in Qosmio X505/ | 2022-03-28 16:43 | - | |
| Touch pad on my Toshiba laptop has stopped working/ | 2022-03-28 16:43 | - | |
| Touchpad on toshibas/ | 2022-03-28 16:43 | - | |
| Touchpad problem - Can't scroll/ | 2022-03-28 16:43 | - | |
| Touchpad won't work with external monitor on Tosh Sat M115-S3094/ | 2022-03-28 16:43 | - | |
| Touch screen owners/ | 2022-03-28 16:43 | - | |
| Trade in trade up program/ | 2022-03-28 16:43 | - | |
| Travel Charger for A500 Available/ | 2022-03-28 16:43 | - | |
| Trojan Virus Going Around/ | 2022-03-28 16:43 | - | |
| Trouble installing sp3 on winxp home/ | 2022-03-28 16:43 | - | |
| Troubleshooting Toshiba Satellite M35X-S149/ | 2022-03-28 16:43 | - | |
| Trouble shooting help P55/ | 2022-03-28 16:43 | - | |
| Trouble with battery on new Satellite!/ | 2022-03-28 16:43 | - | |
| Trouble with keyboard Satellite A105/ | 2022-03-28 16:43 | - | |
| TruBrite/ | 2022-03-28 16:43 | - | |
| TruBrite Screen for Qosmio/ | 2022-03-28 16:43 | - | |
| TruBrite technology disadvantage/ | 2022-03-28 16:43 | - | |
| Trying to downgrade Satellite A205-S5803 to XP -- which drivers/ | 2022-03-28 16:43 | - | |
| Trying to get 4k movies to enjoy on the P55T/ | 2022-03-28 16:43 | - | |
| Trying to get Wireless to turn on/ | 2022-03-28 16:43 | - | |
| Trying to get headset w mic to work on my 505-885/ | 2022-03-28 16:43 | - | |
| Trying to help Sister over phone!!!/ | 2022-03-28 16:43 | - | |
| Trying to install XP on a Satellite M305-S4835/ | 2022-03-28 16:43 | - | |
| Trying to upgrade Toshiba satellite A-215/ | 2022-03-28 16:43 | - | |
| Turbo disabled locked/ | 2022-03-28 16:43 | - | |
| Turn OFF SPEEDSTEPPING Speed Stepping on Toshiba/ | 2022-03-28 16:43 | - | |
| Turns off while burning/ | 2022-03-28 16:43 | - | |
| Tweaking SLI1, start-up/ | 2022-03-28 16:43 | - | |
| Two Operating Systems on Toshiba A205-S5871/ | 2022-03-28 16:43 | - | |
| Two finger tap for middle wheel click on M800/ | 2022-03-28 16:43 | - | |
| U.S. release of Portege M300/ | 2022-03-28 16:43 | - | |
| U105 cheap off Craigslist- See the guts as a result/ | 2022-03-28 16:43 | - | |
| U200-PT7 pcmark05 Scores!!!/ | 2022-03-28 16:43 | - | |
| U200 Memory/ | 2022-03-28 16:43 | - | |
| U200 VGA ouput more then crapy when on AC power/ | 2022-03-28 16:43 | - | |
| U205-5067 CD DVD drive removable/ | 2022-03-28 16:43 | - | |
| U205 Processor Upgrade/ | 2022-03-28 16:43 | - | |
| U205 SD Card Update/ | 2022-03-28 16:43 | - | |
| U205 Volume Problems/ | 2022-03-28 16:43 | - | |
| U300-111 unexpected shutdown-power management/ | 2022-03-28 16:43 | - | |
| U300-FA3 (Canadian Model) Keyboard/ | 2022-03-28 16:43 | - | |
| U300-NS1 Opinion/ | 2022-03-28 16:43 | - | |
| U300-NS5 -- Santa Rosa/ | 2022-03-28 16:43 | - | |
| U300-fa3 13 Inch (canadian Model)/ | 2022-03-28 16:43 | - | |
| U300 Dead Backlit/ | 2022-03-28 16:43 | - | |
| U305 - 7477 or 5127/ | 2022-03-28 16:43 | - | |
| U305-S73446 SD card reader issue/ | 2022-03-28 16:43 | - | |
| U305 HDD protection not support on 32 XP/ | 2022-03-28 16:43 | - | |
| U305 Missing 40+ GB of Space/ | 2022-03-28 16:43 | - | |
| U305 Processor/ | 2022-03-28 16:43 | - | |
| U305 Touchpad Scroll Feature/ | 2022-03-28 16:43 | - | |
| U305 Users Please Give Advice/ | 2022-03-28 16:43 | - | |
| U400 U405 Queries/ | 2022-03-28 16:43 | - | |
| U400 U405 idle temperature/ | 2022-03-28 16:43 | - | |
| U400 vs U405, Fingerprint reader, Vista Biz 64/ | 2022-03-28 16:43 | - | |
| U405-S830 vs. U405S833- Any difference/ | 2022-03-28 16:43 | - | |
| U405-S2817 - Black Screen - Intel (R) 965 Express Chipset Family/ | 2022-03-28 16:43 | - | |
| U405-S2856- Recovery Disk Not Working Properly/ | 2022-03-28 16:43 | - | |
| U405 - need replacement TruBrite LCD 13.3/ | 2022-03-28 16:43 | - | |
| U405-s2826 Downgrade to XP NEED Help/ | 2022-03-28 16:43 | - | |
| U405 tap to click/ | 2022-03-28 16:43 | - | |
| U500 Build quaility/ | 2022-03-28 16:43 | - | |
| U500 U505 Owner's Lounge/ | 2022-03-28 16:43 | - | |
| U500 switch video adapter/ | 2022-03-28 16:43 | - | |
| U600 updated with Geforce 210/ | 2022-03-28 16:43 | - | |
| U945t convertible/ | 2022-03-28 16:43 | - | |
| UJ-85J Firmware or Recommendations for Toshiba Compatible DVD Burner/ | 2022-03-28 16:43 | - | |
| UK Spec Toshiba X200-20s - HDMI/ | 2022-03-28 16:43 | - | |
| URGENT- keyboard stopped working/ | 2022-03-28 16:44 | - | |
| URGENT need help !!/ | 2022-03-28 16:44 | - | |
| USB 2.0 drivers/ | 2022-03-28 16:44 | - | |
| USB 3.0 Express Card for x505-q894/ | 2022-03-28 16:44 | - | |
| USB3.0 on the Qosimo/ | 2022-03-28 16:44 | - | |
| USB POWER OFF ON Satellite Series/ | 2022-03-28 16:44 | - | |
| USB Port Problem/ | 2022-03-28 16:44 | - | |
| USB Unknown error/ | 2022-03-28 16:44 | - | |
| USB port problems with A105-S101/ | 2022-03-28 16:44 | - | |
| US Qosmio tuner for UK TV/ | 2022-03-28 16:44 | - | |
| Uac Is Asking Me To Authorise Tempro On Bootup/ | 2022-03-28 16:43 | - | |
| Ubuntu on R705/ | 2022-03-28 16:43 | - | |
| Ultimate Boot CD/ | 2022-03-28 16:43 | - | |
| Unable to add 512 megs to new P35- S611/ | 2022-03-28 16:43 | - | |
| Unable to eject Disk/ | 2022-03-28 16:43 | - | |
| Unable to enter bios on Toshiba P745 after restoring laptop using Toshiba Recovery Wizard/ | 2022-03-28 16:43 | - | |
| Unboxing Toshiba Satellite A505 - S6965/ | 2022-03-28 16:43 | - | |
| Undervolting Toshiba R700 (or similar models) - any luck/ | 2022-03-28 16:43 | - | |
| Unexpected Shutdown/ | 2022-03-28 16:43 | - | |
| Unhappy with Toshiba/ | 2022-03-28 16:43 | - | |
| Uninstalling OEM crap/ | 2022-03-28 16:43 | - | |
| Unknown Device ACPI TOS1901 Help/ | 2022-03-28 16:43 | - | |
| Unresponsive key on M5/ | 2022-03-28 16:43 | - | |
| Unwanted stuff on my Toshiba/ | 2022-03-28 16:43 | - | |
| Update bios through Linux/ | 2022-03-28 16:43 | - | |
| Updated Drivers & Apps For X205 Series/ | 2022-03-28 16:43 | - | |
| Updated Intel Graphics HD Driver will not install/ | 2022-03-28 16:43 | - | |
| Updated feedback on the A605-p200/ | 2022-03-28 16:43 | - | |
| Update on recovery DVD-ROM problem/ | 2022-03-28 16:43 | - | |
| Updating ATI display & chipset drivers/ | 2022-03-28 16:43 | - | |
| Updating BIOS of my A300/ | 2022-03-28 16:43 | - | |
| Updating Video card drivers Tecra S2/ | 2022-03-28 16:43 | - | |
| Updating the Realtek Drivers on SLI1/ | 2022-03-28 16:43 | - | |
| Upgradable CPU/ | 2022-03-28 16:43 | - | |
| Upgrade 4GB DDR2-5300 for Tohsiba A105-S4384 issues/ | 2022-03-28 16:43 | - | |
| Upgrade CPU Satellite Pro L650 + more/ | 2022-03-28 16:43 | - | |
| Upgrade CPU on U300-FA3/ | 2022-03-28 16:43 | - | |
| Upgrade Friendly/ | 2022-03-28 16:43 | - | |
| Upgrade Hard disk/ | 2022-03-28 16:43 | - | |
| Upgrade M105 CPU from Core Duo to Core 2 Duo/ | 2022-03-28 16:43 | - | |
| Upgrade M700/ | 2022-03-28 16:43 | - | |
| Upgrade Sat A40 CDRW DVD to DVDRW/ | 2022-03-28 16:43 | - | |
| Upgrade Satellite L35-S2174 to DVD-RW/ | 2022-03-28 16:43 | - | |
| Upgrade X775 Qosmio to GTX 770m/ | 2022-03-28 16:43 | - | |
| Upgradeable WiFi/ | 2022-03-28 16:43 | - | |
| Upgraded RAM in Toshiba/ | 2022-03-28 16:44 | - | |
| Upgraded Toshiba Qosmio X505-Q885 to i7 720QM overheating 75C/ | 2022-03-28 16:44 | - | |
| Upgrade from GT 230M TO GTX260M/ | 2022-03-28 16:43 | - | |
| Upgrade processor Toshiba L650-11F/ | 2022-03-28 16:43 | - | |
| Upgrade the Screen on a Satellite A300/ | 2022-03-28 16:43 | - | |
| Upgrade to Windows XP Pro/ | 2022-03-28 16:43 | - | |
| Upgrading/ | 2022-03-28 16:44 | - | |
| Upgrading A60 Hard Dive/ | 2022-03-28 16:44 | - | |
| Upgrading CPU in L850 questions/ | 2022-03-28 16:44 | - | |
| Upgrading CPU on Toshiba Satellite L875-7208/ | 2022-03-28 16:44 | - | |
| Upgrading DDR2 533mhz RAM in Toshiba mini nb205/ | 2022-03-28 16:44 | - | |
| Upgrading HD in A15/ | 2022-03-28 16:44 | - | |
| Upgrading Memory Modules on Toshiba p25-s526/ | 2022-03-28 16:44 | - | |
| Upgrading Memory in A100/ | 2022-03-28 16:44 | - | |
| Upgrading Portege r200's RAM with 2 GB memory chip - possible/ | 2022-03-28 16:44 | - | |
| Upgrading Processor - what can go wrong/ | 2022-03-28 16:44 | - | |
| Upgrading Qosmio G50 CPU/ | 2022-03-28 16:44 | - | |
| Upgrading RAM/ | 2022-03-28 16:44 | - | |
| Upgrading RAM in m50 (canada version)/ | 2022-03-28 16:44 | - | |
| Upgrading RAM on Toshiba A215-S7422/ | 2022-03-28 16:44 | - | |
| Upgrading RAM on a Satellite A70/ | 2022-03-28 16:44 | - | |
| Upgrading Satellite P100-SD8/ | 2022-03-28 16:44 | - | |
| Upgrading Toshiba Qosmio F-25 AV205/ | 2022-03-28 16:44 | - | |
| Upgrading X505 q894/ | 2022-03-28 16:44 | - | |
| Upgrading cpu for satellite a135-s4467/ | 2022-03-28 16:44 | - | |
| Upgrading cpu on Toshiba Satellite Pro 460CDT/ | 2022-03-28 16:44 | - | |
| Upgrading downgrading a Toshiba A135-S7404/ | 2022-03-28 16:44 | - | |
| Upgrading driver for 6520g and 6gb to 8gb question/ | 2022-03-28 16:44 | - | |
| Upgrading from 32 to 64 bits on Qosmio X300 w/ | 2022-03-28 16:44 | - | |
| Upgrading from i3 to i7 920xm in my toshiba a665-s5170/ | 2022-03-28 16:44 | - | |
| Upgrading memory on my X205-9349/ | 2022-03-28 16:44 | - | |
| Upgrading my M30X/ | 2022-03-28 16:44 | - | |
| Upgrading my X205-S9349/ | 2022-03-28 16:44 | - | |
| Upgrading my satellite 2520cds/ | 2022-03-28 16:44 | - | |
| Upgrading my x205-sli1 hard drives/ | 2022-03-28 16:44 | - | |
| Upgrading ram in Qosmio F15/ | 2022-03-28 16:44 | - | |
| Upgrading speakers in A215-S7444/ | 2022-03-28 16:44 | - | |
| Upgrading the CPU on a U200/ | 2022-03-28 16:44 | - | |
| Upgrading the LCD Panel in an A210-11P/ | 2022-03-28 16:44 | - | |
| Upgrading the X205-S9349/ | 2022-03-28 16:44 | - | |
| Upgrading the processor on X205/ | 2022-03-28 16:44 | - | |
| Upgrading x305-q701/ | 2022-03-28 16:44 | - | |
| Urgent Question/ | 2022-03-28 16:44 | - | |
| Usb ports on Toshiba TE2100 fail/ | 2022-03-28 16:44 | - | |
| User Opinions of the Satelite U405/ | 2022-03-28 16:44 | - | |
| User Review and Benchmarks - Toshiba T115D-S1125/ | 2022-03-28 16:44 | - | |
| Users of M40s - Old model = New model/ | 2022-03-28 16:44 | - | |
| Using Digital Output/ | 2022-03-28 16:44 | - | |
| Using HDMI to external monitor Graphic Card/ | 2022-03-28 16:44 | - | |
| Using LabelFlash - comments & questions/ | 2022-03-28 16:44 | - | |
| Using Laptop in car/ | 2022-03-28 16:44 | - | |
| Using S-Video Output to TV on Tecra M3/ | 2022-03-28 16:44 | - | |
| Using Toshiba Recovery Disks/ | 2022-03-28 16:44 | - | |
| Using a Satellite 1135-s155- yes its old/ | 2022-03-28 16:44 | - | |
| Utility programs/ | 2022-03-28 16:44 | - | |
| VGA+Plugged in produces screen flicker/ | 2022-03-28 16:44 | - | |
| VGA Output problems in X205-S9349- Blurred image quality/ | 2022-03-28 16:44 | - | |
| VGA bios A500, L500/ | 2022-03-28 16:44 | - | |
| VISTA Reconsidered-X205/ | 2022-03-28 16:44 | - | |
| Value Added Package XP version/ | 2022-03-28 16:44 | - | |
| Vertical Color Lines on my screen !/ | 2022-03-28 16:44 | - | |
| Vertical lines on my toshiba tecra s2 screen/ | 2022-03-28 16:44 | - | |
| Vertical stripe on screen Qosmio F15/ | 2022-03-28 16:44 | - | |
| Very Faint beep every few seconds/ | 2022-03-28 16:44 | - | |
| Very Good Thermal Paste Compound Article/ | 2022-03-28 16:44 | - | |
| Very Happy with my T215/ | 2022-03-28 16:44 | - | |
| Very Strange Problem with CTRL - X (or any letter)/ | 2022-03-28 16:44 | - | |
| Very Strange Problem with Toshiba Express Media Player/ | 2022-03-28 16:44 | - | |
| Very disappointed with my New Tecra M5/ | 2022-03-28 16:44 | - | |
| Very odd issue with my Qosmio x875/ | 2022-03-28 16:44 | - | |
| Video Card/ | 2022-03-28 16:44 | - | |
| Video Card Fried (Satellite P105-S9312)/ | 2022-03-28 16:44 | - | |
| Video Card Upgrade/ | 2022-03-28 16:44 | - | |
| Video Driever issues/ | 2022-03-28 16:44 | - | |
| Video Memory on satellite/ | 2022-03-28 16:44 | - | |
| Video Recording/ | 2022-03-28 16:44 | - | |
| Video Streaming/ | 2022-03-28 16:44 | - | |
| Video card upgrading/ | 2022-03-28 16:44 | - | |
| Video flicker-n-hang issues/ | 2022-03-28 16:44 | - | |
| Video problem with XP on Satellite P205/ | 2022-03-28 16:44 | - | |
| Video ram for M100-JG2 (advertised as 128mb but displays 64mb)/ | 2022-03-28 16:44 | - | |
| Viewing angle/ | 2022-03-28 16:44 | - | |
| Viewing angles in Toshiba Trubrite screens/ | 2022-03-28 16:44 | - | |
| Vintage Toshiba T1200XE - trying to fix (CMOS battery problem )/ | 2022-03-28 16:44 | - | |
| Virtualization disabled in BIOS/ | 2022-03-28 16:44 | - | |
| Vista, Intel, and Toshiba M105/ | 2022-03-28 16:44 | - | |
| Vista, slow slow wireless connection/ | 2022-03-28 16:44 | - | |
| Vista32 - no usb after sleep fixed/ | 2022-03-28 16:44 | - | |
| Vista 32 or 64. Which one would u install/ | 2022-03-28 16:44 | - | |
| Vista 64 on x205 SLi2/ | 2022-03-28 16:44 | - | |
| Vista Clean install, rather than OEM discs/ | 2022-03-28 16:44 | - | |
| Vista Microphone output to speakers Issues/ | 2022-03-28 16:44 | - | |
| Vista P105-S9312 Speaker Configuration/ | 2022-03-28 16:44 | - | |
| Vista RC2 won't install on Toshiba M115-3094/ | 2022-03-28 16:44 | - | |
| Vista Recovery/ | 2022-03-28 16:44 | - | |
| Vista SP1 recognizes all 4GB ! !/ | 2022-03-28 16:44 | - | |
| Vista Upgrade Problem A105-4334/ | 2022-03-28 16:44 | - | |
| Vista Upgrade for Toshiba M45-S359/ | 2022-03-28 16:44 | - | |
| Vista XP dual boot/ | 2022-03-28 16:44 | - | |
| Vista can't see hard drive after cleaning/ | 2022-03-28 16:44 | - | |
| Vista on R100/ | 2022-03-28 16:44 | - | |
| Vista on a Toshbia m60/ | 2022-03-28 16:44 | - | |
| Vista or XP/ | 2022-03-28 16:44 | - | |
| Vista taking up too much space/ | 2022-03-28 16:44 | - | |
| Vista to XP Pro on Qosimo F40/ | 2022-03-28 16:44 | - | |
| Vista to XP problem/ | 2022-03-28 16:44 | - | |
| Vista uninstallation question/ | 2022-03-28 16:44 | - | |
| Vista video problem-resolution resets upon reboot/ | 2022-03-28 16:44 | - | |
| Volume Adjust Problems During Gaming/ | 2022-03-28 16:44 | - | |
| Volume and Sound Problems w Vista/ | 2022-03-28 16:44 | - | |
| W100 Libretto recovery DVD needed/ | 2022-03-28 16:44 | - | |
| WHAT IS THIS PORT !!! on my satellite a665/ | 2022-03-28 16:44 | - | |
| WHat RAM Toshiba Satellite P100 Supports/ | 2022-03-28 16:44 | - | |
| WIN7 installer can't see hard drive on Satellite/ | 2022-03-28 16:44 | - | |
| WIndows Vista/ | 2022-03-28 16:44 | - | |
| WTBorrow- Recovery CDs for 5205-S503/ | 2022-03-28 16:44 | - | |
| WTBorrow - Satellite 5205 Recovery Disk/ | 2022-03-28 16:44 | - | |
| Wacked out XP video driver on my A215 S7422/ | 2022-03-28 16:44 | - | |
| Wallpaper Qosmio x70/ | 2022-03-28 16:44 | - | |
| Wanted to get a good idea of the Portege A605-P200 before I buy/ | 2022-03-28 16:44 | - | |
| Want to Format my TOSHIBA Satellite 2400-S201/ | 2022-03-28 16:44 | - | |
| Want to buy Laptop/ | 2022-03-28 16:44 | - | |
| Want to sell Toshiba Sattelite-what's it worth/ | 2022-03-28 16:44 | - | |
| Want to upgrade my Toshiba/ | 2022-03-28 16:44 | - | |
| Want to upgrade my X205-S7483 processor from a T5450 to a T7700, possible/ | 2022-03-28 16:44 | - | |
| Warning! Never Buy A Toshiba Laptop!/ | 2022-03-28 16:44 | - | |
| Warning- Toshiba is not honoring Vista upgrade/ | 2022-03-28 16:44 | - | |
| Warranty Repair Service Shipping Options/ | 2022-03-28 16:44 | - | |
| Warranty Upgrade Question/ | 2022-03-28 16:44 | - | |
| Warranty extension not accepted by Toshiba/ | 2022-03-28 16:44 | - | |
| Waves Audio on Win 7/ | 2022-03-28 16:44 | - | |
| Way old toshiba driver question/ | 2022-03-28 16:44 | - | |
| Way to improve sli performance/ | 2022-03-28 16:44 | - | |
| Weak Wireless Connection/ | 2022-03-28 16:44 | - | |
| Weak sound on Satellite A65-S1064/ | 2022-03-28 16:44 | - | |
| Web Cam Help ! Please )-/ | 2022-03-28 16:44 | - | |
| Webcam/ | 2022-03-28 16:44 | - | |
| Webcam driver fail. Please restart camera or computer!!!/ | 2022-03-28 16:44 | - | |
| Webcam driver for Toshiba A200/ | 2022-03-28 16:44 | - | |
| Webcam on for a Second, then goes Blank/ | 2022-03-28 16:44 | - | |
| Webcam troubles!/ | 2022-03-28 16:44 | - | |
| Webroot AB on Toshiba/ | 2022-03-28 16:44 | - | |
| Weird Boot Up/ | 2022-03-28 16:44 | - | |
| Weird Charge Problem/ | 2022-03-28 16:44 | - | |
| Weird Fan Issue/ | 2022-03-28 16:44 | - | |
| Weird Graphics Memory/ | 2022-03-28 16:44 | - | |
| Weird Noise ing from Graphics Card/ | 2022-03-28 16:44 | - | |
| Weird Power Problem with Satellite M45/ | 2022-03-28 16:44 | - | |
| Weird Satellite A100 sond problem/ | 2022-03-28 16:44 | - | |
| Weird Satellite A100 sound problem/ | 2022-03-28 16:44 | - | |
| Weird hard drive noise with Vista - Toshiba u305/ | 2022-03-28 16:44 | - | |
| Weird lines on toshiba screen [toshiba satellite a305d]/ | 2022-03-28 16:44 | - | |
| Weird screen on A100/ | 2022-03-28 16:44 | - | |
| Weird whine sound from the laptop/ | 2022-03-28 16:44 | - | |
| Weird wireless behavior after XP install/ | 2022-03-28 16:44 | - | |
| Well I did it/ | 2022-03-28 16:44 | - | |
| Western Digital MyBook external drive not recognized by my Satellite 4025CDT/ | 2022-03-28 16:44 | - | |
| What's LED Sidelight/ | 2022-03-28 16:44 | - | |
| What's SVP utility/ | 2022-03-28 16:44 | - | |
| What's faster - 32bit XP or 64bit Vista/ | 2022-03-28 16:44 | - | |
| What's the best Toshiba laptop and model line/ | 2022-03-28 16:44 | - | |
| What's the catch/ | 2022-03-28 16:44 | - | |
| What's this Unknown Device in Device Manager/ | 2022-03-28 16:44 | - | |
| What's with the P100's keyboard/ | 2022-03-28 16:44 | - | |
| What's your thoughts on Tecra A10/ | 2022-03-28 16:44 | - | |
| What CPU can you upgrade a Toshiba SatelliteA205-S5804 Pn- PSAF3U-0NR00V To/ | 2022-03-28 16:44 | - | |
| What CPU fan do I have/ | 2022-03-28 16:44 | - | |
| What DVD drive does the Satellite A300 use/ | 2022-03-28 16:44 | - | |
| What HD2600 model is this/ | 2022-03-28 16:44 | - | |
| What I-Link Cable Do I Need/ | 2022-03-28 16:44 | - | |
| What Is The Processor You Can Replace The T5550 With/ | 2022-03-28 16:44 | - | |
| What Nvidia Drivers/ | 2022-03-28 16:44 | - | |
| What Toshiba Laptop might that be/ | 2022-03-28 16:44 | - | |
| What Toshiba should I go for/ | 2022-03-28 16:44 | - | |
| What Works Best To Clean a SLI1 Screen/ | 2022-03-28 16:44 | - | |
| What about GTX 570M/ | 2022-03-28 16:44 | - | |
| What about bloatware/ | 2022-03-28 16:44 | - | |
| What are Program Settings/ | 2022-03-28 16:44 | - | |
| What are the Toshiba HD screens capable of/ | 2022-03-28 16:44 | - | |
| What are this partitions/ | 2022-03-28 16:44 | - | |
| What brand is the Built-In Webcam !/ | 2022-03-28 16:44 | - | |
| What color cases do the M70-SR6s come in/ | 2022-03-28 16:44 | - | |
| What current model compares with the Satellite A505 - S6965/ | 2022-03-28 16:44 | - | |
| What do the 2nd function keys of the Satellite A100 do/ | 2022-03-28 16:44 | - | |
| What do you guys think/ | 2022-03-28 16:44 | - | |
| What do you think about the Protege M600 & R500/ | 2022-03-28 16:44 | - | |
| What do you use your second hard drive for/ | 2022-03-28 16:44 | - | |
| What happened if you uninstall your antivirus software/ | 2022-03-28 16:44 | - | |
| What happened to my A300/ | 2022-03-28 16:44 | - | |
| What has happened with my Toshiba/ | 2022-03-28 16:44 | - | |
| What if any blu ray drive can i fit/ | 2022-03-28 16:44 | - | |
| What is Logic Lower Assembly/ | 2022-03-28 16:44 | - | |
| What is Toshibas obsession with tiny batteries and spinning platters on 2-in-1 laptops/ | 2022-03-28 16:44 | - | |
| What is the Toshiba P105-S9312's Release Date/ | 2022-03-28 16:44 | - | |
| What is the Toshiba Satellite A85/ | 2022-03-28 16:44 | - | |
| What is the advantages of Toshiba over other brands/ | 2022-03-28 16:44 | - | |
| What is the best drivers for x205sli1/ | 2022-03-28 16:44 | - | |
| What is the best laptop/ | 2022-03-28 16:44 | - | |
| What is the color gamut of Toshiba 4k laptop/ | 2022-03-28 16:44 | - | |
| What is the color gamut of the P55T Also, is it IPS/ | 2022-03-28 16:44 | - | |
| What is the difference between p55t and p55w/ | 2022-03-28 16:44 | - | |
| What is the highest you would OC the VRAM on the sli1/ | 2022-03-28 16:44 | - | |
| What is the make and model of the A205 motherboard/ | 2022-03-28 16:44 | - | |
| What is this slot for/ | 2022-03-28 16:44 | - | |
| What is with the stupid keyboards/ | 2022-03-28 16:44 | - | |
| What is your lid color/ | 2022-03-28 16:44 | - | |
| What kind of panel is in a 18.4 1080p Qosimo/ | 2022-03-28 16:44 | - | |
| What kind of screw is this/ | 2022-03-28 16:44 | - | |
| What kind of warranty for Toshiba laptop/ | 2022-03-28 16:44 | - | |
| What laptop should i get/ | 2022-03-28 16:44 | - | |
| What model name is this Toshiba Laptop/ | 2022-03-28 16:44 | - | |
| What modem is there in Toshiba Sattelite M305D-S4829/ | 2022-03-28 16:44 | - | |
| What nVidia drivers for SLi1 w XP/ | 2022-03-28 16:44 | - | |
| Whats going on with Toshiba Satelliate P100's in the UK and Europe/ | 2022-03-28 16:44 | - | |
| What should I ask for my SLi1/ | 2022-03-28 16:44 | - | |
| What software and bloatware is safe to uninstall/ | 2022-03-28 16:44 | - | |
| What software to keep/ | 2022-03-28 16:44 | - | |
| Whats the default power-on password/ | 2022-03-28 16:44 | - | |
| Whats the diff between a Satellite, Satellite Pro, and Tecra/ | 2022-03-28 16:44 | - | |
| Whats the rep on Toshiba/ | 2022-03-28 16:44 | - | |
| Whats up with short cut keys/ | 2022-03-28 16:44 | - | |
| What the differences between R930 and R935/ | 2022-03-28 16:44 | - | |
| What to get instead of i9300/ | 2022-03-28 16:44 | - | |
| What toshiba model should i get/ | 2022-03-28 16:44 | - | |
| What type ram/ | 2022-03-28 16:44 | - | |
| What upgrade portege 4010 hard drive can I use/ | 2022-03-28 16:44 | - | |
| When do new models hit the streets/ | 2022-03-28 16:44 | - | |
| When will PORTEGE get the i7-640um/ | 2022-03-28 16:44 | - | |
| When will Qosmio X300 series be out in Europe/ | 2022-03-28 16:44 | - | |
| When will Toshiba Satellite P105-S9312 come out/ | 2022-03-28 16:44 | - | |
| When will the Tecra start shipping with Dothan/ | 2022-03-28 16:44 | - | |
| When you use a 4k laptop (toshiba) to watch movies does it look more grainy/ | 2022-03-28 16:44 | - | |
| Where (in the US) is the R600/ | 2022-03-28 16:44 | - | |
| Where Do I Get Recovery Discs For Qosmio Laptop/ | 2022-03-28 16:44 | - | |
| Where can I buy a Satellite P105-S9312/ | 2022-03-28 16:44 | - | |
| Where can I find lap top Qosmio Q305-Q706 in USA (California) and How much the price -)/ | 2022-03-28 16:44 | - | |
| Where did Satellite U405-S2920 go/ | 2022-03-28 16:44 | - | |
| Where did YOU get your Toshiba Laptop/ | 2022-03-28 16:44 | - | |
| Where do i go to adjust the GPU ram on a GMA900 on the M70/ | 2022-03-28 16:44 | - | |
| Where have all the Qosmios gone/ | 2022-03-28 16:44 | - | |
| Where in Canada can I buy the Toshiba Satellite X205-S9359/ | 2022-03-28 16:44 | - | |
| Where is a good place to get Toshiba spares/ | 2022-03-28 16:44 | - | |
| Where is the RTC Battery Located on Satellite S50Dt-B/ | 2022-03-28 16:44 | - | |
| Where is the model number/ | 2022-03-28 16:44 | - | |
| Where is the proscessor of x505-898 qosimo/ | 2022-03-28 16:44 | - | |
| Where is the so called Preinstalled User Guide/ | 2022-03-28 16:44 | - | |
| Where should I buy my M640/ | 2022-03-28 16:44 | - | |
| Where the heck is that extra memory slot! ! (M205-S3064)/ | 2022-03-28 16:44 | - | |
| Where to buy (Canada)/ | 2022-03-28 16:44 | - | |
| Where to buy GPUs/ | 2022-03-28 16:44 | - | |
| Where to buy HDD Caddy for Portege S100/ | 2022-03-28 16:44 | - | |
| Where to buy Toshiba parts/ | 2022-03-28 16:44 | - | |
| Where to buy my M40 from/ | 2022-03-28 16:44 | - | |
| Where to buy x205 in Ontario Canada/ | 2022-03-28 16:44 | - | |
| Where to find real specs/ | 2022-03-28 16:44 | - | |
| Where to find the latest drivers for my Toshiba Satelite A500D-10E/ | 2022-03-28 16:44 | - | |
| Where to get a Toshiba R100 CMOS battery/ | 2022-03-28 16:44 | - | |
| Where to get the M40 cheap in Canada/ | 2022-03-28 16:44 | - | |
| Where to start/ | 2022-03-28 16:44 | - | |
| Which A300 do I have/ | 2022-03-28 16:44 | - | |
| Which Card/ | 2022-03-28 16:44 | - | |
| Which LCD is better A130 A135 true brite or Sony FE x-brite-eco/ | 2022-03-28 16:44 | - | |
| Which Laptop To Purchase (Toshiba A505-S6965 or HP dv6-1245dx)/ | 2022-03-28 16:44 | - | |
| Which P300 should I get/ | 2022-03-28 16:44 | - | |
| Which Partitions do What/ | 2022-03-28 16:44 | - | |
| Which Toschiba for business school/ | 2022-03-28 16:44 | - | |
| Which Toshiba/ | 2022-03-28 16:44 | - | |
| Which Toshiba Notebook to buy/ | 2022-03-28 16:44 | - | |
| Which Toshiba apps do you use/ | 2022-03-28 16:44 | - | |
| Which Toshiba for school/ | 2022-03-28 16:44 | - | |
| Which Toshiba laptops support 2.4 GHz & 5 GHz Wireless N/ | 2022-03-28 16:44 | - | |
| Which Toshiba notebook has all of this-/ | 2022-03-28 16:44 | - | |
| Which backpack for satellite X200 (X205)/ | 2022-03-28 16:44 | - | |
| Which driver for the SLI1- 169.61 or 173.80/ | 2022-03-28 16:44 | - | |
| Which file from windows 7 installation DVD to run for windows 7 installation/ | 2022-03-28 16:44 | - | |
| Which is better- $379 display model Toshia Satellite A205-4577 or $576 new Lenovo Thinkpad R61i 8932A11/ | 2022-03-28 16:44 | - | |
| Which is the better deal/ | 2022-03-28 16:44 | - | |
| Which is the mostrecommended mmory upgrade for m115-s3094/ | 2022-03-28 16:44 | - | |
| Which laptop/ | 2022-03-28 16:44 | - | |
| Which laptop is this/ | 2022-03-28 16:44 | - | |
| Which module has a VGA interface/ | 2022-03-28 16:44 | - | |
| Which notebook suits me/ | 2022-03-28 16:44 | - | |
| Which one out of these 2 Toshiba laptops is the better purchase/ | 2022-03-28 16:44 | - | |
| Which one would be better/ | 2022-03-28 16:44 | - | |
| Which spare batteries for A100-0FH/ | 2022-03-28 16:44 | - | |
| Which store/ | 2022-03-28 16:44 | - | |
| Which store in Canada/ | 2022-03-28 16:44 | - | |
| Which submodel of Portege R835 is best VFM/ | 2022-03-28 16:44 | - | |
| Which toshiba to buy/ | 2022-03-28 16:44 | - | |
| Which video driver to install/ | 2022-03-28 16:44 | - | |
| White screen issue toshiba satellite 1130/ | 2022-03-28 16:44 | - | |
| White screen result on Vista - [Satelite A200]/ | 2022-03-28 16:44 | - | |
| White vertical lines on Toshiba M60 LCD/ | 2022-03-28 16:44 | - | |
| Who has Toshiba P105 with Geforce 7600/ | 2022-03-28 16:44 | - | |
| Who runs hotter, Intel or AMD Turions/ | 2022-03-28 16:44 | - | |
| Who sells X205-S9359 in the northern USA/ | 2022-03-28 16:44 | - | |
| Why are manufacturing defects so common nowadays/ | 2022-03-28 16:44 | - | |
| Why does it say I have 384mb when I have 512mb/ | 2022-03-28 16:44 | - | |
| Why doesn't Toshiba offer higher resolution displays on higher-end models/ | 2022-03-28 16:44 | - | |
| Why do you like Toshiba/ | 2022-03-28 16:44 | - | |
| Why is Toshiba so behind in the times/ | 2022-03-28 16:44 | - | |
| Why is my Toshiba A105 turning off by itself/ | 2022-03-28 16:44 | - | |
| Why is the Toshiba P40 Missing in Action/ | 2022-03-28 16:44 | - | |
| Why is the clock messed up on my U200/ | 2022-03-28 16:44 | - | |
| Why not to buy a Toshiba/ | 2022-03-28 16:44 | - | |
| Why pay 2.4k for this laptop !/ | 2022-03-28 16:44 | - | |
| Why should I consider not buying a Satellite laptop anymore/ | 2022-03-28 16:44 | - | |
| Why shouldn't I/ | 2022-03-28 16:44 | - | |
| Why the layout of Toshiba keyboard is so weird/ | 2022-03-28 16:44 | - | |
| Why won't the screensaver enable/ | 2022-03-28 16:44 | - | |
| WiFi Antenna/ | 2022-03-28 16:44 | - | |
| WiFi getting really hot/ | 2022-03-28 16:44 | - | |
| Wich Toshiba would be best/ | 2022-03-28 16:44 | - | |
| Wierd observation/ | 2022-03-28 16:44 | - | |
| Wierd screen problem - any advice appreciated/ | 2022-03-28 16:44 | - | |
| Wife's Toshiba Satellite making funny hissing screeching noise and white lines on the screen/ | 2022-03-28 16:44 | - | |
| Wifi Help/ | 2022-03-28 16:44 | - | |
| Wifi no connections available/ | 2022-03-28 16:44 | - | |
| Will 12.5mm HDD Fit Satellite C650-19T/ | 2022-03-28 16:44 | - | |
| Will 667 Mhz memory work in my laptop ( it has 533mhz memory currently )/ | 2022-03-28 16:44 | - | |
| Will I need a router/ | 2022-03-28 16:44 | - | |
| Will Overheating occur in X505-Q8100X/ | 2022-03-28 16:44 | - | |
| Will This Toshiba run older pc games/ | 2022-03-28 16:44 | - | |
| Will Toshiba Drop Price On x205 series/ | 2022-03-28 16:44 | - | |
| Will Toshiba Ever Make Gaming Laptops Again/ | 2022-03-28 16:44 | - | |
| Will Toshiba laptop work in my country/ | 2022-03-28 16:44 | - | |
| Will a Toshiba M50 be able to run high end design programs/ | 2022-03-28 16:44 | - | |
| Will my Satellite support dual channel ram/ | 2022-03-28 16:44 | - | |
| Will need a WiFi card/ | 2022-03-28 16:44 | - | |
| Will new keyboard fix Portege 4000 accupoint/ | 2022-03-28 16:44 | - | |
| Will someone please help/ | 2022-03-28 16:44 | - | |
| Will the a105 ever have/ | 2022-03-28 16:44 | - | |
| Will the new M205 have the same Vista issues as the A135/ | 2022-03-28 16:44 | - | |
| Win7 64 bits on Toshiba Satellite M300 PSMD0C-FC508C/ | 2022-03-28 16:44 | - | |
| Win7 and Toshiba A300 (A305) - trouble with ATI 3650 graphics drivers/ | 2022-03-28 16:44 | - | |
| Win7 upgrade experiences/ | 2022-03-28 16:44 | - | |
| Win XP SATA driver for Toshiba A215/ | 2022-03-28 16:44 | - | |
| WinXP SP2 drivers for Satellite U305-S5097/ | 2022-03-28 16:44 | - | |
| WinXP Sata Drivers for Toshiba U305/ | 2022-03-28 16:44 | - | |
| Win XP on Toshiba M300-FC5/ | 2022-03-28 16:44 | - | |
| Windows 7/ | 2022-03-28 16:44 | - | |
| Windows 7 Free Upgrade From Toshiba/ | 2022-03-28 16:44 | - | |
| Windows 7 OEM in Toshiba laptop/ | 2022-03-28 16:44 | - | |
| Windows 7 On Nb205-n312 bl/ | 2022-03-28 16:44 | - | |
| Windows 7 Touchpad Driver for Toshiba NB205/ | 2022-03-28 16:44 | - | |
| Windows 7 Upgrade Discs received in record (slow) time!/ | 2022-03-28 16:44 | - | |
| Windows 7 and R500/ | 2022-03-28 16:44 | - | |
| Windows 7 and realtek 2.15 drivers/ | 2022-03-28 16:44 | - | |
| Windows 7 downgrade product number serial/ | 2022-03-28 16:44 | - | |
| Windows 7 on Qosmio F50 X300/ | 2022-03-28 16:44 | - | |
| Windows 7 on Toshiba NB205/ | 2022-03-28 16:44 | - | |
| Windows 7 won't start. black screen/ | 2022-03-28 16:44 | - | |
| Windows 8.1 app(s) starts - splashes then disappears/ | 2022-03-28 16:44 | - | |
| Windows 8 Clean install guide for Satellite A135-S2376/ | 2022-03-28 16:44 | - | |
| Windows 8 and Bluetooth/ | 2022-03-28 16:44 | - | |
| Windows 2000/ | 2022-03-28 16:44 | - | |
| Windows BRICKED my X205 flashing the 1.60 BIOS/ | 2022-03-28 16:44 | - | |
| Windows Install/ | 2022-03-28 16:44 | - | |
| Windows Server 2008 on X205/ | 2022-03-28 16:44 | - | |
| Windows VISTA with Toshiba P100 (low battery options)/ | 2022-03-28 16:44 | - | |
| Windows Vista prem Won't Load/ | 2022-03-28 16:44 | - | |
| Windows Vista won't install on my Satellite M45-S265/ | 2022-03-28 16:44 | - | |
| Windows XP/ | 2022-03-28 16:44 | - | |
| Windows XP CD - does it came a long with the notebook/ | 2022-03-28 16:44 | - | |
| Windows XP Corrupted - recovery disk/ | 2022-03-28 16:44 | - | |
| WindowsXP Drivers for U305-5087/ | 2022-03-28 16:44 | - | |
| Windows XP Graphics Driver for X205-SLI2/ | 2022-03-28 16:44 | - | |
| Windows XP Toshiba x205-s9349 Nvidia driver/ | 2022-03-28 16:44 | - | |
| Windows explorer/ | 2022-03-28 16:44 | - | |
| Windows fatal error,lost $410, and need help!/ | 2022-03-28 16:44 | - | |
| Windows updates with Toshiba/ | 2022-03-28 16:44 | - | |
| Windows will not open on my Toshiba A80/ | 2022-03-28 16:44 | - | |
| Wiping or reformating brand new toshiba laptop/ | 2022-03-28 16:44 | - | |
| Wired LAN problems with my Toshiba/ | 2022-03-28 16:44 | - | |
| Wireless LAN on WinXP in Satellite L40-12N/ | 2022-03-28 16:44 | - | |
| Wireless Mini LAN card doesnt work/ | 2022-03-28 16:44 | - | |
| Wireless Mobile Broadband available on Portege500 Series/ | 2022-03-28 16:44 | - | |
| Wireless Networking Balloon/ | 2022-03-28 16:44 | - | |
| Wireless PC Card Advice/ | 2022-03-28 16:44 | - | |
| Wireless card problem - Thosiba/ | 2022-03-28 16:44 | - | |
| Wireless do not run in Draft-N/ | 2022-03-28 16:44 | - | |
| Wireless network adapter/ | 2022-03-28 16:44 | - | |
| Wireless problem A200/ | 2022-03-28 16:44 | - | |
| Wireless problem Tecra M2/ | 2022-03-28 16:44 | - | |
| Wireless trouble/ | 2022-03-28 16:44 | - | |
| Wold wide release of R500 (Dynabook ss)/ | 2022-03-28 16:44 | - | |
| Won't Boot While External Drive Connected/ | 2022-03-28 16:44 | - | |
| Won't boot unless I go to boot menu/ | 2022-03-28 16:44 | - | |
| Wondering About/ | 2022-03-28 16:44 | - | |
| Wont start after new keyboard/ | 2022-03-28 16:44 | - | |
| World of Warcraft/ | 2022-03-28 16:44 | - | |
| Would Partitioning Hdd Affects Toshiba Recovery Media Feature/ | 2022-03-28 16:44 | - | |
| Would Tecra M1 Motherboard fit on M2/ | 2022-03-28 16:44 | - | |
| Would like to purchase a laptop for my grandson/ | 2022-03-28 16:44 | - | |
| Would the m35 be good/ | 2022-03-28 16:44 | - | |
| Would this be a good buy/ | 2022-03-28 16:44 | - | |
| Would you recommend an x205 for non-Gamer/ | 2022-03-28 16:44 | - | |
| Wow...Just wow/ | 2022-03-28 16:44 | - | |
| X-205 Hdmi Sound Out Put Help Needed/ | 2022-03-28 16:44 | - | |
| X-205 S PDIF question/ | 2022-03-28 16:44 | - | |
| X-775 Batteries/ | 2022-03-28 16:44 | - | |
| X200 ( UK Version ) SLOW BOOT UP/ | 2022-03-28 16:44 | - | |
| X200 Cannot run Futuremark Vantage/ | 2022-03-28 16:44 | - | |
| X200 High CPU temperatures/ | 2022-03-28 16:44 | - | |
| X200 SERIES CUSTOM STICKER after request/ | 2022-03-28 16:44 | - | |
| X200 SLI in UK/ | 2022-03-28 16:44 | - | |
| X200 X205 Wxw/ | 2022-03-28 16:44 | - | |
| X200 adding second hard disc/ | 2022-03-28 16:44 | - | |
| X200 and Intel Turbo Memory (Robson Package)/ | 2022-03-28 16:44 | - | |
| X200 graphic memory - DDR2 or DDR3/ | 2022-03-28 16:44 | - | |
| X200 my mouse hand is on fire/ | 2022-03-28 16:44 | - | |
| X200 or X205 service manual/ | 2022-03-28 16:44 | - | |
| X200 win XP cd/ | 2022-03-28 16:44 | - | |
| X205+Crysis = Win/ | 2022-03-28 16:44 | - | |
| X205- 3 beeps no boot/ | 2022-03-28 16:44 | - | |
| X205-9359 3dmark06 score just 4310 pts/ | 2022-03-28 16:44 | - | |
| X205-9359 tough questions/ | 2022-03-28 16:44 | - | |
| X205-9800 XP load issues/ | 2022-03-28 16:44 | - | |
| X205-S5359 vs Gateway P-7811FX/ | 2022-03-28 16:44 | - | |
| X205-S7483 + T7700 = still want sli/ | 2022-03-28 16:44 | - | |
| X205-S7483 with FSX/ | 2022-03-28 16:44 | - | |
| X205-S7483 with XP install not showing my 2nd harddrive/ | 2022-03-28 16:44 | - | |
| X205-S9349 - Only 1080i/ | 2022-03-28 16:44 | - | |
| X205-S9349 - Upgrading RAM/ | 2022-03-28 16:44 | - | |
| X205-S9349- Where is it Manufactured/ | 2022-03-28 16:44 | - | |
| X205-S9349 Audio Jack Reversed/ | 2022-03-28 16:44 | - | |
| X205-S9349 Busted Graphics Card/ | 2022-03-28 16:44 | - | |
| X205-S9349 PLL chip identification/ | 2022-03-28 16:44 | - | |
| X205-S9349 Upgrades/ | 2022-03-28 16:44 | - | |
| X205-S9349 VISTA game compatibility/ | 2022-03-28 16:44 | - | |
| X205-S9349 Vista Services Not Starting/ | 2022-03-28 16:44 | - | |
| X205-S9349 and USB Readyboost/ | 2022-03-28 16:44 | - | |
| X205-S9349 burning PROBLEMS!!/ | 2022-03-28 16:44 | - | |
| X205-S9349 good enough processor/ | 2022-03-28 16:44 | - | |
| X205-S9349 questions/ | 2022-03-28 16:44 | - | |
| X205-S9349 tft screen driver. Where/ | 2022-03-28 16:44 | - | |
| X205-S9359 DVD burn problem/ | 2022-03-28 16:44 | - | |
| X205-S9359 Help!!/ | 2022-03-28 16:44 | - | |
| X205-S9359 XP drivers/ | 2022-03-28 16:44 | - | |
| X205-S9359 and 64 bit/ | 2022-03-28 16:44 | - | |
| X205-S9359 audio recording/ | 2022-03-28 16:44 | - | |
| X205-S9359 with 1680x1050 res/ | 2022-03-28 16:44 | - | |
| X205-S9800 8700m GT- What driver works for you/ | 2022-03-28 16:44 | - | |
| X205-S9800; PSPB9U-04N026 Headphone Jack messed up/ | 2022-03-28 16:44 | - | |
| X205-S9800 XP driver for 8700M GT/ | 2022-03-28 16:44 | - | |
| X205-S9800 XP guide/ | 2022-03-28 16:44 | - | |
| X205-S9800 beyond 4GB of RAM/ | 2022-03-28 16:44 | - | |
| X205-S9810 - problem after clean install of Vista/ | 2022-03-28 16:44 | - | |
| X205-SL1 Low Sound/ | 2022-03-28 16:44 | - | |
| X205-SLI1 64 Bit Fingerprint webcam question/ | 2022-03-28 16:44 | - | |
| X205-SLI1 8600m gt Drivers/ | 2022-03-28 16:44 | - | |
| X205-SLI1 9000+ 3dmark06/ | 2022-03-28 16:44 | - | |
| X205-SLI1 Can Not Play Gears of War/ | 2022-03-28 16:44 | - | |
| X205-SLI1 Gaming performance ( )/ | 2022-03-28 16:44 | - | |
| X205-SLI1 Owners Alert!!!!!/ | 2022-03-28 16:44 | - | |
| X205-SLI1 Sound Problems after Sleep Mode/ | 2022-03-28 16:44 | - | |
| X205-SLI1 and X205-SLI3 - Toshiba's False Advertising - Only has 256MB VRAM!/ | 2022-03-28 16:44 | - | |
| X205-SLI2 (Not 1 not 3 but TWO)/ | 2022-03-28 16:44 | - | |
| X205-SLI3, Windows 7 Ultimate x64/ | 2022-03-28 16:44 | - | |
| X205-SLI4 Crashes/ | 2022-03-28 16:44 | - | |
| X205-SLI4 has 1680×1050 display, but X205-SLI6 has 1440×900 WHY/ | 2022-03-28 16:44 | - | |
| X205-SLI5 and X205-SLI6/ | 2022-03-28 16:44 | - | |
| X205-SLI Question/ | 2022-03-28 16:44 | - | |
| X205-SLi - Newest Display Driver to keep stock HD DVD player/ | 2022-03-28 16:44 | - | |
| X205-SLi1 - Blank Screen, AGAIN!/ | 2022-03-28 16:44 | - | |
| X205-SLi1 Beep code and blank screen at startup/ | 2022-03-28 16:44 | - | |
| X205-SLi1 Bluetooth and Touchpad drivers/ | 2022-03-28 16:44 | - | |
| X205-SLi1 Processor CPU upgrade/ | 2022-03-28 16:44 | - | |
| X205-SLi1 Ram/ | 2022-03-28 16:44 | - | |
| X205-SLi1 Video Card Problem !!/ | 2022-03-28 16:44 | - | |
| X205-SLi1 Wireless Network Adapter/ | 2022-03-28 16:44 | - | |
| X205-SLi3-strange beeping sound/ | 2022-03-28 16:44 | - | |
| X205-SLi3 or X205-S9359/ | 2022-03-28 16:44 | - | |
| X205-SLi4 GPU temperature !/ | 2022-03-28 16:44 | - | |
| X205-SLi4 just died...help me!/ | 2022-03-28 16:44 | - | |
| X205-SLi5 8600M GT Driver/ | 2022-03-28 16:44 | - | |
| X205-SLi5 alternative battery power/ | 2022-03-28 16:44 | - | |
| X205-SLi6 cheaper than X205-SLi5 on newegg/ | 2022-03-28 16:44 | - | |
| X205-Sli1 - HD DVD Suddenly Stopped Playing HD DVDs/ | 2022-03-28 16:44 | - | |
| X205-Sli1.. RBDSS.sys blue screen and CMOS Checksum/ | 2022-03-28 16:44 | - | |
| X205-Sli2 Question/ | 2022-03-28 16:44 | - | |
| X205-Sli3 & win7x64/ | 2022-03-28 16:44 | - | |
| X205-Sli3- XP Video drivers with Sli/ | 2022-03-28 16:44 | - | |
| X205-Sli3/ | 2022-03-28 16:44 | - | |
| X205-Sli3 Benchmarks and warning/ | 2022-03-28 16:44 | - | |
| X205-Sli3 XP RE-install/ | 2022-03-28 16:44 | - | |
| X205-Sli3 and XP, Sound and Network WiFi Drivers/ | 2022-03-28 16:44 | - | |
| X205-downloading issue/ | 2022-03-28 16:44 | - | |
| X205-s7483/ | 2022-03-28 16:44 | - | |
| X205-s7483 owners- did you get a Vista Anytime Upgrade cd/ | 2022-03-28 16:44 | - | |
| X205-s9349/ | 2022-03-28 16:44 | - | |
| X205-s9349 Sound Issue/ | 2022-03-28 16:44 | - | |
| X205-s9349 and Vista ultimate x64 HD DVD Issues/ | 2022-03-28 16:44 | - | |
| X205-s9349 as HD-DVD Player with Dolby Digital Sound/ | 2022-03-28 16:44 | - | |
| X205-s9800 Hdd Question/ | 2022-03-28 16:44 | - | |
| X205-sli1 question/ | 2022-03-28 16:44 | - | |
| X205-sli1 temps/ | 2022-03-28 16:44 | - | |
| X205-sli3 SDHC/ | 2022-03-28 16:44 | - | |
| X205...Games and movies/ | 2022-03-28 16:44 | - | |
| X205...TV adapter/ | 2022-03-28 16:44 | - | |
| X205. Spilled coke on keyboard/ | 2022-03-28 16:44 | - | |
| X205 64bit support/ | 2022-03-28 16:44 | - | |
| X205 169.04 Rivatuner 2.06 OVERCLOCKING FINALLY!!/ | 2022-03-28 16:44 | - | |
| X205 BIOS Update 1.90/ | 2022-03-28 16:44 | - | |
| X205 Battery charge light/ | 2022-03-28 16:44 | - | |
| X205 Bios update, Penryn support!/ | 2022-03-28 16:44 | - | |
| X205 Core 2 Duo EXTREME X9000 with 8700M GT 767MB/ | 2022-03-28 16:44 | - | |
| X205 Disassembly Guide/ | 2022-03-28 16:44 | - | |
| X205 Dual-boot OS/ | 2022-03-28 16:44 | - | |
| X205 Ethernet Port doesn't work/ | 2022-03-28 16:44 | - | |
| X205 Front Side Bus Speeds/ | 2022-03-28 16:44 | - | |
| X205 Gaming on HD TV threw HDMI/ | 2022-03-28 16:44 | - | |
| X205 Graphics Drivers/ | 2022-03-28 16:44 | - | |
| X205 HD-DVD HDMI need help/ | 2022-03-28 16:44 | - | |
| X205 HDMI out, Cutting off edges/ | 2022-03-28 16:44 | - | |
| X205 HDMI output to projector- best settings/ | 2022-03-28 16:44 | - | |
| X205 Hotkeys/ | 2022-03-28 16:44 | - | |
| X205 Line in out problem/ | 2022-03-28 16:44 | - | |
| X205 Memory speed/ | 2022-03-28 16:44 | - | |
| X205 Missing Power Options/ | 2022-03-28 16:44 | - | |
| X205 Processor Upgrade/ | 2022-03-28 16:44 | - | |
| X205 Questions/ | 2022-03-28 16:44 | - | |
| X205 Quick Keys question/ | 2022-03-28 16:44 | - | |
| X205 Remote/ | 2022-03-28 16:44 | - | |
| X205 Repaired via Toshiba Depot/ | 2022-03-28 16:44 | - | |
| X205 Running Hot!/ | 2022-03-28 16:44 | - | |
| X205 S9349 and 9359-Recording phase error (CD DVD write)/ | 2022-03-28 16:44 | - | |
| X205 S9359 BOSD nvlddmkm.sys on boot/ | 2022-03-28 16:44 | - | |
| X205 SL1 trackpad settings/ | 2022-03-28 16:44 | - | |
| X205 SLI-1 or 3 genuine nforce SLI chipset/ | 2022-03-28 16:44 | - | |
| X205 SLI1 CPU Upgrade/ | 2022-03-28 16:44 | - | |
| X205 SLI 1 gaming possibilites/ | 2022-03-28 16:44 | - | |
| X205 SLI 1 price reduction/ | 2022-03-28 16:44 | - | |
| X205 SLi1 - Blank Screen issue/ | 2022-03-28 16:44 | - | |
| X205 SLi1 - Issue with Power Saver/ | 2022-03-28 16:44 | - | |
| X205 SLi1 Penryn T9300 Upgrade results/ | 2022-03-28 16:44 | - | |
| X205 SLi1 Upgrades/ | 2022-03-28 16:44 | - | |
| X205 SQUEELING noise what is it/ | 2022-03-28 16:44 | - | |
| X205Sli3 WON'T Run Bioshock....help/ | 2022-03-28 16:44 | - | |
| X205 Sli Best Video Driver/ | 2022-03-28 16:44 | - | |
| X205 Thought/ | 2022-03-28 16:44 | - | |
| X205 Upgrades/ | 2022-03-28 16:44 | - | |
| X205 Vista Clean Install/ | 2022-03-28 16:44 | - | |
| X205 Volume Bar!/ | 2022-03-28 16:44 | - | |
| X205 X200 What are your idle temperatures/ | 2022-03-28 16:44 | - | |
| X205 XP vs Vista Video Driver!/ | 2022-03-28 16:44 | - | |
| X205 and DVD Sound/ | 2022-03-28 16:44 | - | |
| X205 and Vista HD Audio Drivers/ | 2022-03-28 16:44 | - | |
| X205 and X200 - the same laptop/ | 2022-03-28 16:44 | - | |
| X205 and XP/ | 2022-03-28 16:44 | - | |
| X205 and wireless N/ | 2022-03-28 16:44 | - | |
| X205 bus speeds/ | 2022-03-28 16:44 | - | |
| X205 game upgrade/ | 2022-03-28 16:44 | - | |
| X205 hard drive real size/ | 2022-03-28 16:44 | - | |
| X205 help!/ | 2022-03-28 16:44 | - | |
| X205 issue/ | 2022-03-28 16:44 | - | |
| X205 owners, a question about access to the heatsink/ | 2022-03-28 16:44 | - | |
| X205 question/ | 2022-03-28 16:44 | - | |
| X205 sli-1 Dual hdd troubles/ | 2022-03-28 16:44 | - | |
| X205 sli1 3dmark 06 in xp/ | 2022-03-28 16:44 | - | |
| X205 sli 1 and vista 64/ | 2022-03-28 16:44 | - | |
| X205 sli1 question/ | 2022-03-28 16:44 | - | |
| X205 sli3 with 256 dedicated Vram wtf/ | 2022-03-28 16:44 | - | |
| X205 strange sounds, help !!!/ | 2022-03-28 16:44 | - | |
| X205 system volume/ | 2022-03-28 16:44 | - | |
| X205 temps/ | 2022-03-28 16:44 | - | |
| X205 weird Hard Drive BEEEP/ | 2022-03-28 16:44 | - | |
| X205 with HDTV/ | 2022-03-28 16:44 | - | |
| X205 won't Boot from CD DVD/ | 2022-03-28 16:44 | - | |
| X300-11S vs Sony Vaio FW11ZU/ | 2022-03-28 16:44 | - | |
| X300-11s sound stutter and popping/ | 2022-03-28 16:44 | - | |
| X300 Laptop Freezing/ | 2022-03-28 16:44 | - | |
| X305-706 Video Drivers/ | 2022-03-28 16:44 | - | |
| X305- Changing the looks completely/ | 2022-03-28 16:44 | - | |
| X305-Q701 Speakers problem ( replacement possible )/ | 2022-03-28 16:44 | - | |
| X305-Q701 Temperatures/ | 2022-03-28 16:44 | - | |
| X305-Q705 xp drivers/ | 2022-03-28 16:44 | - | |
| X305-Q706 Info/ | 2022-03-28 16:44 | - | |
| X305-Q708...What do you think/ | 2022-03-28 16:44 | - | |
| X305-q702/ | 2022-03-28 16:44 | - | |
| X305-q705/ | 2022-03-28 16:44 | - | |
| X305-q725/ | 2022-03-28 16:44 | - | |
| X305. Omg!/ | 2022-03-28 16:44 | - | |
| X305 Q701 CPU upgrade overclock question/ | 2022-03-28 16:44 | - | |
| X305 Q701 RAM Question/ | 2022-03-28 16:44 | - | |
| X305 complete shutdown while playing games/ | 2022-03-28 16:44 | - | |
| X305 is now an outlet item at best buy/ | 2022-03-28 16:44 | - | |
| X500(X505)- Noisy fans after 1 year/ | 2022-03-28 16:44 | - | |
| X500(X505) brightness bios update 2.90- no adustment/ | 2022-03-28 16:44 | - | |
| X500(X505) performance temperature under heavy games/ | 2022-03-28 16:44 | - | |
| X500-165 Drool/ | 2022-03-28 16:44 | - | |
| X500-Q892 - HDD upgrade, will the 2TB drives work(SATA 3.0 vs SATA 1.5)/ | 2022-03-28 16:44 | - | |
| X500 - faster WiFi - own project/ | 2022-03-28 16:44 | - | |
| X500 1333mhx ram upgrade/ | 2022-03-28 16:44 | - | |
| X500 BSOD resolved/ | 2022-03-28 16:44 | - | |
| X500 GTX460M Open CL/ | 2022-03-28 16:44 | - | |
| X500 audio recording device/ | 2022-03-28 16:44 | - | |
| X505-Q830 or 7901H FX/ | 2022-03-28 16:44 | - | |
| X505-Q865 brief hands on/ | 2022-03-28 16:44 | - | |
| X505-Q893 - I got one!!!/ | 2022-03-28 16:44 | - | |
| X505-Q8100X Question/ | 2022-03-28 16:44 | - | |
| X505-q890/ | 2022-03-28 16:44 | - | |
| X505-q8100/ | 2022-03-28 16:44 | - | |
| X505 Backlit Keyboard upgrade Replacement/ | 2022-03-28 16:44 | - | |
| X505 Qosmio and NotePal U3 Cooler/ | 2022-03-28 16:44 | - | |
| X505 Screen Calibration Mini Guide/ | 2022-03-28 16:44 | - | |
| X505 Series Laptop - Strange Problem With Desktop Icons/ | 2022-03-28 16:44 | - | |
| X775-7275 and HM65 problem/ | 2022-03-28 16:44 | - | |
| X775 CPU swap/ | 2022-03-28 16:44 | - | |
| X775 X770 Disassemble Thermal Repaste/ | 2022-03-28 16:44 | - | |
| X775 brightness problem/ | 2022-03-28 16:44 | - | |
| X870 3D Laptop With Core i7-3610QM and GeForce GTX 670M/ | 2022-03-28 16:44 | - | |
| X9000 works in a Portege M700/ | 2022-03-28 16:44 | - | |
| XBox 360 & X205-S9359/ | 2022-03-28 16:44 | - | |
| XP 64Bit X205-S7483/ | 2022-03-28 16:44 | - | |
| XP A205 sound question/ | 2022-03-28 16:44 | - | |
| XP Driver for Toshiba Satellite A205-S4587/ | 2022-03-28 16:44 | - | |
| XP Drivers for A205-S5880/ | 2022-03-28 16:44 | - | |
| XP Drivers for Toshiba A205-S5800/ | 2022-03-28 16:44 | - | |
| XP Drivers for Toshiba L300-ST2501/ | 2022-03-28 16:44 | - | |
| XP Drivers for Toshiba Satellite A135 S4656/ | 2022-03-28 16:44 | - | |
| XP SATA Drivers 4 Toshiba A105/ | 2022-03-28 16:44 | - | |
| XP WI-FI Driver for toshiba P205-S6267/ | 2022-03-28 16:44 | - | |
| XP drivers needed for Tecra S3 Model PTS30/ | 2022-03-28 16:44 | - | |
| XP install on A210 - What Toshiba utilities are really needed/ | 2022-03-28 16:44 | - | |
| XP on A205-s4777 Intel Matrix Storage Manager/ | 2022-03-28 16:44 | - | |
| XP on Satellite A300-05U/ | 2022-03-28 16:44 | - | |
| XP on X205-S9810, and other choices/ | 2022-03-28 16:44 | - | |
| XP on x205 SLI1/ | 2022-03-28 16:44 | - | |
| XP pci device/ | 2022-03-28 16:44 | - | |
| XP start up/ | 2022-03-28 16:44 | - | |
| XP upgrade issues (M35-S456)/ | 2022-03-28 16:44 | - | |
| XP vs Vista Article/ | 2022-03-28 16:44 | - | |
| Xp 64bit on x205 9349/ | 2022-03-28 16:44 | - | |
| Xp Drivers for Toshiba/ | 2022-03-28 16:44 | - | |
| Xp Drivers for Toshiba Satellite A135-S2286/ | 2022-03-28 16:44 | - | |
| Xp Pro/ | 2022-03-28 16:44 | - | |
| Xp drivers for Toshiba Satellite/ | 2022-03-28 16:44 | - | |
| Xp home Xp pro/ | 2022-03-28 16:44 | - | |
| Xp vista dual boot video driver problem X205/ | 2022-03-28 16:44 | - | |
| YEE-HAW! Finally XP drivers from Toshiba for my A200/ | 2022-03-28 16:44 | - | |
| YES i got a X7800 in X205-SLI1..but/ | 2022-03-28 16:44 | - | |
| Yay....Toshiba Satellite A205-S5812/ | 2022-03-28 16:44 | - | |
| Yeah.. so about Qosmio-X305. [WOW!!!]/ | 2022-03-28 16:44 | - | |
| Yellow Display Screen on satellite M65-5821/ | 2022-03-28 16:44 | - | |
| You're going to laugh, but... (Toshiba 2800)/ | 2022-03-28 16:44 | - | |
| You can customized the M8 now/ | 2022-03-28 16:44 | - | |
| You don't have rights to run 'Power Saver' says my 'A50'/ | 2022-03-28 16:44 | - | |
| Your Experience with M50-MX2/ | 2022-03-28 16:44 | - | |
| Your X305-Q706 laptop experience/ | 2022-03-28 16:44 | - | |
| Your thoughts on UPS fixing your Laptop!/ | 2022-03-28 16:44 | - | |
| Z30 BIOS Update/ | 2022-03-28 16:44 | - | |
| Z30 USB ports...3.0 or not/ | 2022-03-28 16:44 | - | |
| Z830 - CPU Re-paste/ | 2022-03-28 16:44 | - | |
| Z830 - Looks Thread/ | 2022-03-28 16:44 | - | |
| Z835 Fan Noise/ | 2022-03-28 16:44 | - | |
| ZOMG updated my Qosmio G35-AV/ | 2022-03-28 16:44 | - | |
| Zalman NC-1000 Notebook Cooler and the A300/ | 2022-03-28 16:44 | - | |
| Zoom In Zoom Out Feature how to adjust/ | 2022-03-28 16:44 | - | |
| [A strange comparison] Toshiba Portégé R200 vs Portégé R500/ | 2022-03-28 16:44 | - | |
| [HELP] How to open Toshiba S1620cds/ | 2022-03-28 16:44 | - | |
| [HELP] Portege R100 can't boot to my external drive/ | 2022-03-28 16:44 | - | |
| [Help]A300-1I4 (PSAGCE)/ | 2022-03-28 16:44 | - | |
| [Help] Satellite m155 error after 1.5 BIOS upgrade/ | 2022-03-28 16:44 | - | |
| [Help] VGA bios for Toshiba satellite L755/ | 2022-03-28 16:44 | - | |
| [Q] Cpu Upgrade for Satellite L875D-S7332/ | 2022-03-28 16:44 | - | |
| [Qosmio X305-Q701][HD Windows Vista Home Premium problem]/ | 2022-03-28 16:44 | - | |
| [REQUEST] Toshiba C660D-10W Unlocked Bios/ | 2022-03-28 16:44 | - | |
| [REQUEST] Unlock Bios Toshiba Satellite L75D-A7288/ | 2022-03-28 16:44 | - | |
| [Satellite A100-237] Dithered screen/ | 2022-03-28 16:44 | - | |
| [URGENT]Request a Picture of LCD Cable Qosmio X305/ | 2022-03-28 16:44 | - | |
| [ ] Toshiba Satellite A665-S6070 with i7 ES CPU/ | 2022-03-28 16:44 | - | |
| [help]About bluetooth of R835-P56x/ | 2022-03-28 16:44 | - | |
| [help] problem to install xp on u305-s7446/ | 2022-03-28 16:44 | - | |
| [request] Toshiba Satellite L200-N401D Fn drivers/ | 2022-03-28 16:44 | - | |
| a10 network problem/ | 2022-03-28 16:39 | - | |
| a15 lcd demon!!/ | 2022-03-28 16:39 | - | |
| a30 any good/ | 2022-03-28 16:39 | - | |
| a45 memory and hard drive/ | 2022-03-28 16:39 | - | |
| a75-s2112 drivers/ | 2022-03-28 16:40 | - | |
| a75 s229/ | 2022-03-28 16:40 | - | |
| a100-599 t7200/ | 2022-03-28 16:39 | - | |
| a100-sk9/ | 2022-03-28 16:39 | - | |
| a105-s4004 acting strange/ | 2022-03-28 16:39 | - | |
| a105-s4024 hard drive/ | 2022-03-28 16:39 | - | |
| a135-s2246 atheros wifi vista problem!/ | 2022-03-28 16:39 | - | |
| a135-s4427 wont shut down/ | 2022-03-28 16:39 | - | |
| a135-s4527 Windows XP Drivers/ | 2022-03-28 16:39 | - | |
| a135-s4527 dead (powers on, won't post, no video - even external)/ | 2022-03-28 16:39 | - | |
| a200 + XP + FN keys/ | 2022-03-28 16:39 | - | |
| a200-st2043 xp fn key drivers/ | 2022-03-28 16:39 | - | |
| a200 problem/ | 2022-03-28 16:39 | - | |
| a200 th1 psae3c th108c CONSTANT BSOD!!!/ | 2022-03-28 16:39 | - | |
| a205, lagging very much on XP/ | 2022-03-28 16:39 | - | |
| a205-s4567 UPGRADE to XP Drivers/ | 2022-03-28 16:39 | - | |
| a205-s4777/ | 2022-03-28 16:39 | - | |
| a205-s5800-need sata drivers for xp-can someone plz help!!/ | 2022-03-28 16:39 | - | |
| a205-s5800 wont recognize hd/ | 2022-03-28 16:39 | - | |
| a205-s5812 DVD question/ | 2022-03-28 16:39 | - | |
| a205-s5814 Ethernet controller for XP/ | 2022-03-28 16:39 | - | |
| a205 really hot/ | 2022-03-28 16:39 | - | |
| a205 s6808/ | 2022-03-28 16:39 | - | |
| a215-s7444 Replacing LCD/ | 2022-03-28 16:39 | - | |
| a300-1bz. Who's got one/ | 2022-03-28 16:39 | - | |
| a300 - Hard Drive making a buzzing grating noise/ | 2022-03-28 16:39 | - | |
| a300 harman kardon speakers/ | 2022-03-28 16:39 | - | |
| a305-s6898 video playback/ | 2022-03-28 16:39 | - | |
| a500 wireless/ | 2022-03-28 16:39 | - | |
| about TOSHIBA Tecra m5-s5331/ | 2022-03-28 16:40 | - | |
| about dead M35X/ | 2022-03-28 16:40 | - | |
| about the m100/ | 2022-03-28 16:40 | - | |
| about toshiba satellite e105-s1802/ | 2022-03-28 16:40 | - | |
| about updating video drivers on x300/ | 2022-03-28 16:40 | - | |
| accident!! uninstalled drivers/ | 2022-03-28 16:40 | - | |
| a couple strange problems/ | 2022-03-28 16:39 | - | |
| adjust video memory/ | 2022-03-28 16:40 | - | |
| advice!! x205-s9800/ | 2022-03-28 16:40 | - | |
| advice on Toshiba Tecra A2/ | 2022-03-28 16:40 | - | |
| aggravating prblem with x500 and eco utility button/ | 2022-03-28 16:40 | - | |
| ahci sata @ toshiba a300/ | 2022-03-28 16:40 | - | |
| all GeFore FX users that care about HL2 read this!/ | 2022-03-28 16:40 | - | |
| alps touchi pad confguration/ | 2022-03-28 16:40 | - | |
| any1 get bioshock to work on X205-SLI1/ | 2022-03-28 16:40 | - | |
| any1 having trouble with firefox/ | 2022-03-28 16:40 | - | |
| any difference p15-s409 and p15-s4091/ | 2022-03-28 16:40 | - | |
| any info on the f55 q502/ | 2022-03-28 16:40 | - | |
| any news on that new qosmio launching in april/ | 2022-03-28 16:40 | - | |
| anyone else got the m65-s809/ | 2022-03-28 16:40 | - | |
| any one else have the save problem with X205 SLi1/ | 2022-03-28 16:40 | - | |
| anyone got an m5 yet/ | 2022-03-28 16:40 | - | |
| anyone have the M700 recovery disk/ | 2022-03-28 16:40 | - | |
| anyone know/ | 2022-03-28 16:40 | - | |
| any one know where to get toshiba x200 win7 64 driver/ | 2022-03-28 16:40 | - | |
| anyone knwo hwo to remove back of m45-s265/ | 2022-03-28 16:40 | - | |
| anyone who will be doing a cpu upgrade on a x205/ | 2022-03-28 16:40 | - | |
| any places to get a sweet deal on toshiba's/ | 2022-03-28 16:40 | - | |
| any review for Tecra A7 please/ | 2022-03-28 16:40 | - | |
| anything better than portege R835-P70/ | 2022-03-28 16:40 | - | |
| any thoughts on the Tecra A8-130/ | 2022-03-28 16:40 | - | |
| any toshiba protege m300 owner/ | 2022-03-28 16:40 | - | |
| are there flash cards for xp/ | 2022-03-28 16:40 | - | |
| are those really xp drivers for A200 A205/ | 2022-03-28 16:40 | - | |
| ati x600 in m60 and nvidia 6600 in qosmio g25 Are they exchangeable/ | 2022-03-28 16:40 | - | |
| a toshiba laptop for $7,000 on ebay/ | 2022-03-28 16:39 | - | |
| at wits end/ | 2022-03-28 16:40 | - | |
| audio device/ | 2022-03-28 16:40 | - | |
| audio divers problem/ | 2022-03-28 16:40 | - | |
| audio problem on satellite/ | 2022-03-28 16:40 | - | |
| averatec bios gone/ | 2022-03-28 16:40 | - | |
| bad flash on toshiba a300/ | 2022-03-28 16:40 | - | |
| bad image checksum/ | 2022-03-28 16:40 | - | |
| base system device/ | 2022-03-28 16:40 | - | |
| battery/ | 2022-03-28 16:40 | - | |
| battery drains when noteboob on sleep/ | 2022-03-28 16:40 | - | |
| battery performance on A200/ | 2022-03-28 16:40 | - | |
| battery plug in, but not charging after installing Vista Service Pack 2/ | 2022-03-28 16:40 | - | |
| battery question/ | 2022-03-28 16:40 | - | |
| best HD for toshiba satellite/ | 2022-03-28 16:40 | - | |
| best nootbook mouny could buy/ | 2022-03-28 16:40 | - | |
| best place for drivers toshiba satellite 1115-S103/ | 2022-03-28 16:40 | - | |
| best way to rid of toshiba crapware/ | 2022-03-28 16:40 | - | |
| better battery for Toshiba/ | 2022-03-28 16:40 | - | |
| better config/ | 2022-03-28 16:40 | - | |
| bios 1.50-win/ | 2022-03-28 16:40 | - | |
| bios 1.70-win/ | 2022-03-28 16:40 | - | |
| bioshock amazing on x205/ | 2022-03-28 16:40 | - | |
| bios password/ | 2022-03-28 16:40 | - | |
| bios problem after reseting password/ | 2022-03-28 16:40 | - | |
| bios update - windows vista/ | 2022-03-28 16:40 | - | |
| bios update/ | 2022-03-28 16:40 | - | |
| bios update 1.90 for vista laptop- Satellite A200-TH7 (PSAE6C-TH70DC)/ | 2022-03-28 16:40 | - | |
| bios update for m30 special ed= m30/ | 2022-03-28 16:40 | - | |
| bios update query/ | 2022-03-28 16:40 | - | |
| black screen/ | 2022-03-28 16:40 | - | |
| blue screen of death crashes/ | 2022-03-28 16:40 | - | |
| bluetooth adapter needed/ | 2022-03-28 16:40 | - | |
| bluetooth mouse connection problem/ | 2022-03-28 16:40 | - | |
| board changing/ | 2022-03-28 16:40 | - | |
| bob/ | 2022-03-28 16:40 | - | |
| booting/ | 2022-03-28 16:40 | - | |
| booting recovery CD via USB CD Rom...pls help -(/ | 2022-03-28 16:40 | - | |
| bootmgr is missing/ | 2022-03-28 16:40 | - | |
| brand new c655d-s5136 touchpad issues/ | 2022-03-28 16:40 | - | |
| brightness buttons doing opposite commands/ | 2022-03-28 16:40 | - | |
| broken screen- A300-1J1. where to get it fixed and how much/ | 2022-03-28 16:40 | - | |
| budget speaker for harman kardon/ | 2022-03-28 16:40 | - | |
| built in mic's/ | 2022-03-28 16:40 | - | |
| buying a spare battery for my x300 305/ | 2022-03-28 16:40 | - | |
| buy my qosmio x505-q870 on ebay!/ | 2022-03-28 16:40 | - | |
| camera assistant software not working/ | 2022-03-28 16:40 | - | |
| can't copy files to cd/ | 2022-03-28 16:40 | - | |
| can't install drivers, system doesn't meet requirements/ | 2022-03-28 16:40 | - | |
| can't use DVD button/ | 2022-03-28 16:40 | - | |
| can anyone/ | 2022-03-28 16:40 | - | |
| can ddr1 be upgraded to ddr2/ | 2022-03-28 16:40 | - | |
| can i OC my a505-s6965/ | 2022-03-28 16:40 | - | |
| can i have an example of what people mean/ | 2022-03-28 16:40 | - | |
| can i run/ | 2022-03-28 16:40 | - | |
| cannot factory reset format x305 q701/ | 2022-03-28 16:40 | - | |
| cannot find P200-1C9 can you!/ | 2022-03-28 16:40 | - | |
| can som1 provide picture of M30 series/ | 2022-03-28 16:40 | - | |
| cant open laptop cover/ | 2022-03-28 16:40 | - | |
| ccfl or led/ | 2022-03-28 16:40 | - | |
| cd dvd drive accoustic silencer.Working/ | 2022-03-28 16:40 | - | |
| cd dvd drive problems/ | 2022-03-28 16:40 | - | |
| cd dvd rom drives/ | 2022-03-28 16:40 | - | |
| change screen on A300/ | 2022-03-28 16:40 | - | |
| changing ide to achi/ | 2022-03-28 16:40 | - | |
| changing the processor on qosmio x300/ | 2022-03-28 16:40 | - | |
| charger connection problems/ | 2022-03-28 16:40 | - | |
| check cable connection, no bootable device/ | 2022-03-28 16:40 | - | |
| chip stuck in bridge media adapter/ | 2022-03-28 16:40 | - | |
| choosing the right laptop (new member)/ | 2022-03-28 16:40 | - | |
| cleaning the laptop/ | 2022-03-28 16:40 | - | |
| clean installation windows 7 for toshiba tecra m9 pmt90e laptop/ | 2022-03-28 16:40 | - | |
| clean install xp pro in Toshiba satellite 1135-s1554/ | 2022-03-28 16:40 | - | |
| clicking poping sound in Realtek HD sound card/ | 2022-03-28 16:40 | - | |
| click on hover. evil/ | 2022-03-28 16:40 | - | |
| cmos/ | 2022-03-28 16:40 | - | |
| color plate/ | 2022-03-28 16:40 | - | |
| command.com not found/ | 2022-03-28 16:40 | - | |
| common module doesnt install/ | 2022-03-28 16:40 | - | |
| company of heroes on x205/ | 2022-03-28 16:40 | - | |
| compatible dvd cd rw drives/ | 2022-03-28 16:40 | - | |
| configuration woes/ | 2022-03-28 16:40 | - | |
| configuring media buttons/ | 2022-03-28 16:40 | - | |
| considering the portege/ | 2022-03-28 16:40 | - | |
| corrup bios in toshiba donwload page/ | 2022-03-28 16:40 | - | |
| cost of laptop/ | 2022-03-28 16:40 | - | |
| could not install new video driver on Q850/ | 2022-03-28 16:40 | - | |
| cpu fan spinning wildly at times/ | 2022-03-28 16:40 | - | |
| cpu fan suddenly turning up too high/ | 2022-03-28 16:40 | - | |
| cpu upgrade/ | 2022-03-28 16:40 | - | |
| cpu upgrade for A215-S7444/ | 2022-03-28 16:40 | - | |
| cpu upgrade in Toshiba M70.. question/ | 2022-03-28 16:40 | - | |
| cpu upgrade on equium p200/ | 2022-03-28 16:40 | - | |
| crapy toshiba/ | 2022-03-28 16:40 | - | |
| crippled XP Pro w Tecra A2/ | 2022-03-28 16:40 | - | |
| crisis disk for satellite A200-1AE/ | 2022-03-28 16:40 | - | |
| current laptop-Qosmio G25 looking 2 replace/ | 2022-03-28 16:40 | - | |
| customizable x205/ | 2022-03-28 16:40 | - | |
| customize Qosmio/ | 2022-03-28 16:40 | - | |
| dc jack info/ | 2022-03-28 16:40 | - | |
| ddr2 is it backward compatible/ | 2022-03-28 16:40 | - | |
| dead pixel on screen even before collection - SHOULD I ACCEPT IT/ | 2022-03-28 16:40 | - | |
| dead toshiba L650-108/ | 2022-03-28 16:40 | - | |
| decrapifying a new satellite a135/ | 2022-03-28 16:40 | - | |
| dell vs toshiba, which is better/ | 2022-03-28 16:40 | - | |
| determining Tecra A10 model number for support downloads/ | 2022-03-28 16:40 | - | |
| did futureshop lie A100-VA9 5400 rpm hd/ | 2022-03-28 16:40 | - | |
| did someone say that they are going to debut the successor to the qosmio x300 series in april/ | 2022-03-28 16:40 | - | |
| dirty screen/ | 2022-03-28 16:40 | - | |
| disable the auto select feature/ | 2022-03-28 16:40 | - | |
| disable top screen pull down/ | 2022-03-28 16:40 | - | |
| disassamble Toshiba Sattelite A45-S120. help please/ | 2022-03-28 16:40 | - | |
| disc that came with laptop/ | 2022-03-28 16:40 | - | |
| do any of the x205's have a dual lamp screen/ | 2022-03-28 16:40 | - | |
| does A205-S4567 has a webcam/ | 2022-03-28 16:40 | - | |
| does nb200 use 2.5'' harddrive/ | 2022-03-28 16:40 | - | |
| does your cursor jump when typing on laptop/ | 2022-03-28 16:40 | - | |
| downgrade to xp/ | 2022-03-28 16:40 | - | |
| downgrating to win XP do i need drivers/ | 2022-03-28 16:40 | - | |
| do you think they are the same models/ | 2022-03-28 16:40 | - | |
| driver for modem device on high definition audio device/ | 2022-03-28 16:40 | - | |
| drivers A135-S2396 for XP/ | 2022-03-28 16:40 | - | |
| drivers for L35-SP2051/ | 2022-03-28 16:40 | - | |
| drivers needed/ | 2022-03-28 16:40 | - | |
| drive will not boot/ | 2022-03-28 16:40 | - | |
| dual screening/ | 2022-03-28 16:40 | - | |
| dvd drive problem on M105-3001 laptop/ | 2022-03-28 16:40 | - | |
| dvd ram drive problems on satellite m40/ | 2022-03-28 16:40 | - | |
| dynabook ss rx2/ | 2022-03-28 16:40 | - | |
| engadget reports Toshiba will use AMD mobile processors/ | 2022-03-28 16:40 | - | |
| equium M40x additional HDD/ | 2022-03-28 16:40 | - | |
| equium not working, help needed/ | 2022-03-28 16:40 | - | |
| etd control center/ | 2022-03-28 16:40 | - | |
| ethernet problem/ | 2022-03-28 16:40 | - | |
| event viewer question/ | 2022-03-28 16:40 | - | |
| ever heard of A200-128 (Turion X2 + HD 2600)/ | 2022-03-28 16:40 | - | |
| experience with Toshiba/ | 2022-03-28 16:40 | - | |
| express media player/ | 2022-03-28 16:40 | - | |
| external monitor/ | 2022-03-28 16:40 | - | |
| external or internal microphone does not work in Satellite s5034/ | 2022-03-28 16:40 | - | |
| external sound card prob/ | 2022-03-28 16:40 | - | |
| extra memory needed for my M45-S355/ | 2022-03-28 16:40 | - | |
| factory resealed/ | 2022-03-28 16:40 | - | |
| fan revs up and down continually almost/ | 2022-03-28 16:40 | - | |
| fan speed control/ | 2022-03-28 16:40 | - | |
| faster memory made my cpu faster/ | 2022-03-28 16:40 | - | |
| find spec of z10t PT141A-059025/ | 2022-03-28 16:40 | - | |
| firewire port to SATELLITE L70-A-138/ | 2022-03-28 16:40 | - | |
| flash cards, cpu and ram/ | 2022-03-28 16:40 | - | |
| for Satellite A200 Nvidia 7300 Go WinXP drivers/ | 2022-03-28 16:40 | - | |
| for Tecra a6 (pta60e) possessor or anyone interested/ | 2022-03-28 16:40 | - | |
| for owners of toshiba satellite a300 series/ | 2022-03-28 16:40 | - | |
| front heardphone port not working correctly/ | 2022-03-28 16:40 | - | |
| gaming video's - sli1/ | 2022-03-28 16:40 | - | |
| gdines/ | 2022-03-28 16:40 | - | |
| geforce fx go5200 supported resolution not available in Display Properties/ | 2022-03-28 16:40 | - | |
| generic batteries/ | 2022-03-28 16:40 | - | |
| global warranty/ | 2022-03-28 16:40 | - | |
| going back to xp/ | 2022-03-28 16:40 | - | |
| going from 9-cell batt to 12-cell on p105/ | 2022-03-28 16:40 | - | |
| good news x775 user. nvidia 285.38 beta driver works on x775 series with gtx 560m -D/ | 2022-03-28 16:40 | - | |
| graphic corruption glitch on Vista desktop (tops of windows, sidebar)/ | 2022-03-28 16:40 | - | |
| half-life 2 (and others) and the satellite a105 s4334/ | 2022-03-28 16:40 | - | |
| hard-drive help please/ | 2022-03-28 16:40 | - | |
| hard disk partitioning and recovery cd on m40/ | 2022-03-28 16:40 | - | |
| harddisk upgrade(Portege 7220cte)/ | 2022-03-28 16:40 | - | |
| hard drive question/ | 2022-03-28 16:40 | - | |
| harman kardon on x200 . does it have an woofer/ | 2022-03-28 16:40 | - | |
| has any pricing been leaked anywhere about the x305/ | 2022-03-28 16:40 | - | |
| hdd password help!!!/ | 2022-03-28 16:40 | - | |
| heats & noise of Toshiba U305-7477/ | 2022-03-28 16:40 | - | |
| hello i have the x505 q880 can i upgrade the 360m to 460m please i try to find answer/ | 2022-03-28 16:40 | - | |
| help!! cpu upgrade problem !!/ | 2022-03-28 16:40 | - | |
| help! dropped my Satellite M30/ | 2022-03-28 16:40 | - | |
| help! harddisk driver not found/ | 2022-03-28 16:40 | - | |
| help - cannot adjust brightness after display driver update/ | 2022-03-28 16:40 | - | |
| help - cannot read cpu temp/ | 2022-03-28 16:40 | - | |
| help asked- backup computer in vista/ | 2022-03-28 16:40 | - | |
| help changing media buttons/ | 2022-03-28 16:40 | - | |
| help for my Sp6000/ | 2022-03-28 16:40 | - | |
| help keyboard removal toshiba l40/ | 2022-03-28 16:40 | - | |
| help me (new user) identify my model number/ | 2022-03-28 16:40 | - | |
| help me optimize!/ | 2022-03-28 16:40 | - | |
| help me plz!/ | 2022-03-28 16:40 | - | |
| help needed/ | 2022-03-28 16:40 | - | |
| help newbe here with control button/ | 2022-03-28 16:40 | - | |
| help please!!!! neone Satellite 1135-S1552/ | 2022-03-28 16:40 | - | |
| help please!/ | 2022-03-28 16:40 | - | |
| help tecra m5 s4332 display after/ | 2022-03-28 16:40 | - | |
| help to choose/ | 2022-03-28 16:40 | - | |
| help with drivers for x300/ | 2022-03-28 16:40 | - | |
| help with keyboard/ | 2022-03-28 16:40 | - | |
| help with my new Toshiba laptop/ | 2022-03-28 16:40 | - | |
| help with my toshiba, no battery meter/ | 2022-03-28 16:40 | - | |
| help with toolbar/ | 2022-03-28 16:40 | - | |
| help with toshiba bluetooth/ | 2022-03-28 16:40 | - | |
| help yall its about my satego x200 laptop ,want to downvolt the gpu/ | 2022-03-28 16:40 | - | |
| hi can i put 100gb hard drive to my a85/ | 2022-03-28 16:40 | - | |
| high pitched noise near cpu motherboard area/ | 2022-03-28 16:40 | - | |
| hi guys new toshiba a85-s107 problem/ | 2022-03-28 16:40 | - | |
| hi guys want to upgrade the memory of my a85-s107/ | 2022-03-28 16:40 | - | |
| ho do I get to the 2 bottons under the touch pad to clean them satellite m105/ | 2022-03-28 16:40 | - | |
| hotkeys and functions on toshiba L505-S6951/ | 2022-03-28 16:40 | - | |
| how can i have ghost image (norton 2003 ) for vista/ | 2022-03-28 16:40 | - | |
| how do I activate my camara on my Toshiba Satellite Lap Top/ | 2022-03-28 16:40 | - | |
| how do I add memory to u205-s5057/ | 2022-03-28 16:40 | - | |
| how do i clean the kyboard from the inside in my A205/ | 2022-03-28 16:40 | - | |
| how do i run the recovery disk/ | 2022-03-28 16:40 | - | |
| how glossy is screen/ | 2022-03-28 16:40 | - | |
| how long for customized laptop/ | 2022-03-28 16:40 | - | |
| how long the Notebook Sat. Pro U200-10B should be charged for the first time/ | 2022-03-28 16:40 | - | |
| how long to charge new laptop batteries/ | 2022-03-28 16:40 | - | |
| how much time you get on M30X battery/ | 2022-03-28 16:40 | - | |
| how often does toshiba have discounts/ | 2022-03-28 16:40 | - | |
| how to access memory tecra a5/ | 2022-03-28 16:40 | - | |
| how to adjust screen brightness. Help please!!!/ | 2022-03-28 16:40 | - | |
| how to adjust the fan a85/ | 2022-03-28 16:40 | - | |
| how to care laptop battery/ | 2022-03-28 16:40 | - | |
| how to change keyboard on a toshiba z830/ | 2022-03-28 16:40 | - | |
| how to free up space on ssd for x505-q898/ | 2022-03-28 16:40 | - | |
| how to get updates for a75/ | 2022-03-28 16:40 | - | |
| how to install express media player and software drivers for m40/ | 2022-03-28 16:40 | - | |
| how to make the instant DVD work/ | 2022-03-28 16:40 | - | |
| how to make toshiba express media player support others/ | 2022-03-28 16:40 | - | |
| how to open up a Tecra S1/ | 2022-03-28 16:40 | - | |
| how to put XP on x205/ | 2022-03-28 16:40 | - | |
| how to refresh battery on toshiba Portege SS 3410/ | 2022-03-28 16:40 | - | |
| how to remove transparent menu on upper part of desktop/ | 2022-03-28 16:40 | - | |
| how to replace the wifi car in T135 (series laptops)/ | 2022-03-28 16:40 | - | |
| how to take apart a p500/ | 2022-03-28 16:40 | - | |
| how to update bios on Toshiba A70/ | 2022-03-28 16:40 | - | |
| how to upgrade my old laptop....ok really old laptop/ | 2022-03-28 16:40 | - | |
| how will these toshibas do with Diablo 3 please help!/ | 2022-03-28 16:40 | - | |
| hyperthreading query/ | 2022-03-28 16:40 | - | |
| i5-2410m and i7-2630qm socket differences/ | 2022-03-28 16:40 | - | |
| i9kfangui or NHC/ | 2022-03-28 16:40 | - | |
| i945pm chipset what is the max ram I can put in it Tecra M5, can I put in sxga 14.1 LCD/ | 2022-03-28 16:40 | - | |
| iPod Mini no go on Vista Home Prem/ | 2022-03-28 16:41 | - | |
| iTunes and A205-S5859- How can I get the buttons to work/ | 2022-03-28 16:41 | - | |
| iTunes help/ | 2022-03-28 16:41 | - | |
| if you own a x205 x200 can you please post your gpu clocks and 3dmark scores/ | 2022-03-28 16:41 | - | |
| i have a intel centrino duo/ | 2022-03-28 16:40 | - | |
| i have a toshiba p205 s 7476 bios pw locked!!/ | 2022-03-28 16:40 | - | |
| i just got a new toshiba and have some questions/ | 2022-03-28 16:40 | - | |
| im a gamer, wondering if P100-ST9752 upgradable/ | 2022-03-28 16:41 | - | |
| image my satellite pro a120/ | 2022-03-28 16:41 | - | |
| i need help.... again --(/ | 2022-03-28 16:40 | - | |
| i need help with toshiba satellite/ | 2022-03-28 16:40 | - | |
| i need recovery CDs for an A205-25804, too/ | 2022-03-28 16:40 | - | |
| i need your opinion/ | 2022-03-28 16:40 | - | |
| information regarding toshiba u200/ | 2022-03-28 16:41 | - | |
| install Toshiba bluetooth module on a U205/ | 2022-03-28 16:41 | - | |
| installing XP on the Satellite x205 SLi1 help/ | 2022-03-28 16:41 | - | |
| installing new SSD, moving installing Windows7, recovery media/ | 2022-03-28 16:41 | - | |
| install vista ultimate/ | 2022-03-28 16:41 | - | |
| integrated bluetooth/ | 2022-03-28 16:41 | - | |
| integrated graphic card/ | 2022-03-28 16:41 | - | |
| intel matrix storage console/ | 2022-03-28 16:41 | - | |
| intel virtualization/ | 2022-03-28 16:41 | - | |
| intermittent dvd drive access/ | 2022-03-28 16:41 | - | |
| internal bluetooth on toshiba m115-s3094/ | 2022-03-28 16:41 | - | |
| inverter or backlight/ | 2022-03-28 16:41 | - | |
| inverter plug wont fit new lcd/ | 2022-03-28 16:41 | - | |
| i realy need help with my toshiba qosmio x305-q701 please help me i really need it/ | 2022-03-28 16:40 | - | |
| is CPU socketed/ | 2022-03-28 16:41 | - | |
| is additional warranty necessary/ | 2022-03-28 16:41 | - | |
| is anyone going to get a F50/ | 2022-03-28 16:41 | - | |
| is it possible to swap the GPU in my qosmio/ | 2022-03-28 16:41 | - | |
| is my CPU and RAM running correctly/ | 2022-03-28 16:41 | - | |
| is my cd drive toast/ | 2022-03-28 16:41 | - | |
| issues with the s456 model.!!!/ | 2022-03-28 16:41 | - | |
| is the 1 year limited warranty international/ | 2022-03-28 16:41 | - | |
| is there a Toshiba Bloatware guide/ | 2022-03-28 16:41 | - | |
| is there any alternate software for the A70 models/ | 2022-03-28 16:41 | - | |
| is there anything I can do to keep my A500's fan from coming on and going off every few seconds/ | 2022-03-28 16:41 | - | |
| is this Toshiba Good Will it Run Wow/ | 2022-03-28 16:41 | - | |
| is this toshiba A300 a good deal/ | 2022-03-28 16:41 | - | |
| just bought L500D, any questions/ | 2022-03-28 16:41 | - | |
| just bought an X205-s9359/ | 2022-03-28 16:41 | - | |
| just bought p105-s9722 from USA -D what plug/ | 2022-03-28 16:41 | - | |
| just bought the sli-5/ | 2022-03-28 16:41 | - | |
| just got a ST9, and I love it/ | 2022-03-28 16:41 | - | |
| just got my replacement m65-s9092 lots of info inside!/ | 2022-03-28 16:41 | - | |
| just picked up a Satellite M50-MX5 (comments and questions)/ | 2022-03-28 16:41 | - | |
| just purchased M30-7101/ | 2022-03-28 16:41 | - | |
| just saw the Trubrite screen today/ | 2022-03-28 16:41 | - | |
| just wondering where do i put the mobile broadband sim for NB200/ | 2022-03-28 16:41 | - | |
| keyboard cover protection for satellites/ | 2022-03-28 16:41 | - | |
| keyboard help/ | 2022-03-28 16:41 | - | |
| keyboard problem on toshiba sm30-604/ | 2022-03-28 16:41 | - | |
| keyboard quirks/ | 2022-03-28 16:41 | - | |
| keyboard replacenent for toshiba x205 series/ | 2022-03-28 16:41 | - | |
| l300d pslc0c vista == xp sm bus controller/ | 2022-03-28 16:41 | - | |
| l745 can't delete file/ | 2022-03-28 16:41 | - | |
| l775-111 laptop/ | 2022-03-28 16:41 | - | |
| l775-111 or l775-13d/ | 2022-03-28 16:41 | - | |
| labelflash media/ | 2022-03-28 16:41 | - | |
| lan driver for xp/ | 2022-03-28 16:41 | - | |
| laptop M45-S169 motherboard failure/ | 2022-03-28 16:41 | - | |
| laptop car adapter/ | 2022-03-28 16:41 | - | |
| laptop cooling/ | 2022-03-28 16:41 | - | |
| laptop from japan!!/ | 2022-03-28 16:41 | - | |
| laptop help/ | 2022-03-28 16:41 | - | |
| laptop lids problem/ | 2022-03-28 16:41 | - | |
| laptop model given screen model part number/ | 2022-03-28 16:41 | - | |
| laptop newbie/ | 2022-03-28 16:41 | - | |
| laptop power cord stuck/ | 2022-03-28 16:41 | - | |
| laptop safety/ | 2022-03-28 16:41 | - | |
| laptop screen problem/ | 2022-03-28 16:41 | - | |
| laptop shutting down for no reason! help!/ | 2022-03-28 16:41 | - | |
| laptop speaker recommendations please/ | 2022-03-28 16:41 | - | |
| laptops with overclocking in the bios/ | 2022-03-28 16:41 | - | |
| laptop temp issues, are they covered by warranty/ | 2022-03-28 16:41 | - | |
| laptopvid2go drivers with x305/ | 2022-03-28 16:41 | - | |
| laptop won't auto-select external monitor after sleep/ | 2022-03-28 16:41 | - | |
| laptop won't power up/ | 2022-03-28 16:41 | - | |
| lcd doesnot work(a100) ..please kindly help -(((/ | 2022-03-28 16:41 | - | |
| lcd turning white/ | 2022-03-28 16:41 | - | |
| little bit of help please!/ | 2022-03-28 16:41 | - | |
| littledonny thanks sound problem fixed/ | 2022-03-28 16:41 | - | |
| local area connection cable unplugged/ | 2022-03-28 16:41 | - | |
| local dealer in area overcharges 400% on dvdrw drive/ | 2022-03-28 16:41 | - | |
![[TXT]](/icons/text.gif) | log.txt | 2022-01-29 03:03 | 783K | |
| log.txt.lck | 2022-01-29 01:12 | 0 | |
| looking for Xp drivers for a satellite L305D-S5934/ | 2022-03-28 16:41 | - | |
| looking for a 17 toshiba/ | 2022-03-28 16:41 | - | |
| looking to buy a Toshiba A305-s6845...but/ | 2022-03-28 16:41 | - | |
| lost password for m105-s1021/ | 2022-03-28 16:41 | - | |
| lot´s of new tosh´s/ | 2022-03-28 16:41 | - | |
| love this!/ | 2022-03-28 16:41 | - | |
| m-45 wont turn on =/ | 2022-03-28 16:41 | - | |
| m15-s405 Fan/ | 2022-03-28 16:41 | - | |
| m30-ysj or m35-s456/ | 2022-03-28 16:41 | - | |
| m30 for 1850/ | 2022-03-28 16:41 | - | |
| m30 notebook sleeve/ | 2022-03-28 16:41 | - | |
| m30 or m35 users, please help!!!!/ | 2022-03-28 16:41 | - | |
| m30 video problems/ | 2022-03-28 16:41 | - | |
| m30x heat problem/ | 2022-03-28 16:41 | - | |
| m30x or p30/ | 2022-03-28 16:41 | - | |
| m35x-s109/ | 2022-03-28 16:41 | - | |
| m35x does not start/ | 2022-03-28 16:41 | - | |
| m40-jm8/ | 2022-03-28 16:41 | - | |
| m40 buzzing noise whats the verdict/ | 2022-03-28 16:41 | - | |
| m40 graphic drivers/ | 2022-03-28 16:41 | - | |
| m40 screen - dark spots Pressure damage/ | 2022-03-28 16:41 | - | |
| m40 sf3/ | 2022-03-28 16:41 | - | |
| m40 sf3 drivers/ | 2022-03-28 16:41 | - | |
| m40 shutting down in games/ | 2022-03-28 16:41 | - | |
| m45 touchpad heat/ | 2022-03-28 16:41 | - | |
| m50 60 70 vs a p m100/ | 2022-03-28 16:41 | - | |
| m60 vs. g25-av513/ | 2022-03-28 16:41 | - | |
| m70 problem/ | 2022-03-28 16:41 | - | |
| m100- yeah or nay/ | 2022-03-28 16:41 | - | |
| m105 vista audio driver issue/ | 2022-03-28 16:41 | - | |
| m115-3094 - problem with AC adapter or something else/ | 2022-03-28 16:41 | - | |
| m115-s3094 recovery disc creator problem/ | 2022-03-28 16:41 | - | |
| m200 Restore CDs/ | 2022-03-28 16:41 | - | |
| m300 fm tuner problem/ | 2022-03-28 16:41 | - | |
| max DVD drive height in u500/ | 2022-03-28 16:41 | - | |
| maximum upgrade a305-s6825 cpu/ | 2022-03-28 16:41 | - | |
| max system upgrade of A305 S6858/ | 2022-03-28 16:41 | - | |
| maya and 3ds max/ | 2022-03-28 16:41 | - | |
| memtest cpu reaches 80 degrees, it's normal !/ | 2022-03-28 16:41 | - | |
| messed with starup now fn key not working/ | 2022-03-28 16:41 | - | |
| might be a dumb question/ | 2022-03-28 16:41 | - | |
| migrating from vista to windows 7 on a toshiba a214 s7444 satellite laptop/ | 2022-03-28 16:41 | - | |
| missing video drivers for x205-s9349 xp/ | 2022-03-28 16:41 | - | |
| mobile intel(R) 945 Express Chipset Family Trouble/ | 2022-03-28 16:41 | - | |
| modem driver for U305/ | 2022-03-28 16:41 | - | |
| monitor off/ | 2022-03-28 16:41 | - | |
| motherboard in a tosh m30x-129/ | 2022-03-28 16:41 | - | |
| mother board laptop satellite L40/ | 2022-03-28 16:41 | - | |
| my first impressions on the Qosmio X305-Q706 and the issue of SLI/ | 2022-03-28 16:41 | - | |
| my m115-s3094 is feeling slow, what can I do/ | 2022-03-28 16:41 | - | |
| my m115 screen isalready dirty, what's the best way to clean it/ | 2022-03-28 16:41 | - | |
| my monitor freezes/ | 2022-03-28 16:41 | - | |
| my shiba wont read 3 gigs of ram/ | 2022-03-28 16:41 | - | |
| my tecra M4 won't boot into bios, any suggestions/ | 2022-03-28 16:41 | - | |
| my toshiba is not working at all/ | 2022-03-28 16:41 | - | |
| my toshiba laptop cursor quit working and I am 70 yrs old and cannot know what to do/ | 2022-03-28 16:41 | - | |
| my toshiba laptop doesnt come on/ | 2022-03-28 16:41 | - | |
| my toshiba wouldn't start/ | 2022-03-28 16:41 | - | |
| nVidia Geforce GO7600 Graphics Card FAILED!/ | 2022-03-28 16:41 | - | |
| name change/ | 2022-03-28 16:41 | - | |
| nb205 Beeping Issue When Battery 10%/ | 2022-03-28 16:41 | - | |
| nbr Toshiba core graphic/ | 2022-03-28 16:41 | - | |
| need Qosmio x500 895/ | 2022-03-28 16:41 | - | |
| need advice on RETURN a Toshiba Laptop/ | 2022-03-28 16:41 | - | |
| need comment/ | 2022-03-28 16:41 | - | |
| needed qosmio f15 video bios/ | 2022-03-28 16:41 | - | |
| need help, looking for toshiba satellite a40 drivers... where are they/ | 2022-03-28 16:41 | - | |
| need help- cannot boot from cd/ | 2022-03-28 16:41 | - | |
| need help - toshiba satellite m105-sp381 drivers/ | 2022-03-28 16:41 | - | |
| need help about toshiba/ | 2022-03-28 16:41 | - | |
| need help choosing laptop/ | 2022-03-28 16:41 | - | |
| need help find the drivers for toshiba satellite laptop M205 200/ | 2022-03-28 16:41 | - | |
| need help for Toshiba M200/ | 2022-03-28 16:41 | - | |
| need help on my old toshiba laptop/ | 2022-03-28 16:41 | - | |
| need help please with my recovery partition/ | 2022-03-28 16:41 | - | |
| need help to down grade to xp/ | 2022-03-28 16:41 | - | |
| need help with buying qosmio/ | 2022-03-28 16:41 | - | |
| need help with downgrading my m700 to XP/ | 2022-03-28 16:41 | - | |
| need help with lan/ | 2022-03-28 16:41 | - | |
| need help with m45-s351 backlight please/ | 2022-03-28 16:41 | - | |
| need help with sound downgrade to xp/ | 2022-03-28 16:41 | - | |
| need help with toshiba satellite u405-s2830/ | 2022-03-28 16:41 | - | |
| need info. for sending T135 in for touchpad repair/ | 2022-03-28 16:41 | - | |
| need newest toshiba DMI tools for satellite L510/ | 2022-03-28 16:41 | - | |
| need opinions about A135-S4437/ | 2022-03-28 16:41 | - | |
| need service manual for Toshiba Satellite 2455-S305/ | 2022-03-28 16:41 | - | |
| need the latest nvidia 6600 drivers/ | 2022-03-28 16:41 | - | |
| need xprt advice x305/ | 2022-03-28 16:41 | - | |
| net framework and toshiba laptop/ | 2022-03-28 16:41 | - | |
| new A300/ | 2022-03-28 16:41 | - | |
| new BIOS v1.4 for M115/ | 2022-03-28 16:41 | - | |
| new M30 M35's CSV LCD technology/ | 2022-03-28 16:41 | - | |
| new T115 - weird round tab at bottom of the screen/ | 2022-03-28 16:41 | - | |
| new a315/ | 2022-03-28 16:41 | - | |
| newbie here with satellite p205/ | 2022-03-28 16:41 | - | |
| newbie on notebooks! need help!/ | 2022-03-28 16:41 | - | |
| newbie question - toshiba m50/ | 2022-03-28 16:41 | - | |
| newbie question - toshiba monitor/ | 2022-03-28 16:41 | - | |
| newbie question/ | 2022-03-28 16:41 | - | |
| newbie to Toshiba X205 SLI3/ | 2022-03-28 16:41 | - | |
| newby needs help with SD/ | 2022-03-28 16:41 | - | |
| new display drivers/ | 2022-03-28 16:41 | - | |
| new laptop! what can I uninstall/ | 2022-03-28 16:41 | - | |
| new screen for U400/ | 2022-03-28 16:41 | - | |
| new to Qosmio F15/ | 2022-03-28 16:41 | - | |
| new toshiba P205 cd-rom non-functional... help!/ | 2022-03-28 16:41 | - | |
| new to toshiba/ | 2022-03-28 16:41 | - | |
| no connection screen on x205/ | 2022-03-28 16:41 | - | |
| no excitement about the libretto/ | 2022-03-28 16:41 | - | |
| noisy fan/ | 2022-03-28 16:41 | - | |
| noob questions regarding my first toshiba lappy/ | 2022-03-28 16:41 | - | |
| no power/ | 2022-03-28 16:41 | - | |
| no sound on the tecra/ | 2022-03-28 16:41 | - | |
| notebook dosn't loading/ | 2022-03-28 16:41 | - | |
| notebook hardware control probs/ | 2022-03-28 16:41 | - | |
| notebook recomendation/ | 2022-03-28 16:41 | - | |
| no toshiba for me/ | 2022-03-28 16:41 | - | |
| not showing os menu when laptop starting/ | 2022-03-28 16:41 | - | |
| not sure which RAM is ok/ | 2022-03-28 16:41 | - | |
| official X205 Owner's Thread/ | 2022-03-28 16:41 | - | |
| old qosmio x300 question - battery/ | 2022-03-28 16:41 | - | |
| old satellite pro/ | 2022-03-28 16:41 | - | |
| on board memory/ | 2022-03-28 16:41 | - | |
| one simple question to A200 owners/ | 2022-03-28 16:41 | - | |
| opinion/ | 2022-03-28 16:41 | - | |
| opinions on U300-NS1/ | 2022-03-28 16:41 | - | |
| opinions on toshiba satellites/ | 2022-03-28 16:41 | - | |
| optical drive/ | 2022-03-28 16:41 | - | |
| overclocking/ | 2022-03-28 16:41 | - | |
| overclocking X205-S9349/ | 2022-03-28 16:41 | - | |
| overclocking my 8700m Gt ;/ | 2022-03-28 16:41 | - | |
| p15 s479/ | 2022-03-28 16:41 | - | |
| p30 chkdsk problem/ | 2022-03-28 16:41 | - | |
| p100-ma6 hard drive question/ | 2022-03-28 16:41 | - | |
| p100-st9752 laptop loose power cord/ | 2022-03-28 16:41 | - | |
| p100 or p105 s921/ | 2022-03-28 16:41 | - | |
| p105 (go 7900gs) fix/ | 2022-03-28 16:41 | - | |
| p105-s921 port relicator does it exist/ | 2022-03-28 16:41 | - | |
| p105-s6147.. upgrades/ | 2022-03-28 16:41 | - | |
| p105 1440 x 900 max resolution/ | 2022-03-28 16:41 | - | |
| p205-s7806 xp install, no HD detected/ | 2022-03-28 16:41 | - | |
| p205d-s7802 question/ | 2022-03-28 16:41 | - | |
| p205d sound sucks/ | 2022-03-28 16:41 | - | |
| p775-s7100 video blurry/ | 2022-03-28 16:41 | - | |
| p855-s5312 dual band, bluetooth wifi card/ | 2022-03-28 16:41 | - | |
| p855-s5312 problem/ | 2022-03-28 16:41 | - | |
| p7350 overclocking/ | 2022-03-28 16:41 | - | |
| partial xp boot in dual xp-Vista boot situation/ | 2022-03-28 16:41 | - | |
| password/ | 2022-03-28 16:41 | - | |
| password problem1/ | 2022-03-28 16:41 | - | |
| performance question about an older toshiba laptop/ | 2022-03-28 16:41 | - | |
| performance settings help/ | 2022-03-28 16:41 | - | |
| pink display at start up/ | 2022-03-28 16:41 | - | |
| planning on new notebook/ | 2022-03-28 16:41 | - | |
| please connect the fingerprint reader/ | 2022-03-28 16:41 | - | |
| please delete/ | 2022-03-28 16:41 | - | |
| please help me out with laptop formating/ | 2022-03-28 16:41 | - | |
| please help me with protege m300 sound driver!!!/ | 2022-03-28 16:41 | - | |
| please help with an A105-s2091/ | 2022-03-28 16:41 | - | |
| pls advice re replacement part/ | 2022-03-28 16:41 | - | |
| pls help looking for laptop similar to M600/ | 2022-03-28 16:41 | - | |
| plugging a hard dirve into my notebook/ | 2022-03-28 16:41 | - | |
| plz bios recover satellite l500/ | 2022-03-28 16:41 | - | |
| plz guys i need help with satellite a205-s4557/ | 2022-03-28 16:41 | - | |
| plz help me/ | 2022-03-28 16:41 | - | |
| portege 3490ct and its cpu speed/ | 2022-03-28 16:41 | - | |
| portege r300 where are reviews/ | 2022-03-28 16:41 | - | |
| possible overheating issue/ | 2022-03-28 16:41 | - | |
| power options/ | 2022-03-28 16:41 | - | |
| power problem with vista/ | 2022-03-28 16:41 | - | |
| power save and fan noise on S2/ | 2022-03-28 16:41 | - | |
| power saving modes/ | 2022-03-28 16:41 | - | |
| powersaving software for R100/ | 2022-03-28 16:41 | - | |
| preinstalling M115-S3094 need help/ | 2022-03-28 16:41 | - | |
| problem burning dvds on toshiba m40 dvd super drive/ | 2022-03-28 16:41 | - | |
| problem installing latest ATI driver for Toshiba sattellite notebook/ | 2022-03-28 16:41 | - | |
| problem in toshiba sattelite M50 please help/ | 2022-03-28 16:41 | - | |
| problems...hang ups/ | 2022-03-28 16:42 | - | |
| problems with HD-DVD Playback/ | 2022-03-28 16:42 | - | |
| problems with download tv setup options/ | 2022-03-28 16:42 | - | |
| problems with my thoshiba P35 S611's screen/ | 2022-03-28 16:42 | - | |
| problems with the M305 S4910/ | 2022-03-28 16:42 | - | |
| problems with vista keeping connections/ | 2022-03-28 16:42 | - | |
| problem with drivers and my x205-s9349/ | 2022-03-28 16:41 | - | |
| problem with my tecra A4/ | 2022-03-28 16:41 | - | |
| problem with the processor/ | 2022-03-28 16:42 | - | |
| problem with toshiba notebook built in light up track pad w buttons/ | 2022-03-28 16:42 | - | |
| problem with toshiba virtual sound on m40..plzz help/ | 2022-03-28 16:42 | - | |
| problem with toshiba x300/ | 2022-03-28 16:42 | - | |
| problem with video card i think/ | 2022-03-28 16:42 | - | |
| problem wz drivers( satellite u400 )/ | 2022-03-28 16:42 | - | |
| product key/ | 2022-03-28 16:42 | - | |
| protector suite ql/ | 2022-03-28 16:42 | - | |
| protege m205 opinions/ | 2022-03-28 16:42 | - | |
| protege r500 comments/ | 2022-03-28 16:42 | - | |
| ps help urgent/ | 2022-03-28 16:42 | - | |
| psm40c-sf300e Toshiba recovery help/ | 2022-03-28 16:42 | - | |
| pulling the heatsink microprocessor/ | 2022-03-28 16:42 | - | |
| puzzling keyboard problem on Tecra 8000/ | 2022-03-28 16:42 | - | |
| q775-3dv78 bloatware help/ | 2022-03-28 16:42 | - | |
| q892 benchmarks/ | 2022-03-28 16:42 | - | |
| qosmio 15.4 f10/ | 2022-03-28 16:42 | - | |
| qosmio CPU oc/ | 2022-03-28 16:42 | - | |
| qosmio HDMI output not full screen on tv/ | 2022-03-28 16:42 | - | |
| qosmio f55 driver issue/ | 2022-03-28 16:42 | - | |
| qosmio hotkey turns on laptop without pressing power button/ | 2022-03-28 16:42 | - | |
| qosmio screen backlight question/ | 2022-03-28 16:42 | - | |
| qosmio tv tuner and basic cable (no box)/ | 2022-03-28 16:42 | - | |
| qosmio x300 Gpu overheating/ | 2022-03-28 16:42 | - | |
| qosmio x305 questions/ | 2022-03-28 16:42 | - | |
| qosmio x500 bios update/ | 2022-03-28 16:42 | - | |
| qosmio x505-q8102x supports 16gb/ | 2022-03-28 16:42 | - | |
| qosmio x505 is now junk 'cause of drop of rain/ | 2022-03-28 16:42 | - | |
| qosmio x775 issues after opening to clean fan/ | 2022-03-28 16:42 | - | |
| qosmio x870 InsydeH2O password/ | 2022-03-28 16:42 | - | |
| question about SystemGuard + Warranty Extension/ | 2022-03-28 16:42 | - | |
| question about reinstall OS on Laptop/ | 2022-03-28 16:42 | - | |
| question about vista's resources with satellite a135/ | 2022-03-28 16:42 | - | |
| question about x205 specs/ | 2022-03-28 16:42 | - | |
| question for toshiba satellite u305-s2804/ | 2022-03-28 16:42 | - | |
| question of RAM/ | 2022-03-28 16:42 | - | |
| question on a Toshiba/ | 2022-03-28 16:42 | - | |
| questions about A205-S4567/ | 2022-03-28 16:42 | - | |
| questiontoshiba p200 Indenpent or integrated graphics card/ | 2022-03-28 16:42 | - | |
| quick question about x205 specs/ | 2022-03-28 16:42 | - | |
| quick question on buttons/ | 2022-03-28 16:42 | - | |
| r500 montevina refresh/ | 2022-03-28 16:42 | - | |
| r500 windows 7 transflective button/ | 2022-03-28 16:42 | - | |
| r700 creaky chrome hinge/ | 2022-03-28 16:42 | - | |
| r830 or Tecra r840/ | 2022-03-28 16:42 | - | |
| r835-P56x bios problem/ | 2022-03-28 16:42 | - | |
| r835-p89 disk controller driver issue/ | 2022-03-28 16:42 | - | |
| r835 worth the investment/ | 2022-03-28 16:42 | - | |
| ram Kingston 512MB DDR2 4200 533Mhz SODIMM/ | 2022-03-28 16:42 | - | |
| rate Toshiba tech support/ | 2022-03-28 16:42 | - | |
| realtek audio driver/ | 2022-03-28 16:42 | - | |
| reconsidering Toshiba/ | 2022-03-28 16:42 | - | |
| recovery disc, restart issue/ | 2022-03-28 16:42 | - | |
| recovery process/ | 2022-03-28 16:42 | - | |
| reformatting without recovery cd dvd/ | 2022-03-28 16:42 | - | |
| refresh force/ | 2022-03-28 16:42 | - | |
| refurb tablet/ | 2022-03-28 16:42 | - | |
| regarding compatibility with dvd writer/ | 2022-03-28 16:42 | - | |
| regarding the restore system/ | 2022-03-28 16:42 | - | |
| reinstalled Vista, getting 4945 in 3dMark06/ | 2022-03-28 16:42 | - | |
| reinstall vista/ | 2022-03-28 16:42 | - | |
| remote control for Satellite Pro P300 1FO/ | 2022-03-28 16:42 | - | |
| removed vista and installed xp.. wireless wont work now/ | 2022-03-28 16:42 | - | |
| replace DVD optical drive in L25/ | 2022-03-28 16:42 | - | |
| replace Satellite C655D screen with IPS display Possible/ | 2022-03-28 16:42 | - | |
| replaced motherboard...no video/ | 2022-03-28 16:42 | - | |
| replaced motherboard on p105, can't change brightness/ | 2022-03-28 16:42 | - | |
| replacing cd-rom/ | 2022-03-28 16:42 | - | |
| replacing graphics card/ | 2022-03-28 16:42 | - | |
| requesting Tecra A3 S611 review/ | 2022-03-28 16:42 | - | |
| reset bios password Equium L40/ | 2022-03-28 16:42 | - | |
| resource conflict -PCI on motherboard Satellite M55/ | 2022-03-28 16:42 | - | |
| restore toshiba satellite 1410/ | 2022-03-28 16:42 | - | |
| returning a customized toshiba satellite/ | 2022-03-28 16:42 | - | |
| right click disconnect/ | 2022-03-28 16:42 | - | |
| rntlc/ | 2022-03-28 16:42 | - | |
| s507 lcd screen problem/ | 2022-03-28 16:42 | - | |
| s4777 Vista to XP pro/ | 2022-03-28 16:42 | - | |
| sadved/ | 2022-03-28 16:42 | - | |
| safe to upgrade bios and video drivers and other drivers on m40/ | 2022-03-28 16:42 | - | |
| satallie a500 problem/ | 2022-03-28 16:42 | - | |
| satelite a100/ | 2022-03-28 16:42 | - | |
| satelite l505 plug port broke/ | 2022-03-28 16:42 | - | |
| satelite m15-s405 doesnt turn on/ | 2022-03-28 16:42 | - | |
| satelite u3505-s5077 drivers/ | 2022-03-28 16:42 | - | |
| satelitte P200 display turns black with AC CD adapter/ | 2022-03-28 16:42 | - | |
| satellite 305D/ | 2022-03-28 16:42 | - | |
| satellite 355 won't boot/ | 2022-03-28 16:42 | - | |
| satellite 1410 screen switching problem/ | 2022-03-28 16:42 | - | |
| satellite 4090xcdt, lan & modem driver/ | 2022-03-28 16:42 | - | |
| satellite A15-S157- repair or replace/ | 2022-03-28 16:42 | - | |
| satellite A105 audio output to TV/ | 2022-03-28 16:42 | - | |
| satellite A135 lid switch -is there one/ | 2022-03-28 16:42 | - | |
| satellite A205-s5804 wont hdd wont boot/ | 2022-03-28 16:42 | - | |
| satellite A300 NIC problem/ | 2022-03-28 16:42 | - | |
| satellite L650-13P cpu vga ram upgrade/ | 2022-03-28 16:42 | - | |
| satellite M70 keyboard is messed up/ | 2022-03-28 16:42 | - | |
| satellite P100 memory ugrade option/ | 2022-03-28 16:42 | - | |
| satellite a75 s2291/ | 2022-03-28 16:42 | - | |
| satellite a105-s2051 display/ | 2022-03-28 16:42 | - | |
| satellite a200-1m8 leds/ | 2022-03-28 16:42 | - | |
| satellite a 215/ | 2022-03-28 16:42 | - | |
| satellite a500/ | 2022-03-28 16:42 | - | |
| satellite a500 fan problem/ | 2022-03-28 16:42 | - | |
| satellite j11 driver/ | 2022-03-28 16:42 | - | |
| satellite l40-18w sound driver/ | 2022-03-28 16:42 | - | |
| satellite l45 optical disk drive/ | 2022-03-28 16:42 | - | |
| satellite l450-18d left clicker pushed into laptop/ | 2022-03-28 16:42 | - | |
| satellite laptop a100-s2211td sound/ | 2022-03-28 16:42 | - | |
| satellite m40 vs tecra s2/ | 2022-03-28 16:42 | - | |
| satellite m60 drivers/ | 2022-03-28 16:42 | - | |
| satellite m65-s9092 gfx card upgrade/ | 2022-03-28 16:42 | - | |
| satellite m70-144 with x700/ | 2022-03-28 16:42 | - | |
| satellite m70 burned/ | 2022-03-28 16:42 | - | |
| satellite m70 disassembly guide/ | 2022-03-28 16:42 | - | |
| satellite p205-s6337/ | 2022-03-28 16:42 | - | |
| satellite p205 quick question/ | 2022-03-28 16:42 | - | |
| satellite p300 keyboard help please/ | 2022-03-28 16:42 | - | |
| satellite pro 435CDS won't start/ | 2022-03-28 16:42 | - | |
| satellite pro L40 brightness problem/ | 2022-03-28 16:42 | - | |
| satellite pro M15-S405 IDE#0 error/ | 2022-03-28 16:42 | - | |
| satellite pro a10 - has it got game/ | 2022-03-28 16:42 | - | |
| satellite pro p200 1dv. cpu upgrade/ | 2022-03-28 16:42 | - | |
| satellite u300 touchpad issue/ | 2022-03-28 16:42 | - | |
| satellite won't turn on/ | 2022-03-28 16:42 | - | |
| satellite x205-sli1 and HDTV output/ | 2022-03-28 16:42 | - | |
| satellite x205 audio output questions/ | 2022-03-28 16:42 | - | |
| sat pro M40 Battery problem/ | 2022-03-28 16:42 | - | |
| sat pro a200 partition help/ | 2022-03-28 16:42 | - | |
| sattelite A100 recovery/ | 2022-03-28 16:42 | - | |
| sattelite p300 power problem after BIOS flash/ | 2022-03-28 16:42 | - | |
| screen/ | 2022-03-28 16:42 | - | |
| screen from P300D-20B not working in P100 (backlight only)/ | 2022-03-28 16:42 | - | |
| screen of U300/ | 2022-03-28 16:42 | - | |
| screen on toshiba gets pretty hot/ | 2022-03-28 16:42 | - | |
| scrolling doesn't work/ | 2022-03-28 16:42 | - | |
| second hd-p305 satellite/ | 2022-03-28 16:42 | - | |
| securing hard drive from bumps - portege r705/ | 2022-03-28 16:42 | - | |
| seems that buying a Toshiba was not a good idea/ | 2022-03-28 16:42 | - | |
| serious m35-s456 usb problems/ | 2022-03-28 16:42 | - | |
| settings for connecting P100-240 to Sony TV/ | 2022-03-28 16:42 | - | |
| shopping for a budget computer, Circuit city/ | 2022-03-28 16:42 | - | |
| shopping to replace my 5105 S607/ | 2022-03-28 16:42 | - | |
| should I BUY toshiba L650-I5310/ | 2022-03-28 16:42 | - | |
| should i buy it/ | 2022-03-28 16:42 | - | |
| should i buy the toshiba qosmio/ | 2022-03-28 16:42 | - | |
| should this Satellite 4015CDS be saved/ | 2022-03-28 16:42 | - | |
| silicone protective cover for toshiba laptops question/ | 2022-03-28 16:42 | - | |
| simple question about my Satellite A105/ | 2022-03-28 16:42 | - | |
| sli1 w xp where is ieeeauthentication/ | 2022-03-28 16:42 | - | |
| slow Tecra A10/ | 2022-03-28 16:42 | - | |
| slow dvd data transfer rate on m115-s3094/ | 2022-03-28 16:42 | - | |
| slow processer benchmark scores on x205 =(/ | 2022-03-28 16:42 | - | |
| sluggish CPU fan on 6100/ | 2022-03-28 16:42 | - | |
| sodimm in toshiba satellite compatability/ | 2022-03-28 16:42 | - | |
| so i reformatted my laptop....results/ | 2022-03-28 16:42 | - | |
| solution for webcam driver open fail. please restart camera or system/ | 2022-03-28 16:42 | - | |
| some questions on Portege R835/ | 2022-03-28 16:42 | - | |
| something strange happened to a toshiba satellite A-215 sp4057/ | 2022-03-28 16:42 | - | |
| sos toshiba satellite u300/ | 2022-03-28 16:42 | - | |
| sound skipping problems toshiba a210/ | 2022-03-28 16:42 | - | |
| sound vanished in toshiba sat pro A120/ | 2022-03-28 16:42 | - | |
| sp6ooo fans/ | 2022-03-28 16:42 | - | |
| sp6000 cutting out/ | 2022-03-28 16:42 | - | |
| space bar error/ | 2022-03-28 16:42 | - | |
| spdif/ | 2022-03-28 16:42 | - | |
| speaker issue x205/ | 2022-03-28 16:42 | - | |
| spy ware on my new toshiba notebook/ | 2022-03-28 16:42 | - | |
| stores in NYC central NJ/ | 2022-03-28 16:42 | - | |
| strangeness with the l25 s1193 ati x200 memory/ | 2022-03-28 16:42 | - | |
| strange noise from my satellite m50-mx5 driving me crazy!!!/ | 2022-03-28 16:42 | - | |
| stuck memory stick/ | 2022-03-28 16:42 | - | |
| sudden loss of brightness/ | 2022-03-28 16:42 | - | |
| super cheap x205/ | 2022-03-28 16:42 | - | |
| super high temp probs/ | 2022-03-28 16:42 | - | |
| swapping mobo of tecra r840 to tecra 940 series/ | 2022-03-28 16:42 | - | |
| switching back to XP from Vista in Toshiba U300 Y01/ | 2022-03-28 16:42 | - | |
| synaptics touchpad enhancements/ | 2022-03-28 16:42 | - | |
| system disabled/ | 2022-03-28 16:42 | - | |
| system locked please need helo/ | 2022-03-28 16:42 | - | |
| system restore on a200/ | 2022-03-28 16:42 | - | |
| te2100 battery dies/ | 2022-03-28 16:42 | - | |
| te2100 no sound input mic/ | 2022-03-28 16:42 | - | |
| techra m9 recovery disc/ | 2022-03-28 16:42 | - | |
| tecra A9 with problems/ | 2022-03-28 16:42 | - | |
| tecra M5 s4332 SATA driver for XP/ | 2022-03-28 16:42 | - | |
| tecra a4 hangups/ | 2022-03-28 16:42 | - | |
| tecra m2-s530 drivers for windows 7/ | 2022-03-28 16:42 | - | |
| tecra m2 cd rom not visible/ | 2022-03-28 16:42 | - | |
| tecra m3 display problem/ | 2022-03-28 16:42 | - | |
| tecra m3 function keys/ | 2022-03-28 16:42 | - | |
| tecra s2 controller/ | 2022-03-28 16:42 | - | |
| tecra won't start/ | 2022-03-28 16:42 | - | |
| the A70 screen, WOW/ | 2022-03-28 16:42 | - | |
| the Toshiba Satellite M35X-S329 and the Tecra A2-S/ | 2022-03-28 16:42 | - | |
| the built of Tohsiba A7 and the built of Toshiba notebook generally/ | 2022-03-28 16:42 | - | |
| the fan on my laptop/ | 2022-03-28 16:42 | - | |
| the satellite keyboard protection cover/ | 2022-03-28 16:42 | - | |
| the satellite m70 or M70-CL1/ | 2022-03-28 16:42 | - | |
| thinking of buying toshiba/ | 2022-03-28 16:42 | - | |
| this is weird/ | 2022-03-28 16:42 | - | |
| this temperature normal booo!!!/ | 2022-03-28 16:42 | - | |
| todshiba satalite black screen help/ | 2022-03-28 16:42 | - | |
| to m100-164, -178, -221 owners - question about fan running on intel gma units/ | 2022-03-28 16:42 | - | |
| took my Toshiba Laptop back and got a refund, any experts on here with Laptops/ | 2022-03-28 16:42 | - | |
| toshba laptop P105-S6147 Memory upgrade/ | 2022-03-28 16:42 | - | |
| toshiba/ | 2022-03-28 16:42 | - | |
| toshiba 1110 screen problems/ | 2022-03-28 16:42 | - | |
| toshiba A35-S159 Battery charge/ | 2022-03-28 16:43 | - | |
| toshiba A135-S4637 drivers for xp/ | 2022-03-28 16:42 | - | |
| toshiba A200-204 built in microphone parasite presence any ideas how to fix it/ | 2022-03-28 16:43 | - | |
| toshiba A200 webcam problem/ | 2022-03-28 16:43 | - | |
| toshiba A205/ | 2022-03-28 16:43 | - | |
| toshiba A210-11p xp drivers help/ | 2022-03-28 16:43 | - | |
| toshiba A665-S5199x screen problems/ | 2022-03-28 16:43 | - | |
| toshiba A665-S6098/ | 2022-03-28 16:43 | - | |
| toshiba EGPU help/ | 2022-03-28 16:43 | - | |
| toshiba L300/ | 2022-03-28 16:43 | - | |
| toshiba L300 L300D series, system recovery options/ | 2022-03-28 16:43 | - | |
| toshiba L310's driver/ | 2022-03-28 16:43 | - | |
| toshiba M35X-S311 replacement/ | 2022-03-28 16:43 | - | |
| toshiba M40/ | 2022-03-28 16:43 | - | |
| toshiba M50 quickplay ems does not work/ | 2022-03-28 16:43 | - | |
| toshiba M55-S3293/ | 2022-03-28 16:43 | - | |
| toshiba M100/ | 2022-03-28 16:43 | - | |
| toshiba M115 dvd upgrade/ | 2022-03-28 16:43 | - | |
| toshiba M305D-S4830 xp drivers/ | 2022-03-28 16:43 | - | |
| toshiba P105-S6024 Windows 2003/ | 2022-03-28 16:43 | - | |
| toshiba Satellite 5105-S501 keeps rebooting/ | 2022-03-28 16:43 | - | |
| toshiba Satellite M65-S821 New LCD display Issue/ | 2022-03-28 16:43 | - | |
| toshiba Satellite P100 has no power/ | 2022-03-28 16:43 | - | |
| toshiba T110/ | 2022-03-28 16:43 | - | |
| toshiba X200-219/ | 2022-03-28 16:43 | - | |
| toshiba a20 driver help/ | 2022-03-28 16:42 | - | |
| toshiba a25 s207 battery or motherboard/ | 2022-03-28 16:43 | - | |
| toshiba a70 OS upgrade (help needed)/ | 2022-03-28 16:43 | - | |
| toshiba a70 fan noise/ | 2022-03-28 16:43 | - | |
| toshiba a75 s229 no serial number/ | 2022-03-28 16:43 | - | |
| toshiba a85 any good/ | 2022-03-28 16:43 | - | |
| toshiba a100-528/ | 2022-03-28 16:42 | - | |
| toshiba a100-sk9/ | 2022-03-28 16:42 | - | |
| toshiba a100 pro/ | 2022-03-28 16:42 | - | |
| toshiba a100 running very slow/ | 2022-03-28 16:42 | - | |
| toshiba a135-s2386 i need an opinion/ | 2022-03-28 16:42 | - | |
| toshiba a135/ | 2022-03-28 16:42 | - | |
| toshiba a135 s2276/ | 2022-03-28 16:42 | - | |
| toshiba a200-10w supports PC2-6400 ram/ | 2022-03-28 16:43 | - | |
| toshiba a200 bios flash - CRASHED/ | 2022-03-28 16:43 | - | |
| toshiba a200 laptop mousepad scrolling and flashcards problem/ | 2022-03-28 16:43 | - | |
| toshiba a200 p200 here!/ | 2022-03-28 16:43 | - | |
| toshiba a205-p7548 blank screen problem/ | 2022-03-28 16:43 | - | |
| toshiba a210-1ao oc'ing (gpu also)/ | 2022-03-28 16:43 | - | |
| toshiba a210-11p long life battery req/ | 2022-03-28 16:43 | - | |
| toshiba a210 satellite webcam problems/ | 2022-03-28 16:43 | - | |
| toshiba a215-s7414 cpu upgrade/ | 2022-03-28 16:43 | - | |
| toshiba a215 brightness on vista/ | 2022-03-28 16:43 | - | |
| toshiba a215 vista option/ | 2022-03-28 16:43 | - | |
| toshiba a300/ | 2022-03-28 16:43 | - | |
| toshiba a300 sound problem when plugs into mains/ | 2022-03-28 16:43 | - | |
| toshiba blue ray play back/ | 2022-03-28 16:43 | - | |
| toshiba c55-b5299/ | 2022-03-28 16:43 | - | |
| toshiba camera assistant software not working - help/ | 2022-03-28 16:43 | - | |
| toshiba cpu upgrade/ | 2022-03-28 16:43 | - | |
| toshiba drivers/ | 2022-03-28 16:43 | - | |
| toshiba equium a100-027/ | 2022-03-28 16:43 | - | |
| toshiba flashcards doesnt run on startup/ | 2022-03-28 16:43 | - | |
| toshiba graphics card problem/ | 2022-03-28 16:43 | - | |
| toshiba hot keys problem in vista home premium upgrade - a135 s2276/ | 2022-03-28 16:43 | - | |
| toshiba is hot/ | 2022-03-28 16:43 | - | |
| toshiba l40-18w sound driver/ | 2022-03-28 16:43 | - | |
| toshiba l500 ,usb,touchpad,keyboard (except FN keys) stopped working,even in bios/ | 2022-03-28 16:43 | - | |
| toshiba laptop at CES las vegas 2007/ | 2022-03-28 16:43 | - | |
| toshiba laptop powers down/ | 2022-03-28 16:43 | - | |
| toshiba laptop won't stay off/ | 2022-03-28 16:43 | - | |
| toshiba lcd inverter/ | 2022-03-28 16:43 | - | |
| toshiba lid hinges again HELP! -)/ | 2022-03-28 16:43 | - | |
| toshiba m1 password removal/ | 2022-03-28 16:43 | - | |
| toshiba m30x questions/ | 2022-03-28 16:43 | - | |
| toshiba m35-456 super dvd problems/ | 2022-03-28 16:43 | - | |
| toshiba m35x-s149 beeping/ | 2022-03-28 16:43 | - | |
| toshiba m35x DC-in problem/ | 2022-03-28 16:43 | - | |
| toshiba m40-232 won't boot without battery on/ | 2022-03-28 16:43 | - | |
| toshiba m40-sf3 and BT CD burning/ | 2022-03-28 16:43 | - | |
| toshiba m40 sf3 or asus z71v/ | 2022-03-28 16:43 | - | |
| toshiba m40x n00 only $1498AUD/ | 2022-03-28 16:43 | - | |
| toshiba m60 + linux/ | 2022-03-28 16:43 | - | |
| toshiba nb100 - speaker problem, help/ | 2022-03-28 16:43 | - | |
| toshiba nb200 battery problems/ | 2022-03-28 16:43 | - | |
| toshiba notebook formatting issue/ | 2022-03-28 16:43 | - | |
| toshiba or fujitsu/ | 2022-03-28 16:43 | - | |
| toshiba p10-792 comments/ | 2022-03-28 16:43 | - | |
| toshiba p30 question/ | 2022-03-28 16:43 | - | |
| toshiba p100 .. power saver with winxp!! -(/ | 2022-03-28 16:43 | - | |
| toshiba p105 ac adapter/ | 2022-03-28 16:43 | - | |
| toshiba p205/ | 2022-03-28 16:43 | - | |
| toshiba p205 s7476 drivers/ | 2022-03-28 16:43 | - | |
| toshiba p300-1a8 problem/ | 2022-03-28 16:43 | - | |
| toshiba pentium A 4 processor 538 3.2GHz 15.4 screen/ | 2022-03-28 16:43 | - | |
| toshiba portege/ | 2022-03-28 16:43 | - | |
| toshiba portege R930 keyboard replacement/ | 2022-03-28 16:43 | - | |
| toshiba power saver options/ | 2022-03-28 16:43 | - | |
| toshiba preinstalled software, how do i remove it/ | 2022-03-28 16:43 | - | |
| toshiba qosmio x305-q701 drivers/ | 2022-03-28 16:43 | - | |
| toshiba qosmio x505- 898 or sandy bridge/ | 2022-03-28 16:43 | - | |
| toshiba question/ | 2022-03-28 16:43 | - | |
| toshiba questions/ | 2022-03-28 16:43 | - | |
| toshiba recobery and applications drivers dvd satellite a100/ | 2022-03-28 16:43 | - | |
| toshibas/ | 2022-03-28 16:43 | - | |
| toshiba s100 screen going bad/ | 2022-03-28 16:43 | - | |
| toshiba s1620cds/ | 2022-03-28 16:43 | - | |
| toshiba satallite 1950 bios password problem/ | 2022-03-28 16:43 | - | |
| toshiba satelite c55t-a5102 screen replacement/ | 2022-03-28 16:43 | - | |
| toshiba satelite pro a100!!!!!/ | 2022-03-28 16:43 | - | |
| toshiba satelite pro laptop help/ | 2022-03-28 16:43 | - | |
| toshiba satellite 1100/ | 2022-03-28 16:43 | - | |
| toshiba satellite 1620CDS acting weird with battery/ | 2022-03-28 16:43 | - | |
| toshiba satellite 5205 S504 motherboard/ | 2022-03-28 16:43 | - | |
| toshiba satellite A15-S157/ | 2022-03-28 16:43 | - | |
| toshiba satellite A505-S6005 - safe removal of programs/ | 2022-03-28 16:43 | - | |
| toshiba satellite A505D-S6958/ | 2022-03-28 16:43 | - | |
| toshiba satellite L35-S2366/ | 2022-03-28 16:43 | - | |
| toshiba satellite L35-s2171 recovery cds/ | 2022-03-28 16:43 | - | |
| toshiba satellite L510 overclocking/ | 2022-03-28 16:43 | - | |
| toshiba satellite LCD, 15 or 17/ | 2022-03-28 16:43 | - | |
| toshiba satellite M70 keyboard problem!/ | 2022-03-28 16:43 | - | |
| toshiba satellite R15 tablet fan noise/ | 2022-03-28 16:43 | - | |
| toshiba satellite X205-SLi1 questions/ | 2022-03-28 16:43 | - | |
| toshiba satellite a80 question/ | 2022-03-28 16:43 | - | |
| toshiba satellite a100 spacebar problem/ | 2022-03-28 16:43 | - | |
| toshiba satellite a135-s2276 problem/ | 2022-03-28 16:43 | - | |
| toshiba satellite a210-11p fn key drivers/ | 2022-03-28 16:43 | - | |
| toshiba satellite a215-7408 computer lock up issues/ | 2022-03-28 16:43 | - | |
| toshiba satellite battery exchange problem/ | 2022-03-28 16:43 | - | |
| toshiba satellite c40-a128/ | 2022-03-28 16:43 | - | |
| toshiba satellite c50d-a-12r/ | 2022-03-28 16:43 | - | |
| toshiba satellite l50-c-13w and egpu/ | 2022-03-28 16:43 | - | |
| toshiba satellite l500-1h1/ | 2022-03-28 16:43 | - | |
| toshiba satellite m30-ysj se - how do you like it/ | 2022-03-28 16:43 | - | |
| toshiba satellite m30-ysj se/ | 2022-03-28 16:43 | - | |
| toshiba satellite m35x-s329 BLANK SCREEN HELPP!!!/ | 2022-03-28 16:43 | - | |
| toshiba satellite m40 compatible ram/ | 2022-03-28 16:43 | - | |
| toshiba satellite m40 or satellite m50 or tecra m3/ | 2022-03-28 16:43 | - | |
| toshiba satellite m45-s169/ | 2022-03-28 16:43 | - | |
| toshiba satellite m300 300 notebook wakes up from sleep/ | 2022-03-28 16:43 | - | |
| toshiba satellite p100 105 memory brand/ | 2022-03-28 16:43 | - | |
| toshiba satellite p100 bios 4.30 help please/ | 2022-03-28 16:43 | - | |
| toshiba satellite p100 toshiba software question/ | 2022-03-28 16:43 | - | |
| toshiba satellite pro a120 hot keys screen brightness problem/ | 2022-03-28 16:43 | - | |
| toshiba satellite pro l10/ | 2022-03-28 16:43 | - | |
| toshiba satellite u300 series dual boot help required/ | 2022-03-28 16:43 | - | |
| toshiba satellite x200 x205 GPU price + upgrade options/ | 2022-03-28 16:43 | - | |
| toshiba satillite j11 i need drivers/ | 2022-03-28 16:43 | - | |
| toshiba sattelite m30x-129 BIOS question/ | 2022-03-28 16:43 | - | |
| toshiba soft problem need help!!/ | 2022-03-28 16:43 | - | |
| toshiba t1850 basic rom error/ | 2022-03-28 16:43 | - | |
| toshiba tecra 8200/ | 2022-03-28 16:43 | - | |
| toshiba tecra A6-S513 - Loses Time Help!/ | 2022-03-28 16:43 | - | |
| toshiba tecra T9100 1.8ghz p4 mobile processor/ | 2022-03-28 16:43 | - | |
| toshiba tecra a4s313/ | 2022-03-28 16:43 | - | |
| toshiba tecra m1 screen gone dark/ | 2022-03-28 16:43 | - | |
| toshiba tecra m2 Please give me your comment/ | 2022-03-28 16:43 | - | |
| toshiba tecra m5/ | 2022-03-28 16:43 | - | |
| toshiba touchpad stopped working/ | 2022-03-28 16:43 | - | |
| toshiba u205 bootup issue/ | 2022-03-28 16:43 | - | |
| toshiba u400-15e xp drivers/ | 2022-03-28 16:43 | - | |
| toshiba value added package vista x64/ | 2022-03-28 16:43 | - | |
| toshiba vista bios 1.50/ | 2022-03-28 16:43 | - | |
| toshiba wants to send me a M65-S9092 .. good/ | 2022-03-28 16:43 | - | |
| toshiba web cam/ | 2022-03-28 16:43 | - | |
| toshiba webcam driver/ | 2022-03-28 16:43 | - | |
| toshiba with 970 980m or any maxwell, when/ | 2022-03-28 16:43 | - | |
| toshiba x200 review +bench/ | 2022-03-28 16:43 | - | |
| toshiba x205-sli1 adapter power wiring help/ | 2022-03-28 16:43 | - | |
| toshiba x300/ | 2022-03-28 16:43 | - | |
| toshiba x300 problem/ | 2022-03-28 16:43 | - | |
| toshipa background/ | 2022-03-28 16:43 | - | |
| totally leftfield question/ | 2022-03-28 16:43 | - | |
| touchpad- virtual scrolling/ | 2022-03-28 16:43 | - | |
| touch pad and mouse button problem/ | 2022-03-28 16:43 | - | |
| touchpad working through gloves/ | 2022-03-28 16:43 | - | |
| transfer the Recovery partition to CD/ | 2022-03-28 16:43 | - | |
| trouble with a Toshiba Satellite A205-S5803/ | 2022-03-28 16:43 | - | |
| trubrite vs. briteview/ | 2022-03-28 16:43 | - | |
| turion gold 2.2 question/ | 2022-03-28 16:43 | - | |
| two models of Toshiba,which one is better/ | 2022-03-28 16:43 | - | |
| two questions about biod updating/ | 2022-03-28 16:43 | - | |
| typing on my new sli 5/ | 2022-03-28 16:43 | - | |
| u205-5057 Memory Upgrade/ | 2022-03-28 16:43 | - | |
| u300 xp drivers/ | 2022-03-28 16:43 | - | |
| u305-S2808 xp instal lan problems/ | 2022-03-28 16:43 | - | |
| u305 Disassembly guide/ | 2022-03-28 16:43 | - | |
| u305 s5077 webcam problem/ | 2022-03-28 16:43 | - | |
| u400 overheating/ | 2022-03-28 16:43 | - | |
| uTorrent Caused Major Error!!!/ | 2022-03-28 16:44 | - | |
| uh oooh, another M45 question/ | 2022-03-28 16:43 | - | |
| unable install XP on Portege A200/ | 2022-03-28 16:43 | - | |
| undervolting Rmclock and toshiba powersaver/ | 2022-03-28 16:43 | - | |
| uninstalling bloatware/ | 2022-03-28 16:43 | - | |
| update M400 BIOS in Windows 7/ | 2022-03-28 16:43 | - | |
| updated drivers equium a60/ | 2022-03-28 16:43 | - | |
| updating r600 to Windows 7/ | 2022-03-28 16:43 | - | |
| upgrade cpu x205/ | 2022-03-28 16:43 | - | |
| upgraded my R835-P56x/ | 2022-03-28 16:44 | - | |
| upgrade graphics/ | 2022-03-28 16:43 | - | |
| up grading GMA X3100/ | 2022-03-28 16:43 | - | |
| upgrading Vista to Windows 7/ | 2022-03-28 16:44 | - | |
| upgrading X505 CPU/ | 2022-03-28 16:44 | - | |
| upgrading cpu on U300/ | 2022-03-28 16:44 | - | |
| upgrading gpu in toshiba X875 possible solution/ | 2022-03-28 16:44 | - | |
| upgrading hard drive satellite p105-s921/ | 2022-03-28 16:44 | - | |
| upgrading m45-s355 graphics card/ | 2022-03-28 16:44 | - | |
| upgrading processor toshiba M115-S3094/ | 2022-03-28 16:44 | - | |
| upgrading the cpu/ | 2022-03-28 16:44 | - | |
| upgrading video memory, please help/ | 2022-03-28 16:44 | - | |
| upload speeds/ | 2022-03-28 16:44 | - | |
| usb ports not working/ | 2022-03-28 16:44 | - | |
| useless processes on new toshiba/ | 2022-03-28 16:44 | - | |
| usp ports not working/ | 2022-03-28 16:44 | - | |
| very confusing to me/ | 2022-03-28 16:44 | - | |
| very high temp help/ | 2022-03-28 16:44 | - | |
| vga out no longer works....ati 2600, satellite p200/ | 2022-03-28 16:44 | - | |
| video card drivers for the 9700m/ | 2022-03-28 16:44 | - | |
| video in problem/ | 2022-03-28 16:44 | - | |
| view temps on an x205-sli1/ | 2022-03-28 16:44 | - | |
| vista and sp1/ | 2022-03-28 16:44 | - | |
| vista dump/ | 2022-03-28 16:44 | - | |
| vista or windows xp/ | 2022-03-28 16:44 | - | |
| vista upgrade clean install key on bottom laptop/ | 2022-03-28 16:44 | - | |
| vista will not recognize hardrive during setup/ | 2022-03-28 16:44 | - | |
| volume too low/ | 2022-03-28 16:44 | - | |
| wanna buy a new notbook for my sister.. stay long and cheap does not need frquent repairing/ | 2022-03-28 16:44 | - | |
| wanting to upgrade my memory/ | 2022-03-28 16:44 | - | |
| webcam problem/ | 2022-03-28 16:44 | - | |
| weird weird noise/ | 2022-03-28 16:44 | - | |
| what's a good Free app to monitor 2 GPU temps/ | 2022-03-28 16:44 | - | |
| what/ | 2022-03-28 16:44 | - | |
| what can i upgrade ib A205-S4587/ | 2022-03-28 16:44 | - | |
| what do you guys think about the M205-S4806/ | 2022-03-28 16:44 | - | |
| what do you think about this Lapto A210-158/ | 2022-03-28 16:44 | - | |
| what do you think about this laptop(Satellite M45-S169 Notebook)/ | 2022-03-28 16:44 | - | |
| what happen to qosmio f55-q503/ | 2022-03-28 16:44 | - | |
| what i meant for clarification/ | 2022-03-28 16:44 | - | |
| what is photo-bon/ | 2022-03-28 16:44 | - | |
| what is the best oc to my geforce go 7600/ | 2022-03-28 16:44 | - | |
| what is the best toshiba for gamming/ | 2022-03-28 16:44 | - | |
| what is the difference between those three/ | 2022-03-28 16:44 | - | |
| what new models have softthinks restore/ | 2022-03-28 16:44 | - | |
| what on earth the quality of Qosmio is/ | 2022-03-28 16:44 | - | |
| what ram for satellite 1115-S103/ | 2022-03-28 16:44 | - | |
| what ram speed to get. For Toshiba SP 2100/ | 2022-03-28 16:44 | - | |
| what should i upgrade to increase loading speeds/ | 2022-03-28 16:44 | - | |
| what toshiba a100 is this/ | 2022-03-28 16:44 | - | |
| what toshiba should i get/ | 2022-03-28 16:44 | - | |
| where's the best place to buy Toshiba spares/ | 2022-03-28 16:44 | - | |
| where are the centrino 2 notebooks/ | 2022-03-28 16:44 | - | |
| where can I buy a toshiba/ | 2022-03-28 16:44 | - | |
| where can I buy x305-q706 and ships to singapore/ | 2022-03-28 16:44 | - | |
| where is m30 m35 made in/ | 2022-03-28 16:44 | - | |
| where is realtek hd audio manager download/ | 2022-03-28 16:44 | - | |
| where to buy A200-23Q/ | 2022-03-28 16:44 | - | |
| where to buy toshiba/ | 2022-03-28 16:44 | - | |
| where to download Toshiba BIOS/ | 2022-03-28 16:44 | - | |
| where to find A205-S4587 drivers for xp/ | 2022-03-28 16:44 | - | |
| which ddr3 memory/ | 2022-03-28 16:44 | - | |
| which exe for M30 buttons/ | 2022-03-28 16:44 | - | |
| which laptop is better/ | 2022-03-28 16:44 | - | |
| which toshiba for portability and gaming/ | 2022-03-28 16:44 | - | |
| which toshiba model to go for/ | 2022-03-28 16:44 | - | |
| white bar on the bottom of my notebook screen (M115-S3094)/ | 2022-03-28 16:44 | - | |
| why did Toshiba switch to toshiba Conexant instead of Realtek for Audio Chipset/ | 2022-03-28 16:44 | - | |
| why wont windows xp install/ | 2022-03-28 16:44 | - | |
| wi-fi missing/ | 2022-03-28 16:44 | - | |
| wierd question but worth a shot/ | 2022-03-28 16:44 | - | |
| wifi problem in A135-S2386/ | 2022-03-28 16:44 | - | |
| wifi problem on m45-s351 with Intel 2200BG/ | 2022-03-28 16:44 | - | |
| wifi problems on satellite 1135-s1553/ | 2022-03-28 16:44 | - | |
| will R500 ever be upgraded again later this year/ | 2022-03-28 16:44 | - | |
| will qosmio x500 x505 run 1333mhz ram instead of 1066 do you/ | 2022-03-28 16:44 | - | |
| will this motherboard work with my toshiba laptop/ | 2022-03-28 16:44 | - | |
| windows XP Toshiba Satellite A135-S4467 Drivers/ | 2022-03-28 16:44 | - | |
| windows activasion key/ | 2022-03-28 16:44 | - | |
| windows xp home recovery disc/ | 2022-03-28 16:44 | - | |
| windows xp on L300D-242/ | 2022-03-28 16:44 | - | |
| wird battery problem/ | 2022-03-28 16:44 | - | |
| wireless card not properly installed...help please/ | 2022-03-28 16:44 | - | |
| wireless connection/ | 2022-03-28 16:44 | - | |
| wireless driver help on toshiba/ | 2022-03-28 16:44 | - | |
| wireless not working Toshiba M15/ | 2022-03-28 16:44 | - | |
| wireless problem (U405 )/ | 2022-03-28 16:44 | - | |
| without s video, how to hook up to tv/ | 2022-03-28 16:44 | - | |
| woohoo free laptop -)/ | 2022-03-28 16:44 | - | |
| would the ram and hard drive from a p105 or m105 fit and a105/ | 2022-03-28 16:44 | - | |
| wow prices are dropping on the x205's/ | 2022-03-28 16:44 | - | |
| x200-15K resolution problem/ | 2022-03-28 16:44 | - | |
| x200-15k vista problem (urgent)/ | 2022-03-28 16:44 | - | |
| x200-x205 cpu upgrade/ | 2022-03-28 16:44 | - | |
| x200 or x205 Bluetooth module- is it usb or serial/ | 2022-03-28 16:44 | - | |
| x205-9349- screensaver doesn't work and screen doesn't turn off after 20 min (power options)/ | 2022-03-28 16:44 | - | |
| x205-9349 bloatware/ | 2022-03-28 16:44 | - | |
| x205-S9349 processor upgrade/ | 2022-03-28 16:44 | - | |
| x205-SLi1 Vista 64 bluetooth install question/ | 2022-03-28 16:44 | - | |
| x205-SLi2 and vista x64/ | 2022-03-28 16:44 | - | |
| x205-SLi2 video memory/ | 2022-03-28 16:44 | - | |
| x205-Sli1/ | 2022-03-28 16:44 | - | |
| x205-s9349 - ram upgrade/ | 2022-03-28 16:44 | - | |
| x205-s9349 XP Killed Vista/ | 2022-03-28 16:44 | - | |
| x205-s9349 hdmi output is clipped/ | 2022-03-28 16:44 | - | |
| x205-s9800 memory upgrade and possible overclock questions/ | 2022-03-28 16:44 | - | |
| x205-sli1 Wireless not working/ | 2022-03-28 16:44 | - | |
| x205-sli1 blank screen when sli is enabled/ | 2022-03-28 16:44 | - | |
| x205-sli1 dual boot (XP and Vista)/ | 2022-03-28 16:44 | - | |
| x205-sli1 fan noise/ | 2022-03-28 16:44 | - | |
| x205-sli1 locking up among other problems/ | 2022-03-28 16:44 | - | |
| x205-sli1 memory question/ | 2022-03-28 16:44 | - | |
| x205-sli1 running slow/ | 2022-03-28 16:44 | - | |
| x205-sli1 video card problem/ | 2022-03-28 16:44 | - | |
| x205-sli1 vista crawling - eating all my ram/ | 2022-03-28 16:44 | - | |
| x205-sli2 ACPI EC Driver for XP/ | 2022-03-28 16:44 | - | |
| x205-sli3 Performance Questions/ | 2022-03-28 16:44 | - | |
| x205-sli3 force ware drivers/ | 2022-03-28 16:44 | - | |
| x205-sli temps/ | 2022-03-28 16:44 | - | |
| x205 8700gt OC'ing peak/ | 2022-03-28 16:44 | - | |
| x205 9800 Should I buy/ | 2022-03-28 16:44 | - | |
| x205 Hard Drive Help!!!!!/ | 2022-03-28 16:44 | - | |
| x205 Multimedia Keys/ | 2022-03-28 16:44 | - | |
| x205 Multimedia Keys with Winamp/ | 2022-03-28 16:44 | - | |
| x205 SL1 & OSx86 project/ | 2022-03-28 16:44 | - | |
| x205 Warranty/ | 2022-03-28 16:44 | - | |
| x205 drive swap question/ | 2022-03-28 16:44 | - | |
| x205 hard drive upgrade/ | 2022-03-28 16:44 | - | |
| x205 it´s now $ 100 lower !/ | 2022-03-28 16:44 | - | |
| x205 owners how do you like your screen/ | 2022-03-28 16:44 | - | |
| x205 problem/ | 2022-03-28 16:44 | - | |
| x205 really mxm/ | 2022-03-28 16:44 | - | |
| x205 s9349 drivers/ | 2022-03-28 16:44 | - | |
| x205 sli1, no power lights motherboard/ | 2022-03-28 16:44 | - | |
| x205 sli1 BIOS update/ | 2022-03-28 16:44 | - | |
| x205 sli1 arrived today/ | 2022-03-28 16:44 | - | |
| x205 sli1 audio out put/ | 2022-03-28 16:44 | - | |
| x205 sli1 vista SP1/ | 2022-03-28 16:44 | - | |
| x205 sli3 for 23459 at mac mall/ | 2022-03-28 16:44 | - | |
| x205 speakers sound/ | 2022-03-28 16:44 | - | |
| x205 terrible webcam/ | 2022-03-28 16:44 | - | |
| x205 will not turn on/ | 2022-03-28 16:44 | - | |
| x205 windows xp help/ | 2022-03-28 16:44 | - | |
| x205x-sli2 - Fallout 3 - Gad graphics/ | 2022-03-28 16:44 | - | |
| x250camera problems/ | 2022-03-28 16:44 | - | |
| x300 11w/ | 2022-03-28 16:44 | - | |
| x300 305 Farcry 2 performance/ | 2022-03-28 16:44 | - | |
| x300 x305 Cooling Mod/ | 2022-03-28 16:44 | - | |
| x305-11W/ | 2022-03-28 16:44 | - | |
| x305-701 Overheating please help/ | 2022-03-28 16:44 | - | |
| x305-q720/ | 2022-03-28 16:44 | - | |
| x305 706/ | 2022-03-28 16:44 | - | |
| x305 Fallout 3 performance/ | 2022-03-28 16:44 | - | |
| x305 GPU upgrade! Fast!/ | 2022-03-28 16:44 | - | |
| x305 Overheating!/ | 2022-03-28 16:44 | - | |
| x305 screen problems/ | 2022-03-28 16:44 | - | |
| x505-898 Keyboard backlight not working/ | 2022-03-28 16:44 | - | |
| x505 compatible verde drivers/ | 2022-03-28 16:44 | - | |
| x505 opinions/ | 2022-03-28 16:44 | - | |
| x505 q8100x SSD upgrade but Sata I, II or III/ | 2022-03-28 16:44 | - | |
| x755-3dv78 review/ | 2022-03-28 16:44 | - | |
| x775-3dv8 Geoforce 560m update/ | 2022-03-28 16:44 | - | |
| x775 1080p upgrade help/ | 2022-03-28 16:44 | - | |
| xp drivers for M305D/ | 2022-03-28 16:44 | - | |
| xp installation problems/ | 2022-03-28 16:44 | - | |
| xp on A205-4777/ | 2022-03-28 16:44 | - | |
| xp recovery dvd/ | 2022-03-28 16:44 | - | |
| z830 Portege - Can not extend partition/ | 2022-03-28 16:44 | - | |
| z835 or z935 need advice/ | 2022-03-28 16:44 | - | |
|
|---|